summaryrefslogtreecommitdiffstats
path: root/module/web
diff options
context:
space:
mode:
authorGravatar RaNaN <Mast3rRaNaN@hotmail.de> 2012-09-18 17:59:50 +0200
committerGravatar RaNaN <Mast3rRaNaN@hotmail.de> 2012-09-18 17:59:50 +0200
commit6130a2377ca6754fee88773097ce220abef1aa47 (patch)
tree76bea0d76393100fcf393c164c96d34f286aba7a /module/web
parentAdded DuckcryptInfo decrypter, smaller fixes (diff)
parentdropdowns in navbar (diff)
downloadpyload-6130a2377ca6754fee88773097ce220abef1aa47.tar.xz
merged stable into default
Diffstat (limited to 'module/web')
-rw-r--r--module/web/ServerThread.py23
-rw-r--r--module/web/api_app.py47
-rw-r--r--module/web/cnl_app.py6
-rw-r--r--module/web/json_app.py312
-rw-r--r--module/web/media/default/css/MooDialog.css92
-rw-r--r--module/web/media/default/css/default.css908
-rw-r--r--module/web/media/default/css/log.css72
-rw-r--r--module/web/media/default/css/pathchooser.css68
-rw-r--r--module/web/media/default/css/window.css73
-rw-r--r--module/web/media/default/img/add_folder.pngbin571 -> 0 bytes
-rw-r--r--module/web/media/default/img/ajax-loader.gifbin404 -> 0 bytes
-rw-r--r--module/web/media/default/img/arrow_right.pngbin349 -> 0 bytes
-rw-r--r--module/web/media/default/img/big_button.gifbin1905 -> 0 bytes
-rw-r--r--module/web/media/default/img/big_button_over.gifbin728 -> 0 bytes
-rw-r--r--module/web/media/default/img/body.pngbin402 -> 0 bytes
-rw-r--r--module/web/media/default/img/button.pngbin452 -> 0 bytes
-rw-r--r--module/web/media/default/img/closebtn.gifbin254 -> 0 bytes
-rw-r--r--module/web/media/default/img/cog.pngbin512 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_add.pngbin446 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_add_blue.pngbin845 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_cancel.pngbin3349 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_cancel_blue.pngbin787 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_pause.pngbin598 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_pause_blue.pngbin721 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_play.pngbin592 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_play_blue.pngbin717 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_stop.pngbin403 -> 0 bytes
-rw-r--r--module/web/media/default/img/control_stop_blue.pngbin695 -> 0 bytes
-rw-r--r--module/web/media/default/img/drag_corner.gifbin76 -> 0 bytes
-rw-r--r--module/web/media/default/img/error.pngbin701 -> 0 bytes
-rw-r--r--module/web/media/default/img/full.pngbin3543 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-login.pngbin1288 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-collector.pngbin1953 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-config.pngbin1802 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-development.pngbin876 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-download.pngbin721 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-home.pngbin920 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-index.pngbin482 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-news.pngbin628 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-queue.pngbin2629 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-recent.pngbin932 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-menu-wiki.pngbin1204 -> 0 bytes
-rw-r--r--module/web/media/default/img/head-search-noshadow.pngbin1187 -> 0 bytes
-rw-r--r--module/web/media/default/img/head_bg1.pngbin125 -> 0 bytes
-rw-r--r--module/web/media/default/img/images.pngbin661 -> 0 bytes
-rw-r--r--module/web/media/default/img/notice.pngbin778 -> 0 bytes
-rw-r--r--module/web/media/default/img/package_go.pngbin898 -> 0 bytes
-rw-r--r--module/web/media/default/img/page-tools-backlinks.pngbin540 -> 0 bytes
-rw-r--r--module/web/media/default/img/page-tools-edit.pngbin574 -> 0 bytes
-rw-r--r--module/web/media/default/img/page-tools-revisions.pngbin603 -> 0 bytes
-rw-r--r--module/web/media/default/img/parseUri.pngbin666 -> 0 bytes
-rw-r--r--module/web/media/default/img/pyload-logo-edited3.5-new-font-small.pngbin8457 -> 0 bytes
-rw-r--r--module/web/media/default/img/reconnect.pngbin755 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_None.pngbin7613 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_downloading.pngbin943 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_failed.pngbin701 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_finished.pngbin781 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_offline.pngbin700 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_proc.pngbin512 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_queue.pngbin7613 -> 0 bytes
-rw-r--r--module/web/media/default/img/status_waiting.pngbin889 -> 0 bytes
-rw-r--r--module/web/media/default/img/success.pngbin781 -> 0 bytes
-rw-r--r--module/web/media/default/img/tab-background.pngbin179 -> 0 bytes
-rw-r--r--module/web/media/default/img/tabs-border-bottom.pngbin163 -> 0 bytes
-rw-r--r--module/web/media/default/img/user-actions-logout.pngbin799 -> 0 bytes
-rw-r--r--module/web/media/default/img/user-actions-profile.pngbin628 -> 0 bytes
-rw-r--r--module/web/media/default/img/user-info.pngbin3963 -> 0 bytes
-rw-r--r--module/web/media/img/dialog-close.pngbin689 -> 0 bytes
-rw-r--r--module/web/media/img/dialog-question.pngbin2073 -> 0 bytes
-rw-r--r--module/web/media/js/MooDialog_static.js401
-rw-r--r--module/web/media/js/MooDropMenu_static.js89
-rw-r--r--module/web/media/js/admin.coffee58
-rw-r--r--module/web/media/js/admin.js3
-rw-r--r--module/web/media/js/base.coffee173
-rw-r--r--module/web/media/js/base.js3
-rw-r--r--module/web/media/js/mootools-core-1.4.1.js476
-rw-r--r--module/web/media/js/mootools-more-1.4.0.1.js216
-rw-r--r--module/web/media/js/package_ui.js377
-rw-r--r--module/web/media/js/purr_static.js308
-rw-r--r--module/web/media/js/settings.coffee107
-rw-r--r--module/web/media/js/settings.js3
-rw-r--r--module/web/media/js/tinytab_static.js50
-rw-r--r--module/web/middlewares.py14
-rw-r--r--module/web/pyload_app.py491
-rw-r--r--module/web/static/css/bootstrap.css5774
-rw-r--r--module/web/static/css/default/style.less318
-rw-r--r--module/web/static/css/font.css37
-rw-r--r--module/web/static/css/mobile/images/ajax-loader.gifbin0 -> 7825 bytes
-rw-r--r--module/web/static/css/mobile/images/ajax-loader.pngbin0 -> 340 bytes
-rw-r--r--module/web/static/css/mobile/images/icons-18-black.pngbin0 -> 1767 bytes
-rw-r--r--module/web/static/css/mobile/images/icons-18-white.pngbin0 -> 1806 bytes
-rw-r--r--module/web/static/css/mobile/images/icons-36-black.pngbin0 -> 3611 bytes
-rw-r--r--module/web/static/css/mobile/images/icons-36-white.pngbin0 -> 3648 bytes
-rw-r--r--module/web/static/css/mobile/jquery.mobile-1.1.1.min.css2
-rw-r--r--module/web/static/css/mobile/my.css93
-rw-r--r--module/web/static/css/mobile/style.css214
-rw-r--r--module/web/static/fonts/Sansation_Bold-webfont.eotbin0 -> 35336 bytes
-rw-r--r--module/web/static/fonts/Sansation_Bold-webfont.ttfbin0 -> 35160 bytes
-rw-r--r--module/web/static/fonts/Sansation_Bold-webfont.woffbin0 -> 18496 bytes
-rw-r--r--module/web/static/fonts/Sansation_Light-webfont.eotbin0 -> 36700 bytes
-rw-r--r--module/web/static/fonts/Sansation_Light-webfont.ttfbin0 -> 36520 bytes
-rw-r--r--module/web/static/fonts/Sansation_Light-webfont.woffbin0 -> 18408 bytes
-rw-r--r--module/web/static/fonts/Sansation_Regular-webfont.eotbin0 -> 36368 bytes
-rw-r--r--module/web/static/fonts/Sansation_Regular-webfont.ttfbin0 -> 36180 bytes
-rw-r--r--module/web/static/fonts/Sansation_Regular-webfont.woffbin0 -> 18316 bytes
-rw-r--r--module/web/static/img/default/arrow_refresh.png (renamed from module/web/media/default/img/arrow_refresh.png)bin685 -> 685 bytes
-rw-r--r--module/web/static/img/default/bgpattern.pngbin0 -> 2487 bytes
-rw-r--r--module/web/static/img/default/delete.png (renamed from module/web/media/default/img/delete.png)bin715 -> 715 bytes
-rw-r--r--module/web/static/img/default/double-line.gifbin0 -> 50 bytes
-rw-r--r--module/web/static/img/default/fancy_deboss.pngbin0 -> 265 bytes
-rw-r--r--module/web/static/img/default/folder.png (renamed from module/web/media/default/img/folder.png)bin537 -> 537 bytes
-rw-r--r--module/web/static/img/default/icon_blank_file_black.pngbin0 -> 291 bytes
-rw-r--r--module/web/static/img/default/icon_clock_small_white.pngbin0 -> 1540 bytes
-rw-r--r--module/web/static/img/default/icon_folder.pngbin0 -> 222 bytes
-rw-r--r--module/web/static/img/default/icon_speed_small_white.pngbin0 -> 1654 bytes
-rw-r--r--module/web/static/img/default/icon_user_small_white.pngbin0 -> 1475 bytes
-rw-r--r--module/web/static/img/default/logo.pngbin0 -> 8340 bytes
-rw-r--r--module/web/static/img/default/logo_grey.pngbin0 -> 6236 bytes
-rw-r--r--module/web/static/img/default/main-wrapper-bg.pngbin0 -> 114902 bytes
-rw-r--r--module/web/static/img/default/pencil.png (renamed from module/web/media/default/img/pencil.png)bin450 -> 450 bytes
-rw-r--r--module/web/static/img/favicon.ico (renamed from module/web/media/img/favicon.ico)bin7206 -> 7206 bytes
-rw-r--r--module/web/static/img/glyphicons-halflings-white.pngbin0 -> 8777 bytes
-rw-r--r--module/web/static/img/glyphicons-halflings.pngbin0 -> 12799 bytes
-rw-r--r--module/web/static/js/app.build.js22
-rw-r--r--module/web/static/js/collections/FileList.js17
-rw-r--r--module/web/static/js/collections/PackageList.js15
-rw-r--r--module/web/static/js/default.js57
-rw-r--r--module/web/static/js/libs/backbone-0.9.2.js1431
-rw-r--r--module/web/static/js/libs/bootstrap-2.1.1.js2027
-rw-r--r--module/web/static/js/libs/jquery-1.8.0.js9227
-rw-r--r--module/web/static/js/libs/jquery.fastClick-0.2.js96
-rw-r--r--module/web/static/js/libs/jquery.flot.min.js6
-rw-r--r--module/web/static/js/libs/jquery.mobile-1.1.1.min.js181
-rw-r--r--module/web/static/js/libs/jquery.omniwindow.js141
-rw-r--r--module/web/static/js/libs/jquery.transit-0.1.3.js658
-rw-r--r--module/web/static/js/libs/jqueryui/accordion.js614
-rw-r--r--module/web/static/js/libs/jqueryui/autocomplete.js634
-rw-r--r--module/web/static/js/libs/jqueryui/button.js417
-rw-r--r--module/web/static/js/libs/jqueryui/core.js337
-rw-r--r--module/web/static/js/libs/jqueryui/datepicker.js1857
-rw-r--r--module/web/static/js/libs/jqueryui/dialog.js869
-rw-r--r--module/web/static/js/libs/jqueryui/draggable.js836
-rw-r--r--module/web/static/js/libs/jqueryui/droppable.js299
-rw-r--r--module/web/static/js/libs/jqueryui/effects/blind.js52
-rw-r--r--module/web/static/js/libs/jqueryui/effects/bounce.js81
-rw-r--r--module/web/static/js/libs/jqueryui/effects/clip.js57
-rw-r--r--module/web/static/js/libs/jqueryui/effects/core.js615
-rw-r--r--module/web/static/js/libs/jqueryui/effects/drop.js53
-rw-r--r--module/web/static/js/libs/jqueryui/effects/explode.js82
-rw-r--r--module/web/static/js/libs/jqueryui/effects/fade.js35
-rw-r--r--module/web/static/js/libs/jqueryui/effects/fold.js59
-rw-r--r--module/web/static/js/libs/jqueryui/effects/highlight.js53
-rw-r--r--module/web/static/js/libs/jqueryui/effects/pulsate.js54
-rw-r--r--module/web/static/js/libs/jqueryui/effects/scale.js181
-rw-r--r--module/web/static/js/libs/jqueryui/effects/shake.js60
-rw-r--r--module/web/static/js/libs/jqueryui/effects/slide.js53
-rw-r--r--module/web/static/js/libs/jqueryui/effects/transfer.js48
-rw-r--r--module/web/static/js/libs/jqueryui/mouse.js170
-rw-r--r--module/web/static/js/libs/jqueryui/position.js311
-rw-r--r--module/web/static/js/libs/jqueryui/progressbar.js112
-rw-r--r--module/web/static/js/libs/jqueryui/resizable.js810
-rw-r--r--module/web/static/js/libs/jqueryui/selectable.js270
-rw-r--r--module/web/static/js/libs/jqueryui/slider.js665
-rw-r--r--module/web/static/js/libs/jqueryui/sortable.js1087
-rw-r--r--module/web/static/js/libs/jqueryui/tabs.js760
-rw-r--r--module/web/static/js/libs/jqueryui/widget.js275
-rw-r--r--module/web/static/js/libs/less-1.3.0.min.js9
-rw-r--r--module/web/static/js/libs/lodash-0.5.2.js4263
-rw-r--r--module/web/static/js/libs/require-2.0.6.js2041
-rw-r--r--module/web/static/js/mobile.js42
-rw-r--r--module/web/static/js/models/File.js33
-rw-r--r--module/web/static/js/models/Package.js76
-rw-r--r--module/web/static/js/models/TreeCollection.js38
-rw-r--r--module/web/static/js/plugins/text-2.0.3.js308
-rw-r--r--module/web/static/js/routers/defaultRouter.js29
-rw-r--r--module/web/static/js/routers/mobileRouter.js55
-rw-r--r--module/web/static/js/utils/animations.js36
-rw-r--r--module/web/static/js/utils/lazyRequire.js89
-rw-r--r--module/web/static/js/views/fileView.js20
-rw-r--r--module/web/static/js/views/headerView.js75
-rw-r--r--module/web/static/js/views/mobile/my.js275
-rw-r--r--module/web/static/js/views/modal/modalView.js84
-rw-r--r--module/web/static/js/views/packageTreeView.js75
-rw-r--r--module/web/static/js/views/packageView.js60
-rw-r--r--module/web/templates/500.html3
-rw-r--r--module/web/templates/default/admin.html98
-rw-r--r--module/web/templates/default/backbone/modal.html11
-rw-r--r--module/web/templates/default/base.html283
-rw-r--r--module/web/templates/default/captcha.html42
-rw-r--r--module/web/templates/default/dashboard.html65
-rw-r--r--module/web/templates/default/downloads.html29
-rw-r--r--module/web/templates/default/filemanager.html80
-rw-r--r--module/web/templates/default/filemanager_ui.js291
-rw-r--r--module/web/templates/default/folder.html15
-rw-r--r--module/web/templates/default/home.html266
-rw-r--r--module/web/templates/default/info.html81
-rw-r--r--module/web/templates/default/login.html61
-rw-r--r--module/web/templates/default/logout.html9
-rw-r--r--module/web/templates/default/logs.html41
-rw-r--r--module/web/templates/default/pathchooser.html76
-rw-r--r--module/web/templates/default/queue.html104
-rw-r--r--module/web/templates/default/settings.html214
-rw-r--r--module/web/templates/default/settings_item.html48
-rw-r--r--module/web/templates/default/setup.html13
-rw-r--r--module/web/templates/default/window.html46
-rw-r--r--module/web/templates/mobile/base.html41
-rw-r--r--module/web/templates/mobile/login.html5
-rw-r--r--module/web/utils.py123
-rw-r--r--module/web/webinterface.py10
209 files changed, 40171 insertions, 5984 deletions
diff --git a/module/web/ServerThread.py b/module/web/ServerThread.py
index 84667e5f6..bf5ba8373 100644
--- a/module/web/ServerThread.py
+++ b/module/web/ServerThread.py
@@ -35,13 +35,6 @@ class WebServer(threading.Thread):
log.warning(_("SSL certificates not found."))
self.https = False
- if self.server in ("lighttpd", "nginx"):
- log.warning(_("Sorry, we dropped support for starting %s directly within pyLoad") % self.server)
- log.warning(_("You can use the threaded server which offers good performance and ssl,"))
- log.warning(_("of course you can still use your existing %s with pyLoads fastcgi server") % self.server)
- log.warning(_("sample configs are located in the module/web/servers directory"))
- self.server = "builtin"
-
if self.server == "fastcgi":
try:
import flup
@@ -59,12 +52,10 @@ class WebServer(threading.Thread):
log.warning(_("Of course you need to be familiar with linux and know how to compile software"))
self.server = "builtin"
- if os.name == "nt":
- self.core.log.info(_("Server set to threaded, due to known performance problems on windows."))
- self.core.config['webinterface']['server'] = "threaded"
+ # threaded is the new default server
+ if self.server == "builtin":
self.server = "threaded"
-
if self.server == "fastcgi":
self.start_fcgi()
elif self.server == "threaded":
@@ -72,9 +63,9 @@ class WebServer(threading.Thread):
elif self.server == "lightweight":
self.start_lightweight()
else:
- self.start_builtin()
+ self.start_fallback()
- def start_builtin(self):
+ def start_fallback(self):
if self.https:
log.warning(_("This server offers no SSL, please consider using threaded instead"))
@@ -94,6 +85,12 @@ class WebServer(threading.Thread):
def start_fcgi(self):
+ from flup.server.threadedserver import ThreadedServer
+ def noop(*args, **kwargs):
+ pass
+
+ ThreadedServer._installSignalHandlers = noop
+
self.core.log.info(_("Starting fastcgi server: %(host)s:%(port)d") % {"host": self.host, "port": self.port})
webinterface.run_fcgi(host=self.host, port=self.port)
diff --git a/module/web/api_app.py b/module/web/api_app.py
index 1629c1677..b2d7fa5b6 100644
--- a/module/web/api_app.py
+++ b/module/web/api_app.py
@@ -7,10 +7,11 @@ from traceback import format_exc, print_exc
from bottle import route, request, response, HTTPError
-from utils import toDict, set_session
+from utils import set_session, get_user_api
from webinterface import PYLOAD
from module.common.json_layer import json
+from module.utils import remove_chars, to_dict
from module.lib.SafeEval import const_eval as literal_eval
from module.Api import BaseObject
@@ -19,26 +20,32 @@ class TBaseEncoder(json.JSONEncoder):
def default(self, o):
if isinstance(o, BaseObject):
- return toDict(o)
+ return to_dict(o)
return json.JSONEncoder.default(self, o)
-# accepting positional arguments, as well as kwargs via post and get
+def add_header(r):
+ r.headers.replace("Content-type", "application/json")
+ r.headers.append("Cache-Control", "no-cache, must-revalidate")
+ r.headers.append("Access-Control-Allow-Origin", "*") # allow xhr requests
-@route("/api/:func:args#[a-zA-Z0-9\-_/\"'\[\]%{}]*#")
-@route("/api/:func:args#[a-zA-Z0-9\-_/\"'\[\]%{}]*#", method="POST")
+# accepting positional arguments, as well as kwargs via post and get
+# only forbidden path symbol are "?", which is used to separate GET data and #
+@route("/api/<func><args:re:[^#?]*>")
+@route("/api/<func><args:re:[^#?]*>", method="POST")
def call_api(func, args=""):
- response.headers.replace("Content-type", "application/json")
- response.headers.append("Cache-Control", "no-cache, must-revalidate")
+ add_header(response)
s = request.environ.get('beaker.session')
if 'session' in request.POST:
- s = s.get_by_id(request.POST['session'])
+ # removes "' so it works on json strings
+ s = s.get_by_id(remove_chars(request.POST['session'], "'\""))
- if not s or not s.get("authenticated", False):
+ api = get_user_api(s)
+ if not api:
return HTTPError(403, json.dumps("Forbidden"))
- if not PYLOAD.isAuthorized(func, {"role": s["role"], "permission": s["perms"]}):
+ if not PYLOAD.isAuthorized(func, api.user):
return HTTPError(401, json.dumps("Unauthorized"))
args = args.split("/")[1:]
@@ -54,16 +61,18 @@ def call_api(func, args=""):
print_exc()
return HTTPError(500, json.dumps({"error": e.message, "traceback": format_exc()}))
+# Better error codes on invalid input
def callApi(func, *args, **kwargs):
if not hasattr(PYLOAD.EXTERNAL, func) or func.startswith("_"):
print "Invalid API call", func
return HTTPError(404, json.dumps("Not Found"))
+ # TODO: encoding
result = getattr(PYLOAD, func)(*[literal_eval(x) for x in args],
**dict([(x, literal_eval(y)) for x, y in kwargs.iteritems()]))
- # null is invalid json response
+ # null is invalid json response
if result is None: result = True
return json.dumps(result, cls=TBaseEncoder)
@@ -72,31 +81,31 @@ def callApi(func, *args, **kwargs):
#post -> username, password
@route("/api/login", method="POST")
def login():
- response.headers.replace("Content-type", "application/json")
- response.headers.append("Cache-Control", "no-cache, must-revalidate")
+ add_header(response)
- user = request.forms.get("username")
+ username = request.forms.get("username")
password = request.forms.get("password")
- info = PYLOAD.checkAuth(user, password)
+ user = PYLOAD.checkAuth(username, password)
- if not info:
+ if not user:
return json.dumps(False)
- s = set_session(request, info)
+ s = set_session(request, user)
# get the session id by dirty way, documentations seems wrong
try:
sid = s._headers["cookie_out"].split("=")[1].split(";")[0]
return json.dumps(sid)
except:
+ print "Could not get session"
return json.dumps(True)
@route("/api/logout")
+@route("/api/logout", method="POST")
def logout():
- response.headers.replace("Content-type", "application/json")
- response.headers.append("Cache-Control", "no-cache, must-revalidate")
+ add_header(response)
s = request.environ.get('beaker.session')
s.delete()
diff --git a/module/web/cnl_app.py b/module/web/cnl_app.py
index d8f7c1180..b6a98a0a8 100644
--- a/module/web/cnl_app.py
+++ b/module/web/cnl_app.py
@@ -6,6 +6,8 @@ from urllib import unquote
from base64 import standard_b64decode
from binascii import unhexlify
+from module.utils.fs import save_filename
+
from bottle import route, request, HTTPError
from webinterface import PYLOAD, DL_ROOT, JS
@@ -18,7 +20,7 @@ except:
def local_check(function):
def _view(*args, **kwargs):
if request.environ.get('REMOTE_ADDR', "0") in ('127.0.0.1', 'localhost') \
- or request.environ.get('HTTP_HOST','0') == '127.0.0.1:9666':
+ or request.environ.get('HTTP_HOST','0') in ('127.0.0.1:9666', 'localhost:9666'):
return function(*args, **kwargs)
else:
return HTTPError(403, "Forbidden")
@@ -53,7 +55,7 @@ def addcrypted():
package = request.forms.get('referer', 'ClickAndLoad Package')
dlc = request.forms['crypted'].replace(" ", "+")
- dlc_path = join(DL_ROOT, package.replace("/", "").replace("\\", "").replace(":", "") + ".dlc")
+ dlc_path = join(DL_ROOT, save_filename(package) + ".dlc")
dlc_file = open(dlc_path, "wb")
dlc_file.write(dlc)
dlc_file.close()
diff --git a/module/web/json_app.py b/module/web/json_app.py
deleted file mode 100644
index f3626405c..000000000
--- a/module/web/json_app.py
+++ /dev/null
@@ -1,312 +0,0 @@
-#!/usr/bin/env python
-# -*- coding: utf-8 -*-
-
-from os.path import join
-from traceback import print_exc
-from shutil import copyfileobj
-
-from bottle import route, request, HTTPError
-
-from webinterface import PYLOAD
-
-from utils import login_required, render_to_response, toDict
-
-from module.utils import decode, formatSize
-
-
-def format_time(seconds):
- seconds = int(seconds)
-
- hours, seconds = divmod(seconds, 3600)
- minutes, seconds = divmod(seconds, 60)
- return "%.2i:%.2i:%.2i" % (hours, minutes, seconds)
-
-
-def get_sort_key(item):
- return item["order"]
-
-
-@route("/json/status")
-@route("/json/status", method="POST")
-@login_required('LIST')
-def status():
- try:
- status = toDict(PYLOAD.statusServer())
- status['captcha'] = PYLOAD.isCaptchaWaiting()
- return status
- except:
- return HTTPError()
-
-
-@route("/json/links")
-@route("/json/links", method="POST")
-@login_required('LIST')
-def links():
- try:
- links = [toDict(x) for x in PYLOAD.statusDownloads()]
- ids = []
- for link in links:
- ids.append(link['fid'])
-
- if link['status'] == 12:
- link['info'] = "%s @ %s/s" % (link['format_eta'], formatSize(link['speed']))
- elif link['status'] == 5:
- link['percent'] = 0
- link['size'] = 0
- link['bleft'] = 0
- link['info'] = _("waiting %s") % link['format_wait']
- else:
- link['info'] = ""
-
- data = {'links': links, 'ids': ids}
- return data
- except Exception, e:
- print_exc()
- return HTTPError()
-
-
-@route("/json/packages")
-@login_required('LIST')
-def packages():
- print "/json/packages"
- try:
- data = PYLOAD.getQueue()
-
- for package in data:
- package['links'] = []
- for file in PYLOAD.get_package_files(package['id']):
- package['links'].append(PYLOAD.get_file_info(file))
-
- return data
-
- except:
- return HTTPError()
-
-
-@route("/json/package/<id:int>")
-@login_required('LIST')
-def package(id):
- try:
- data = toDict(PYLOAD.getPackageData(id))
- data["links"] = [toDict(x) for x in data["links"]]
-
- for pyfile in data["links"]:
- if pyfile["status"] == 0:
- pyfile["icon"] = "status_finished.png"
- elif pyfile["status"] in (2, 3):
- pyfile["icon"] = "status_queue.png"
- elif pyfile["status"] in (9, 1):
- pyfile["icon"] = "status_offline.png"
- elif pyfile["status"] == 5:
- pyfile["icon"] = "status_waiting.png"
- elif pyfile["status"] == 8:
- pyfile["icon"] = "status_failed.png"
- elif pyfile["status"] == 4:
- pyfile["icon"] = "arrow_right.png"
- elif pyfile["status"] in (11, 13):
- pyfile["icon"] = "status_proc.png"
- else:
- pyfile["icon"] = "status_downloading.png"
-
- tmp = data["links"]
- tmp.sort(key=get_sort_key)
- data["links"] = tmp
- return data
-
- except:
- print_exc()
- return HTTPError()
-
-
-@route("/json/package_order/:ids")
-@login_required('ADD')
-def package_order(ids):
- try:
- pid, pos = ids.split("|")
- PYLOAD.orderPackage(int(pid), int(pos))
- return {"response": "success"}
- except:
- return HTTPError()
-
-
-@route("/json/abort_link/<id:int>")
-@login_required('DELETE')
-def abort_link(id):
- try:
- PYLOAD.stopDownloads([id])
- return {"response": "success"}
- except:
- return HTTPError()
-
-
-@route("/json/link_order/:ids")
-@login_required('ADD')
-def link_order(ids):
- try:
- pid, pos = ids.split("|")
- PYLOAD.orderFile(int(pid), int(pos))
- return {"response": "success"}
- except:
- return HTTPError()
-
-
-@route("/json/add_package")
-@route("/json/add_package", method="POST")
-@login_required('ADD')
-def add_package():
- name = request.forms.get("add_name", "New Package").strip()
- queue = int(request.forms['add_dest'])
- links = decode(request.forms['add_links'])
- links = links.split("\n")
- pw = request.forms.get("add_password", "").strip("\n\r")
-
- try:
- f = request.files['add_file']
-
- if not name or name == "New Package":
- name = f.name
-
- fpath = join(PYLOAD.getConfigValue("general", "download_folder"), "tmp_" + f.filename)
- destination = open(fpath, 'wb')
- copyfileobj(f.file, destination)
- destination.close()
- links.insert(0, fpath)
- except:
- pass
-
- name = name.decode("utf8", "ignore")
-
- links = map(lambda x: x.strip(), links)
- links = filter(lambda x: x != "", links)
-
- pack = PYLOAD.addPackage(name, links, queue)
- if pw:
- pw = pw.decode("utf8", "ignore")
- data = {"password": pw}
- PYLOAD.setPackageData(pack, data)
-
-
-@route("/json/move_package/<dest:int>/<id:int>")
-@login_required('MODIFY')
-def move_package(dest, id):
- try:
- PYLOAD.movePackage(dest, id)
- return {"response": "success"}
- except:
- return HTTPError()
-
-
-@route("/json/edit_package", method="POST")
-@login_required('MODIFY')
-def edit_package():
- try:
- id = int(request.forms.get("pack_id"))
- data = {"name": request.forms.get("pack_name").decode("utf8", "ignore"),
- "folder": request.forms.get("pack_folder").decode("utf8", "ignore"),
- "password": request.forms.get("pack_pws").decode("utf8", "ignore")}
-
- PYLOAD.setPackageData(id, data)
- return {"response": "success"}
-
- except:
- return HTTPError()
-
-
-@route("/json/set_captcha")
-@route("/json/set_captcha", method="POST")
-@login_required('ADD')
-def set_captcha():
- if request.environ.get('REQUEST_METHOD', "GET") == "POST":
- try:
- PYLOAD.setCaptchaResult(request.forms["cap_id"], request.forms["cap_result"])
- except:
- pass
-
- task = PYLOAD.getCaptchaTask()
-
- if task.tid >= 0:
- src = "data:image/%s;base64,%s" % (task.type, task.data)
-
- return {'captcha': True, 'id': task.tid, 'src': src, 'result_type' : task.resultType}
- else:
- return {'captcha': False}
-
-
-@route("/json/load_config/:category/:section")
-@login_required("SETTINGS")
-def load_config(category, section):
- conf = None
- if category == "general":
- conf = PYLOAD.getConfigDict()
- elif category == "plugin":
- conf = PYLOAD.getPluginConfigDict()
-
- for key, option in conf[section].iteritems():
- if key in ("desc","outline"): continue
-
- if ";" in option["type"]:
- option["list"] = option["type"].split(";")
-
- option["value"] = decode(option["value"])
-
- return render_to_response("settings_item.html", {"skey": section, "section": conf[section]})
-
-
-@route("/json/save_config/:category", method="POST")
-@login_required("SETTINGS")
-def save_config(category):
- for key, value in request.POST.iteritems():
- try:
- section, option = key.split("|")
- except:
- continue
-
- if category == "general": category = "core"
-
- PYLOAD.setConfigValue(section, option, decode(value), category)
-
-
-@route("/json/add_account", method="POST")
-@login_required("ACCOUNTS")
-def add_account():
- login = request.POST["account_login"]
- password = request.POST["account_password"]
- type = request.POST["account_type"]
-
- PYLOAD.updateAccount(type, login, password)
-
-
-@route("/json/update_accounts", method="POST")
-@login_required("ACCOUNTS")
-def update_accounts():
- deleted = [] #dont update deleted accs or they will be created again
-
- for name, value in request.POST.iteritems():
- value = value.strip()
- if not value: continue
-
- tmp, user = name.split(";")
- plugin, action = tmp.split("|")
-
- if (plugin, user) in deleted: continue
-
- if action == "password":
- PYLOAD.updateAccount(plugin, user, value)
- elif action == "time" and "-" in value:
- PYLOAD.updateAccount(plugin, user, options={"time": [value]})
- elif action == "limitdl" and value.isdigit():
- PYLOAD.updateAccount(plugin, user, options={"limitDL": [value]})
- elif action == "delete":
- deleted.append((plugin,user))
- PYLOAD.removeAccount(plugin, user)
-
-@route("/json/change_password", method="POST")
-def change_password():
-
- user = request.POST["user_login"]
- oldpw = request.POST["login_current_password"]
- newpw = request.POST["login_new_password"]
-
- if not PYLOAD.changePassword(user, oldpw, newpw):
- print "Wrong password"
- return HTTPError()
diff --git a/module/web/media/default/css/MooDialog.css b/module/web/media/default/css/MooDialog.css
deleted file mode 100644
index 48c9166ad..000000000
--- a/module/web/media/default/css/MooDialog.css
+++ /dev/null
@@ -1,92 +0,0 @@
-/* Created by Arian Stolwijk <http://www.aryweb.nl> */
-
-.MooDialog {
-/* position: fixed;*/
- margin: 0 auto 0 -350px;
- width:600px;
- padding:14px;
- left:50%;
- top: 100px;
-
- position: absolute;
- left: 50%;
- z-index: 50000;
-
- background: #eef5f8;
- color: black;
- border-radius: 7px;
- -moz-border-radius: 7px;
- -webkit-border-radius: 7px;
- border-radius: 7px;
- -moz-box-shadow: 1px 1px 5px rgba(0,0,0,0.8);
- -webkit-box-shadow: 1px 1px 5px rgba(0,0,0,0.8);
- box-shadow: 1px 1px 5px rgba(0,0,0,0.8);
-}
-
-.MooDialogTitle {
- padding-top: 30px;
-}
-
-.MooDialog .title {
- position: absolute;
- top: 0;
- left: 0;
- right: 0;
- padding: 3px 20px;
- background: #b7c4dc;
- border-bottom: 1px solid #a1aec5;
- font-weight: bold;
- text-shadow: 1px 1px 0 #fff;
- color: black;
- border-radius: 7px;
- -moz-border-radius: 7px;
- -webkit-border-radius: 7px;
-}
-
-.MooDialog .close {
- background: url(/media/img/dialog-close.png) no-repeat;
- width: 16px;
- height: 16px;
- display: block;
- cursor: pointer;
- top: -5px;
- left: -5px;
- position: absolute;
-}
-
-.MooDialog .buttons {
- text-align: right;
- margin: 0;
- padding: 0;
- border: 0;
- background: none;
-}
-
-.MooDialog .iframe {
- width: 100%;
- height: 100%;
-}
-
-.MooDialog .textInput {
- width: 200px;
- float: left;
-}
-
-.MooDialog .MooDialogAlert,
-.MooDialog .MooDialogConfirm,
-.MooDialog .MooDialogPrompt,
-.MooDialog .MooDialogError {
- background: url(/media/img/dialog-warning.png) no-repeat;
- padding-left: 40px;
- min-height: 40px;
-}
-
-.MooDialog .MooDialogConfirm,
-.MooDialog .MooDialogPromt {
- background: url(/media/img/dialog-question.png) no-repeat;
-}
-
-.MooDialog .MooDialogError {
- background: url(/media/img/dialog-error.png) no-repeat;
-}
-
diff --git a/module/web/media/default/css/default.css b/module/web/media/default/css/default.css
deleted file mode 100644
index fc0d148c2..000000000
--- a/module/web/media/default/css/default.css
+++ /dev/null
@@ -1,908 +0,0 @@
-.hidden {
- display:none;
-}
-.leftalign {
- text-align:left;
-}
-.centeralign {
- text-align:center;
-}
-.rightalign {
- text-align:right;
-}
-
-
-.dokuwiki div.plugin_translation ul li a.wikilink1:link, .dokuwiki div.plugin_translation ul li a.wikilink1:hover, .dokuwiki div.plugin_translation ul li a.wikilink1:active, .dokuwiki div.plugin_translation ul li a.wikilink1:visited {
- background-color:#000080;
- color:#fff !important;
- text-decoration:none;
- padding:0 0.2em;
- margin:0.1em 0.2em;
- border:none !important;
-}
-.dokuwiki div.plugin_translation ul li a.wikilink2:link, .dokuwiki div.plugin_translation ul li a.wikilink2:hover, .dokuwiki div.plugin_translation ul li a.wikilink2:active, .dokuwiki div.plugin_translation ul li a.wikilink2:visited {
- background-color:#808080;
- color:#fff !important;
- text-decoration:none;
- padding:0 0.2em;
- margin:0.1em 0.2em;
- border:none !important;
-}
-
-.dokuwiki div.plugin_translation ul li a:hover img {
- opacity:1.0;
- height:15px;
-}
-
-body {
- margin:0;
- padding:0;
- background-color:white;
- color:black;
- font-size:12px;
- font-family:Verdana, Helvetica, "Lucida Grande", Lucida, Arial, sans-serif;
- font-family:sans-serif;
- font-size:99, 96%;
- font-size-adjust:none;
- font-style:normal;
- font-variant:normal;
- font-weight:normal;
- line-height:normal;
-}
-hr {
- border-width:0;
- border-bottom:1px #aaa dotted;
-}
-img {
- border:none;
-}
-form {
- margin:0px;
- padding:0px;
- border:none;
- display:inline;
- background:transparent;
-}
-ul li {
- margin:5px;
-}
-textarea {
- font-family:monospace;
-}
-table {
- margin:0.5em 0;
- border-collapse:collapse;
-}
-td {
- padding:0.25em;
- border:1pt solid #ADB9CC;
-}
-a {
- color:#3465a4;
- text-decoration:none;
-}
-a:hover {
- text-decoration:underline;
-}
-
-option {
- border:0 none #fff;
-}
-strong.highlight {
- background-color:#fc9;
- padding:1pt;
-}
-#pagebottom {
- clear:both;
-}
-hr {
- height:1px;
- color:#c0c0c0;
- background-color:#c0c0c0;
- border:none;
- margin:.2em 0 .2em 0;
-}
-
-.invisible {
- margin:0px;
- border:0px;
- padding:0px;
- height:0px;
- visibility:hidden;
-}
-.left {
- float:left !important;
-}
-.right {
- float:right !important;
-}
-.center {
- text-align:center;
-}
-div#body-wrapper {
- padding:40px 40px 10px 40px;
- font-size:127%;
-}
-div#content {
- margin-top:-20px;
- padding:0;
- font-size:14px;
- color:black;
- line-height:1.5em;
-}
-h1, h2, h3, h4, h5, h6 {
- background:transparent none repeat scroll 0 0;
- border-bottom:1px solid #aaa;
- color:black;
- font-weight:normal;
- margin:0;
- padding:0;
- padding-bottom:0.17em;
- padding-top:0.5em;
-}
-h1 {
- font-size:188%;
- line-height:1.2em;
- margin-bottom:0.1em;
- padding-bottom:0;
-}
-h2 {
- font-size:150%;
-}
-h3, h4, h5, h6 {
- border-bottom:none;
- font-weight:bold;
-}
-h3 {
- font-size:132%;
-}
-h4 {
- font-size:116%;
-}
-h5 {
- font-size:100%;
-}
-h6 {
- font-size:80%;
-}
-ul#page-actions, ul#page-actions-more {
- float:right;
- margin:10px 10px 0 10px;
- padding:6px;
- color:black;
- background-color:#ececec;
- list-style-type:none;
- white-space: nowrap;
- border-radius:5px;
- -moz-border-radius:5px;
-}
-ul#user-actions {
- padding:5px;
- margin:0;
- display:inline;
- color:black;
- background-color:#ececec;
- list-style-type:none;
- -moz-border-radius:3px;
- border-radius:3px;
-}
-ul#page-actions li, ul#user-actions li, ul#page-actions-more li {
- display:inline;
-}
-ul#page-actions a, ul#user-actions a, ul#page-actions-more a {
- text-decoration:none;
- color:black;
- display:inline;
- margin:0 3px;
- padding:2px 0px 2px 18px;
-}
-ul#page-actions a:hover, ul#page-actions a:focus, ul#user-actions a:hover, ul#user-actions a:focus {
- /*text-decoration:underline;*/
-}
-/***************************/
-ul#page-actions2 {
- float:left;
- margin:10px 10px 0 10px;
- padding:6px;
- color:black;
- background-color:#ececec;
- list-style-type:none;
- border-radius:5px;
- -moz-border-radius:5px;
-}
-ul#user-actions2 {
- padding:5px;
- margin:0;
- display:inline;
- color:black;
- background-color:#ececec;
- list-style-type:none;
- border-radius:3px;
- -moz-border-radius:3px;
-}
-ul#page-actions2 li, ul#user-actions2 li {
- display:inline;
-}
-ul#page-actions2 a, ul#user-actions2 a {
- text-decoration:none;
- color:black;
- display:inline;
- margin:0 3px;
- padding:2px 0px 2px 18px;
-}
-ul#page-actions2 a:hover, ul#page-actions2 a:focus, ul#user-actions2 a:hover, ul#user-actions2 a:focus,
-ul#page-actions-more a:hover, ul#page-actions-more a:focus{
- color: #4e7bb4;
-}
-/****************************/
-.hidden {
- display:none;
-}
-
-a.action.index {
- background:transparent url(/media/default/img/wiki-tools-index.png) 0px 1px no-repeat;
-}
-a.action.recent {
- background:transparent url(/media/default/img/wiki-tools-recent.png) 0px 1px no-repeat;
-}
-a.logout {
- background:transparent url(/media/default/img/user-actions-logout.png) 0px 1px no-repeat;
-}
-
-a.info {
- background:transparent url(/media/default/img/user-info.png) 0px 1px no-repeat;
-}
-
-a.admin {
- background:transparent url(/media/default/img/user-actions-admin.png) 0px 1px no-repeat;
-}
-a.profile {
- background:transparent url(/media/default/img/user-actions-profile.png) 0px 1px no-repeat;
-}
-a.create, a.edit {
- background:transparent url(/media/default/img/page-tools-edit.png) 0px 1px no-repeat;
-}
-a.source, a.show {
- background:transparent url(/media/default/img/page-tools-source.png) 0px 1px no-repeat;
-}
-a.revisions {
- background:transparent url(/media/default/img/page-tools-revisions.png) 0px 1px no-repeat;
-}
-a.subscribe, a.unsubscribe {
- background:transparent url(/media/default/img/page-tools-subscribe.png) 0px 1px no-repeat;
-}
-a.backlink {
- background:transparent url(/media/default/img/page-tools-backlinks.png) 0px 1px no-repeat;
-}
-a.play {
- background:transparent url(/media/default/img/control_play.png) 0px 1px no-repeat;
-}
-.time {
- background:transparent url(/media/default/img/status_None.png) 0px 1px no-repeat;
- padding: 2px 0px 2px 18px;
- margin: 0px 3px;
-}
-.reconnect {
- background:transparent url(/media/default/img/reconnect.png) 0px 1px no-repeat;
- padding: 2px 0px 2px 18px;
- margin: 0px 3px;
-}
-a.play:hover {
- background:transparent url(/media/default/img/control_play_blue.png) 0px 1px no-repeat;
-}
-a.cancel {
- background:transparent url(/media/default/img/control_cancel.png) 0px 1px no-repeat;
-}
-a.cancel:hover {
- background:transparent url(/media/default/img/control_cancel_blue.png) 0px 1px no-repeat;
-}
-a.pause {
- background:transparent url(/media/default/img/control_pause.png) 0px 1px no-repeat;
-}
-a.pause:hover {
- background:transparent url(/media/default/img/control_pause_blue.png) 0px 1px no-repeat;
- font-weight: bold;
-}
-a.stop {
- background:transparent url(/media/default/img/control_stop.png) 0px 1px no-repeat;
-}
-a.stop:hover {
- background:transparent url(/media/default/img/control_stop_blue.png) 0px 1px no-repeat;
-}
-a.add {
- background:transparent url(/media/default/img/control_add.png) 0px 1px no-repeat;
-}
-a.add:hover {
- background:transparent url(/media/default/img/control_add_blue.png) 0px 1px no-repeat;
-}
-a.cog {
- background:transparent url(/media/default/img/cog.png) 0px 1px no-repeat;
-}
-#head-panel {
- background:#525252 url(/media/default/img/head_bg1.png) bottom left repeat-x;
-}
-#head-panel h1 {
- display:none;
- margin:0;
- text-decoration:none;
- padding-top:0.8em;
- padding-left:3.3em;
- font-size:2.6em;
- color:#eeeeec;
-}
-#head-panel #head-logo {
- float:left;
- margin:5px 0 -15px 5px;
- padding:0;
- overflow:visible;
-}
-#head-menu {
- background:transparent url(/media/default/img/tabs-border-bottom.png) 0 100% repeat-x;
- width:100%;
- float:left;
- margin:0;
- padding:0;
- padding-top:0.8em;
-}
-#head-menu ul {
- list-style:none;
- margin:0 1em 0 2em;
-}
-#head-menu ul li {
- float:left;
- margin:0;
- margin-left:0.3em;
- font-size:14px;
- margin-bottom:4px;
-}
-#head-menu ul li.selected, #head-menu ul li:hover {
- margin-bottom:0px;
-}
-#head-menu ul li a img {
- height:22px;
- width:22px;
- vertical-align:middle;
-}
-#head-menu ul li a, #head-menu ul li a:link {
- float:left;
- text-decoration:none;
- color:#555;
- background:#eaeaea url(/media/default/img/tab-background.png) 0 100% repeat-x;
- padding:3px 7px 3px 7px;
- border:2px solid #ccc;
- border-bottom:0px solid transparent;
- padding-bottom:3px;
- -moz-border-radius:5px;
- border-radius:5px;
-}
-#head-menu ul li a:hover, #head-menu ul li a:focus {
- color:#111;
- padding-bottom:7px;
- border-bottom:0px none transparent;
- outline:none;
- border-bottom-left-radius: 0px;
- border-bottom-right-radius: 0px;
- -moz-border-radius-bottomright:0px;
- -moz-border-radius-bottomleft:0px;
-}
-#head-menu ul li a:focus {
- margin-bottom:-4px;
-}
-#head-menu ul li.selected a {
- color:#3566A5;
- background:#fff;
- padding-bottom:7px;
- border-bottom:0px none transparent;
- border-bottom-left-radius: 0px;
- border-bottom-right-radius: 0px;
- -moz-border-radius-bottomright:0px;
- -moz-border-radius-bottomleft:0px;
-}
-#head-menu ul li.selected a:hover, #head-menu ul li.selected a:focus {
- color:#111;
-}
-div#head-search-and-login {
- float:right;
- margin:0 1em 0 0;
- background-color:#222;
- padding:7px 7px 5px 5px;
- color:white;
- white-space: nowrap;
- border-bottom-left-radius: 6px;
- border-bottom-right-radius: 6px;
- -moz-border-radius-bottomright:6px;
- -moz-border-radius-bottomleft:6px;
-}
-div#head-search-and-login form {
- display:inline;
- padding:0 3px;
-}
-div#head-search-and-login form input {
- border:2px solid #888;
- background:#eee;
- font-size:14px;
- padding:2px;
- border-radius:3px;
- -moz-border-radius:3px;
-}
-div#head-search-and-login form input:focus {
- background:#fff;
-}
-#head-search {
- font-size:14px;
-}
-#head-username, #head-password {
- width:80px;
- font-size:14px;
-}
-#pageinfo {
- clear:both;
- color:#888;
- padding:0.6em 0;
- margin:0;
-}
-#foot {
- font-style:normal;
- color:#888;
- text-align:center;
-}
-#foot a {
- color:#aaf;
-}
-#foot img {
- vertical-align:middle;
-}
-div.toc {
- border:1px dotted #888;
- background:#f0f0f0;
- margin:1em 0 1em 1em;
- float:right;
- font-size:95%;
-}
-div.toc .tocheader {
- font-weight:bold;
- margin:0.5em 1em;
-}
-div.toc ol {
- margin:1em 0.5em 1em 1em;
- padding:0;
-}
-div.toc ol li {
- margin:0;
- padding:0;
- margin-left:1em;
-}
-div.toc ol ol {
- margin:0.5em 0.5em 0.5em 1em;
- padding:0;
-}
-div.recentchanges table {
- clear:both;
-}
-div#editor-help {
- font-size:90%;
- border:1px dotted #888;
- padding:0ex 1ex 1ex 1ex;
- background:#f7f6f2;
-}
-div#preview {
- margin-top:1em;
-}
-label.block {
- display:block;
- text-align:right;
- font-weight:bold;
-}
-label.simple {
- display:block;
- text-align:left;
- font-weight:normal;
-}
-label.block input.edit {
- width:50%;
-}
-/*fieldset {
- width:300px;
- text-align:center;
- padding:0.5em;
- margin:auto;
-}
-*/
-div.editor {
- margin:0 0 0 0;
-}
-table {
- margin:0.5em 0;
- border-collapse:collapse;
-}
-td {
- padding:0.25em;
- border:1pt solid #ADB9CC;
-}
-td p {
- margin:0;
- padding:0;
-}
-.u {
- text-decoration:underline;
-}
-.footnotes ul {
- padding:0 2em;
- margin:0 0 1em;
-}
-.footnotes li {
- list-style:none;
-}
-.userpref table, .userpref td {
- border:none;
-}
-#message {
- clear:both;
- padding:5px 10px;
- background-color:#eee;
- border-bottom:2px solid #ccc;
-}
-#message p {
- margin:5px 0;
- padding:0;
- font-weight:bold;
-}
-#message div.buttons {
- font-weight:normal;
-}
-.diff {
- width:99%;
-}
-.diff-title {
- background-color:#C0C0C0;
-}
-.searchresult dd span {
- font-weight:bold;
-}
-.boxtext {
- font-family:tahoma, arial, sans-serif;
- font-size:11px;
- color:#000;
- float:none;
- padding:3px 0 0 10px;
-}
-.statusbutton {
- width:32px;
- height:32px;
- float:left;
- margin-left:-32px;
- margin-right:5px;
- opacity:0;
- cursor:pointer
-}
-.dlsize {
- float:left;
- padding-right: 8px;
-}
-.dlspeed {
- float:left;
- padding-right: 8px;
-}
-.package {
- margin-bottom: 10px;
-}
-.packagename {
- font-weight: bold;
-}
-
-.child {
- margin-left: 20px;
-}
-.child_status {
- margin-right: 10px;
-}
-.child_secrow {
- font-size: 10px;
-}
-
-.header, .header th {
- text-align: left;
- font-weight: normal;
- background-color:#ececec;
- -moz-border-radius:5px;
- border-radius:5px;
-}
-.progress_bar {
- background: #0C0;
- height: 5px;
-
-}
-
-.queue {
- border: none
-}
-
-.queue tr td {
- border: none
-}
-
-.header, .header th{
- text-align: left;
- font-weight: normal;
-}
-
-
-.clearer
-{
- clear: both;
- height: 1px;
-}
-
-.left
-{
- float: left;
-}
-
-.right
-{
- float: right;
-}
-
-
-.setfield
-{
- display: table-cell;
-}
-
-ul.tabs li a
-{
- padding: 5px 16px 4px 15px;
- border: none;
- font-weight: bold;
-
- border-radius: 5px 5px 0 0;
- -moz-border-radius: 5px 5px 0 0;
-
-}
-
-
-#tabs span
-{
- display: none;
-}
-
-#tabs span.selected
-{
- display: inline;
-}
-
-#tabsback
-{
- background-color: #525252;
- margin: 2px 0 0;
- padding: 6px 4px 1px 4px;
-
- border-top-right-radius: 30px;
- border-top-left-radius: 3px;
- -moz-border-radius-topright: 30px;
- -moz-border-radius-topleft: 3px;
-}
-ul.tabs
-{
- list-style-type: none;
- margin:0;
- padding: 0 40px 0 0;
-}
-
-ul.tabs li
-{
- display: inline;
- margin-left: 8px;
-}
-
-
-ul.tabs li a
-{
- color: #42454a;
- background-color: #eaeaea;
- border: 1px none #c9c3ba;
- margin: 0;
- text-decoration: none;
-
- outline: 0;
-
- padding: 5px 16px 4px 15px;
- font-weight: bold;
-
- border-radius: 5px 5px 0 0;
- -moz-border-radius: 5px 5px 0 0;
-
-}
-
-ul.tabs li a.selected, ul.tabs li a:hover
-{
- color: #000;
- background-color: white;
-
- border-bottom-right-radius: 0;
- border-bottom-left-radius: 0;
- -moz-border-radius-bottomright: 0;
- -moz-border-radius-bottomleft: 0;
-}
-
-ul.tabs li a:hover
-{
- background-color: #f1f4ee;
-}
-
-ul.tabs li a.selected
-{
- font-weight: bold;
- background-color: #525252;
- padding-bottom: 5px;
- color: white;
-}
-
-
-#tabs-body {
- position: relative;
- overflow: hidden;
-}
-
-
-span.tabContent
-{
- border: 2px solid #525252;
- margin: 0;
- padding: 0;
- padding-bottom: 10px;
-}
-
-#tabs-body > span {
- display: none;
-}
-
-#tabs-body > span.active {
- display: block;
-}
-
-.hide
-{
- display: none;
-}
-
-.settable
-{
- margin: 20px;
- border: none;
-}
-.settable td
-{
- border: none;
- margin: 0;
- padding: 5px;
-}
-
-.settable th{
- padding-bottom: 8px;
-}
-
-.settable.wide td , .settable.wide th {
- padding-left: 15px;
- padding-right: 15px;
-}
-
-
-/*settings navbar*/
-ul.nav {
- margin: -30px 0 0;
- padding: 0;
- list-style: none;
- position: absolute;
-}
-
-
-ul.nav li {
- position: relative;
- float: left;
- padding: 5px;
-}
-
-ul.nav > li a {
- background: white;
- -moz-border-radius: 4px 4px 4px 4px;
- border: 1px solid #C9C3BA;
- border-bottom: medium none;
- color: black;
-}
-
-ul.nav ul {
- position: absolute;
- top: 26px;
- left: 10px;
- margin: 0;
- padding: 0;
- list-style: none;
- border: 1px solid #AAA;
- background: #f1f1f1;
- -webkit-box-shadow: 1px 1px 5px #AAA;
- -moz-box-shadow: 1px 1px 5px #AAA;
- box-shadow: 1px 1px 5px #AAA;
- cursor: pointer;
-}
-
-ul.nav .open {
- display: block;
-}
-
-ul.nav .close {
- display: none;
-}
-
-ul.nav ul li {
- float: none;
- padding: 0;
-}
-
-ul.nav ul li a {
- width: 130px;
- background: #f1f1f1;
- padding: 3px;
- display: block;
- font-weight: normal;
-}
-
-ul.nav ul li a:hover {
- background: #CDCDCD;
-}
-
-ul.nav ul ul {
- left: 137px;
- top: 0;
-}
-
-.purr-wrapper{
- margin:10px;
-}
-
-/*Purr alert styles*/
-
-.purr-alert{
- margin-bottom:10px;
- padding:10px;
- background:#000;
- font-size:13px;
- font-weight:bold;
- color:#FFF;
- -moz-border-radius:5px;
- -webkit-border-radius:5px;
- /*-moz-box-shadow: 0 0 10px rgba(255,255,0,.25);*/
- width:300px;
-}
-.purr-alert.error{
- color:#F55;
- padding-left:30px;
- background:url(/media/default/img/error.png) no-repeat #000 7px 10px;
- width:280px;
-}
-.purr-alert.success{
- color:#5F5;
- padding-left:30px;
- background:url(/media/default/img/success.png) no-repeat #000 7px 10px;
- width:280px;
-}
-.purr-alert.notice{
- color:#99F;
- padding-left:30px;
- background:url(/media/default/img//notice.png) no-repeat #000 7px 10px;
- width:280px;
-}
-
-table.system {
- border: none;
- margin-left: 10px;
-}
-
-table.system td {
- border: none
-}
-
-table.system tr > td:first-child {
- font-weight: bold;
- padding-right: 10px;
-} \ No newline at end of file
diff --git a/module/web/media/default/css/log.css b/module/web/media/default/css/log.css
deleted file mode 100644
index 73786bfb4..000000000
--- a/module/web/media/default/css/log.css
+++ /dev/null
@@ -1,72 +0,0 @@
-
-html, body, #content
-{
- height: 100%;
-}
-#body-wrapper
-{
- height: 70%;
-}
-.logdiv
-{
- height: 90%;
- width: 100%;
- overflow: auto;
- border: 2px solid #CCC;
- outline: 1px solid #666;
- background-color: #FFE;
- margin-right: auto;
- margin-left: auto;
-}
-.logform
-{
- display: table;
- margin: 0 auto 0 auto;
- padding-top: 5px;
-}
-.logtable
-{
-
- margin: 0px;
-}
-.logtable td
-{
- border: none;
- white-space: nowrap;
-
-
- font-family: monospace;
- font-size: 16px;
- margin: 0px;
- padding: 0px 10px 0px 10px;
- line-height: 110%;
-}
-td.logline
-{
- background-color: #EEE;
- text-align:right;
- padding: 0px 5px 0px 5px;
-}
-td.loglevel
-{
- text-align:right;
-}
-.logperpage
-{
- float: right;
- padding-bottom: 8px;
-}
-.logpaginator
-{
- float: left;
- padding-top: 5px;
-}
-.logpaginator a
-{
- padding: 0px 8px 0px 8px;
-}
-.logwarn
-{
- text-align: center;
- color: red;
-} \ No newline at end of file
diff --git a/module/web/media/default/css/pathchooser.css b/module/web/media/default/css/pathchooser.css
deleted file mode 100644
index 894cc335e..000000000
--- a/module/web/media/default/css/pathchooser.css
+++ /dev/null
@@ -1,68 +0,0 @@
-table {
- width: 90%;
- border: 1px dotted #888888;
- font-family: sans-serif;
- font-size: 10pt;
-}
-
-th {
- background-color: #525252;
- color: #E0E0E0;
-}
-
-table, tr, td {
- background-color: #F0F0F0;
-}
-
-a, a:visited {
- text-decoration: none;
- font-weight: bold;
-}
-
-#paths {
- width: 90%;
- text-align: left;
-}
-
-.file_directory {
- color: #c0c0c0;
-}
-.path_directory {
- color: #3c3c3c;
-}
-.file_file {
- color: #3c3c3c;
-}
-.path_file {
- color: #c0c0c0;
-}
-
-.parentdir {
- color: #000000;
- font-size: 10pt;
-}
-.name {
- text-align: left;
-}
-.size {
- text-align: right;
-}
-.type {
- text-align: left;
-}
-.mtime {
- text-align: center;
-}
-
-.path_abs_rel {
- color: #3c3c3c;
- text-decoration: none;
- font-weight: bold;
- font-family: sans-serif;
- font-size: 10pt;
-}
-
-.path_abs_rel a {
- color: #3c3c3c;
- font-style: italic;
-}
diff --git a/module/web/media/default/css/window.css b/module/web/media/default/css/window.css
deleted file mode 100644
index 8b13f55ec..000000000
--- a/module/web/media/default/css/window.css
+++ /dev/null
@@ -1,73 +0,0 @@
-/* ----------- stylized ----------- */
-.window_box h1{
- font-size:14px;
- font-weight:bold;
- margin-bottom:8px;
-}
-.window_box p{
- font-size:11px;
- color:#666666;
- margin-bottom:20px;
- border-bottom:solid 1px #b7ddf2;
- padding-bottom:10px;
-}
-.window_box label{
- display:block;
- font-weight:bold;
- text-align:right;
- width:240px;
- float:left;
-}
-.window_box .small{
- color:#666666;
- display:block;
- font-size:11px;
- font-weight:normal;
- text-align:right;
- width:240px;
-}
-.window_box select, .window_box input{
- float:left;
- font-size:12px;
- padding:4px 2px;
- border:solid 1px #aacfe4;
- width:300px;
- margin:2px 0 20px 10px;
-}
-.window_box .cont{
- float:left;
- font-size:12px;
- padding: 0px 10px 15px 0px;
- width:300px;
- margin:0px 0px 0px 10px;
-}
-.window_box .cont input{
- float: none;
- margin: 0px 15px 0px 1px;
-}
-.window_box textarea{
- float:left;
- font-size:12px;
- padding:4px 2px;
- border:solid 1px #aacfe4;
- width:300px;
- margin:2px 0 20px 10px;
-}
-.window_box button, .styled_button{
- clear:both;
- margin-left:150px;
- width:125px;
- height:31px;
- background:#666666 url(../img/button.png) no-repeat;
- text-align:center;
- line-height:31px;
- color:#FFFFFF;
- font-size:11px;
- font-weight:bold;
- border: 0px;
-}
-
-.styled_button {
- margin-left: 15px;
- cursor: pointer;
-}
diff --git a/module/web/media/default/img/add_folder.png b/module/web/media/default/img/add_folder.png
deleted file mode 100644
index 8acbc411b..000000000
--- a/module/web/media/default/img/add_folder.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/ajax-loader.gif b/module/web/media/default/img/ajax-loader.gif
deleted file mode 100644
index 2fd8e0737..000000000
--- a/module/web/media/default/img/ajax-loader.gif
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/arrow_right.png b/module/web/media/default/img/arrow_right.png
deleted file mode 100644
index b1a181923..000000000
--- a/module/web/media/default/img/arrow_right.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/big_button.gif b/module/web/media/default/img/big_button.gif
deleted file mode 100644
index 7680490ea..000000000
--- a/module/web/media/default/img/big_button.gif
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/big_button_over.gif b/module/web/media/default/img/big_button_over.gif
deleted file mode 100644
index 2e3ee10d2..000000000
--- a/module/web/media/default/img/big_button_over.gif
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/body.png b/module/web/media/default/img/body.png
deleted file mode 100644
index 7ff1043e0..000000000
--- a/module/web/media/default/img/body.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/button.png b/module/web/media/default/img/button.png
deleted file mode 100644
index 890160614..000000000
--- a/module/web/media/default/img/button.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/closebtn.gif b/module/web/media/default/img/closebtn.gif
deleted file mode 100644
index 3e27e6030..000000000
--- a/module/web/media/default/img/closebtn.gif
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/cog.png b/module/web/media/default/img/cog.png
deleted file mode 100644
index 67de2c6cc..000000000
--- a/module/web/media/default/img/cog.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_add.png b/module/web/media/default/img/control_add.png
deleted file mode 100644
index d39886893..000000000
--- a/module/web/media/default/img/control_add.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_add_blue.png b/module/web/media/default/img/control_add_blue.png
deleted file mode 100644
index d11b7f41d..000000000
--- a/module/web/media/default/img/control_add_blue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_cancel.png b/module/web/media/default/img/control_cancel.png
deleted file mode 100644
index 7b9bc3fba..000000000
--- a/module/web/media/default/img/control_cancel.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_cancel_blue.png b/module/web/media/default/img/control_cancel_blue.png
deleted file mode 100644
index 0c5c96ce3..000000000
--- a/module/web/media/default/img/control_cancel_blue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_pause.png b/module/web/media/default/img/control_pause.png
deleted file mode 100644
index 2d9ce9c4e..000000000
--- a/module/web/media/default/img/control_pause.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_pause_blue.png b/module/web/media/default/img/control_pause_blue.png
deleted file mode 100644
index ec61099b0..000000000
--- a/module/web/media/default/img/control_pause_blue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_play.png b/module/web/media/default/img/control_play.png
deleted file mode 100644
index 0846555d0..000000000
--- a/module/web/media/default/img/control_play.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_play_blue.png b/module/web/media/default/img/control_play_blue.png
deleted file mode 100644
index f8c8ec683..000000000
--- a/module/web/media/default/img/control_play_blue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_stop.png b/module/web/media/default/img/control_stop.png
deleted file mode 100644
index 893bb60e5..000000000
--- a/module/web/media/default/img/control_stop.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/control_stop_blue.png b/module/web/media/default/img/control_stop_blue.png
deleted file mode 100644
index e6f75d232..000000000
--- a/module/web/media/default/img/control_stop_blue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/drag_corner.gif b/module/web/media/default/img/drag_corner.gif
deleted file mode 100644
index befb1adf1..000000000
--- a/module/web/media/default/img/drag_corner.gif
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/error.png b/module/web/media/default/img/error.png
deleted file mode 100644
index c37bd062e..000000000
--- a/module/web/media/default/img/error.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/full.png b/module/web/media/default/img/full.png
deleted file mode 100644
index fea52af76..000000000
--- a/module/web/media/default/img/full.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-login.png b/module/web/media/default/img/head-login.png
deleted file mode 100644
index b59b7cbbf..000000000
--- a/module/web/media/default/img/head-login.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-collector.png b/module/web/media/default/img/head-menu-collector.png
deleted file mode 100644
index 861be40bc..000000000
--- a/module/web/media/default/img/head-menu-collector.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-config.png b/module/web/media/default/img/head-menu-config.png
deleted file mode 100644
index bbf43d4f3..000000000
--- a/module/web/media/default/img/head-menu-config.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-development.png b/module/web/media/default/img/head-menu-development.png
deleted file mode 100644
index fad150fe1..000000000
--- a/module/web/media/default/img/head-menu-development.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-download.png b/module/web/media/default/img/head-menu-download.png
deleted file mode 100644
index 98c5da9db..000000000
--- a/module/web/media/default/img/head-menu-download.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-home.png b/module/web/media/default/img/head-menu-home.png
deleted file mode 100644
index 9d62109aa..000000000
--- a/module/web/media/default/img/head-menu-home.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-index.png b/module/web/media/default/img/head-menu-index.png
deleted file mode 100644
index 44d631064..000000000
--- a/module/web/media/default/img/head-menu-index.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-news.png b/module/web/media/default/img/head-menu-news.png
deleted file mode 100644
index 43950ebc9..000000000
--- a/module/web/media/default/img/head-menu-news.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-queue.png b/module/web/media/default/img/head-menu-queue.png
deleted file mode 100644
index be98793ce..000000000
--- a/module/web/media/default/img/head-menu-queue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-recent.png b/module/web/media/default/img/head-menu-recent.png
deleted file mode 100644
index fc9b0497f..000000000
--- a/module/web/media/default/img/head-menu-recent.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-menu-wiki.png b/module/web/media/default/img/head-menu-wiki.png
deleted file mode 100644
index 07cf0102d..000000000
--- a/module/web/media/default/img/head-menu-wiki.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head-search-noshadow.png b/module/web/media/default/img/head-search-noshadow.png
deleted file mode 100644
index aafdae015..000000000
--- a/module/web/media/default/img/head-search-noshadow.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/head_bg1.png b/module/web/media/default/img/head_bg1.png
deleted file mode 100644
index f2848c3cc..000000000
--- a/module/web/media/default/img/head_bg1.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/images.png b/module/web/media/default/img/images.png
deleted file mode 100644
index 184860d1e..000000000
--- a/module/web/media/default/img/images.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/notice.png b/module/web/media/default/img/notice.png
deleted file mode 100644
index 12cd1aef9..000000000
--- a/module/web/media/default/img/notice.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/package_go.png b/module/web/media/default/img/package_go.png
deleted file mode 100644
index aace63ad6..000000000
--- a/module/web/media/default/img/package_go.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/page-tools-backlinks.png b/module/web/media/default/img/page-tools-backlinks.png
deleted file mode 100644
index 3eb6a9ce3..000000000
--- a/module/web/media/default/img/page-tools-backlinks.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/page-tools-edit.png b/module/web/media/default/img/page-tools-edit.png
deleted file mode 100644
index 188e1c12b..000000000
--- a/module/web/media/default/img/page-tools-edit.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/page-tools-revisions.png b/module/web/media/default/img/page-tools-revisions.png
deleted file mode 100644
index 5c3b8587f..000000000
--- a/module/web/media/default/img/page-tools-revisions.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/parseUri.png b/module/web/media/default/img/parseUri.png
deleted file mode 100644
index 937bded9d..000000000
--- a/module/web/media/default/img/parseUri.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/pyload-logo-edited3.5-new-font-small.png b/module/web/media/default/img/pyload-logo-edited3.5-new-font-small.png
deleted file mode 100644
index 2443cd8b1..000000000
--- a/module/web/media/default/img/pyload-logo-edited3.5-new-font-small.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/reconnect.png b/module/web/media/default/img/reconnect.png
deleted file mode 100644
index 49b269145..000000000
--- a/module/web/media/default/img/reconnect.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_None.png b/module/web/media/default/img/status_None.png
deleted file mode 100644
index 293b13f77..000000000
--- a/module/web/media/default/img/status_None.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_downloading.png b/module/web/media/default/img/status_downloading.png
deleted file mode 100644
index fb4ebc850..000000000
--- a/module/web/media/default/img/status_downloading.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_failed.png b/module/web/media/default/img/status_failed.png
deleted file mode 100644
index c37bd062e..000000000
--- a/module/web/media/default/img/status_failed.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_finished.png b/module/web/media/default/img/status_finished.png
deleted file mode 100644
index 89c8129a4..000000000
--- a/module/web/media/default/img/status_finished.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_offline.png b/module/web/media/default/img/status_offline.png
deleted file mode 100644
index 0cfd58596..000000000
--- a/module/web/media/default/img/status_offline.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_proc.png b/module/web/media/default/img/status_proc.png
deleted file mode 100644
index 67de2c6cc..000000000
--- a/module/web/media/default/img/status_proc.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_queue.png b/module/web/media/default/img/status_queue.png
deleted file mode 100644
index 293b13f77..000000000
--- a/module/web/media/default/img/status_queue.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/status_waiting.png b/module/web/media/default/img/status_waiting.png
deleted file mode 100644
index 2842cc338..000000000
--- a/module/web/media/default/img/status_waiting.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/success.png b/module/web/media/default/img/success.png
deleted file mode 100644
index 89c8129a4..000000000
--- a/module/web/media/default/img/success.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/tab-background.png b/module/web/media/default/img/tab-background.png
deleted file mode 100644
index 29a5d1991..000000000
--- a/module/web/media/default/img/tab-background.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/tabs-border-bottom.png b/module/web/media/default/img/tabs-border-bottom.png
deleted file mode 100644
index 02440f428..000000000
--- a/module/web/media/default/img/tabs-border-bottom.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/user-actions-logout.png b/module/web/media/default/img/user-actions-logout.png
deleted file mode 100644
index 0010931e2..000000000
--- a/module/web/media/default/img/user-actions-logout.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/user-actions-profile.png b/module/web/media/default/img/user-actions-profile.png
deleted file mode 100644
index 46573fff6..000000000
--- a/module/web/media/default/img/user-actions-profile.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/default/img/user-info.png b/module/web/media/default/img/user-info.png
deleted file mode 100644
index 6e643100f..000000000
--- a/module/web/media/default/img/user-info.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/img/dialog-close.png b/module/web/media/img/dialog-close.png
deleted file mode 100644
index 81ebb88b2..000000000
--- a/module/web/media/img/dialog-close.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/img/dialog-question.png b/module/web/media/img/dialog-question.png
deleted file mode 100644
index b0af3db5b..000000000
--- a/module/web/media/img/dialog-question.png
+++ /dev/null
Binary files differ
diff --git a/module/web/media/js/MooDialog_static.js b/module/web/media/js/MooDialog_static.js
deleted file mode 100644
index d497d3d57..000000000
--- a/module/web/media/js/MooDialog_static.js
+++ /dev/null
@@ -1,401 +0,0 @@
-/*
----
-
-name: Overlay
-
-authors:
- - David Walsh (http://davidwalsh.name)
-
-license:
- - MIT-style license
-
-requires: [Core/Class, Core/Element.Style, Core/Element.Event, Core/Element.Dimensions, Core/Fx.Tween]
-
-provides:
- - Overlay
-...
-*/
-
-var Overlay = new Class({
-
- Implements: [Options, Events],
-
- options: {
- id: 'overlay',
- color: '#000',
- duration: 500,
- opacity: 0.5,
- zIndex: 5000/*,
- onClick: $empty,
- onClose: $empty,
- onHide: $empty,
- onOpen: $empty,
- onShow: $empty
- */
- },
-
- initialize: function(container, options){
- this.setOptions(options);
- this.container = document.id(container);
-
- this.bound = {
- 'window': {
- resize: this.resize.bind(this),
- scroll: this.scroll.bind(this)
- },
- overlayClick: this.overlayClick.bind(this),
- tweenStart: this.tweenStart.bind(this),
- tweenComplete: this.tweenComplete.bind(this)
- };
-
- this.build().attach();
- },
-
- build: function(){
- this.overlay = new Element('div', {
- id: this.options.id,
- opacity: 0,
- styles: {
- position: (Browser.ie6) ? 'absolute' : 'fixed',
- background: this.options.color,
- left: 0,
- top: 0,
- 'z-index': this.options.zIndex
- }
- }).inject(this.container);
- this.tween = new Fx.Tween(this.overlay, {
- duration: this.options.duration,
- link: 'cancel',
- property: 'opacity'
- });
- this.tween.set('opacity', 0)
- return this;
- }.protect(),
-
- attach: function(){
- window.addEvents(this.bound.window);
- this.overlay.addEvent('click', this.bound.overlayClick);
- this.tween.addEvents({
- onStart: this.bound.tweenStart,
- onComplete: this.bound.tweenComplete
- });
- return this;
- },
-
- detach: function(){
- var args = Array.prototype.slice.call(arguments);
- args.each(function(item){
- if(item == 'window') window.removeEvents(this.bound.window);
- if(item == 'overlay') this.overlay.removeEvent('click', this.bound.overlayClick);
- }, this);
- return this;
- },
-
- overlayClick: function(){
- this.fireEvent('click');
- return this;
- },
-
- tweenStart: function(){
- this.overlay.setStyles({
- width: '100%',
- height: this.container.getScrollSize().y
- });
- return this;
- },
-
- tweenComplete: function(){
- this.fireEvent(this.overlay.get('opacity') == this.options.opacity ? 'show' : 'hide');
- return this;
- },
-
- open: function(){
- this.fireEvent('open');
- this.tween.set('display', 'block');
- this.tween.start(this.options.opacity);
- return this;
- },
-
- close: function(){
- this.fireEvent('close');
- this.tween.start(0).chain(function(){
- this.tween.set('display', 'none');
- }.bind(this));
- return this;
- },
-
- resize: function(){
- this.fireEvent('resize');
- this.overlay.setStyle('height', this.container.getScrollSize().y);
- return this;
- },
-
- scroll: function(){
- this.fireEvent('scroll');
- if (Browser.ie6) this.overlay.setStyle('left', window.getScroll().x);
- return this;
- }
-
-});
-/*
----
-name: MooDialog
-description: The base class of MooDialog
-authors: Arian Stolwijk
-license: MIT-style license
-requires: [Core/Class, Core/Element, Core/Element.Styles, Core/Element.Event]
-provides: [MooDialog, Element.MooDialog]
-...
-*/
-
-
-var MooDialog = new Class({
-
- Implements: [Options, Events],
-
- options: {
- 'class': 'MooDialog',
- title: null,
- scroll: true, // IE
- forceScroll: false,
- useEscKey: true,
- destroyOnHide: true,
- autoOpen: true,
- closeButton: true,
- onInitialize: function(){
- this.wrapper.setStyle('display', 'none');
- },
- onBeforeOpen: function(){
- this.wrapper.setStyle('display', 'block');
- this.fireEvent('show');
- },
- onBeforeClose: function(){
- this.wrapper.setStyle('display', 'none');
- this.fireEvent('hide');
- }/*,
- onOpen: function(){},
- onClose: function(){},
- onShow: function(){},
- onHide: function(){}*/
- },
-
- initialize: function(options){
- this.setOptions(options);
- this.options.inject = this.options.inject || document.body;
- options = this.options;
-
- var wrapper = this.wrapper = new Element('div.' + options['class'].replace(' ', '.')).inject(options.inject);
- this.content = new Element('div.content').inject(wrapper);
- wrapper.setStyle('display', 'none');
-
- if (options.title){
- this.title = new Element('div.title').set('text', options.title).inject(wrapper);
- wrapper.addClass('MooDialogTitle');
- }
-
- if (options.closeButton){
- this.closeButton = new Element('a.close', {
- events: {click: this.close.bind(this)}
- }).inject(wrapper);
- }
-
-
- /*<ie6>*/// IE 6 scroll
- if ((options.scroll && Browser.ie6) || options.forceScroll){
- wrapper.setStyle('position', 'absolute');
- var position = wrapper.getPosition(options.inject);
- window.addEvent('scroll', function(){
- var scroll = document.getScroll();
- wrapper.setPosition({
- x: position.x + scroll.x,
- y: position.y + scroll.y
- });
- });
- }
- /*</ie6>*/
-
- if (options.useEscKey){
- // Add event for the esc key
- document.addEvent('keydown', function(e){
- if (e.key == 'esc') this.close();
- }.bind(this));
- }
-
- this.addEvent('hide', function(){
- if (options.destroyOnHide) this.destroy();
- }.bind(this));
-
- this.fireEvent('initialize', wrapper);
- },
-
- setContent: function(){
- var content = Array.from(arguments);
- if (content.length == 1) content = content[0];
-
- this.content.empty();
-
- var type = typeOf(content);
- if (['string', 'number'].contains(type)) this.content.set('text', content);
- else this.content.adopt(content);
-
- return this;
- },
-
- open: function(){
- this.fireEvent('beforeOpen', this.wrapper).fireEvent('open');
- this.opened = true;
- return this;
- },
-
- close: function(){
- this.fireEvent('beforeClose', this.wrapper).fireEvent('close');
- this.opened = false;
- return this;
- },
-
- destroy: function(){
- this.wrapper.destroy();
- },
-
- toElement: function(){
- return this.wrapper;
- }
-
-});
-
-
-Element.implement({
-
- MooDialog: function(options){
- this.store('MooDialog',
- new MooDialog(options).setContent(this).open()
- );
- return this;
- }
-
-});
-/*
----
-name: MooDialog.Fx
-description: Overwrite the default events so the Dialogs are using Fx on open and close
-authors: Arian Stolwijk
-license: MIT-style license
-requires: [Cores/Fx.Tween, Overlay]
-provides: MooDialog.Fx
-...
-*/
-
-
-MooDialog.implement('options', {
-
- duration: 400,
- closeOnOverlayClick: true,
-
- onInitialize: function(wrapper){
- this.fx = new Fx.Tween(wrapper, {
- property: 'opacity',
- duration: this.options.duration
- }).set(0);
- this.overlay = new Overlay(this.options.inject, {
- duration: this.options.duration
- });
- if (this.options.closeOnOverlayClick) this.overlay.addEvent('click', this.close.bind(this));
- },
-
- onBeforeOpen: function(wrapper){
- this.overlay.open();
- wrapper.setStyle('display', 'block');
- this.fx.start(1).chain(function(){
- this.fireEvent('show');
- }.bind(this));
- },
-
- onBeforeClose: function(wrapper){
- this.overlay.close();
- this.fx.start(0).chain(function(){
- this.fireEvent('hide');
- wrapper.setStyle('display', 'none');
- }.bind(this));
- }
-
-});
-/*
----
-name: MooDialog.Confirm
-description: Creates an Confirm Dialog
-authors: Arian Stolwijk
-license: MIT-style license
-requires: MooDialog
-provides: [MooDialog.Confirm, Element.confirmLinkClick, Element.confirmFormSubmit]
-...
-*/
-
-
-MooDialog.Confirm = new Class({
-
- Extends: MooDialog,
-
- options: {
- okText: 'Ok',
- cancelText: 'Cancel',
- focus: true,
- textPClass: 'MooDialogConfirm'
- },
-
- initialize: function(msg, fn, fn1, options){
- this.parent(options);
- var emptyFn = function(){},
- self = this;
-
- var buttons = [
- {fn: fn || emptyFn, txt: this.options.okText},
- {fn: fn1 || emptyFn, txt: this.options.cancelText}
- ].map(function(button){
- return new Element('input[type=button]', {
- events: {
- click: function(){
- button.fn();
- self.close();
- }
- },
- value: button.txt
- });
- });
-
- this.setContent(
- new Element('p.' + this.options.textPClass, {text: msg}),
- new Element('div.buttons').adopt(buttons)
- );
- if (this.options.autoOpen) this.open();
-
- if(this.options.focus) this.addEvent('show', function(){
- buttons[1].focus();
- });
-
- }
-});
-
-
-Element.implement({
-
- confirmLinkClick: function(msg, options){
- this.addEvent('click', function(e){
- e.stop();
- new MooDialog.Confirm(msg, function(){
- location.href = this.get('href');
- }.bind(this), null, options)
- });
- return this;
- },
-
- confirmFormSubmit: function(msg, options){
- this.addEvent('submit', function(e){
- e.stop();
- new MooDialog.Confirm(msg, function(){
- this.submit();
- }.bind(this), null, options)
- }.bind(this));
- return this;
- }
-
-});
diff --git a/module/web/media/js/MooDropMenu_static.js b/module/web/media/js/MooDropMenu_static.js
deleted file mode 100644
index b9cd8cc10..000000000
--- a/module/web/media/js/MooDropMenu_static.js
+++ /dev/null
@@ -1,89 +0,0 @@
-/*
----
-description: This provides a simple Drop Down menu with infinit levels
-
-license: MIT-style
-
-authors:
-- Arian Stolwijk
-
-requires:
- - Core/Class.Extras
- - Core/Element.Event
- - Core/Selectors
-
-provides: [MooDropMenu, Element.MooDropMenu]
-
-...
-*/
-
-var MooDropMenu = new Class({
-
- Implements: [Options, Events],
-
- options: {
- onOpen: function(el){
- el.removeClass('close').addClass('open');
- },
- onClose: function(el){
- el.removeClass('open').addClass('close');
- },
- onInitialize: function(el){
- el.removeClass('open').addClass('close');
- },
- mouseoutDelay: 200,
- mouseoverDelay: 0,
- listSelector: 'ul',
- itemSelector: 'li'
- },
-
- initialize: function(menu, options, level){
- this.setOptions(options);
- options = this.options;
-
- var menu = this.menu = document.id(menu);
-
- menu.getElements(options.itemSelector + ' > ' + options.listSelector).each(function(el){
-
- this.fireEvent('initialize', el);
-
- var parent = el.getParent(options.itemSelector),
- timer;
-
- parent.addEvents({
-
- 'mouseenter': function(){
- parent.store('DropDownOpen', true);
-
- clearTimeout(timer);
- if (options.mouseoverDelay) timer = this.fireEvent.delay(options.mouseoverDelay, this, ['open', el]);
- else this.fireEvent('open', el);
-
- }.bind(this),
-
- 'mouseleave': function(){
- parent.store('DropDownOpen', false);
-
- clearTimeout(timer);
- timer = (function(){
- if (!parent.retrieve('DropDownOpen')) this.fireEvent('close', el);
- }).delay(options.mouseoutDelay, this);
-
- }.bind(this)
- });
-
- }, this);
- },
-
- toElement: function(){
- return this.menu
- }
-
-});
-
-/* So you can do like this $('nav').MooDropMenu(); or even $('nav').MooDropMenu().setStyle('border',1); */
-Element.implement({
- MooDropMenu: function(options){
- return this.store('MooDropMenu', new MooDropMenu(this, options));
- }
-});
diff --git a/module/web/media/js/admin.coffee b/module/web/media/js/admin.coffee
deleted file mode 100644
index 82b0dd3ec..000000000
--- a/module/web/media/js/admin.coffee
+++ /dev/null
@@ -1,58 +0,0 @@
-root = this
-
-window.addEvent "domready", ->
-
- root.passwordDialog = new MooDialog {destroyOnHide: false}
- root.passwordDialog.setContent $ 'password_box'
-
- $("login_password_reset").addEvent "click", (e) -> root.passwordDialog.close()
- $("login_password_button").addEvent "click", (e) ->
-
- newpw = $("login_new_password").get("value")
- newpw2 = $("login_new_password2").get("value")
-
- if newpw is newpw2
- form = $("password_form")
- form.set "send", {
- onSuccess: (data) ->
- root.notify.alert "Success", {
- 'className': 'success'
- }
- onFailure: (data) ->
- root.notify.alert "Error", {
- 'className': 'error'
- }
- }
-
- form.send()
-
- root.passwordDialog.close()
- else
- alert '{{_("Passwords did not match.")}}'
-
- e.stop()
-
- for item in $$(".change_password")
- id = item.get("id")
- user = id.split("|")[1]
- $("user_login").set("value", user)
- item.addEvent "click", (e) -> root.passwordDialog.open()
-
- $('quit-pyload').addEvent "click", (e) ->
- new MooDialog.Confirm "{{_('You are really sure you want to quit pyLoad?')}}", ->
- new Request.JSON({
- url: '/api/kill'
- method: 'get'
- }).send()
- , ->
- e.stop()
-
- $('restart-pyload').addEvent "click", (e) ->
- new MooDialog.Confirm "{{_('Are you sure you want to restart pyLoad?')}}", ->
- new Request.JSON({
- url: '/api/restart'
- method: 'get'
- onSuccess: (data) -> alert "{{_('pyLoad restarted')}}"
- }).send()
- , ->
- e.stop() \ No newline at end of file
diff --git a/module/web/media/js/admin.js b/module/web/media/js/admin.js
deleted file mode 100644
index d34d310a0..000000000
--- a/module/web/media/js/admin.js
+++ /dev/null
@@ -1,3 +0,0 @@
-{% autoescape true %}
-var root;root=this;window.addEvent("domready",function(){var f,c,b,e,a,d;root.passwordDialog=new MooDialog({destroyOnHide:false});root.passwordDialog.setContent($("password_box"));$("login_password_reset").addEvent("click",function(g){return root.passwordDialog.close()});$("login_password_button").addEvent("click",function(j){var h,i,g;i=$("login_new_password").get("value");g=$("login_new_password2").get("value");if(i===g){h=$("password_form");h.set("send",{onSuccess:function(k){return root.notify.alert("Success",{className:"success"})},onFailure:function(k){return root.notify.alert("Error",{className:"error"})}});h.send();root.passwordDialog.close()}else{alert('{{_("Passwords did not match.")}}')}return j.stop()});d=$$(".change_password");for(e=0,a=d.length;e<a;e++){c=d[e];f=c.get("id");b=f.split("|")[1];$("user_login").set("value",b);c.addEvent("click",function(g){return root.passwordDialog.open()})}$("quit-pyload").addEvent("click",function(g){new MooDialog.Confirm("{{_('You are really sure you want to quit pyLoad?')}}",function(){return new Request.JSON({url:"/api/kill",method:"get"}).send()},function(){});return g.stop()});return $("restart-pyload").addEvent("click",function(g){new MooDialog.Confirm("{{_('Are you sure you want to restart pyLoad?')}}",function(){return new Request.JSON({url:"/api/restart",method:"get",onSuccess:function(h){return alert("{{_('pyLoad restarted')}}")}}).send()},function(){});return g.stop()})});
-{% endautoescape %} \ No newline at end of file
diff --git a/module/web/media/js/base.coffee b/module/web/media/js/base.coffee
deleted file mode 100644
index 3b5d33e82..000000000
--- a/module/web/media/js/base.coffee
+++ /dev/null
@@ -1,173 +0,0 @@
-# External scope
-root = this
-
-# helper functions
-humanFileSize = (size) ->
- filesizename = new Array("B", "KiB", "MiB", "GiB", "TiB", "PiB")
- loga = Math.log(size) / Math.log(1024)
- i = Math.floor(loga)
- a = Math.pow(1024, i)
- if size is 0 then "0 B" else (Math.round(size * 100 / a) / 100 + " " + filesizename[i])
-
-parseUri = () ->
- oldString = $("add_links").value
- regxp = new RegExp('(ht|f)tp(s?):\/\/[a-zA-Z0-9\-\.\/\?=_&%#]+[<| |\"|\'|\r|\n|\t]{1}', 'g')
- resu = oldString.match regxp
- return if resu == null
- res = "";
-
- for part in resu
- if part.indexOf(" ") != -1
- res = res + part.replace(" ", " \n")
- else if part.indexOf("\t") != -1
- res = res + part.replace("\t", " \n")
- else if part.indexOf("\r") != -1
- res = res + part.replace("\r", " \n")
- else if part.indexOf("\"") != -1
- res = res + part.replace("\"", " \n")
- else if part.indexOf("<") != -1
- res = res + part.replace("<", " \n")
- else if part.indexOf("'") != -1
- res = res + part.replace("'", " \n")
- else
- res = res + part.replace("\n", " \n")
-
- $("add_links").value = res;
-
-
-Array::remove = (from, to) ->
- rest = this.slice((to || from) + 1 || this.length)
- this.length = from < 0 ? this.length + from : from
- return [] if this.length == 0
- return this.push.apply(this, rest)
-
-
-document.addEvent "domready", ->
-
- # global notification
- root.notify = new Purr {
- 'mode': 'top'
- 'position': 'center'
- }
-
- root.captchaBox = new MooDialog {destroyOnHide: false}
- root.captchaBox.setContent $ 'cap_box'
-
- root.addBox = new MooDialog {destroyOnHide: false}
- root.addBox.setContent $ 'add_box'
-
- $('add_form').onsubmit = ->
- $('add_form').target = 'upload_target'
- if $('add_name').value is "" and $('add_file').value is ""
- alert '{{_("Please Enter a packagename.")}}'
- return false
- else
- root.addBox.close()
- return true
-
- $('add_reset').addEvent 'click', -> root.addBox.close()
-
- $('action_add').addEvent 'click', -> $("add_form").reset(); root.addBox.open()
- $('action_play').addEvent 'click', -> new Request({method: 'get', url: '/api/unpauseServer'}).send()
- $('action_cancel').addEvent 'click', -> new Request({method: 'get', url: '/api/stopAllDownloads'}).send()
- $('action_stop').addEvent 'click', -> new Request({method: 'get', url: '/api/pauseServer'}).send()
-
-
- # captcha events
-
- $('cap_info').addEvent 'click', ->
- load_captcha "get", ""
- root.captchaBox.open()
- $('cap_reset').addEvent 'click', -> root.captchaBox.close()
- $('cap_form').addEvent 'submit', (e) ->
- submit_captcha()
- e.stop()
-
- $('cap_positional').addEvent 'click', on_captcha_click
-
- new Request.JSON({
- url: "/json/status"
- onSuccess: LoadJsonToContent
- secure: false
- async: true
- initialDelay: 0
- delay: 4000
- limit: 3000
- }).startTimer()
-
-LoadJsonToContent = (data) ->
- $("speed").set 'text', humanFileSize(data.speed)+"/s"
- $("aktiv").set 'text', data.active
- $("aktiv_from").set 'text', data.queue
- $("aktiv_total").set 'text', data.total
-
- if data.captcha
- if $("cap_info").getStyle("display") != "inline"
- $("cap_info").setStyle 'display', 'inline'
- root.notify.alert '{{_("New Captcha Request")}}', {
- 'className': 'notify'
- }
- else
- $("cap_info").setStyle 'display', 'none'
-
-
- if data.download
- $("time").set 'text', ' {{_("on")}}'
- $("time").setStyle 'background-color', "#8ffc25"
- else
- $("time").set 'text', ' {{_("off")}}'
- $("time").setStyle 'background-color', "#fc6e26"
-
- if data.reconnect
- $("reconnect").set 'text', ' {{_("on")}}'
- $("reconnect").setStyle 'background-color', "#8ffc25"
- else
- $("reconnect").set 'text', ' {{_("off")}}'
- $("reconnect").setStyle 'background-color', "#fc6e26"
-
- return null
-
-
-set_captcha = (data) ->
- $('cap_id').set 'value', data.id
- if (data.result_type is 'textual')
- $('cap_textual_img').set 'src', data.src
- $('cap_title').set 'text', '{{_("Please read the text on the captcha.")}}'
- $('cap_submit').setStyle 'display', 'inline'
- $('cap_textual').setStyle 'display', 'block'
- $('cap_positional').setStyle 'display', 'none'
-
- else if (data.result_type == 'positional')
- $('cap_positional_img').set('src', data.src)
- $('cap_title').set('text', '{{_("Please click on the right captcha position.")}}')
- $('cap_submit').setStyle('display', 'none')
- $('cap_textual').setStyle('display', 'none')
-
-
-load_captcha = (method, post) ->
- new Request.JSON({
- url: "/json/set_captcha"
- onSuccess: (data) -> set_captcha(data) if data.captcha else clear_captcha()
- secure: false
- async: true
- method: method
- }).send(post)
-
-clear_captcha = ->
- $('cap_textual').setStyle 'display', 'none'
- $('cap_textual_img').set 'src', ''
- $('cap_positional').setStyle 'display', 'none'
- $('cap_positional_img').set 'src', ''
- $('cap_title').set 'text', '{{_("No Captchas to read.")}}'
-
-submit_captcha = ->
- load_captcha("post", "cap_id=" + $('cap_id').get('value') + "&cap_result=" + $('cap_result').get('value') );
- $('cap_result').set('value', '')
- false
-
-on_captcha_click = (e) ->
- position = e.target.getPosition()
- x = e.page.x - position.x
- y = e.page.y - position.y
- $('cap_result').value = x + "," + y
- submit_captcha() \ No newline at end of file
diff --git a/module/web/media/js/base.js b/module/web/media/js/base.js
deleted file mode 100644
index c68b1047a..000000000
--- a/module/web/media/js/base.js
+++ /dev/null
@@ -1,3 +0,0 @@
-{% autoescape true %}
-var LoadJsonToContent,clear_captcha,humanFileSize,load_captcha,on_captcha_click,parseUri,root,set_captcha,submit_captcha;root=this;humanFileSize=function(f){var c,d,e,b;d=new Array("B","KiB","MiB","GiB","TiB","PiB");b=Math.log(f)/Math.log(1024);e=Math.floor(b);c=Math.pow(1024,e);if(f===0){return"0 B"}else{return Math.round(f*100/c)/100+" "+d[e]}};parseUri=function(){var b,c,g,e,d,f,a;b=$("add_links").value;g=new RegExp("(ht|f)tp(s?)://[a-zA-Z0-9-./?=_&%#]+[<| |\"|'|\r|\n|\t]{1}","g");d=b.match(g);if(d===null){return}e="";for(f=0,a=d.length;f<a;f++){c=d[f];if(c.indexOf(" ")!==-1){e=e+c.replace(" "," \n")}else{if(c.indexOf("\t")!==-1){e=e+c.replace("\t"," \n")}else{if(c.indexOf("\r")!==-1){e=e+c.replace("\r"," \n")}else{if(c.indexOf('"')!==-1){e=e+c.replace('"'," \n")}else{if(c.indexOf("<")!==-1){e=e+c.replace("<"," \n")}else{if(c.indexOf("'")!==-1){e=e+c.replace("'"," \n")}else{e=e+c.replace("\n"," \n")}}}}}}}return $("add_links").value=e};Array.prototype.remove=function(d,c){var a,b;a=this.slice((c||d)+1||this.length);this.length=(b=d<0)!=null?b:this.length+{from:d};if(this.length===0){return[]}return this.push.apply(this,a)};document.addEvent("domready",function(){root.notify=new Purr({mode:"top",position:"center"});root.captchaBox=new MooDialog({destroyOnHide:false});root.captchaBox.setContent($("cap_box"));root.addBox=new MooDialog({destroyOnHide:false});root.addBox.setContent($("add_box"));$("add_form").onsubmit=function(){$("add_form").target="upload_target";if($("add_name").value===""&&$("add_file").value===""){alert('{{_("Please Enter a packagename.")}}');return false}else{root.addBox.close();return true}};$("add_reset").addEvent("click",function(){return root.addBox.close()});$("action_add").addEvent("click",function(){$("add_form").reset();return root.addBox.open()});$("action_play").addEvent("click",function(){return new Request({method:"get",url:"/api/unpauseServer"}).send()});$("action_cancel").addEvent("click",function(){return new Request({method:"get",url:"/api/stopAllDownloads"}).send()});$("action_stop").addEvent("click",function(){return new Request({method:"get",url:"/api/pauseServer"}).send()});$("cap_info").addEvent("click",function(){load_captcha("get","");return root.captchaBox.open()});$("cap_reset").addEvent("click",function(){return root.captchaBox.close()});$("cap_form").addEvent("submit",function(a){submit_captcha();return a.stop()});$("cap_positional").addEvent("click",on_captcha_click);return new Request.JSON({url:"/json/status",onSuccess:LoadJsonToContent,secure:false,async:true,initialDelay:0,delay:4000,limit:3000}).startTimer()});LoadJsonToContent=function(a){$("speed").set("text",humanFileSize(a.speed)+"/s");$("aktiv").set("text",a.active);$("aktiv_from").set("text",a.queue);$("aktiv_total").set("text",a.total);if(a.captcha){if($("cap_info").getStyle("display")!=="inline"){$("cap_info").setStyle("display","inline");root.notify.alert('{{_("New Captcha Request")}}',{className:"notify"})}}else{$("cap_info").setStyle("display","none")}if(a.download){$("time").set("text",' {{_("on")}}');$("time").setStyle("background-color","#8ffc25")}else{$("time").set("text",' {{_("off")}}');$("time").setStyle("background-color","#fc6e26")}if(a.reconnect){$("reconnect").set("text",' {{_("on")}}');$("reconnect").setStyle("background-color","#8ffc25")}else{$("reconnect").set("text",' {{_("off")}}');$("reconnect").setStyle("background-color","#fc6e26")}return null};set_captcha=function(a){$("cap_id").set("value",a.id);if(a.result_type==="textual"){$("cap_textual_img").set("src",a.src);$("cap_title").set("text",'{{_("Please read the text on the captcha.")}}');$("cap_submit").setStyle("display","inline");$("cap_textual").setStyle("display","block");return $("cap_positional").setStyle("display","none")}else{if(a.result_type==="positional"){$("cap_positional_img").set("src",a.src);$("cap_title").set("text",'{{_("Please click on the right captcha position.")}}');$("cap_submit").setStyle("display","none");return $("cap_textual").setStyle("display","none")}}};load_captcha=function(b,a){return new Request.JSON({url:"/json/set_captcha",onSuccess:function(c){return set_captcha(c)(c.captcha?void 0:clear_captcha())},secure:false,async:true,method:b}).send(a)};clear_captcha=function(){$("cap_textual").setStyle("display","none");$("cap_textual_img").set("src","");$("cap_positional").setStyle("display","none");$("cap_positional_img").set("src","");return $("cap_title").set("text",'{{_("No Captchas to read.")}}')};submit_captcha=function(){load_captcha("post","cap_id="+$("cap_id").get("value")+"&cap_result="+$("cap_result").get("value"));$("cap_result").set("value","");return false};on_captcha_click=function(c){var b,a,d;b=c.target.getPosition();a=c.page.x-b.x;d=c.page.y-b.y;$("cap_result").value=a+","+d;return submit_captcha()};
-{% endautoescape %} \ No newline at end of file
diff --git a/module/web/media/js/mootools-core-1.4.1.js b/module/web/media/js/mootools-core-1.4.1.js
deleted file mode 100644
index 835b4bbe2..000000000
--- a/module/web/media/js/mootools-core-1.4.1.js
+++ /dev/null
@@ -1,476 +0,0 @@
-/*
----
-MooTools: the javascript framework
-
-web build:
- - http://mootools.net/core/76bf47062d6c1983d66ce47ad66aa0e0
-
-packager build:
- - packager build Core/Core Core/Array Core/String Core/Number Core/Function Core/Object Core/Event Core/Browser Core/Class Core/Class.Extras Core/Slick.Parser Core/Slick.Finder Core/Element Core/Element.Style Core/Element.Event Core/Element.Delegation Core/Element.Dimensions Core/Fx Core/Fx.CSS Core/Fx.Tween Core/Fx.Morph Core/Fx.Transitions Core/Request Core/Request.HTML Core/Request.JSON Core/Cookie Core/JSON Core/DOMReady Core/Swiff
-
-copyrights:
- - [MooTools](http://mootools.net)
-
-licenses:
- - [MIT License](http://mootools.net/license.txt)
-...
-*/
-(function(){this.MooTools={version:"1.4.1",build:"d1fb25710e3c5482a219ab9dc675a4e0ad2176b6"};var o=this.typeOf=function(i){if(i==null){return"null";}if(i.$family){return i.$family();
-}if(i.nodeName){if(i.nodeType==1){return"element";}if(i.nodeType==3){return(/\S/).test(i.nodeValue)?"textnode":"whitespace";}}else{if(typeof i.length=="number"){if(i.callee){return"arguments";
-}if("item" in i){return"collection";}}}return typeof i;};var j=this.instanceOf=function(t,i){if(t==null){return false;}var s=t.$constructor||t.constructor;
-while(s){if(s===i){return true;}s=s.parent;}return t instanceof i;};var f=this.Function;var p=true;for(var k in {toString:1}){p=null;}if(p){p=["hasOwnProperty","valueOf","isPrototypeOf","propertyIsEnumerable","toLocaleString","toString","constructor"];
-}f.prototype.overloadSetter=function(s){var i=this;return function(u,t){if(u==null){return this;}if(s||typeof u!="string"){for(var v in u){i.call(this,v,u[v]);
-}if(p){for(var w=p.length;w--;){v=p[w];if(u.hasOwnProperty(v)){i.call(this,v,u[v]);}}}}else{i.call(this,u,t);}return this;};};f.prototype.overloadGetter=function(s){var i=this;
-return function(u){var v,t;if(s||typeof u!="string"){v=u;}else{if(arguments.length>1){v=arguments;}}if(v){t={};for(var w=0;w<v.length;w++){t[v[w]]=i.call(this,v[w]);
-}}else{t=i.call(this,u);}return t;};};f.prototype.extend=function(i,s){this[i]=s;}.overloadSetter();f.prototype.implement=function(i,s){this.prototype[i]=s;
-}.overloadSetter();var n=Array.prototype.slice;f.from=function(i){return(o(i)=="function")?i:function(){return i;};};Array.from=function(i){if(i==null){return[];
-}return(a.isEnumerable(i)&&typeof i!="string")?(o(i)=="array")?i:n.call(i):[i];};Number.from=function(s){var i=parseFloat(s);return isFinite(i)?i:null;
-};String.from=function(i){return i+"";};f.implement({hide:function(){this.$hidden=true;return this;},protect:function(){this.$protected=true;return this;
-}});var a=this.Type=function(u,t){if(u){var s=u.toLowerCase();var i=function(v){return(o(v)==s);};a["is"+u]=i;if(t!=null){t.prototype.$family=(function(){return s;
-}).hide();}}if(t==null){return null;}t.extend(this);t.$constructor=a;t.prototype.$constructor=t;return t;};var e=Object.prototype.toString;a.isEnumerable=function(i){return(i!=null&&typeof i.length=="number"&&e.call(i)!="[object Function]");
-};var q={};var r=function(i){var s=o(i.prototype);return q[s]||(q[s]=[]);};var b=function(t,x){if(x&&x.$hidden){return;}var s=r(this);for(var u=0;u<s.length;
-u++){var w=s[u];if(o(w)=="type"){b.call(w,t,x);}else{w.call(this,t,x);}}var v=this.prototype[t];if(v==null||!v.$protected){this.prototype[t]=x;}if(this[t]==null&&o(x)=="function"){m.call(this,t,function(i){return x.apply(i,n.call(arguments,1));
-});}};var m=function(i,t){if(t&&t.$hidden){return;}var s=this[i];if(s==null||!s.$protected){this[i]=t;}};a.implement({implement:b.overloadSetter(),extend:m.overloadSetter(),alias:function(i,s){b.call(this,i,this.prototype[s]);
-}.overloadSetter(),mirror:function(i){r(this).push(i);return this;}});new a("Type",a);var d=function(s,w,u){var t=(w!=Object),A=w.prototype;if(t){w=new a(s,w);
-}for(var x=0,v=u.length;x<v;x++){var B=u[x],z=w[B],y=A[B];if(z){z.protect();}if(t&&y){delete A[B];A[B]=y.protect();}}if(t){w.implement(A);}return d;};d("String",String,["charAt","charCodeAt","concat","indexOf","lastIndexOf","match","quote","replace","search","slice","split","substr","substring","trim","toLowerCase","toUpperCase"])("Array",Array,["pop","push","reverse","shift","sort","splice","unshift","concat","join","slice","indexOf","lastIndexOf","filter","forEach","every","map","some","reduce","reduceRight"])("Number",Number,["toExponential","toFixed","toLocaleString","toPrecision"])("Function",f,["apply","call","bind"])("RegExp",RegExp,["exec","test"])("Object",Object,["create","defineProperty","defineProperties","keys","getPrototypeOf","getOwnPropertyDescriptor","getOwnPropertyNames","preventExtensions","isExtensible","seal","isSealed","freeze","isFrozen"])("Date",Date,["now"]);
-Object.extend=m.overloadSetter();Date.extend("now",function(){return +(new Date);});new a("Boolean",Boolean);Number.prototype.$family=function(){return isFinite(this)?"number":"null";
-}.hide();Number.extend("random",function(s,i){return Math.floor(Math.random()*(i-s+1)+s);});var g=Object.prototype.hasOwnProperty;Object.extend("forEach",function(i,t,u){for(var s in i){if(g.call(i,s)){t.call(u,i[s],s,i);
-}}});Object.each=Object.forEach;Array.implement({forEach:function(u,v){for(var t=0,s=this.length;t<s;t++){if(t in this){u.call(v,this[t],t,this);}}},each:function(i,s){Array.forEach(this,i,s);
-return this;}});var l=function(i){switch(o(i)){case"array":return i.clone();case"object":return Object.clone(i);default:return i;}};Array.implement("clone",function(){var s=this.length,t=new Array(s);
-while(s--){t[s]=l(this[s]);}return t;});var h=function(s,i,t){switch(o(t)){case"object":if(o(s[i])=="object"){Object.merge(s[i],t);}else{s[i]=Object.clone(t);
-}break;case"array":s[i]=t.clone();break;default:s[i]=t;}return s;};Object.extend({merge:function(z,u,t){if(o(u)=="string"){return h(z,u,t);}for(var y=1,s=arguments.length;
-y<s;y++){var w=arguments[y];for(var x in w){h(z,x,w[x]);}}return z;},clone:function(i){var t={};for(var s in i){t[s]=l(i[s]);}return t;},append:function(w){for(var v=1,t=arguments.length;
-v<t;v++){var s=arguments[v]||{};for(var u in s){w[u]=s[u];}}return w;}});["Object","WhiteSpace","TextNode","Collection","Arguments"].each(function(i){new a(i);
-});var c=Date.now();String.extend("uniqueID",function(){return(c++).toString(36);});})();Array.implement({every:function(c,d){for(var b=0,a=this.length>>>0;
-b<a;b++){if((b in this)&&!c.call(d,this[b],b,this)){return false;}}return true;},filter:function(d,e){var c=[];for(var b=0,a=this.length>>>0;b<a;b++){if((b in this)&&d.call(e,this[b],b,this)){c.push(this[b]);
-}}return c;},indexOf:function(c,d){var b=this.length>>>0;for(var a=(d<0)?Math.max(0,b+d):d||0;a<b;a++){if(this[a]===c){return a;}}return -1;},map:function(c,e){var d=this.length>>>0,b=Array(d);
-for(var a=0;a<d;a++){if(a in this){b[a]=c.call(e,this[a],a,this);}}return b;},some:function(c,d){for(var b=0,a=this.length>>>0;b<a;b++){if((b in this)&&c.call(d,this[b],b,this)){return true;
-}}return false;},clean:function(){return this.filter(function(a){return a!=null;});},invoke:function(a){var b=Array.slice(arguments,1);return this.map(function(c){return c[a].apply(c,b);
-});},associate:function(c){var d={},b=Math.min(this.length,c.length);for(var a=0;a<b;a++){d[c[a]]=this[a];}return d;},link:function(c){var a={};for(var e=0,b=this.length;
-e<b;e++){for(var d in c){if(c[d](this[e])){a[d]=this[e];delete c[d];break;}}}return a;},contains:function(a,b){return this.indexOf(a,b)!=-1;},append:function(a){this.push.apply(this,a);
-return this;},getLast:function(){return(this.length)?this[this.length-1]:null;},getRandom:function(){return(this.length)?this[Number.random(0,this.length-1)]:null;
-},include:function(a){if(!this.contains(a)){this.push(a);}return this;},combine:function(c){for(var b=0,a=c.length;b<a;b++){this.include(c[b]);}return this;
-},erase:function(b){for(var a=this.length;a--;){if(this[a]===b){this.splice(a,1);}}return this;},empty:function(){this.length=0;return this;},flatten:function(){var d=[];
-for(var b=0,a=this.length;b<a;b++){var c=typeOf(this[b]);if(c=="null"){continue;}d=d.concat((c=="array"||c=="collection"||c=="arguments"||instanceOf(this[b],Array))?Array.flatten(this[b]):this[b]);
-}return d;},pick:function(){for(var b=0,a=this.length;b<a;b++){if(this[b]!=null){return this[b];}}return null;},hexToRgb:function(b){if(this.length!=3){return null;
-}var a=this.map(function(c){if(c.length==1){c+=c;}return c.toInt(16);});return(b)?a:"rgb("+a+")";},rgbToHex:function(d){if(this.length<3){return null;}if(this.length==4&&this[3]==0&&!d){return"transparent";
-}var b=[];for(var a=0;a<3;a++){var c=(this[a]-0).toString(16);b.push((c.length==1)?"0"+c:c);}return(d)?b:"#"+b.join("");}});String.implement({test:function(a,b){return((typeOf(a)=="regexp")?a:new RegExp(""+a,b)).test(this);
-},contains:function(a,b){return(b)?(b+this+b).indexOf(b+a+b)>-1:String(this).indexOf(a)>-1;},trim:function(){return String(this).replace(/^\s+|\s+$/g,"");
-},clean:function(){return String(this).replace(/\s+/g," ").trim();},camelCase:function(){return String(this).replace(/-\D/g,function(a){return a.charAt(1).toUpperCase();
-});},hyphenate:function(){return String(this).replace(/[A-Z]/g,function(a){return("-"+a.charAt(0).toLowerCase());});},capitalize:function(){return String(this).replace(/\b[a-z]/g,function(a){return a.toUpperCase();
-});},escapeRegExp:function(){return String(this).replace(/([-.*+?^${}()|[\]\/\\])/g,"\\$1");},toInt:function(a){return parseInt(this,a||10);},toFloat:function(){return parseFloat(this);
-},hexToRgb:function(b){var a=String(this).match(/^#?(\w{1,2})(\w{1,2})(\w{1,2})$/);return(a)?a.slice(1).hexToRgb(b):null;},rgbToHex:function(b){var a=String(this).match(/\d{1,3}/g);
-return(a)?a.rgbToHex(b):null;},substitute:function(a,b){return String(this).replace(b||(/\\?\{([^{}]+)\}/g),function(d,c){if(d.charAt(0)=="\\"){return d.slice(1);
-}return(a[c]!=null)?a[c]:"";});}});Number.implement({limit:function(b,a){return Math.min(a,Math.max(b,this));},round:function(a){a=Math.pow(10,a||0).toFixed(a<0?-a:0);
-return Math.round(this*a)/a;},times:function(b,c){for(var a=0;a<this;a++){b.call(c,a,this);}},toFloat:function(){return parseFloat(this);},toInt:function(a){return parseInt(this,a||10);
-}});Number.alias("each","times");(function(b){var a={};b.each(function(c){if(!Number[c]){a[c]=function(){return Math[c].apply(null,[this].concat(Array.from(arguments)));
-};}});Number.implement(a);})(["abs","acos","asin","atan","atan2","ceil","cos","exp","floor","log","max","min","pow","sin","sqrt","tan"]);Function.extend({attempt:function(){for(var b=0,a=arguments.length;
-b<a;b++){try{return arguments[b]();}catch(c){}}return null;}});Function.implement({attempt:function(a,c){try{return this.apply(c,Array.from(a));}catch(b){}return null;
-},bind:function(e){var a=this,b=arguments.length>1?Array.slice(arguments,1):null,d=function(){};var c=function(){var g=e,h=arguments.length;if(this instanceof c){d.prototype=a.prototype;
-g=new d;}var f=(!b&&!h)?a.call(g):a.apply(g,b&&h?b.concat(Array.slice(arguments)):b||arguments);return g==e?f:g;};return c;},pass:function(b,c){var a=this;
-if(b!=null){b=Array.from(b);}return function(){return a.apply(c,b||arguments);};},delay:function(b,c,a){return setTimeout(this.pass((a==null?[]:a),c),b);
-},periodical:function(c,b,a){return setInterval(this.pass((a==null?[]:a),b),c);}});(function(){var a=Object.prototype.hasOwnProperty;Object.extend({subset:function(d,g){var f={};
-for(var e=0,b=g.length;e<b;e++){var c=g[e];if(c in d){f[c]=d[c];}}return f;},map:function(b,e,f){var d={};for(var c in b){if(a.call(b,c)){d[c]=e.call(f,b[c],c,b);
-}}return d;},filter:function(b,e,g){var d={};for(var c in b){var f=b[c];if(a.call(b,c)&&e.call(g,f,c,b)){d[c]=f;}}return d;},every:function(b,d,e){for(var c in b){if(a.call(b,c)&&!d.call(e,b[c],c)){return false;
-}}return true;},some:function(b,d,e){for(var c in b){if(a.call(b,c)&&d.call(e,b[c],c)){return true;}}return false;},keys:function(b){var d=[];for(var c in b){if(a.call(b,c)){d.push(c);
-}}return d;},values:function(c){var b=[];for(var d in c){if(a.call(c,d)){b.push(c[d]);}}return b;},getLength:function(b){return Object.keys(b).length;},keyOf:function(b,d){for(var c in b){if(a.call(b,c)&&b[c]===d){return c;
-}}return null;},contains:function(b,c){return Object.keyOf(b,c)!=null;},toQueryString:function(b,c){var d=[];Object.each(b,function(h,g){if(c){g=c+"["+g+"]";
-}var f;switch(typeOf(h)){case"object":f=Object.toQueryString(h,g);break;case"array":var e={};h.each(function(k,j){e[j]=k;});f=Object.toQueryString(e,g);
-break;default:f=g+"="+encodeURIComponent(h);}if(h!=null){d.push(f);}});return d.join("&");}});})();(function(){var k=this.document;var i=k.window=this;
-var b=1;this.$uid=(i.ActiveXObject)?function(e){return(e.uid||(e.uid=[b++]))[0];}:function(e){return e.uid||(e.uid=b++);};$uid(i);$uid(k);var a=navigator.userAgent.toLowerCase(),c=navigator.platform.toLowerCase(),j=a.match(/(opera|ie|firefox|chrome|version)[\s\/:]([\w\d\.]+)?.*?(safari|version[\s\/:]([\w\d\.]+)|$)/)||[null,"unknown",0],f=j[1]=="ie"&&k.documentMode;
-var o=this.Browser={extend:Function.prototype.extend,name:(j[1]=="version")?j[3]:j[1],version:f||parseFloat((j[1]=="opera"&&j[4])?j[4]:j[2]),Platform:{name:a.match(/ip(?:ad|od|hone)/)?"ios":(a.match(/(?:webos|android)/)||c.match(/mac|win|linux/)||["other"])[0]},Features:{xpath:!!(k.evaluate),air:!!(i.runtime),query:!!(k.querySelector),json:!!(i.JSON)},Plugins:{}};
-o[o.name]=true;o[o.name+parseInt(o.version,10)]=true;o.Platform[o.Platform.name]=true;o.Request=(function(){var q=function(){return new XMLHttpRequest();
-};var p=function(){return new ActiveXObject("MSXML2.XMLHTTP");};var e=function(){return new ActiveXObject("Microsoft.XMLHTTP");};return Function.attempt(function(){q();
-return q;},function(){p();return p;},function(){e();return e;});})();o.Features.xhr=!!(o.Request);var h=(Function.attempt(function(){return navigator.plugins["Shockwave Flash"].description;
-},function(){return new ActiveXObject("ShockwaveFlash.ShockwaveFlash").GetVariable("$version");})||"0 r0").match(/\d+/g);o.Plugins.Flash={version:Number(h[0]||"0."+h[1])||0,build:Number(h[2])||0};
-o.exec=function(p){if(!p){return p;}if(i.execScript){i.execScript(p);}else{var e=k.createElement("script");e.setAttribute("type","text/javascript");e.text=p;
-k.head.appendChild(e);k.head.removeChild(e);}return p;};String.implement("stripScripts",function(p){var e="";var q=this.replace(/<script[^>]*>([\s\S]*?)<\/script>/gi,function(r,s){e+=s+"\n";
-return"";});if(p===true){o.exec(e);}else{if(typeOf(p)=="function"){p(e,q);}}return q;});o.extend({Document:this.Document,Window:this.Window,Element:this.Element,Event:this.Event});
-this.Window=this.$constructor=new Type("Window",function(){});this.$family=Function.from("window").hide();Window.mirror(function(e,p){i[e]=p;});this.Document=k.$constructor=new Type("Document",function(){});
-k.$family=Function.from("document").hide();Document.mirror(function(e,p){k[e]=p;});k.html=k.documentElement;if(!k.head){k.head=k.getElementsByTagName("head")[0];
-}if(k.execCommand){try{k.execCommand("BackgroundImageCache",false,true);}catch(g){}}if(this.attachEvent&&!this.addEventListener){var d=function(){this.detachEvent("onunload",d);
-k.head=k.html=k.window=null;};this.attachEvent("onunload",d);}var m=Array.from;try{m(k.html.childNodes);}catch(g){Array.from=function(p){if(typeof p!="string"&&Type.isEnumerable(p)&&typeOf(p)!="array"){var e=p.length,q=new Array(e);
-while(e--){q[e]=p[e];}return q;}return m(p);};var l=Array.prototype,n=l.slice;["pop","push","reverse","shift","sort","splice","unshift","concat","join","slice"].each(function(e){var p=l[e];
-Array[e]=function(q){return p.apply(Array.from(q),n.call(arguments,1));};});}})();(function(){var b={};var a=this.DOMEvent=new Type("DOMEvent",function(c,g){if(!g){g=window;
-}c=c||g.event;if(c.$extended){return c;}this.event=c;this.$extended=true;this.shift=c.shiftKey;this.control=c.ctrlKey;this.alt=c.altKey;this.meta=c.metaKey;
-var i=this.type=c.type;var h=c.target||c.srcElement;while(h&&h.nodeType==3){h=h.parentNode;}this.target=document.id(h);if(i.indexOf("key")==0){var d=this.code=(c.which||c.keyCode);
-this.key=b[d];if(i=="keydown"){if(d>111&&d<124){this.key="f"+(d-111);}else{if(d>95&&d<106){this.key=d-96;}}}if(this.key==null){this.key=String.fromCharCode(d).toLowerCase();
-}}else{if(i=="click"||i=="dblclick"||i=="contextmenu"||i=="DOMMouseScroll"||i.indexOf("mouse")==0){var j=g.document;j=(!j.compatMode||j.compatMode=="CSS1Compat")?j.html:j.body;
-this.page={x:(c.pageX!=null)?c.pageX:c.clientX+j.scrollLeft,y:(c.pageY!=null)?c.pageY:c.clientY+j.scrollTop};this.client={x:(c.pageX!=null)?c.pageX-g.pageXOffset:c.clientX,y:(c.pageY!=null)?c.pageY-g.pageYOffset:c.clientY};
-if(i=="DOMMouseScroll"||i=="mousewheel"){this.wheel=(c.wheelDelta)?c.wheelDelta/120:-(c.detail||0)/3;}this.rightClick=(c.which==3||c.button==2);if(i=="mouseover"||i=="mouseout"){var k=c.relatedTarget||c[(i=="mouseover"?"from":"to")+"Element"];
-while(k&&k.nodeType==3){k=k.parentNode;}this.relatedTarget=document.id(k);}}else{if(i.indexOf("touch")==0||i.indexOf("gesture")==0){this.rotation=c.rotation;
-this.scale=c.scale;this.targetTouches=c.targetTouches;this.changedTouches=c.changedTouches;var f=this.touches=c.touches;if(f&&f[0]){var e=f[0];this.page={x:e.pageX,y:e.pageY};
-this.client={x:e.clientX,y:e.clientY};}}}}if(!this.client){this.client={};}if(!this.page){this.page={};}});a.implement({stop:function(){return this.preventDefault().stopPropagation();
-},stopPropagation:function(){if(this.event.stopPropagation){this.event.stopPropagation();}else{this.event.cancelBubble=true;}return this;},preventDefault:function(){if(this.event.preventDefault){this.event.preventDefault();
-}else{this.event.returnValue=false;}return this;}});a.defineKey=function(d,c){b[d]=c;return this;};a.defineKeys=a.defineKey.overloadSetter(true);a.defineKeys({"38":"up","40":"down","37":"left","39":"right","27":"esc","32":"space","8":"backspace","9":"tab","46":"delete","13":"enter"});
-})();(function(){var a=this.Class=new Type("Class",function(h){if(instanceOf(h,Function)){h={initialize:h};}var g=function(){e(this);if(g.$prototyping){return this;
-}this.$caller=null;var i=(this.initialize)?this.initialize.apply(this,arguments):this;this.$caller=this.caller=null;return i;}.extend(this).implement(h);
-g.$constructor=a;g.prototype.$constructor=g;g.prototype.parent=c;return g;});var c=function(){if(!this.$caller){throw new Error('The method "parent" cannot be called.');
-}var g=this.$caller.$name,h=this.$caller.$owner.parent,i=(h)?h.prototype[g]:null;if(!i){throw new Error('The method "'+g+'" has no parent.');}return i.apply(this,arguments);
-};var e=function(g){for(var h in g){var j=g[h];switch(typeOf(j)){case"object":var i=function(){};i.prototype=j;g[h]=e(new i);break;case"array":g[h]=j.clone();
-break;}}return g;};var b=function(g,h,j){if(j.$origin){j=j.$origin;}var i=function(){if(j.$protected&&this.$caller==null){throw new Error('The method "'+h+'" cannot be called.');
-}var l=this.caller,m=this.$caller;this.caller=m;this.$caller=i;var k=j.apply(this,arguments);this.$caller=m;this.caller=l;return k;}.extend({$owner:g,$origin:j,$name:h});
-return i;};var f=function(h,i,g){if(a.Mutators.hasOwnProperty(h)){i=a.Mutators[h].call(this,i);if(i==null){return this;}}if(typeOf(i)=="function"){if(i.$hidden){return this;
-}this.prototype[h]=(g)?i:b(this,h,i);}else{Object.merge(this.prototype,h,i);}return this;};var d=function(g){g.$prototyping=true;var h=new g;delete g.$prototyping;
-return h;};a.implement("implement",f.overloadSetter());a.Mutators={Extends:function(g){this.parent=g;this.prototype=d(g);},Implements:function(g){Array.from(g).each(function(j){var h=new j;
-for(var i in h){f.call(this,i,h[i],true);}},this);}};})();(function(){this.Chain=new Class({$chain:[],chain:function(){this.$chain.append(Array.flatten(arguments));
-return this;},callChain:function(){return(this.$chain.length)?this.$chain.shift().apply(this,arguments):false;},clearChain:function(){this.$chain.empty();
-return this;}});var a=function(b){return b.replace(/^on([A-Z])/,function(c,d){return d.toLowerCase();});};this.Events=new Class({$events:{},addEvent:function(d,c,b){d=a(d);
-this.$events[d]=(this.$events[d]||[]).include(c);if(b){c.internal=true;}return this;},addEvents:function(b){for(var c in b){this.addEvent(c,b[c]);}return this;
-},fireEvent:function(e,c,b){e=a(e);var d=this.$events[e];if(!d){return this;}c=Array.from(c);d.each(function(f){if(b){f.delay(b,this,c);}else{f.apply(this,c);
-}},this);return this;},removeEvent:function(e,d){e=a(e);var c=this.$events[e];if(c&&!d.internal){var b=c.indexOf(d);if(b!=-1){delete c[b];}}return this;
-},removeEvents:function(d){var e;if(typeOf(d)=="object"){for(e in d){this.removeEvent(e,d[e]);}return this;}if(d){d=a(d);}for(e in this.$events){if(d&&d!=e){continue;
-}var c=this.$events[e];for(var b=c.length;b--;){if(b in c){this.removeEvent(e,c[b]);}}}return this;}});this.Options=new Class({setOptions:function(){var b=this.options=Object.merge.apply(null,[{},this.options].append(arguments));
-if(this.addEvent){for(var c in b){if(typeOf(b[c])!="function"||!(/^on[A-Z]/).test(c)){continue;}this.addEvent(c,b[c]);delete b[c];}}return this;}});})();
-(function(){var k,n,l,g,a={},c={},m=/\\/g;var e=function(q,p){if(q==null){return null;}if(q.Slick===true){return q;}q=(""+q).replace(/^\s+|\s+$/g,"");g=!!p;
-var o=(g)?c:a;if(o[q]){return o[q];}k={Slick:true,expressions:[],raw:q,reverse:function(){return e(this.raw,true);}};n=-1;while(q!=(q=q.replace(j,b))){}k.length=k.expressions.length;
-return o[k.raw]=(g)?h(k):k;};var i=function(o){if(o==="!"){return" ";}else{if(o===" "){return"!";}else{if((/^!/).test(o)){return o.replace(/^!/,"");}else{return"!"+o;
-}}}};var h=function(u){var r=u.expressions;for(var p=0;p<r.length;p++){var t=r[p];var q={parts:[],tag:"*",combinator:i(t[0].combinator)};for(var o=0;o<t.length;
-o++){var s=t[o];if(!s.reverseCombinator){s.reverseCombinator=" ";}s.combinator=s.reverseCombinator;delete s.reverseCombinator;}t.reverse().push(q);}return u;
-};var f=function(o){return o.replace(/[-[\]{}()*+?.\\^$|,#\s]/g,function(p){return"\\"+p;});};var j=new RegExp("^(?:\\s*(,)\\s*|\\s*(<combinator>+)\\s*|(\\s+)|(<unicode>+|\\*)|\\#(<unicode>+)|\\.(<unicode>+)|\\[\\s*(<unicode1>+)(?:\\s*([*^$!~|]?=)(?:\\s*(?:([\"']?)(.*?)\\9)))?\\s*\\](?!\\])|(:+)(<unicode>+)(?:\\((?:(?:([\"'])([^\\13]*)\\13)|((?:\\([^)]+\\)|[^()]*)+))\\))?)".replace(/<combinator>/,"["+f(">+~`!@$%^&={}\\;</")+"]").replace(/<unicode>/g,"(?:[\\w\\u00a1-\\uFFFF-]|\\\\[^\\s0-9a-f])").replace(/<unicode1>/g,"(?:[:\\w\\u00a1-\\uFFFF-]|\\\\[^\\s0-9a-f])"));
-function b(x,s,D,z,r,C,q,B,A,y,u,F,G,v,p,w){if(s||n===-1){k.expressions[++n]=[];l=-1;if(s){return"";}}if(D||z||l===-1){D=D||" ";var t=k.expressions[n];
-if(g&&t[l]){t[l].reverseCombinator=i(D);}t[++l]={combinator:D,tag:"*"};}var o=k.expressions[n][l];if(r){o.tag=r.replace(m,"");}else{if(C){o.id=C.replace(m,"");
-}else{if(q){q=q.replace(m,"");if(!o.classList){o.classList=[];}if(!o.classes){o.classes=[];}o.classList.push(q);o.classes.push({value:q,regexp:new RegExp("(^|\\s)"+f(q)+"(\\s|$)")});
-}else{if(G){w=w||p;w=w?w.replace(m,""):null;if(!o.pseudos){o.pseudos=[];}o.pseudos.push({key:G.replace(m,""),value:w,type:F.length==1?"class":"element"});
-}else{if(B){B=B.replace(m,"");u=(u||"").replace(m,"");var E,H;switch(A){case"^=":H=new RegExp("^"+f(u));break;case"$=":H=new RegExp(f(u)+"$");break;case"~=":H=new RegExp("(^|\\s)"+f(u)+"(\\s|$)");
-break;case"|=":H=new RegExp("^"+f(u)+"(-|$)");break;case"=":E=function(I){return u==I;};break;case"*=":E=function(I){return I&&I.indexOf(u)>-1;};break;
-case"!=":E=function(I){return u!=I;};break;default:E=function(I){return !!I;};}if(u==""&&(/^[*$^]=$/).test(A)){E=function(){return false;};}if(!E){E=function(I){return I&&H.test(I);
-};}if(!o.attributes){o.attributes=[];}o.attributes.push({key:B,operator:A,value:u,test:E});}}}}}return"";}var d=(this.Slick||{});d.parse=function(o){return e(o);
-};d.escapeRegExp=f;if(!this.Slick){this.Slick=d;}}).apply((typeof exports!="undefined")?exports:this);(function(){var k={},m={},d=Object.prototype.toString;
-k.isNativeCode=function(c){return(/\{\s*\[native code\]\s*\}/).test(""+c);};k.isXML=function(c){return(!!c.xmlVersion)||(!!c.xml)||(d.call(c)=="[object XMLDocument]")||(c.nodeType==9&&c.documentElement.nodeName!="HTML");
-};k.setDocument=function(x){var u=x.nodeType;if(u==9){}else{if(u){x=x.ownerDocument;}else{if(x.navigator){x=x.document;}else{return;}}}if(this.document===x){return;
-}this.document=x;var z=x.documentElement,v=this.getUIDXML(z),p=m[v],B;if(p){for(B in p){this[B]=p[B];}return;}p=m[v]={};p.root=z;p.isXMLDocument=this.isXML(x);
-p.brokenStarGEBTN=p.starSelectsClosedQSA=p.idGetsName=p.brokenMixedCaseQSA=p.brokenGEBCN=p.brokenCheckedQSA=p.brokenEmptyAttributeQSA=p.isHTMLDocument=p.nativeMatchesSelector=false;
-var n,o,y,r,s;var t,c="slick_uniqueid";var A=x.createElement("div");var q=x.body||x.getElementsByTagName("body")[0]||z;q.appendChild(A);try{A.innerHTML='<a id="'+c+'"></a>';
-p.isHTMLDocument=!!x.getElementById(c);}catch(w){}if(p.isHTMLDocument){A.style.display="none";A.appendChild(x.createComment(""));o=(A.getElementsByTagName("*").length>1);
-try{A.innerHTML="foo</foo>";t=A.getElementsByTagName("*");n=(t&&!!t.length&&t[0].nodeName.charAt(0)=="/");}catch(w){}p.brokenStarGEBTN=o||n;try{A.innerHTML='<a name="'+c+'"></a><b id="'+c+'"></b>';
-p.idGetsName=x.getElementById(c)===A.firstChild;}catch(w){}if(A.getElementsByClassName){try{A.innerHTML='<a class="f"></a><a class="b"></a>';A.getElementsByClassName("b").length;
-A.firstChild.className="b";r=(A.getElementsByClassName("b").length!=2);}catch(w){}try{A.innerHTML='<a class="a"></a><a class="f b a"></a>';y=(A.getElementsByClassName("a").length!=2);
-}catch(w){}p.brokenGEBCN=r||y;}if(A.querySelectorAll){try{A.innerHTML="foo</foo>";t=A.querySelectorAll("*");p.starSelectsClosedQSA=(t&&!!t.length&&t[0].nodeName.charAt(0)=="/");
-}catch(w){}try{A.innerHTML='<a class="MiX"></a>';p.brokenMixedCaseQSA=!A.querySelectorAll(".MiX").length;}catch(w){}try{A.innerHTML='<select><option selected="selected">a</option></select>';
-p.brokenCheckedQSA=(A.querySelectorAll(":checked").length==0);}catch(w){}try{A.innerHTML='<a class=""></a>';p.brokenEmptyAttributeQSA=(A.querySelectorAll('[class*=""]').length!=0);
-}catch(w){}}try{A.innerHTML='<form action="s"><input id="action"/></form>';s=(A.firstChild.getAttribute("action")!="s");}catch(w){}p.nativeMatchesSelector=z.matchesSelector||z.mozMatchesSelector||z.webkitMatchesSelector;
-if(p.nativeMatchesSelector){try{p.nativeMatchesSelector.call(z,":slick");p.nativeMatchesSelector=null;}catch(w){}}}try{z.slick_expando=1;delete z.slick_expando;
-p.getUID=this.getUIDHTML;}catch(w){p.getUID=this.getUIDXML;}q.removeChild(A);A=t=q=null;p.getAttribute=(p.isHTMLDocument&&s)?function(E,C){var F=this.attributeGetters[C];
-if(F){return F.call(E);}var D=E.getAttributeNode(C);return(D)?D.nodeValue:null;}:function(D,C){var E=this.attributeGetters[C];return(E)?E.call(D):D.getAttribute(C);
-};p.hasAttribute=(z&&this.isNativeCode(z.hasAttribute))?function(D,C){return D.hasAttribute(C);}:function(D,C){D=D.getAttributeNode(C);return !!(D&&(D.specified||D.nodeValue));
-};p.contains=(z&&this.isNativeCode(z.contains))?function(C,D){return C.contains(D);}:(z&&z.compareDocumentPosition)?function(C,D){return C===D||!!(C.compareDocumentPosition(D)&16);
-}:function(C,D){if(D){do{if(D===C){return true;}}while((D=D.parentNode));}return false;};p.documentSorter=(z.compareDocumentPosition)?function(D,C){if(!D.compareDocumentPosition||!C.compareDocumentPosition){return 0;
-}return D.compareDocumentPosition(C)&4?-1:D===C?0:1;}:("sourceIndex" in z)?function(D,C){if(!D.sourceIndex||!C.sourceIndex){return 0;}return D.sourceIndex-C.sourceIndex;
-}:(x.createRange)?function(F,D){if(!F.ownerDocument||!D.ownerDocument){return 0;}var E=F.ownerDocument.createRange(),C=D.ownerDocument.createRange();E.setStart(F,0);
-E.setEnd(F,0);C.setStart(D,0);C.setEnd(D,0);return E.compareBoundaryPoints(Range.START_TO_END,C);}:null;z=null;for(B in p){this[B]=p[B];}};var f=/^([#.]?)((?:[\w-]+|\*))$/,h=/\[.+[*$^]=(?:""|'')?\]/,g={};
-k.search=function(U,z,H,s){var p=this.found=(s)?null:(H||[]);if(!U){return p;}else{if(U.navigator){U=U.document;}else{if(!U.nodeType){return p;}}}var F,O,V=this.uniques={},I=!!(H&&H.length),y=(U.nodeType==9);
-if(this.document!==(y?U:U.ownerDocument)){this.setDocument(U);}if(I){for(O=p.length;O--;){V[this.getUID(p[O])]=true;}}if(typeof z=="string"){var r=z.match(f);
-simpleSelectors:if(r){var u=r[1],v=r[2],A,E;if(!u){if(v=="*"&&this.brokenStarGEBTN){break simpleSelectors;}E=U.getElementsByTagName(v);if(s){return E[0]||null;
-}for(O=0;A=E[O++];){if(!(I&&V[this.getUID(A)])){p.push(A);}}}else{if(u=="#"){if(!this.isHTMLDocument||!y){break simpleSelectors;}A=U.getElementById(v);
-if(!A){return p;}if(this.idGetsName&&A.getAttributeNode("id").nodeValue!=v){break simpleSelectors;}if(s){return A||null;}if(!(I&&V[this.getUID(A)])){p.push(A);
-}}else{if(u=="."){if(!this.isHTMLDocument||((!U.getElementsByClassName||this.brokenGEBCN)&&U.querySelectorAll)){break simpleSelectors;}if(U.getElementsByClassName&&!this.brokenGEBCN){E=U.getElementsByClassName(v);
-if(s){return E[0]||null;}for(O=0;A=E[O++];){if(!(I&&V[this.getUID(A)])){p.push(A);}}}else{var T=new RegExp("(^|\\s)"+e.escapeRegExp(v)+"(\\s|$)");E=U.getElementsByTagName("*");
-for(O=0;A=E[O++];){className=A.className;if(!(className&&T.test(className))){continue;}if(s){return A;}if(!(I&&V[this.getUID(A)])){p.push(A);}}}}}}if(I){this.sort(p);
-}return(s)?null:p;}querySelector:if(U.querySelectorAll){if(!this.isHTMLDocument||g[z]||this.brokenMixedCaseQSA||(this.brokenCheckedQSA&&z.indexOf(":checked")>-1)||(this.brokenEmptyAttributeQSA&&h.test(z))||(!y&&z.indexOf(",")>-1)||e.disableQSA){break querySelector;
-}var S=z,x=U;if(!y){var C=x.getAttribute("id"),t="slickid__";x.setAttribute("id",t);S="#"+t+" "+S;U=x.parentNode;}try{if(s){return U.querySelector(S)||null;
-}else{E=U.querySelectorAll(S);}}catch(Q){g[z]=1;break querySelector;}finally{if(!y){if(C){x.setAttribute("id",C);}else{x.removeAttribute("id");}U=x;}}if(this.starSelectsClosedQSA){for(O=0;
-A=E[O++];){if(A.nodeName>"@"&&!(I&&V[this.getUID(A)])){p.push(A);}}}else{for(O=0;A=E[O++];){if(!(I&&V[this.getUID(A)])){p.push(A);}}}if(I){this.sort(p);
-}return p;}F=this.Slick.parse(z);if(!F.length){return p;}}else{if(z==null){return p;}else{if(z.Slick){F=z;}else{if(this.contains(U.documentElement||U,z)){(p)?p.push(z):p=z;
-return p;}else{return p;}}}}this.posNTH={};this.posNTHLast={};this.posNTHType={};this.posNTHTypeLast={};this.push=(!I&&(s||(F.length==1&&F.expressions[0].length==1)))?this.pushArray:this.pushUID;
-if(p==null){p=[];}var M,L,K;var B,J,D,c,q,G,W;var N,P,o,w,R=F.expressions;search:for(O=0;(P=R[O]);O++){for(M=0;(o=P[M]);M++){B="combinator:"+o.combinator;
-if(!this[B]){continue search;}J=(this.isXMLDocument)?o.tag:o.tag.toUpperCase();D=o.id;c=o.classList;q=o.classes;G=o.attributes;W=o.pseudos;w=(M===(P.length-1));
-this.bitUniques={};if(w){this.uniques=V;this.found=p;}else{this.uniques={};this.found=[];}if(M===0){this[B](U,J,D,q,G,W,c);if(s&&w&&p.length){break search;
-}}else{if(s&&w){for(L=0,K=N.length;L<K;L++){this[B](N[L],J,D,q,G,W,c);if(p.length){break search;}}}else{for(L=0,K=N.length;L<K;L++){this[B](N[L],J,D,q,G,W,c);
-}}}N=this.found;}}if(I||(F.expressions.length>1)){this.sort(p);}return(s)?(p[0]||null):p;};k.uidx=1;k.uidk="slick-uniqueid";k.getUIDXML=function(n){var c=n.getAttribute(this.uidk);
-if(!c){c=this.uidx++;n.setAttribute(this.uidk,c);}return c;};k.getUIDHTML=function(c){return c.uniqueNumber||(c.uniqueNumber=this.uidx++);};k.sort=function(c){if(!this.documentSorter){return c;
-}c.sort(this.documentSorter);return c;};k.cacheNTH={};k.matchNTH=/^([+-]?\d*)?([a-z]+)?([+-]\d+)?$/;k.parseNTHArgument=function(q){var o=q.match(this.matchNTH);
-if(!o){return false;}var p=o[2]||false;var n=o[1]||1;if(n=="-"){n=-1;}var c=+o[3]||0;o=(p=="n")?{a:n,b:c}:(p=="odd")?{a:2,b:1}:(p=="even")?{a:2,b:0}:{a:0,b:n};
-return(this.cacheNTH[q]=o);};k.createNTHPseudo=function(p,n,c,o){return function(s,q){var u=this.getUID(s);if(!this[c][u]){var A=s.parentNode;if(!A){return false;
-}var r=A[p],t=1;if(o){var z=s.nodeName;do{if(r.nodeName!=z){continue;}this[c][this.getUID(r)]=t++;}while((r=r[n]));}else{do{if(r.nodeType!=1){continue;
-}this[c][this.getUID(r)]=t++;}while((r=r[n]));}}q=q||"n";var v=this.cacheNTH[q]||this.parseNTHArgument(q);if(!v){return false;}var y=v.a,x=v.b,w=this[c][u];
-if(y==0){return x==w;}if(y>0){if(w<x){return false;}}else{if(x<w){return false;}}return((w-x)%y)==0;};};k.pushArray=function(p,c,r,o,n,q){if(this.matchSelector(p,c,r,o,n,q)){this.found.push(p);
-}};k.pushUID=function(q,c,s,p,n,r){var o=this.getUID(q);if(!this.uniques[o]&&this.matchSelector(q,c,s,p,n,r)){this.uniques[o]=true;this.found.push(q);}};
-k.matchNode=function(n,o){if(this.isHTMLDocument&&this.nativeMatchesSelector){try{return this.nativeMatchesSelector.call(n,o.replace(/\[([^=]+)=\s*([^'"\]]+?)\s*\]/g,'[$1="$2"]'));
-}catch(u){}}var t=this.Slick.parse(o);if(!t){return true;}var r=t.expressions,s=0,q;for(q=0;(currentExpression=r[q]);q++){if(currentExpression.length==1){var p=currentExpression[0];
-if(this.matchSelector(n,(this.isXMLDocument)?p.tag:p.tag.toUpperCase(),p.id,p.classes,p.attributes,p.pseudos)){return true;}s++;}}if(s==t.length){return false;
-}var c=this.search(this.document,t),v;for(q=0;v=c[q++];){if(v===n){return true;}}return false;};k.matchPseudo=function(q,c,p){var n="pseudo:"+c;if(this[n]){return this[n](q,p);
-}var o=this.getAttribute(q,c);return(p)?p==o:!!o;};k.matchSelector=function(o,v,c,p,q,s){if(v){var t=(this.isXMLDocument)?o.nodeName:o.nodeName.toUpperCase();
-if(v=="*"){if(t<"@"){return false;}}else{if(t!=v){return false;}}}if(c&&o.getAttribute("id")!=c){return false;}var r,n,u;if(p){for(r=p.length;r--;){u=o.getAttribute("class")||o.className;
-if(!(u&&p[r].regexp.test(u))){return false;}}}if(q){for(r=q.length;r--;){n=q[r];if(n.operator?!n.test(this.getAttribute(o,n.key)):!this.hasAttribute(o,n.key)){return false;
-}}}if(s){for(r=s.length;r--;){n=s[r];if(!this.matchPseudo(o,n.key,n.value)){return false;}}}return true;};var j={" ":function(q,w,n,r,s,u,p){var t,v,o;
-if(this.isHTMLDocument){getById:if(n){v=this.document.getElementById(n);if((!v&&q.all)||(this.idGetsName&&v&&v.getAttributeNode("id").nodeValue!=n)){o=q.all[n];
-if(!o){return;}if(!o[0]){o=[o];}for(t=0;v=o[t++];){var c=v.getAttributeNode("id");if(c&&c.nodeValue==n){this.push(v,w,null,r,s,u);break;}}return;}if(!v){if(this.contains(this.root,q)){return;
-}else{break getById;}}else{if(this.document!==q&&!this.contains(q,v)){return;}}this.push(v,w,null,r,s,u);return;}getByClass:if(r&&q.getElementsByClassName&&!this.brokenGEBCN){o=q.getElementsByClassName(p.join(" "));
-if(!(o&&o.length)){break getByClass;}for(t=0;v=o[t++];){this.push(v,w,n,null,s,u);}return;}}getByTag:{o=q.getElementsByTagName(w);if(!(o&&o.length)){break getByTag;
-}if(!this.brokenStarGEBTN){w=null;}for(t=0;v=o[t++];){this.push(v,w,n,r,s,u);}}},">":function(p,c,r,o,n,q){if((p=p.firstChild)){do{if(p.nodeType==1){this.push(p,c,r,o,n,q);
-}}while((p=p.nextSibling));}},"+":function(p,c,r,o,n,q){while((p=p.nextSibling)){if(p.nodeType==1){this.push(p,c,r,o,n,q);break;}}},"^":function(p,c,r,o,n,q){p=p.firstChild;
-if(p){if(p.nodeType==1){this.push(p,c,r,o,n,q);}else{this["combinator:+"](p,c,r,o,n,q);}}},"~":function(q,c,s,p,n,r){while((q=q.nextSibling)){if(q.nodeType!=1){continue;
-}var o=this.getUID(q);if(this.bitUniques[o]){break;}this.bitUniques[o]=true;this.push(q,c,s,p,n,r);}},"++":function(p,c,r,o,n,q){this["combinator:+"](p,c,r,o,n,q);
-this["combinator:!+"](p,c,r,o,n,q);},"~~":function(p,c,r,o,n,q){this["combinator:~"](p,c,r,o,n,q);this["combinator:!~"](p,c,r,o,n,q);},"!":function(p,c,r,o,n,q){while((p=p.parentNode)){if(p!==this.document){this.push(p,c,r,o,n,q);
-}}},"!>":function(p,c,r,o,n,q){p=p.parentNode;if(p!==this.document){this.push(p,c,r,o,n,q);}},"!+":function(p,c,r,o,n,q){while((p=p.previousSibling)){if(p.nodeType==1){this.push(p,c,r,o,n,q);
-break;}}},"!^":function(p,c,r,o,n,q){p=p.lastChild;if(p){if(p.nodeType==1){this.push(p,c,r,o,n,q);}else{this["combinator:!+"](p,c,r,o,n,q);}}},"!~":function(q,c,s,p,n,r){while((q=q.previousSibling)){if(q.nodeType!=1){continue;
-}var o=this.getUID(q);if(this.bitUniques[o]){break;}this.bitUniques[o]=true;this.push(q,c,s,p,n,r);}}};for(var i in j){k["combinator:"+i]=j[i];}var l={empty:function(c){var n=c.firstChild;
-return !(n&&n.nodeType==1)&&!(c.innerText||c.textContent||"").length;},not:function(c,n){return !this.matchNode(c,n);},contains:function(c,n){return(c.innerText||c.textContent||"").indexOf(n)>-1;
-},"first-child":function(c){while((c=c.previousSibling)){if(c.nodeType==1){return false;}}return true;},"last-child":function(c){while((c=c.nextSibling)){if(c.nodeType==1){return false;
-}}return true;},"only-child":function(o){var n=o;while((n=n.previousSibling)){if(n.nodeType==1){return false;}}var c=o;while((c=c.nextSibling)){if(c.nodeType==1){return false;
-}}return true;},"nth-child":k.createNTHPseudo("firstChild","nextSibling","posNTH"),"nth-last-child":k.createNTHPseudo("lastChild","previousSibling","posNTHLast"),"nth-of-type":k.createNTHPseudo("firstChild","nextSibling","posNTHType",true),"nth-last-of-type":k.createNTHPseudo("lastChild","previousSibling","posNTHTypeLast",true),index:function(n,c){return this["pseudo:nth-child"](n,""+c+1);
-},even:function(c){return this["pseudo:nth-child"](c,"2n");},odd:function(c){return this["pseudo:nth-child"](c,"2n+1");},"first-of-type":function(c){var n=c.nodeName;
-while((c=c.previousSibling)){if(c.nodeName==n){return false;}}return true;},"last-of-type":function(c){var n=c.nodeName;while((c=c.nextSibling)){if(c.nodeName==n){return false;
-}}return true;},"only-of-type":function(o){var n=o,p=o.nodeName;while((n=n.previousSibling)){if(n.nodeName==p){return false;}}var c=o;while((c=c.nextSibling)){if(c.nodeName==p){return false;
-}}return true;},enabled:function(c){return !c.disabled;},disabled:function(c){return c.disabled;},checked:function(c){return c.checked||c.selected;},focus:function(c){return this.isHTMLDocument&&this.document.activeElement===c&&(c.href||c.type||this.hasAttribute(c,"tabindex"));
-},root:function(c){return(c===this.root);},selected:function(c){return c.selected;}};for(var b in l){k["pseudo:"+b]=l[b];}var a=k.attributeGetters={"class":function(){return this.getAttribute("class")||this.className;
-},"for":function(){return("htmlFor" in this)?this.htmlFor:this.getAttribute("for");},href:function(){return("href" in this)?this.getAttribute("href",2):this.getAttribute("href");
-},style:function(){return(this.style)?this.style.cssText:this.getAttribute("style");},tabindex:function(){var c=this.getAttributeNode("tabindex");return(c&&c.specified)?c.nodeValue:null;
-},type:function(){return this.getAttribute("type");},maxlength:function(){var c=this.getAttributeNode("maxLength");return(c&&c.specified)?c.nodeValue:null;
-}};a.MAXLENGTH=a.maxLength=a.maxlength;var e=k.Slick=(this.Slick||{});e.version="1.1.6";e.search=function(n,o,c){return k.search(n,o,c);};e.find=function(c,n){return k.search(c,n,null,true);
-};e.contains=function(c,n){k.setDocument(c);return k.contains(c,n);};e.getAttribute=function(n,c){k.setDocument(n);return k.getAttribute(n,c);};e.hasAttribute=function(n,c){k.setDocument(n);
-return k.hasAttribute(n,c);};e.match=function(n,c){if(!(n&&c)){return false;}if(!c||c===n){return true;}k.setDocument(n);return k.matchNode(n,c);};e.defineAttributeGetter=function(c,n){k.attributeGetters[c]=n;
-return this;};e.lookupAttributeGetter=function(c){return k.attributeGetters[c];};e.definePseudo=function(c,n){k["pseudo:"+c]=function(p,o){return n.call(p,o);
-};return this;};e.lookupPseudo=function(c){var n=k["pseudo:"+c];if(n){return function(o){return n.call(this,o);};}return null;};e.override=function(n,c){k.override(n,c);
-return this;};e.isXML=k.isXML;e.uidOf=function(c){return k.getUIDHTML(c);};if(!this.Slick){this.Slick=e;}}).apply((typeof exports!="undefined")?exports:this);
-var Element=function(b,g){var h=Element.Constructors[b];if(h){return h(g);}if(typeof b!="string"){return document.id(b).set(g);}if(!g){g={};}if(!(/^[\w-]+$/).test(b)){var e=Slick.parse(b).expressions[0][0];
-b=(e.tag=="*")?"div":e.tag;if(e.id&&g.id==null){g.id=e.id;}var d=e.attributes;if(d){for(var a,f=0,c=d.length;f<c;f++){a=d[f];if(g[a.key]!=null){continue;
-}if(a.value!=null&&a.operator=="="){g[a.key]=a.value;}else{if(!a.value&&!a.operator){g[a.key]=true;}}}}if(e.classList&&g["class"]==null){g["class"]=e.classList.join(" ");
-}}return document.newElement(b,g);};if(Browser.Element){Element.prototype=Browser.Element.prototype;}new Type("Element",Element).mirror(function(a){if(Array.prototype[a]){return;
-}var b={};b[a]=function(){var h=[],e=arguments,j=true;for(var g=0,d=this.length;g<d;g++){var f=this[g],c=h[g]=f[a].apply(f,e);j=(j&&typeOf(c)=="element");
-}return(j)?new Elements(h):h;};Elements.implement(b);});if(!Browser.Element){Element.parent=Object;Element.Prototype={"$family":Function.from("element").hide()};
-Element.mirror(function(a,b){Element.Prototype[a]=b;});}Element.Constructors={};var IFrame=new Type("IFrame",function(){var e=Array.link(arguments,{properties:Type.isObject,iframe:function(f){return(f!=null);
-}});var c=e.properties||{},b;if(e.iframe){b=document.id(e.iframe);}var d=c.onload||function(){};delete c.onload;c.id=c.name=[c.id,c.name,b?(b.id||b.name):"IFrame_"+String.uniqueID()].pick();
-b=new Element(b||"iframe",c);var a=function(){d.call(b.contentWindow);};if(window.frames[c.id]){a();}else{b.addListener("load",a);}return b;});var Elements=this.Elements=function(a){if(a&&a.length){var e={},d;
-for(var c=0;d=a[c++];){var b=Slick.uidOf(d);if(!e[b]){e[b]=true;this.push(d);}}}};Elements.prototype={length:0};Elements.parent=Array;new Type("Elements",Elements).implement({filter:function(a,b){if(!a){return this;
-}return new Elements(Array.filter(this,(typeOf(a)=="string")?function(c){return c.match(a);}:a,b));}.protect(),push:function(){var d=this.length;for(var b=0,a=arguments.length;
-b<a;b++){var c=document.id(arguments[b]);if(c){this[d++]=c;}}return(this.length=d);}.protect(),unshift:function(){var b=[];for(var c=0,a=arguments.length;
-c<a;c++){var d=document.id(arguments[c]);if(d){b.push(d);}}return Array.prototype.unshift.apply(this,b);}.protect(),concat:function(){var b=new Elements(this);
-for(var c=0,a=arguments.length;c<a;c++){var d=arguments[c];if(Type.isEnumerable(d)){b.append(d);}else{b.push(d);}}return b;}.protect(),append:function(c){for(var b=0,a=c.length;
-b<a;b++){this.push(c[b]);}return this;}.protect(),empty:function(){while(this.length){delete this[--this.length];}return this;}.protect()});(function(){var g=Array.prototype.splice,b={"0":0,"1":1,length:2};
-g.call(b,1,1);if(b[1]==1){Elements.implement("splice",function(){var h=this.length;var e=g.apply(this,arguments);while(h>=this.length){delete this[h--];
-}return e;}.protect());}Elements.implement(Array.prototype);Array.mirror(Elements);var f;try{var a=document.createElement("<input name=x>");f=(a.name=="x");
-}catch(c){}var d=function(e){return(""+e).replace(/&/g,"&amp;").replace(/"/g,"&quot;");};Document.implement({newElement:function(e,h){if(h&&h.checked!=null){h.defaultChecked=h.checked;
-}if(f&&h){e="<"+e;if(h.name){e+=' name="'+d(h.name)+'"';}if(h.type){e+=' type="'+d(h.type)+'"';}e+=">";delete h.name;delete h.type;}return this.id(this.createElement(e)).set(h);
-}});})();Document.implement({newTextNode:function(a){return this.createTextNode(a);},getDocument:function(){return this;},getWindow:function(){return this.window;
-},id:(function(){var a={string:function(d,c,b){d=Slick.find(b,"#"+d.replace(/(\W)/g,"\\$1"));return(d)?a.element(d,c):null;},element:function(b,c){$uid(b);
-if(!c&&!b.$family&&!(/^(?:object|embed)$/i).test(b.tagName)){Object.append(b,Element.Prototype);}return b;},object:function(c,d,b){if(c.toElement){return a.element(c.toElement(b),d);
-}return null;}};a.textnode=a.whitespace=a.window=a.document=function(b){return b;};return function(c,e,d){if(c&&c.$family&&c.uid){return c;}var b=typeOf(c);
-return(a[b])?a[b](c,e,d||document):null;};})()});if(window.$==null){Window.implement("$",function(a,b){return document.id(a,b,this.document);});}Window.implement({getDocument:function(){return this.document;
-},getWindow:function(){return this;}});[Document,Element].invoke("implement",{getElements:function(a){return Slick.search(this,a,new Elements);},getElement:function(a){return document.id(Slick.find(this,a));
-}});var contains={contains:function(a){return Slick.contains(this,a);}};if(!document.contains){Document.implement(contains);}if(!document.createElement("div").contains){Element.implement(contains);
-}var injectCombinator=function(d,c){if(!d){return c;}d=Object.clone(Slick.parse(d));var b=d.expressions;for(var a=b.length;a--;){b[a][0].combinator=c;}return d;
-};Object.forEach({getNext:"~",getPrevious:"!~",getParent:"!"},function(a,b){Element.implement(b,function(c){return this.getElement(injectCombinator(c,a));
-});});Object.forEach({getAllNext:"~",getAllPrevious:"!~",getSiblings:"~~",getChildren:">",getParents:"!"},function(a,b){Element.implement(b,function(c){return this.getElements(injectCombinator(c,a));
-});});Element.implement({getFirst:function(a){return document.id(Slick.search(this,injectCombinator(a,">"))[0]);},getLast:function(a){return document.id(Slick.search(this,injectCombinator(a,">")).getLast());
-},getWindow:function(){return this.ownerDocument.window;},getDocument:function(){return this.ownerDocument;},getElementById:function(a){return document.id(Slick.find(this,"#"+(""+a).replace(/(\W)/g,"\\$1")));
-},match:function(a){return !a||Slick.match(this,a);}});if(window.$$==null){Window.implement("$$",function(a){if(arguments.length==1){if(typeof a=="string"){return Slick.search(this.document,a,new Elements);
-}else{if(Type.isEnumerable(a)){return new Elements(a);}}}return new Elements(arguments);});}(function(){var b={before:function(n,m){var o=m.parentNode;
-if(o){o.insertBefore(n,m);}},after:function(n,m){var o=m.parentNode;if(o){o.insertBefore(n,m.nextSibling);}},bottom:function(n,m){m.appendChild(n);},top:function(n,m){m.insertBefore(n,m.firstChild);
-}};b.inside=b.bottom;var k={},d={};var i={};Array.forEach(["type","value","defaultValue","accessKey","cellPadding","cellSpacing","colSpan","frameBorder","readOnly","rowSpan","tabIndex","useMap"],function(m){i[m.toLowerCase()]=m;
-});Object.append(i,{html:"innerHTML",text:(function(){var m=document.createElement("div");return(m.textContent==null)?"innerText":"textContent";})()});
-Object.forEach(i,function(n,m){d[m]=function(o,p){o[n]=p;};k[m]=function(o){return o[n];};});var a=["compact","nowrap","ismap","declare","noshade","checked","disabled","readOnly","multiple","selected","noresize","defer","defaultChecked","autofocus","controls","autoplay","loop"];
-var h={};Array.forEach(a,function(m){var n=m.toLowerCase();h[n]=m;d[n]=function(o,p){o[m]=!!p;};k[n]=function(o){return !!o[m];};});Object.append(d,{"class":function(m,n){("className" in m)?m.className=n:m.setAttribute("class",n);
-},"for":function(m,n){("htmlFor" in m)?m.htmlFor=n:m.setAttribute("for",n);},style:function(m,n){(m.style)?m.style.cssText=n:m.setAttribute("style",n);
-}});Element.implement({setProperty:function(n,o){var m=n.toLowerCase();if(o==null){if(!h[m]){this.removeAttribute(n);return this;}o=false;}var p=d[m];if(p){p(this,o);
-}else{this.setAttribute(n,o);}return this;},setProperties:function(m){for(var n in m){this.setProperty(n,m[n]);}return this;},getProperty:function(o){var n=k[o.toLowerCase()];
-if(n){return n(this);}var m=Slick.getAttribute(this,o);return(!m&&!Slick.hasAttribute(this,o))?null:m;},getProperties:function(){var m=Array.from(arguments);
-return m.map(this.getProperty,this).associate(m);},removeProperty:function(m){return this.setProperty(m,null);},removeProperties:function(){Array.each(arguments,this.removeProperty,this);
-return this;},set:function(o,n){var m=Element.Properties[o];(m&&m.set)?m.set.call(this,n):this.setProperty(o,n);}.overloadSetter(),get:function(n){var m=Element.Properties[n];
-return(m&&m.get)?m.get.apply(this):this.getProperty(n);}.overloadGetter(),erase:function(n){var m=Element.Properties[n];(m&&m.erase)?m.erase.apply(this):this.removeProperty(n);
-return this;},hasClass:function(m){return this.className.clean().contains(m," ");},addClass:function(m){if(!this.hasClass(m)){this.className=(this.className+" "+m).clean();
-}return this;},removeClass:function(m){this.className=this.className.replace(new RegExp("(^|\\s)"+m+"(?:\\s|$)"),"$1");return this;},toggleClass:function(m,n){if(n==null){n=!this.hasClass(m);
-}return(n)?this.addClass(m):this.removeClass(m);},adopt:function(){var p=this,m,r=Array.flatten(arguments),q=r.length;if(q>1){p=m=document.createDocumentFragment();
-}for(var o=0;o<q;o++){var n=document.id(r[o],true);if(n){p.appendChild(n);}}if(m){this.appendChild(m);}return this;},appendText:function(n,m){return this.grab(this.getDocument().newTextNode(n),m);
-},grab:function(n,m){b[m||"bottom"](document.id(n,true),this);return this;},inject:function(n,m){b[m||"bottom"](this,document.id(n,true));return this;},replaces:function(m){m=document.id(m,true);
-m.parentNode.replaceChild(this,m);return this;},wraps:function(n,m){n=document.id(n,true);return this.replaces(n).grab(n,m);},getSelected:function(){this.selectedIndex;
-return new Elements(Array.from(this.options).filter(function(m){return m.selected;}));},toQueryString:function(){var m=[];this.getElements("input, select, textarea").each(function(o){var n=o.type;
-if(!o.name||o.disabled||n=="submit"||n=="reset"||n=="file"||n=="image"){return;}var p=(o.get("tag")=="select")?o.getSelected().map(function(q){return document.id(q).get("value");
-}):((n=="radio"||n=="checkbox")&&!o.checked)?null:o.get("value");Array.from(p).each(function(q){if(typeof q!="undefined"){m.push(encodeURIComponent(o.name)+"="+encodeURIComponent(q));
-}});});return m.join("&");}});var j={},e={};var c=function(m){return(e[m]||(e[m]={}));};var g=function(n){var m=n.uid;if(n.removeEvents){n.removeEvents();
-}if(n.clearAttributes){n.clearAttributes();}if(m!=null){delete j[m];delete e[m];}return n;};var l={input:"checked",option:"selected",textarea:"value"};
-Element.implement({destroy:function(){var m=g(this).getElementsByTagName("*");Array.each(m,g);Element.dispose(this);return null;},empty:function(){Array.from(this.childNodes).each(Element.dispose);
-return this;},dispose:function(){return(this.parentNode)?this.parentNode.removeChild(this):this;},clone:function(r,p){r=r!==false;var w=this.cloneNode(r),o=[w],q=[this],u;
-if(r){o.append(Array.from(w.getElementsByTagName("*")));q.append(Array.from(this.getElementsByTagName("*")));}for(u=o.length;u--;){var s=o[u],v=q[u];if(!p){s.removeAttribute("id");
-}if(s.clearAttributes){s.clearAttributes();s.mergeAttributes(v);s.removeAttribute("uid");if(s.options){var z=s.options,m=v.options;for(var t=z.length;t--;
-){z[t].selected=m[t].selected;}}}var n=l[v.tagName.toLowerCase()];if(n&&v[n]){s[n]=v[n];}}if(Browser.ie){var x=w.getElementsByTagName("object"),y=this.getElementsByTagName("object");
-for(u=x.length;u--;){x[u].outerHTML=y[u].outerHTML;}}return document.id(w);}});[Element,Window,Document].invoke("implement",{addListener:function(p,o){if(p=="unload"){var m=o,n=this;
-o=function(){n.removeListener("unload",o);m();};}else{j[$uid(this)]=this;}if(this.addEventListener){this.addEventListener(p,o,!!arguments[2]);}else{this.attachEvent("on"+p,o);
-}return this;},removeListener:function(n,m){if(this.removeEventListener){this.removeEventListener(n,m,!!arguments[2]);}else{this.detachEvent("on"+n,m);
-}return this;},retrieve:function(n,m){var p=c($uid(this)),o=p[n];if(m!=null&&o==null){o=p[n]=m;}return o!=null?o:null;},store:function(n,m){var o=c($uid(this));
-o[n]=m;return this;},eliminate:function(m){var n=c($uid(this));delete n[m];return this;}});if(window.attachEvent&&!window.addEventListener){window.addListener("unload",function(){Object.each(j,g);
-if(window.CollectGarbage){CollectGarbage();}});}Element.Properties={};Element.Properties.style={set:function(m){this.style.cssText=m;},get:function(){return this.style.cssText;
-},erase:function(){this.style.cssText="";}};Element.Properties.tag={get:function(){return this.tagName.toLowerCase();}};Element.Properties.html=(function(){var s=Function.attempt(function(){var u=document.createElement("table");
-u.innerHTML="<tr><td></td></tr>";});var t=document.createElement("div");var o={table:[1,"<table>","</table>"],select:[1,"<select>","</select>"],tbody:[2,"<table><tbody>","</tbody></table>"],tr:[3,"<table><tbody><tr>","</tr></tbody></table>"]};
-o.thead=o.tfoot=o.tbody;t.innerHTML="<nav></nav>";var n=t.childNodes.length==1;if(!n){var q="abbr article aside audio canvas datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video".split(" "),p=document.createDocumentFragment(),m=q.length;
-while(m--){p.createElement(q[m]);}p.appendChild(t);}var r={set:function(v){if(typeOf(v)=="array"){v=v.join("");}var w=(!s&&o[this.get("tag")]);if(!w&&!n){w=[0,"",""];
-}if(w){var x=t;x.innerHTML=w[1]+v+w[2];for(var u=w[0];u--;){x=x.firstChild;}this.empty().adopt(x.childNodes);}else{this.innerHTML=v;}}};r.erase=r.set;return r;
-})();var f=document.createElement("form");f.innerHTML="<select><option>s</option></select>";if(f.firstChild.value!="s"){Element.Properties.value={set:function(r){var n=this.get("tag");
-if(n!="select"){return this.setProperty("value",r);}var o=this.getElements("option");for(var p=0;p<o.length;p++){var q=o[p],m=q.getAttributeNode("value"),s=(m&&m.specified)?q.value:q.get("text");
-if(s==r){return q.selected=true;}}},get:function(){var o=this,n=o.get("tag");if(n!="select"&&n!="option"){return this.getProperty("value");}if(n=="select"&&!(o=o.getSelected()[0])){return"";
-}var m=o.getAttributeNode("value");return(m&&m.specified)?o.value:o.get("text");}};}})();(function(){var f=document.html;Element.Properties.styles={set:function(i){this.setStyles(i);
-}};var h=(f.style.opacity!=null),a=(f.style.filter!=null),g=/alpha\(opacity=([\d.]+)\)/i;var b=function(j,i){j.store("$opacity",i);j.style.visibility=i>0?"visible":"hidden";
-};var d=(h?function(j,i){j.style.opacity=i;}:(a?function(j,i){if(!j.currentStyle||!j.currentStyle.hasLayout){j.style.zoom=1;}i=(i*100).limit(0,100).round();
-i=(i==100)?"":"alpha(opacity="+i+")";var k=j.style.filter||j.getComputedStyle("filter")||"";j.style.filter=g.test(k)?k.replace(g,i):k+i;}:b));var e=(h?function(j){var i=j.style.opacity||j.getComputedStyle("opacity");
-return(i=="")?1:i.toFloat();}:(a?function(j){var k=(j.style.filter||j.getComputedStyle("filter")),i;if(k){i=k.match(g);}return(i==null||k==null)?1:(i[1]/100);
-}:function(j){var i=j.retrieve("$opacity");if(i==null){i=(j.style.visibility=="hidden"?0:1);}return i;}));var c=(f.style.cssFloat==null)?"styleFloat":"cssFloat";
-Element.implement({getComputedStyle:function(k){if(this.currentStyle){return this.currentStyle[k.camelCase()];}var j=Element.getDocument(this).defaultView,i=j?j.getComputedStyle(this,null):null;
-return(i)?i.getPropertyValue((k==c)?"float":k.hyphenate()):null;},setStyle:function(j,i){if(j=="opacity"){d(this,parseFloat(i));return this;}j=(j=="float"?c:j).camelCase();
-if(typeOf(i)!="string"){var k=(Element.Styles[j]||"@").split(" ");i=Array.from(i).map(function(m,l){if(!k[l]){return"";}return(typeOf(m)=="number")?k[l].replace("@",Math.round(m)):m;
-}).join(" ");}else{if(i==String(Number(i))){i=Math.round(i);}}this.style[j]=i;return this;},getStyle:function(o){if(o=="opacity"){return e(this);}o=(o=="float"?c:o).camelCase();
-var i=this.style[o];if(!i||o=="zIndex"){i=[];for(var n in Element.ShortStyles){if(o!=n){continue;}for(var m in Element.ShortStyles[n]){i.push(this.getStyle(m));
-}return i.join(" ");}i=this.getComputedStyle(o);}if(i){i=String(i);var k=i.match(/rgba?\([\d\s,]+\)/);if(k){i=i.replace(k[0],k[0].rgbToHex());}}if(Browser.opera||(Browser.ie&&isNaN(parseFloat(i)))){if((/^(height|width)$/).test(o)){var j=(o=="width")?["left","right"]:["top","bottom"],l=0;
-j.each(function(p){l+=this.getStyle("border-"+p+"-width").toInt()+this.getStyle("padding-"+p).toInt();},this);return this["offset"+o.capitalize()]-l+"px";
-}if(Browser.opera&&String(i).indexOf("px")!=-1){return i;}if((/^border(.+)Width|margin|padding/).test(o)){return"0px";}}return i;},setStyles:function(j){for(var i in j){this.setStyle(i,j[i]);
-}return this;},getStyles:function(){var i={};Array.flatten(arguments).each(function(j){i[j]=this.getStyle(j);},this);return i;}});Element.Styles={left:"@px",top:"@px",bottom:"@px",right:"@px",width:"@px",height:"@px",maxWidth:"@px",maxHeight:"@px",minWidth:"@px",minHeight:"@px",backgroundColor:"rgb(@, @, @)",backgroundPosition:"@px @px",color:"rgb(@, @, @)",fontSize:"@px",letterSpacing:"@px",lineHeight:"@px",clip:"rect(@px @px @px @px)",margin:"@px @px @px @px",padding:"@px @px @px @px",border:"@px @ rgb(@, @, @) @px @ rgb(@, @, @) @px @ rgb(@, @, @)",borderWidth:"@px @px @px @px",borderStyle:"@ @ @ @",borderColor:"rgb(@, @, @) rgb(@, @, @) rgb(@, @, @) rgb(@, @, @)",zIndex:"@",zoom:"@",fontWeight:"@",textIndent:"@px",opacity:"@"};
-Element.ShortStyles={margin:{},padding:{},border:{},borderWidth:{},borderStyle:{},borderColor:{}};["Top","Right","Bottom","Left"].each(function(o){var n=Element.ShortStyles;
-var j=Element.Styles;["margin","padding"].each(function(p){var q=p+o;n[p][q]=j[q]="@px";});var m="border"+o;n.border[m]=j[m]="@px @ rgb(@, @, @)";var l=m+"Width",i=m+"Style",k=m+"Color";
-n[m]={};n.borderWidth[l]=n[m][l]=j[l]="@px";n.borderStyle[i]=n[m][i]=j[i]="@";n.borderColor[k]=n[m][k]=j[k]="rgb(@, @, @)";});})();(function(){Element.Properties.events={set:function(b){this.addEvents(b);
-}};[Element,Window,Document].invoke("implement",{addEvent:function(f,h){var i=this.retrieve("events",{});if(!i[f]){i[f]={keys:[],values:[]};}if(i[f].keys.contains(h)){return this;
-}i[f].keys.push(h);var g=f,b=Element.Events[f],d=h,j=this;if(b){if(b.onAdd){b.onAdd.call(this,h,f);}if(b.condition){d=function(k){if(b.condition.call(this,k,f)){return h.call(this,k);
-}return true;};}if(b.base){g=Function.from(b.base).call(this,f);}}var e=function(){return h.call(j);};var c=Element.NativeEvents[g];if(c){if(c==2){e=function(k){k=new DOMEvent(k,j.getWindow());
-if(d.call(j,k)===false){k.stop();}};}this.addListener(g,e,arguments[2]);}i[f].values.push(e);return this;},removeEvent:function(e,d){var c=this.retrieve("events");
-if(!c||!c[e]){return this;}var h=c[e];var b=h.keys.indexOf(d);if(b==-1){return this;}var g=h.values[b];delete h.keys[b];delete h.values[b];var f=Element.Events[e];
-if(f){if(f.onRemove){f.onRemove.call(this,d,e);}if(f.base){e=Function.from(f.base).call(this,e);}}return(Element.NativeEvents[e])?this.removeListener(e,g,arguments[2]):this;
-},addEvents:function(b){for(var c in b){this.addEvent(c,b[c]);}return this;},removeEvents:function(b){var d;if(typeOf(b)=="object"){for(d in b){this.removeEvent(d,b[d]);
-}return this;}var c=this.retrieve("events");if(!c){return this;}if(!b){for(d in c){this.removeEvents(d);}this.eliminate("events");}else{if(c[b]){c[b].keys.each(function(e){this.removeEvent(b,e);
-},this);delete c[b];}}return this;},fireEvent:function(e,c,b){var d=this.retrieve("events");if(!d||!d[e]){return this;}c=Array.from(c);d[e].keys.each(function(f){if(b){f.delay(b,this,c);
-}else{f.apply(this,c);}},this);return this;},cloneEvents:function(e,d){e=document.id(e);var c=e.retrieve("events");if(!c){return this;}if(!d){for(var b in c){this.cloneEvents(e,b);
-}}else{if(c[d]){c[d].keys.each(function(f){this.addEvent(d,f);},this);}}return this;}});Element.NativeEvents={click:2,dblclick:2,mouseup:2,mousedown:2,contextmenu:2,mousewheel:2,DOMMouseScroll:2,mouseover:2,mouseout:2,mousemove:2,selectstart:2,selectend:2,keydown:2,keypress:2,keyup:2,orientationchange:2,touchstart:2,touchmove:2,touchend:2,touchcancel:2,gesturestart:2,gesturechange:2,gestureend:2,focus:2,blur:2,change:2,reset:2,select:2,submit:2,paste:2,input:2,load:2,unload:1,beforeunload:2,resize:1,move:1,DOMContentLoaded:1,readystatechange:1,error:1,abort:1,scroll:1};
-var a=function(b){var c=b.relatedTarget;if(c==null){return true;}if(!c){return false;}return(c!=this&&c.prefix!="xul"&&typeOf(this)!="document"&&!this.contains(c));
-};Element.Events={mouseenter:{base:"mouseover",condition:a},mouseleave:{base:"mouseout",condition:a},mousewheel:{base:(Browser.firefox)?"DOMMouseScroll":"mousewheel"}};
-if(!window.addEventListener){Element.NativeEvents.propertychange=2;Element.Events.change={base:function(){var b=this.type;return(this.get("tag")=="input"&&(b=="radio"||b=="checkbox"))?"propertychange":"change";
-},condition:function(b){return !!(this.type!="radio"||this.checked);}};}})();(function(){var c=!!window.addEventListener;Element.NativeEvents.focusin=Element.NativeEvents.focusout=2;
-var k=function(l,m,n,o,p){while(p&&p!=l){if(m(p,o)){return n.call(p,o,p);}p=document.id(p.parentNode);}};var a={mouseenter:{base:"mouseover"},mouseleave:{base:"mouseout"},focus:{base:"focus"+(c?"":"in"),capture:true},blur:{base:c?"blur":"focusout",capture:true}};
-var b="$delegation:";var i=function(l){return{base:"focusin",remove:function(m,o){var p=m.retrieve(b+l+"listeners",{})[o];if(p&&p.forms){for(var n=p.forms.length;
-n--;){p.forms[n].removeEvent(l,p.fns[n]);}}},listen:function(x,r,v,n,t,s){var o=(t.get("tag")=="form")?t:n.target.getParent("form");if(!o){return;}var u=x.retrieve(b+l+"listeners",{}),p=u[s]||{forms:[],fns:[]},m=p.forms,w=p.fns;
-if(m.indexOf(o)!=-1){return;}m.push(o);var q=function(y){k(x,r,v,y,t);};o.addEvent(l,q);w.push(q);u[s]=p;x.store(b+l+"listeners",u);}};};var d=function(l){return{base:"focusin",listen:function(m,n,p,q,r){var o={blur:function(){this.removeEvents(o);
-}};o[l]=function(s){k(m,n,p,s,r);};q.target.addEvents(o);}};};if(!c){Object.append(a,{submit:i("submit"),reset:i("reset"),change:d("change"),select:d("select")});
-}var h=Element.prototype,f=h.addEvent,j=h.removeEvent;var e=function(l,m){return function(r,q,n){if(r.indexOf(":relay")==-1){return l.call(this,r,q,n);
-}var o=Slick.parse(r).expressions[0][0];if(o.pseudos[0].key!="relay"){return l.call(this,r,q,n);}var p=o.tag;o.pseudos.slice(1).each(function(s){p+=":"+s.key+(s.value?"("+s.value+")":"");
-});l.call(this,r,q);return m.call(this,p,o.pseudos[0].value,q);};};var g={addEvent:function(v,q,x){var t=this.retrieve("$delegates",{}),r=t[v];if(r){for(var y in r){if(r[y].fn==x&&r[y].match==q){return this;
-}}}var p=v,u=q,o=x,n=a[v]||{};v=n.base||p;q=function(B){return Slick.match(B,u);};var w=Element.Events[p];if(w&&w.condition){var l=q,m=w.condition;q=function(C,B){return l(C,B)&&m.call(C,B,v);
-};}var z=this,s=String.uniqueID();var A=n.listen?function(B,C){if(!C&&B&&B.target){C=B.target;}if(C){n.listen(z,q,x,B,C,s);}}:function(B,C){if(!C&&B&&B.target){C=B.target;
-}if(C){k(z,q,x,B,C);}};if(!r){r={};}r[s]={match:u,fn:o,delegator:A};t[p]=r;return f.call(this,v,A,n.capture);},removeEvent:function(r,n,t,u){var q=this.retrieve("$delegates",{}),p=q[r];
-if(!p){return this;}if(u){var m=r,w=p[u].delegator,l=a[r]||{};r=l.base||m;if(l.remove){l.remove(this,u);}delete p[u];q[m]=p;return j.call(this,r,w);}var o,v;
-if(t){for(o in p){v=p[o];if(v.match==n&&v.fn==t){return g.removeEvent.call(this,r,n,t,o);}}}else{for(o in p){v=p[o];if(v.match==n){g.removeEvent.call(this,r,n,v.fn,o);
-}}}return this;}};[Element,Window,Document].invoke("implement",{addEvent:e(f,g.addEvent),removeEvent:e(j,g.removeEvent)});})();(function(){var h=document.createElement("div"),e=document.createElement("div");
-h.style.height="0";h.appendChild(e);var d=(e.offsetParent===h);h=e=null;var l=function(m){return k(m,"position")!="static"||a(m);};var i=function(m){return l(m)||(/^(?:table|td|th)$/i).test(m.tagName);
-};Element.implement({scrollTo:function(m,n){if(a(this)){this.getWindow().scrollTo(m,n);}else{this.scrollLeft=m;this.scrollTop=n;}return this;},getSize:function(){if(a(this)){return this.getWindow().getSize();
-}return{x:this.offsetWidth,y:this.offsetHeight};},getScrollSize:function(){if(a(this)){return this.getWindow().getScrollSize();}return{x:this.scrollWidth,y:this.scrollHeight};
-},getScroll:function(){if(a(this)){return this.getWindow().getScroll();}return{x:this.scrollLeft,y:this.scrollTop};},getScrolls:function(){var n=this.parentNode,m={x:0,y:0};
-while(n&&!a(n)){m.x+=n.scrollLeft;m.y+=n.scrollTop;n=n.parentNode;}return m;},getOffsetParent:d?function(){var m=this;if(a(m)||k(m,"position")=="fixed"){return null;
-}var n=(k(m,"position")=="static")?i:l;while((m=m.parentNode)){if(n(m)){return m;}}return null;}:function(){var m=this;if(a(m)||k(m,"position")=="fixed"){return null;
-}try{return m.offsetParent;}catch(n){}return null;},getOffsets:function(){if(this.getBoundingClientRect&&!Browser.Platform.ios){var r=this.getBoundingClientRect(),o=document.id(this.getDocument().documentElement),q=o.getScroll(),t=this.getScrolls(),s=(k(this,"position")=="fixed");
-return{x:r.left.toInt()+t.x+((s)?0:q.x)-o.clientLeft,y:r.top.toInt()+t.y+((s)?0:q.y)-o.clientTop};}var n=this,m={x:0,y:0};if(a(this)){return m;}while(n&&!a(n)){m.x+=n.offsetLeft;
-m.y+=n.offsetTop;if(Browser.firefox){if(!c(n)){m.x+=b(n);m.y+=g(n);}var p=n.parentNode;if(p&&k(p,"overflow")!="visible"){m.x+=b(p);m.y+=g(p);}}else{if(n!=this&&Browser.safari){m.x+=b(n);
-m.y+=g(n);}}n=n.offsetParent;}if(Browser.firefox&&!c(this)){m.x-=b(this);m.y-=g(this);}return m;},getPosition:function(p){var q=this.getOffsets(),n=this.getScrolls();
-var m={x:q.x-n.x,y:q.y-n.y};if(p&&(p=document.id(p))){var o=p.getPosition();return{x:m.x-o.x-b(p),y:m.y-o.y-g(p)};}return m;},getCoordinates:function(o){if(a(this)){return this.getWindow().getCoordinates();
-}var m=this.getPosition(o),n=this.getSize();var p={left:m.x,top:m.y,width:n.x,height:n.y};p.right=p.left+p.width;p.bottom=p.top+p.height;return p;},computePosition:function(m){return{left:m.x-j(this,"margin-left"),top:m.y-j(this,"margin-top")};
-},setPosition:function(m){return this.setStyles(this.computePosition(m));}});[Document,Window].invoke("implement",{getSize:function(){var m=f(this);return{x:m.clientWidth,y:m.clientHeight};
-},getScroll:function(){var n=this.getWindow(),m=f(this);return{x:n.pageXOffset||m.scrollLeft,y:n.pageYOffset||m.scrollTop};},getScrollSize:function(){var o=f(this),n=this.getSize(),m=this.getDocument().body;
-return{x:Math.max(o.scrollWidth,m.scrollWidth,n.x),y:Math.max(o.scrollHeight,m.scrollHeight,n.y)};},getPosition:function(){return{x:0,y:0};},getCoordinates:function(){var m=this.getSize();
-return{top:0,left:0,bottom:m.y,right:m.x,height:m.y,width:m.x};}});var k=Element.getComputedStyle;function j(m,n){return k(m,n).toInt()||0;}function c(m){return k(m,"-moz-box-sizing")=="border-box";
-}function g(m){return j(m,"border-top-width");}function b(m){return j(m,"border-left-width");}function a(m){return(/^(?:body|html)$/i).test(m.tagName);
-}function f(m){var n=m.getDocument();return(!n.compatMode||n.compatMode=="CSS1Compat")?n.html:n.body;}})();Element.alias({position:"setPosition"});[Window,Document,Element].invoke("implement",{getHeight:function(){return this.getSize().y;
-},getWidth:function(){return this.getSize().x;},getScrollTop:function(){return this.getScroll().y;},getScrollLeft:function(){return this.getScroll().x;
-},getScrollHeight:function(){return this.getScrollSize().y;},getScrollWidth:function(){return this.getScrollSize().x;},getTop:function(){return this.getPosition().y;
-},getLeft:function(){return this.getPosition().x;}});(function(){var f=this.Fx=new Class({Implements:[Chain,Events,Options],options:{fps:60,unit:false,duration:500,frames:null,frameSkip:true,link:"ignore"},initialize:function(g){this.subject=this.subject||this;
-this.setOptions(g);},getTransition:function(){return function(g){return -(Math.cos(Math.PI*g)-1)/2;};},step:function(g){if(this.options.frameSkip){var h=(this.time!=null)?(g-this.time):0,i=h/this.frameInterval;
-this.time=g;this.frame+=i;}else{this.frame++;}if(this.frame<this.frames){var j=this.transition(this.frame/this.frames);this.set(this.compute(this.from,this.to,j));
-}else{this.frame=this.frames;this.set(this.compute(this.from,this.to,1));this.stop();}},set:function(g){return g;},compute:function(i,h,g){return f.compute(i,h,g);
-},check:function(){if(!this.isRunning()){return true;}switch(this.options.link){case"cancel":this.cancel();return true;case"chain":this.chain(this.caller.pass(arguments,this));
-return false;}return false;},start:function(k,j){if(!this.check(k,j)){return this;}this.from=k;this.to=j;this.frame=(this.options.frameSkip)?0:-1;this.time=null;
-this.transition=this.getTransition();var i=this.options.frames,h=this.options.fps,g=this.options.duration;this.duration=f.Durations[g]||g.toInt();this.frameInterval=1000/h;
-this.frames=i||Math.round(this.duration/this.frameInterval);this.fireEvent("start",this.subject);b.call(this,h);return this;},stop:function(){if(this.isRunning()){this.time=null;
-d.call(this,this.options.fps);if(this.frames==this.frame){this.fireEvent("complete",this.subject);if(!this.callChain()){this.fireEvent("chainComplete",this.subject);
-}}else{this.fireEvent("stop",this.subject);}}return this;},cancel:function(){if(this.isRunning()){this.time=null;d.call(this,this.options.fps);this.frame=this.frames;
-this.fireEvent("cancel",this.subject).clearChain();}return this;},pause:function(){if(this.isRunning()){this.time=null;d.call(this,this.options.fps);}return this;
-},resume:function(){if((this.frame<this.frames)&&!this.isRunning()){b.call(this,this.options.fps);}return this;},isRunning:function(){var g=e[this.options.fps];
-return g&&g.contains(this);}});f.compute=function(i,h,g){return(h-i)*g+i;};f.Durations={"short":250,normal:500,"long":1000};var e={},c={};var a=function(){var h=Date.now();
-for(var j=this.length;j--;){var g=this[j];if(g){g.step(h);}}};var b=function(h){var g=e[h]||(e[h]=[]);g.push(this);if(!c[h]){c[h]=a.periodical(Math.round(1000/h),g);
-}};var d=function(h){var g=e[h];if(g){g.erase(this);if(!g.length&&c[h]){delete e[h];c[h]=clearInterval(c[h]);}}};})();Fx.CSS=new Class({Extends:Fx,prepare:function(c,d,b){b=Array.from(b);
-if(b[1]==null){b[1]=b[0];b[0]=c.getStyle(d);}var a=b.map(this.parse);return{from:a[0],to:a[1]};},parse:function(a){a=Function.from(a)();a=(typeof a=="string")?a.split(" "):Array.from(a);
-return a.map(function(c){c=String(c);var b=false;Object.each(Fx.CSS.Parsers,function(f,e){if(b){return;}var d=f.parse(c);if(d||d===0){b={value:d,parser:f};
-}});b=b||{value:c,parser:Fx.CSS.Parsers.String};return b;});},compute:function(d,c,b){var a=[];(Math.min(d.length,c.length)).times(function(e){a.push({value:d[e].parser.compute(d[e].value,c[e].value,b),parser:d[e].parser});
-});a.$family=Function.from("fx:css:value");return a;},serve:function(c,b){if(typeOf(c)!="fx:css:value"){c=this.parse(c);}var a=[];c.each(function(d){a=a.concat(d.parser.serve(d.value,b));
-});return a;},render:function(a,d,c,b){a.setStyle(d,this.serve(c,b));},search:function(a){if(Fx.CSS.Cache[a]){return Fx.CSS.Cache[a];}var c={},b=new RegExp("^"+a.escapeRegExp()+"$");
-Array.each(document.styleSheets,function(f,e){var d=f.href;if(d&&d.contains("://")&&!d.contains(document.domain)){return;}var g=f.rules||f.cssRules;Array.each(g,function(k,h){if(!k.style){return;
-}var j=(k.selectorText)?k.selectorText.replace(/^\w+/,function(i){return i.toLowerCase();}):null;if(!j||!b.test(j)){return;}Object.each(Element.Styles,function(l,i){if(!k.style[i]||Element.ShortStyles[i]){return;
-}l=String(k.style[i]);c[i]=((/^rgb/).test(l))?l.rgbToHex():l;});});});return Fx.CSS.Cache[a]=c;}});Fx.CSS.Cache={};Fx.CSS.Parsers={Color:{parse:function(a){if(a.match(/^#[0-9a-f]{3,6}$/i)){return a.hexToRgb(true);
-}return((a=a.match(/(\d+),\s*(\d+),\s*(\d+)/)))?[a[1],a[2],a[3]]:false;},compute:function(c,b,a){return c.map(function(e,d){return Math.round(Fx.compute(c[d],b[d],a));
-});},serve:function(a){return a.map(Number);}},Number:{parse:parseFloat,compute:Fx.compute,serve:function(b,a){return(a)?b+a:b;}},String:{parse:Function.from(false),compute:function(b,a){return a;
-},serve:function(a){return a;}}};Fx.Tween=new Class({Extends:Fx.CSS,initialize:function(b,a){this.element=this.subject=document.id(b);this.parent(a);},set:function(b,a){if(arguments.length==1){a=b;
-b=this.property||this.options.property;}this.render(this.element,b,a,this.options.unit);return this;},start:function(c,e,d){if(!this.check(c,e,d)){return this;
-}var b=Array.flatten(arguments);this.property=this.options.property||b.shift();var a=this.prepare(this.element,this.property,b);return this.parent(a.from,a.to);
-}});Element.Properties.tween={set:function(a){this.get("tween").cancel().setOptions(a);return this;},get:function(){var a=this.retrieve("tween");if(!a){a=new Fx.Tween(this,{link:"cancel"});
-this.store("tween",a);}return a;}};Element.implement({tween:function(a,c,b){this.get("tween").start(a,c,b);return this;},fade:function(c){var d=this.get("tween"),f,e,a;
-if(c==null){c="toggle";}switch(c){case"in":f="start";e=1;break;case"out":f="start";e=0;break;case"show":f="set";e=1;break;case"hide":f="set";e=0;break;
-case"toggle":var b=this.retrieve("fade:flag",this.getStyle("opacity")==1);f="start";e=b?0:1;this.store("fade:flag",!b);a=true;break;default:f="start";e=c;
-}if(!a){this.eliminate("fade:flag");}d[f]("opacity",e);if(f=="set"||e!=0){this.setStyle("visibility",e==0?"hidden":"visible");}else{d.chain(function(){this.element.setStyle("visibility","hidden");
-});}return this;},highlight:function(c,a){if(!a){a=this.retrieve("highlight:original",this.getStyle("background-color"));a=(a=="transparent")?"#fff":a;
-}var b=this.get("tween");b.start("background-color",c||"#ffff88",a).chain(function(){this.setStyle("background-color",this.retrieve("highlight:original"));
-b.callChain();}.bind(this));return this;}});Fx.Morph=new Class({Extends:Fx.CSS,initialize:function(b,a){this.element=this.subject=document.id(b);this.parent(a);
-},set:function(a){if(typeof a=="string"){a=this.search(a);}for(var b in a){this.render(this.element,b,a[b],this.options.unit);}return this;},compute:function(e,d,c){var a={};
-for(var b in e){a[b]=this.parent(e[b],d[b],c);}return a;},start:function(b){if(!this.check(b)){return this;}if(typeof b=="string"){b=this.search(b);}var e={},d={};
-for(var c in b){var a=this.prepare(this.element,c,b[c]);e[c]=a.from;d[c]=a.to;}return this.parent(e,d);}});Element.Properties.morph={set:function(a){this.get("morph").cancel().setOptions(a);
-return this;},get:function(){var a=this.retrieve("morph");if(!a){a=new Fx.Morph(this,{link:"cancel"});this.store("morph",a);}return a;}};Element.implement({morph:function(a){this.get("morph").start(a);
-return this;}});Fx.implement({getTransition:function(){var a=this.options.transition||Fx.Transitions.Sine.easeInOut;if(typeof a=="string"){var b=a.split(":");
-a=Fx.Transitions;a=a[b[0]]||a[b[0].capitalize()];if(b[1]){a=a["ease"+b[1].capitalize()+(b[2]?b[2].capitalize():"")];}}return a;}});Fx.Transition=function(c,b){b=Array.from(b);
-var a=function(d){return c(d,b);};return Object.append(a,{easeIn:a,easeOut:function(d){return 1-c(1-d,b);},easeInOut:function(d){return(d<=0.5?c(2*d,b):(2-c(2*(1-d),b)))/2;
-}});};Fx.Transitions={linear:function(a){return a;}};Fx.Transitions.extend=function(a){for(var b in a){Fx.Transitions[b]=new Fx.Transition(a[b]);}};Fx.Transitions.extend({Pow:function(b,a){return Math.pow(b,a&&a[0]||6);
-},Expo:function(a){return Math.pow(2,8*(a-1));},Circ:function(a){return 1-Math.sin(Math.acos(a));},Sine:function(a){return 1-Math.cos(a*Math.PI/2);},Back:function(b,a){a=a&&a[0]||1.618;
-return Math.pow(b,2)*((a+1)*b-a);},Bounce:function(f){var e;for(var d=0,c=1;1;d+=c,c/=2){if(f>=(7-4*d)/11){e=c*c-Math.pow((11-6*d-11*f)/4,2);break;}}return e;
-},Elastic:function(b,a){return Math.pow(2,10*--b)*Math.cos(20*b*Math.PI*(a&&a[0]||1)/3);}});["Quad","Cubic","Quart","Quint"].each(function(b,a){Fx.Transitions[b]=new Fx.Transition(function(c){return Math.pow(c,a+2);
-});});(function(){var d=function(){},a=("onprogress" in new Browser.Request);var c=this.Request=new Class({Implements:[Chain,Events,Options],options:{url:"",data:"",headers:{"X-Requested-With":"XMLHttpRequest",Accept:"text/javascript, text/html, application/xml, text/xml, */*"},async:true,format:false,method:"post",link:"ignore",isSuccess:null,emulation:true,urlEncoded:true,encoding:"utf-8",evalScripts:false,evalResponse:false,timeout:0,noCache:false},initialize:function(e){this.xhr=new Browser.Request();
-this.setOptions(e);this.headers=this.options.headers;},onStateChange:function(){var e=this.xhr;if(e.readyState!=4||!this.running){return;}this.running=false;
-this.status=0;Function.attempt(function(){var f=e.status;this.status=(f==1223)?204:f;}.bind(this));e.onreadystatechange=d;if(a){e.onprogress=e.onloadstart=d;
-}clearTimeout(this.timer);this.response={text:this.xhr.responseText||"",xml:this.xhr.responseXML};if(this.options.isSuccess.call(this,this.status)){this.success(this.response.text,this.response.xml);
-}else{this.failure();}},isSuccess:function(){var e=this.status;return(e>=200&&e<300);},isRunning:function(){return !!this.running;},processScripts:function(e){if(this.options.evalResponse||(/(ecma|java)script/).test(this.getHeader("Content-type"))){return Browser.exec(e);
-}return e.stripScripts(this.options.evalScripts);},success:function(f,e){this.onSuccess(this.processScripts(f),e);},onSuccess:function(){this.fireEvent("complete",arguments).fireEvent("success",arguments).callChain();
-},failure:function(){this.onFailure();},onFailure:function(){this.fireEvent("complete").fireEvent("failure",this.xhr);},loadstart:function(e){this.fireEvent("loadstart",[e,this.xhr]);
-},progress:function(e){this.fireEvent("progress",[e,this.xhr]);},timeout:function(){this.fireEvent("timeout",this.xhr);},setHeader:function(e,f){this.headers[e]=f;
-return this;},getHeader:function(e){return Function.attempt(function(){return this.xhr.getResponseHeader(e);}.bind(this));},check:function(){if(!this.running){return true;
-}switch(this.options.link){case"cancel":this.cancel();return true;case"chain":this.chain(this.caller.pass(arguments,this));return false;}return false;},send:function(o){if(!this.check(o)){return this;
-}this.options.isSuccess=this.options.isSuccess||this.isSuccess;this.running=true;var l=typeOf(o);if(l=="string"||l=="element"){o={data:o};}var h=this.options;
-o=Object.append({data:h.data,url:h.url,method:h.method},o);var j=o.data,f=String(o.url),e=o.method.toLowerCase();switch(typeOf(j)){case"element":j=document.id(j).toQueryString();
-break;case"object":case"hash":j=Object.toQueryString(j);}if(this.options.format){var m="format="+this.options.format;j=(j)?m+"&"+j:m;}if(this.options.emulation&&!["get","post"].contains(e)){var k="_method="+e;
-j=(j)?k+"&"+j:k;e="post";}if(this.options.urlEncoded&&["post","put"].contains(e)){var g=(this.options.encoding)?"; charset="+this.options.encoding:"";this.headers["Content-type"]="application/x-www-form-urlencoded"+g;
-}if(!f){f=document.location.pathname;}var i=f.lastIndexOf("/");if(i>-1&&(i=f.indexOf("#"))>-1){f=f.substr(0,i);}if(this.options.noCache){f+=(f.contains("?")?"&":"?")+String.uniqueID();
-}if(j&&e=="get"){f+=(f.contains("?")?"&":"?")+j;j=null;}var n=this.xhr;if(a){n.onloadstart=this.loadstart.bind(this);n.onprogress=this.progress.bind(this);
-}n.open(e.toUpperCase(),f,this.options.async,this.options.user,this.options.password);if(this.options.user&&"withCredentials" in n){n.withCredentials=true;
-}n.onreadystatechange=this.onStateChange.bind(this);Object.each(this.headers,function(q,p){try{n.setRequestHeader(p,q);}catch(r){this.fireEvent("exception",[p,q]);
-}},this);this.fireEvent("request");n.send(j);if(!this.options.async){this.onStateChange();}if(this.options.timeout){this.timer=this.timeout.delay(this.options.timeout,this);
-}return this;},cancel:function(){if(!this.running){return this;}this.running=false;var e=this.xhr;e.abort();clearTimeout(this.timer);e.onreadystatechange=d;
-if(a){e.onprogress=e.onloadstart=d;}this.xhr=new Browser.Request();this.fireEvent("cancel");return this;}});var b={};["get","post","put","delete","GET","POST","PUT","DELETE"].each(function(e){b[e]=function(g){var f={method:e};
-if(g!=null){f.data=g;}return this.send(f);};});c.implement(b);Element.Properties.send={set:function(e){var f=this.get("send").cancel();f.setOptions(e);
-return this;},get:function(){var e=this.retrieve("send");if(!e){e=new c({data:this,link:"cancel",method:this.get("method")||"post",url:this.get("action")});
-this.store("send",e);}return e;}};Element.implement({send:function(e){var f=this.get("send");f.send({data:this,url:e||f.options.url});return this;}});})();
-Request.HTML=new Class({Extends:Request,options:{update:false,append:false,evalScripts:true,filter:false,headers:{Accept:"text/html, application/xml, text/xml, */*"}},success:function(f){var e=this.options,c=this.response;
-c.html=f.stripScripts(function(h){c.javascript=h;});var d=c.html.match(/<body[^>]*>([\s\S]*?)<\/body>/i);if(d){c.html=d[1];}var b=new Element("div").set("html",c.html);
-c.tree=b.childNodes;c.elements=b.getElements(e.filter||"*");if(e.filter){c.tree=c.elements;}if(e.update){var g=document.id(e.update).empty();if(e.filter){g.adopt(c.elements);
-}else{g.set("html",c.html);}}else{if(e.append){var a=document.id(e.append);if(e.filter){c.elements.reverse().inject(a);}else{a.adopt(b.getChildren());}}}if(e.evalScripts){Browser.exec(c.javascript);
-}this.onSuccess(c.tree,c.elements,c.html,c.javascript);}});Element.Properties.load={set:function(a){var b=this.get("load").cancel();b.setOptions(a);return this;
-},get:function(){var a=this.retrieve("load");if(!a){a=new Request.HTML({data:this,link:"cancel",update:this,method:"get"});this.store("load",a);}return a;
-}};Element.implement({load:function(){this.get("load").send(Array.link(arguments,{data:Type.isObject,url:Type.isString}));return this;}});if(typeof JSON=="undefined"){this.JSON={};
-}(function(){var special={"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"};var escape=function(chr){return special[chr]||"\\u"+("0000"+chr.charCodeAt(0).toString(16)).slice(-4);
-};JSON.validate=function(string){string=string.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"");
-return(/^[\],:{}\s]*$/).test(string);};JSON.encode=JSON.stringify?function(obj){return JSON.stringify(obj);}:function(obj){if(obj&&obj.toJSON){obj=obj.toJSON();
-}switch(typeOf(obj)){case"string":return'"'+obj.replace(/[\x00-\x1f\\"]/g,escape)+'"';case"array":return"["+obj.map(JSON.encode).clean()+"]";case"object":case"hash":var string=[];
-Object.each(obj,function(value,key){var json=JSON.encode(value);if(json){string.push(JSON.encode(key)+":"+json);}});return"{"+string+"}";case"number":case"boolean":return""+obj;
-case"null":return"null";}return null;};JSON.decode=function(string,secure){if(!string||typeOf(string)!="string"){return null;}if(secure||JSON.secure){if(JSON.parse){return JSON.parse(string);
-}if(!JSON.validate(string)){throw new Error("JSON could not decode the input; security is enabled and the value is not secure.");}}return eval("("+string+")");
-};})();Request.JSON=new Class({Extends:Request,options:{secure:true},initialize:function(a){this.parent(a);Object.append(this.headers,{Accept:"application/json","X-Request":"JSON"});
-},success:function(c){var b;try{b=this.response.json=JSON.decode(c,this.options.secure);}catch(a){this.fireEvent("error",[c,a]);return;}if(b==null){this.onFailure();
-}else{this.onSuccess(b,c);}}});var Cookie=new Class({Implements:Options,options:{path:"/",domain:false,duration:false,secure:false,document:document,encode:true},initialize:function(b,a){this.key=b;
-this.setOptions(a);},write:function(b){if(this.options.encode){b=encodeURIComponent(b);}if(this.options.domain){b+="; domain="+this.options.domain;}if(this.options.path){b+="; path="+this.options.path;
-}if(this.options.duration){var a=new Date();a.setTime(a.getTime()+this.options.duration*24*60*60*1000);b+="; expires="+a.toGMTString();}if(this.options.secure){b+="; secure";
-}this.options.document.cookie=this.key+"="+b;return this;},read:function(){var a=this.options.document.cookie.match("(?:^|;)\\s*"+this.key.escapeRegExp()+"=([^;]*)");
-return(a)?decodeURIComponent(a[1]):null;},dispose:function(){new Cookie(this.key,Object.merge({},this.options,{duration:-1})).write("");return this;}});
-Cookie.write=function(b,c,a){return new Cookie(b,a).write(c);};Cookie.read=function(a){return new Cookie(a).read();};Cookie.dispose=function(b,a){return new Cookie(b,a).dispose();
-};(function(i,k){var l,f,e=[],c,b,d=k.createElement("div");var g=function(){clearTimeout(b);if(l){return;}Browser.loaded=l=true;k.removeListener("DOMContentLoaded",g).removeListener("readystatechange",a);
-k.fireEvent("domready");i.fireEvent("domready");};var a=function(){for(var m=e.length;m--;){if(e[m]()){g();return true;}}return false;};var j=function(){clearTimeout(b);
-if(!a()){b=setTimeout(j,10);}};k.addListener("DOMContentLoaded",g);var h=function(){try{d.doScroll();return true;}catch(m){}return false;};if(d.doScroll&&!h()){e.push(h);
-c=true;}if(k.readyState){e.push(function(){var m=k.readyState;return(m=="loaded"||m=="complete");});}if("onreadystatechange" in k){k.addListener("readystatechange",a);
-}else{c=true;}if(c){j();}Element.Events.domready={onAdd:function(m){if(l){m.call(this);}}};Element.Events.load={base:"load",onAdd:function(m){if(f&&this==i){m.call(this);
-}},condition:function(){if(this==i){g();delete Element.Events.load;}return true;}};i.addEvent("load",function(){f=true;});})(window,document);(function(){var Swiff=this.Swiff=new Class({Implements:Options,options:{id:null,height:1,width:1,container:null,properties:{},params:{quality:"high",allowScriptAccess:"always",wMode:"window",swLiveConnect:true},callBacks:{},vars:{}},toElement:function(){return this.object;
-},initialize:function(path,options){this.instance="Swiff_"+String.uniqueID();this.setOptions(options);options=this.options;var id=this.id=options.id||this.instance;
-var container=document.id(options.container);Swiff.CallBacks[this.instance]={};var params=options.params,vars=options.vars,callBacks=options.callBacks;
-var properties=Object.append({height:options.height,width:options.width},options.properties);var self=this;for(var callBack in callBacks){Swiff.CallBacks[this.instance][callBack]=(function(option){return function(){return option.apply(self.object,arguments);
-};})(callBacks[callBack]);vars[callBack]="Swiff.CallBacks."+this.instance+"."+callBack;}params.flashVars=Object.toQueryString(vars);if(Browser.ie){properties.classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000";
-params.movie=path;}else{properties.type="application/x-shockwave-flash";}properties.data=path;var build='<object id="'+id+'"';for(var property in properties){build+=" "+property+'="'+properties[property]+'"';
-}build+=">";for(var param in params){if(params[param]){build+='<param name="'+param+'" value="'+params[param]+'" />';}}build+="</object>";this.object=((container)?container.empty():new Element("div")).set("html",build).firstChild;
-},replaces:function(element){element=document.id(element,true);element.parentNode.replaceChild(this.toElement(),element);return this;},inject:function(element){document.id(element,true).appendChild(this.toElement());
-return this;},remote:function(){return Swiff.remote.apply(Swiff,[this.toElement()].append(arguments));}});Swiff.CallBacks={};Swiff.remote=function(obj,fn){var rs=obj.CallFunction('<invoke name="'+fn+'" returntype="javascript">'+__flash__argumentsToXML(arguments,2)+"</invoke>");
-return eval(rs);};})(); \ No newline at end of file
diff --git a/module/web/media/js/mootools-more-1.4.0.1.js b/module/web/media/js/mootools-more-1.4.0.1.js
deleted file mode 100644
index f3f8e4ee1..000000000
--- a/module/web/media/js/mootools-more-1.4.0.1.js
+++ /dev/null
@@ -1,216 +0,0 @@
-// MooTools: the javascript framework.
-// Load this file's selection again by visiting: http://mootools.net/more/c1cc18c2fff04bcc58921b4dff80a6f1
-// Or build this file again with packager using: packager build More/Form.Request More/Fx.Reveal More/Sortables More/Request.Periodical More/Color
-/*
----
-copyrights:
- - [MooTools](http://mootools.net)
-
-licenses:
- - [MIT License](http://mootools.net/license.txt)
-...
-*/
-MooTools.More={version:"1.4.0.1",build:"a4244edf2aa97ac8a196fc96082dd35af1abab87"};Class.Mutators.Binds=function(a){if(!this.prototype.initialize){this.implement("initialize",function(){});
-}return Array.from(a).concat(this.prototype.Binds||[]);};Class.Mutators.initialize=function(a){return function(){Array.from(this.Binds).each(function(b){var c=this[b];
-if(c){this[b]=c.bind(this);}},this);return a.apply(this,arguments);};};Class.Occlude=new Class({occlude:function(c,b){b=document.id(b||this.element);var a=b.retrieve(c||this.property);
-if(a&&!this.occluded){return(this.occluded=a);}this.occluded=false;b.store(c||this.property,this);return this.occluded;}});Class.refactor=function(b,a){Object.each(a,function(e,d){var c=b.prototype[d];
-c=(c&&c.$origin)||c||function(){};b.implement(d,(typeof e=="function")?function(){var f=this.previous;this.previous=c;var g=e.apply(this,arguments);this.previous=f;
-return g;}:e);});return b;};(function(){var b=function(e,d){var f=[];Object.each(d,function(g){Object.each(g,function(h){e.each(function(i){f.push(i+"-"+h+(i=="border"?"-width":""));
-});});});return f;};var c=function(f,e){var d=0;Object.each(e,function(h,g){if(g.test(f)){d=d+h.toInt();}});return d;};var a=function(d){return !!(!d||d.offsetHeight||d.offsetWidth);
-};Element.implement({measure:function(h){if(a(this)){return h.call(this);}var g=this.getParent(),e=[];while(!a(g)&&g!=document.body){e.push(g.expose());
-g=g.getParent();}var f=this.expose(),d=h.call(this);f();e.each(function(i){i();});return d;},expose:function(){if(this.getStyle("display")!="none"){return function(){};
-}var d=this.style.cssText;this.setStyles({display:"block",position:"absolute",visibility:"hidden"});return function(){this.style.cssText=d;}.bind(this);
-},getDimensions:function(d){d=Object.merge({computeSize:false},d);var i={x:0,y:0};var h=function(j,e){return(e.computeSize)?j.getComputedSize(e):j.getSize();
-};var f=this.getParent("body");if(f&&this.getStyle("display")=="none"){i=this.measure(function(){return h(this,d);});}else{if(f){try{i=h(this,d);}catch(g){}}}return Object.append(i,(i.x||i.x===0)?{width:i.x,height:i.y}:{x:i.width,y:i.height});
-},getComputedSize:function(d){d=Object.merge({styles:["padding","border"],planes:{height:["top","bottom"],width:["left","right"]},mode:"both"},d);var g={},e={width:0,height:0},f;
-if(d.mode=="vertical"){delete e.width;delete d.planes.width;}else{if(d.mode=="horizontal"){delete e.height;delete d.planes.height;}}b(d.styles,d.planes).each(function(h){g[h]=this.getStyle(h).toInt();
-},this);Object.each(d.planes,function(i,h){var k=h.capitalize(),j=this.getStyle(h);if(j=="auto"&&!f){f=this.getDimensions();}j=g[h]=(j=="auto")?f[h]:j.toInt();
-e["total"+k]=j;i.each(function(m){var l=c(m,g);e["computed"+m.capitalize()]=l;e["total"+k]+=l;});},this);return Object.append(e,g);}});})();(function(b){var a=Element.Position={options:{relativeTo:document.body,position:{x:"center",y:"center"},offset:{x:0,y:0}},getOptions:function(d,c){c=Object.merge({},a.options,c);
-a.setPositionOption(c);a.setEdgeOption(c);a.setOffsetOption(d,c);a.setDimensionsOption(d,c);return c;},setPositionOption:function(c){c.position=a.getCoordinateFromValue(c.position);
-},setEdgeOption:function(d){var c=a.getCoordinateFromValue(d.edge);d.edge=c?c:(d.position.x=="center"&&d.position.y=="center")?{x:"center",y:"center"}:{x:"left",y:"top"};
-},setOffsetOption:function(f,d){var c={x:0,y:0},g=f.measure(function(){return document.id(this.getOffsetParent());}),e=g.getScroll();if(!g||g==f.getDocument().body){return;
-}c=g.measure(function(){var i=this.getPosition();if(this.getStyle("position")=="fixed"){var h=window.getScroll();i.x+=h.x;i.y+=h.y;}return i;});d.offset={parentPositioned:g!=document.id(d.relativeTo),x:d.offset.x-c.x+e.x,y:d.offset.y-c.y+e.y};
-},setDimensionsOption:function(d,c){c.dimensions=d.getDimensions({computeSize:true,styles:["padding","border","margin"]});},getPosition:function(e,d){var c={};
-d=a.getOptions(e,d);var f=document.id(d.relativeTo)||document.body;a.setPositionCoordinates(d,c,f);if(d.edge){a.toEdge(c,d);}var g=d.offset;c.left=((c.x>=0||g.parentPositioned||d.allowNegative)?c.x:0).toInt();
-c.top=((c.y>=0||g.parentPositioned||d.allowNegative)?c.y:0).toInt();a.toMinMax(c,d);if(d.relFixedPosition||f.getStyle("position")=="fixed"){a.toRelFixedPosition(f,c);
-}if(d.ignoreScroll){a.toIgnoreScroll(f,c);}if(d.ignoreMargins){a.toIgnoreMargins(c,d);}c.left=Math.ceil(c.left);c.top=Math.ceil(c.top);delete c.x;delete c.y;
-return c;},setPositionCoordinates:function(k,g,d){var f=k.offset.y,h=k.offset.x,e=(d==document.body)?window.getScroll():d.getPosition(),j=e.y,c=e.x,i=window.getSize();
-switch(k.position.x){case"left":g.x=c+h;break;case"right":g.x=c+h+d.offsetWidth;break;default:g.x=c+((d==document.body?i.x:d.offsetWidth)/2)+h;break;}switch(k.position.y){case"top":g.y=j+f;
-break;case"bottom":g.y=j+f+d.offsetHeight;break;default:g.y=j+((d==document.body?i.y:d.offsetHeight)/2)+f;break;}},toMinMax:function(c,d){var f={left:"x",top:"y"},e;
-["minimum","maximum"].each(function(g){["left","top"].each(function(h){e=d[g]?d[g][f[h]]:null;if(e!=null&&((g=="minimum")?c[h]<e:c[h]>e)){c[h]=e;}});});
-},toRelFixedPosition:function(e,c){var d=window.getScroll();c.top+=d.y;c.left+=d.x;},toIgnoreScroll:function(e,d){var c=e.getScroll();d.top-=c.y;d.left-=c.x;
-},toIgnoreMargins:function(c,d){c.left+=d.edge.x=="right"?d.dimensions["margin-right"]:(d.edge.x!="center"?-d.dimensions["margin-left"]:-d.dimensions["margin-left"]+((d.dimensions["margin-right"]+d.dimensions["margin-left"])/2));
-c.top+=d.edge.y=="bottom"?d.dimensions["margin-bottom"]:(d.edge.y!="center"?-d.dimensions["margin-top"]:-d.dimensions["margin-top"]+((d.dimensions["margin-bottom"]+d.dimensions["margin-top"])/2));
-},toEdge:function(c,d){var e={},g=d.dimensions,f=d.edge;switch(f.x){case"left":e.x=0;break;case"right":e.x=-g.x-g.computedRight-g.computedLeft;break;default:e.x=-(Math.round(g.totalWidth/2));
-break;}switch(f.y){case"top":e.y=0;break;case"bottom":e.y=-g.y-g.computedTop-g.computedBottom;break;default:e.y=-(Math.round(g.totalHeight/2));break;}c.x+=e.x;
-c.y+=e.y;},getCoordinateFromValue:function(c){if(typeOf(c)!="string"){return c;}c=c.toLowerCase();return{x:c.test("left")?"left":(c.test("right")?"right":"center"),y:c.test(/upper|top/)?"top":(c.test("bottom")?"bottom":"center")};
-}};Element.implement({position:function(d){if(d&&(d.x!=null||d.y!=null)){return(b?b.apply(this,arguments):this);}var c=this.setStyle("position","absolute").calculatePosition(d);
-return(d&&d.returnPos)?c:this.setStyles(c);},calculatePosition:function(c){return a.getPosition(this,c);}});})(Element.prototype.position);var IframeShim=new Class({Implements:[Options,Events,Class.Occlude],options:{className:"iframeShim",src:'javascript:false;document.write("");',display:false,zIndex:null,margin:0,offset:{x:0,y:0},browsers:(Browser.ie6||(Browser.firefox&&Browser.version<3&&Browser.Platform.mac))},property:"IframeShim",initialize:function(b,a){this.element=document.id(b);
-if(this.occlude()){return this.occluded;}this.setOptions(a);this.makeShim();return this;},makeShim:function(){if(this.options.browsers){var c=this.element.getStyle("zIndex").toInt();
-if(!c){c=1;var b=this.element.getStyle("position");if(b=="static"||!b){this.element.setStyle("position","relative");}this.element.setStyle("zIndex",c);
-}c=((this.options.zIndex!=null||this.options.zIndex===0)&&c>this.options.zIndex)?this.options.zIndex:c-1;if(c<0){c=1;}this.shim=new Element("iframe",{src:this.options.src,scrolling:"no",frameborder:0,styles:{zIndex:c,position:"absolute",border:"none",filter:"progid:DXImageTransform.Microsoft.Alpha(style=0,opacity=0)"},"class":this.options.className}).store("IframeShim",this);
-var a=(function(){this.shim.inject(this.element,"after");this[this.options.display?"show":"hide"]();this.fireEvent("inject");}).bind(this);if(!IframeShim.ready){window.addEvent("load",a);
-}else{a();}}else{this.position=this.hide=this.show=this.dispose=Function.from(this);}},position:function(){if(!IframeShim.ready||!this.shim){return this;
-}var a=this.element.measure(function(){return this.getSize();});if(this.options.margin!=undefined){a.x=a.x-(this.options.margin*2);a.y=a.y-(this.options.margin*2);
-this.options.offset.x+=this.options.margin;this.options.offset.y+=this.options.margin;}this.shim.set({width:a.x,height:a.y}).position({relativeTo:this.element,offset:this.options.offset});
-return this;},hide:function(){if(this.shim){this.shim.setStyle("display","none");}return this;},show:function(){if(this.shim){this.shim.setStyle("display","block");
-}return this.position();},dispose:function(){if(this.shim){this.shim.dispose();}return this;},destroy:function(){if(this.shim){this.shim.destroy();}return this;
-}});window.addEvent("load",function(){IframeShim.ready=true;});var Mask=new Class({Implements:[Options,Events],Binds:["position"],options:{style:{},"class":"mask",maskMargins:false,useIframeShim:true,iframeShimOptions:{}},initialize:function(b,a){this.target=document.id(b)||document.id(document.body);
-this.target.store("mask",this);this.setOptions(a);this.render();this.inject();},render:function(){this.element=new Element("div",{"class":this.options["class"],id:this.options.id||"mask-"+String.uniqueID(),styles:Object.merge({},this.options.style,{display:"none"}),events:{click:function(a){this.fireEvent("click",a);
-if(this.options.hideOnClick){this.hide();}}.bind(this)}});this.hidden=true;},toElement:function(){return this.element;},inject:function(b,a){a=a||(this.options.inject?this.options.inject.where:"")||this.target==document.body?"inside":"after";
-b=b||(this.options.inject&&this.options.inject.target)||this.target;this.element.inject(b,a);if(this.options.useIframeShim){this.shim=new IframeShim(this.element,this.options.iframeShimOptions);
-this.addEvents({show:this.shim.show.bind(this.shim),hide:this.shim.hide.bind(this.shim),destroy:this.shim.destroy.bind(this.shim)});}},position:function(){this.resize(this.options.width,this.options.height);
-this.element.position({relativeTo:this.target,position:"topLeft",ignoreMargins:!this.options.maskMargins,ignoreScroll:this.target==document.body});return this;
-},resize:function(a,e){var b={styles:["padding","border"]};if(this.options.maskMargins){b.styles.push("margin");}var d=this.target.getComputedSize(b);if(this.target==document.body){this.element.setStyles({width:0,height:0});
-var c=window.getScrollSize();if(d.totalHeight<c.y){d.totalHeight=c.y;}if(d.totalWidth<c.x){d.totalWidth=c.x;}}this.element.setStyles({width:Array.pick([a,d.totalWidth,d.x]),height:Array.pick([e,d.totalHeight,d.y])});
-return this;},show:function(){if(!this.hidden){return this;}window.addEvent("resize",this.position);this.position();this.showMask.apply(this,arguments);
-return this;},showMask:function(){this.element.setStyle("display","block");this.hidden=false;this.fireEvent("show");},hide:function(){if(this.hidden){return this;
-}window.removeEvent("resize",this.position);this.hideMask.apply(this,arguments);if(this.options.destroyOnHide){return this.destroy();}return this;},hideMask:function(){this.element.setStyle("display","none");
-this.hidden=true;this.fireEvent("hide");},toggle:function(){this[this.hidden?"show":"hide"]();},destroy:function(){this.hide();this.element.destroy();this.fireEvent("destroy");
-this.target.eliminate("mask");}});Element.Properties.mask={set:function(b){var a=this.retrieve("mask");if(a){a.destroy();}return this.eliminate("mask").store("mask:options",b);
-},get:function(){var a=this.retrieve("mask");if(!a){a=new Mask(this,this.retrieve("mask:options"));this.store("mask",a);}return a;}};Element.implement({mask:function(a){if(a){this.set("mask",a);
-}this.get("mask").show();return this;},unmask:function(){this.get("mask").hide();return this;}});var Spinner=new Class({Extends:Mask,Implements:Chain,options:{"class":"spinner",containerPosition:{},content:{"class":"spinner-content"},messageContainer:{"class":"spinner-msg"},img:{"class":"spinner-img"},fxOptions:{link:"chain"}},initialize:function(c,a){this.target=document.id(c)||document.id(document.body);
-this.target.store("spinner",this);this.setOptions(a);this.render();this.inject();var b=function(){this.active=false;}.bind(this);this.addEvents({hide:b,show:b});
-},render:function(){this.parent();this.element.set("id",this.options.id||"spinner-"+String.uniqueID());this.content=document.id(this.options.content)||new Element("div",this.options.content);
-this.content.inject(this.element);if(this.options.message){this.msg=document.id(this.options.message)||new Element("p",this.options.messageContainer).appendText(this.options.message);
-this.msg.inject(this.content);}if(this.options.img){this.img=document.id(this.options.img)||new Element("div",this.options.img);this.img.inject(this.content);
-}this.element.set("tween",this.options.fxOptions);},show:function(a){if(this.active){return this.chain(this.show.bind(this));}if(!this.hidden){this.callChain.delay(20,this);
-return this;}this.active=true;return this.parent(a);},showMask:function(a){var b=function(){this.content.position(Object.merge({relativeTo:this.element},this.options.containerPosition));
-}.bind(this);if(a){this.parent();b();}else{if(!this.options.style.opacity){this.options.style.opacity=this.element.getStyle("opacity").toFloat();}this.element.setStyles({display:"block",opacity:0}).tween("opacity",this.options.style.opacity);
-b();this.hidden=false;this.fireEvent("show");this.callChain();}},hide:function(a){if(this.active){return this.chain(this.hide.bind(this));}if(this.hidden){this.callChain.delay(20,this);
-return this;}this.active=true;return this.parent(a);},hideMask:function(a){if(a){return this.parent();}this.element.tween("opacity",0).get("tween").chain(function(){this.element.setStyle("display","none");
-this.hidden=true;this.fireEvent("hide");this.callChain();}.bind(this));},destroy:function(){this.content.destroy();this.parent();this.target.eliminate("spinner");
-}});Request=Class.refactor(Request,{options:{useSpinner:false,spinnerOptions:{},spinnerTarget:false},initialize:function(a){this._send=this.send;this.send=function(b){var c=this.getSpinner();
-if(c){c.chain(this._send.pass(b,this)).show();}else{this._send(b);}return this;};this.previous(a);},getSpinner:function(){if(!this.spinner){var b=document.id(this.options.spinnerTarget)||document.id(this.options.update);
-if(this.options.useSpinner&&b){b.set("spinner",this.options.spinnerOptions);var a=this.spinner=b.get("spinner");["complete","exception","cancel"].each(function(c){this.addEvent(c,a.hide.bind(a));
-},this);}}return this.spinner;}});Element.Properties.spinner={set:function(a){var b=this.retrieve("spinner");if(b){b.destroy();}return this.eliminate("spinner").store("spinner:options",a);
-},get:function(){var a=this.retrieve("spinner");if(!a){a=new Spinner(this,this.retrieve("spinner:options"));this.store("spinner",a);}return a;}};Element.implement({spin:function(a){if(a){this.set("spinner",a);
-}this.get("spinner").show();return this;},unspin:function(){this.get("spinner").hide();return this;}});String.implement({parseQueryString:function(d,a){if(d==null){d=true;
-}if(a==null){a=true;}var c=this.split(/[&;]/),b={};if(!c.length){return b;}c.each(function(i){var e=i.indexOf("=")+1,g=e?i.substr(e):"",f=e?i.substr(0,e-1).match(/([^\]\[]+|(\B)(?=\]))/g):[i],h=b;
-if(!f){return;}if(a){g=decodeURIComponent(g);}f.each(function(k,j){if(d){k=decodeURIComponent(k);}var l=h[k];if(j<f.length-1){h=h[k]=l||{};}else{if(typeOf(l)=="array"){l.push(g);
-}else{h[k]=l!=null?[l,g]:g;}}});});return b;},cleanQueryString:function(a){return this.split("&").filter(function(e){var b=e.indexOf("="),c=b<0?"":e.substr(0,b),d=e.substr(b+1);
-return a?a.call(null,c,d):(d||d===0);}).join("&");}});(function(){Events.Pseudos=function(h,e,f){var d="_monitorEvents:";var c=function(i){return{store:i.store?function(j,k){i.store(d+j,k);
-}:function(j,k){(i._monitorEvents||(i._monitorEvents={}))[j]=k;},retrieve:i.retrieve?function(j,k){return i.retrieve(d+j,k);}:function(j,k){if(!i._monitorEvents){return k;
-}return i._monitorEvents[j]||k;}};};var g=function(k){if(k.indexOf(":")==-1||!h){return null;}var j=Slick.parse(k).expressions[0][0],p=j.pseudos,i=p.length,o=[];
-while(i--){var n=p[i].key,m=h[n];if(m!=null){o.push({event:j.tag,value:p[i].value,pseudo:n,original:k,listener:m});}}return o.length?o:null;};return{addEvent:function(m,p,j){var n=g(m);
-if(!n){return e.call(this,m,p,j);}var k=c(this),r=k.retrieve(m,[]),i=n[0].event,l=Array.slice(arguments,2),o=p,q=this;n.each(function(s){var t=s.listener,u=o;
-if(t==false){i+=":"+s.pseudo+"("+s.value+")";}else{o=function(){t.call(q,s,u,arguments,o);};}});r.include({type:i,event:p,monitor:o});k.store(m,r);if(m!=i){e.apply(this,[m,p].concat(l));
-}return e.apply(this,[i,o].concat(l));},removeEvent:function(m,l){var k=g(m);if(!k){return f.call(this,m,l);}var n=c(this),j=n.retrieve(m);if(!j){return this;
-}var i=Array.slice(arguments,2);f.apply(this,[m,l].concat(i));j.each(function(o,p){if(!l||o.event==l){f.apply(this,[o.type,o.monitor].concat(i));}delete j[p];
-},this);n.store(m,j);return this;}};};var b={once:function(e,f,d,c){f.apply(this,d);this.removeEvent(e.event,c).removeEvent(e.original,f);},throttle:function(d,e,c){if(!e._throttled){e.apply(this,c);
-e._throttled=setTimeout(function(){e._throttled=false;},d.value||250);}},pause:function(d,e,c){clearTimeout(e._pause);e._pause=e.delay(d.value||250,this,c);
-}};Events.definePseudo=function(c,d){b[c]=d;return this;};Events.lookupPseudo=function(c){return b[c];};var a=Events.prototype;Events.implement(Events.Pseudos(b,a.addEvent,a.removeEvent));
-["Request","Fx"].each(function(c){if(this[c]){this[c].implement(Events.prototype);}});})();(function(){var d={relay:false},c=["once","throttle","pause"],b=c.length;
-while(b--){d[c[b]]=Events.lookupPseudo(c[b]);}DOMEvent.definePseudo=function(e,f){d[e]=f;return this;};var a=Element.prototype;[Element,Window,Document].invoke("implement",Events.Pseudos(d,a.addEvent,a.removeEvent));
-})();if(!window.Form){window.Form={};}(function(){Form.Request=new Class({Binds:["onSubmit","onFormValidate"],Implements:[Options,Events,Class.Occlude],options:{requestOptions:{evalScripts:true,useSpinner:true,emulation:false,link:"ignore"},sendButtonClicked:true,extraData:{},resetForm:true},property:"form.request",initialize:function(b,c,a){this.element=document.id(b);
-if(this.occlude()){return this.occluded;}this.setOptions(a).setTarget(c).attach();},setTarget:function(a){this.target=document.id(a);if(!this.request){this.makeRequest();
-}else{this.request.setOptions({update:this.target});}return this;},toElement:function(){return this.element;},makeRequest:function(){var a=this;this.request=new Request.HTML(Object.merge({update:this.target,emulation:false,spinnerTarget:this.element,method:this.element.get("method")||"post"},this.options.requestOptions)).addEvents({success:function(c,e,d,b){["complete","success"].each(function(f){a.fireEvent(f,[a.target,c,e,d,b]);
-});},failure:function(){a.fireEvent("complete",arguments).fireEvent("failure",arguments);},exception:function(){a.fireEvent("failure",arguments);}});return this.attachReset();
-},attachReset:function(){if(!this.options.resetForm){return this;}this.request.addEvent("success",function(){Function.attempt(function(){this.element.reset();
-}.bind(this));if(window.OverText){OverText.update();}}.bind(this));return this;},attach:function(a){var c=(a!=false)?"addEvent":"removeEvent";this.element[c]("click:relay(button, input[type=submit])",this.saveClickedButton.bind(this));
-var b=this.element.retrieve("validator");if(b){b[c]("onFormValidate",this.onFormValidate);}else{this.element[c]("submit",this.onSubmit);}return this;},detach:function(){return this.attach(false);
-},enable:function(){return this.attach();},disable:function(){return this.detach();},onFormValidate:function(c,b,a){if(!a){return;}var d=this.element.retrieve("validator");
-if(c||(d&&!d.options.stopOnFailure)){a.stop();this.send();}},onSubmit:function(a){var b=this.element.retrieve("validator");if(b){this.element.removeEvent("submit",this.onSubmit);
-b.addEvent("onFormValidate",this.onFormValidate);this.element.validate();return;}if(a){a.stop();}this.send();},saveClickedButton:function(b,c){var a=c.get("name");
-if(!a||!this.options.sendButtonClicked){return;}this.options.extraData[a]=c.get("value")||true;this.clickedCleaner=function(){delete this.options.extraData[a];
-this.clickedCleaner=function(){};}.bind(this);},clickedCleaner:function(){},send:function(){var b=this.element.toQueryString().trim(),a=Object.toQueryString(this.options.extraData);
-if(b){b+="&"+a;}else{b=a;}this.fireEvent("send",[this.element,b.parseQueryString()]);this.request.send({data:b,url:this.options.requestOptions.url||this.element.get("action")});
-this.clickedCleaner();return this;}});Element.implement("formUpdate",function(c,b){var a=this.retrieve("form.request");if(!a){a=new Form.Request(this,c,b);
-}else{if(c){a.setTarget(c);}if(b){a.setOptions(b).makeRequest();}}a.send();return this;});})();Element.implement({isDisplayed:function(){return this.getStyle("display")!="none";
-},isVisible:function(){var a=this.offsetWidth,b=this.offsetHeight;return(a==0&&b==0)?false:(a>0&&b>0)?true:this.style.display!="none";},toggle:function(){return this[this.isDisplayed()?"hide":"show"]();
-},hide:function(){var b;try{b=this.getStyle("display");}catch(a){}if(b=="none"){return this;}return this.store("element:_originalDisplay",b||"").setStyle("display","none");
-},show:function(a){if(!a&&this.isDisplayed()){return this;}a=a||this.retrieve("element:_originalDisplay")||"block";return this.setStyle("display",(a=="none")?"block":a);
-},swapClass:function(a,b){return this.removeClass(a).addClass(b);}});Document.implement({clearSelection:function(){if(window.getSelection){var a=window.getSelection();
-if(a&&a.removeAllRanges){a.removeAllRanges();}}else{if(document.selection&&document.selection.empty){try{document.selection.empty();}catch(b){}}}}});(function(){var a=function(d){var b=d.options.hideInputs;
-if(window.OverText){var c=[null];OverText.each(function(e){c.include("."+e.options.labelClass);});if(c){b+=c.join(", ");}}return(b)?d.element.getElements(b):null;
-};Fx.Reveal=new Class({Extends:Fx.Morph,options:{link:"cancel",styles:["padding","border","margin"],transitionOpacity:!Browser.ie6,mode:"vertical",display:function(){return this.element.get("tag")!="tr"?"block":"table-row";
-},opacity:1,hideInputs:Browser.ie?"select, input, textarea, object, embed":null},dissolve:function(){if(!this.hiding&&!this.showing){if(this.element.getStyle("display")!="none"){this.hiding=true;
-this.showing=false;this.hidden=true;this.cssText=this.element.style.cssText;var d=this.element.getComputedSize({styles:this.options.styles,mode:this.options.mode});
-if(this.options.transitionOpacity){d.opacity=this.options.opacity;}var c={};Object.each(d,function(f,e){c[e]=[f,0];});this.element.setStyles({display:Function.from(this.options.display).call(this),overflow:"hidden"});
-var b=a(this);if(b){b.setStyle("visibility","hidden");}this.$chain.unshift(function(){if(this.hidden){this.hiding=false;this.element.style.cssText=this.cssText;
-this.element.setStyle("display","none");if(b){b.setStyle("visibility","visible");}}this.fireEvent("hide",this.element);this.callChain();}.bind(this));this.start(c);
-}else{this.callChain.delay(10,this);this.fireEvent("complete",this.element);this.fireEvent("hide",this.element);}}else{if(this.options.link=="chain"){this.chain(this.dissolve.bind(this));
-}else{if(this.options.link=="cancel"&&!this.hiding){this.cancel();this.dissolve();}}}return this;},reveal:function(){if(!this.showing&&!this.hiding){if(this.element.getStyle("display")=="none"){this.hiding=false;
-this.showing=true;this.hidden=false;this.cssText=this.element.style.cssText;var d;this.element.measure(function(){d=this.element.getComputedSize({styles:this.options.styles,mode:this.options.mode});
-}.bind(this));if(this.options.heightOverride!=null){d.height=this.options.heightOverride.toInt();}if(this.options.widthOverride!=null){d.width=this.options.widthOverride.toInt();
-}if(this.options.transitionOpacity){this.element.setStyle("opacity",0);d.opacity=this.options.opacity;}var c={height:0,display:Function.from(this.options.display).call(this)};
-Object.each(d,function(f,e){c[e]=0;});c.overflow="hidden";this.element.setStyles(c);var b=a(this);if(b){b.setStyle("visibility","hidden");}this.$chain.unshift(function(){this.element.style.cssText=this.cssText;
-this.element.setStyle("display",Function.from(this.options.display).call(this));if(!this.hidden){this.showing=false;}if(b){b.setStyle("visibility","visible");
-}this.callChain();this.fireEvent("show",this.element);}.bind(this));this.start(d);}else{this.callChain();this.fireEvent("complete",this.element);this.fireEvent("show",this.element);
-}}else{if(this.options.link=="chain"){this.chain(this.reveal.bind(this));}else{if(this.options.link=="cancel"&&!this.showing){this.cancel();this.reveal();
-}}}return this;},toggle:function(){if(this.element.getStyle("display")=="none"){this.reveal();}else{this.dissolve();}return this;},cancel:function(){this.parent.apply(this,arguments);
-if(this.cssText!=null){this.element.style.cssText=this.cssText;}this.hiding=false;this.showing=false;return this;}});Element.Properties.reveal={set:function(b){this.get("reveal").cancel().setOptions(b);
-return this;},get:function(){var b=this.retrieve("reveal");if(!b){b=new Fx.Reveal(this);this.store("reveal",b);}return b;}};Element.Properties.dissolve=Element.Properties.reveal;
-Element.implement({reveal:function(b){this.get("reveal").setOptions(b).reveal();return this;},dissolve:function(b){this.get("reveal").setOptions(b).dissolve();
-return this;},nix:function(b){var c=Array.link(arguments,{destroy:Type.isBoolean,options:Type.isObject});this.get("reveal").setOptions(b).dissolve().chain(function(){this[c.destroy?"destroy":"dispose"]();
-}.bind(this));return this;},wink:function(){var c=Array.link(arguments,{duration:Type.isNumber,options:Type.isObject});var b=this.get("reveal").setOptions(c.options);
-b.reveal().chain(function(){(function(){b.dissolve();}).delay(c.duration||2000);});}});})();var Drag=new Class({Implements:[Events,Options],options:{snap:6,unit:"px",grid:false,style:true,limit:false,handle:false,invert:false,preventDefault:false,stopPropagation:false,modifiers:{x:"left",y:"top"}},initialize:function(){var b=Array.link(arguments,{options:Type.isObject,element:function(c){return c!=null;
-}});this.element=document.id(b.element);this.document=this.element.getDocument();this.setOptions(b.options||{});var a=typeOf(this.options.handle);this.handles=((a=="array"||a=="collection")?$$(this.options.handle):document.id(this.options.handle))||this.element;
-this.mouse={now:{},pos:{}};this.value={start:{},now:{}};this.selection=(Browser.ie)?"selectstart":"mousedown";if(Browser.ie&&!Drag.ondragstartFixed){document.ondragstart=Function.from(false);
-Drag.ondragstartFixed=true;}this.bound={start:this.start.bind(this),check:this.check.bind(this),drag:this.drag.bind(this),stop:this.stop.bind(this),cancel:this.cancel.bind(this),eventStop:Function.from(false)};
-this.attach();},attach:function(){this.handles.addEvent("mousedown",this.bound.start);return this;},detach:function(){this.handles.removeEvent("mousedown",this.bound.start);
-return this;},start:function(a){var j=this.options;if(a.rightClick){return;}if(j.preventDefault){a.preventDefault();}if(j.stopPropagation){a.stopPropagation();
-}this.mouse.start=a.page;this.fireEvent("beforeStart",this.element);var c=j.limit;this.limit={x:[],y:[]};var e,g;for(e in j.modifiers){if(!j.modifiers[e]){continue;
-}var b=this.element.getStyle(j.modifiers[e]);if(b&&!b.match(/px$/)){if(!g){g=this.element.getCoordinates(this.element.getOffsetParent());}b=g[j.modifiers[e]];
-}if(j.style){this.value.now[e]=(b||0).toInt();}else{this.value.now[e]=this.element[j.modifiers[e]];}if(j.invert){this.value.now[e]*=-1;}this.mouse.pos[e]=a.page[e]-this.value.now[e];
-if(c&&c[e]){var d=2;while(d--){var f=c[e][d];if(f||f===0){this.limit[e][d]=(typeof f=="function")?f():f;}}}}if(typeOf(this.options.grid)=="number"){this.options.grid={x:this.options.grid,y:this.options.grid};
-}var h={mousemove:this.bound.check,mouseup:this.bound.cancel};h[this.selection]=this.bound.eventStop;this.document.addEvents(h);},check:function(a){if(this.options.preventDefault){a.preventDefault();
-}var b=Math.round(Math.sqrt(Math.pow(a.page.x-this.mouse.start.x,2)+Math.pow(a.page.y-this.mouse.start.y,2)));if(b>this.options.snap){this.cancel();this.document.addEvents({mousemove:this.bound.drag,mouseup:this.bound.stop});
-this.fireEvent("start",[this.element,a]).fireEvent("snap",this.element);}},drag:function(b){var a=this.options;if(a.preventDefault){b.preventDefault();
-}this.mouse.now=b.page;for(var c in a.modifiers){if(!a.modifiers[c]){continue;}this.value.now[c]=this.mouse.now[c]-this.mouse.pos[c];if(a.invert){this.value.now[c]*=-1;
-}if(a.limit&&this.limit[c]){if((this.limit[c][1]||this.limit[c][1]===0)&&(this.value.now[c]>this.limit[c][1])){this.value.now[c]=this.limit[c][1];}else{if((this.limit[c][0]||this.limit[c][0]===0)&&(this.value.now[c]<this.limit[c][0])){this.value.now[c]=this.limit[c][0];
-}}}if(a.grid[c]){this.value.now[c]-=((this.value.now[c]-(this.limit[c][0]||0))%a.grid[c]);}if(a.style){this.element.setStyle(a.modifiers[c],this.value.now[c]+a.unit);
-}else{this.element[a.modifiers[c]]=this.value.now[c];}}this.fireEvent("drag",[this.element,b]);},cancel:function(a){this.document.removeEvents({mousemove:this.bound.check,mouseup:this.bound.cancel});
-if(a){this.document.removeEvent(this.selection,this.bound.eventStop);this.fireEvent("cancel",this.element);}},stop:function(b){var a={mousemove:this.bound.drag,mouseup:this.bound.stop};
-a[this.selection]=this.bound.eventStop;this.document.removeEvents(a);if(b){this.fireEvent("complete",[this.element,b]);}}});Element.implement({makeResizable:function(a){var b=new Drag(this,Object.merge({modifiers:{x:"width",y:"height"}},a));
-this.store("resizer",b);return b.addEvent("drag",function(){this.fireEvent("resize",b);}.bind(this));}});Drag.Move=new Class({Extends:Drag,options:{droppables:[],container:false,precalculate:false,includeMargins:true,checkDroppables:true},initialize:function(b,a){this.parent(b,a);
-b=this.element;this.droppables=$$(this.options.droppables);this.container=document.id(this.options.container);if(this.container&&typeOf(this.container)!="element"){this.container=document.id(this.container.getDocument().body);
-}if(this.options.style){if(this.options.modifiers.x=="left"&&this.options.modifiers.y=="top"){var c=b.getOffsetParent(),d=b.getStyles("left","top");if(c&&(d.left=="auto"||d.top=="auto")){b.setPosition(b.getPosition(c));
-}}if(b.getStyle("position")=="static"){b.setStyle("position","absolute");}}this.addEvent("start",this.checkDroppables,true);this.overed=null;},start:function(a){if(this.container){this.options.limit=this.calculateLimit();
-}if(this.options.precalculate){this.positions=this.droppables.map(function(b){return b.getCoordinates();});}this.parent(a);},calculateLimit:function(){var j=this.element,e=this.container,d=document.id(j.getOffsetParent())||document.body,h=e.getCoordinates(d),c={},b={},k={},g={},m={};
-["top","right","bottom","left"].each(function(q){c[q]=j.getStyle("margin-"+q).toInt();b[q]=j.getStyle("border-"+q).toInt();k[q]=e.getStyle("margin-"+q).toInt();
-g[q]=e.getStyle("border-"+q).toInt();m[q]=d.getStyle("padding-"+q).toInt();},this);var f=j.offsetWidth+c.left+c.right,p=j.offsetHeight+c.top+c.bottom,i=0,l=0,o=h.right-g.right-f,a=h.bottom-g.bottom-p;
-if(this.options.includeMargins){i+=c.left;l+=c.top;}else{o+=c.right;a+=c.bottom;}if(j.getStyle("position")=="relative"){var n=j.getCoordinates(d);n.left-=j.getStyle("left").toInt();
-n.top-=j.getStyle("top").toInt();i-=n.left;l-=n.top;if(e.getStyle("position")!="relative"){i+=g.left;l+=g.top;}o+=c.left-n.left;a+=c.top-n.top;if(e!=d){i+=k.left+m.left;
-l+=((Browser.ie6||Browser.ie7)?0:k.top)+m.top;}}else{i-=c.left;l-=c.top;if(e!=d){i+=h.left+g.left;l+=h.top+g.top;}}return{x:[i,o],y:[l,a]};},getDroppableCoordinates:function(c){var b=c.getCoordinates();
-if(c.getStyle("position")=="fixed"){var a=window.getScroll();b.left+=a.x;b.right+=a.x;b.top+=a.y;b.bottom+=a.y;}return b;},checkDroppables:function(){var a=this.droppables.filter(function(d,c){d=this.positions?this.positions[c]:this.getDroppableCoordinates(d);
-var b=this.mouse.now;return(b.x>d.left&&b.x<d.right&&b.y<d.bottom&&b.y>d.top);},this).getLast();if(this.overed!=a){if(this.overed){this.fireEvent("leave",[this.element,this.overed]);
-}if(a){this.fireEvent("enter",[this.element,a]);}this.overed=a;}},drag:function(a){this.parent(a);if(this.options.checkDroppables&&this.droppables.length){this.checkDroppables();
-}},stop:function(a){this.checkDroppables();this.fireEvent("drop",[this.element,this.overed,a]);this.overed=null;return this.parent(a);}});Element.implement({makeDraggable:function(a){var b=new Drag.Move(this,a);
-this.store("dragger",b);return b;}});var Sortables=new Class({Implements:[Events,Options],options:{opacity:1,clone:false,revert:false,handle:false,dragOptions:{}},initialize:function(a,b){this.setOptions(b);
-this.elements=[];this.lists=[];this.idle=true;this.addLists($$(document.id(a)||a));if(!this.options.clone){this.options.revert=false;}if(this.options.revert){this.effect=new Fx.Morph(null,Object.merge({duration:250,link:"cancel"},this.options.revert));
-}},attach:function(){this.addLists(this.lists);return this;},detach:function(){this.lists=this.removeLists(this.lists);return this;},addItems:function(){Array.flatten(arguments).each(function(a){this.elements.push(a);
-var b=a.retrieve("sortables:start",function(c){this.start.call(this,c,a);}.bind(this));(this.options.handle?a.getElement(this.options.handle)||a:a).addEvent("mousedown",b);
-},this);return this;},addLists:function(){Array.flatten(arguments).each(function(a){this.lists.include(a);this.addItems(a.getChildren());},this);return this;
-},removeItems:function(){return $$(Array.flatten(arguments).map(function(a){this.elements.erase(a);var b=a.retrieve("sortables:start");(this.options.handle?a.getElement(this.options.handle)||a:a).removeEvent("mousedown",b);
-return a;},this));},removeLists:function(){return $$(Array.flatten(arguments).map(function(a){this.lists.erase(a);this.removeItems(a.getChildren());return a;
-},this));},getClone:function(b,a){if(!this.options.clone){return new Element(a.tagName).inject(document.body);}if(typeOf(this.options.clone)=="function"){return this.options.clone.call(this,b,a,this.list);
-}var c=a.clone(true).setStyles({margin:0,position:"absolute",visibility:"hidden",width:a.getStyle("width")}).addEvent("mousedown",function(d){a.fireEvent("mousedown",d);
-});if(c.get("html").test("radio")){c.getElements("input[type=radio]").each(function(d,e){d.set("name","clone_"+e);if(d.get("checked")){a.getElements("input[type=radio]")[e].set("checked",true);
-}});}return c.inject(this.list).setPosition(a.getPosition(a.getOffsetParent()));},getDroppables:function(){var a=this.list.getChildren().erase(this.clone).erase(this.element);
-if(!this.options.constrain){a.append(this.lists).erase(this.list);}return a;},insert:function(c,b){var a="inside";if(this.lists.contains(b)){this.list=b;
-this.drag.droppables=this.getDroppables();}else{a=this.element.getAllPrevious().contains(b)?"before":"after";}this.element.inject(b,a);this.fireEvent("sort",[this.element,this.clone]);
-},start:function(b,a){if(!this.idle||b.rightClick||["button","input","a","textarea"].contains(b.target.get("tag"))){return;}this.idle=false;this.element=a;
-this.opacity=a.getStyle("opacity");this.list=a.getParent();this.clone=this.getClone(b,a);this.drag=new Drag.Move(this.clone,Object.merge({droppables:this.getDroppables()},this.options.dragOptions)).addEvents({onSnap:function(){b.stop();
-this.clone.setStyle("visibility","visible");this.element.setStyle("opacity",this.options.opacity||0);this.fireEvent("start",[this.element,this.clone]);
-}.bind(this),onEnter:this.insert.bind(this),onCancel:this.end.bind(this),onComplete:this.end.bind(this)});this.clone.inject(this.element,"before");this.drag.start(b);
-},end:function(){this.drag.detach();this.element.setStyle("opacity",this.opacity);if(this.effect){var b=this.element.getStyles("width","height"),d=this.clone,c=d.computePosition(this.element.getPosition(this.clone.getOffsetParent()));
-var a=function(){this.removeEvent("cancel",a);d.destroy();};this.effect.element=d;this.effect.start({top:c.top,left:c.left,width:b.width,height:b.height,opacity:0.25}).addEvent("cancel",a).chain(a);
-}else{this.clone.destroy();}this.reset();},reset:function(){this.idle=true;this.fireEvent("complete",this.element);},serialize:function(){var c=Array.link(arguments,{modifier:Type.isFunction,index:function(d){return d!=null;
-}});var b=this.lists.map(function(d){return d.getChildren().map(c.modifier||function(e){return e.get("id");},this);},this);var a=c.index;if(this.lists.length==1){a=0;
-}return(a||a===0)&&a>=0&&a<this.lists.length?b[a]:b;}});Request.implement({options:{initialDelay:5000,delay:5000,limit:60000},startTimer:function(b){var a=function(){if(!this.running){this.send({data:b});
-}};this.lastDelay=this.options.initialDelay;this.timer=a.delay(this.lastDelay,this);this.completeCheck=function(c){clearTimeout(this.timer);this.lastDelay=(c)?this.options.delay:(this.lastDelay+this.options.delay).min(this.options.limit);
-this.timer=a.delay(this.lastDelay,this);};return this.addEvent("complete",this.completeCheck);},stopTimer:function(){clearTimeout(this.timer);return this.removeEvent("complete",this.completeCheck);
-}});(function(){var a=this.Color=new Type("Color",function(c,d){if(arguments.length>=3){d="rgb";c=Array.slice(arguments,0,3);}else{if(typeof c=="string"){if(c.match(/rgb/)){c=c.rgbToHex().hexToRgb(true);
-}else{if(c.match(/hsb/)){c=c.hsbToRgb();}else{c=c.hexToRgb(true);}}}}d=d||"rgb";switch(d){case"hsb":var b=c;c=c.hsbToRgb();c.hsb=b;break;case"hex":c=c.hexToRgb(true);
-break;}c.rgb=c.slice(0,3);c.hsb=c.hsb||c.rgbToHsb();c.hex=c.rgbToHex();return Object.append(c,this);});a.implement({mix:function(){var b=Array.slice(arguments);
-var d=(typeOf(b.getLast())=="number")?b.pop():50;var c=this.slice();b.each(function(e){e=new a(e);for(var f=0;f<3;f++){c[f]=Math.round((c[f]/100*(100-d))+(e[f]/100*d));
-}});return new a(c,"rgb");},invert:function(){return new a(this.map(function(b){return 255-b;}));},setHue:function(b){return new a([b,this.hsb[1],this.hsb[2]],"hsb");
-},setSaturation:function(b){return new a([this.hsb[0],b,this.hsb[2]],"hsb");},setBrightness:function(b){return new a([this.hsb[0],this.hsb[1],b],"hsb");
-}});this.$RGB=function(e,d,c){return new a([e,d,c],"rgb");};this.$HSB=function(e,d,c){return new a([e,d,c],"hsb");};this.$HEX=function(b){return new a(b,"hex");
-};Array.implement({rgbToHsb:function(){var c=this[0],d=this[1],k=this[2],h=0;var j=Math.max(c,d,k),f=Math.min(c,d,k);var l=j-f;var i=j/255,g=(j!=0)?l/j:0;
-if(g!=0){var e=(j-c)/l;var b=(j-d)/l;var m=(j-k)/l;if(c==j){h=m-b;}else{if(d==j){h=2+e-m;}else{h=4+b-e;}}h/=6;if(h<0){h++;}}return[Math.round(h*360),Math.round(g*100),Math.round(i*100)];
-},hsbToRgb:function(){var d=Math.round(this[2]/100*255);if(this[1]==0){return[d,d,d];}else{var b=this[0]%360;var g=b%60;var h=Math.round((this[2]*(100-this[1]))/10000*255);
-var e=Math.round((this[2]*(6000-this[1]*g))/600000*255);var c=Math.round((this[2]*(6000-this[1]*(60-g)))/600000*255);switch(Math.floor(b/60)){case 0:return[d,c,h];
-case 1:return[e,d,h];case 2:return[h,d,c];case 3:return[h,e,d];case 4:return[c,h,d];case 5:return[d,h,e];}}return false;}});String.implement({rgbToHsb:function(){var b=this.match(/\d{1,3}/g);
-return(b)?b.rgbToHsb():null;},hsbToRgb:function(){var b=this.match(/\d{1,3}/g);return(b)?b.hsbToRgb():null;}});})(); \ No newline at end of file
diff --git a/module/web/media/js/package_ui.js b/module/web/media/js/package_ui.js
deleted file mode 100644
index 3ea965649..000000000
--- a/module/web/media/js/package_ui.js
+++ /dev/null
@@ -1,377 +0,0 @@
-var root = this;
-
-document.addEvent("domready", function() {
- root.load = new Fx.Tween($("load-indicator"), {link: "cancel"});
- root.load.set("opacity", 0);
-
-
- root.packageBox = new MooDialog({destroyOnHide: false});
- root.packageBox.setContent($('pack_box'));
-
- $('pack_reset').addEvent('click', function() {
- $('pack_form').reset();
- root.packageBox.close();
- });
-});
-
-function indicateLoad() {
- //$("load-indicator").reveal();
- root.load.start("opacity", 1)
-}
-
-function indicateFinish() {
- root.load.start("opacity", 0)
-}
-
-function indicateSuccess() {
- indicateFinish();
- root.notify.alert('{{_("Success")}}.', {
- 'className': 'success'
- });
-}
-
-function indicateFail() {
- indicateFinish();
- root.notify.alert('{{_("Failed")}}.', {
- 'className': 'error'
- });
-}
-
-var PackageUI = new Class({
- initialize: function(url, type) {
- this.url = url;
- this.type = type;
- this.packages = [];
- this.parsePackages();
-
- this.sorts = new Sortables($("package-list"), {
- constrain: false,
- clone: true,
- revert: true,
- opacity: 0.4,
- handle: ".package_drag",
- onComplete: this.saveSort.bind(this)
- });
-
- $("del_finished").addEvent("click", this.deleteFinished.bind(this));
- $("restart_failed").addEvent("click", this.restartFailed.bind(this));
-
- },
-
- parsePackages: function() {
- $("package-list").getChildren("li").each(function(ele) {
- var id = ele.getFirst().get("id").match(/[0-9]+/);
- this.packages.push(new Package(this, id, ele))
- }.bind(this))
- },
-
- loadPackages: function() {
- },
-
- deleteFinished: function() {
- indicateLoad();
- new Request.JSON({
- method: 'get',
- url: '/api/deleteFinished',
- onSuccess: function(data) {
- if (data.length > 0) {
- window.location.reload()
- } else {
- this.packages.each(function(pack) {
- pack.close();
- });
- indicateSuccess();
- }
- }.bind(this),
- onFailure: indicateFail
- }).send();
- },
-
- restartFailed: function() {
- indicateLoad();
- new Request.JSON({
- method: 'get',
- url: '/api/restartFailed',
- onSuccess: function(data) {
- this.packages.each(function(pack) {
- pack.close();
- });
- indicateSuccess();
- }.bind(this),
- onFailure: indicateFail
- }).send();
- },
-
- startSort: function(ele, copy) {
- },
-
- saveSort: function(ele, copy) {
- var order = [];
- this.sorts.serialize(function(li, pos) {
- if (li == ele && ele.retrieve("order") != pos) {
- order.push(ele.retrieve("pid") + "|" + pos)
- }
- li.store("order", pos)
- });
- if (order.length > 0) {
- indicateLoad();
- new Request.JSON({
- method: 'get',
- url: '/json/package_order/' + order[0],
- onSuccess: indicateFinish,
- onFailure: indicateFail
- }).send();
- }
- }
-
-});
-
-var Package = new Class({
- initialize: function(ui, id, ele, data) {
- this.ui = ui;
- this.id = id;
- this.linksLoaded = false;
-
- if (!ele) {
- this.createElement(data);
- } else {
- this.ele = ele;
- this.order = ele.getElements("div.order")[0].get("html");
- this.ele.store("order", this.order);
- this.ele.store("pid", this.id);
- this.parseElement();
- }
-
- var pname = this.ele.getElements(".packagename")[0];
- this.buttons = new Fx.Tween(this.ele.getElements(".buttons")[0], {link: "cancel"});
- this.buttons.set("opacity", 0);
-
- pname.addEvent("mouseenter", function(e) {
- this.buttons.start("opacity", 1)
- }.bind(this));
-
- pname.addEvent("mouseleave", function(e) {
- this.buttons.start("opacity", 0)
- }.bind(this));
-
-
- },
-
- createElement: function() {
- alert("create")
- },
-
- parseElement: function() {
- var imgs = this.ele.getElements('img');
-
- this.name = this.ele.getElements('.name')[0];
- this.folder = this.ele.getElements('.folder')[0];
- this.password = this.ele.getElements('.password')[0];
-
- imgs[1].addEvent('click', this.deletePackage.bind(this));
- imgs[2].addEvent('click', this.restartPackage.bind(this));
- imgs[3].addEvent('click', this.editPackage.bind(this));
- imgs[4].addEvent('click', this.movePackage.bind(this));
-
- this.ele.getElement('.packagename').addEvent('click', this.toggle.bind(this));
-
- },
-
- loadLinks: function() {
- indicateLoad();
- new Request.JSON({
- method: 'get',
- url: '/json/package/' + this.id,
- onSuccess: this.createLinks.bind(this),
- onFailure: indicateFail
- }).send();
- },
-
- createLinks: function(data) {
- var ul = $("sort_children_{id}".substitute({"id": this.id}));
- ul.set("html", "");
- data.links.each(function(link) {
- link.id = link.fid;
- var li = new Element("li", {
- "style": {
- "margin-left": 0
- }
- });
-
- var html = "<span style='cursor: move' class='child_status sorthandle'><img src='/media/default/img/{icon}' style='width: 12px; height:12px;'/></span>\n".substitute({"icon": link.icon});
- html += "<span style='font-size: 15px'>{name}</span><br /><div class='child_secrow'>".substitute({"name": link.name});
- html += "<span class='child_status'>{statusmsg}</span>{error}&nbsp;".substitute({"statusmsg": link.statusmsg, "error":link.error});
- html += "<span class='child_status'>{format_size}</span>".substitute({"format_size": link.format_size});
- html += "<span class='child_status'>{plugin}</span>&nbsp;&nbsp;".substitute({"plugin": link.plugin});
- html += "<img title='{{_("Delete Link")}}' style='cursor: pointer;' width='10px' height='10px' src='/media/default/img/delete.png' />&nbsp;&nbsp;";
- html += "<img title='{{_("Restart Link")}}' style='cursor: pointer;margin-left: -4px' width='10px' height='10px' src='/media/default/img/arrow_refresh.png' /></div>";
-
- var div = new Element("div", {
- "id": "file_" + link.id,
- "class": "child",
- "html": html
- });
-
- li.store("order", link.order);
- li.store("lid", link.id);
-
- li.adopt(div);
- ul.adopt(li);
- });
- this.sorts = new Sortables(ul, {
- constrain: false,
- clone: true,
- revert: true,
- opacity: 0.4,
- handle: ".sorthandle",
- onComplete: this.saveSort.bind(this)
- });
- this.registerLinkEvents();
- this.linksLoaded = true;
- indicateFinish();
- this.toggle();
- },
-
- registerLinkEvents: function() {
- this.ele.getElements('.child').each(function(child) {
- var lid = child.get('id').match(/[0-9]+/);
- var imgs = child.getElements('.child_secrow img');
- imgs[0].addEvent('click', function(e) {
- new Request({
- method: 'get',
- url: '/api/deleteFiles/[' + this + "]",
- onSuccess: function() {
- $('file_' + this).nix()
- }.bind(this),
- onFailure: indicateFail
- }).send();
- }.bind(lid));
-
- imgs[1].addEvent('click', function(e) {
- new Request({
- method: 'get',
- url: '/api/restartFile/' + this,
- onSuccess: function() {
- var ele = $('file_' + this);
- var imgs = ele.getElements("img");
- imgs[0].set("src", "/media/default/img/status_queue.png");
- var spans = ele.getElements(".child_status");
- spans[1].set("html", "queued");
- indicateSuccess();
- }.bind(this),
- onFailure: indicateFail
- }).send();
- }.bind(lid));
- });
- },
-
- toggle: function() {
- var child = this.ele.getElement('.children');
- if (child.getStyle('display') == "block") {
- child.dissolve();
- } else {
- if (!this.linksLoaded) {
- this.loadLinks();
- } else {
- child.reveal();
- }
- }
- },
-
-
- deletePackage: function(event) {
- indicateLoad();
- new Request({
- method: 'get',
- url: '/api/deletePackages/[' + this.id + "]",
- onSuccess: function() {
- this.ele.nix();
- indicateFinish();
- }.bind(this),
- onFailure: indicateFail
- }).send();
- //hide_pack();
- event.stop();
- },
-
- restartPackage: function(event) {
- indicateLoad();
- new Request({
- method: 'get',
- url: '/api/restartPackage/' + this.id,
- onSuccess: function() {
- this.close();
- indicateSuccess();
- }.bind(this),
- onFailure: indicateFail
- }).send();
- event.stop();
- },
-
- close: function() {
- var child = this.ele.getElement('.children');
- if (child.getStyle('display') == "block") {
- child.dissolve();
- }
- var ul = $("sort_children_{id}".substitute({"id": this.id}));
- ul.erase("html");
- this.linksLoaded = false;
- },
-
- movePackage: function(event) {
- indicateLoad();
- new Request({
- method: 'get',
- url: '/json/move_package/' + ((this.ui.type + 1) % 2) + "/" + this.id,
- onSuccess: function() {
- this.ele.nix();
- indicateFinish();
- }.bind(this),
- onFailure: indicateFail
- }).send();
- event.stop();
- },
-
- editPackage: function(event) {
- $("pack_form").removeEvents("submit");
- $("pack_form").addEvent("submit", this.savePackage.bind(this));
-
- $("pack_id").set("value", this.id);
- $("pack_name").set("value", this.name.get("text"));
- $("pack_folder").set("value", this.folder.get("text"));
- $("pack_pws").set("value", this.password.get("text"));
-
- root.packageBox.open();
- event.stop();
- },
-
- savePackage: function(event) {
- $("pack_form").send();
- this.name.set("text", $("pack_name").get("value"));
- this.folder.set("text", $("pack_folder").get("value"));
- this.password.set("text", $("pack_pws").get("value"));
- root.packageBox.close();
- event.stop();
- },
-
- saveSort: function(ele, copy) {
- var order = [];
- this.sorts.serialize(function(li, pos) {
- if (li == ele && ele.retrieve("order") != pos) {
- order.push(ele.retrieve("lid") + "|" + pos)
- }
- li.store("order", pos)
- });
- if (order.length > 0) {
- indicateLoad();
- new Request.JSON({
- method: 'get',
- url: '/json/link_order/' + order[0],
- onSuccess: indicateFinish,
- onFailure: indicateFail
- }).send();
- }
- }
-
-});
-
diff --git a/module/web/media/js/purr_static.js b/module/web/media/js/purr_static.js
deleted file mode 100644
index 7e0aee949..000000000
--- a/module/web/media/js/purr_static.js
+++ /dev/null
@@ -1,308 +0,0 @@
-/*
----
-script: purr.js
-
-description: Class to create growl-style popup notifications.
-
-license: MIT-style
-
-authors: [atom smith]
-
-requires:
-- core/1.3: [Core, Browser, Array, Function, Number, String, Hash, Event, Class.Extras, Element.Event, Element.Style, Element.Dimensions, Fx.CSS, FX.Tween, Fx.Morph]
-
-provides: [Purr, Element.alert]
-...
-*/
-
-
-var Purr = new Class({
-
- 'options': {
- 'mode': 'top',
- 'position': 'left',
- 'elementAlertClass': 'purr-element-alert',
- 'elements': {
- 'wrapper': 'div',
- 'alert': 'div',
- 'buttonWrapper': 'div',
- 'button': 'button'
- },
- 'elementOptions': {
- 'wrapper': {
- 'styles': {
- 'position': 'fixed',
- 'z-index': '9999'
- },
- 'class': 'purr-wrapper'
- },
- 'alert': {
- 'class': 'purr-alert',
- 'styles': {
- 'opacity': '.85'
- }
- },
- 'buttonWrapper': {
- 'class': 'purr-button-wrapper'
- },
- 'button': {
- 'class': 'purr-button'
- }
- },
- 'alert': {
- 'buttons': [],
- 'clickDismiss': true,
- 'hoverWait': true,
- 'hideAfter': 5000,
- 'fx': {
- 'duration': 500
- },
- 'highlightRepeat': false,
- 'highlight': { // false to disable highlighting
- 'start': '#FF0',
- 'end': false
- }
- }
- },
-
- 'Implements': [Options, Events, Chain],
-
- 'initialize': function(options){
- this.setOptions(options);
- this.createWrapper();
- return this;
- },
-
- 'bindAlert': function(){
- return this.alert.bind(this);
- },
-
- 'createWrapper': function(){
- this.wrapper = new Element(this.options.elements.wrapper, this.options.elementOptions.wrapper);
- if(this.options.mode == 'top')
- {
- this.wrapper.setStyle('top', 0);
- }
- else
- {
- this.wrapper.setStyle('bottom', 0);
- }
- document.id(document.body).grab(this.wrapper);
- this.positionWrapper(this.options.position);
- },
-
- 'positionWrapper': function(position){
- if(typeOf(position) == 'object')
- {
-
- var wrapperCoords = this.getWrapperCoords();
-
- this.wrapper.setStyles({
- 'bottom': '',
- 'left': position.x,
- 'top': position.y - wrapperCoords.height,
- 'position': 'absolute'
- });
- }
- else if(position == 'left')
- {
- this.wrapper.setStyle('left', 0);
- }
- else if(position == 'right')
- {
- this.wrapper.setStyle('right', 0);
- }
- else
- {
- this.wrapper.setStyle('left', (window.innerWidth / 2) - (this.getWrapperCoords().width / 2));
- }
- return this;
- },
-
- 'getWrapperCoords': function(){
- this.wrapper.setStyle('visibility', 'hidden');
- var measurer = this.alert('need something in here to measure');
- var coords = this.wrapper.getCoordinates();
- measurer.destroy();
- this.wrapper.setStyle('visibility','');
- return coords;
- },
-
- 'alert': function(msg, options){
-
- options = Object.merge({}, this.options.alert, options || {});
-
- var alert = new Element(this.options.elements.alert, this.options.elementOptions.alert);
-
- if(typeOf(msg) == 'string')
- {
- alert.set('html', msg);
- }
- else if(typeOf(msg) == 'element')
- {
- alert.grab(msg);
- }
- else if(typeOf(msg) == 'array')
- {
- var alerts = [];
- msg.each(function(m){
- alerts.push(this.alert(m, options));
- }, this);
- return alerts;
- }
-
- alert.store('options', options);
-
- if(options.buttons.length > 0)
- {
- options.clickDismiss = false;
- options.hideAfter = false;
- options.hoverWait = false;
- var buttonWrapper = new Element(this.options.elements.buttonWrapper, this.options.elementOptions.buttonWrapper);
- alert.grab(buttonWrapper);
- options.buttons.each(function(button){
- if(button.text !== undefined)
- {
- var callbackButton = new Element(this.options.elements.button, this.options.elementOptions.button);
- callbackButton.set('html', button.text);
- if(button.callback !== undefined)
- {
- callbackButton.addEvent('click', button.callback.pass(alert));
- }
- if(button.dismiss !== undefined && button.dismiss)
- {
- callbackButton.addEvent('click', this.dismiss.pass(alert, this));
- }
- buttonWrapper.grab(callbackButton);
- }
- }, this);
- }
- if(options.className !== undefined)
- {
- alert.addClass(options.className);
- }
-
- this.wrapper.grab(alert, (this.options.mode == 'top') ? 'bottom' : 'top');
-
- var fx = Object.merge(this.options.alert.fx, options.fx);
- var alertFx = new Fx.Morph(alert, fx);
- alert.store('fx', alertFx);
- this.fadeIn(alert);
-
- if(options.highlight)
- {
- alertFx.addEvent('complete', function(){
- alert.highlight(options.highlight.start, options.highlight.end);
- if(options.highlightRepeat)
- {
- alert.highlight.periodical(options.highlightRepeat, alert, [options.highlight.start, options.highlight.end]);
- }
- });
- }
- if(options.hideAfter)
- {
- this.dismiss(alert);
- }
-
- if(options.clickDismiss)
- {
- alert.addEvent('click', function(){
- this.holdUp = false;
- this.dismiss(alert, true);
- }.bind(this));
- }
-
- if(options.hoverWait)
- {
- alert.addEvents({
- 'mouseenter': function(){
- this.holdUp = true;
- }.bind(this),
- 'mouseleave': function(){
- this.holdUp = false;
- }.bind(this)
- });
- }
-
- return alert;
- },
-
- 'fadeIn': function(alert){
- var alertFx = alert.retrieve('fx');
- alertFx.set({
- 'opacity': 0
- });
- alertFx.start({
- 'opacity': [this.options.elementOptions.alert.styles.opacity, '.9'].pick()
- });
- },
-
- 'dismiss': function(alert, now){
- now = now || false;
- var options = alert.retrieve('options');
- if(now)
- {
- this.fadeOut(alert);
- }
- else
- {
- this.fadeOut.delay(options.hideAfter, this, alert);
- }
- },
-
- 'fadeOut': function(alert){
- if(this.holdUp)
- {
- this.dismiss.delay(100, this, [alert, true]);
- return null;
- }
- var alertFx = alert.retrieve('fx');
- if(!alertFx)
- {
- return null;
- }
- var to = {
- 'opacity': 0
- };
- if(this.options.mode == 'top')
- {
- to['margin-top'] = '-'+alert.offsetHeight+'px';
- }
- else
- {
- to['margin-bottom'] = '-'+alert.offsetHeight+'px';
- }
- alertFx.start(to);
- alertFx.addEvent('complete', function(){
- alert.destroy();
- });
- }
-});
-
-Element.implement({
-
- 'alert': function(msg, options){
- var alert = this.retrieve('alert');
- if(!alert)
- {
- options = options || {
- 'mode':'top'
- };
- alert = new Purr(options);
- this.store('alert', alert);
- }
-
- var coords = this.getCoordinates();
-
- alert.alert(msg, options);
-
- alert.wrapper.setStyles({
- 'bottom': '',
- 'left': (coords.left - (alert.wrapper.getWidth() / 2)) + (this.getWidth() / 2),
- 'top': coords.top - (alert.wrapper.getHeight()),
- 'position': 'absolute'
- });
-
- }
-
-}); \ No newline at end of file
diff --git a/module/web/media/js/settings.coffee b/module/web/media/js/settings.coffee
deleted file mode 100644
index 9205233e3..000000000
--- a/module/web/media/js/settings.coffee
+++ /dev/null
@@ -1,107 +0,0 @@
-root = this
-
-window.addEvent 'domready', ->
- root.accountDialog = new MooDialog {destroyOnHide: false}
- root.accountDialog.setContent $ 'account_box'
-
- new TinyTab $$('#toptabs li a'), $$('#tabs-body > span')
-
- $$('ul.nav').each (nav) ->
- new MooDropMenu nav, {
- onOpen: (el) -> el.fade 'in'
- onClose: (el) -> el.fade 'out'
- onInitialize: (el) -> el.fade('hide').set 'tween', {duration:500}
- }
-
- new SettingsUI()
-
-
-class SettingsUI
- constructor: ->
- @menu = $$ "#general-menu li"
- @menu.append $$ "#plugin-menu li"
-
- @name = $ "tabsback"
- @general = $ "general_form_content"
- @plugin = $ "plugin_form_content"
-
- el.addEvent 'click', @menuClick.bind(this) for el in @menu
-
- $("general|submit").addEvent "click", @configSubmit.bind(this)
- $("plugin|submit").addEvent "click", @configSubmit.bind(this)
-
- $("account_add").addEvent "click", (e) ->
- root.accountDialog.open()
- e.stop()
-
- $("account_reset").addEvent "click", (e) ->
- root.accountDialog.close()
-
- $("account_add_button").addEvent "click", @addAccount.bind(this)
- $("account_submit").addEvent "click", @submitAccounts.bind(this)
-
-
- menuClick: (e) ->
- [category, section] = e.target.get("id").split("|")
- name = e.target.get "text"
-
-
- target = if category is "general" then @general else @plugin
- target.dissolve()
-
- new Request({
- "method" : "get"
- "url" : "/json/load_config/#{category}/#{section}"
- "onSuccess": (data) =>
- target.set "html", data
- target.reveal()
- this.name.set "text", name
- }).send()
-
-
- configSubmit: (e) ->
- category = e.target.get("id").split("|")[0];
- form = $("#{category}_form");
-
- form.set "send", {
- "method": "post"
- "url": "/json/save_config/#{category}"
- "onSuccess" : ->
- root.notify.alert '{{ _("Settings saved.")}}', {
- 'className': 'success'
- }
- "onFailure": ->
- root.notify.alert '{{ _("Error occured.")}}', {
- 'className': 'error'
- }
- }
- form.send()
- e.stop()
-
- addAccount: (e) ->
- form = $ "add_account_form"
- form.set "send", {
- "method": "post"
- "onSuccess" : -> window.location.reload()
- "onFailure": ->
- root.notify.alert '{{_("Error occured.")}}', {
- 'className': 'error'
- }
- }
-
- form.send()
- e.stop()
-
- submitAccounts: (e) ->
- form = $ "account_form"
- form.set "send", {
- "method": "post",
- "onSuccess" : -> window.location.reload()
- "onFailure": ->
- root.notify.alert('{{ _("Error occured.") }}', {
- 'className': 'error'
- });
- }
-
- form.send()
- e.stop() \ No newline at end of file
diff --git a/module/web/media/js/settings.js b/module/web/media/js/settings.js
deleted file mode 100644
index 9191fac72..000000000
--- a/module/web/media/js/settings.js
+++ /dev/null
@@ -1,3 +0,0 @@
-{% autoescape true %}
-var SettingsUI,root;var __bind=function(a,b){return function(){return a.apply(b,arguments)}};root=this;window.addEvent("domready",function(){root.accountDialog=new MooDialog({destroyOnHide:false});root.accountDialog.setContent($("account_box"));new TinyTab($$("#toptabs li a"),$$("#tabs-body > span"));$$("ul.nav").each(function(a){return new MooDropMenu(a,{onOpen:function(b){return b.fade("in")},onClose:function(b){return b.fade("out")},onInitialize:function(b){return b.fade("hide").set("tween",{duration:500})}})});return new SettingsUI()});SettingsUI=(function(){function a(){var c,e,b,d;this.menu=$$("#general-menu li");this.menu.append($$("#plugin-menu li"));this.name=$("tabsback");this.general=$("general_form_content");this.plugin=$("plugin_form_content");d=this.menu;for(e=0,b=d.length;e<b;e++){c=d[e];c.addEvent("click",this.menuClick.bind(this))}$("general|submit").addEvent("click",this.configSubmit.bind(this));$("plugin|submit").addEvent("click",this.configSubmit.bind(this));$("account_add").addEvent("click",function(f){root.accountDialog.open();return f.stop()});$("account_reset").addEvent("click",function(f){return root.accountDialog.close()});$("account_add_button").addEvent("click",this.addAccount.bind(this));$("account_submit").addEvent("click",this.submitAccounts.bind(this))}a.prototype.menuClick=function(h){var c,b,g,f,d;d=h.target.get("id").split("|"),c=d[0],g=d[1];b=h.target.get("text");f=c==="general"?this.general:this.plugin;f.dissolve();return new Request({method:"get",url:"/json/load_config/"+c+"/"+g,onSuccess:__bind(function(e){f.set("html",e);f.reveal();return this.name.set("text",b)},this)}).send()};a.prototype.configSubmit=function(d){var c,b;c=d.target.get("id").split("|")[0];b=$(""+c+"_form");b.set("send",{method:"post",url:"/json/save_config/"+c,onSuccess:function(){return root.notify.alert('{{ _("Settings saved.")}}',{className:"success"})},onFailure:function(){return root.notify.alert('{{ _("Error occured.")}}',{className:"error"})}});b.send();return d.stop()};a.prototype.addAccount=function(c){var b;b=$("add_account_form");b.set("send",{method:"post",onSuccess:function(){return window.location.reload()},onFailure:function(){return root.notify.alert('{{_("Error occured.")}}',{className:"error"})}});b.send();return c.stop()};a.prototype.submitAccounts=function(c){var b;b=$("account_form");b.set("send",{method:"post",onSuccess:function(){return window.location.reload()},onFailure:function(){return root.notify.alert('{{ _("Error occured.") }}',{className:"error"})}});b.send();return c.stop()};return a})();
-{% endautoescape %} \ No newline at end of file
diff --git a/module/web/media/js/tinytab_static.js b/module/web/media/js/tinytab_static.js
deleted file mode 100644
index 6c38292f5..000000000
--- a/module/web/media/js/tinytab_static.js
+++ /dev/null
@@ -1,50 +0,0 @@
-/*
----
-description: TinyTab - Tiny and simple tab handler for Mootools.
-
-license: MIT-style
-
-authors:
-- Danillo César de O. Melo
-
-requires:
-- core/1.2.4: '*'
-
-provides: TinyTab
-
-...
-*/
-(function($) {
- this.TinyTab = new Class({
- Implements: Events,
- initialize: function(tabs, contents, opt) {
- this.tabs = tabs;
- this.contents = contents;
- this.header = $("tabsback");
- this.headers = [];
- for(var i =0; i < this.tabs.length; i++){
- this.headers.push("");
- }
- if(!opt) opt = {};
- this.css = opt.selectedClass || 'selected';
- this.select(this.tabs[0]);
- tabs.each(function(el){
- el.addEvent('click',function(e){
- this.select(el);
- e.stop();
- }.bind(this));
- }.bind(this));
- },
-
- select: function(el) {
- this.tabs.removeClass(this.css);
- el.addClass(this.css);
- this.contents.setStyle('display','none');
- var index = this.tabs.indexOf(el);
- this.header.set("text", this.headers[index]);
- var content = this.contents[index];
- content.setStyle('display','block');
- this.fireEvent('change',[content,el]);
- }
- });
-})(document.id); \ No newline at end of file
diff --git a/module/web/middlewares.py b/module/web/middlewares.py
index e0e6c3102..3cf49a8fc 100644
--- a/module/web/middlewares.py
+++ b/module/web/middlewares.py
@@ -31,9 +31,6 @@ class PrefixMiddleware(object):
# (c) 2005 Ian Bicking and contributors; written for Paste (http://pythonpaste.org)
# Licensed under the MIT license: http://www.opensource.org/licenses/mit-license.php
-# (c) 2005 Ian Bicking and contributors; written for Paste (http://pythonpaste.org)
-# Licensed under the MIT license: http://www.opensource.org/licenses/mit-license.php
-
# WSGI middleware
# Gzip-encodes the response.
@@ -90,14 +87,15 @@ class GzipResponse(object):
cl = int(cl)
else:
cl = 201
- self.compressible = False
- if ct and (ct.startswith('text/') or ct.startswith('application/')) \
- and 'zip' not in ct and cl > 200:
- self.compressible = True
+
if ce:
self.compressible = False
- if self.compressible:
+ elif ct and (ct.startswith('text/') or ct.startswith('application/')) \
+ and 'zip' not in ct and 200 < cl < 1024*1024:
+ self.compressible = True
headers.append(('content-encoding', 'gzip'))
+ headers.append(('vary', 'Accept-Encoding'))
+
remove_header(headers, 'content-length')
self.headers = headers
self.status = status
diff --git a/module/web/pyload_app.py b/module/web/pyload_app.py
index df4a4b3d4..8401e1778 100644
--- a/module/web/pyload_app.py
+++ b/module/web/pyload_app.py
@@ -16,74 +16,51 @@
@author: RaNaN
"""
-from datetime import datetime
-from operator import itemgetter, attrgetter
-
import time
-import os
-import sys
-from os import listdir
-from os.path import isdir, isfile, join, abspath
-from sys import getfilesystemencoding
-from urllib import unquote
+from os.path import join
from bottle import route, static_file, request, response, redirect, HTTPError, error
-from webinterface import PYLOAD, PYLOAD_DIR, PROJECT_DIR, SETUP, env
-
-from utils import render_to_response, parse_permissions, parse_userdata, \
- login_required, get_permission, set_permission, permlist, toDict, set_session
+from webinterface import PYLOAD, PROJECT_DIR, SETUP, env
-from filters import relpath, unquotepath
+from utils import render_to_response, login_required, set_session, get_user_api, is_mobile
-from module.utils import formatSize, save_join, fs_encode, fs_decode
+##########
# Helper
+##########
+# TODO: useful but needs a rewrite, too
def pre_processor():
s = request.environ.get('beaker.session')
- user = parse_userdata(s)
- perms = parse_permissions(s)
- status = {}
- captcha = False
- update = False
- plugins = False
- if user["is_authenticated"]:
- status = PYLOAD.statusServer()
- info = PYLOAD.getInfoByPlugin("UpdateManager")
- captcha = PYLOAD.isCaptchaWaiting()
-
- # check if update check is available
- if info:
- if info["pyload"] == "True": update = True
- if info["plugins"] == "True": plugins = True
+ api = get_user_api(s)
+ user = None
+ status = None
+ if api is not None:
+ user = api.user
+ status = api.statusServer()
return {"user": user,
- 'status': status,
- 'captcha': captcha,
- 'perms': perms,
- 'url': request.url,
- 'update': update,
- 'plugins': plugins}
+ 'server': status,
+ 'url': request.url }
def base(messages):
return render_to_response('base.html', {'messages': messages}, [pre_processor])
-## Views
@error(500)
def error500(error):
- print "An error occured while processing the request."
+ print "An error occurred while processing the request."
if error.traceback:
print error.traceback
- return base(["An Error occured, please enable debug mode to get more details.", error,
+ return base(["An error occurred while processing the request.", error,
error.traceback.replace("\n", "<br>") if error.traceback else "No Traceback"])
-# render js
-@route("/media/js/<path:re:.+\.js>")
+# TODO: not working
+# @route("/static/js/<path:re:.+\.js>")
def js_dynamic(path):
response.headers['Expires'] = time.strftime("%a, %d %b %Y %H:%M:%S GMT",
time.gmtime(time.time() + 60 * 60 * 24 * 2))
@@ -92,442 +69,80 @@ def js_dynamic(path):
try:
# static files are not rendered
- if "static" not in path and "mootools" not in path:
+ if "static" not in path:
t = env.get_template("js/%s" % path)
return t.render()
else:
- return static_file(path, root=join(PROJECT_DIR, "media", "js"))
+ return static_file(path, root=join(PROJECT_DIR, "static", "js"))
except:
return HTTPError(404, "Not Found")
-@route('/media/<path:path>')
+@route('/static/<path:path>')
def server_static(path):
response.headers['Expires'] = time.strftime("%a, %d %b %Y %H:%M:%S GMT",
time.gmtime(time.time() + 60 * 60 * 24 * 7))
response.headers['Cache-control'] = "public"
- return static_file(path, root=join(PROJECT_DIR, "media"))
+ return static_file(path, root=join(PROJECT_DIR, "static"))
+
+@route('/templates/<path:path>')
+def serve_template(path):
+ """ Serve backbone templates """
+ args = path.split("/")
+ args.insert(1, "backbone")
+ return static_file("/".join(args), root=join(PROJECT_DIR, "templates"))
@route('/favicon.ico')
def favicon():
- return static_file("favicon.ico", root=join(PROJECT_DIR, "media", "img"))
+ return static_file("favicon.ico", root=join(PROJECT_DIR, "static", "img"))
+
+
+##########
+# Views
+##########
@route('/login', method="GET")
def login():
+ # set mobilecookie to reduce is_mobile check-time
+ response.set_cookie("mobile", str(is_mobile()))
if not PYLOAD and SETUP:
redirect("/setup")
else:
return render_to_response("login.html", proc=[pre_processor])
-
@route('/nopermission')
def nopermission():
- return base([_("You dont have permission to access this page.")])
+ return base([_("You don't have permission to access this page.")])
@route("/login", method="POST")
def login_post():
- user = request.forms.get("username")
+ username = request.forms.get("username")
password = request.forms.get("password")
-
- info = PYLOAD.checkAuth(user, password)
-
- if not info:
+ user = PYLOAD.checkAuth(username, password)
+ if not user:
return render_to_response("login.html", {"errors": True}, [pre_processor])
-
- set_session(request, info)
+ set_session(request, user)
return redirect("/")
+@route("/toggle_mobile")
+def toggle_mobile():
+ response.set_cookie("mobile", str(not is_mobile()))
+ return redirect("/")
@route("/logout")
def logout():
s = request.environ.get('beaker.session')
s.delete()
- return render_to_response("logout.html", proc=[pre_processor])
-
+ return render_to_response("login.html", {"logout": True}, proc=[pre_processor])
@route("/")
-@route("/home")
-@login_required("LIST")
-def home():
- try:
- res = [toDict(x) for x in PYLOAD.statusDownloads()]
- except:
- s = request.environ.get('beaker.session')
- s.delete()
- return redirect("/login")
-
- for link in res:
- if link["status"] == 12:
- link["information"] = "%s kB @ %s kB/s" % (link["size"] - link["bleft"], link["speed"])
-
- return render_to_response("home.html", {"res": res}, [pre_processor])
-
-
-@route("/queue")
-@login_required("LIST")
-def queue():
- queue = PYLOAD.getQueue()
-
- queue.sort(key=attrgetter("order"))
-
- return render_to_response('queue.html', {'content': queue, 'target': 1}, [pre_processor])
-
-
-@route("/collector")
-@login_required('LIST')
-def collector():
- queue = PYLOAD.getCollector()
-
- queue.sort(key=attrgetter("order"))
-
- return render_to_response('queue.html', {'content': queue, 'target': 0}, [pre_processor])
-
-
-@route("/downloads")
-@login_required('DOWNLOAD')
-def downloads():
- root = PYLOAD.getConfigValue("general", "download_folder")
-
- if not isdir(root):
- return base([_('Download directory not found.')])
- data = {
- 'folder': [],
- 'files': []
- }
-
- items = listdir(fs_encode(root))
-
- for item in sorted([fs_decode(x) for x in items]):
- if isdir(save_join(root, item)):
- folder = {
- 'name': item,
- 'path': item,
- 'files': []
- }
- files = listdir(save_join(root, item))
- for file in sorted([fs_decode(x) for x in files]):
- try:
- if isfile(save_join(root, item, file)):
- folder['files'].append(file)
- except:
- pass
-
- data['folder'].append(folder)
- elif isfile(join(root, item)):
- data['files'].append(item)
-
- return render_to_response('downloads.html', {'files': data}, [pre_processor])
-
-
-@route("/downloads/get/<path:re:.+>")
-@login_required("DOWNLOAD")
-def get_download(path):
- path = unquote(path).decode("utf8")
- #@TODO some files can not be downloaded
-
- root = PYLOAD.getConfigValue("general", "download_folder")
-
- path = path.replace("..", "")
- try:
- return static_file(fs_encode(path), fs_encode(root))
-
- except Exception, e:
- print e
- return HTTPError(404, "File not Found.")
-
-
+@login_required()
+def index(api):
+ return render_to_response("dashboard.html", proc=[pre_processor])
@route("/settings")
-@login_required('SETTINGS')
-def config():
- conf = PYLOAD.getConfig()
- plugin = PYLOAD.getPluginConfig()
-
- conf_menu = []
- plugin_menu = []
-
- for entry in sorted(conf.keys()):
- conf_menu.append((entry, conf[entry].description))
-
- for entry in sorted(plugin.keys()):
- plugin_menu.append((entry, plugin[entry].description))
-
- accs = PYLOAD.getAccounts(False)
-
- for data in accs:
- if data.trafficleft == -1:
- data.trafficleft = _("unlimited")
- elif not data.trafficleft:
- data.trafficleft = _("not available")
- else:
- data.trafficleft = formatSize(data.trafficleft * 1024)
-
- if data.validuntil == -1:
- data.validuntil = _("unlimited")
- elif not data.validuntil :
- data.validuntil = _("not available")
- else:
- t = time.localtime(data.validuntil)
- data.validuntil = time.strftime("%d.%m.%Y", t)
-
- if "time" in data.options:
- try:
- data.options["time"] = data.options["time"][0]
- except:
- data.options["time"] = "0:00-0:00"
-
- if "limitDL" in data.options:
- data.options["limitdl"] = data.options["limitDL"][0]
- else:
- data.options["limitdl"] = "0"
-
- return render_to_response('settings.html',
- {'conf': {'plugin': plugin_menu, 'general': conf_menu, 'accs': accs}, 'types': PYLOAD.getAccountTypes()},
- [pre_processor])
-
+@login_required()
+def settings(api):
+ return render_to_response("settings.html", proc=[pre_processor])
-@route("/filechooser")
-@route("/pathchooser")
-@route("/filechooser/:file#.+#")
-@route("/pathchooser/:path#.+#")
-@login_required('STATUS')
-def path(file="", path=""):
- if file:
- type = "file"
- else:
- type = "folder"
-
- path = os.path.normpath(unquotepath(path))
-
- if os.path.isfile(path):
- oldfile = path
- path = os.path.dirname(path)
- else:
- oldfile = ''
-
- abs = False
-
- if os.path.isdir(path):
- if os.path.isabs(path):
- cwd = os.path.abspath(path)
- abs = True
- else:
- cwd = relpath(path)
- else:
- cwd = os.getcwd()
-
- try:
- cwd = cwd.encode("utf8")
- except:
- pass
-
- cwd = os.path.normpath(os.path.abspath(cwd))
- parentdir = os.path.dirname(cwd)
- if not abs:
- if os.path.abspath(cwd) == "/":
- cwd = relpath(cwd)
- else:
- cwd = relpath(cwd) + os.path.sep
- parentdir = relpath(parentdir) + os.path.sep
-
- if os.path.abspath(cwd) == "/":
- parentdir = ""
-
- try:
- folders = os.listdir(cwd)
- except:
- folders = []
-
- files = []
-
- for f in folders:
- try:
- f = f.decode(getfilesystemencoding())
- data = {'name': f, 'fullpath': join(cwd, f)}
- data['sort'] = data['fullpath'].lower()
- data['modified'] = datetime.fromtimestamp(int(os.path.getmtime(join(cwd, f))))
- data['ext'] = os.path.splitext(f)[1]
- except:
- continue
-
- if os.path.isdir(join(cwd, f)):
- data['type'] = 'dir'
- else:
- data['type'] = 'file'
-
- if os.path.isfile(join(cwd, f)):
- data['size'] = os.path.getsize(join(cwd, f))
-
- power = 0
- while (data['size'] / 1024) > 0.3:
- power += 1
- data['size'] /= 1024.
- units = ('', 'K', 'M', 'G', 'T')
- data['unit'] = units[power] + 'Byte'
- else:
- data['size'] = ''
-
- files.append(data)
-
- files = sorted(files, key=itemgetter('type', 'sort'))
-
- return render_to_response('pathchooser.html',
- {'cwd': cwd, 'files': files, 'parentdir': parentdir, 'type': type, 'oldfile': oldfile,
- 'absolute': abs}, [])
-
-
-@route("/logs")
-@route("/logs", method="POST")
-@route("/logs/:item")
-@route("/logs/:item", method="POST")
-@login_required('LOGS')
-def logs(item=-1):
- s = request.environ.get('beaker.session')
-
- perpage = s.get('perpage', 34)
- reversed = s.get('reversed', False)
-
- warning = ""
- conf = PYLOAD.getConfigValue("log","file_log")
- if not conf:
- warning = "Warning: File log is disabled, see settings page."
-
- perpage_p = ((20, 20), (34, 34), (40, 40), (100, 100), (0, 'all'))
- fro = None
-
- if request.environ.get('REQUEST_METHOD', "GET") == "POST":
- try:
- fro = datetime.strptime(request.forms['from'], '%d.%m.%Y %H:%M:%S')
- except:
- pass
- try:
- perpage = int(request.forms['perpage'])
- s['perpage'] = perpage
-
- reversed = bool(request.forms.get('reversed', False))
- s['reversed'] = reversed
- except:
- pass
-
- s.save()
-
- try:
- item = int(item)
- except:
- pass
-
- log = PYLOAD.getLog()
- if not perpage:
- item = 0
-
- if item < 1 or type(item) is not int:
- item = 1 if len(log) - perpage + 1 < 1 else len(log) - perpage + 1
-
- if type(fro) is datetime: # we will search for datetime
- item = -1
-
- data = []
- counter = 0
- perpagecheck = 0
- for l in log:
- counter += 1
-
- if counter >= item:
- try:
- date, time, level, message = l.decode("utf8", "ignore").split(" ", 3)
- dtime = datetime.strptime(date + ' ' + time, '%d.%m.%Y %H:%M:%S')
- except:
- dtime = None
- date = '?'
- time = ' '
- level = '?'
- message = l
- if item == -1 and dtime is not None and fro <= dtime:
- item = counter #found our datetime
- if item >= 0:
- data.append({'line': counter, 'date': date + " " + time, 'level': level, 'message': message})
- perpagecheck += 1
- if fro is None and dtime is not None: #if fro not set set it to first showed line
- fro = dtime
- if perpagecheck >= perpage > 0:
- break
-
- if fro is None: #still not set, empty log?
- fro = datetime.now()
- if reversed:
- data.reverse()
- return render_to_response('logs.html', {'warning': warning, 'log': data, 'from': fro.strftime('%d.%m.%Y %H:%M:%S'),
- 'reversed': reversed, 'perpage': perpage, 'perpage_p': sorted(perpage_p),
- 'iprev': 1 if item - perpage < 1 else item - perpage,
- 'inext': (item + perpage) if item + perpage < len(log) else item},
- [pre_processor])
-
-
-@route("/admin")
-@route("/admin", method="POST")
-@login_required("ADMIN")
-def admin():
- # convert to dict
- user = dict([(name, toDict(y)) for name, y in PYLOAD.getAllUserData().iteritems()])
- perms = permlist()
-
- for data in user.itervalues():
- data["perms"] = {}
- get_permission(data["perms"], data["permission"])
- data["perms"]["admin"] = True if data["role"] is 0 else False
-
-
- s = request.environ.get('beaker.session')
- if request.environ.get('REQUEST_METHOD', "GET") == "POST":
- for name in user:
- if request.POST.get("%s|admin" % name, False):
- user[name]["role"] = 0
- user[name]["perms"]["admin"] = True
- elif name != s["name"]:
- user[name]["role"] = 1
- user[name]["perms"]["admin"] = False
-
- # set all perms to false
- for perm in perms:
- user[name]["perms"][perm] = False
-
-
- for perm in request.POST.getall("%s|perms" % name):
- user[name]["perms"][perm] = True
-
- user[name]["permission"] = set_permission(user[name]["perms"])
-
- PYLOAD.setUserPermission(name, user[name]["permission"], user[name]["role"])
-
- return render_to_response("admin.html", {"users": user, "permlist": perms}, [pre_processor])
-
-
-@route("/setup")
-def setup():
- if PYLOAD or not SETUP:
- return base([_("Run pyLoadCore.py -s to access the setup.")])
-
- return render_to_response('setup.html', {"user": False, "perms": False})
-
-
-@route("/info")
-def info():
- conf = PYLOAD.getConfigDict()
-
- if hasattr(os, "uname"):
- extra = os.uname()
- else:
- extra = tuple()
-
- data = {"python": sys.version,
- "os": " ".join((os.name, sys.platform) + extra),
- "version": PYLOAD.getServerVersion(),
- "folder": abspath(PYLOAD_DIR), "config": abspath(""),
- "download": abspath(conf["general"]["download_folder"]["value"]),
- "freespace": formatSize(PYLOAD.freeSpace()),
- "remote": conf["remote"]["port"]["value"],
- "webif": conf["webinterface"]["port"]["value"],
- "language": conf["general"]["language"]["value"]}
-
- return render_to_response("info.html", data, [pre_processor])
diff --git a/module/web/static/css/bootstrap.css b/module/web/static/css/bootstrap.css
new file mode 100644
index 000000000..9fa6f766f
--- /dev/null
+++ b/module/web/static/css/bootstrap.css
@@ -0,0 +1,5774 @@
+/*!
+ * Bootstrap v2.1.1
+ *
+ * Copyright 2012 Twitter, Inc
+ * Licensed under the Apache License v2.0
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
+ */
+
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+nav,
+section {
+ display: block;
+}
+
+audio,
+canvas,
+video {
+ display: inline-block;
+ *display: inline;
+ *zoom: 1;
+}
+
+audio:not([controls]) {
+ display: none;
+}
+
+html {
+ font-size: 100%;
+ -webkit-text-size-adjust: 100%;
+ -ms-text-size-adjust: 100%;
+}
+
+a:focus {
+ outline: thin dotted #333;
+ outline: 5px auto -webkit-focus-ring-color;
+ outline-offset: -2px;
+}
+
+a:hover,
+a:active {
+ outline: 0;
+}
+
+sub,
+sup {
+ position: relative;
+ font-size: 75%;
+ line-height: 0;
+ vertical-align: baseline;
+}
+
+sup {
+ top: -0.5em;
+}
+
+sub {
+ bottom: -0.25em;
+}
+
+img {
+ width: auto\9;
+ height: auto;
+ max-width: 100%;
+ vertical-align: middle;
+ border: 0;
+ -ms-interpolation-mode: bicubic;
+}
+
+#map_canvas img {
+ max-width: none;
+}
+
+button,
+input,
+select,
+textarea {
+ margin: 0;
+ font-size: 100%;
+ vertical-align: middle;
+}
+
+button,
+input {
+ *overflow: visible;
+ line-height: normal;
+}
+
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+ padding: 0;
+ border: 0;
+}
+
+button,
+input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+ cursor: pointer;
+ -webkit-appearance: button;
+}
+
+input[type="search"] {
+ -webkit-box-sizing: content-box;
+ -moz-box-sizing: content-box;
+ box-sizing: content-box;
+ -webkit-appearance: textfield;
+}
+
+input[type="search"]::-webkit-search-decoration,
+input[type="search"]::-webkit-search-cancel-button {
+ -webkit-appearance: none;
+}
+
+textarea {
+ overflow: auto;
+ vertical-align: top;
+}
+
+.clearfix {
+ *zoom: 1;
+}
+
+.clearfix:before,
+.clearfix:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.clearfix:after {
+ clear: both;
+}
+
+.hide-text {
+ font: 0/0 a;
+ color: transparent;
+ text-shadow: none;
+ background-color: transparent;
+ border: 0;
+}
+
+.input-block-level {
+ display: block;
+ width: 100%;
+ min-height: 30px;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+body {
+ margin: 0;
+ font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+ font-size: 14px;
+ line-height: 20px;
+ color: #333333;
+ background-color: #ffffff;
+}
+
+a {
+ color: #0088cc;
+ text-decoration: none;
+}
+
+a:hover {
+ color: #005580;
+ text-decoration: underline;
+}
+
+.img-rounded {
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+}
+
+.img-polaroid {
+ padding: 4px;
+ background-color: #fff;
+ border: 1px solid #ccc;
+ border: 1px solid rgba(0, 0, 0, 0.2);
+ -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.1);
+ -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.1);
+ box-shadow: 0 1px 3px rgba(0, 0, 0, 0.1);
+}
+
+.img-circle {
+ -webkit-border-radius: 500px;
+ -moz-border-radius: 500px;
+ border-radius: 500px;
+}
+
+.row {
+ margin-left: -20px;
+ *zoom: 1;
+}
+
+.row:before,
+.row:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.row:after {
+ clear: both;
+}
+
+[class*="span"] {
+ float: left;
+ min-height: 1px;
+ margin-left: 20px;
+}
+
+.container,
+.navbar-static-top .container,
+.navbar-fixed-top .container,
+.navbar-fixed-bottom .container {
+ width: 940px;
+}
+
+.span12 {
+ width: 940px;
+}
+
+.span11 {
+ width: 860px;
+}
+
+.span10 {
+ width: 780px;
+}
+
+.span9 {
+ width: 700px;
+}
+
+.span8 {
+ width: 620px;
+}
+
+.span7 {
+ width: 540px;
+}
+
+.span6 {
+ width: 460px;
+}
+
+.span5 {
+ width: 380px;
+}
+
+.span4 {
+ width: 300px;
+}
+
+.span3 {
+ width: 220px;
+}
+
+.span2 {
+ width: 140px;
+}
+
+.span1 {
+ width: 60px;
+}
+
+.offset12 {
+ margin-left: 980px;
+}
+
+.offset11 {
+ margin-left: 900px;
+}
+
+.offset10 {
+ margin-left: 820px;
+}
+
+.offset9 {
+ margin-left: 740px;
+}
+
+.offset8 {
+ margin-left: 660px;
+}
+
+.offset7 {
+ margin-left: 580px;
+}
+
+.offset6 {
+ margin-left: 500px;
+}
+
+.offset5 {
+ margin-left: 420px;
+}
+
+.offset4 {
+ margin-left: 340px;
+}
+
+.offset3 {
+ margin-left: 260px;
+}
+
+.offset2 {
+ margin-left: 180px;
+}
+
+.offset1 {
+ margin-left: 100px;
+}
+
+.row-fluid {
+ width: 100%;
+ *zoom: 1;
+}
+
+.row-fluid:before,
+.row-fluid:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.row-fluid:after {
+ clear: both;
+}
+
+.row-fluid [class*="span"] {
+ display: block;
+ float: left;
+ width: 100%;
+ min-height: 30px;
+ margin-left: 2.127659574468085%;
+ *margin-left: 2.074468085106383%;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+.row-fluid [class*="span"]:first-child {
+ margin-left: 0;
+}
+
+.row-fluid .span12 {
+ width: 100%;
+ *width: 99.94680851063829%;
+}
+
+.row-fluid .span11 {
+ width: 91.48936170212765%;
+ *width: 91.43617021276594%;
+}
+
+.row-fluid .span10 {
+ width: 82.97872340425532%;
+ *width: 82.92553191489361%;
+}
+
+.row-fluid .span9 {
+ width: 74.46808510638297%;
+ *width: 74.41489361702126%;
+}
+
+.row-fluid .span8 {
+ width: 65.95744680851064%;
+ *width: 65.90425531914893%;
+}
+
+.row-fluid .span7 {
+ width: 57.44680851063829%;
+ *width: 57.39361702127659%;
+}
+
+.row-fluid .span6 {
+ width: 48.93617021276595%;
+ *width: 48.88297872340425%;
+}
+
+.row-fluid .span5 {
+ width: 40.42553191489362%;
+ *width: 40.37234042553192%;
+}
+
+.row-fluid .span4 {
+ width: 31.914893617021278%;
+ *width: 31.861702127659576%;
+}
+
+.row-fluid .span3 {
+ width: 23.404255319148934%;
+ *width: 23.351063829787233%;
+}
+
+.row-fluid .span2 {
+ width: 14.893617021276595%;
+ *width: 14.840425531914894%;
+}
+
+.row-fluid .span1 {
+ width: 6.382978723404255%;
+ *width: 6.329787234042553%;
+}
+
+.row-fluid .offset12 {
+ margin-left: 104.25531914893617%;
+ *margin-left: 104.14893617021275%;
+}
+
+.row-fluid .offset12:first-child {
+ margin-left: 102.12765957446808%;
+ *margin-left: 102.02127659574467%;
+}
+
+.row-fluid .offset11 {
+ margin-left: 95.74468085106382%;
+ *margin-left: 95.6382978723404%;
+}
+
+.row-fluid .offset11:first-child {
+ margin-left: 93.61702127659574%;
+ *margin-left: 93.51063829787232%;
+}
+
+.row-fluid .offset10 {
+ margin-left: 87.23404255319149%;
+ *margin-left: 87.12765957446807%;
+}
+
+.row-fluid .offset10:first-child {
+ margin-left: 85.1063829787234%;
+ *margin-left: 84.99999999999999%;
+}
+
+.row-fluid .offset9 {
+ margin-left: 78.72340425531914%;
+ *margin-left: 78.61702127659572%;
+}
+
+.row-fluid .offset9:first-child {
+ margin-left: 76.59574468085106%;
+ *margin-left: 76.48936170212764%;
+}
+
+.row-fluid .offset8 {
+ margin-left: 70.2127659574468%;
+ *margin-left: 70.10638297872339%;
+}
+
+.row-fluid .offset8:first-child {
+ margin-left: 68.08510638297872%;
+ *margin-left: 67.9787234042553%;
+}
+
+.row-fluid .offset7 {
+ margin-left: 61.70212765957446%;
+ *margin-left: 61.59574468085106%;
+}
+
+.row-fluid .offset7:first-child {
+ margin-left: 59.574468085106375%;
+ *margin-left: 59.46808510638297%;
+}
+
+.row-fluid .offset6 {
+ margin-left: 53.191489361702125%;
+ *margin-left: 53.085106382978715%;
+}
+
+.row-fluid .offset6:first-child {
+ margin-left: 51.063829787234035%;
+ *margin-left: 50.95744680851063%;
+}
+
+.row-fluid .offset5 {
+ margin-left: 44.68085106382979%;
+ *margin-left: 44.57446808510638%;
+}
+
+.row-fluid .offset5:first-child {
+ margin-left: 42.5531914893617%;
+ *margin-left: 42.4468085106383%;
+}
+
+.row-fluid .offset4 {
+ margin-left: 36.170212765957444%;
+ *margin-left: 36.06382978723405%;
+}
+
+.row-fluid .offset4:first-child {
+ margin-left: 34.04255319148936%;
+ *margin-left: 33.93617021276596%;
+}
+
+.row-fluid .offset3 {
+ margin-left: 27.659574468085104%;
+ *margin-left: 27.5531914893617%;
+}
+
+.row-fluid .offset3:first-child {
+ margin-left: 25.53191489361702%;
+ *margin-left: 25.425531914893618%;
+}
+
+.row-fluid .offset2 {
+ margin-left: 19.148936170212764%;
+ *margin-left: 19.04255319148936%;
+}
+
+.row-fluid .offset2:first-child {
+ margin-left: 17.02127659574468%;
+ *margin-left: 16.914893617021278%;
+}
+
+.row-fluid .offset1 {
+ margin-left: 10.638297872340425%;
+ *margin-left: 10.53191489361702%;
+}
+
+.row-fluid .offset1:first-child {
+ margin-left: 8.51063829787234%;
+ *margin-left: 8.404255319148938%;
+}
+
+[class*="span"].hide,
+.row-fluid [class*="span"].hide {
+ display: none;
+}
+
+[class*="span"].pull-right,
+.row-fluid [class*="span"].pull-right {
+ float: right;
+}
+
+.container {
+ margin-right: auto;
+ margin-left: auto;
+ *zoom: 1;
+}
+
+.container:before,
+.container:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.container:after {
+ clear: both;
+}
+
+.container-fluid {
+ padding-right: 20px;
+ padding-left: 20px;
+ *zoom: 1;
+}
+
+.container-fluid:before,
+.container-fluid:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.container-fluid:after {
+ clear: both;
+}
+
+p {
+ margin: 0 0 10px;
+}
+
+.lead {
+ margin-bottom: 20px;
+ font-size: 21px;
+ font-weight: 200;
+ line-height: 30px;
+}
+
+small {
+ font-size: 85%;
+}
+
+strong {
+ font-weight: bold;
+}
+
+em {
+ font-style: italic;
+}
+
+cite {
+ font-style: normal;
+}
+
+.muted {
+ color: #999999;
+}
+
+.text-warning {
+ color: #c09853;
+}
+
+.text-error {
+ color: #b94a48;
+}
+
+.text-info {
+ color: #3a87ad;
+}
+
+.text-success {
+ color: #468847;
+}
+
+h1,
+h2,
+h3,
+h4,
+h5,
+h6 {
+ margin: 10px 0;
+ font-family: inherit;
+ font-weight: bold;
+ line-height: 1;
+ color: inherit;
+ text-rendering: optimizelegibility;
+}
+
+h1 small,
+h2 small,
+h3 small,
+h4 small,
+h5 small,
+h6 small {
+ font-weight: normal;
+ line-height: 1;
+ color: #999999;
+}
+
+h1 {
+ font-size: 36px;
+ line-height: 40px;
+}
+
+h2 {
+ font-size: 30px;
+ line-height: 40px;
+}
+
+h3 {
+ font-size: 24px;
+ line-height: 40px;
+}
+
+h4 {
+ font-size: 18px;
+ line-height: 20px;
+}
+
+h5 {
+ font-size: 14px;
+ line-height: 20px;
+}
+
+h6 {
+ font-size: 12px;
+ line-height: 20px;
+}
+
+h1 small {
+ font-size: 24px;
+}
+
+h2 small {
+ font-size: 18px;
+}
+
+h3 small {
+ font-size: 14px;
+}
+
+h4 small {
+ font-size: 14px;
+}
+
+.page-header {
+ padding-bottom: 9px;
+ margin: 20px 0 30px;
+ border-bottom: 1px solid #eeeeee;
+}
+
+ul,
+ol {
+ padding: 0;
+ margin: 0 0 10px 25px;
+}
+
+ul ul,
+ul ol,
+ol ol,
+ol ul {
+ margin-bottom: 0;
+}
+
+li {
+ line-height: 20px;
+}
+
+ul.unstyled,
+ol.unstyled {
+ margin-left: 0;
+ list-style: none;
+}
+
+dl {
+ margin-bottom: 20px;
+}
+
+dt,
+dd {
+ line-height: 20px;
+}
+
+dt {
+ font-weight: bold;
+}
+
+dd {
+ margin-left: 10px;
+}
+
+.dl-horizontal {
+ *zoom: 1;
+}
+
+.dl-horizontal:before,
+.dl-horizontal:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.dl-horizontal:after {
+ clear: both;
+}
+
+.dl-horizontal dt {
+ float: left;
+ width: 160px;
+ overflow: hidden;
+ clear: left;
+ text-align: right;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+}
+
+.dl-horizontal dd {
+ margin-left: 180px;
+}
+
+hr {
+ margin: 20px 0;
+ border: 0;
+ border-top: 1px solid #eeeeee;
+ border-bottom: 1px solid #ffffff;
+}
+
+abbr[title] {
+ cursor: help;
+ border-bottom: 1px dotted #999999;
+}
+
+abbr.initialism {
+ font-size: 90%;
+ text-transform: uppercase;
+}
+
+blockquote {
+ padding: 0 0 0 15px;
+ margin: 0 0 20px;
+ border-left: 5px solid #eeeeee;
+}
+
+blockquote p {
+ margin-bottom: 0;
+ font-size: 16px;
+ font-weight: 300;
+ line-height: 25px;
+}
+
+blockquote small {
+ display: block;
+ line-height: 20px;
+ color: #999999;
+}
+
+blockquote small:before {
+ content: '\2014 \00A0';
+}
+
+blockquote.pull-right {
+ float: right;
+ padding-right: 15px;
+ padding-left: 0;
+ border-right: 5px solid #eeeeee;
+ border-left: 0;
+}
+
+blockquote.pull-right p,
+blockquote.pull-right small {
+ text-align: right;
+}
+
+blockquote.pull-right small:before {
+ content: '';
+}
+
+blockquote.pull-right small:after {
+ content: '\00A0 \2014';
+}
+
+q:before,
+q:after,
+blockquote:before,
+blockquote:after {
+ content: "";
+}
+
+address {
+ display: block;
+ margin-bottom: 20px;
+ font-style: normal;
+ line-height: 20px;
+}
+
+code,
+pre {
+ padding: 0 3px 2px;
+ font-family: Monaco, Menlo, Consolas, "Courier New", monospace;
+ font-size: 12px;
+ color: #333333;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+code {
+ padding: 2px 4px;
+ color: #d14;
+ background-color: #f7f7f9;
+ border: 1px solid #e1e1e8;
+}
+
+pre {
+ display: block;
+ padding: 9.5px;
+ margin: 0 0 10px;
+ font-size: 13px;
+ line-height: 20px;
+ word-break: break-all;
+ word-wrap: break-word;
+ white-space: pre;
+ white-space: pre-wrap;
+ background-color: #f5f5f5;
+ border: 1px solid #ccc;
+ border: 1px solid rgba(0, 0, 0, 0.15);
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+pre.prettyprint {
+ margin-bottom: 20px;
+}
+
+pre code {
+ padding: 0;
+ color: inherit;
+ background-color: transparent;
+ border: 0;
+}
+
+.pre-scrollable {
+ max-height: 340px;
+ overflow-y: scroll;
+}
+
+form {
+ margin: 0 0 20px;
+}
+
+fieldset {
+ padding: 0;
+ margin: 0;
+ border: 0;
+}
+
+legend {
+ display: block;
+ width: 100%;
+ padding: 0;
+ margin-bottom: 20px;
+ font-size: 21px;
+ line-height: 40px;
+ color: #333333;
+ border: 0;
+ border-bottom: 1px solid #e5e5e5;
+}
+
+legend small {
+ font-size: 15px;
+ color: #999999;
+}
+
+label,
+input,
+button,
+select,
+textarea {
+ font-size: 14px;
+ font-weight: normal;
+ line-height: 20px;
+}
+
+input,
+button,
+select,
+textarea {
+ font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+}
+
+label {
+ display: block;
+ margin-bottom: 5px;
+}
+
+select,
+textarea,
+input[type="text"],
+input[type="password"],
+input[type="datetime"],
+input[type="datetime-local"],
+input[type="date"],
+input[type="month"],
+input[type="time"],
+input[type="week"],
+input[type="number"],
+input[type="email"],
+input[type="url"],
+input[type="search"],
+input[type="tel"],
+input[type="color"],
+.uneditable-input {
+ display: inline-block;
+ height: 20px;
+ padding: 4px 6px;
+ margin-bottom: 9px;
+ font-size: 14px;
+ line-height: 20px;
+ color: #555555;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+input,
+textarea,
+.uneditable-input {
+ width: 206px;
+}
+
+textarea {
+ height: auto;
+}
+
+textarea,
+input[type="text"],
+input[type="password"],
+input[type="datetime"],
+input[type="datetime-local"],
+input[type="date"],
+input[type="month"],
+input[type="time"],
+input[type="week"],
+input[type="number"],
+input[type="email"],
+input[type="url"],
+input[type="search"],
+input[type="tel"],
+input[type="color"],
+.uneditable-input {
+ background-color: #ffffff;
+ border: 1px solid #cccccc;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -webkit-transition: border linear 0.2s, box-shadow linear 0.2s;
+ -moz-transition: border linear 0.2s, box-shadow linear 0.2s;
+ -o-transition: border linear 0.2s, box-shadow linear 0.2s;
+ transition: border linear 0.2s, box-shadow linear 0.2s;
+}
+
+textarea:focus,
+input[type="text"]:focus,
+input[type="password"]:focus,
+input[type="datetime"]:focus,
+input[type="datetime-local"]:focus,
+input[type="date"]:focus,
+input[type="month"]:focus,
+input[type="time"]:focus,
+input[type="week"]:focus,
+input[type="number"]:focus,
+input[type="email"]:focus,
+input[type="url"]:focus,
+input[type="search"]:focus,
+input[type="tel"]:focus,
+input[type="color"]:focus,
+.uneditable-input:focus {
+ border-color: rgba(82, 168, 236, 0.8);
+ outline: 0;
+ outline: thin dotted \9;
+ /* IE6-9 */
+
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6);
+}
+
+input[type="radio"],
+input[type="checkbox"] {
+ margin: 4px 0 0;
+ margin-top: 1px \9;
+ *margin-top: 0;
+ line-height: normal;
+ cursor: pointer;
+}
+
+input[type="file"],
+input[type="image"],
+input[type="submit"],
+input[type="reset"],
+input[type="button"],
+input[type="radio"],
+input[type="checkbox"] {
+ width: auto;
+}
+
+select,
+input[type="file"] {
+ height: 30px;
+ /* In IE7, the height of the select element cannot be changed by height, only font-size */
+
+ *margin-top: 4px;
+ /* For IE7, add top margin to align select with labels */
+
+ line-height: 30px;
+}
+
+select {
+ width: 220px;
+ background-color: #ffffff;
+ border: 1px solid #cccccc;
+}
+
+select[multiple],
+select[size] {
+ height: auto;
+}
+
+select:focus,
+input[type="file"]:focus,
+input[type="radio"]:focus,
+input[type="checkbox"]:focus {
+ outline: thin dotted #333;
+ outline: 5px auto -webkit-focus-ring-color;
+ outline-offset: -2px;
+}
+
+.uneditable-input,
+.uneditable-textarea {
+ color: #999999;
+ cursor: not-allowed;
+ background-color: #fcfcfc;
+ border-color: #cccccc;
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025);
+ -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025);
+}
+
+.uneditable-input {
+ overflow: hidden;
+ white-space: nowrap;
+}
+
+.uneditable-textarea {
+ width: auto;
+ height: auto;
+}
+
+input:-moz-placeholder,
+textarea:-moz-placeholder {
+ color: #999999;
+}
+
+input:-ms-input-placeholder,
+textarea:-ms-input-placeholder {
+ color: #999999;
+}
+
+input::-webkit-input-placeholder,
+textarea::-webkit-input-placeholder {
+ color: #999999;
+}
+
+.radio,
+.checkbox {
+ min-height: 18px;
+ padding-left: 18px;
+}
+
+.radio input[type="radio"],
+.checkbox input[type="checkbox"] {
+ float: left;
+ margin-left: -18px;
+}
+
+.controls > .radio:first-child,
+.controls > .checkbox:first-child {
+ padding-top: 5px;
+}
+
+.radio.inline,
+.checkbox.inline {
+ display: inline-block;
+ padding-top: 5px;
+ margin-bottom: 0;
+ vertical-align: middle;
+}
+
+.radio.inline + .radio.inline,
+.checkbox.inline + .checkbox.inline {
+ margin-left: 10px;
+}
+
+.input-mini {
+ width: 60px;
+}
+
+.input-small {
+ width: 90px;
+}
+
+.input-medium {
+ width: 150px;
+}
+
+.input-large {
+ width: 210px;
+}
+
+.input-xlarge {
+ width: 270px;
+}
+
+.input-xxlarge {
+ width: 530px;
+}
+
+input[class*="span"],
+select[class*="span"],
+textarea[class*="span"],
+.uneditable-input[class*="span"],
+.row-fluid input[class*="span"],
+.row-fluid select[class*="span"],
+.row-fluid textarea[class*="span"],
+.row-fluid .uneditable-input[class*="span"] {
+ float: none;
+ margin-left: 0;
+}
+
+.input-append input[class*="span"],
+.input-append .uneditable-input[class*="span"],
+.input-prepend input[class*="span"],
+.input-prepend .uneditable-input[class*="span"],
+.row-fluid input[class*="span"],
+.row-fluid select[class*="span"],
+.row-fluid textarea[class*="span"],
+.row-fluid .uneditable-input[class*="span"],
+.row-fluid .input-prepend [class*="span"],
+.row-fluid .input-append [class*="span"] {
+ display: inline-block;
+}
+
+input,
+textarea,
+.uneditable-input {
+ margin-left: 0;
+}
+
+.controls-row [class*="span"] + [class*="span"] {
+ margin-left: 20px;
+}
+
+input.span12,
+textarea.span12,
+.uneditable-input.span12 {
+ width: 926px;
+}
+
+input.span11,
+textarea.span11,
+.uneditable-input.span11 {
+ width: 846px;
+}
+
+input.span10,
+textarea.span10,
+.uneditable-input.span10 {
+ width: 766px;
+}
+
+input.span9,
+textarea.span9,
+.uneditable-input.span9 {
+ width: 686px;
+}
+
+input.span8,
+textarea.span8,
+.uneditable-input.span8 {
+ width: 606px;
+}
+
+input.span7,
+textarea.span7,
+.uneditable-input.span7 {
+ width: 526px;
+}
+
+input.span6,
+textarea.span6,
+.uneditable-input.span6 {
+ width: 446px;
+}
+
+input.span5,
+textarea.span5,
+.uneditable-input.span5 {
+ width: 366px;
+}
+
+input.span4,
+textarea.span4,
+.uneditable-input.span4 {
+ width: 286px;
+}
+
+input.span3,
+textarea.span3,
+.uneditable-input.span3 {
+ width: 206px;
+}
+
+input.span2,
+textarea.span2,
+.uneditable-input.span2 {
+ width: 126px;
+}
+
+input.span1,
+textarea.span1,
+.uneditable-input.span1 {
+ width: 46px;
+}
+
+.controls-row {
+ *zoom: 1;
+}
+
+.controls-row:before,
+.controls-row:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.controls-row:after {
+ clear: both;
+}
+
+.controls-row [class*="span"] {
+ float: left;
+}
+
+input[disabled],
+select[disabled],
+textarea[disabled],
+input[readonly],
+select[readonly],
+textarea[readonly] {
+ cursor: not-allowed;
+ background-color: #eeeeee;
+}
+
+input[type="radio"][disabled],
+input[type="checkbox"][disabled],
+input[type="radio"][readonly],
+input[type="checkbox"][readonly] {
+ background-color: transparent;
+}
+
+.control-group.warning > label,
+.control-group.warning .help-block,
+.control-group.warning .help-inline {
+ color: #c09853;
+}
+
+.control-group.warning .checkbox,
+.control-group.warning .radio,
+.control-group.warning input,
+.control-group.warning select,
+.control-group.warning textarea {
+ color: #c09853;
+}
+
+.control-group.warning input,
+.control-group.warning select,
+.control-group.warning textarea {
+ border-color: #c09853;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+}
+
+.control-group.warning input:focus,
+.control-group.warning select:focus,
+.control-group.warning textarea:focus {
+ border-color: #a47e3c;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #dbc59e;
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #dbc59e;
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #dbc59e;
+}
+
+.control-group.warning .input-prepend .add-on,
+.control-group.warning .input-append .add-on {
+ color: #c09853;
+ background-color: #fcf8e3;
+ border-color: #c09853;
+}
+
+.control-group.error > label,
+.control-group.error .help-block,
+.control-group.error .help-inline {
+ color: #b94a48;
+}
+
+.control-group.error .checkbox,
+.control-group.error .radio,
+.control-group.error input,
+.control-group.error select,
+.control-group.error textarea {
+ color: #b94a48;
+}
+
+.control-group.error input,
+.control-group.error select,
+.control-group.error textarea {
+ border-color: #b94a48;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+}
+
+.control-group.error input:focus,
+.control-group.error select:focus,
+.control-group.error textarea:focus {
+ border-color: #953b39;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #d59392;
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #d59392;
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #d59392;
+}
+
+.control-group.error .input-prepend .add-on,
+.control-group.error .input-append .add-on {
+ color: #b94a48;
+ background-color: #f2dede;
+ border-color: #b94a48;
+}
+
+.control-group.success > label,
+.control-group.success .help-block,
+.control-group.success .help-inline {
+ color: #468847;
+}
+
+.control-group.success .checkbox,
+.control-group.success .radio,
+.control-group.success input,
+.control-group.success select,
+.control-group.success textarea {
+ color: #468847;
+}
+
+.control-group.success input,
+.control-group.success select,
+.control-group.success textarea {
+ border-color: #468847;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+}
+
+.control-group.success input:focus,
+.control-group.success select:focus,
+.control-group.success textarea:focus {
+ border-color: #356635;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #7aba7b;
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #7aba7b;
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #7aba7b;
+}
+
+.control-group.success .input-prepend .add-on,
+.control-group.success .input-append .add-on {
+ color: #468847;
+ background-color: #dff0d8;
+ border-color: #468847;
+}
+
+.control-group.info > label,
+.control-group.info .help-block,
+.control-group.info .help-inline {
+ color: #3a87ad;
+}
+
+.control-group.info .checkbox,
+.control-group.info .radio,
+.control-group.info input,
+.control-group.info select,
+.control-group.info textarea {
+ color: #3a87ad;
+}
+
+.control-group.info input,
+.control-group.info select,
+.control-group.info textarea {
+ border-color: #3a87ad;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+}
+
+.control-group.info input:focus,
+.control-group.info select:focus,
+.control-group.info textarea:focus {
+ border-color: #2d6987;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #7ab5d3;
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #7ab5d3;
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #7ab5d3;
+}
+
+.control-group.info .input-prepend .add-on,
+.control-group.info .input-append .add-on {
+ color: #3a87ad;
+ background-color: #d9edf7;
+ border-color: #3a87ad;
+}
+
+input:focus:required:invalid,
+textarea:focus:required:invalid,
+select:focus:required:invalid {
+ color: #b94a48;
+ border-color: #ee5f5b;
+}
+
+input:focus:required:invalid:focus,
+textarea:focus:required:invalid:focus,
+select:focus:required:invalid:focus {
+ border-color: #e9322d;
+ -webkit-box-shadow: 0 0 6px #f8b9b7;
+ -moz-box-shadow: 0 0 6px #f8b9b7;
+ box-shadow: 0 0 6px #f8b9b7;
+}
+
+.form-actions {
+ padding: 19px 20px 20px;
+ margin-top: 20px;
+ margin-bottom: 20px;
+ background-color: #f5f5f5;
+ border-top: 1px solid #e5e5e5;
+ *zoom: 1;
+}
+
+.form-actions:before,
+.form-actions:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.form-actions:after {
+ clear: both;
+}
+
+.help-block,
+.help-inline {
+ color: #595959;
+}
+
+.help-block {
+ display: block;
+ margin-bottom: 10px;
+}
+
+.help-inline {
+ display: inline-block;
+ *display: inline;
+ padding-left: 5px;
+ vertical-align: middle;
+ *zoom: 1;
+}
+
+.input-append,
+.input-prepend {
+ margin-bottom: 5px;
+ font-size: 0;
+ white-space: nowrap;
+}
+
+.input-append input,
+.input-prepend input,
+.input-append select,
+.input-prepend select,
+.input-append .uneditable-input,
+.input-prepend .uneditable-input {
+ position: relative;
+ margin-bottom: 0;
+ *margin-left: 0;
+ font-size: 14px;
+ vertical-align: top;
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.input-append input:focus,
+.input-prepend input:focus,
+.input-append select:focus,
+.input-prepend select:focus,
+.input-append .uneditable-input:focus,
+.input-prepend .uneditable-input:focus {
+ z-index: 2;
+}
+
+.input-append .add-on,
+.input-prepend .add-on {
+ display: inline-block;
+ width: auto;
+ height: 20px;
+ min-width: 16px;
+ padding: 4px 5px;
+ font-size: 14px;
+ font-weight: normal;
+ line-height: 20px;
+ text-align: center;
+ text-shadow: 0 1px 0 #ffffff;
+ background-color: #eeeeee;
+ border: 1px solid #ccc;
+}
+
+.input-append .add-on,
+.input-prepend .add-on,
+.input-append .btn,
+.input-prepend .btn {
+ vertical-align: top;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.input-append .active,
+.input-prepend .active {
+ background-color: #a9dba9;
+ border-color: #46a546;
+}
+
+.input-prepend .add-on,
+.input-prepend .btn {
+ margin-right: -1px;
+}
+
+.input-prepend .add-on:first-child,
+.input-prepend .btn:first-child {
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.input-append input,
+.input-append select,
+.input-append .uneditable-input {
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.input-append .add-on,
+.input-append .btn {
+ margin-left: -1px;
+}
+
+.input-append .add-on:last-child,
+.input-append .btn:last-child {
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.input-prepend.input-append input,
+.input-prepend.input-append select,
+.input-prepend.input-append .uneditable-input {
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.input-prepend.input-append .add-on:first-child,
+.input-prepend.input-append .btn:first-child {
+ margin-right: -1px;
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.input-prepend.input-append .add-on:last-child,
+.input-prepend.input-append .btn:last-child {
+ margin-left: -1px;
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+input.search-query {
+ padding-right: 14px;
+ padding-right: 4px \9;
+ padding-left: 14px;
+ padding-left: 4px \9;
+ /* IE7-8 doesn't have border-radius, so don't indent the padding */
+
+ margin-bottom: 0;
+ -webkit-border-radius: 15px;
+ -moz-border-radius: 15px;
+ border-radius: 15px;
+}
+
+/* Allow for input prepend/append in search forms */
+
+.form-search .input-append .search-query,
+.form-search .input-prepend .search-query {
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.form-search .input-append .search-query {
+ -webkit-border-radius: 14px 0 0 14px;
+ -moz-border-radius: 14px 0 0 14px;
+ border-radius: 14px 0 0 14px;
+}
+
+.form-search .input-append .btn {
+ -webkit-border-radius: 0 14px 14px 0;
+ -moz-border-radius: 0 14px 14px 0;
+ border-radius: 0 14px 14px 0;
+}
+
+.form-search .input-prepend .search-query {
+ -webkit-border-radius: 0 14px 14px 0;
+ -moz-border-radius: 0 14px 14px 0;
+ border-radius: 0 14px 14px 0;
+}
+
+.form-search .input-prepend .btn {
+ -webkit-border-radius: 14px 0 0 14px;
+ -moz-border-radius: 14px 0 0 14px;
+ border-radius: 14px 0 0 14px;
+}
+
+.form-search input,
+.form-inline input,
+.form-horizontal input,
+.form-search textarea,
+.form-inline textarea,
+.form-horizontal textarea,
+.form-search select,
+.form-inline select,
+.form-horizontal select,
+.form-search .help-inline,
+.form-inline .help-inline,
+.form-horizontal .help-inline,
+.form-search .uneditable-input,
+.form-inline .uneditable-input,
+.form-horizontal .uneditable-input,
+.form-search .input-prepend,
+.form-inline .input-prepend,
+.form-horizontal .input-prepend,
+.form-search .input-append,
+.form-inline .input-append,
+.form-horizontal .input-append {
+ display: inline-block;
+ *display: inline;
+ margin-bottom: 0;
+ vertical-align: middle;
+ *zoom: 1;
+}
+
+.form-search .hide,
+.form-inline .hide,
+.form-horizontal .hide {
+ display: none;
+}
+
+.form-search label,
+.form-inline label,
+.form-search .btn-group,
+.form-inline .btn-group {
+ display: inline-block;
+}
+
+.form-search .input-append,
+.form-inline .input-append,
+.form-search .input-prepend,
+.form-inline .input-prepend {
+ margin-bottom: 0;
+}
+
+.form-search .radio,
+.form-search .checkbox,
+.form-inline .radio,
+.form-inline .checkbox {
+ padding-left: 0;
+ margin-bottom: 0;
+ vertical-align: middle;
+}
+
+.form-search .radio input[type="radio"],
+.form-search .checkbox input[type="checkbox"],
+.form-inline .radio input[type="radio"],
+.form-inline .checkbox input[type="checkbox"] {
+ float: left;
+ margin-right: 3px;
+ margin-left: 0;
+}
+
+.control-group {
+ margin-bottom: 10px;
+}
+
+legend + .control-group {
+ margin-top: 20px;
+ -webkit-margin-top-collapse: separate;
+}
+
+.form-horizontal .control-group {
+ margin-bottom: 20px;
+ *zoom: 1;
+}
+
+.form-horizontal .control-group:before,
+.form-horizontal .control-group:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.form-horizontal .control-group:after {
+ clear: both;
+}
+
+.form-horizontal .control-label {
+ float: left;
+ width: 160px;
+ padding-top: 5px;
+ text-align: right;
+}
+
+.form-horizontal .controls {
+ *display: inline-block;
+ *padding-left: 20px;
+ margin-left: 180px;
+ *margin-left: 0;
+}
+
+.form-horizontal .controls:first-child {
+ *padding-left: 180px;
+}
+
+.form-horizontal .help-block {
+ margin-bottom: 0;
+}
+
+.form-horizontal input + .help-block,
+.form-horizontal select + .help-block,
+.form-horizontal textarea + .help-block {
+ margin-top: 10px;
+}
+
+.form-horizontal .form-actions {
+ padding-left: 180px;
+}
+
+table {
+ max-width: 100%;
+ background-color: transparent;
+ border-collapse: collapse;
+ border-spacing: 0;
+}
+
+.table {
+ width: 100%;
+ margin-bottom: 20px;
+}
+
+.table th,
+.table td {
+ padding: 8px;
+ line-height: 20px;
+ text-align: left;
+ vertical-align: top;
+ border-top: 1px solid #dddddd;
+}
+
+.table th {
+ font-weight: bold;
+}
+
+.table thead th {
+ vertical-align: bottom;
+}
+
+.table caption + thead tr:first-child th,
+.table caption + thead tr:first-child td,
+.table colgroup + thead tr:first-child th,
+.table colgroup + thead tr:first-child td,
+.table thead:first-child tr:first-child th,
+.table thead:first-child tr:first-child td {
+ border-top: 0;
+}
+
+.table tbody + tbody {
+ border-top: 2px solid #dddddd;
+}
+
+.table-condensed th,
+.table-condensed td {
+ padding: 4px 5px;
+}
+
+.table-bordered {
+ border: 1px solid #dddddd;
+ border-collapse: separate;
+ *border-collapse: collapse;
+ border-left: 0;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.table-bordered th,
+.table-bordered td {
+ border-left: 1px solid #dddddd;
+}
+
+.table-bordered caption + thead tr:first-child th,
+.table-bordered caption + tbody tr:first-child th,
+.table-bordered caption + tbody tr:first-child td,
+.table-bordered colgroup + thead tr:first-child th,
+.table-bordered colgroup + tbody tr:first-child th,
+.table-bordered colgroup + tbody tr:first-child td,
+.table-bordered thead:first-child tr:first-child th,
+.table-bordered tbody:first-child tr:first-child th,
+.table-bordered tbody:first-child tr:first-child td {
+ border-top: 0;
+}
+
+.table-bordered thead:first-child tr:first-child th:first-child,
+.table-bordered tbody:first-child tr:first-child td:first-child {
+ -webkit-border-top-left-radius: 4px;
+ border-top-left-radius: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.table-bordered thead:first-child tr:first-child th:last-child,
+.table-bordered tbody:first-child tr:first-child td:last-child {
+ -webkit-border-top-right-radius: 4px;
+ border-top-right-radius: 4px;
+ -moz-border-radius-topright: 4px;
+}
+
+.table-bordered thead:last-child tr:last-child th:first-child,
+.table-bordered tbody:last-child tr:last-child td:first-child,
+.table-bordered tfoot:last-child tr:last-child td:first-child {
+ -webkit-border-radius: 0 0 0 4px;
+ -moz-border-radius: 0 0 0 4px;
+ border-radius: 0 0 0 4px;
+ -webkit-border-bottom-left-radius: 4px;
+ border-bottom-left-radius: 4px;
+ -moz-border-radius-bottomleft: 4px;
+}
+
+.table-bordered thead:last-child tr:last-child th:last-child,
+.table-bordered tbody:last-child tr:last-child td:last-child,
+.table-bordered tfoot:last-child tr:last-child td:last-child {
+ -webkit-border-bottom-right-radius: 4px;
+ border-bottom-right-radius: 4px;
+ -moz-border-radius-bottomright: 4px;
+}
+
+.table-bordered caption + thead tr:first-child th:first-child,
+.table-bordered caption + tbody tr:first-child td:first-child,
+.table-bordered colgroup + thead tr:first-child th:first-child,
+.table-bordered colgroup + tbody tr:first-child td:first-child {
+ -webkit-border-top-left-radius: 4px;
+ border-top-left-radius: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.table-bordered caption + thead tr:first-child th:last-child,
+.table-bordered caption + tbody tr:first-child td:last-child,
+.table-bordered colgroup + thead tr:first-child th:last-child,
+.table-bordered colgroup + tbody tr:first-child td:last-child {
+ -webkit-border-top-right-radius: 4px;
+ border-top-right-radius: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.table-striped tbody tr:nth-child(odd) td,
+.table-striped tbody tr:nth-child(odd) th {
+ background-color: #f9f9f9;
+}
+
+.table-hover tbody tr:hover td,
+.table-hover tbody tr:hover th {
+ background-color: #f5f5f5;
+}
+
+table [class*=span],
+.row-fluid table [class*=span] {
+ display: table-cell;
+ float: none;
+ margin-left: 0;
+}
+
+.table .span1 {
+ float: none;
+ width: 44px;
+ margin-left: 0;
+}
+
+.table .span2 {
+ float: none;
+ width: 124px;
+ margin-left: 0;
+}
+
+.table .span3 {
+ float: none;
+ width: 204px;
+ margin-left: 0;
+}
+
+.table .span4 {
+ float: none;
+ width: 284px;
+ margin-left: 0;
+}
+
+.table .span5 {
+ float: none;
+ width: 364px;
+ margin-left: 0;
+}
+
+.table .span6 {
+ float: none;
+ width: 444px;
+ margin-left: 0;
+}
+
+.table .span7 {
+ float: none;
+ width: 524px;
+ margin-left: 0;
+}
+
+.table .span8 {
+ float: none;
+ width: 604px;
+ margin-left: 0;
+}
+
+.table .span9 {
+ float: none;
+ width: 684px;
+ margin-left: 0;
+}
+
+.table .span10 {
+ float: none;
+ width: 764px;
+ margin-left: 0;
+}
+
+.table .span11 {
+ float: none;
+ width: 844px;
+ margin-left: 0;
+}
+
+.table .span12 {
+ float: none;
+ width: 924px;
+ margin-left: 0;
+}
+
+.table .span13 {
+ float: none;
+ width: 1004px;
+ margin-left: 0;
+}
+
+.table .span14 {
+ float: none;
+ width: 1084px;
+ margin-left: 0;
+}
+
+.table .span15 {
+ float: none;
+ width: 1164px;
+ margin-left: 0;
+}
+
+.table .span16 {
+ float: none;
+ width: 1244px;
+ margin-left: 0;
+}
+
+.table .span17 {
+ float: none;
+ width: 1324px;
+ margin-left: 0;
+}
+
+.table .span18 {
+ float: none;
+ width: 1404px;
+ margin-left: 0;
+}
+
+.table .span19 {
+ float: none;
+ width: 1484px;
+ margin-left: 0;
+}
+
+.table .span20 {
+ float: none;
+ width: 1564px;
+ margin-left: 0;
+}
+
+.table .span21 {
+ float: none;
+ width: 1644px;
+ margin-left: 0;
+}
+
+.table .span22 {
+ float: none;
+ width: 1724px;
+ margin-left: 0;
+}
+
+.table .span23 {
+ float: none;
+ width: 1804px;
+ margin-left: 0;
+}
+
+.table .span24 {
+ float: none;
+ width: 1884px;
+ margin-left: 0;
+}
+
+.table tbody tr.success td {
+ background-color: #dff0d8;
+}
+
+.table tbody tr.error td {
+ background-color: #f2dede;
+}
+
+.table tbody tr.warning td {
+ background-color: #fcf8e3;
+}
+
+.table tbody tr.info td {
+ background-color: #d9edf7;
+}
+
+.table-hover tbody tr.success:hover td {
+ background-color: #d0e9c6;
+}
+
+.table-hover tbody tr.error:hover td {
+ background-color: #ebcccc;
+}
+
+.table-hover tbody tr.warning:hover td {
+ background-color: #faf2cc;
+}
+
+.table-hover tbody tr.info:hover td {
+ background-color: #c4e3f3;
+}
+
+[class^="icon-"],
+[class*=" icon-"] {
+ display: inline-block;
+ width: 14px;
+ height: 14px;
+ margin-top: 1px;
+ *margin-right: .3em;
+ line-height: 14px;
+ vertical-align: text-top;
+ background-image: url("../img/glyphicons-halflings.png");
+ background-position: 14px 14px;
+ background-repeat: no-repeat;
+}
+
+/* White icons with optional class, or on hover/active states of certain elements */
+
+.icon-white,
+.nav-tabs > .active > a > [class^="icon-"],
+.nav-tabs > .active > a > [class*=" icon-"],
+.nav-pills > .active > a > [class^="icon-"],
+.nav-pills > .active > a > [class*=" icon-"],
+.nav-list > .active > a > [class^="icon-"],
+.nav-list > .active > a > [class*=" icon-"],
+.navbar-inverse .nav > .active > a > [class^="icon-"],
+.navbar-inverse .nav > .active > a > [class*=" icon-"],
+.dropdown-menu > li > a:hover > [class^="icon-"],
+.dropdown-menu > li > a:hover > [class*=" icon-"],
+.dropdown-menu > .active > a > [class^="icon-"],
+.dropdown-menu > .active > a > [class*=" icon-"] {
+ background-image: url("../img/glyphicons-halflings-white.png");
+}
+
+.icon-glass {
+ background-position: 0 0;
+}
+
+.icon-music {
+ background-position: -24px 0;
+}
+
+.icon-search {
+ background-position: -48px 0;
+}
+
+.icon-envelope {
+ background-position: -72px 0;
+}
+
+.icon-heart {
+ background-position: -96px 0;
+}
+
+.icon-star {
+ background-position: -120px 0;
+}
+
+.icon-star-empty {
+ background-position: -144px 0;
+}
+
+.icon-user {
+ background-position: -168px 0;
+}
+
+.icon-film {
+ background-position: -192px 0;
+}
+
+.icon-th-large {
+ background-position: -216px 0;
+}
+
+.icon-th {
+ background-position: -240px 0;
+}
+
+.icon-th-list {
+ background-position: -264px 0;
+}
+
+.icon-ok {
+ background-position: -288px 0;
+}
+
+.icon-remove {
+ background-position: -312px 0;
+}
+
+.icon-zoom-in {
+ background-position: -336px 0;
+}
+
+.icon-zoom-out {
+ background-position: -360px 0;
+}
+
+.icon-off {
+ background-position: -384px 0;
+}
+
+.icon-signal {
+ background-position: -408px 0;
+}
+
+.icon-cog {
+ background-position: -432px 0;
+}
+
+.icon-trash {
+ background-position: -456px 0;
+}
+
+.icon-home {
+ background-position: 0 -24px;
+}
+
+.icon-file {
+ background-position: -24px -24px;
+}
+
+.icon-time {
+ background-position: -48px -24px;
+}
+
+.icon-road {
+ background-position: -72px -24px;
+}
+
+.icon-download-alt {
+ background-position: -96px -24px;
+}
+
+.icon-download {
+ background-position: -120px -24px;
+}
+
+.icon-upload {
+ background-position: -144px -24px;
+}
+
+.icon-inbox {
+ background-position: -168px -24px;
+}
+
+.icon-play-circle {
+ background-position: -192px -24px;
+}
+
+.icon-repeat {
+ background-position: -216px -24px;
+}
+
+.icon-refresh {
+ background-position: -240px -24px;
+}
+
+.icon-list-alt {
+ background-position: -264px -24px;
+}
+
+.icon-lock {
+ background-position: -287px -24px;
+}
+
+.icon-flag {
+ background-position: -312px -24px;
+}
+
+.icon-headphones {
+ background-position: -336px -24px;
+}
+
+.icon-volume-off {
+ background-position: -360px -24px;
+}
+
+.icon-volume-down {
+ background-position: -384px -24px;
+}
+
+.icon-volume-up {
+ background-position: -408px -24px;
+}
+
+.icon-qrcode {
+ background-position: -432px -24px;
+}
+
+.icon-barcode {
+ background-position: -456px -24px;
+}
+
+.icon-tag {
+ background-position: 0 -48px;
+}
+
+.icon-tags {
+ background-position: -25px -48px;
+}
+
+.icon-book {
+ background-position: -48px -48px;
+}
+
+.icon-bookmark {
+ background-position: -72px -48px;
+}
+
+.icon-print {
+ background-position: -96px -48px;
+}
+
+.icon-camera {
+ background-position: -120px -48px;
+}
+
+.icon-font {
+ background-position: -144px -48px;
+}
+
+.icon-bold {
+ background-position: -167px -48px;
+}
+
+.icon-italic {
+ background-position: -192px -48px;
+}
+
+.icon-text-height {
+ background-position: -216px -48px;
+}
+
+.icon-text-width {
+ background-position: -240px -48px;
+}
+
+.icon-align-left {
+ background-position: -264px -48px;
+}
+
+.icon-align-center {
+ background-position: -288px -48px;
+}
+
+.icon-align-right {
+ background-position: -312px -48px;
+}
+
+.icon-align-justify {
+ background-position: -336px -48px;
+}
+
+.icon-list {
+ background-position: -360px -48px;
+}
+
+.icon-indent-left {
+ background-position: -384px -48px;
+}
+
+.icon-indent-right {
+ background-position: -408px -48px;
+}
+
+.icon-facetime-video {
+ background-position: -432px -48px;
+}
+
+.icon-picture {
+ background-position: -456px -48px;
+}
+
+.icon-pencil {
+ background-position: 0 -72px;
+}
+
+.icon-map-marker {
+ background-position: -24px -72px;
+}
+
+.icon-adjust {
+ background-position: -48px -72px;
+}
+
+.icon-tint {
+ background-position: -72px -72px;
+}
+
+.icon-edit {
+ background-position: -96px -72px;
+}
+
+.icon-share {
+ background-position: -120px -72px;
+}
+
+.icon-check {
+ background-position: -144px -72px;
+}
+
+.icon-move {
+ background-position: -168px -72px;
+}
+
+.icon-step-backward {
+ background-position: -192px -72px;
+}
+
+.icon-fast-backward {
+ background-position: -216px -72px;
+}
+
+.icon-backward {
+ background-position: -240px -72px;
+}
+
+.icon-play {
+ background-position: -264px -72px;
+}
+
+.icon-pause {
+ background-position: -288px -72px;
+}
+
+.icon-stop {
+ background-position: -312px -72px;
+}
+
+.icon-forward {
+ background-position: -336px -72px;
+}
+
+.icon-fast-forward {
+ background-position: -360px -72px;
+}
+
+.icon-step-forward {
+ background-position: -384px -72px;
+}
+
+.icon-eject {
+ background-position: -408px -72px;
+}
+
+.icon-chevron-left {
+ background-position: -432px -72px;
+}
+
+.icon-chevron-right {
+ background-position: -456px -72px;
+}
+
+.icon-plus-sign {
+ background-position: 0 -96px;
+}
+
+.icon-minus-sign {
+ background-position: -24px -96px;
+}
+
+.icon-remove-sign {
+ background-position: -48px -96px;
+}
+
+.icon-ok-sign {
+ background-position: -72px -96px;
+}
+
+.icon-question-sign {
+ background-position: -96px -96px;
+}
+
+.icon-info-sign {
+ background-position: -120px -96px;
+}
+
+.icon-screenshot {
+ background-position: -144px -96px;
+}
+
+.icon-remove-circle {
+ background-position: -168px -96px;
+}
+
+.icon-ok-circle {
+ background-position: -192px -96px;
+}
+
+.icon-ban-circle {
+ background-position: -216px -96px;
+}
+
+.icon-arrow-left {
+ background-position: -240px -96px;
+}
+
+.icon-arrow-right {
+ background-position: -264px -96px;
+}
+
+.icon-arrow-up {
+ background-position: -289px -96px;
+}
+
+.icon-arrow-down {
+ background-position: -312px -96px;
+}
+
+.icon-share-alt {
+ background-position: -336px -96px;
+}
+
+.icon-resize-full {
+ background-position: -360px -96px;
+}
+
+.icon-resize-small {
+ background-position: -384px -96px;
+}
+
+.icon-plus {
+ background-position: -408px -96px;
+}
+
+.icon-minus {
+ background-position: -433px -96px;
+}
+
+.icon-asterisk {
+ background-position: -456px -96px;
+}
+
+.icon-exclamation-sign {
+ background-position: 0 -120px;
+}
+
+.icon-gift {
+ background-position: -24px -120px;
+}
+
+.icon-leaf {
+ background-position: -48px -120px;
+}
+
+.icon-fire {
+ background-position: -72px -120px;
+}
+
+.icon-eye-open {
+ background-position: -96px -120px;
+}
+
+.icon-eye-close {
+ background-position: -120px -120px;
+}
+
+.icon-warning-sign {
+ background-position: -144px -120px;
+}
+
+.icon-plane {
+ background-position: -168px -120px;
+}
+
+.icon-calendar {
+ background-position: -192px -120px;
+}
+
+.icon-random {
+ width: 16px;
+ background-position: -216px -120px;
+}
+
+.icon-comment {
+ background-position: -240px -120px;
+}
+
+.icon-magnet {
+ background-position: -264px -120px;
+}
+
+.icon-chevron-up {
+ background-position: -288px -120px;
+}
+
+.icon-chevron-down {
+ background-position: -313px -119px;
+}
+
+.icon-retweet {
+ background-position: -336px -120px;
+}
+
+.icon-shopping-cart {
+ background-position: -360px -120px;
+}
+
+.icon-folder-close {
+ background-position: -384px -120px;
+}
+
+.icon-folder-open {
+ width: 16px;
+ background-position: -408px -120px;
+}
+
+.icon-resize-vertical {
+ background-position: -432px -119px;
+}
+
+.icon-resize-horizontal {
+ background-position: -456px -118px;
+}
+
+.icon-hdd {
+ background-position: 0 -144px;
+}
+
+.icon-bullhorn {
+ background-position: -24px -144px;
+}
+
+.icon-bell {
+ background-position: -48px -144px;
+}
+
+.icon-certificate {
+ background-position: -72px -144px;
+}
+
+.icon-thumbs-up {
+ background-position: -96px -144px;
+}
+
+.icon-thumbs-down {
+ background-position: -120px -144px;
+}
+
+.icon-hand-right {
+ background-position: -144px -144px;
+}
+
+.icon-hand-left {
+ background-position: -168px -144px;
+}
+
+.icon-hand-up {
+ background-position: -192px -144px;
+}
+
+.icon-hand-down {
+ background-position: -216px -144px;
+}
+
+.icon-circle-arrow-right {
+ background-position: -240px -144px;
+}
+
+.icon-circle-arrow-left {
+ background-position: -264px -144px;
+}
+
+.icon-circle-arrow-up {
+ background-position: -288px -144px;
+}
+
+.icon-circle-arrow-down {
+ background-position: -312px -144px;
+}
+
+.icon-globe {
+ background-position: -336px -144px;
+}
+
+.icon-wrench {
+ background-position: -360px -144px;
+}
+
+.icon-tasks {
+ background-position: -384px -144px;
+}
+
+.icon-filter {
+ background-position: -408px -144px;
+}
+
+.icon-briefcase {
+ background-position: -432px -144px;
+}
+
+.icon-fullscreen {
+ background-position: -456px -144px;
+}
+
+.dropup,
+.dropdown {
+ position: relative;
+}
+
+.dropdown-toggle {
+ *margin-bottom: -3px;
+}
+
+.dropdown-toggle:active,
+.open .dropdown-toggle {
+ outline: 0;
+}
+
+.caret {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ vertical-align: top;
+ border-top: 4px solid #000000;
+ border-right: 4px solid transparent;
+ border-left: 4px solid transparent;
+ content: "";
+}
+
+.dropdown .caret {
+ margin-top: 8px;
+ margin-left: 2px;
+}
+
+.dropdown-menu {
+ position: absolute;
+ top: 100%;
+ left: 0;
+ z-index: 1000;
+ display: none;
+ float: left;
+ min-width: 160px;
+ padding: 5px 0;
+ margin: 2px 0 0;
+ list-style: none;
+ background-color: #ffffff;
+ border: 1px solid #ccc;
+ border: 1px solid rgba(0, 0, 0, 0.2);
+ *border-right-width: 2px;
+ *border-bottom-width: 2px;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+ -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ -moz-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding;
+ background-clip: padding-box;
+}
+
+.dropdown-menu.pull-right {
+ right: 0;
+ left: auto;
+}
+
+.dropdown-menu .divider {
+ *width: 100%;
+ height: 1px;
+ margin: 9px 1px;
+ *margin: -5px 0 5px;
+ overflow: hidden;
+ background-color: #e5e5e5;
+ border-bottom: 1px solid #ffffff;
+}
+
+.dropdown-menu a {
+ display: block;
+ padding: 3px 20px;
+ clear: both;
+ font-weight: normal;
+ line-height: 20px;
+ color: #333333;
+ white-space: nowrap;
+}
+
+.dropdown-menu li > a:hover,
+.dropdown-menu li > a:focus,
+.dropdown-submenu:hover > a {
+ color: #ffffff;
+ text-decoration: none;
+ background-color: #0088cc;
+ background-color: #0081c2;
+ background-image: -moz-linear-gradient(top, #0088cc, #0077b3);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0077b3));
+ background-image: -webkit-linear-gradient(top, #0088cc, #0077b3);
+ background-image: -o-linear-gradient(top, #0088cc, #0077b3);
+ background-image: linear-gradient(to bottom, #0088cc, #0077b3);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0077b3', GradientType=0);
+}
+
+.dropdown-menu .active > a,
+.dropdown-menu .active > a:hover {
+ color: #ffffff;
+ text-decoration: none;
+ background-color: #0088cc;
+ background-color: #0081c2;
+ background-image: linear-gradient(to bottom, #0088cc, #0077b3);
+ background-image: -moz-linear-gradient(top, #0088cc, #0077b3);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0077b3));
+ background-image: -webkit-linear-gradient(top, #0088cc, #0077b3);
+ background-image: -o-linear-gradient(top, #0088cc, #0077b3);
+ background-repeat: repeat-x;
+ outline: 0;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0077b3', GradientType=0);
+}
+
+.dropdown-menu .disabled > a,
+.dropdown-menu .disabled > a:hover {
+ color: #999999;
+}
+
+.dropdown-menu .disabled > a:hover {
+ text-decoration: none;
+ cursor: default;
+ background-color: transparent;
+}
+
+.open {
+ *z-index: 1000;
+}
+
+.open > .dropdown-menu {
+ display: block;
+}
+
+.pull-right > .dropdown-menu {
+ right: 0;
+ left: auto;
+}
+
+.dropup .caret,
+.navbar-fixed-bottom .dropdown .caret {
+ border-top: 0;
+ border-bottom: 4px solid #000000;
+ content: "";
+}
+
+.dropup .dropdown-menu,
+.navbar-fixed-bottom .dropdown .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+ margin-bottom: 1px;
+}
+
+.dropdown-submenu {
+ position: relative;
+}
+
+.dropdown-submenu > .dropdown-menu {
+ top: 0;
+ left: 100%;
+ margin-top: -6px;
+ margin-left: -1px;
+ -webkit-border-radius: 0 6px 6px 6px;
+ -moz-border-radius: 0 6px 6px 6px;
+ border-radius: 0 6px 6px 6px;
+}
+
+.dropdown-submenu:hover > .dropdown-menu {
+ display: block;
+}
+
+.dropdown-submenu > a:after {
+ display: block;
+ float: right;
+ width: 0;
+ height: 0;
+ margin-top: 5px;
+ margin-right: -10px;
+ border-color: transparent;
+ border-left-color: #cccccc;
+ border-style: solid;
+ border-width: 5px 0 5px 5px;
+ content: " ";
+}
+
+.dropdown-submenu:hover > a:after {
+ border-left-color: #ffffff;
+}
+
+.dropdown .dropdown-menu .nav-header {
+ padding-right: 20px;
+ padding-left: 20px;
+}
+
+.typeahead {
+ margin-top: 2px;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.well {
+ min-height: 20px;
+ padding: 19px;
+ margin-bottom: 20px;
+ background-color: #f5f5f5;
+ border: 1px solid #e3e3e3;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+}
+
+.well blockquote {
+ border-color: #ddd;
+ border-color: rgba(0, 0, 0, 0.15);
+}
+
+.well-large {
+ padding: 24px;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+}
+
+.well-small {
+ padding: 9px;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+.fade {
+ opacity: 0;
+ -webkit-transition: opacity 0.15s linear;
+ -moz-transition: opacity 0.15s linear;
+ -o-transition: opacity 0.15s linear;
+ transition: opacity 0.15s linear;
+}
+
+.fade.in {
+ opacity: 1;
+}
+
+.collapse {
+ position: relative;
+ height: 0;
+ overflow: hidden;
+ -webkit-transition: height 0.35s ease;
+ -moz-transition: height 0.35s ease;
+ -o-transition: height 0.35s ease;
+ transition: height 0.35s ease;
+}
+
+.collapse.in {
+ height: auto;
+}
+
+.close {
+ float: right;
+ font-size: 20px;
+ font-weight: bold;
+ line-height: 20px;
+ color: #000000;
+ text-shadow: 0 1px 0 #ffffff;
+ opacity: 0.2;
+ filter: alpha(opacity=20);
+}
+
+.close:hover {
+ color: #000000;
+ text-decoration: none;
+ cursor: pointer;
+ opacity: 0.4;
+ filter: alpha(opacity=40);
+}
+
+button.close {
+ padding: 0;
+ cursor: pointer;
+ background: transparent;
+ border: 0;
+ -webkit-appearance: none;
+}
+
+.btn {
+ display: inline-block;
+ *display: inline;
+ padding: 4px 14px;
+ margin-bottom: 0;
+ *margin-left: .3em;
+ font-size: 14px;
+ line-height: 20px;
+ *line-height: 20px;
+ color: #333333;
+ text-align: center;
+ text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75);
+ vertical-align: middle;
+ cursor: pointer;
+ background-color: #f5f5f5;
+ *background-color: #e6e6e6;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6));
+ background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6);
+ background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
+ background-image: linear-gradient(to bottom, #ffffff, #e6e6e6);
+ background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6);
+ background-repeat: repeat-x;
+ border: 1px solid #bbbbbb;
+ *border: 0;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ border-color: #e6e6e6 #e6e6e6 #bfbfbf;
+ border-bottom-color: #a2a2a2;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe6e6e6', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+ *zoom: 1;
+ -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn:hover,
+.btn:active,
+.btn.active,
+.btn.disabled,
+.btn[disabled] {
+ color: #333333;
+ background-color: #e6e6e6;
+ *background-color: #d9d9d9;
+}
+
+.btn:active,
+.btn.active {
+ background-color: #cccccc \9;
+}
+
+.btn:first-child {
+ *margin-left: 0;
+}
+
+.btn:hover {
+ color: #333333;
+ text-decoration: none;
+ background-color: #e6e6e6;
+ *background-color: #d9d9d9;
+ /* Buttons in IE7 don't get borders, so darken on hover */
+
+ background-position: 0 -15px;
+ -webkit-transition: background-position 0.1s linear;
+ -moz-transition: background-position 0.1s linear;
+ -o-transition: background-position 0.1s linear;
+ transition: background-position 0.1s linear;
+}
+
+.btn:focus {
+ outline: thin dotted #333;
+ outline: 5px auto -webkit-focus-ring-color;
+ outline-offset: -2px;
+}
+
+.btn.active,
+.btn:active {
+ background-color: #e6e6e6;
+ background-color: #d9d9d9 \9;
+ background-image: none;
+ outline: 0;
+ -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn.disabled,
+.btn[disabled] {
+ cursor: default;
+ background-color: #e6e6e6;
+ background-image: none;
+ opacity: 0.65;
+ filter: alpha(opacity=65);
+ -webkit-box-shadow: none;
+ -moz-box-shadow: none;
+ box-shadow: none;
+}
+
+.btn-large {
+ padding: 9px 14px;
+ font-size: 16px;
+ line-height: normal;
+ -webkit-border-radius: 5px;
+ -moz-border-radius: 5px;
+ border-radius: 5px;
+}
+
+.btn-large [class^="icon-"] {
+ margin-top: 2px;
+}
+
+.btn-small {
+ padding: 3px 9px;
+ font-size: 12px;
+ line-height: 18px;
+}
+
+.btn-small [class^="icon-"] {
+ margin-top: 0;
+}
+
+.btn-mini {
+ padding: 2px 6px;
+ font-size: 11px;
+ line-height: 17px;
+}
+
+.btn-block {
+ display: block;
+ width: 100%;
+ padding-right: 0;
+ padding-left: 0;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+.btn-block + .btn-block {
+ margin-top: 5px;
+}
+
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+ width: 100%;
+}
+
+.btn-primary.active,
+.btn-warning.active,
+.btn-danger.active,
+.btn-success.active,
+.btn-info.active,
+.btn-inverse.active {
+ color: rgba(255, 255, 255, 0.75);
+}
+
+.btn {
+ border-color: #c5c5c5;
+ border-color: rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.15) rgba(0, 0, 0, 0.25);
+}
+
+.btn-primary {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #006dcc;
+ *background-color: #0044cc;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0044cc));
+ background-image: -webkit-linear-gradient(top, #0088cc, #0044cc);
+ background-image: -o-linear-gradient(top, #0088cc, #0044cc);
+ background-image: linear-gradient(to bottom, #0088cc, #0044cc);
+ background-image: -moz-linear-gradient(top, #0088cc, #0044cc);
+ background-repeat: repeat-x;
+ border-color: #0044cc #0044cc #002a80;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0044cc', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-primary:hover,
+.btn-primary:active,
+.btn-primary.active,
+.btn-primary.disabled,
+.btn-primary[disabled] {
+ color: #ffffff;
+ background-color: #0044cc;
+ *background-color: #003bb3;
+}
+
+.btn-primary:active,
+.btn-primary.active {
+ background-color: #003399 \9;
+}
+
+.btn-warning {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #faa732;
+ *background-color: #f89406;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
+ background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
+ background-image: -o-linear-gradient(top, #fbb450, #f89406);
+ background-image: linear-gradient(to bottom, #fbb450, #f89406);
+ background-image: -moz-linear-gradient(top, #fbb450, #f89406);
+ background-repeat: repeat-x;
+ border-color: #f89406 #f89406 #ad6704;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#fffbb450', endColorstr='#fff89406', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-warning:hover,
+.btn-warning:active,
+.btn-warning.active,
+.btn-warning.disabled,
+.btn-warning[disabled] {
+ color: #ffffff;
+ background-color: #f89406;
+ *background-color: #df8505;
+}
+
+.btn-warning:active,
+.btn-warning.active {
+ background-color: #c67605 \9;
+}
+
+.btn-danger {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #da4f49;
+ *background-color: #bd362f;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f));
+ background-image: -webkit-linear-gradient(top, #ee5f5b, #bd362f);
+ background-image: -o-linear-gradient(top, #ee5f5b, #bd362f);
+ background-image: linear-gradient(to bottom, #ee5f5b, #bd362f);
+ background-image: -moz-linear-gradient(top, #ee5f5b, #bd362f);
+ background-repeat: repeat-x;
+ border-color: #bd362f #bd362f #802420;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ffee5f5b', endColorstr='#ffbd362f', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-danger:hover,
+.btn-danger:active,
+.btn-danger.active,
+.btn-danger.disabled,
+.btn-danger[disabled] {
+ color: #ffffff;
+ background-color: #bd362f;
+ *background-color: #a9302a;
+}
+
+.btn-danger:active,
+.btn-danger.active {
+ background-color: #942a25 \9;
+}
+
+.btn-success {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #5bb75b;
+ *background-color: #51a351;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351));
+ background-image: -webkit-linear-gradient(top, #62c462, #51a351);
+ background-image: -o-linear-gradient(top, #62c462, #51a351);
+ background-image: linear-gradient(to bottom, #62c462, #51a351);
+ background-image: -moz-linear-gradient(top, #62c462, #51a351);
+ background-repeat: repeat-x;
+ border-color: #51a351 #51a351 #387038;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff62c462', endColorstr='#ff51a351', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-success:hover,
+.btn-success:active,
+.btn-success.active,
+.btn-success.disabled,
+.btn-success[disabled] {
+ color: #ffffff;
+ background-color: #51a351;
+ *background-color: #499249;
+}
+
+.btn-success:active,
+.btn-success.active {
+ background-color: #408140 \9;
+}
+
+.btn-info {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #49afcd;
+ *background-color: #2f96b4;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4));
+ background-image: -webkit-linear-gradient(top, #5bc0de, #2f96b4);
+ background-image: -o-linear-gradient(top, #5bc0de, #2f96b4);
+ background-image: linear-gradient(to bottom, #5bc0de, #2f96b4);
+ background-image: -moz-linear-gradient(top, #5bc0de, #2f96b4);
+ background-repeat: repeat-x;
+ border-color: #2f96b4 #2f96b4 #1f6377;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2f96b4', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-info:hover,
+.btn-info:active,
+.btn-info.active,
+.btn-info.disabled,
+.btn-info[disabled] {
+ color: #ffffff;
+ background-color: #2f96b4;
+ *background-color: #2a85a0;
+}
+
+.btn-info:active,
+.btn-info.active {
+ background-color: #24748c \9;
+}
+
+.btn-inverse {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #363636;
+ *background-color: #222222;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#444444), to(#222222));
+ background-image: -webkit-linear-gradient(top, #444444, #222222);
+ background-image: -o-linear-gradient(top, #444444, #222222);
+ background-image: linear-gradient(to bottom, #444444, #222222);
+ background-image: -moz-linear-gradient(top, #444444, #222222);
+ background-repeat: repeat-x;
+ border-color: #222222 #222222 #000000;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff444444', endColorstr='#ff222222', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-inverse:hover,
+.btn-inverse:active,
+.btn-inverse.active,
+.btn-inverse.disabled,
+.btn-inverse[disabled] {
+ color: #ffffff;
+ background-color: #222222;
+ *background-color: #151515;
+}
+
+.btn-inverse:active,
+.btn-inverse.active {
+ background-color: #080808 \9;
+}
+
+button.btn,
+input[type="submit"].btn {
+ *padding-top: 3px;
+ *padding-bottom: 3px;
+}
+
+button.btn::-moz-focus-inner,
+input[type="submit"].btn::-moz-focus-inner {
+ padding: 0;
+ border: 0;
+}
+
+button.btn.btn-large,
+input[type="submit"].btn.btn-large {
+ *padding-top: 7px;
+ *padding-bottom: 7px;
+}
+
+button.btn.btn-small,
+input[type="submit"].btn.btn-small {
+ *padding-top: 3px;
+ *padding-bottom: 3px;
+}
+
+button.btn.btn-mini,
+input[type="submit"].btn.btn-mini {
+ *padding-top: 1px;
+ *padding-bottom: 1px;
+}
+
+.btn-link,
+.btn-link:active,
+.btn-link[disabled] {
+ background-color: transparent;
+ background-image: none;
+ -webkit-box-shadow: none;
+ -moz-box-shadow: none;
+ box-shadow: none;
+}
+
+.btn-link {
+ color: #0088cc;
+ cursor: pointer;
+ border-color: transparent;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.btn-link:hover {
+ color: #005580;
+ text-decoration: underline;
+ background-color: transparent;
+}
+
+.btn-link[disabled]:hover {
+ color: #333333;
+ text-decoration: none;
+}
+
+.btn-group {
+ position: relative;
+ *margin-left: .3em;
+ font-size: 0;
+ white-space: nowrap;
+ vertical-align: middle;
+}
+
+.btn-group:first-child {
+ *margin-left: 0;
+}
+
+.btn-group + .btn-group {
+ margin-left: 5px;
+}
+
+.btn-toolbar {
+ margin-top: 10px;
+ margin-bottom: 10px;
+ font-size: 0;
+}
+
+.btn-toolbar .btn-group {
+ display: inline-block;
+ *display: inline;
+ /* IE7 inline-block hack */
+
+ *zoom: 1;
+}
+
+.btn-toolbar .btn + .btn,
+.btn-toolbar .btn-group + .btn,
+.btn-toolbar .btn + .btn-group {
+ margin-left: 5px;
+}
+
+.btn-group > .btn {
+ position: relative;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.btn-group > .btn + .btn {
+ margin-left: -1px;
+}
+
+.btn-group > .btn,
+.btn-group > .dropdown-menu {
+ font-size: 14px;
+}
+
+.btn-group > .btn-mini {
+ font-size: 11px;
+}
+
+.btn-group > .btn-small {
+ font-size: 12px;
+}
+
+.btn-group > .btn-large {
+ font-size: 16px;
+}
+
+.btn-group > .btn:first-child {
+ margin-left: 0;
+ -webkit-border-bottom-left-radius: 4px;
+ border-bottom-left-radius: 4px;
+ -webkit-border-top-left-radius: 4px;
+ border-top-left-radius: 4px;
+ -moz-border-radius-bottomleft: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.btn-group > .btn:last-child,
+.btn-group > .dropdown-toggle {
+ -webkit-border-top-right-radius: 4px;
+ border-top-right-radius: 4px;
+ -webkit-border-bottom-right-radius: 4px;
+ border-bottom-right-radius: 4px;
+ -moz-border-radius-topright: 4px;
+ -moz-border-radius-bottomright: 4px;
+}
+
+.btn-group > .btn.large:first-child {
+ margin-left: 0;
+ -webkit-border-bottom-left-radius: 6px;
+ border-bottom-left-radius: 6px;
+ -webkit-border-top-left-radius: 6px;
+ border-top-left-radius: 6px;
+ -moz-border-radius-bottomleft: 6px;
+ -moz-border-radius-topleft: 6px;
+}
+
+.btn-group > .btn.large:last-child,
+.btn-group > .large.dropdown-toggle {
+ -webkit-border-top-right-radius: 6px;
+ border-top-right-radius: 6px;
+ -webkit-border-bottom-right-radius: 6px;
+ border-bottom-right-radius: 6px;
+ -moz-border-radius-topright: 6px;
+ -moz-border-radius-bottomright: 6px;
+}
+
+.btn-group > .btn:hover,
+.btn-group > .btn:focus,
+.btn-group > .btn:active,
+.btn-group > .btn.active {
+ z-index: 2;
+}
+
+.btn-group .dropdown-toggle:active,
+.btn-group.open .dropdown-toggle {
+ outline: 0;
+}
+
+.btn-group > .btn + .dropdown-toggle {
+ *padding-top: 5px;
+ padding-right: 8px;
+ *padding-bottom: 5px;
+ padding-left: 8px;
+ -webkit-box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn-group > .btn-mini + .dropdown-toggle {
+ *padding-top: 2px;
+ padding-right: 5px;
+ *padding-bottom: 2px;
+ padding-left: 5px;
+}
+
+.btn-group > .btn-small + .dropdown-toggle {
+ *padding-top: 5px;
+ *padding-bottom: 4px;
+}
+
+.btn-group > .btn-large + .dropdown-toggle {
+ *padding-top: 7px;
+ padding-right: 12px;
+ *padding-bottom: 7px;
+ padding-left: 12px;
+}
+
+.btn-group.open .dropdown-toggle {
+ background-image: none;
+ -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn-group.open .btn.dropdown-toggle {
+ background-color: #e6e6e6;
+}
+
+.btn-group.open .btn-primary.dropdown-toggle {
+ background-color: #0044cc;
+}
+
+.btn-group.open .btn-warning.dropdown-toggle {
+ background-color: #f89406;
+}
+
+.btn-group.open .btn-danger.dropdown-toggle {
+ background-color: #bd362f;
+}
+
+.btn-group.open .btn-success.dropdown-toggle {
+ background-color: #51a351;
+}
+
+.btn-group.open .btn-info.dropdown-toggle {
+ background-color: #2f96b4;
+}
+
+.btn-group.open .btn-inverse.dropdown-toggle {
+ background-color: #222222;
+}
+
+.btn .caret {
+ margin-top: 8px;
+ margin-left: 0;
+}
+
+.btn-mini .caret,
+.btn-small .caret,
+.btn-large .caret {
+ margin-top: 6px;
+}
+
+.btn-large .caret {
+ border-top-width: 5px;
+ border-right-width: 5px;
+ border-left-width: 5px;
+}
+
+.dropup .btn-large .caret {
+ border-top: 0;
+ border-bottom: 5px solid #000000;
+}
+
+.btn-primary .caret,
+.btn-warning .caret,
+.btn-danger .caret,
+.btn-info .caret,
+.btn-success .caret,
+.btn-inverse .caret {
+ border-top-color: #ffffff;
+ border-bottom-color: #ffffff;
+}
+
+.btn-group-vertical {
+ display: inline-block;
+ *display: inline;
+ /* IE7 inline-block hack */
+
+ *zoom: 1;
+}
+
+.btn-group-vertical .btn {
+ display: block;
+ float: none;
+ width: 100%;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.btn-group-vertical .btn + .btn {
+ margin-top: -1px;
+ margin-left: 0;
+}
+
+.btn-group-vertical .btn:first-child {
+ -webkit-border-radius: 4px 4px 0 0;
+ -moz-border-radius: 4px 4px 0 0;
+ border-radius: 4px 4px 0 0;
+}
+
+.btn-group-vertical .btn:last-child {
+ -webkit-border-radius: 0 0 4px 4px;
+ -moz-border-radius: 0 0 4px 4px;
+ border-radius: 0 0 4px 4px;
+}
+
+.btn-group-vertical .btn-large:first-child {
+ -webkit-border-radius: 6px 6px 0 0;
+ -moz-border-radius: 6px 6px 0 0;
+ border-radius: 6px 6px 0 0;
+}
+
+.btn-group-vertical .btn-large:last-child {
+ -webkit-border-radius: 0 0 6px 6px;
+ -moz-border-radius: 0 0 6px 6px;
+ border-radius: 0 0 6px 6px;
+}
+
+.alert {
+ padding: 8px 35px 8px 14px;
+ margin-bottom: 20px;
+ color: #c09853;
+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
+ background-color: #fcf8e3;
+ border: 1px solid #fbeed5;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.alert h4 {
+ margin: 0;
+}
+
+.alert .close {
+ position: relative;
+ top: -2px;
+ right: -21px;
+ line-height: 20px;
+}
+
+.alert-success {
+ color: #468847;
+ background-color: #dff0d8;
+ border-color: #d6e9c6;
+}
+
+.alert-danger,
+.alert-error {
+ color: #b94a48;
+ background-color: #f2dede;
+ border-color: #eed3d7;
+}
+
+.alert-info {
+ color: #3a87ad;
+ background-color: #d9edf7;
+ border-color: #bce8f1;
+}
+
+.alert-block {
+ padding-top: 14px;
+ padding-bottom: 14px;
+}
+
+.alert-block > p,
+.alert-block > ul {
+ margin-bottom: 0;
+}
+
+.alert-block p + p {
+ margin-top: 5px;
+}
+
+.nav {
+ margin-bottom: 20px;
+ margin-left: 0;
+ list-style: none;
+}
+
+.nav > li > a {
+ display: block;
+}
+
+.nav > li > a:hover {
+ text-decoration: none;
+ background-color: #eeeeee;
+}
+
+.nav > .pull-right {
+ float: right;
+}
+
+.nav-header {
+ display: block;
+ padding: 3px 15px;
+ font-size: 11px;
+ font-weight: bold;
+ line-height: 20px;
+ color: #999999;
+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
+ text-transform: uppercase;
+}
+
+.nav li + .nav-header {
+ margin-top: 9px;
+}
+
+.nav-list {
+ padding-right: 15px;
+ padding-left: 15px;
+ margin-bottom: 0;
+}
+
+.nav-list > li > a,
+.nav-list .nav-header {
+ margin-right: -15px;
+ margin-left: -15px;
+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
+}
+
+.nav-list > li > a {
+ padding: 3px 15px;
+}
+
+.nav-list > .active > a,
+.nav-list > .active > a:hover {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.2);
+ background-color: #0088cc;
+}
+
+.nav-list [class^="icon-"] {
+ margin-right: 2px;
+}
+
+.nav-list .divider {
+ *width: 100%;
+ height: 1px;
+ margin: 9px 1px;
+ *margin: -5px 0 5px;
+ overflow: hidden;
+ background-color: #e5e5e5;
+ border-bottom: 1px solid #ffffff;
+}
+
+.nav-tabs,
+.nav-pills {
+ *zoom: 1;
+}
+
+.nav-tabs:before,
+.nav-pills:before,
+.nav-tabs:after,
+.nav-pills:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.nav-tabs:after,
+.nav-pills:after {
+ clear: both;
+}
+
+.nav-tabs > li,
+.nav-pills > li {
+ float: left;
+}
+
+.nav-tabs > li > a,
+.nav-pills > li > a {
+ padding-right: 12px;
+ padding-left: 12px;
+ margin-right: 2px;
+ line-height: 14px;
+}
+
+.nav-tabs {
+ border-bottom: 1px solid #ddd;
+}
+
+.nav-tabs > li {
+ margin-bottom: -1px;
+}
+
+.nav-tabs > li > a {
+ padding-top: 8px;
+ padding-bottom: 8px;
+ line-height: 20px;
+ border: 1px solid transparent;
+ -webkit-border-radius: 4px 4px 0 0;
+ -moz-border-radius: 4px 4px 0 0;
+ border-radius: 4px 4px 0 0;
+}
+
+.nav-tabs > li > a:hover {
+ border-color: #eeeeee #eeeeee #dddddd;
+}
+
+.nav-tabs > .active > a,
+.nav-tabs > .active > a:hover {
+ color: #555555;
+ cursor: default;
+ background-color: #ffffff;
+ border: 1px solid #ddd;
+ border-bottom-color: transparent;
+}
+
+.nav-pills > li > a {
+ padding-top: 8px;
+ padding-bottom: 8px;
+ margin-top: 2px;
+ margin-bottom: 2px;
+ -webkit-border-radius: 5px;
+ -moz-border-radius: 5px;
+ border-radius: 5px;
+}
+
+.nav-pills > .active > a,
+.nav-pills > .active > a:hover {
+ color: #ffffff;
+ background-color: #0088cc;
+}
+
+.nav-stacked > li {
+ float: none;
+}
+
+.nav-stacked > li > a {
+ margin-right: 0;
+}
+
+.nav-tabs.nav-stacked {
+ border-bottom: 0;
+}
+
+.nav-tabs.nav-stacked > li > a {
+ border: 1px solid #ddd;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.nav-tabs.nav-stacked > li:first-child > a {
+ -webkit-border-top-right-radius: 4px;
+ border-top-right-radius: 4px;
+ -webkit-border-top-left-radius: 4px;
+ border-top-left-radius: 4px;
+ -moz-border-radius-topright: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.nav-tabs.nav-stacked > li:last-child > a {
+ -webkit-border-bottom-right-radius: 4px;
+ border-bottom-right-radius: 4px;
+ -webkit-border-bottom-left-radius: 4px;
+ border-bottom-left-radius: 4px;
+ -moz-border-radius-bottomright: 4px;
+ -moz-border-radius-bottomleft: 4px;
+}
+
+.nav-tabs.nav-stacked > li > a:hover {
+ z-index: 2;
+ border-color: #ddd;
+}
+
+.nav-pills.nav-stacked > li > a {
+ margin-bottom: 3px;
+}
+
+.nav-pills.nav-stacked > li:last-child > a {
+ margin-bottom: 1px;
+}
+
+.nav-tabs .dropdown-menu {
+ -webkit-border-radius: 0 0 6px 6px;
+ -moz-border-radius: 0 0 6px 6px;
+ border-radius: 0 0 6px 6px;
+}
+
+.nav-pills .dropdown-menu {
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+}
+
+.nav .dropdown-toggle .caret {
+ margin-top: 6px;
+ border-top-color: #0088cc;
+ border-bottom-color: #0088cc;
+}
+
+.nav .dropdown-toggle:hover .caret {
+ border-top-color: #005580;
+ border-bottom-color: #005580;
+}
+
+/* move down carets for tabs */
+
+.nav-tabs .dropdown-toggle .caret {
+ margin-top: 8px;
+}
+
+.nav .active .dropdown-toggle .caret {
+ border-top-color: #fff;
+ border-bottom-color: #fff;
+}
+
+.nav-tabs .active .dropdown-toggle .caret {
+ border-top-color: #555555;
+ border-bottom-color: #555555;
+}
+
+.nav > .dropdown.active > a:hover {
+ cursor: pointer;
+}
+
+.nav-tabs .open .dropdown-toggle,
+.nav-pills .open .dropdown-toggle,
+.nav > li.dropdown.open.active > a:hover {
+ color: #ffffff;
+ background-color: #999999;
+ border-color: #999999;
+}
+
+.nav li.dropdown.open .caret,
+.nav li.dropdown.open.active .caret,
+.nav li.dropdown.open a:hover .caret {
+ border-top-color: #ffffff;
+ border-bottom-color: #ffffff;
+ opacity: 1;
+ filter: alpha(opacity=100);
+}
+
+.tabs-stacked .open > a:hover {
+ border-color: #999999;
+}
+
+.tabbable {
+ *zoom: 1;
+}
+
+.tabbable:before,
+.tabbable:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.tabbable:after {
+ clear: both;
+}
+
+.tab-content {
+ overflow: auto;
+}
+
+.tabs-below > .nav-tabs,
+.tabs-right > .nav-tabs,
+.tabs-left > .nav-tabs {
+ border-bottom: 0;
+}
+
+.tab-content > .tab-pane,
+.pill-content > .pill-pane {
+ display: none;
+}
+
+.tab-content > .active,
+.pill-content > .active {
+ display: block;
+}
+
+.tabs-below > .nav-tabs {
+ border-top: 1px solid #ddd;
+}
+
+.tabs-below > .nav-tabs > li {
+ margin-top: -1px;
+ margin-bottom: 0;
+}
+
+.tabs-below > .nav-tabs > li > a {
+ -webkit-border-radius: 0 0 4px 4px;
+ -moz-border-radius: 0 0 4px 4px;
+ border-radius: 0 0 4px 4px;
+}
+
+.tabs-below > .nav-tabs > li > a:hover {
+ border-top-color: #ddd;
+ border-bottom-color: transparent;
+}
+
+.tabs-below > .nav-tabs > .active > a,
+.tabs-below > .nav-tabs > .active > a:hover {
+ border-color: transparent #ddd #ddd #ddd;
+}
+
+.tabs-left > .nav-tabs > li,
+.tabs-right > .nav-tabs > li {
+ float: none;
+}
+
+.tabs-left > .nav-tabs > li > a,
+.tabs-right > .nav-tabs > li > a {
+ min-width: 74px;
+ margin-right: 0;
+ margin-bottom: 3px;
+}
+
+.tabs-left > .nav-tabs {
+ float: left;
+ margin-right: 19px;
+ border-right: 1px solid #ddd;
+}
+
+.tabs-left > .nav-tabs > li > a {
+ margin-right: -1px;
+ -webkit-border-radius: 4px 0 0 4px;
+ -moz-border-radius: 4px 0 0 4px;
+ border-radius: 4px 0 0 4px;
+}
+
+.tabs-left > .nav-tabs > li > a:hover {
+ border-color: #eeeeee #dddddd #eeeeee #eeeeee;
+}
+
+.tabs-left > .nav-tabs .active > a,
+.tabs-left > .nav-tabs .active > a:hover {
+ border-color: #ddd transparent #ddd #ddd;
+ *border-right-color: #ffffff;
+}
+
+.tabs-right > .nav-tabs {
+ float: right;
+ margin-left: 19px;
+ border-left: 1px solid #ddd;
+}
+
+.tabs-right > .nav-tabs > li > a {
+ margin-left: -1px;
+ -webkit-border-radius: 0 4px 4px 0;
+ -moz-border-radius: 0 4px 4px 0;
+ border-radius: 0 4px 4px 0;
+}
+
+.tabs-right > .nav-tabs > li > a:hover {
+ border-color: #eeeeee #eeeeee #eeeeee #dddddd;
+}
+
+.tabs-right > .nav-tabs .active > a,
+.tabs-right > .nav-tabs .active > a:hover {
+ border-color: #ddd #ddd #ddd transparent;
+ *border-left-color: #ffffff;
+}
+
+.nav > .disabled > a {
+ color: #999999;
+}
+
+.nav > .disabled > a:hover {
+ text-decoration: none;
+ cursor: default;
+ background-color: transparent;
+}
+
+.navbar {
+ *position: relative;
+ *z-index: 2;
+ margin-bottom: 20px;
+ overflow: visible;
+ color: #777777;
+}
+
+.navbar-inner {
+ min-height: 40px;
+ padding-right: 20px;
+ padding-left: 20px;
+ background-color: #fafafa;
+ background-image: -moz-linear-gradient(top, #ffffff, #f2f2f2);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#f2f2f2));
+ background-image: -webkit-linear-gradient(top, #ffffff, #f2f2f2);
+ background-image: -o-linear-gradient(top, #ffffff, #f2f2f2);
+ background-image: linear-gradient(to bottom, #ffffff, #f2f2f2);
+ background-repeat: repeat-x;
+ border: 1px solid #d4d4d4;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ffffffff', endColorstr='#fff2f2f2', GradientType=0);
+ *zoom: 1;
+ -webkit-box-shadow: 0 1px 4px rgba(0, 0, 0, 0.065);
+ -moz-box-shadow: 0 1px 4px rgba(0, 0, 0, 0.065);
+ box-shadow: 0 1px 4px rgba(0, 0, 0, 0.065);
+}
+
+.navbar-inner:before,
+.navbar-inner:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.navbar-inner:after {
+ clear: both;
+}
+
+.navbar .container {
+ width: auto;
+}
+
+.nav-collapse.collapse {
+ height: auto;
+}
+
+.navbar .brand {
+ display: block;
+ float: left;
+ padding: 10px 20px 10px;
+ margin-left: -20px;
+ font-size: 20px;
+ font-weight: 200;
+ color: #777777;
+ text-shadow: 0 1px 0 #ffffff;
+}
+
+.navbar .brand:hover {
+ text-decoration: none;
+}
+
+.navbar-text {
+ margin-bottom: 0;
+ line-height: 40px;
+}
+
+.navbar-link {
+ color: #777777;
+}
+
+.navbar-link:hover {
+ color: #333333;
+}
+
+.navbar .divider-vertical {
+ height: 40px;
+ margin: 0 9px;
+ border-right: 1px solid #ffffff;
+ border-left: 1px solid #f2f2f2;
+}
+
+.navbar .btn,
+.navbar .btn-group {
+ margin-top: 5px;
+}
+
+.navbar .btn-group .btn,
+.navbar .input-prepend .btn,
+.navbar .input-append .btn {
+ margin-top: 0;
+}
+
+.navbar-form {
+ margin-bottom: 0;
+ *zoom: 1;
+}
+
+.navbar-form:before,
+.navbar-form:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.navbar-form:after {
+ clear: both;
+}
+
+.navbar-form input,
+.navbar-form select,
+.navbar-form .radio,
+.navbar-form .checkbox {
+ margin-top: 5px;
+}
+
+.navbar-form input,
+.navbar-form select,
+.navbar-form .btn {
+ display: inline-block;
+ margin-bottom: 0;
+}
+
+.navbar-form input[type="image"],
+.navbar-form input[type="checkbox"],
+.navbar-form input[type="radio"] {
+ margin-top: 3px;
+}
+
+.navbar-form .input-append,
+.navbar-form .input-prepend {
+ margin-top: 6px;
+ white-space: nowrap;
+}
+
+.navbar-form .input-append input,
+.navbar-form .input-prepend input {
+ margin-top: 0;
+}
+
+.navbar-search {
+ position: relative;
+ float: left;
+ margin-top: 5px;
+ margin-bottom: 0;
+}
+
+.navbar-search .search-query {
+ padding: 4px 14px;
+ margin-bottom: 0;
+ font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+ font-size: 13px;
+ font-weight: normal;
+ line-height: 1;
+ -webkit-border-radius: 15px;
+ -moz-border-radius: 15px;
+ border-radius: 15px;
+}
+
+.navbar-static-top {
+ position: static;
+ width: 100%;
+ margin-bottom: 0;
+}
+
+.navbar-static-top .navbar-inner {
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.navbar-fixed-top,
+.navbar-fixed-bottom {
+ position: fixed;
+ right: 0;
+ left: 0;
+ z-index: 1030;
+ margin-bottom: 0;
+}
+
+.navbar-fixed-top .navbar-inner,
+.navbar-static-top .navbar-inner {
+ border-width: 0 0 1px;
+}
+
+.navbar-fixed-bottom .navbar-inner {
+ border-width: 1px 0 0;
+}
+
+.navbar-fixed-top .navbar-inner,
+.navbar-fixed-bottom .navbar-inner {
+ padding-right: 0;
+ padding-left: 0;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.navbar-static-top .container,
+.navbar-fixed-top .container,
+.navbar-fixed-bottom .container {
+ width: 940px;
+}
+
+.navbar-fixed-top {
+ top: 0;
+}
+
+.navbar-fixed-top .navbar-inner,
+.navbar-static-top .navbar-inner {
+ -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.1), 0 1px 10px rgba(0, 0, 0, 0.1);
+ -moz-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.1), 0 1px 10px rgba(0, 0, 0, 0.1);
+ box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.1), 0 1px 10px rgba(0, 0, 0, 0.1);
+}
+
+.navbar-fixed-bottom {
+ bottom: 0;
+}
+
+.navbar-fixed-bottom .navbar-inner {
+ -webkit-box-shadow: inset 0 1px 0 rgba(0, 0, 0, 0.1), 0 -1px 10px rgba(0, 0, 0, 0.1);
+ -moz-box-shadow: inset 0 1px 0 rgba(0, 0, 0, 0.1), 0 -1px 10px rgba(0, 0, 0, 0.1);
+ box-shadow: inset 0 1px 0 rgba(0, 0, 0, 0.1), 0 -1px 10px rgba(0, 0, 0, 0.1);
+}
+
+.navbar .nav {
+ position: relative;
+ left: 0;
+ display: block;
+ float: left;
+ margin: 0 10px 0 0;
+}
+
+.navbar .nav.pull-right {
+ float: right;
+ margin-right: 0;
+}
+
+.navbar .nav > li {
+ float: left;
+}
+
+.navbar .nav > li > a {
+ float: none;
+ padding: 10px 15px 10px;
+ color: #777777;
+ text-decoration: none;
+ text-shadow: 0 1px 0 #ffffff;
+}
+
+.navbar .nav .dropdown-toggle .caret {
+ margin-top: 8px;
+}
+
+.navbar .nav > li > a:focus,
+.navbar .nav > li > a:hover {
+ color: #333333;
+ text-decoration: none;
+ background-color: transparent;
+}
+
+.navbar .nav > .active > a,
+.navbar .nav > .active > a:hover,
+.navbar .nav > .active > a:focus {
+ color: #555555;
+ text-decoration: none;
+ background-color: #e5e5e5;
+ -webkit-box-shadow: inset 0 3px 8px rgba(0, 0, 0, 0.125);
+ -moz-box-shadow: inset 0 3px 8px rgba(0, 0, 0, 0.125);
+ box-shadow: inset 0 3px 8px rgba(0, 0, 0, 0.125);
+}
+
+.navbar .btn-navbar {
+ display: none;
+ float: right;
+ padding: 7px 10px;
+ margin-right: 5px;
+ margin-left: 5px;
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #ededed;
+ *background-color: #e5e5e5;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#f2f2f2), to(#e5e5e5));
+ background-image: -webkit-linear-gradient(top, #f2f2f2, #e5e5e5);
+ background-image: -o-linear-gradient(top, #f2f2f2, #e5e5e5);
+ background-image: linear-gradient(to bottom, #f2f2f2, #e5e5e5);
+ background-image: -moz-linear-gradient(top, #f2f2f2, #e5e5e5);
+ background-repeat: repeat-x;
+ border-color: #e5e5e5 #e5e5e5 #bfbfbf;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#fff2f2f2', endColorstr='#ffe5e5e5', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+ -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075);
+ -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075);
+ box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075);
+}
+
+.navbar .btn-navbar:hover,
+.navbar .btn-navbar:active,
+.navbar .btn-navbar.active,
+.navbar .btn-navbar.disabled,
+.navbar .btn-navbar[disabled] {
+ color: #ffffff;
+ background-color: #e5e5e5;
+ *background-color: #d9d9d9;
+}
+
+.navbar .btn-navbar:active,
+.navbar .btn-navbar.active {
+ background-color: #cccccc \9;
+}
+
+.navbar .btn-navbar .icon-bar {
+ display: block;
+ width: 18px;
+ height: 2px;
+ background-color: #f5f5f5;
+ -webkit-border-radius: 1px;
+ -moz-border-radius: 1px;
+ border-radius: 1px;
+ -webkit-box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25);
+ -moz-box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25);
+ box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.btn-navbar .icon-bar + .icon-bar {
+ margin-top: 3px;
+}
+
+.navbar .nav > li > .dropdown-menu:before {
+ position: absolute;
+ top: -7px;
+ left: 9px;
+ display: inline-block;
+ border-right: 7px solid transparent;
+ border-bottom: 7px solid #ccc;
+ border-left: 7px solid transparent;
+ border-bottom-color: rgba(0, 0, 0, 0.2);
+ content: '';
+}
+
+.navbar .nav > li > .dropdown-menu:after {
+ position: absolute;
+ top: -6px;
+ left: 10px;
+ display: inline-block;
+ border-right: 6px solid transparent;
+ border-bottom: 6px solid #ffffff;
+ border-left: 6px solid transparent;
+ content: '';
+}
+
+.navbar-fixed-bottom .nav > li > .dropdown-menu:before {
+ top: auto;
+ bottom: -7px;
+ border-top: 7px solid #ccc;
+ border-bottom: 0;
+ border-top-color: rgba(0, 0, 0, 0.2);
+}
+
+.navbar-fixed-bottom .nav > li > .dropdown-menu:after {
+ top: auto;
+ bottom: -6px;
+ border-top: 6px solid #ffffff;
+ border-bottom: 0;
+}
+
+.navbar .nav li.dropdown.open > .dropdown-toggle,
+.navbar .nav li.dropdown.active > .dropdown-toggle,
+.navbar .nav li.dropdown.open.active > .dropdown-toggle {
+ color: #555555;
+ background-color: #e5e5e5;
+}
+
+.navbar .nav li.dropdown > .dropdown-toggle .caret {
+ border-top-color: #777777;
+ border-bottom-color: #777777;
+}
+
+.navbar .nav li.dropdown.open > .dropdown-toggle .caret,
+.navbar .nav li.dropdown.active > .dropdown-toggle .caret,
+.navbar .nav li.dropdown.open.active > .dropdown-toggle .caret {
+ border-top-color: #555555;
+ border-bottom-color: #555555;
+}
+
+.navbar .pull-right > li > .dropdown-menu,
+.navbar .nav > li > .dropdown-menu.pull-right {
+ right: 0;
+ left: auto;
+}
+
+.navbar .pull-right > li > .dropdown-menu:before,
+.navbar .nav > li > .dropdown-menu.pull-right:before {
+ right: 12px;
+ left: auto;
+}
+
+.navbar .pull-right > li > .dropdown-menu:after,
+.navbar .nav > li > .dropdown-menu.pull-right:after {
+ right: 13px;
+ left: auto;
+}
+
+.navbar .pull-right > li > .dropdown-menu .dropdown-menu,
+.navbar .nav > li > .dropdown-menu.pull-right .dropdown-menu {
+ right: 100%;
+ left: auto;
+ margin-right: -1px;
+ margin-left: 0;
+ -webkit-border-radius: 6px 0 6px 6px;
+ -moz-border-radius: 6px 0 6px 6px;
+ border-radius: 6px 0 6px 6px;
+}
+
+.navbar-inverse {
+ color: #999999;
+}
+
+.navbar-inverse .navbar-inner {
+ background-color: #1b1b1b;
+ background-image: -moz-linear-gradient(top, #222222, #111111);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#222222), to(#111111));
+ background-image: -webkit-linear-gradient(top, #222222, #111111);
+ background-image: -o-linear-gradient(top, #222222, #111111);
+ background-image: linear-gradient(to bottom, #222222, #111111);
+ background-repeat: repeat-x;
+ border-color: #252525;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff222222', endColorstr='#ff111111', GradientType=0);
+}
+
+.navbar-inverse .brand,
+.navbar-inverse .nav > li > a {
+ color: #999999;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.navbar-inverse .brand:hover,
+.navbar-inverse .nav > li > a:hover {
+ color: #ffffff;
+}
+
+.navbar-inverse .nav > li > a:focus,
+.navbar-inverse .nav > li > a:hover {
+ color: #ffffff;
+ background-color: transparent;
+}
+
+.navbar-inverse .nav .active > a,
+.navbar-inverse .nav .active > a:hover,
+.navbar-inverse .nav .active > a:focus {
+ color: #ffffff;
+ background-color: #111111;
+}
+
+.navbar-inverse .navbar-link {
+ color: #999999;
+}
+
+.navbar-inverse .navbar-link:hover {
+ color: #ffffff;
+}
+
+.navbar-inverse .divider-vertical {
+ border-right-color: #222222;
+ border-left-color: #111111;
+}
+
+.navbar-inverse .nav li.dropdown.open > .dropdown-toggle,
+.navbar-inverse .nav li.dropdown.active > .dropdown-toggle,
+.navbar-inverse .nav li.dropdown.open.active > .dropdown-toggle {
+ color: #ffffff;
+ background-color: #111111;
+}
+
+.navbar-inverse .nav li.dropdown > .dropdown-toggle .caret {
+ border-top-color: #999999;
+ border-bottom-color: #999999;
+}
+
+.navbar-inverse .nav li.dropdown.open > .dropdown-toggle .caret,
+.navbar-inverse .nav li.dropdown.active > .dropdown-toggle .caret,
+.navbar-inverse .nav li.dropdown.open.active > .dropdown-toggle .caret {
+ border-top-color: #ffffff;
+ border-bottom-color: #ffffff;
+}
+
+.navbar-inverse .navbar-search .search-query {
+ color: #ffffff;
+ background-color: #515151;
+ border-color: #111111;
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0 rgba(255, 255, 255, 0.15);
+ -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0 rgba(255, 255, 255, 0.15);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0 rgba(255, 255, 255, 0.15);
+ -webkit-transition: none;
+ -moz-transition: none;
+ -o-transition: none;
+ transition: none;
+}
+
+.navbar-inverse .navbar-search .search-query:-moz-placeholder {
+ color: #cccccc;
+}
+
+.navbar-inverse .navbar-search .search-query:-ms-input-placeholder {
+ color: #cccccc;
+}
+
+.navbar-inverse .navbar-search .search-query::-webkit-input-placeholder {
+ color: #cccccc;
+}
+
+.navbar-inverse .navbar-search .search-query:focus,
+.navbar-inverse .navbar-search .search-query.focused {
+ padding: 5px 15px;
+ color: #333333;
+ text-shadow: 0 1px 0 #ffffff;
+ background-color: #ffffff;
+ border: 0;
+ outline: 0;
+ -webkit-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15);
+ -moz-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15);
+ box-shadow: 0 0 3px rgba(0, 0, 0, 0.15);
+}
+
+.navbar-inverse .btn-navbar {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #0e0e0e;
+ *background-color: #040404;
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#151515), to(#040404));
+ background-image: -webkit-linear-gradient(top, #151515, #040404);
+ background-image: -o-linear-gradient(top, #151515, #040404);
+ background-image: linear-gradient(to bottom, #151515, #040404);
+ background-image: -moz-linear-gradient(top, #151515, #040404);
+ background-repeat: repeat-x;
+ border-color: #040404 #040404 #000000;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff151515', endColorstr='#ff040404', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.navbar-inverse .btn-navbar:hover,
+.navbar-inverse .btn-navbar:active,
+.navbar-inverse .btn-navbar.active,
+.navbar-inverse .btn-navbar.disabled,
+.navbar-inverse .btn-navbar[disabled] {
+ color: #ffffff;
+ background-color: #040404;
+ *background-color: #000000;
+}
+
+.navbar-inverse .btn-navbar:active,
+.navbar-inverse .btn-navbar.active {
+ background-color: #000000 \9;
+}
+
+.breadcrumb {
+ padding: 8px 15px;
+ margin: 0 0 20px;
+ list-style: none;
+ background-color: #f5f5f5;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.breadcrumb li {
+ display: inline-block;
+ *display: inline;
+ text-shadow: 0 1px 0 #ffffff;
+ *zoom: 1;
+}
+
+.breadcrumb .divider {
+ padding: 0 5px;
+ color: #ccc;
+}
+
+.breadcrumb .active {
+ color: #999999;
+}
+
+.pagination {
+ height: 40px;
+ margin: 20px 0;
+}
+
+.pagination ul {
+ display: inline-block;
+ *display: inline;
+ margin-bottom: 0;
+ margin-left: 0;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+ *zoom: 1;
+ -webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.pagination ul > li {
+ display: inline;
+}
+
+.pagination ul > li > a,
+.pagination ul > li > span {
+ float: left;
+ padding: 0 14px;
+ line-height: 38px;
+ text-decoration: none;
+ background-color: #ffffff;
+ border: 1px solid #dddddd;
+ border-left-width: 0;
+}
+
+.pagination ul > li > a:hover,
+.pagination ul > .active > a,
+.pagination ul > .active > span {
+ background-color: #f5f5f5;
+}
+
+.pagination ul > .active > a,
+.pagination ul > .active > span {
+ color: #999999;
+ cursor: default;
+}
+
+.pagination ul > .disabled > span,
+.pagination ul > .disabled > a,
+.pagination ul > .disabled > a:hover {
+ color: #999999;
+ cursor: default;
+ background-color: transparent;
+}
+
+.pagination ul > li:first-child > a,
+.pagination ul > li:first-child > span {
+ border-left-width: 1px;
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.pagination ul > li:last-child > a,
+.pagination ul > li:last-child > span {
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.pagination-centered {
+ text-align: center;
+}
+
+.pagination-right {
+ text-align: right;
+}
+
+.pager {
+ margin: 20px 0;
+ text-align: center;
+ list-style: none;
+ *zoom: 1;
+}
+
+.pager:before,
+.pager:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.pager:after {
+ clear: both;
+}
+
+.pager li {
+ display: inline;
+}
+
+.pager a,
+.pager span {
+ display: inline-block;
+ padding: 5px 14px;
+ background-color: #fff;
+ border: 1px solid #ddd;
+ -webkit-border-radius: 15px;
+ -moz-border-radius: 15px;
+ border-radius: 15px;
+}
+
+.pager a:hover {
+ text-decoration: none;
+ background-color: #f5f5f5;
+}
+
+.pager .next a,
+.pager .next span {
+ float: right;
+}
+
+.pager .previous a {
+ float: left;
+}
+
+.pager .disabled a,
+.pager .disabled a:hover,
+.pager .disabled span {
+ color: #999999;
+ cursor: default;
+ background-color: #fff;
+}
+
+.modal-open .modal .dropdown-menu {
+ z-index: 2050;
+}
+
+.modal-open .modal .dropdown.open {
+ *z-index: 2050;
+}
+
+.modal-open .modal .popover {
+ z-index: 2060;
+}
+
+.modal-open .modal .tooltip {
+ z-index: 2080;
+}
+
+.modal-backdrop {
+ position: fixed;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: 1040;
+ background-color: #000000;
+}
+
+.modal-backdrop.fade {
+ opacity: 0;
+}
+
+.modal-backdrop,
+.modal-backdrop.fade.in {
+ opacity: 0.8;
+ filter: alpha(opacity=80);
+}
+
+.modal {
+ position: fixed;
+ top: 50%;
+ left: 50%;
+ z-index: 1050;
+ width: 560px;
+ margin: -250px 0 0 -280px;
+ overflow: auto;
+ background-color: #ffffff;
+ border: 1px solid #999;
+ border: 1px solid rgba(0, 0, 0, 0.3);
+ *border: 1px solid #999;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+ -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding-box;
+ background-clip: padding-box;
+}
+
+.modal.fade {
+ top: -25%;
+ -webkit-transition: opacity 0.3s linear, top 0.3s ease-out;
+ -moz-transition: opacity 0.3s linear, top 0.3s ease-out;
+ -o-transition: opacity 0.3s linear, top 0.3s ease-out;
+ transition: opacity 0.3s linear, top 0.3s ease-out;
+}
+
+.modal.fade.in {
+ top: 50%;
+}
+
+.modal-header {
+ padding: 9px 15px;
+ border-bottom: 1px solid #eee;
+}
+
+.modal-header .close {
+ margin-top: 2px;
+}
+
+.modal-header h3 {
+ margin: 0;
+ line-height: 30px;
+}
+
+.modal-body {
+ max-height: 400px;
+ padding: 15px;
+ overflow-y: auto;
+}
+
+.modal-form {
+ margin-bottom: 0;
+}
+
+.modal-footer {
+ padding: 14px 15px 15px;
+ margin-bottom: 0;
+ text-align: right;
+ background-color: #f5f5f5;
+ border-top: 1px solid #ddd;
+ -webkit-border-radius: 0 0 6px 6px;
+ -moz-border-radius: 0 0 6px 6px;
+ border-radius: 0 0 6px 6px;
+ *zoom: 1;
+ -webkit-box-shadow: inset 0 1px 0 #ffffff;
+ -moz-box-shadow: inset 0 1px 0 #ffffff;
+ box-shadow: inset 0 1px 0 #ffffff;
+}
+
+.modal-footer:before,
+.modal-footer:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.modal-footer:after {
+ clear: both;
+}
+
+.modal-footer .btn + .btn {
+ margin-bottom: 0;
+ margin-left: 5px;
+}
+
+.modal-footer .btn-group .btn + .btn {
+ margin-left: -1px;
+}
+
+.tooltip {
+ position: absolute;
+ z-index: 1030;
+ display: block;
+ padding: 5px;
+ font-size: 11px;
+ opacity: 0;
+ filter: alpha(opacity=0);
+ visibility: visible;
+}
+
+.tooltip.in {
+ opacity: 0.8;
+ filter: alpha(opacity=80);
+}
+
+.tooltip.top {
+ margin-top: -3px;
+}
+
+.tooltip.right {
+ margin-left: 3px;
+}
+
+.tooltip.bottom {
+ margin-top: 3px;
+}
+
+.tooltip.left {
+ margin-left: -3px;
+}
+
+.tooltip-inner {
+ max-width: 200px;
+ padding: 3px 8px;
+ color: #ffffff;
+ text-align: center;
+ text-decoration: none;
+ background-color: #000000;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.tooltip-arrow {
+ position: absolute;
+ width: 0;
+ height: 0;
+ border-color: transparent;
+ border-style: solid;
+}
+
+.tooltip.top .tooltip-arrow {
+ bottom: 0;
+ left: 50%;
+ margin-left: -5px;
+ border-top-color: #000000;
+ border-width: 5px 5px 0;
+}
+
+.tooltip.right .tooltip-arrow {
+ top: 50%;
+ left: 0;
+ margin-top: -5px;
+ border-right-color: #000000;
+ border-width: 5px 5px 5px 0;
+}
+
+.tooltip.left .tooltip-arrow {
+ top: 50%;
+ right: 0;
+ margin-top: -5px;
+ border-left-color: #000000;
+ border-width: 5px 0 5px 5px;
+}
+
+.tooltip.bottom .tooltip-arrow {
+ top: 0;
+ left: 50%;
+ margin-left: -5px;
+ border-bottom-color: #000000;
+ border-width: 0 5px 5px;
+}
+
+.popover {
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: 1010;
+ display: none;
+ width: 236px;
+ padding: 1px;
+ background-color: #ffffff;
+ border: 1px solid #ccc;
+ border: 1px solid rgba(0, 0, 0, 0.2);
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+ -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ -moz-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding;
+ background-clip: padding-box;
+}
+
+.popover.top {
+ margin-bottom: 10px;
+}
+
+.popover.right {
+ margin-left: 10px;
+}
+
+.popover.bottom {
+ margin-top: 10px;
+}
+
+.popover.left {
+ margin-right: 10px;
+}
+
+.popover-title {
+ padding: 8px 14px;
+ margin: 0;
+ font-size: 14px;
+ font-weight: normal;
+ line-height: 18px;
+ background-color: #f7f7f7;
+ border-bottom: 1px solid #ebebeb;
+ -webkit-border-radius: 5px 5px 0 0;
+ -moz-border-radius: 5px 5px 0 0;
+ border-radius: 5px 5px 0 0;
+}
+
+.popover-content {
+ padding: 9px 14px;
+}
+
+.popover-content p,
+.popover-content ul,
+.popover-content ol {
+ margin-bottom: 0;
+}
+
+.popover .arrow,
+.popover .arrow:after {
+ position: absolute;
+ display: inline-block;
+ width: 0;
+ height: 0;
+ border-color: transparent;
+ border-style: solid;
+}
+
+.popover .arrow:after {
+ z-index: -1;
+ content: "";
+}
+
+.popover.top .arrow {
+ bottom: -10px;
+ left: 50%;
+ margin-left: -10px;
+ border-top-color: #ffffff;
+ border-width: 10px 10px 0;
+}
+
+.popover.top .arrow:after {
+ bottom: -1px;
+ left: -11px;
+ border-top-color: rgba(0, 0, 0, 0.25);
+ border-width: 11px 11px 0;
+}
+
+.popover.right .arrow {
+ top: 50%;
+ left: -10px;
+ margin-top: -10px;
+ border-right-color: #ffffff;
+ border-width: 10px 10px 10px 0;
+}
+
+.popover.right .arrow:after {
+ bottom: -11px;
+ left: -1px;
+ border-right-color: rgba(0, 0, 0, 0.25);
+ border-width: 11px 11px 11px 0;
+}
+
+.popover.bottom .arrow {
+ top: -10px;
+ left: 50%;
+ margin-left: -10px;
+ border-bottom-color: #ffffff;
+ border-width: 0 10px 10px;
+}
+
+.popover.bottom .arrow:after {
+ top: -1px;
+ left: -11px;
+ border-bottom-color: rgba(0, 0, 0, 0.25);
+ border-width: 0 11px 11px;
+}
+
+.popover.left .arrow {
+ top: 50%;
+ right: -10px;
+ margin-top: -10px;
+ border-left-color: #ffffff;
+ border-width: 10px 0 10px 10px;
+}
+
+.popover.left .arrow:after {
+ right: -1px;
+ bottom: -11px;
+ border-left-color: rgba(0, 0, 0, 0.25);
+ border-width: 11px 0 11px 11px;
+}
+
+.thumbnails {
+ margin-left: -20px;
+ list-style: none;
+ *zoom: 1;
+}
+
+.thumbnails:before,
+.thumbnails:after {
+ display: table;
+ line-height: 0;
+ content: "";
+}
+
+.thumbnails:after {
+ clear: both;
+}
+
+.row-fluid .thumbnails {
+ margin-left: 0;
+}
+
+.thumbnails > li {
+ float: left;
+ margin-bottom: 20px;
+ margin-left: 20px;
+}
+
+.thumbnail {
+ display: block;
+ padding: 4px;
+ line-height: 20px;
+ border: 1px solid #ddd;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.055);
+ -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.055);
+ box-shadow: 0 1px 3px rgba(0, 0, 0, 0.055);
+ -webkit-transition: all 0.2s ease-in-out;
+ -moz-transition: all 0.2s ease-in-out;
+ -o-transition: all 0.2s ease-in-out;
+ transition: all 0.2s ease-in-out;
+}
+
+a.thumbnail:hover {
+ border-color: #0088cc;
+ -webkit-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25);
+ -moz-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25);
+ box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25);
+}
+
+.thumbnail > img {
+ display: block;
+ max-width: 100%;
+ margin-right: auto;
+ margin-left: auto;
+}
+
+.thumbnail .caption {
+ padding: 9px;
+ color: #555555;
+}
+
+.label,
+.badge {
+ font-size: 11.844px;
+ font-weight: bold;
+ line-height: 14px;
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ white-space: nowrap;
+ vertical-align: baseline;
+ background-color: #999999;
+}
+
+.label {
+ padding: 1px 4px 2px;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+.badge {
+ padding: 1px 9px 2px;
+ -webkit-border-radius: 9px;
+ -moz-border-radius: 9px;
+ border-radius: 9px;
+}
+
+a.label:hover,
+a.badge:hover {
+ color: #ffffff;
+ text-decoration: none;
+ cursor: pointer;
+}
+
+.label-important,
+.badge-important {
+ background-color: #b94a48;
+}
+
+.label-important[href],
+.badge-important[href] {
+ background-color: #953b39;
+}
+
+.label-warning,
+.badge-warning {
+ background-color: #f89406;
+}
+
+.label-warning[href],
+.badge-warning[href] {
+ background-color: #c67605;
+}
+
+.label-success,
+.badge-success {
+ background-color: #468847;
+}
+
+.label-success[href],
+.badge-success[href] {
+ background-color: #356635;
+}
+
+.label-info,
+.badge-info {
+ background-color: #3a87ad;
+}
+
+.label-info[href],
+.badge-info[href] {
+ background-color: #2d6987;
+}
+
+.label-inverse,
+.badge-inverse {
+ background-color: #333333;
+}
+
+.label-inverse[href],
+.badge-inverse[href] {
+ background-color: #1a1a1a;
+}
+
+.btn .label,
+.btn .badge {
+ position: relative;
+ top: -1px;
+}
+
+.btn-mini .label,
+.btn-mini .badge {
+ top: 0;
+}
+
+@-webkit-keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@-moz-keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@-ms-keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@-o-keyframes progress-bar-stripes {
+ from {
+ background-position: 0 0;
+ }
+ to {
+ background-position: 40px 0;
+ }
+}
+
+@keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+.progress {
+ height: 20px;
+ margin-bottom: 20px;
+ overflow: hidden;
+ background-color: #f7f7f7;
+ background-image: -moz-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#f5f5f5), to(#f9f9f9));
+ background-image: -webkit-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: -o-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: linear-gradient(to bottom, #f5f5f5, #f9f9f9);
+ background-repeat: repeat-x;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#fff9f9f9', GradientType=0);
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+ -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+}
+
+.progress .bar {
+ float: left;
+ width: 0;
+ height: 100%;
+ font-size: 12px;
+ color: #ffffff;
+ text-align: center;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #0e90d2;
+ background-image: -moz-linear-gradient(top, #149bdf, #0480be);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#149bdf), to(#0480be));
+ background-image: -webkit-linear-gradient(top, #149bdf, #0480be);
+ background-image: -o-linear-gradient(top, #149bdf, #0480be);
+ background-image: linear-gradient(to bottom, #149bdf, #0480be);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff149bdf', endColorstr='#ff0480be', GradientType=0);
+ -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ -moz-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ box-sizing: border-box;
+ -webkit-transition: width 0.6s ease;
+ -moz-transition: width 0.6s ease;
+ -o-transition: width 0.6s ease;
+ transition: width 0.6s ease;
+}
+
+.progress .bar + .bar {
+ -webkit-box-shadow: inset 1px 0 0 rgba(0, 0, 0, 0.15), inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ -moz-box-shadow: inset 1px 0 0 rgba(0, 0, 0, 0.15), inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ box-shadow: inset 1px 0 0 rgba(0, 0, 0, 0.15), inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+}
+
+.progress-striped .bar {
+ background-color: #149bdf;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ -webkit-background-size: 40px 40px;
+ -moz-background-size: 40px 40px;
+ -o-background-size: 40px 40px;
+ background-size: 40px 40px;
+}
+
+.progress.active .bar {
+ -webkit-animation: progress-bar-stripes 2s linear infinite;
+ -moz-animation: progress-bar-stripes 2s linear infinite;
+ -ms-animation: progress-bar-stripes 2s linear infinite;
+ -o-animation: progress-bar-stripes 2s linear infinite;
+ animation: progress-bar-stripes 2s linear infinite;
+}
+
+.progress-danger .bar,
+.progress .bar-danger {
+ background-color: #dd514c;
+ background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#c43c35));
+ background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: -o-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: linear-gradient(to bottom, #ee5f5b, #c43c35);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ffee5f5b', endColorstr='#ffc43c35', GradientType=0);
+}
+
+.progress-danger.progress-striped .bar,
+.progress-striped .bar-danger {
+ background-color: #ee5f5b;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.progress-success .bar,
+.progress .bar-success {
+ background-color: #5eb95e;
+ background-image: -moz-linear-gradient(top, #62c462, #57a957);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#57a957));
+ background-image: -webkit-linear-gradient(top, #62c462, #57a957);
+ background-image: -o-linear-gradient(top, #62c462, #57a957);
+ background-image: linear-gradient(to bottom, #62c462, #57a957);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff62c462', endColorstr='#ff57a957', GradientType=0);
+}
+
+.progress-success.progress-striped .bar,
+.progress-striped .bar-success {
+ background-color: #62c462;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.progress-info .bar,
+.progress .bar-info {
+ background-color: #4bb1cf;
+ background-image: -moz-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#339bb9));
+ background-image: -webkit-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: -o-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: linear-gradient(to bottom, #5bc0de, #339bb9);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff339bb9', GradientType=0);
+}
+
+.progress-info.progress-striped .bar,
+.progress-striped .bar-info {
+ background-color: #5bc0de;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.progress-warning .bar,
+.progress .bar-warning {
+ background-color: #faa732;
+ background-image: -moz-linear-gradient(top, #fbb450, #f89406);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
+ background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
+ background-image: -o-linear-gradient(top, #fbb450, #f89406);
+ background-image: linear-gradient(to bottom, #fbb450, #f89406);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#fffbb450', endColorstr='#fff89406', GradientType=0);
+}
+
+.progress-warning.progress-striped .bar,
+.progress-striped .bar-warning {
+ background-color: #fbb450;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.accordion {
+ margin-bottom: 20px;
+}
+
+.accordion-group {
+ margin-bottom: 2px;
+ border: 1px solid #e5e5e5;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.accordion-heading {
+ border-bottom: 0;
+}
+
+.accordion-heading .accordion-toggle {
+ display: block;
+ padding: 8px 15px;
+}
+
+.accordion-toggle {
+ cursor: pointer;
+}
+
+.accordion-inner {
+ padding: 9px 15px;
+ border-top: 1px solid #e5e5e5;
+}
+
+.carousel {
+ position: relative;
+ margin-bottom: 20px;
+ line-height: 1;
+}
+
+.carousel-inner {
+ position: relative;
+ width: 100%;
+ overflow: hidden;
+}
+
+.carousel .item {
+ position: relative;
+ display: none;
+ -webkit-transition: 0.6s ease-in-out left;
+ -moz-transition: 0.6s ease-in-out left;
+ -o-transition: 0.6s ease-in-out left;
+ transition: 0.6s ease-in-out left;
+}
+
+.carousel .item > img {
+ display: block;
+ line-height: 1;
+}
+
+.carousel .active,
+.carousel .next,
+.carousel .prev {
+ display: block;
+}
+
+.carousel .active {
+ left: 0;
+}
+
+.carousel .next,
+.carousel .prev {
+ position: absolute;
+ top: 0;
+ width: 100%;
+}
+
+.carousel .next {
+ left: 100%;
+}
+
+.carousel .prev {
+ left: -100%;
+}
+
+.carousel .next.left,
+.carousel .prev.right {
+ left: 0;
+}
+
+.carousel .active.left {
+ left: -100%;
+}
+
+.carousel .active.right {
+ left: 100%;
+}
+
+.carousel-control {
+ position: absolute;
+ top: 40%;
+ left: 15px;
+ width: 40px;
+ height: 40px;
+ margin-top: -20px;
+ font-size: 60px;
+ font-weight: 100;
+ line-height: 30px;
+ color: #ffffff;
+ text-align: center;
+ background: #222222;
+ border: 3px solid #ffffff;
+ -webkit-border-radius: 23px;
+ -moz-border-radius: 23px;
+ border-radius: 23px;
+ opacity: 0.5;
+ filter: alpha(opacity=50);
+}
+
+.carousel-control.right {
+ right: 15px;
+ left: auto;
+}
+
+.carousel-control:hover {
+ color: #ffffff;
+ text-decoration: none;
+ opacity: 0.9;
+ filter: alpha(opacity=90);
+}
+
+.carousel-caption {
+ position: absolute;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ padding: 15px;
+ background: #333333;
+ background: rgba(0, 0, 0, 0.75);
+}
+
+.carousel-caption h4,
+.carousel-caption p {
+ line-height: 20px;
+ color: #ffffff;
+}
+
+.carousel-caption h4 {
+ margin: 0 0 5px;
+}
+
+.carousel-caption p {
+ margin-bottom: 0;
+}
+
+.hero-unit {
+ padding: 60px;
+ margin-bottom: 30px;
+ background-color: #eeeeee;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+}
+
+.hero-unit h1 {
+ margin-bottom: 0;
+ font-size: 60px;
+ line-height: 1;
+ letter-spacing: -1px;
+ color: inherit;
+}
+
+.hero-unit p {
+ font-size: 18px;
+ font-weight: 200;
+ line-height: 30px;
+ color: inherit;
+}
+
+.pull-right {
+ float: right;
+}
+
+.pull-left {
+ float: left;
+}
+
+.hide {
+ display: none;
+}
+
+.show {
+ display: block;
+}
+
+.invisible {
+ visibility: hidden;
+}
+
+.affix {
+ position: fixed;
+}
diff --git a/module/web/static/css/default/style.less b/module/web/static/css/default/style.less
new file mode 100644
index 000000000..203135e97
--- /dev/null
+++ b/module/web/static/css/default/style.less
@@ -0,0 +1,318 @@
+
+/*
+ General
+ */
+
+@min-width: 1000px;
+@header-height: 70px;
+@footer-height: 100px;
+@margin-side: 150px;
+
+@dark: #333333;
+@grey: #757575;
+@yellow: #fee247;
+@blue: #3a79aa;
+@emph: #FF7637;
+
+
+* {
+ margin: 0;
+}
+
+html, body {
+ height: 100%;
+}
+
+body {
+ margin: 0;
+ padding: 0;
+ font-family: 'Abel', sans-serif;
+ font-size: 16px;
+ background: url("../../img/default/bgpattern.png") repeat scroll 0 0 transparent;
+ min-width: @min-width;
+}
+
+h1, h2, h3 {
+ margin: 0;
+ padding: 0;
+ font-weight: normal;
+}
+
+a {
+ text-decoration: none;
+ color: @blue;
+}
+
+a:hover {
+ text-decoration: none;
+ color: @emph;
+}
+
+#wrap {
+ min-height: 100%;
+}
+
+#content {
+ margin-left: @margin-side;
+ margin-right: @margin-side ;
+ padding-bottom: @footer-height;
+}
+
+#content:before {
+ display: block;
+ content: " ";
+ height: @header-height;
+}
+
+/*
+ Header
+*/
+
+header {
+ background: url("../../img/default/main-wrapper-bg.png") repeat-x;
+ height: @header-height;
+ position: fixed;
+ top: 0;
+ vertical-align: top;
+ width: 100%;
+ z-index: 10;
+ min-width: @min-width;
+ color: #ffffff;
+}
+
+header a {
+ color: #ffffff;
+}
+
+header:before {
+ position: absolute;
+ content: ' ';
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ background-color: transparent;
+ box-shadow: 0 0 5px black;
+ z-index: -1;
+}
+
+header div.center {
+ position: relative;
+ padding-left: 20px;
+ padding-right: 20px;
+}
+header div.center span.title {
+ color: white;
+ float: left;
+ font-family: SansationRegular, sans-serif;
+ font-size: 40px;
+ cursor: default;
+ margin-top: 24px;
+}
+header .logo {
+ float: left;
+ margin-right: 10px;
+ margin-top: 6px;
+ width: 120px;
+ height: 120px;
+ background: url("../../img/default/logo.png")no-repeat;
+}
+
+.header_block {
+ float: right;
+ margin: 12px 12px 0;
+ font-family: SansationRegular, sans-serif;
+}
+.header_icon {
+ padding-top: 2px;
+ padding-bottom: 5px;
+ padding-left: 25px;
+ height: 20px;
+}
+
+.header_text {
+ text-align: center;
+}
+
+.icon_info img {
+ margin-bottom: -4px;
+ padding-right: 5px;
+}
+
+#notification_div {
+ position: absolute;
+ left: 50%;
+ width: 28%;
+ height: 45px;
+ margin-left: -14%;
+ margin-top: 12px;
+ text-align: center;
+}
+
+#globalprogress {
+ height: 8px;
+ margin: 8px 5px 0;
+}
+
+#globalprogress .bar {
+ background-color: @yellow;
+}
+
+#speedgraph {
+ float: right;
+ height: 45px;
+ width: 14%;
+ margin-top: 12px;
+ font-family: sans-serif
+}
+
+#header_user {
+ background: url("../../img/default/icon_user_small_white.png")no-repeat;
+}
+
+#header_speed {
+ background: url("../../img/default/icon_speed_small_white.png")no-repeat;
+}
+
+#header_qeuue {
+ background: url("../../img/default/icon_clock_small_white.png")no-repeat;
+}
+
+/*
+ Login
+*/
+.login {
+ vertical-align: middle;
+ border: 2px solid @dark;
+ padding: 15px 50px;
+ font-size: 17px;
+ border-radius: 15px;
+ -moz-border-radius: 15px;
+ -webkit-border-radius: 15px;
+}
+/*
+ Footer
+*/
+footer {
+ background: url("../../img/default/main-wrapper-bg.png") repeat-x;
+ color: @grey;
+ height: @footer-height;
+ margin-top: -@footer-height;
+ position: relative;
+ width: 100%;
+ line-height: 16px;
+ z-index: 10;
+}
+
+footer .logo {
+ background: url(../../img/default/logo_grey.png) no-repeat;
+ float: left;
+ width: 60px;
+ height: 60px;
+ margin-top: 12px;
+ margin-right: 12px;
+}
+
+footer div.center {
+ padding-top: 8px;
+ width: 900px;
+ margin-left: auto;
+ margin-right: auto;
+}
+
+footer:before {
+ position: absolute;
+ content: ' ';
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ background-color: transparent;
+ box-shadow: 0 0 5px black;
+ z-index: -1;
+}
+
+footer .block {
+ font-size: 12px;
+ float: left;
+ margin: 0;
+ width: 150px;
+ padding-top: 6px;
+ padding-right: 30px;
+}
+
+footer .copyright {
+ text-align: center;
+ width: auto;
+ padding-top: 22px;
+}
+
+footer h2 {
+ background: url("../../img/default/double-line.gif") repeat-x scroll center bottom transparent !important;
+ color: #FFFFFF;
+ font-family: SansationLight, sans-serif;
+ font-size: 16px;
+ font-weight: normal;
+ line-height: 16px;
+ margin: 0;
+ padding-bottom: 6px;
+}
+
+/*
+ Modal Overlay
+*/
+#modal-overlay {
+ content: " ";
+ height: 100%;
+ width: 100%;
+ position: absolute;
+ left: 0;
+ top: 0;
+ background: -moz-radial-gradient(center, ellipse cover, rgba(236,208,66,0) 0%, rgba(40,119,171,0.9) 100%);
+ background: -webkit-gradient(radial, center center, 0px, center center, 100%, color-stop(0%,rgba(236,208,66,0)), color-stop(100%,rgba(40,119,171,0.9)));
+ background: -webkit-radial-gradient(center, ellipse cover, rgba(236,208,66,0) 0%,rgba(40,119,171,0.9) 100%);
+ background: -o-radial-gradient(center, ellipse cover, rgba(236,208,66,0) 0%,rgba(40,119,171,0.9) 100%);
+ background: -ms-radial-gradient(center, ellipse cover, rgba(236,208,66,0) 0%,rgba(40,119,171,0.9) 100%);
+ background: radial-gradient(center, ellipse cover, rgba(236,208,66,0) 0%,rgba(40,119,171,0.9) 100%);
+ z-index: 50;
+ opacity: 0;
+}
+
+/*
+ Dashboard
+*/
+
+.nav > li > a:hover {
+ color: @blue;
+}
+
+#dash-nav {
+ border-bottom: 1px dashed @grey;
+ padding-bottom: 2px;
+ margin-bottom: 5px;
+}
+
+#dash-nav li > a {
+ margin-top: 5px;
+}
+
+#dash-nav .breadcrumb {
+ margin: 0;
+ padding-top: 10px;
+ padding-bottom: 0;
+
+ .active {
+ color: @grey;
+ }
+
+}
+
+#dash-nav form {
+ margin-top: 8px;
+ margin-bottom: 0;
+}
+
+#dash-nav input, #dash-nav button {
+ padding-top: 2px;
+ padding-bottom: 2px;
+} \ No newline at end of file
diff --git a/module/web/static/css/font.css b/module/web/static/css/font.css
new file mode 100644
index 000000000..ee117d43b
--- /dev/null
+++ b/module/web/static/css/font.css
@@ -0,0 +1,37 @@
+/**
+ * @file
+ * Font styling
+ */
+
+@font-face {
+ font-family: 'SansationRegular';
+ src: url('../fonts/Sansation_Regular-webfont.eot');
+ src: url('../fonts/Sansation_Regular-webfont.eot?#iefix') format('embedded-opentype'),
+ url('../fonts/Sansation_Regular-webfont.woff') format('woff'),
+ url('../fonts/Sansation_Regular-webfont.ttf') format('truetype'),
+ url('../fonts/Sansation_Regular-webfont.svg#SansationRegular') format('svg');
+ font-weight: normal;
+ font-style: normal;
+}
+
+@font-face {
+ font-family: 'SansationLight';
+ src: url('../fonts/Sansation_Light-webfont.eot');
+ src: url('../fonts/Sansation_Light-webfont.eot?#iefix') format('embedded-opentype'),
+ url('../fonts/Sansation_Light-webfont.woff') format('woff'),
+ url('../fonts/Sansation_Light-webfont.ttf') format('truetype'),
+ url('../fonts/Sansation_Light-webfont.svg#SansationLight') format('svg');
+ font-weight: normal;
+ font-style: normal;
+}
+
+@font-face {
+ font-family: 'SansationBold';
+ src: url('../fonts/Sansation_Bold-webfont.eot');
+ src: url('../fonts/Sansation_Bold-webfont.eot?#iefix') format('embedded-opentype'),
+ url('../fonts/Sansation_Bold-webfont.woff') format('woff'),
+ url('../fonts/Sansation_Bold-webfont.ttf') format('truetype'),
+ url('../fonts/Sansation_Bold-webfont.svg#SansationBold') format('svg');
+ font-weight: normal;
+ font-style: normal;
+} \ No newline at end of file
diff --git a/module/web/static/css/mobile/images/ajax-loader.gif b/module/web/static/css/mobile/images/ajax-loader.gif
new file mode 100644
index 000000000..fd1a189c2
--- /dev/null
+++ b/module/web/static/css/mobile/images/ajax-loader.gif
Binary files differ
diff --git a/module/web/static/css/mobile/images/ajax-loader.png b/module/web/static/css/mobile/images/ajax-loader.png
new file mode 100644
index 000000000..13b208ddd
--- /dev/null
+++ b/module/web/static/css/mobile/images/ajax-loader.png
Binary files differ
diff --git a/module/web/static/css/mobile/images/icons-18-black.png b/module/web/static/css/mobile/images/icons-18-black.png
new file mode 100644
index 000000000..ce1b758ad
--- /dev/null
+++ b/module/web/static/css/mobile/images/icons-18-black.png
Binary files differ
diff --git a/module/web/static/css/mobile/images/icons-18-white.png b/module/web/static/css/mobile/images/icons-18-white.png
new file mode 100644
index 000000000..1ab012723
--- /dev/null
+++ b/module/web/static/css/mobile/images/icons-18-white.png
Binary files differ
diff --git a/module/web/static/css/mobile/images/icons-36-black.png b/module/web/static/css/mobile/images/icons-36-black.png
new file mode 100644
index 000000000..1a59d7c37
--- /dev/null
+++ b/module/web/static/css/mobile/images/icons-36-black.png
Binary files differ
diff --git a/module/web/static/css/mobile/images/icons-36-white.png b/module/web/static/css/mobile/images/icons-36-white.png
new file mode 100644
index 000000000..5647bdc94
--- /dev/null
+++ b/module/web/static/css/mobile/images/icons-36-white.png
Binary files differ
diff --git a/module/web/static/css/mobile/jquery.mobile-1.1.1.min.css b/module/web/static/css/mobile/jquery.mobile-1.1.1.min.css
new file mode 100644
index 000000000..3bbf55c66
--- /dev/null
+++ b/module/web/static/css/mobile/jquery.mobile-1.1.1.min.css
@@ -0,0 +1,2 @@
+/*! jQuery Mobile v1.1.1 1981b3f5ec22675ae47df8f0bdf9622e7780e90e jquerymobile.com | jquery.org/license */
+.ui-bar-a{border:1px solid #333;background:#111;color:#fff;font-weight:bold;text-shadow:0 -1px 1px #000;background-image:-webkit-gradient(linear,left top,left bottom,from(#3c3c3c),to(#111));background-image:-webkit-linear-gradient(#3c3c3c,#111);background-image:-moz-linear-gradient(#3c3c3c,#111);background-image:-ms-linear-gradient(#3c3c3c,#111);background-image:-o-linear-gradient(#3c3c3c,#111);background-image:linear-gradient(#3c3c3c,#111)}.ui-bar-a,.ui-bar-a input,.ui-bar-a select,.ui-bar-a textarea,.ui-bar-a button{font-family:Helvetica,Arial,sans-serif}.ui-bar-a .ui-link-inherit{color:#fff}.ui-bar-a a.ui-link{color:#7cc4e7;font-weight:bold}.ui-bar-a a.ui-link:visited{color:#2489ce}.ui-bar-a a.ui-link:hover{color:#2489ce}.ui-bar-a a.ui-link:active{color:#2489ce}.ui-body-a,.ui-overlay-a{border:1px solid #444;background:#222;color:#fff;text-shadow:0 1px 1px #111;font-weight:normal;background-image:-webkit-gradient(linear,left top,left bottom,from(#444),to(#222));background-image:-webkit-linear-gradient(#444,#222);background-image:-moz-linear-gradient(#444,#222);background-image:-ms-linear-gradient(#444,#222);background-image:-o-linear-gradient(#444,#222);background-image:linear-gradient(#444,#222)}.ui-overlay-a{background-image:none;border-width:0}.ui-body-a,.ui-body-a input,.ui-body-a select,.ui-body-a textarea,.ui-body-a button{font-family:Helvetica,Arial,sans-serif}.ui-body-a .ui-link-inherit{color:#fff}.ui-body-a .ui-link{color:#2489ce;font-weight:bold}.ui-body-a .ui-link:visited{color:#2489ce}.ui-body-a .ui-link:hover{color:#2489ce}.ui-body-a .ui-link:active{color:#2489ce}.ui-btn-up-a{border:1px solid #111;background:#333;font-weight:bold;color:#fff;text-shadow:0 1px 1px #111;background-image:-webkit-gradient(linear,left top,left bottom,from(#444),to(#2d2d2d));background-image:-webkit-linear-gradient(#444,#2d2d2d);background-image:-moz-linear-gradient(#444,#2d2d2d);background-image:-ms-linear-gradient(#444,#2d2d2d);background-image:-o-linear-gradient(#444,#2d2d2d);background-image:linear-gradient(#444,#2d2d2d)}.ui-btn-up-a:visited,.ui-btn-up-a a.ui-link-inherit{color:#fff}.ui-btn-hover-a{border:1px solid #000;background:#444;font-weight:bold;color:#fff;text-shadow:0 1px 1px #111;background-image:-webkit-gradient(linear,left top,left bottom,from(#555),to(#383838));background-image:-webkit-linear-gradient(#555,#383838);background-image:-moz-linear-gradient(#555,#383838);background-image:-ms-linear-gradient(#555,#383838);background-image:-o-linear-gradient(#555,#383838);background-image:linear-gradient(#555,#383838)}.ui-btn-hover-a:visited,.ui-btn-hover-a:hover,.ui-btn-hover-a a.ui-link-inherit{color:#fff}.ui-btn-down-a{border:1px solid #000;background:#222;font-weight:bold;color:#fff;text-shadow:0 1px 1px #111;background-image:-webkit-gradient(linear,left top,left bottom,from(#202020),to(#2c2c2c));background-image:-webkit-linear-gradient(#202020,#2c2c2c);background-image:-moz-linear-gradient(#202020,#2c2c2c);background-image:-ms-linear-gradient(#202020,#2c2c2c);background-image:-o-linear-gradient(#202020,#2c2c2c);background-image:linear-gradient(#202020,#2c2c2c)}.ui-btn-down-a:visited,.ui-btn-down-a:hover,.ui-btn-down-a a.ui-link-inherit{color:#fff}.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-b{border:1px solid #456f9a;background:#5e87b0;color:#fff;font-weight:bold;text-shadow:0 1px 1px #3e6790;background-image:-webkit-gradient(linear,left top,left bottom,from(#6facd5),to(#497bae));background-image:-webkit-linear-gradient(#6facd5,#497bae);background-image:-moz-linear-gradient(#6facd5,#497bae);background-image:-ms-linear-gradient(#6facd5,#497bae);background-image:-o-linear-gradient(#6facd5,#497bae);background-image:linear-gradient(#6facd5,#497bae)}.ui-bar-b,.ui-bar-b input,.ui-bar-b select,.ui-bar-b textarea,.ui-bar-b button{font-family:Helvetica,Arial,sans-serif}.ui-bar-b .ui-link-inherit{color:#fff}.ui-bar-b a.ui-link{color:#ddf0f8;font-weight:bold}.ui-bar-b a.ui-link:visited{color:#ddf0f8}.ui-bar-b a.ui-link:hover{color:#ddf0f8}.ui-bar-b a.ui-link:active{color:#ddf0f8}.ui-body-b,.ui-overlay-b{border:1px solid #999;background:#f3f3f3;color:#222;text-shadow:0 1px 0 #fff;font-weight:normal;background-image:-webkit-gradient(linear,left top,left bottom,from(#ddd),to(#ccc));background-image:-webkit-linear-gradient(#ddd,#ccc);background-image:-moz-linear-gradient(#ddd,#ccc);background-image:-ms-linear-gradient(#ddd,#ccc);background-image:-o-linear-gradient(#ddd,#ccc);background-image:linear-gradient(#ddd,#ccc)}.ui-overlay-b{background-image:none;border-width:0}.ui-body-b,.ui-body-b input,.ui-body-b select,.ui-body-b textarea,.ui-body-b button{font-family:Helvetica,Arial,sans-serif}.ui-body-b .ui-link-inherit{color:#333}.ui-body-b .ui-link{color:#2489ce;font-weight:bold}.ui-body-b .ui-link:visited{color:#2489ce}.ui-body-b .ui-link:hover{color:#2489ce}.ui-body-b .ui-link:active{color:#2489ce}.ui-btn-up-b{border:1px solid #044062;background:#396b9e;font-weight:bold;color:#fff;text-shadow:0 1px 1px #194b7e;background-image:-webkit-gradient(linear,left top,left bottom,from(#5f9cc5),to(#396b9e));background-image:-webkit-linear-gradient(#5f9cc5,#396b9e);background-image:-moz-linear-gradient(#5f9cc5,#396b9e);background-image:-ms-linear-gradient(#5f9cc5,#396b9e);background-image:-o-linear-gradient(#5f9cc5,#396b9e);background-image:linear-gradient(#5f9cc5,#396b9e)}.ui-btn-up-b:visited,.ui-btn-up-b a.ui-link-inherit{color:#fff}.ui-btn-hover-b{border:1px solid #00415e;background:#4b88b6;font-weight:bold;color:#fff;text-shadow:0 1px 1px #194b7e;background-image:-webkit-gradient(linear,left top,left bottom,from(#6facd5),to(#4272a4));background-image:-webkit-linear-gradient(#6facd5,#4272a4);background-image:-moz-linear-gradient(#6facd5,#4272a4);background-image:-ms-linear-gradient(#6facd5,#4272a4);background-image:-o-linear-gradient(#6facd5,#4272a4);background-image:linear-gradient(#6facd5,#4272a4)}.ui-btn-hover-b:visited,.ui-btn-hover-a:hover,.ui-btn-hover-b a.ui-link-inherit{color:#fff}.ui-btn-down-b{border:1px solid #225377;background:#4e89c5;font-weight:bold;color:#fff;text-shadow:0 1px 1px #194b7e;background-image:-webkit-gradient(linear,left top,left bottom,from(#295b8e),to(#3e79b5));background-image:-webkit-linear-gradient(#295b8e,#3e79b5);background-image:-moz-linear-gradient(#295b8e,#3e79b5);background-image:-ms-linear-gradient(#295b8e,#3e79b5);background-image:-o-linear-gradient(#295b8e,#3e79b5);background-image:linear-gradient(#295b8e,#3e79b5)}.ui-btn-down-b:visited,.ui-btn-down-b:hover,.ui-btn-down-b a.ui-link-inherit{color:#fff}.ui-btn-up-b,.ui-btn-hover-b,.ui-btn-down-b{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-c{border:1px solid #b3b3b3;background:#eee;color:#3e3e3e;font-weight:bold;text-shadow:0 1px 1px #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#f0f0f0),to(#ddd));background-image:-webkit-linear-gradient(#f0f0f0,#ddd);background-image:-moz-linear-gradient(#f0f0f0,#ddd);background-image:-ms-linear-gradient(#f0f0f0,#ddd);background-image:-o-linear-gradient(#f0f0f0,#ddd);background-image:linear-gradient(#f0f0f0,#ddd)}.ui-bar-c .ui-link-inherit{color:#3e3e3e}.ui-bar-c a.ui-link{color:#7cc4e7;font-weight:bold}.ui-bar-c a.ui-link:visited{color:#2489ce}.ui-bar-c a.ui-link:hover{color:#2489ce}.ui-bar-c a.ui-link:active{color:#2489ce}.ui-bar-c,.ui-bar-c input,.ui-bar-c select,.ui-bar-c textarea,.ui-bar-c button{font-family:Helvetica,Arial,sans-serif}.ui-body-c,.ui-overlay-c{border:1px solid #aaa;color:#333;text-shadow:0 1px 0 #fff;background:#f9f9f9;background-image:-webkit-gradient(linear,left top,left bottom,from(#f9f9f9),to(#eee));background-image:-webkit-linear-gradient(#f9f9f9,#eee);background-image:-moz-linear-gradient(#f9f9f9,#eee);background-image:-ms-linear-gradient(#f9f9f9,#eee);background-image:-o-linear-gradient(#f9f9f9,#eee);background-image:linear-gradient(#f9f9f9,#eee)}.ui-overlay-c{background-image:none;border-width:0}.ui-body-c,.ui-body-c input,.ui-body-c select,.ui-body-c textarea,.ui-body-c button{font-family:Helvetica,Arial,sans-serif}.ui-body-c .ui-link-inherit{color:#333}.ui-body-c .ui-link{color:#2489ce;font-weight:bold}.ui-body-c .ui-link:visited{color:#2489ce}.ui-body-c .ui-link:hover{color:#2489ce}.ui-body-c .ui-link:active{color:#2489ce}.ui-btn-up-c{border:1px solid #ccc;background:#eee;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#f1f1f1));background-image:-webkit-linear-gradient(#fff,#f1f1f1);background-image:-moz-linear-gradient(#fff,#f1f1f1);background-image:-ms-linear-gradient(#fff,#f1f1f1);background-image:-o-linear-gradient(#fff,#f1f1f1);background-image:linear-gradient(#fff,#f1f1f1)}.ui-btn-up-c:visited,.ui-btn-up-c a.ui-link-inherit{color:#2f3e46}.ui-btn-hover-c{border:1px solid #bbb;background:#dfdfdf;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#f6f6f6),to(#e0e0e0));background-image:-webkit-linear-gradient(#f6f6f6,#e0e0e0);background-image:-moz-linear-gradient(#f6f6f6,#e0e0e0);background-image:-ms-linear-gradient(#f6f6f6,#e0e0e0);background-image:-o-linear-gradient(#f6f6f6,#e0e0e0);background-image:linear-gradient(#f6f6f6,#e0e0e0)}.ui-btn-hover-c:visited,.ui-btn-hover-c:hover,.ui-btn-hover-c a.ui-link-inherit{color:#2f3e46}.ui-btn-down-c{border:1px solid #bbb;background:#d6d6d6;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#d0d0d0),to(#dfdfdf));background-image:-webkit-linear-gradient(#d0d0d0,#dfdfdf);background-image:-moz-linear-gradient(#d0d0d0,#dfdfdf);background-image:-ms-linear-gradient(#d0d0d0,#dfdfdf);background-image:-o-linear-gradient(#d0d0d0,#dfdfdf);background-image:linear-gradient(#d0d0d0,#dfdfdf)}.ui-btn-down-c:visited,.ui-btn-down-c:hover,.ui-btn-down-c a.ui-link-inherit{color:#2f3e46}.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-d{border:1px solid #bbb;background:#bbb;color:#333;text-shadow:0 1px 0 #eee;background-image:-webkit-gradient(linear,left top,left bottom,from(#ddd),to(#bbb));background-image:-webkit-linear-gradient(#ddd,#bbb);background-image:-moz-linear-gradient(#ddd,#bbb);background-image:-ms-linear-gradient(#ddd,#bbb);background-image:-o-linear-gradient(#ddd,#bbb);background-image:linear-gradient(#ddd,#bbb)}.ui-bar-d,.ui-bar-d input,.ui-bar-d select,.ui-bar-d textarea,.ui-bar-d button{font-family:Helvetica,Arial,sans-serif}.ui-bar-d .ui-link-inherit{color:#333}.ui-bar-d a.ui-link{color:#2489ce;font-weight:bold}.ui-bar-d a.ui-link:visited{color:#2489ce}.ui-bar-d a.ui-link:hover{color:#2489ce}.ui-bar-d a.ui-link:active{color:#2489ce}.ui-body-d,.ui-overlay-d{border:1px solid #bbb;color:#333;text-shadow:0 1px 0 #fff;background:#fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#fff));background-image:-webkit-linear-gradient(#fff,#fff);background-image:-moz-linear-gradient(#fff,#fff);background-image:-ms-linear-gradient(#fff,#fff);background-image:-o-linear-gradient(#fff,#fff);background-image:linear-gradient(#fff,#fff)}.ui-overlay-d{background-image:none;border-width:0}.ui-body-d,.ui-body-d input,.ui-body-d select,.ui-body-d textarea,.ui-body-d button{font-family:Helvetica,Arial,sans-serif}.ui-body-d .ui-link-inherit{color:#333}.ui-body-d .ui-link{color:#2489ce;font-weight:bold}.ui-body-d .ui-link:visited{color:#2489ce}.ui-body-d .ui-link:hover{color:#2489ce}.ui-body-d .ui-link:active{color:#2489ce}.ui-btn-up-d{border:1px solid #bbb;background:#fff;font-weight:bold;color:#333;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fafafa),to(#f6f6f6));background-image:-webkit-linear-gradient(#fafafa,#f6f6f6);background-image:-moz-linear-gradient(#fafafa,#f6f6f6);background-image:-ms-linear-gradient(#fafafa,#f6f6f6);background-image:-o-linear-gradient(#fafafa,#f6f6f6);background-image:linear-gradient(#fafafa,#f6f6f6)}.ui-btn-up-d:visited,.ui-btn-up-d a.ui-link-inherit{color:#333}.ui-btn-hover-d{border:1px solid #aaa;background:#eee;font-weight:bold;color:#333;cursor:pointer;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#eee),to(#fff));background-image:-webkit-linear-gradient(#eee,#fff);background-image:-moz-linear-gradient(#eee,#fff);background-image:-ms-linear-gradient(#eee,#fff);background-image:-o-linear-gradient(#eee,#fff);background-image:linear-gradient(#eee,#fff)}.ui-btn-hover-d:visited,.ui-btn-hover-d:hover,.ui-btn-hover-d a.ui-link-inherit{color:#333}.ui-btn-down-d{border:1px solid #aaa;background:#eee;font-weight:bold;color:#333;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#e5e5e5),to(#f2f2f2));background-image:-webkit-linear-gradient(#e5e5e5,#f2f2f2);background-image:-moz-linear-gradient(#e5e5e5,#f2f2f2);background-image:-ms-linear-gradient(#e5e5e5,#f2f2f2);background-image:-o-linear-gradient(#e5e5e5,#f2f2f2);background-image:linear-gradient(#e5e5e5,#f2f2f2)}.ui-btn-down-d:visited,.ui-btn-down-d:hover,.ui-btn-down-d a.ui-link-inherit{color:#333}.ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-e{border:1px solid #f7c942;background:#fadb4e;color:#333;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fceda7),to(#fbef7e));background-image:-webkit-linear-gradient(#fceda7,#fbef7e);background-image:-moz-linear-gradient(#fceda7,#fbef7e);background-image:-ms-linear-gradient(#fceda7,#fbef7e);background-image:-o-linear-gradient(#fceda7,#fbef7e);background-image:linear-gradient(#fceda7,#fbef7e)}.ui-bar-e,.ui-bar-e input,.ui-bar-e select,.ui-bar-e textarea,.ui-bar-e button{font-family:Helvetica,Arial,sans-serif}.ui-bar-e .ui-link-inherit{color:#333}.ui-bar-e a.ui-link{color:#2489ce;font-weight:bold}.ui-bar-e a.ui-link:visited{color:#2489ce}.ui-bar-e a.ui-link:hover{color:#2489ce}.ui-bar-e a.ui-link:active{color:#2489ce}.ui-body-e,.ui-overlay-e{border:1px solid #f7c942;color:#222;text-shadow:0 1px 0 #fff;background:#fff9df;background-image:-webkit-gradient(linear,left top,left bottom,from(#fffadf),to(#fff3a5));background-image:-webkit-linear-gradient(#fffadf,#fff3a5);background-image:-moz-linear-gradient(#fffadf,#fff3a5);background-image:-ms-linear-gradient(#fffadf,#fff3a5);background-image:-o-linear-gradient(#fffadf,#fff3a5);background-image:linear-gradient(#fffadf,#fff3a5)}.ui-overlay-e{background-image:none;border-width:0}.ui-body-e,.ui-body-e input,.ui-body-e select,.ui-body-e textarea,.ui-body-e button{font-family:Helvetica,Arial,sans-serif}.ui-body-e .ui-link-inherit{color:#333}.ui-body-e .ui-link{color:#2489ce;font-weight:bold}.ui-body-e .ui-link:visited{color:#2489ce}.ui-body-e .ui-link:hover{color:#2489ce}.ui-body-e .ui-link:active{color:#2489ce}.ui-btn-up-e{border:1px solid #f4c63f;background:#fadb4e;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#ffefaa),to(#ffe155));background-image:-webkit-linear-gradient(#ffefaa,#ffe155);background-image:-moz-linear-gradient(#ffefaa,#ffe155);background-image:-ms-linear-gradient(#ffefaa,#ffe155);background-image:-o-linear-gradient(#ffefaa,#ffe155);background-image:linear-gradient(#ffefaa,#ffe155)}.ui-btn-up-e:visited,.ui-btn-up-e a.ui-link-inherit{color:#222}.ui-btn-hover-e{border:1px solid #f2c43d;background:#fbe26f;font-weight:bold;color:#111;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fff5ba),to(#fbdd52));background-image:-webkit-linear-gradient(#fff5ba,#fbdd52);background-image:-moz-linear-gradient(#fff5ba,#fbdd52);background-image:-ms-linear-gradient(#fff5ba,#fbdd52);background-image:-o-linear-gradient(#fff5ba,#fbdd52);background-image:linear-gradient(#fff5ba,#fbdd52)}.ui-btn-hover-e:visited,.ui-btn-hover-e:hover,.ui-btn-hover-e a.ui-link-inherit{color:#333}.ui-btn-down-e{border:1px solid #f2c43d;background:#fceda7;font-weight:bold;color:#111;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#f8d94c),to(#fadb4e));background-image:-webkit-linear-gradient(#f8d94c,#fadb4e);background-image:-moz-linear-gradient(#f8d94c,#fadb4e);background-image:-ms-linear-gradient(#f8d94c,#fadb4e);background-image:-o-linear-gradient(#f8d94c,#fadb4e);background-image:linear-gradient(#f8d94c,#fadb4e)}.ui-btn-down-e:visited,.ui-btn-down-e:hover,.ui-btn-down-e a.ui-link-inherit{color:#333}.ui-btn-up-e,.ui-btn-hover-e,.ui-btn-down-e{font-family:Helvetica,Arial,sans-serif;text-decoration:none}a.ui-link-inherit{text-decoration:none!important}.ui-btn-active{border:1px solid #2373a5;background:#5393c5;font-weight:bold;color:#fff;cursor:pointer;text-shadow:0 1px 1px #3373a5;text-decoration:none;background-image:-webkit-gradient(linear,left top,left bottom,from(#5393c5),to(#6facd5));background-image:-webkit-linear-gradient(#5393c5,#6facd5);background-image:-moz-linear-gradient(#5393c5,#6facd5);background-image:-ms-linear-gradient(#5393c5,#6facd5);background-image:-o-linear-gradient(#5393c5,#6facd5);background-image:linear-gradient(#5393c5,#6facd5);font-family:Helvetica,Arial,sans-serif}.ui-btn-active:visited,.ui-btn-active:hover,.ui-btn-active a.ui-link-inherit{color:#fff}.ui-btn-inner{border-top:1px solid #fff;border-color:rgba(255,255,255,.3)}.ui-corner-tl{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em}.ui-corner-tr{-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em}.ui-corner-bl{-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em}.ui-corner-br{-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-top{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em;-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em}.ui-corner-bottom{-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em;-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-right{-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em;-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-left{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em;-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em}.ui-corner-all{-moz-border-radius:.6em;-webkit-border-radius:.6em;border-radius:.6em}.ui-corner-none{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.ui-br{border-bottom:#828282;border-bottom:rgba(130,130,130,.3);border-bottom-width:1px;border-bottom-style:solid}.ui-disabled{opacity:.3}.ui-disabled,.ui-disabled a{cursor:default!important;pointer-events:none}.ui-disabled .ui-btn-text{-ms-filter:"alpha(opacity=30)";filter:alpha(opacity=30);zoom:1}.ui-icon,.ui-icon-searchfield:after{background:#666;background:rgba(0,0,0,.4);background-image:url(images/icons-18-white.png);background-repeat:no-repeat;-moz-border-radius:9px;-webkit-border-radius:9px;border-radius:9px}.ui-icon-alt{background:#fff;background:rgba(255,255,255,.3);background-image:url(images/icons-18-black.png);background-repeat:no-repeat}@media only screen and (-webkit-min-device-pixel-ratio:1.5),only screen and (min--moz-device-pixel-ratio:1.5),only screen and (min-resolution:240dpi){.ui-icon-plus,.ui-icon-minus,.ui-icon-delete,.ui-icon-arrow-r,.ui-icon-arrow-l,.ui-icon-arrow-u,.ui-icon-arrow-d,.ui-icon-check,.ui-icon-gear,.ui-icon-refresh,.ui-icon-forward,.ui-icon-back,.ui-icon-grid,.ui-icon-star,.ui-icon-alert,.ui-icon-info,.ui-icon-home,.ui-icon-search,.ui-icon-searchfield:after,.ui-icon-checkbox-off,.ui-icon-checkbox-on,.ui-icon-radio-off,.ui-icon-radio-on{background-image:url(images/icons-36-white.png);-moz-background-size:776px 18px;-o-background-size:776px 18px;-webkit-background-size:776px 18px;background-size:776px 18px}.ui-icon-alt{background-image:url(images/icons-36-black.png)}}.ui-icon-plus{background-position:-0 50%}.ui-icon-minus{background-position:-36px 50%}.ui-icon-delete{background-position:-72px 50%}.ui-icon-arrow-r{background-position:-108px 50%}.ui-icon-arrow-l{background-position:-144px 50%}.ui-icon-arrow-u{background-position:-180px 50%}.ui-icon-arrow-d{background-position:-216px 50%}.ui-icon-check{background-position:-252px 50%}.ui-icon-gear{background-position:-288px 50%}.ui-icon-refresh{background-position:-324px 50%}.ui-icon-forward{background-position:-360px 50%}.ui-icon-back{background-position:-396px 50%}.ui-icon-grid{background-position:-432px 50%}.ui-icon-star{background-position:-468px 50%}.ui-icon-alert{background-position:-504px 50%}.ui-icon-info{background-position:-540px 50%}.ui-icon-home{background-position:-576px 50%}.ui-icon-search,.ui-icon-searchfield:after{background-position:-612px 50%}.ui-icon-checkbox-off{background-position:-684px 50%}.ui-icon-checkbox-on{background-position:-648px 50%}.ui-icon-radio-off{background-position:-756px 50%}.ui-icon-radio-on{background-position:-720px 50%}.ui-checkbox .ui-icon{-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px}.ui-icon-checkbox-off,.ui-icon-radio-off{background-color:transparent}.ui-checkbox-on .ui-icon,.ui-radio-on .ui-icon{background-color:#4596ce}.ui-icon-loading{background:url(images/ajax-loader.gif);background-size:46px 46px}.ui-btn-corner-tl{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em}.ui-btn-corner-tr{-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em}.ui-btn-corner-bl{-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em}.ui-btn-corner-br{-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-top{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em;-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em}.ui-btn-corner-bottom{-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em;-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-right{-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em;-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-left{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em;-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em}.ui-btn-corner-all{-moz-border-radius:1em;-webkit-border-radius:1em;border-radius:1em}.ui-corner-tl,.ui-corner-tr,.ui-corner-bl,.ui-corner-br,.ui-corner-top,.ui-corner-bottom,.ui-corner-right,.ui-corner-left,.ui-corner-all,.ui-btn-corner-tl,.ui-btn-corner-tr,.ui-btn-corner-bl,.ui-btn-corner-br,.ui-btn-corner-top,.ui-btn-corner-bottom,.ui-btn-corner-right,.ui-btn-corner-left,.ui-btn-corner-all{-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box}.ui-overlay{background:#666;opacity:.5;filter:Alpha(Opacity=50);position:absolute;width:100%;height:100%}.ui-overlay-shadow{-moz-box-shadow:0 0 12px rgba(0,0,0,.6);-webkit-box-shadow:0 0 12px rgba(0,0,0,.6);box-shadow:0 0 12px rgba(0,0,0,.6)}.ui-shadow{-moz-box-shadow:0 1px 4px rgba(0,0,0,.3);-webkit-box-shadow:0 1px 4px rgba(0,0,0,.3);box-shadow:0 1px 4px rgba(0,0,0,.3)}.ui-bar-a .ui-shadow,.ui-bar-b .ui-shadow,.ui-bar-c .ui-shadow{-moz-box-shadow:0 1px 0 rgba(255,255,255,.3);-webkit-box-shadow:0 1px 0 rgba(255,255,255,.3);box-shadow:0 1px 0 rgba(255,255,255,.3)}.ui-shadow-inset{-moz-box-shadow:inset 0 1px 4px rgba(0,0,0,.2);-webkit-box-shadow:inset 0 1px 4px rgba(0,0,0,.2);box-shadow:inset 0 1px 4px rgba(0,0,0,.2)}.ui-icon-shadow{-moz-box-shadow:0 1px 0 rgba(255,255,255,.4);-webkit-box-shadow:0 1px 0 rgba(255,255,255,.4);box-shadow:0 1px 0 rgba(255,255,255,.4)}.ui-btn:focus,.ui-link-inherit:focus{outline:0}.ui-btn.ui-focus{z-index:1}.ui-focus,.ui-btn:focus{-moz-box-shadow:inset 0 0 3px #387bbe,0px 0 9px #387bbe;-webkit-box-shadow:inset 0 0 3px #387bbe,0px 0 9px #387bbe;box-shadow:inset 0 0 3px #387bbe,0px 0 9px #387bbe}.ui-input-text.ui-focus,.ui-input-search.ui-focus{-moz-box-shadow:0 0 12px #387bbe;-webkit-box-shadow:0 0 12px #387bbe;box-shadow:0 0 12px #387bbe}.ui-mobile-nosupport-boxshadow *{-moz-box-shadow:none!important;-webkit-box-shadow:none!important;box-shadow:none!important}.ui-mobile-nosupport-boxshadow .ui-focus,.ui-mobile-nosupport-boxshadow .ui-btn:focus,.ui-mobile-nosupport-boxshadow .ui-link-inherit:focus{outline-width:1px;outline-style:auto}.ui-mobile,.ui-mobile body{height:99.9%}.ui-mobile fieldset,.ui-page{padding:0;margin:0}.ui-mobile a img,.ui-mobile fieldset{border-width:0}.ui-mobile-viewport{margin:0;overflow-x:visible;-webkit-text-size-adjust:none;-ms-text-size-adjust:none;-webkit-tap-highlight-color:rgba(0,0,0,0)}body.ui-mobile-viewport,div.ui-mobile-viewport{overflow-x:hidden}.ui-mobile [data-role=page],.ui-mobile [data-role=dialog],.ui-page{top:0;left:0;width:100%;min-height:100%;position:absolute;display:none;border:0}.ui-mobile .ui-page-active{display:block;overflow:visible}.ui-page{outline:0}@media screen and (orientation:portrait){.ui-mobile,.ui-mobile .ui-page{min-height:420px}}@media screen and (orientation:landscape){.ui-mobile,.ui-mobile .ui-page{min-height:300px}}.ui-loading .ui-loader{display:block}.ui-loader{display:none;z-index:9999999;position:fixed;top:50%;left:50%;border:0}.ui-loader-default{background:0;opacity:.18;width:46px;height:46px;margin-left:-23px;margin-top:-23px}.ui-loader-verbose{width:200px;opacity:.88;box-shadow:0 1px 1px -1px #fff;height:auto;margin-left:-110px;margin-top:-43px;padding:10px}.ui-loader-default h1{font-size:0;width:0;height:0;overflow:hidden}.ui-loader-verbose h1{font-size:16px;margin:0;text-align:center}.ui-loader .ui-icon{background-color:#000;display:block;margin:0;width:44px;height:44px;padding:1px;-webkit-border-radius:36px;-moz-border-radius:36px;border-radius:36px}.ui-loader-verbose .ui-icon{margin:0 auto 10px;opacity:.75}.ui-loader-textonly{padding:15px;margin-left:-115px}.ui-loader-textonly .ui-icon{display:none}.ui-loader-fakefix{position:absolute}.ui-mobile-rendering>*{visibility:hidden}.ui-bar,.ui-body{position:relative;padding:.4em 15px;overflow:hidden;display:block;clear:both}.ui-bar{font-size:16px;margin:0}.ui-bar h1,.ui-bar h2,.ui-bar h3,.ui-bar h4,.ui-bar h5,.ui-bar h6{margin:0;padding:0;font-size:16px;display:inline-block}.ui-header,.ui-footer{position:relative;border-left-width:0;border-right-width:0;zoom:1}.ui-header .ui-btn-left,.ui-header .ui-btn-right,.ui-footer .ui-btn-left,.ui-footer .ui-btn-right{position:absolute;top:3px}.ui-header .ui-btn-left,.ui-footer .ui-btn-left{left:5px}.ui-header .ui-btn-right,.ui-footer .ui-btn-right{right:5px}.ui-footer .ui-btn-icon-notext,.ui-header .ui-btn-icon-notext{top:6px}.ui-header .ui-title,.ui-footer .ui-title{min-height:1.1em;text-align:center;font-size:16px;display:block;margin:.6em 30% .8em;padding:0;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;outline:0!important}.ui-footer .ui-title{margin:.6em 15px .8em}.ui-content{border-width:0;overflow:visible;overflow-x:hidden;padding:15px}.ui-icon{width:18px;height:18px}.ui-nojs{position:absolute;left:-9999px}.ui-hide-label label.ui-input-text,.ui-hide-label label.ui-select,.ui-hide-label label.ui-slider,.ui-hide-label label.ui-submit,.ui-hide-label .ui-controlgroup-label,.ui-hidden-accessible{position:absolute!important;left:-9999px;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px)}.ui-mobile-viewport-transitioning,.ui-mobile-viewport-transitioning .ui-page{width:100%;height:100%;overflow:hidden;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.in{-webkit-animation-timing-function:ease-out;-webkit-animation-duration:350ms;-moz-animation-timing-function:ease-out;-moz-animation-duration:350ms}.out{-webkit-animation-timing-function:ease-in;-webkit-animation-duration:225ms;-moz-animation-timing-function:ease-in;-moz-animation-duration:225}@-webkit-keyframes fadein{from{opacity:0}to{opacity:1}}@-moz-keyframes fadein{from{opacity:0}to{opacity:1}}@-webkit-keyframes fadeout{from{opacity:1}to{opacity:0}}@-moz-keyframes fadeout{from{opacity:1}to{opacity:0}}.fade.out{opacity:0;-webkit-animation-duration:125ms;-webkit-animation-name:fadeout;-moz-animation-duration:125ms;-moz-animation-name:fadeout}.fade.in{opacity:1;-webkit-animation-duration:225ms;-webkit-animation-name:fadein;-moz-animation-duration:225ms;-moz-animation-name:fadein}.pop{-webkit-transform-origin:50% 50%;-moz-transform-origin:50% 50%}.pop.in{-webkit-transform:scale(1);-moz-transform:scale(1);opacity:1;-webkit-animation-name:popin;-moz-animation-name:popin;-webkit-animation-duration:350ms;-moz-animation-duration:350ms}.pop.out{-webkit-animation-name:fadeout;-moz-animation-name:fadeout;opacity:0;-webkit-animation-duration:100ms;-moz-animation-duration:100ms}.pop.in.reverse{-webkit-animation-name:fadein;-moz-animation-name:fadein}.pop.out.reverse{-webkit-transform:scale(.8);-moz-transform:scale(.8);-webkit-animation-name:popout;-moz-animation-name:popout}@-webkit-keyframes popin{from{-webkit-transform:scale(.8);opacity:0}to{-webkit-transform:scale(1);opacity:1}}@-moz-keyframes popin{from{-moz-transform:scale(.8);opacity:0}to{-moz-transform:scale(1);opacity:1}}@-webkit-keyframes popout{from{-webkit-transform:scale(1);opacity:1}to{-webkit-transform:scale(.8);opacity:0}}@-moz-keyframes popout{from{-moz-transform:scale(1);opacity:1}to{-moz-transform:scale(.8);opacity:0}}@-webkit-keyframes slideinfromright{from{-webkit-transform:translateX(100%)}to{-webkit-transform:translateX(0)}}@-moz-keyframes slideinfromright{from{-moz-transform:translateX(100%)}to{-moz-transform:translateX(0)}}@-webkit-keyframes slideinfromleft{from{-webkit-transform:translateX(-100%)}to{-webkit-transform:translateX(0)}}@-moz-keyframes slideinfromleft{from{-moz-transform:translateX(-100%)}to{-moz-transform:translateX(0)}}@-webkit-keyframes slideouttoleft{from{-webkit-transform:translateX(0)}to{-webkit-transform:translateX(-100%)}}@-moz-keyframes slideouttoleft{from{-moz-transform:translateX(0)}to{-moz-transform:translateX(-100%)}}@-webkit-keyframes slideouttoright{from{-webkit-transform:translateX(0)}to{-webkit-transform:translateX(100%)}}@-moz-keyframes slideouttoright{from{-moz-transform:translateX(0)}to{-moz-transform:translateX(100%)}}.slide.out,.slide.in{-webkit-animation-timing-function:ease-out;-webkit-animation-duration:350ms;-moz-animation-timing-function:ease-out;-moz-animation-duration:350ms}.slide.out{-webkit-transform:translateX(-100%);-webkit-animation-name:slideouttoleft;-moz-transform:translateX(-100%);-moz-animation-name:slideouttoleft}.slide.in{-webkit-transform:translateX(0);-webkit-animation-name:slideinfromright;-moz-transform:translateX(0);-moz-animation-name:slideinfromright}.slide.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:slideouttoright;-moz-transform:translateX(100%);-moz-animation-name:slideouttoright}.slide.in.reverse{-webkit-transform:translateX(0);-webkit-animation-name:slideinfromleft;-moz-transform:translateX(0);-moz-animation-name:slideinfromleft}.slidefade.out{-webkit-transform:translateX(-100%);-webkit-animation-name:slideouttoleft;-moz-transform:translateX(-100%);-moz-animation-name:slideouttoleft;-webkit-animation-duration:225ms;-moz-animation-duration:225ms}.slidefade.in{-webkit-transform:translateX(0);-webkit-animation-name:fadein;-moz-transform:translateX(0);-moz-animation-name:fadein;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}.slidefade.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:slideouttoright;-moz-transform:translateX(100%);-moz-animation-name:slideouttoright;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}.slidefade.in.reverse{-webkit-transform:translateX(0);-webkit-animation-name:fadein;-moz-transform:translateX(0);-moz-animation-name:fadein;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}.slidedown.out{-webkit-animation-name:fadeout;-moz-animation-name:fadeout;-webkit-animation-duration:100ms;-moz-animation-duration:100ms}.slidedown.in{-webkit-transform:translateY(0);-webkit-animation-name:slideinfromtop;-moz-transform:translateY(0);-moz-animation-name:slideinfromtop;-webkit-animation-duration:250ms;-moz-animation-duration:250ms}.slidedown.in.reverse{-webkit-animation-name:fadein;-moz-animation-name:fadein;-webkit-animation-duration:150ms;-moz-animation-duration:150ms}.slidedown.out.reverse{-webkit-transform:translateY(-100%);-moz-transform:translateY(-100%);-webkit-animation-name:slideouttotop;-moz-animation-name:slideouttotop;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}@-webkit-keyframes slideinfromtop{from{-webkit-transform:translateY(-100%)}to{-webkit-transform:translateY(0)}}@-moz-keyframes slideinfromtop{from{-moz-transform:translateY(-100%)}to{-moz-transform:translateY(0)}}@-webkit-keyframes slideouttotop{from{-webkit-transform:translateY(0)}to{-webkit-transform:translateY(-100%)}}@-moz-keyframes slideouttotop{from{-moz-transform:translateY(0)}to{-moz-transform:translateY(-100%)}}.slideup.out{-webkit-animation-name:fadeout;-moz-animation-name:fadeout;-webkit-animation-duration:100ms;-moz-animation-duration:100ms}.slideup.in{-webkit-transform:translateY(0);-webkit-animation-name:slideinfrombottom;-moz-transform:translateY(0);-moz-animation-name:slideinfrombottom;-webkit-animation-duration:250ms;-moz-animation-duration:250ms}.slideup.in.reverse{-webkit-animation-name:fadein;-moz-animation-name:fadein;-webkit-animation-duration:150ms;-moz-animation-duration:150ms}.slideup.out.reverse{-webkit-transform:translateY(100%);-moz-transform:translateY(100%);-webkit-animation-name:slideouttobottom;-moz-animation-name:slideouttobottom;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}@-webkit-keyframes slideinfrombottom{from{-webkit-transform:translateY(100%)}to{-webkit-transform:translateY(0)}}@-moz-keyframes slideinfrombottom{from{-moz-transform:translateY(100%)}to{-moz-transform:translateY(0)}}@-webkit-keyframes slideouttobottom{from{-webkit-transform:translateY(0)}to{-webkit-transform:translateY(100%)}}@-moz-keyframes slideouttobottom{from{-moz-transform:translateY(0)}to{-moz-transform:translateY(100%)}}.viewport-flip{-webkit-perspective:1000;-moz-perspective:1000;position:absolute}.flip{-webkit-backface-visibility:hidden;-webkit-transform:translateX(0);-moz-backface-visibility:hidden;-moz-transform:translateX(0)}.flip.out{-webkit-transform:rotateY(-90deg) scale(.9);-webkit-animation-name:flipouttoleft;-webkit-animation-duration:175ms;-moz-transform:rotateY(-90deg) scale(.9);-moz-animation-name:flipouttoleft;-moz-animation-duration:175ms}.flip.in{-webkit-animation-name:flipintoright;-webkit-animation-duration:225ms;-moz-animation-name:flipintoright;-moz-animation-duration:225ms}.flip.out.reverse{-webkit-transform:rotateY(90deg) scale(.9);-webkit-animation-name:flipouttoright;-moz-transform:rotateY(90deg) scale(.9);-moz-animation-name:flipouttoright}.flip.in.reverse{-webkit-animation-name:flipintoleft;-moz-animation-name:flipintoleft}@-webkit-keyframes flipouttoleft{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(-90deg) scale(.9)}}@-moz-keyframes flipouttoleft{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(-90deg) scale(.9)}}@-webkit-keyframes flipouttoright{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(90deg) scale(.9)}}@-moz-keyframes flipouttoright{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(90deg) scale(.9)}}@-webkit-keyframes flipintoleft{from{-webkit-transform:rotateY(-90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoleft{from{-moz-transform:rotateY(-90deg) scale(.9)}to{-moz-transform:rotateY(0)}}@-webkit-keyframes flipintoright{from{-webkit-transform:rotateY(90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoright{from{-moz-transform:rotateY(90deg) scale(.9)}to{-moz-transform:rotateY(0)}}.viewport-turn{-webkit-perspective:1000;-moz-perspective:1000;position:absolute}.turn{-webkit-backface-visibility:hidden;-webkit-transform:translateX(0);-webkit-transform-origin:0 0;-moz-backface-visibility:hidden;-moz-transform:translateX(0);-moz-transform-origin:0 0}.turn.out{-webkit-transform:rotateY(-90deg) scale(.9);-webkit-animation-name:flipouttoleft;-moz-transform:rotateY(-90deg) scale(.9);-moz-animation-name:flipouttoleft;-webkit-animation-duration:125ms;-moz-animation-duration:125ms}.turn.in{-webkit-animation-name:flipintoright;-moz-animation-name:flipintoright;-webkit-animation-duration:250ms;-moz-animation-duration:250ms}.turn.out.reverse{-webkit-transform:rotateY(90deg) scale(.9);-webkit-animation-name:flipouttoright;-moz-transform:rotateY(90deg) scale(.9);-moz-animation-name:flipouttoright}.turn.in.reverse{-webkit-animation-name:flipintoleft;-moz-animation-name:flipintoleft}@-webkit-keyframes flipouttoleft{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(-90deg) scale(.9)}}@-moz-keyframes flipouttoleft{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(-90deg) scale(.9)}}@-webkit-keyframes flipouttoright{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(90deg) scale(.9)}}@-moz-keyframes flipouttoright{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(90deg) scale(.9)}}@-webkit-keyframes flipintoleft{from{-webkit-transform:rotateY(-90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoleft{from{-moz-transform:rotateY(-90deg) scale(.9)}to{-moz-transform:rotateY(0)}}@-webkit-keyframes flipintoright{from{-webkit-transform:rotateY(90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoright{from{-moz-transform:rotateY(90deg) scale(.9)}to{-moz-transform:rotateY(0)}}.flow{-webkit-transform-origin:50% 30%;-moz-transform-origin:50% 30%;-webkit-box-shadow:0 0 20px rgba(0,0,0,.4);-moz-box-shadow:0 0 20px rgba(0,0,0,.4)}.ui-dialog.flow{-webkit-transform-origin:none;-moz-transform-origin:none;-webkit-box-shadow:none;-moz-box-shadow:none}.flow.out{-webkit-transform:translateX(-100%) scale(.7);-webkit-animation-name:flowouttoleft;-webkit-animation-timing-function:ease;-webkit-animation-duration:350ms;-moz-transform:translateX(-100%) scale(.7);-moz-animation-name:flowouttoleft;-moz-animation-timing-function:ease;-moz-animation-duration:350ms}.flow.in{-webkit-transform:translateX(0) scale(1);-webkit-animation-name:flowinfromright;-webkit-animation-timing-function:ease;-webkit-animation-duration:350ms;-moz-transform:translateX(0) scale(1);-moz-animation-name:flowinfromright;-moz-animation-timing-function:ease;-moz-animation-duration:350ms}.flow.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:flowouttoright;-moz-transform:translateX(100%);-moz-animation-name:flowouttoright}.flow.in.reverse{-webkit-animation-name:flowinfromleft;-moz-animation-name:flowinfromleft}@-webkit-keyframes flowouttoleft{0%{-webkit-transform:translateX(0) scale(1)}60%,70%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(-100%) scale(.7)}}@-moz-keyframes flowouttoleft{0%{-moz-transform:translateX(0) scale(1)}60%,70%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(-100%) scale(.7)}}@-webkit-keyframes flowouttoright{0%{-webkit-transform:translateX(0) scale(1)}60%,70%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(100%) scale(.7)}}@-moz-keyframes flowouttoright{0%{-moz-transform:translateX(0) scale(1)}60%,70%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(100%) scale(.7)}}@-webkit-keyframes flowinfromleft{0%{-webkit-transform:translateX(-100%) scale(.7)}30%,40%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(0) scale(1)}}@-moz-keyframes flowinfromleft{0%{-moz-transform:translateX(-100%) scale(.7)}30%,40%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(0) scale(1)}}@-webkit-keyframes flowinfromright{0%{-webkit-transform:translateX(100%) scale(.7)}30%,40%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(0) scale(1)}}@-moz-keyframes flowinfromright{0%{-moz-transform:translateX(100%) scale(.7)}30%,40%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(0) scale(1)}}.ui-grid-a,.ui-grid-b,.ui-grid-c,.ui-grid-d{overflow:hidden}.ui-block-a,.ui-block-b,.ui-block-c,.ui-block-d,.ui-block-e{margin:0;padding:0;border:0;float:left;min-height:1px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.ui-grid-solo .ui-block-a{display:block;float:none}.ui-grid-a .ui-block-a,.ui-grid-a .ui-block-b{width:49.95%}.ui-grid-a>:nth-child(n){width:50%;margin-right:-.5px}.ui-grid-a .ui-block-a{clear:left}.ui-grid-b .ui-block-a,.ui-grid-b .ui-block-b,.ui-grid-b .ui-block-c{width:33.25%}.ui-grid-b>:nth-child(n){width:33.333%;margin-right:-.5px}.ui-grid-b .ui-block-a{clear:left}.ui-grid-c .ui-block-a,.ui-grid-c .ui-block-b,.ui-grid-c .ui-block-c,.ui-grid-c .ui-block-d{width:24.925%}.ui-grid-c>:nth-child(n){width:25%;margin-right:-.5px}.ui-grid-c .ui-block-a{clear:left}.ui-grid-d .ui-block-a,.ui-grid-d .ui-block-b,.ui-grid-d .ui-block-c,.ui-grid-d .ui-block-d,.ui-grid-d .ui-block-e{width:19.925%}.ui-grid-d>:nth-child(n){width:20%}.ui-grid-d .ui-block-a{clear:left}.ui-header-fixed,.ui-footer-fixed{left:0;right:0;width:100%;position:fixed;z-index:1000}.ui-page-pre-in{opacity:0}.ui-header-fixed{top:0}.ui-footer-fixed{bottom:0}.ui-header-fullscreen,.ui-footer-fullscreen{opacity:.9}.ui-page-header-fixed{padding-top:2.6875em}.ui-page-footer-fixed{padding-bottom:2.6875em}.ui-page-header-fullscreen .ui-content,.ui-page-footer-fullscreen .ui-content{padding:0}.ui-fixed-hidden{position:absolute}.ui-page-header-fullscreen .ui-fixed-hidden,.ui-page-footer-fullscreen .ui-fixed-hidden{left:-99999em}.ui-header-fixed .ui-btn,.ui-footer-fixed .ui-btn{z-index:10}.ui-navbar{max-width:100%}.ui-navbar ul{list-style:none;margin:0;padding:0;position:relative;display:block;border:0;max-width:100%;overflow:hidden}.ui-navbar li .ui-btn{display:block;text-align:center;margin:0 -1px 0 0;border-right-width:0}.ui-navbar li .ui-btn-icon-right .ui-icon{right:6px}.ui-navbar li:last-child .ui-btn,.ui-navbar .ui-grid-duo .ui-block-b .ui-btn{margin-right:0;border-right-width:1px}.ui-header .ui-navbar li:last-child .ui-btn,.ui-footer .ui-navbar li:last-child .ui-btn,.ui-header .ui-navbar .ui-grid-duo .ui-block-b .ui-btn,.ui-footer .ui-navbar .ui-grid-duo .ui-block-b .ui-btn{margin-right:-1px;border-right-width:0}.ui-navbar .ui-grid-duo li.ui-block-a:last-child .ui-btn{margin-right:-1px;border-right-width:1px}.ui-header .ui-navbar li .ui-btn,.ui-footer .ui-navbar li .ui-btn{border-top-width:0;border-bottom-width:0}.ui-header .ui-navbar .ui-grid-b li.ui-block-c .ui-btn,.ui-footer .ui-navbar .ui-grid-b li.ui-block-c .ui-btn{margin-right:-5px}.ui-header .ui-navbar .ui-grid-c li.ui-block-d .ui-btn,.ui-footer .ui-navbar .ui-grid-c li.ui-block-d .ui-btn,.ui-header .ui-navbar .ui-grid-d li.ui-block-e .ui-btn,.ui-footer .ui-navbar .ui-grid-d li.ui-block-e .ui-btn{margin-right:-4px}.ui-header .ui-navbar .ui-grid-b li.ui-block-c .ui-btn-icon-right .ui-icon,.ui-footer .ui-navbar .ui-grid-b li.ui-block-c .ui-btn-icon-right .ui-icon,.ui-header .ui-navbar .ui-grid-c li.ui-block-d .ui-btn-icon-right .ui-icon,.ui-footer .ui-navbar .ui-grid-c li.ui-block-d .ui-btn-icon-right .ui-icon,.ui-header .ui-navbar .ui-grid-d li.ui-block-e .ui-btn-icon-right .ui-icon,.ui-footer .ui-navbar .ui-grid-d li.ui-block-e .ui-btn-icon-right .ui-icon{right:8px}.ui-navbar li .ui-btn .ui-btn-inner{padding-top:.7em;padding-bottom:.8em}.ui-navbar li .ui-btn-icon-top .ui-btn-inner{padding-top:30px}.ui-navbar li .ui-btn-icon-bottom .ui-btn-inner{padding-bottom:30px}.ui-btn{display:block;text-align:center;cursor:pointer;position:relative;margin:.5em 0;padding:0}.ui-btn.ui-mini{margin-top:.25em;margin-bottom:.25em}.ui-btn-left,.ui-btn-right,.ui-input-clear,.ui-btn-inline,.ui-grid-a .ui-btn,.ui-grid-b .ui-btn,.ui-grid-c .ui-btn,.ui-grid-d .ui-btn,.ui-grid-e .ui-btn,.ui-grid-solo .ui-btn{margin-right:5px;margin-left:5px}.ui-btn-inner{font-size:16px;padding:.6em 20px;min-width:.75em;display:block;position:relative;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;zoom:1}.ui-btn input,.ui-btn button{z-index:2}.ui-btn-left,.ui-btn-right,.ui-btn-inline{display:inline-block;vertical-align:middle}.ui-btn-block{display:block}.ui-header .ui-btn,.ui-footer .ui-btn{display:inline-block;margin:0}.ui-header .ui-btn-block,.ui-footer .ui-btn-block{display:block}.ui-header .ui-btn-inner,.ui-footer .ui-btn-inner,.ui-mini .ui-btn-inner{font-size:12.5px;padding:.55em 11px .5em}.ui-header .ui-fullsize .ui-btn-inner,.ui-footer .ui-fullsize .ui-btn-inner{font-size:16px;padding:.6em 25px}.ui-btn-icon-notext{width:24px;height:24px}.ui-btn-icon-notext .ui-btn-inner{padding:0;height:100%}.ui-btn-icon-notext .ui-btn-inner .ui-icon{margin:2px 1px 2px 3px;float:left}.ui-btn-text{position:relative;z-index:1;width:100%;-moz-user-select:none;-webkit-user-select:none;-ms-user-select:none}.ui-btn-icon-notext .ui-btn-text{position:absolute;left:-9999px}.ui-btn-icon-left .ui-btn-inner{padding-left:40px}.ui-btn-icon-right .ui-btn-inner{padding-right:40px}.ui-btn-icon-top .ui-btn-inner{padding-top:40px}.ui-btn-icon-bottom .ui-btn-inner{padding-bottom:40px}.ui-header .ui-btn-icon-left .ui-btn-inner,.ui-footer .ui-btn-icon-left .ui-btn-inner,.ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-mini .ui-btn-icon-left .ui-btn-inner{padding-left:30px}.ui-header .ui-btn-icon-right .ui-btn-inner,.ui-footer .ui-btn-icon-right .ui-btn-inner,.ui-mini.ui-btn-icon-right .ui-btn-inner,.ui-mini .ui-btn-icon-right .ui-btn-inner{padding-right:30px}.ui-header .ui-btn-icon-top .ui-btn-inner,.ui-footer .ui-btn-icon-top .ui-btn-inner{padding:30px 3px .5em 3px}.ui-mini.ui-btn-icon-top .ui-btn-inner,.ui-mini .ui-btn-icon-top .ui-btn-inner{padding-top:30px}.ui-header .ui-btn-icon-bottom .ui-btn-inner,.ui-footer .ui-btn-icon-bottom .ui-btn-inner{padding:.55em 3px 30px 3px}.ui-mini.ui-btn-icon-bottom .ui-btn-inner,.ui-mini .ui-btn-icon-bottom .ui-btn-inner{padding-bottom:30px}.ui-btn-icon-notext .ui-icon{display:block;z-index:0}.ui-btn-icon-left>.ui-btn-inner>.ui-icon,.ui-btn-icon-right>.ui-btn-inner>.ui-icon{position:absolute;top:50%;margin-top:-9px}.ui-btn-icon-top .ui-btn-inner .ui-icon,.ui-btn-icon-bottom .ui-btn-inner .ui-icon{position:absolute;left:50%;margin-left:-9px}.ui-btn-icon-left .ui-icon{left:10px}.ui-btn-icon-right .ui-icon{right:10px}.ui-btn-icon-top .ui-icon{top:10px}.ui-btn-icon-bottom .ui-icon{top:auto;bottom:10px}.ui-header .ui-btn-icon-left .ui-icon,.ui-footer .ui-btn-icon-left .ui-icon,.ui-mini.ui-btn-icon-left .ui-icon,.ui-mini .ui-btn-icon-left .ui-icon{left:5px}.ui-header .ui-btn-icon-right .ui-icon,.ui-footer .ui-btn-icon-right .ui-icon,.ui-mini.ui-btn-icon-right .ui-icon,.ui-mini .ui-btn-icon-right .ui-icon{right:5px}.ui-header .ui-btn-icon-top .ui-icon,.ui-footer .ui-btn-icon-top .ui-icon,.ui-mini.ui-btn-icon-top .ui-icon,.ui-mini .ui-btn-icon-top .ui-icon{top:5px}.ui-header .ui-btn-icon-bottom .ui-icon,.ui-footer .ui-btn-icon-bottom .ui-icon,.ui-mini.ui-btn-icon-bottom .ui-icon,.ui-mini .ui-btn-icon-bottom .ui-icon{bottom:5px}.ui-btn-hidden{position:absolute;top:0;left:0;width:100%;height:100%;-webkit-appearance:none;opacity:.1;cursor:pointer;background:#fff;background:rgba(255,255,255,0);filter:Alpha(Opacity=0);font-size:1px;border:0;text-indent:-9999px}.ui-field-contain .ui-btn.ui-submit{margin:0}label.ui-submit{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}@media all and (min-width:450px){.ui-field-contain label.ui-submit{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain .ui-btn.ui-submit{width:60%;display:inline-block;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.ui-hide-label .ui-btn.ui-submit{width:auto}}.ui-collapsible{margin:.5em 0}.ui-collapsible-heading{font-size:16px;display:block;margin:0 -8px;padding:0;border-width:0 0 1px 0;position:relative}.ui-collapsible-heading .ui-btn{text-align:left;margin:0}.ui-collapsible-heading .ui-btn-inner,.ui-collapsible-heading .ui-btn-icon-left .ui-btn-inner{padding-left:40px}.ui-collapsible-heading .ui-btn-icon-right .ui-btn-inner{padding-left:12px;padding-right:40px}.ui-collapsible-heading .ui-btn-icon-top .ui-btn-inner,.ui-collapsible-heading .ui-btn-icon-bottom .ui-btn-inner{padding-right:40px;text-align:center}.ui-collapsible-heading .ui-btn span.ui-btn{position:absolute;left:6px;top:50%;margin:-12px 0 0 0;width:20px;height:20px;padding:1px 0 1px 2px;text-indent:-9999px}.ui-collapsible-heading .ui-btn span.ui-btn .ui-btn-inner{padding:10px 0}.ui-collapsible-heading .ui-btn span.ui-btn .ui-icon{left:0;margin-top:-10px}.ui-collapsible-heading-status{position:absolute;top:-9999px;left:0}.ui-collapsible-content{display:block;margin:0 -8px;padding:10px 16px;border-top:0;background-image:none;font-weight:normal}.ui-collapsible-content-collapsed{display:none}.ui-collapsible-set{margin:.5em 0}.ui-collapsible-set .ui-collapsible{margin:-1px 0 0}.ui-controlgroup,fieldset.ui-controlgroup{padding:0;margin:.5em 0;zoom:1}.ui-controlgroup.ui-mini,fieldset.ui-controlgroup.ui-mini{margin:.25em 0}.ui-field-contain .ui-controlgroup,.ui-field-contain fieldset.ui-controlgroup{margin:0}.ui-bar .ui-controlgroup{margin:0 5px}.ui-controlgroup-label{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .4em}.ui-controlgroup-controls{display:block;width:100%}.ui-controlgroup li{list-style:none}.ui-controlgroup-vertical .ui-btn,.ui-controlgroup-vertical .ui-checkbox,.ui-controlgroup-vertical .ui-radio{margin:0;border-bottom-width:0}.ui-controlgroup-vertical .ui-controlgroup-last{border-bottom-width:1px}.ui-controlgroup-controls label.ui-select{position:absolute;left:-9999px}.ui-controlgroup .ui-btn-icon-notext{width:24px;height:24px}.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner .ui-icon{position:absolute;top:50%;right:50%;margin:-9px -9px 0 0}.ui-controlgroup-horizontal .ui-controlgroup-controls:before,.ui-controlgroup-horizontal .ui-controlgroup-controls:after{content:"";display:table}.ui-controlgroup-horizontal .ui-controlgroup-controls:after{clear:both}.ui-controlgroup-horizontal .ui-controlgroup-controls{zoom:1}.ui-controlgroup-horizontal .ui-btn-inner{text-align:center}.ui-controlgroup-horizontal .ui-btn,.ui-controlgroup-horizontal .ui-select,.ui-controlgroup-horizontal .ui-checkbox,.ui-controlgroup-horizontal .ui-radio{float:left;clear:none;margin:0 -1px 0 0}.ui-controlgroup-horizontal .ui-select .ui-btn,.ui-controlgroup-horizontal .ui-checkbox .ui-btn,.ui-controlgroup-horizontal .ui-radio .ui-btn,.ui-controlgroup-horizontal .ui-checkbox:last-child,.ui-controlgroup-horizontal .ui-radio:last-child{margin-right:0}.ui-controlgroup-horizontal .ui-controlgroup-last{margin-right:0}.ui-controlgroup .ui-checkbox label,.ui-controlgroup .ui-radio label{font-size:16px}@media all and (min-width:450px){.ui-field-contain .ui-controlgroup-label{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain .ui-controlgroup-controls{width:60%;display:inline-block}.ui-field-contain .ui-controlgroup .ui-select{width:100%;display:block}.ui-field-contain .ui-controlgroup-horizontal .ui-select{width:auto}.ui-hide-label .ui-controlgroup-controls{width:100%}}.ui-dialog{background:none!important}.ui-dialog-contain{width:92.5%;max-width:500px;margin:10% auto 15px auto;padding:0}.ui-dialog .ui-header{margin-top:15%;border:0;overflow:hidden}.ui-dialog .ui-header,.ui-dialog .ui-content,.ui-dialog .ui-footer{display:block;position:relative;width:auto}.ui-dialog .ui-header,.ui-dialog .ui-footer{z-index:10;padding:0}.ui-dialog .ui-footer{padding:0 15px}.ui-dialog .ui-content{padding:15px}.ui-dialog{margin-top:-15px}.ui-checkbox,.ui-radio{position:relative;clear:both;margin:0;z-index:1}.ui-checkbox .ui-btn,.ui-radio .ui-btn{margin:.5em 0;text-align:left;z-index:2}.ui-checkbox .ui-btn.ui-mini,.ui-radio .ui-btn.ui-mini{margin:.25em 0}.ui-controlgroup .ui-checkbox .ui-btn,.ui-controlgroup .ui-radio .ui-btn{margin:0}.ui-checkbox .ui-btn-inner,.ui-radio .ui-btn-inner{white-space:normal}.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner{padding-left:45px}.ui-checkbox .ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-left .ui-btn-inner{padding-left:36px}.ui-checkbox .ui-btn-icon-right .ui-btn-inner,.ui-radio .ui-btn-icon-right .ui-btn-inner{padding-right:45px}.ui-checkbox .ui-mini.ui-btn-icon-right .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-right .ui-btn-inner{padding-right:36px}.ui-checkbox .ui-btn-icon-top .ui-btn-inner,.ui-radio .ui-btn-icon-top .ui-btn-inner{padding-right:0;padding-left:0;text-align:center}.ui-checkbox .ui-btn-icon-bottom .ui-btn-inner,.ui-radio .ui-btn-icon-bottom .ui-btn-inner{padding-right:0;padding-left:0;text-align:center}.ui-checkbox .ui-icon,.ui-radio .ui-icon{top:1.1em}.ui-checkbox .ui-btn-icon-left .ui-icon,.ui-radio .ui-btn-icon-left .ui-icon{left:15px}.ui-checkbox .ui-mini.ui-btn-icon-left .ui-icon,.ui-radio .ui-mini.ui-btn-icon-left .ui-icon{left:9px}.ui-checkbox .ui-btn-icon-right .ui-icon,.ui-radio .ui-btn-icon-right .ui-icon{right:15px}.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon,.ui-radio .ui-mini.ui-btn-icon-right .ui-icon{right:9px}.ui-checkbox .ui-btn-icon-top .ui-icon,.ui-radio .ui-btn-icon-top .ui-icon{top:10px}.ui-checkbox .ui-btn-icon-bottom .ui-icon,.ui-radio .ui-btn-icon-bottom .ui-icon{top:auto;bottom:10px}.ui-checkbox .ui-btn-icon-right .ui-icon,.ui-radio .ui-btn-icon-right .ui-icon{right:15px}.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon,.ui-radio .ui-mini.ui-btn-icon-right .ui-icon{right:9px}.ui-checkbox input,.ui-radio input{position:absolute;left:20px;top:50%;width:10px;height:10px;margin:-5px 0 0 0;outline:0!important;z-index:1}.ui-field-contain,fieldset.ui-field-contain{padding:.8em 0;margin:0;border-width:0 0 1px 0;overflow:visible}.ui-field-contain:last-child{border-bottom-width:0}.ui-field-contain{max-width:100%}@media all and (min-width:450px){.ui-field-contain,.ui-mobile fieldset.ui-field-contain{border-width:0;padding:0;margin:1em 0}}.ui-select{display:block;position:relative}.ui-select select{position:absolute;left:-9999px;top:-9999px}.ui-select .ui-btn{overflow:hidden;opacity:1}.ui-field-contain .ui-select .ui-btn{margin:0}.ui-select .ui-btn select{cursor:pointer;-webkit-appearance:none;left:0;top:0;width:100%;min-height:1.5em;min-height:100%;height:3em;max-height:100%;opacity:0;-ms-filter:"alpha(opacity=0)";filter:alpha(opacity=0);z-index:2}.ui-select .ui-disabled{opacity:.3}@-moz-document url-prefix(){.ui-select .ui-btn select{opacity:.0001}}.ui-select .ui-btn.ui-select-nativeonly{border-radius:0}.ui-select .ui-btn.ui-select-nativeonly select{opacity:1;text-indent:0}.ui-select .ui-btn-icon-right .ui-btn-inner,.ui-select .ui-li-has-count .ui-btn-inner{padding-right:45px}.ui-select .ui-mini.ui-btn-icon-right .ui-btn-inner{padding-right:32px}.ui-select .ui-btn-icon-right.ui-li-has-count .ui-btn-inner{padding-right:80px}.ui-select .ui-mini.ui-btn-icon-right.ui-li-has-count .ui-btn-inner{padding-right:67px}.ui-select .ui-btn-icon-right .ui-icon{right:15px}.ui-select .ui-mini.ui-btn-icon-right .ui-icon{right:7px}.ui-select .ui-btn-icon-right.ui-li-has-count .ui-li-count{right:45px}.ui-select .ui-mini.ui-btn-icon-right.ui-li-has-count .ui-li-count{right:32px}label.ui-select{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}.ui-select .ui-btn-text,.ui-selectmenu .ui-btn-text{display:block;min-height:1em;overflow:hidden!important}.ui-select .ui-btn-text{text-overflow:ellipsis}.ui-selectmenu{position:absolute;padding:0;z-index:1100!important;width:80%;max-width:350px;padding:6px}.ui-selectmenu .ui-listview{margin:0}.ui-selectmenu .ui-btn.ui-li-divider{cursor:default}.ui-selectmenu-hidden{top:-99999px;left:-9999px}.ui-selectmenu-screen{position:absolute;top:0;left:0;width:100%;height:100%;z-index:99}.ui-screen-hidden,.ui-selectmenu-list .ui-li .ui-icon{display:none}.ui-selectmenu-list .ui-li .ui-icon{display:block}.ui-li.ui-selectmenu-placeholder{display:none}.ui-selectmenu .ui-header .ui-title{margin:.6em 46px .8em}@media all and (min-width:450px){.ui-field-contain label.ui-select{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain .ui-select{width:60%;display:inline-block}.ui-hide-label .ui-select{width:100%}}.ui-selectmenu .ui-header h1:after{content:'.';visibility:hidden}label.ui-input-text{font-size:16px;line-height:1.4;display:block;font-weight:normal;margin:0 0 .3em}input.ui-input-text,textarea.ui-input-text{background-image:none;padding:.4em;margin:.5em 0;line-height:1.4;font-size:16px;display:block;width:100%;outline:0}input.ui-input-text.ui-mini,textarea.ui-input-text.ui-mini{margin:.25em 0}.ui-field-contain input.ui-input-text,.ui-field-contain textarea.ui-input-text{margin:0}input.ui-input-text,textarea.ui-input-text,.ui-input-search{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}input.ui-input-text{-webkit-appearance:none}textarea.ui-input-text{height:50px;-webkit-transition:height 200ms linear;-moz-transition:height 200ms linear;-o-transition:height 200ms linear;transition:height 200ms linear}.ui-input-search{padding:0 30px;margin:.5em 0;background-image:none;position:relative}.ui-input-search.ui-mini{margin:.25em 0}.ui-field-contain .ui-input-search{margin:0}.ui-icon-searchfield:after{position:absolute;left:7px;top:50%;margin-top:-9px;content:"";width:18px;height:18px;opacity:.5}.ui-input-search input.ui-input-text{border:0;width:98%;padding:.4em 0;margin:0;display:block;background:transparent none;outline:0!important}.ui-input-search .ui-input-clear{position:absolute;right:0;top:50%;margin-top:-13px}.ui-mini .ui-input-clear{right:-3px}.ui-input-search .ui-input-clear-hidden{display:none}input.ui-mini,.ui-mini input,textarea.ui-mini{font-size:14px}textarea.ui-mini{height:45px}@media all and (min-width:450px){.ui-field-contain label.ui-input-text{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain input.ui-input-text,.ui-field-contain textarea.ui-input-text,.ui-field-contain .ui-input-search{width:60%;display:inline-block}.ui-hide-label input.ui-input-text,.ui-hide-label textarea.ui-input-text,.ui-hide-label .ui-input-search{width:100%}.ui-input-search input.ui-input-text{width:98%}}.ui-listview{margin:0;counter-reset:listnumbering}.ui-content .ui-listview{margin:-15px}.ui-content .ui-listview-inset{margin:1em 0}.ui-listview,.ui-li{list-style:none;padding:0}.ui-li,.ui-li.ui-field-contain{display:block;margin:0;position:relative;overflow:visible;text-align:left;border-width:0;border-top-width:1px}.ui-li .ui-btn-text a.ui-link-inherit{text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-divider,.ui-li-static{padding:.5em 15px;font-size:14px;font-weight:bold}.ui-li-divider .ui-btn-text,.ui-li-static .ui-btn-text{font-size:16px}.ui-li-divider .ui-mini .ui-btn-text,.ui-li-static .ui-mini .ui-btn-text{font-size:inherit}.ui-li-divider{counter-reset:listnumbering}ol.ui-listview .ui-link-inherit:before,ol.ui-listview .ui-li-static:before,.ui-li-dec{font-size:.8em;display:inline-block;padding-right:.3em;font-weight:normal;counter-increment:listnumbering;content:counter(listnumbering) ". "}ol.ui-listview .ui-li-jsnumbering:before{content:""!important}.ui-listview-inset .ui-li{border-right-width:1px;border-left-width:1px}.ui-li:last-child,.ui-li.ui-field-contain:last-child{border-bottom-width:1px}.ui-li>.ui-btn-inner{display:block;position:relative;padding:0}.ui-li .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li{padding:.7em 15px;display:block}.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-thumb{min-height:60px;padding-left:100px}.ui-li-has-icon .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-icon{min-height:20px;padding-left:40px}.ui-li-has-count .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-count,.ui-li-divider.ui-li-has-count{padding-right:45px}.ui-li-has-arrow .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-arrow{padding-right:40px}.ui-li-has-arrow.ui-li-has-count .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-arrow.ui-li-has-count{padding-right:75px}.ui-li-heading{font-size:16px;font-weight:bold;display:block;margin:.6em 0;text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-desc{font-size:12px;font-weight:normal;display:block;margin:-.5em 0 .6em;text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-thumb,.ui-listview .ui-li-icon{position:absolute;left:1px;top:0;max-height:80px;max-width:80px}.ui-listview .ui-li-icon{max-height:16px;max-width:16px;left:10px;top:.9em}.ui-li-thumb,.ui-listview .ui-li-icon,.ui-li-content{float:left;margin-right:10px}.ui-li-aside{float:right;width:50%;text-align:right;margin:.3em 0}@media all and (min-width:480px){.ui-li-aside{width:45%}}.ui-li-divider{cursor:default}.ui-li-has-alt .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-alt{padding-right:53px}.ui-li-has-alt.ui-li-has-count .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-alt.ui-li-has-count{padding-right:88px}.ui-li-has-count .ui-li-count{position:absolute;font-size:11px;font-weight:bold;padding:.2em .5em;top:50%;margin-top:-.9em;right:10px}.ui-li-has-count.ui-li-divider .ui-li-count,.ui-li-has-count .ui-link-inherit .ui-li-count{margin-top:-.95em}.ui-li-has-arrow.ui-li-has-count .ui-li-count{right:40px}.ui-li-has-alt.ui-li-has-count .ui-li-count{right:53px}.ui-li-link-alt{position:absolute;width:40px;height:100%;border-width:0;border-left-width:1px;top:0;right:0;margin:0;padding:0;z-index:2}.ui-li-link-alt .ui-btn{overflow:hidden;position:absolute;right:8px;top:50%;margin:-13px 0 0 0;border-bottom-width:1px;z-index:-1}.ui-li-link-alt .ui-btn-inner{padding:0;height:100%;position:absolute;width:100%;top:0;left:0}.ui-li-link-alt .ui-btn .ui-icon{right:50%;margin-right:-9px}.ui-li-link-alt .ui-btn-icon-notext .ui-btn-inner .ui-icon{position:absolute;top:50%;margin-top:-9px}.ui-listview * .ui-btn-inner>.ui-btn>.ui-btn-inner{border-top:0}.ui-listview-filter{border-width:0;overflow:hidden;margin:-15px -15px 15px -15px}.ui-listview-filter .ui-input-search{margin:5px;width:auto;display:block}.ui-listview-filter-inset{margin:-15px -5px -15px -5px;background:transparent}.ui-li.ui-screen-hidden{display:none}@media only screen and (min-device-width:768px) and (max-device-width:1024px){.ui-li .ui-btn-text{overflow:visible}}label.ui-slider{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}input.ui-slider-input,.ui-field-contain input.ui-slider-input{display:inline-block;width:50px;background-image:none;padding:.4em;margin:.5em 0;line-height:1.4;font-size:16px;outline:0}input.ui-slider-input.ui-mini,.ui-field-contain input.ui-slider-input.ui-mini{width:45px;margin:.25em 0;font-size:14px}.ui-field-contain input.ui-slider-input{margin:0}input.ui-slider-input,.ui-field-contain input.ui-slider-input{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;-ms-box-sizing:content-box;box-sizing:content-box}select.ui-slider-switch{display:none}div.ui-slider{position:relative;display:inline-block;overflow:visible;height:15px;padding:0;margin:0 2% 0 20px;top:4px;width:65%}div.ui-slider-mini{height:12px;margin-left:10px;top:2px}div.ui-slider-bg{border:0;height:100%;padding-right:8px}.ui-controlgroup a.ui-slider-handle,a.ui-slider-handle{position:absolute;z-index:1;top:50%;width:28px;height:28px;margin-top:-15px;margin-left:-15px;outline:0}a.ui-slider-handle .ui-btn-inner{padding:0;height:100%}div.ui-slider-mini a.ui-slider-handle{height:14px;width:14px;margin:-8px 0 0 -7px}div.ui-slider-mini a.ui-slider-handle .ui-btn-inner{height:30px;width:30px;padding:0;margin:-9px 0 0 -9px;border-top:0}@media all and (min-width:450px){.ui-field-contain label.ui-slider{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain div.ui-slider{width:43%}.ui-field-contain div.ui-slider-switch{width:5.5em}}div.ui-slider-switch{height:32px;margin-left:0;width:5.8em}a.ui-slider-handle-snapping{-webkit-transition:left 70ms linear;-moz-transition:left 70ms linear}div.ui-slider-switch .ui-slider-handle{margin-top:1px}.ui-slider-inneroffset{margin:0 16px;position:relative;z-index:1}div.ui-slider-switch.ui-slider-mini{width:5em;height:29px}div.ui-slider-switch.ui-slider-mini .ui-slider-inneroffset{margin:0 15px 0 14px}div.ui-slider-switch.ui-slider-mini .ui-slider-handle{width:25px;height:25px;margin:1px 0 0 -13px}div.ui-slider-switch.ui-slider-mini a.ui-slider-handle .ui-btn-inner{height:30px;width:30px;padding:0;margin:0}span.ui-slider-label{position:absolute;text-align:center;width:100%;overflow:hidden;font-size:16px;top:0;line-height:2;min-height:100%;border-width:0;white-space:nowrap}.ui-slider-mini span.ui-slider-label{font-size:14px}span.ui-slider-label-a{z-index:1;left:0;text-indent:-1.5em}span.ui-slider-label-b{z-index:0;right:0;text-indent:1.5em}.ui-slider-inline{width:120px;display:inline-block} \ No newline at end of file
diff --git a/module/web/static/css/mobile/my.css b/module/web/static/css/mobile/my.css
new file mode 100644
index 000000000..2e73c1f35
--- /dev/null
+++ b/module/web/static/css/mobile/my.css
@@ -0,0 +1,93 @@
+.text-align-center {
+ text-align: center;
+}
+.text-align-right {
+ text-align: right;
+}
+
+/** CSS for non-standard jQuery Mobile styles or Codiqa components **/
+.split-wrapper {
+ width: 100%;
+ min-height: 200px;
+ clear: both;
+}
+@media all and (min-width: 650px) {
+ .content-secondary {
+ text-align: left;
+ float: left;
+ width: 45%;
+ background: none;
+ padding: 1.5em 6% 3em 0;
+ margin: 0;
+ }
+ .content-secondary {
+ background: none;
+ border-top: none;
+ }
+ .content-primary {
+ width: 45%;
+ float: right;
+ margin-right: 1%;
+ padding-right: 1%;
+ }
+ .content-primary ul:first-child {
+ margin-top: 0;
+ }
+ .content-secondary ul.ui-listview, .content-secondary ul.ui-listview-inset {
+ margin: 0;
+ }
+ .content-secondary ul.ui-listview .ui-li-divider, .content-secondary ul.ui-listview .ui-li {
+ border-radius: 0px;
+ }
+ .content-secondary ul.ui-listview .ui-li {
+ border-left: 0;
+ border-right: 0;
+ }
+ .content-secondary h2 {
+ position: absolute;
+ left: -9999px;
+ }
+ .content-secondary .ui-li-divider {
+ padding-top: 1em;
+ padding-bottom: 1em;
+ }
+ .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+
+}
+@media all and (min-width: 750px){
+ .content-secondary {
+ width: 34%;
+ }
+ .content-primary {
+ width: 60%;
+ padding-right: 1%;
+ }
+ .content-secondary ul.ui-listview-inset {
+}
+
+@media all and (min-width: 1200px){
+ .content-secondary {
+ width: 30%;
+ padding-right:6%;
+ margin: 0px 0 20px 5%;
+ }
+ .content-secondary ul {
+ margin: 0;
+ }
+ .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+ .content-primary {
+ width: 50%;
+ margin-right: 5%;
+ padding-right: 3%;
+ }
+ .content-primary {
+ width: 60%;
+ }
+}
+
diff --git a/module/web/static/css/mobile/style.css b/module/web/static/css/mobile/style.css
new file mode 100644
index 000000000..349b54bc0
--- /dev/null
+++ b/module/web/static/css/mobile/style.css
@@ -0,0 +1,214 @@
+
+/*
+ General
+ */
+
+* {
+ margin: 0;
+}
+
+html, body {
+ height: 100%;
+}
+
+body {
+ margin: 0;
+ padding: 0;
+ font-family: 'Abel', sans-serif;
+ font-size: 16px;
+ color: #757575;
+ background: url("../../img/default/fancy_deboss.png") repeat scroll 0 0 transparent;
+ min-width: 320px;
+}
+
+h1, h2, h3 {
+ margin: 0;
+ padding: 0;
+ font-weight: normal;
+ color: #221D1D;
+}
+
+h1 {
+ font-size: 2em;
+}
+
+h2 {
+ font-size: 2.4em;
+}
+
+h3 {
+ font-size: 1.6em;
+}
+
+p, ul, ol {
+ margin-top: 0;
+ line-height: 180%;
+}
+
+ul, ol {
+}
+
+a {
+ text-decoration: none;
+ color: #FF7637;
+}
+
+a:hover {
+}
+
+#wrap {
+ min-height: 100%;
+}
+
+#content {
+ padding-left: 10px;
+ padding-bottom: 30px; /* Height of footer */
+}
+
+#content:before {
+ display: block;
+ content: " ";
+ height: 30px;
+}
+
+/*
+ Header
+*/
+
+header {
+ background: url("../../img/default/main-wrapper-bg.png") repeat-x;
+ height: 30px;
+ position: fixed;
+ top: 0;
+ vertical-align: top;
+ width: 100%;
+ z-index: 10;
+ min-width: 1000px;
+ color: #ffffff;
+}
+
+header a {
+ color: #ffffff;
+}
+
+header:before {
+ position: absolute;
+ content: ' ';
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ background-color: transparent;
+ box-shadow: 0 0 5px black;
+ z-index: -1;
+}
+
+header div.center {
+ position: relative;
+ padding-left: 20px;
+ padding-right: 20px;
+}
+header span.title {
+ color: white;
+ float: left;
+ font-family: SansationRegular, sans-serif;
+ font-size: 18px;
+ cursor: default;
+ margin-top: 4px;
+ padding-left: 10px;
+}
+
+/*
+ Login
+*/
+.login {
+ vertical-align: middle;
+ text-align: center;
+ border: 2px solid #000000;
+ padding: 15px;
+ font-size: 17px;
+ border-radius: 15px;
+ -moz-border-radius: 15px;
+ -webkit-border-radius: 15px;
+}
+
+.login input, .login div{
+ padding: 3px;
+}
+.login_submit input {
+ padding: 5px 15px;
+}
+.login_user , .login_password {
+ text-align: right;
+ width: 320px;
+ margin-left: auto;
+ margin-right: auto;
+}
+.login_user span, .login_password span{
+ margin-right: 5px;
+}
+/*
+ Footer
+*/
+footer {
+ background: url("../../img/default/main-wrapper-bg.png") repeat-x;
+ height: 30px;
+ margin-top: -30px;
+ position: relative;
+ width: 100%;
+ z-index: 10;
+}
+
+footer .logo {
+ background: url(../../img/default/logo_grey.png) no-repeat;
+ float: left;
+ width: 60px;
+ height: 60px;
+ margin-top: 12px;
+ margin-right: 12px;
+}
+
+footer div.center {
+ padding-top: 10px;
+ width: 900px;
+ margin-left: auto;
+ margin-right: auto;
+}
+
+footer:before {
+ position: absolute;
+ content: ' ';
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ background-color: transparent;
+ box-shadow: 0 0 5px black;
+ z-index: -1;
+}
+
+footer .block {
+ font-size: 12px;
+ float: left;
+ margin: 0;
+ width: 150px;
+ padding-top: 6px;
+ padding-right: 30px;
+}
+
+footer .copyright {
+ text-align: center;
+ width: auto;
+ padding-top: 22px;
+}
+
+footer h2 {
+ background: url("../../img/default/double-line.gif") repeat-x scroll center bottom transparent !important;
+ color: #FFFFFF;
+ font-family: SansationLight, sans-serif;
+ font-size: 16px;
+ font-weight: normal;
+ line-height: 16px;
+ margin: 0;
+ padding-bottom: 6px;
+} \ No newline at end of file
diff --git a/module/web/static/fonts/Sansation_Bold-webfont.eot b/module/web/static/fonts/Sansation_Bold-webfont.eot
new file mode 100644
index 000000000..43ed2ee31
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Bold-webfont.eot
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Bold-webfont.ttf b/module/web/static/fonts/Sansation_Bold-webfont.ttf
new file mode 100644
index 000000000..d2e7c4c2a
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Bold-webfont.ttf
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Bold-webfont.woff b/module/web/static/fonts/Sansation_Bold-webfont.woff
new file mode 100644
index 000000000..9ee938d55
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Bold-webfont.woff
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Light-webfont.eot b/module/web/static/fonts/Sansation_Light-webfont.eot
new file mode 100644
index 000000000..d83fa9cf6
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Light-webfont.eot
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Light-webfont.ttf b/module/web/static/fonts/Sansation_Light-webfont.ttf
new file mode 100644
index 000000000..64d734bec
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Light-webfont.ttf
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Light-webfont.woff b/module/web/static/fonts/Sansation_Light-webfont.woff
new file mode 100644
index 000000000..5f3dce493
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Light-webfont.woff
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Regular-webfont.eot b/module/web/static/fonts/Sansation_Regular-webfont.eot
new file mode 100644
index 000000000..46219c9ff
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Regular-webfont.eot
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Regular-webfont.ttf b/module/web/static/fonts/Sansation_Regular-webfont.ttf
new file mode 100644
index 000000000..92f686359
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Regular-webfont.ttf
Binary files differ
diff --git a/module/web/static/fonts/Sansation_Regular-webfont.woff b/module/web/static/fonts/Sansation_Regular-webfont.woff
new file mode 100644
index 000000000..524b67992
--- /dev/null
+++ b/module/web/static/fonts/Sansation_Regular-webfont.woff
Binary files differ
diff --git a/module/web/media/default/img/arrow_refresh.png b/module/web/static/img/default/arrow_refresh.png
index 0de26566d..0de26566d 100644
--- a/module/web/media/default/img/arrow_refresh.png
+++ b/module/web/static/img/default/arrow_refresh.png
Binary files differ
diff --git a/module/web/static/img/default/bgpattern.png b/module/web/static/img/default/bgpattern.png
new file mode 100644
index 000000000..5111e6bdf
--- /dev/null
+++ b/module/web/static/img/default/bgpattern.png
Binary files differ
diff --git a/module/web/media/default/img/delete.png b/module/web/static/img/default/delete.png
index 08f249365..08f249365 100644
--- a/module/web/media/default/img/delete.png
+++ b/module/web/static/img/default/delete.png
Binary files differ
diff --git a/module/web/static/img/default/double-line.gif b/module/web/static/img/default/double-line.gif
new file mode 100644
index 000000000..e9f4cf971
--- /dev/null
+++ b/module/web/static/img/default/double-line.gif
Binary files differ
diff --git a/module/web/static/img/default/fancy_deboss.png b/module/web/static/img/default/fancy_deboss.png
new file mode 100644
index 000000000..926a762db
--- /dev/null
+++ b/module/web/static/img/default/fancy_deboss.png
Binary files differ
diff --git a/module/web/media/default/img/folder.png b/module/web/static/img/default/folder.png
index 784e8fa48..784e8fa48 100644
--- a/module/web/media/default/img/folder.png
+++ b/module/web/static/img/default/folder.png
Binary files differ
diff --git a/module/web/static/img/default/icon_blank_file_black.png b/module/web/static/img/default/icon_blank_file_black.png
new file mode 100644
index 000000000..d054a2af7
--- /dev/null
+++ b/module/web/static/img/default/icon_blank_file_black.png
Binary files differ
diff --git a/module/web/static/img/default/icon_clock_small_white.png b/module/web/static/img/default/icon_clock_small_white.png
new file mode 100644
index 000000000..9e6c9bdd0
--- /dev/null
+++ b/module/web/static/img/default/icon_clock_small_white.png
Binary files differ
diff --git a/module/web/static/img/default/icon_folder.png b/module/web/static/img/default/icon_folder.png
new file mode 100644
index 000000000..31773520a
--- /dev/null
+++ b/module/web/static/img/default/icon_folder.png
Binary files differ
diff --git a/module/web/static/img/default/icon_speed_small_white.png b/module/web/static/img/default/icon_speed_small_white.png
new file mode 100644
index 000000000..ac86514ca
--- /dev/null
+++ b/module/web/static/img/default/icon_speed_small_white.png
Binary files differ
diff --git a/module/web/static/img/default/icon_user_small_white.png b/module/web/static/img/default/icon_user_small_white.png
new file mode 100644
index 000000000..6434734fa
--- /dev/null
+++ b/module/web/static/img/default/icon_user_small_white.png
Binary files differ
diff --git a/module/web/static/img/default/logo.png b/module/web/static/img/default/logo.png
new file mode 100644
index 000000000..7cb924d60
--- /dev/null
+++ b/module/web/static/img/default/logo.png
Binary files differ
diff --git a/module/web/static/img/default/logo_grey.png b/module/web/static/img/default/logo_grey.png
new file mode 100644
index 000000000..7061372aa
--- /dev/null
+++ b/module/web/static/img/default/logo_grey.png
Binary files differ
diff --git a/module/web/static/img/default/main-wrapper-bg.png b/module/web/static/img/default/main-wrapper-bg.png
new file mode 100644
index 000000000..68febb6a2
--- /dev/null
+++ b/module/web/static/img/default/main-wrapper-bg.png
Binary files differ
diff --git a/module/web/media/default/img/pencil.png b/module/web/static/img/default/pencil.png
index 0bfecd50e..0bfecd50e 100644
--- a/module/web/media/default/img/pencil.png
+++ b/module/web/static/img/default/pencil.png
Binary files differ
diff --git a/module/web/media/img/favicon.ico b/module/web/static/img/favicon.ico
index 58b1f4b89..58b1f4b89 100644
--- a/module/web/media/img/favicon.ico
+++ b/module/web/static/img/favicon.ico
Binary files differ
diff --git a/module/web/static/img/glyphicons-halflings-white.png b/module/web/static/img/glyphicons-halflings-white.png
new file mode 100644
index 000000000..3bf6484a2
--- /dev/null
+++ b/module/web/static/img/glyphicons-halflings-white.png
Binary files differ
diff --git a/module/web/static/img/glyphicons-halflings.png b/module/web/static/img/glyphicons-halflings.png
new file mode 100644
index 000000000..a99699932
--- /dev/null
+++ b/module/web/static/img/glyphicons-halflings.png
Binary files differ
diff --git a/module/web/static/js/app.build.js b/module/web/static/js/app.build.js
new file mode 100644
index 000000000..88b96cb89
--- /dev/null
+++ b/module/web/static/js/app.build.js
@@ -0,0 +1,22 @@
+//Install node.js, navigate to the js folder, and then run this command: "node r.js -o app.build.js"
+({
+
+ // Creates a js-optimized folder at the same folder level as your "js" folder and places the optimized project there
+ dir: "../js-optimized",
+
+ // Tells Require.js to look at desktop.js for all shim and path configurations
+ mainConfigFile: 'default.js',
+
+ // Modules to be optimized:
+ modules: [
+
+ {
+ name: "mobile"
+ },
+
+ {
+ name: "default"
+ }
+ ]
+
+}) \ No newline at end of file
diff --git a/module/web/static/js/collections/FileList.js b/module/web/static/js/collections/FileList.js
new file mode 100644
index 000000000..e91088867
--- /dev/null
+++ b/module/web/static/js/collections/FileList.js
@@ -0,0 +1,17 @@
+define(['jquery', 'backbone', 'underscore', 'models/File'], function($, Backbone, _, File) {
+
+ return Backbone.Collection.extend({
+
+ model: File,
+
+ comparator: function(file) {
+ return file.get('fileorder');
+ },
+
+ initialize: function() {
+
+ }
+
+ });
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/collections/PackageList.js b/module/web/static/js/collections/PackageList.js
new file mode 100644
index 000000000..a36f8bcdc
--- /dev/null
+++ b/module/web/static/js/collections/PackageList.js
@@ -0,0 +1,15 @@
+define(['jquery', 'backbone', 'underscore', 'models/Package'], function($, Backbone, _, Package) {
+
+ return Backbone.Collection.extend({
+
+ model: Package,
+
+ comparator: function(pack) {
+ return pack.get('packageorder');
+ },
+
+ initialize: function() {
+ }
+
+ });
+}); \ No newline at end of file
diff --git a/module/web/static/js/default.js b/module/web/static/js/default.js
new file mode 100644
index 000000000..e200f470a
--- /dev/null
+++ b/module/web/static/js/default.js
@@ -0,0 +1,57 @@
+// Sets the require.js configuration for your application.
+// Note: Config needs to be duplicated for mobile.js
+require.config({
+
+ // XXX: To many dots in file breaks dependencies
+ paths:{
+
+ jquery:"libs/jquery-1.8.0",
+ jqueryui:"libs/jqueryui",
+ flot:"libs/jquery.flot.min",
+ transit:"libs/jquery.transit-0.1.3",
+ omniwindow: "libs/jquery.omniwindow",
+ bootstrap: "libs/bootstrap-2.1.1",
+
+ underscore:"libs/lodash-0.5.2",
+ backbone:"libs/backbone-0.9.2",
+
+ // Require.js Plugins
+ text:"plugins/text-2.0.3",
+ tpl: "../../templates"
+
+ },
+
+ // Sets the configuration for your third party scripts that are not AMD compatible
+ shim:{
+
+ "backbone":{
+ deps:["underscore", "jquery"],
+ exports:"Backbone" //attaches "Backbone" to the window object
+ },
+ "flot" : ["jquery"],
+ "transit" : ["jquery"],
+ "omniwindow" : ["jquery"],
+ "bootstrap" : ["jquery"]
+ } // end Shim Configuration
+
+});
+
+define('default', ['jquery', 'backbone', 'routers/defaultRouter', 'views/headerView', 'views/packageTreeView',
+ 'utils/animations', 'bootstrap'],
+ function ($, Backbone, DefaultRouter, HeaderView, TreeView) {
+
+
+ var init = function(){
+ var view = new HeaderView();
+ view.render();
+ };
+
+ var initPackageTree = function() {
+ $(function() {
+ var view = new TreeView();
+ view.init();
+ });
+ };
+
+ return {"init":init, "initPackageTree": initPackageTree};
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/backbone-0.9.2.js b/module/web/static/js/libs/backbone-0.9.2.js
new file mode 100644
index 000000000..d0410b5c8
--- /dev/null
+++ b/module/web/static/js/libs/backbone-0.9.2.js
@@ -0,0 +1,1431 @@
+// Backbone.js 0.9.2
+
+// (c) 2010-2012 Jeremy Ashkenas, DocumentCloud Inc.
+// Backbone may be freely distributed under the MIT license.
+// For all details and documentation:
+// http://backbonejs.org
+
+(function(){
+
+ // Initial Setup
+ // -------------
+
+ // Save a reference to the global object (`window` in the browser, `global`
+ // on the server).
+ var root = this;
+
+ // Save the previous value of the `Backbone` variable, so that it can be
+ // restored later on, if `noConflict` is used.
+ var previousBackbone = root.Backbone;
+
+ // Create a local reference to slice/splice.
+ var slice = Array.prototype.slice;
+ var splice = Array.prototype.splice;
+
+ // The top-level namespace. All public Backbone classes and modules will
+ // be attached to this. Exported for both CommonJS and the browser.
+ var Backbone;
+ if (typeof exports !== 'undefined') {
+ Backbone = exports;
+ } else {
+ Backbone = root.Backbone = {};
+ }
+
+ // Current version of the library. Keep in sync with `package.json`.
+ Backbone.VERSION = '0.9.2';
+
+ // Require Underscore, if we're on the server, and it's not already present.
+ var _ = root._;
+ if (!_ && (typeof require !== 'undefined')) _ = require('underscore');
+
+ // For Backbone's purposes, jQuery, Zepto, or Ender owns the `$` variable.
+ var $ = root.jQuery || root.Zepto || root.ender;
+
+ // Set the JavaScript library that will be used for DOM manipulation and
+ // Ajax calls (a.k.a. the `$` variable). By default Backbone will use: jQuery,
+ // Zepto, or Ender; but the `setDomLibrary()` method lets you inject an
+ // alternate JavaScript library (or a mock library for testing your views
+ // outside of a browser).
+ Backbone.setDomLibrary = function(lib) {
+ $ = lib;
+ };
+
+ // Runs Backbone.js in *noConflict* mode, returning the `Backbone` variable
+ // to its previous owner. Returns a reference to this Backbone object.
+ Backbone.noConflict = function() {
+ root.Backbone = previousBackbone;
+ return this;
+ };
+
+ // Turn on `emulateHTTP` to support legacy HTTP servers. Setting this option
+ // will fake `"PUT"` and `"DELETE"` requests via the `_method` parameter and
+ // set a `X-Http-Method-Override` header.
+ Backbone.emulateHTTP = false;
+
+ // Turn on `emulateJSON` to support legacy servers that can't deal with direct
+ // `application/json` requests ... will encode the body as
+ // `application/x-www-form-urlencoded` instead and will send the model in a
+ // form param named `model`.
+ Backbone.emulateJSON = false;
+
+ // Backbone.Events
+ // -----------------
+
+ // Regular expression used to split event strings
+ var eventSplitter = /\s+/;
+
+ // A module that can be mixed in to *any object* in order to provide it with
+ // custom events. You may bind with `on` or remove with `off` callback functions
+ // to an event; trigger`-ing an event fires all callbacks in succession.
+ //
+ // var object = {};
+ // _.extend(object, Backbone.Events);
+ // object.on('expand', function(){ alert('expanded'); });
+ // object.trigger('expand');
+ //
+ var Events = Backbone.Events = {
+
+ // Bind one or more space separated events, `events`, to a `callback`
+ // function. Passing `"all"` will bind the callback to all events fired.
+ on: function(events, callback, context) {
+
+ var calls, event, node, tail, list;
+ if (!callback) return this;
+ events = events.split(eventSplitter);
+ calls = this._callbacks || (this._callbacks = {});
+
+ // Create an immutable callback list, allowing traversal during
+ // modification. The tail is an empty object that will always be used
+ // as the next node.
+ while (event = events.shift()) {
+ list = calls[event];
+ node = list ? list.tail : {};
+ node.next = tail = {};
+ node.context = context;
+ node.callback = callback;
+ calls[event] = {tail: tail, next: list ? list.next : node};
+ }
+
+ return this;
+ },
+
+ // Remove one or many callbacks. If `context` is null, removes all callbacks
+ // with that function. If `callback` is null, removes all callbacks for the
+ // event. If `events` is null, removes all bound callbacks for all events.
+ off: function(events, callback, context) {
+ var event, calls, node, tail, cb, ctx;
+
+ // No events, or removing *all* events.
+ if (!(calls = this._callbacks)) return;
+ if (!(events || callback || context)) {
+ delete this._callbacks;
+ return this;
+ }
+
+ // Loop through the listed events and contexts, splicing them out of the
+ // linked list of callbacks if appropriate.
+ events = events ? events.split(eventSplitter) : _.keys(calls);
+ while (event = events.shift()) {
+ node = calls[event];
+ delete calls[event];
+ if (!node || !(callback || context)) continue;
+ // Create a new list, omitting the indicated callbacks.
+ tail = node.tail;
+ while ((node = node.next) !== tail) {
+ cb = node.callback;
+ ctx = node.context;
+ if ((callback && cb !== callback) || (context && ctx !== context)) {
+ this.on(event, cb, ctx);
+ }
+ }
+ }
+
+ return this;
+ },
+
+ // Trigger one or many events, firing all bound callbacks. Callbacks are
+ // passed the same arguments as `trigger` is, apart from the event name
+ // (unless you're listening on `"all"`, which will cause your callback to
+ // receive the true name of the event as the first argument).
+ trigger: function(events) {
+ var event, node, calls, tail, args, all, rest;
+ if (!(calls = this._callbacks)) return this;
+ all = calls.all;
+ events = events.split(eventSplitter);
+ rest = slice.call(arguments, 1);
+
+ // For each event, walk through the linked list of callbacks twice,
+ // first to trigger the event, then to trigger any `"all"` callbacks.
+ while (event = events.shift()) {
+ if (node = calls[event]) {
+ tail = node.tail;
+ while ((node = node.next) !== tail) {
+ node.callback.apply(node.context || this, rest);
+ }
+ }
+ if (node = all) {
+ tail = node.tail;
+ args = [event].concat(rest);
+ while ((node = node.next) !== tail) {
+ node.callback.apply(node.context || this, args);
+ }
+ }
+ }
+
+ return this;
+ }
+
+ };
+
+ // Aliases for backwards compatibility.
+ Events.bind = Events.on;
+ Events.unbind = Events.off;
+
+ // Backbone.Model
+ // --------------
+
+ // Create a new model, with defined attributes. A client id (`cid`)
+ // is automatically generated and assigned for you.
+ var Model = Backbone.Model = function(attributes, options) {
+ var defaults;
+ attributes || (attributes = {});
+ if (options && options.parse) attributes = this.parse(attributes);
+ if (defaults = getValue(this, 'defaults')) {
+ attributes = _.extend({}, defaults, attributes);
+ }
+ if (options && options.collection) this.collection = options.collection;
+ this.attributes = {};
+ this._escapedAttributes = {};
+ this.cid = _.uniqueId('c');
+ this.changed = {};
+ this._silent = {};
+ this._pending = {};
+ this.set(attributes, {silent: true});
+ // Reset change tracking.
+ this.changed = {};
+ this._silent = {};
+ this._pending = {};
+ this._previousAttributes = _.clone(this.attributes);
+ this.initialize.apply(this, arguments);
+ };
+
+ // Attach all inheritable methods to the Model prototype.
+ _.extend(Model.prototype, Events, {
+
+ // A hash of attributes whose current and previous value differ.
+ changed: null,
+
+ // A hash of attributes that have silently changed since the last time
+ // `change` was called. Will become pending attributes on the next call.
+ _silent: null,
+
+ // A hash of attributes that have changed since the last `'change'` event
+ // began.
+ _pending: null,
+
+ // The default name for the JSON `id` attribute is `"id"`. MongoDB and
+ // CouchDB users may want to set this to `"_id"`.
+ idAttribute: 'id',
+
+ // Initialize is an empty function by default. Override it with your own
+ // initialization logic.
+ initialize: function(){},
+
+ // Return a copy of the model's `attributes` object.
+ toJSON: function(options) {
+ return _.clone(this.attributes);
+ },
+
+ // Get the value of an attribute.
+ get: function(attr) {
+ return this.attributes[attr];
+ },
+
+ // Get the HTML-escaped value of an attribute.
+ escape: function(attr) {
+ var html;
+ if (html = this._escapedAttributes[attr]) return html;
+ var val = this.get(attr);
+ return this._escapedAttributes[attr] = _.escape(val == null ? '' : '' + val);
+ },
+
+ // Returns `true` if the attribute contains a value that is not null
+ // or undefined.
+ has: function(attr) {
+ return this.get(attr) != null;
+ },
+
+ // Set a hash of model attributes on the object, firing `"change"` unless
+ // you choose to silence it.
+ set: function(key, value, options) {
+ var attrs, attr, val;
+
+ // Handle both `"key", value` and `{key: value}` -style arguments.
+ if (_.isObject(key) || key == null) {
+ attrs = key;
+ options = value;
+ } else {
+ attrs = {};
+ attrs[key] = value;
+ }
+
+ // Extract attributes and options.
+ options || (options = {});
+ if (!attrs) return this;
+ if (attrs instanceof Model) attrs = attrs.attributes;
+ if (options.unset) for (attr in attrs) attrs[attr] = void 0;
+
+ // Run validation.
+ if (!this._validate(attrs, options)) return false;
+
+ // Check for changes of `id`.
+ if (this.idAttribute in attrs) this.id = attrs[this.idAttribute];
+
+ var changes = options.changes = {};
+ var now = this.attributes;
+ var escaped = this._escapedAttributes;
+ var prev = this._previousAttributes || {};
+
+ // For each `set` attribute...
+ for (attr in attrs) {
+ val = attrs[attr];
+
+ // If the new and current value differ, record the change.
+ if (!_.isEqual(now[attr], val) || (options.unset && _.has(now, attr))) {
+ delete escaped[attr];
+ (options.silent ? this._silent : changes)[attr] = true;
+ }
+
+ // Update or delete the current value.
+ options.unset ? delete now[attr] : now[attr] = val;
+
+ // If the new and previous value differ, record the change. If not,
+ // then remove changes for this attribute.
+ if (!_.isEqual(prev[attr], val) || (_.has(now, attr) != _.has(prev, attr))) {
+ this.changed[attr] = val;
+ if (!options.silent) this._pending[attr] = true;
+ } else {
+ delete this.changed[attr];
+ delete this._pending[attr];
+ }
+ }
+
+ // Fire the `"change"` events.
+ if (!options.silent) this.change(options);
+ return this;
+ },
+
+ // Remove an attribute from the model, firing `"change"` unless you choose
+ // to silence it. `unset` is a noop if the attribute doesn't exist.
+ unset: function(attr, options) {
+ (options || (options = {})).unset = true;
+ return this.set(attr, null, options);
+ },
+
+ // Clear all attributes on the model, firing `"change"` unless you choose
+ // to silence it.
+ clear: function(options) {
+ (options || (options = {})).unset = true;
+ return this.set(_.clone(this.attributes), options);
+ },
+
+ // Fetch the model from the server. If the server's representation of the
+ // model differs from its current attributes, they will be overriden,
+ // triggering a `"change"` event.
+ fetch: function(options) {
+ options = options ? _.clone(options) : {};
+ var model = this;
+ var success = options.success;
+ options.success = function(resp, status, xhr) {
+ if (!model.set(model.parse(resp, xhr), options)) return false;
+ if (success) success(model, resp);
+ };
+ options.error = Backbone.wrapError(options.error, model, options);
+ return (this.sync || Backbone.sync).call(this, 'read', this, options);
+ },
+
+ // Set a hash of model attributes, and sync the model to the server.
+ // If the server returns an attributes hash that differs, the model's
+ // state will be `set` again.
+ save: function(key, value, options) {
+ var attrs, current;
+
+ // Handle both `("key", value)` and `({key: value})` -style calls.
+ if (_.isObject(key) || key == null) {
+ attrs = key;
+ options = value;
+ } else {
+ attrs = {};
+ attrs[key] = value;
+ }
+ options = options ? _.clone(options) : {};
+
+ // If we're "wait"-ing to set changed attributes, validate early.
+ if (options.wait) {
+ if (!this._validate(attrs, options)) return false;
+ current = _.clone(this.attributes);
+ }
+
+ // Regular saves `set` attributes before persisting to the server.
+ var silentOptions = _.extend({}, options, {silent: true});
+ if (attrs && !this.set(attrs, options.wait ? silentOptions : options)) {
+ return false;
+ }
+
+ // After a successful server-side save, the client is (optionally)
+ // updated with the server-side state.
+ var model = this;
+ var success = options.success;
+ options.success = function(resp, status, xhr) {
+ var serverAttrs = model.parse(resp, xhr);
+ if (options.wait) {
+ delete options.wait;
+ serverAttrs = _.extend(attrs || {}, serverAttrs);
+ }
+ if (!model.set(serverAttrs, options)) return false;
+ if (success) {
+ success(model, resp);
+ } else {
+ model.trigger('sync', model, resp, options);
+ }
+ };
+
+ // Finish configuring and sending the Ajax request.
+ options.error = Backbone.wrapError(options.error, model, options);
+ var method = this.isNew() ? 'create' : 'update';
+ var xhr = (this.sync || Backbone.sync).call(this, method, this, options);
+ if (options.wait) this.set(current, silentOptions);
+ return xhr;
+ },
+
+ // Destroy this model on the server if it was already persisted.
+ // Optimistically removes the model from its collection, if it has one.
+ // If `wait: true` is passed, waits for the server to respond before removal.
+ destroy: function(options) {
+ options = options ? _.clone(options) : {};
+ var model = this;
+ var success = options.success;
+
+ var triggerDestroy = function() {
+ model.trigger('destroy', model, model.collection, options);
+ };
+
+ if (this.isNew()) {
+ triggerDestroy();
+ return false;
+ }
+
+ options.success = function(resp) {
+ if (options.wait) triggerDestroy();
+ if (success) {
+ success(model, resp);
+ } else {
+ model.trigger('sync', model, resp, options);
+ }
+ };
+
+ options.error = Backbone.wrapError(options.error, model, options);
+ var xhr = (this.sync || Backbone.sync).call(this, 'delete', this, options);
+ if (!options.wait) triggerDestroy();
+ return xhr;
+ },
+
+ // Default URL for the model's representation on the server -- if you're
+ // using Backbone's restful methods, override this to change the endpoint
+ // that will be called.
+ url: function() {
+ var base = getValue(this, 'urlRoot') || getValue(this.collection, 'url') || urlError();
+ if (this.isNew()) return base;
+ return base + (base.charAt(base.length - 1) == '/' ? '' : '/') + encodeURIComponent(this.id);
+ },
+
+ // **parse** converts a response into the hash of attributes to be `set` on
+ // the model. The default implementation is just to pass the response along.
+ parse: function(resp, xhr) {
+ return resp;
+ },
+
+ // Create a new model with identical attributes to this one.
+ clone: function() {
+ return new this.constructor(this.attributes);
+ },
+
+ // A model is new if it has never been saved to the server, and lacks an id.
+ isNew: function() {
+ return this.id == null;
+ },
+
+ // Call this method to manually fire a `"change"` event for this model and
+ // a `"change:attribute"` event for each changed attribute.
+ // Calling this will cause all objects observing the model to update.
+ change: function(options) {
+ options || (options = {});
+ var changing = this._changing;
+ this._changing = true;
+
+ // Silent changes become pending changes.
+ for (var attr in this._silent) this._pending[attr] = true;
+
+ // Silent changes are triggered.
+ var changes = _.extend({}, options.changes, this._silent);
+ this._silent = {};
+ for (var attr in changes) {
+ this.trigger('change:' + attr, this, this.get(attr), options);
+ }
+ if (changing) return this;
+
+ // Continue firing `"change"` events while there are pending changes.
+ while (!_.isEmpty(this._pending)) {
+ this._pending = {};
+ this.trigger('change', this, options);
+ // Pending and silent changes still remain.
+ for (var attr in this.changed) {
+ if (this._pending[attr] || this._silent[attr]) continue;
+ delete this.changed[attr];
+ }
+ this._previousAttributes = _.clone(this.attributes);
+ }
+
+ this._changing = false;
+ return this;
+ },
+
+ // Determine if the model has changed since the last `"change"` event.
+ // If you specify an attribute name, determine if that attribute has changed.
+ hasChanged: function(attr) {
+ if (!arguments.length) return !_.isEmpty(this.changed);
+ return _.has(this.changed, attr);
+ },
+
+ // Return an object containing all the attributes that have changed, or
+ // false if there are no changed attributes. Useful for determining what
+ // parts of a view need to be updated and/or what attributes need to be
+ // persisted to the server. Unset attributes will be set to undefined.
+ // You can also pass an attributes object to diff against the model,
+ // determining if there *would be* a change.
+ changedAttributes: function(diff) {
+ if (!diff) return this.hasChanged() ? _.clone(this.changed) : false;
+ var val, changed = false, old = this._previousAttributes;
+ for (var attr in diff) {
+ if (_.isEqual(old[attr], (val = diff[attr]))) continue;
+ (changed || (changed = {}))[attr] = val;
+ }
+ return changed;
+ },
+
+ // Get the previous value of an attribute, recorded at the time the last
+ // `"change"` event was fired.
+ previous: function(attr) {
+ if (!arguments.length || !this._previousAttributes) return null;
+ return this._previousAttributes[attr];
+ },
+
+ // Get all of the attributes of the model at the time of the previous
+ // `"change"` event.
+ previousAttributes: function() {
+ return _.clone(this._previousAttributes);
+ },
+
+ // Check if the model is currently in a valid state. It's only possible to
+ // get into an *invalid* state if you're using silent changes.
+ isValid: function() {
+ return !this.validate(this.attributes);
+ },
+
+ // Run validation against the next complete set of model attributes,
+ // returning `true` if all is well. If a specific `error` callback has
+ // been passed, call that instead of firing the general `"error"` event.
+ _validate: function(attrs, options) {
+ if (options.silent || !this.validate) return true;
+ attrs = _.extend({}, this.attributes, attrs);
+ var error = this.validate(attrs, options);
+ if (!error) return true;
+ if (options && options.error) {
+ options.error(this, error, options);
+ } else {
+ this.trigger('error', this, error, options);
+ }
+ return false;
+ }
+
+ });
+
+ // Backbone.Collection
+ // -------------------
+
+ // Provides a standard collection class for our sets of models, ordered
+ // or unordered. If a `comparator` is specified, the Collection will maintain
+ // its models in sort order, as they're added and removed.
+ var Collection = Backbone.Collection = function(models, options) {
+ options || (options = {});
+ if (options.model) this.model = options.model;
+ if (options.comparator) this.comparator = options.comparator;
+ this._reset();
+ this.initialize.apply(this, arguments);
+ if (models) this.reset(models, {silent: true, parse: options.parse});
+ };
+
+ // Define the Collection's inheritable methods.
+ _.extend(Collection.prototype, Events, {
+
+ // The default model for a collection is just a **Backbone.Model**.
+ // This should be overridden in most cases.
+ model: Model,
+
+ // Initialize is an empty function by default. Override it with your own
+ // initialization logic.
+ initialize: function(){},
+
+ // The JSON representation of a Collection is an array of the
+ // models' attributes.
+ toJSON: function(options) {
+ return this.map(function(model){ return model.toJSON(options); });
+ },
+
+ // Add a model, or list of models to the set. Pass **silent** to avoid
+ // firing the `add` event for every new model.
+ add: function(models, options) {
+ var i, index, length, model, cid, id, cids = {}, ids = {}, dups = [];
+ options || (options = {});
+ models = _.isArray(models) ? models.slice() : [models];
+
+ // Begin by turning bare objects into model references, and preventing
+ // invalid models or duplicate models from being added.
+ for (i = 0, length = models.length; i < length; i++) {
+ if (!(model = models[i] = this._prepareModel(models[i], options))) {
+ throw new Error("Can't add an invalid model to a collection");
+ }
+ cid = model.cid;
+ id = model.id;
+ if (cids[cid] || this._byCid[cid] || ((id != null) && (ids[id] || this._byId[id]))) {
+ dups.push(i);
+ continue;
+ }
+ cids[cid] = ids[id] = model;
+ }
+
+ // Remove duplicates.
+ i = dups.length;
+ while (i--) {
+ models.splice(dups[i], 1);
+ }
+
+ // Listen to added models' events, and index models for lookup by
+ // `id` and by `cid`.
+ for (i = 0, length = models.length; i < length; i++) {
+ (model = models[i]).on('all', this._onModelEvent, this);
+ this._byCid[model.cid] = model;
+ if (model.id != null) this._byId[model.id] = model;
+ }
+
+ // Insert models into the collection, re-sorting if needed, and triggering
+ // `add` events unless silenced.
+ this.length += length;
+ index = options.at != null ? options.at : this.models.length;
+ splice.apply(this.models, [index, 0].concat(models));
+ if (this.comparator) this.sort({silent: true});
+ if (options.silent) return this;
+ for (i = 0, length = this.models.length; i < length; i++) {
+ if (!cids[(model = this.models[i]).cid]) continue;
+ options.index = i;
+ model.trigger('add', model, this, options);
+ }
+ return this;
+ },
+
+ // Remove a model, or a list of models from the set. Pass silent to avoid
+ // firing the `remove` event for every model removed.
+ remove: function(models, options) {
+ var i, l, index, model;
+ options || (options = {});
+ models = _.isArray(models) ? models.slice() : [models];
+ for (i = 0, l = models.length; i < l; i++) {
+ model = this.getByCid(models[i]) || this.get(models[i]);
+ if (!model) continue;
+ delete this._byId[model.id];
+ delete this._byCid[model.cid];
+ index = this.indexOf(model);
+ this.models.splice(index, 1);
+ this.length--;
+ if (!options.silent) {
+ options.index = index;
+ model.trigger('remove', model, this, options);
+ }
+ this._removeReference(model);
+ }
+ return this;
+ },
+
+ // Add a model to the end of the collection.
+ push: function(model, options) {
+ model = this._prepareModel(model, options);
+ this.add(model, options);
+ return model;
+ },
+
+ // Remove a model from the end of the collection.
+ pop: function(options) {
+ var model = this.at(this.length - 1);
+ this.remove(model, options);
+ return model;
+ },
+
+ // Add a model to the beginning of the collection.
+ unshift: function(model, options) {
+ model = this._prepareModel(model, options);
+ this.add(model, _.extend({at: 0}, options));
+ return model;
+ },
+
+ // Remove a model from the beginning of the collection.
+ shift: function(options) {
+ var model = this.at(0);
+ this.remove(model, options);
+ return model;
+ },
+
+ // Get a model from the set by id.
+ get: function(id) {
+ if (id == null) return void 0;
+ return this._byId[id.id != null ? id.id : id];
+ },
+
+ // Get a model from the set by client id.
+ getByCid: function(cid) {
+ return cid && this._byCid[cid.cid || cid];
+ },
+
+ // Get the model at the given index.
+ at: function(index) {
+ return this.models[index];
+ },
+
+ // Return models with matching attributes. Useful for simple cases of `filter`.
+ where: function(attrs) {
+ if (_.isEmpty(attrs)) return [];
+ return this.filter(function(model) {
+ for (var key in attrs) {
+ if (attrs[key] !== model.get(key)) return false;
+ }
+ return true;
+ });
+ },
+
+ // Force the collection to re-sort itself. You don't need to call this under
+ // normal circumstances, as the set will maintain sort order as each item
+ // is added.
+ sort: function(options) {
+ options || (options = {});
+ if (!this.comparator) throw new Error('Cannot sort a set without a comparator');
+ var boundComparator = _.bind(this.comparator, this);
+ if (this.comparator.length == 1) {
+ this.models = this.sortBy(boundComparator);
+ } else {
+ this.models.sort(boundComparator);
+ }
+ if (!options.silent) this.trigger('reset', this, options);
+ return this;
+ },
+
+ // Pluck an attribute from each model in the collection.
+ pluck: function(attr) {
+ return _.map(this.models, function(model){ return model.get(attr); });
+ },
+
+ // When you have more items than you want to add or remove individually,
+ // you can reset the entire set with a new list of models, without firing
+ // any `add` or `remove` events. Fires `reset` when finished.
+ reset: function(models, options) {
+ models || (models = []);
+ options || (options = {});
+ for (var i = 0, l = this.models.length; i < l; i++) {
+ this._removeReference(this.models[i]);
+ }
+ this._reset();
+ this.add(models, _.extend({silent: true}, options));
+ if (!options.silent) this.trigger('reset', this, options);
+ return this;
+ },
+
+ // Fetch the default set of models for this collection, resetting the
+ // collection when they arrive. If `add: true` is passed, appends the
+ // models to the collection instead of resetting.
+ fetch: function(options) {
+ options = options ? _.clone(options) : {};
+ if (options.parse === undefined) options.parse = true;
+ var collection = this;
+ var success = options.success;
+ options.success = function(resp, status, xhr) {
+ collection[options.add ? 'add' : 'reset'](collection.parse(resp, xhr), options);
+ if (success) success(collection, resp);
+ };
+ options.error = Backbone.wrapError(options.error, collection, options);
+ return (this.sync || Backbone.sync).call(this, 'read', this, options);
+ },
+
+ // Create a new instance of a model in this collection. Add the model to the
+ // collection immediately, unless `wait: true` is passed, in which case we
+ // wait for the server to agree.
+ create: function(model, options) {
+ var coll = this;
+ options = options ? _.clone(options) : {};
+ model = this._prepareModel(model, options);
+ if (!model) return false;
+ if (!options.wait) coll.add(model, options);
+ var success = options.success;
+ options.success = function(nextModel, resp, xhr) {
+ if (options.wait) coll.add(nextModel, options);
+ if (success) {
+ success(nextModel, resp);
+ } else {
+ nextModel.trigger('sync', model, resp, options);
+ }
+ };
+ model.save(null, options);
+ return model;
+ },
+
+ // **parse** converts a response into a list of models to be added to the
+ // collection. The default implementation is just to pass it through.
+ parse: function(resp, xhr) {
+ return resp;
+ },
+
+ // Proxy to _'s chain. Can't be proxied the same way the rest of the
+ // underscore methods are proxied because it relies on the underscore
+ // constructor.
+ chain: function () {
+ return _(this.models).chain();
+ },
+
+ // Reset all internal state. Called when the collection is reset.
+ _reset: function(options) {
+ this.length = 0;
+ this.models = [];
+ this._byId = {};
+ this._byCid = {};
+ },
+
+ // Prepare a model or hash of attributes to be added to this collection.
+ _prepareModel: function(model, options) {
+ options || (options = {});
+ if (!(model instanceof Model)) {
+ var attrs = model;
+ options.collection = this;
+ model = new this.model(attrs, options);
+ if (!model._validate(model.attributes, options)) model = false;
+ } else if (!model.collection) {
+ model.collection = this;
+ }
+ return model;
+ },
+
+ // Internal method to remove a model's ties to a collection.
+ _removeReference: function(model) {
+ if (this == model.collection) {
+ delete model.collection;
+ }
+ model.off('all', this._onModelEvent, this);
+ },
+
+ // Internal method called every time a model in the set fires an event.
+ // Sets need to update their indexes when models change ids. All other
+ // events simply proxy through. "add" and "remove" events that originate
+ // in other collections are ignored.
+ _onModelEvent: function(event, model, collection, options) {
+ if ((event == 'add' || event == 'remove') && collection != this) return;
+ if (event == 'destroy') {
+ this.remove(model, options);
+ }
+ if (model && event === 'change:' + model.idAttribute) {
+ delete this._byId[model.previous(model.idAttribute)];
+ this._byId[model.id] = model;
+ }
+ this.trigger.apply(this, arguments);
+ }
+
+ });
+
+ // Underscore methods that we want to implement on the Collection.
+ var methods = ['forEach', 'each', 'map', 'reduce', 'reduceRight', 'find',
+ 'detect', 'filter', 'select', 'reject', 'every', 'all', 'some', 'any',
+ 'include', 'contains', 'invoke', 'max', 'min', 'sortBy', 'sortedIndex',
+ 'toArray', 'size', 'first', 'initial', 'rest', 'last', 'without', 'indexOf',
+ 'shuffle', 'lastIndexOf', 'isEmpty', 'groupBy'];
+
+ // Mix in each Underscore method as a proxy to `Collection#models`.
+ _.each(methods, function(method) {
+ Collection.prototype[method] = function() {
+ return _[method].apply(_, [this.models].concat(_.toArray(arguments)));
+ };
+ });
+
+ // Backbone.Router
+ // -------------------
+
+ // Routers map faux-URLs to actions, and fire events when routes are
+ // matched. Creating a new one sets its `routes` hash, if not set statically.
+ var Router = Backbone.Router = function(options) {
+ options || (options = {});
+ if (options.routes) this.routes = options.routes;
+ this._bindRoutes();
+ this.initialize.apply(this, arguments);
+ };
+
+ // Cached regular expressions for matching named param parts and splatted
+ // parts of route strings.
+ var namedParam = /:\w+/g;
+ var splatParam = /\*\w+/g;
+ var escapeRegExp = /[-[\]{}()+?.,\\^$|#\s]/g;
+
+ // Set up all inheritable **Backbone.Router** properties and methods.
+ _.extend(Router.prototype, Events, {
+
+ // Initialize is an empty function by default. Override it with your own
+ // initialization logic.
+ initialize: function(){},
+
+ // Manually bind a single named route to a callback. For example:
+ //
+ // this.route('search/:query/p:num', 'search', function(query, num) {
+ // ...
+ // });
+ //
+ route: function(route, name, callback) {
+ Backbone.history || (Backbone.history = new History);
+ if (!_.isRegExp(route)) route = this._routeToRegExp(route);
+ if (!callback) callback = this[name];
+ Backbone.history.route(route, _.bind(function(fragment) {
+ var args = this._extractParameters(route, fragment);
+ callback && callback.apply(this, args);
+ this.trigger.apply(this, ['route:' + name].concat(args));
+ Backbone.history.trigger('route', this, name, args);
+ }, this));
+ return this;
+ },
+
+ // Simple proxy to `Backbone.history` to save a fragment into the history.
+ navigate: function(fragment, options) {
+ Backbone.history.navigate(fragment, options);
+ },
+
+ // Bind all defined routes to `Backbone.history`. We have to reverse the
+ // order of the routes here to support behavior where the most general
+ // routes can be defined at the bottom of the route map.
+ _bindRoutes: function() {
+ if (!this.routes) return;
+ var routes = [];
+ for (var route in this.routes) {
+ routes.unshift([route, this.routes[route]]);
+ }
+ for (var i = 0, l = routes.length; i < l; i++) {
+ this.route(routes[i][0], routes[i][1], this[routes[i][1]]);
+ }
+ },
+
+ // Convert a route string into a regular expression, suitable for matching
+ // against the current location hash.
+ _routeToRegExp: function(route) {
+ route = route.replace(escapeRegExp, '\\$&')
+ .replace(namedParam, '([^\/]+)')
+ .replace(splatParam, '(.*?)');
+ return new RegExp('^' + route + '$');
+ },
+
+ // Given a route, and a URL fragment that it matches, return the array of
+ // extracted parameters.
+ _extractParameters: function(route, fragment) {
+ return route.exec(fragment).slice(1);
+ }
+
+ });
+
+ // Backbone.History
+ // ----------------
+
+ // Handles cross-browser history management, based on URL fragments. If the
+ // browser does not support `onhashchange`, falls back to polling.
+ var History = Backbone.History = function() {
+ this.handlers = [];
+ _.bindAll(this, 'checkUrl');
+ };
+
+ // Cached regex for cleaning leading hashes and slashes .
+ var routeStripper = /^[#\/]/;
+
+ // Cached regex for detecting MSIE.
+ var isExplorer = /msie [\w.]+/;
+
+ // Has the history handling already been started?
+ History.started = false;
+
+ // Set up all inheritable **Backbone.History** properties and methods.
+ _.extend(History.prototype, Events, {
+
+ // The default interval to poll for hash changes, if necessary, is
+ // twenty times a second.
+ interval: 50,
+
+ // Gets the true hash value. Cannot use location.hash directly due to bug
+ // in Firefox where location.hash will always be decoded.
+ getHash: function(windowOverride) {
+ var loc = windowOverride ? windowOverride.location : window.location;
+ var match = loc.href.match(/#(.*)$/);
+ return match ? match[1] : '';
+ },
+
+ // Get the cross-browser normalized URL fragment, either from the URL,
+ // the hash, or the override.
+ getFragment: function(fragment, forcePushState) {
+ if (fragment == null) {
+ if (this._hasPushState || forcePushState) {
+ fragment = window.location.pathname;
+ var search = window.location.search;
+ if (search) fragment += search;
+ } else {
+ fragment = this.getHash();
+ }
+ }
+ if (!fragment.indexOf(this.options.root)) fragment = fragment.substr(this.options.root.length);
+ return fragment.replace(routeStripper, '');
+ },
+
+ // Start the hash change handling, returning `true` if the current URL matches
+ // an existing route, and `false` otherwise.
+ start: function(options) {
+ if (History.started) throw new Error("Backbone.history has already been started");
+ History.started = true;
+
+ // Figure out the initial configuration. Do we need an iframe?
+ // Is pushState desired ... is it available?
+ this.options = _.extend({}, {root: '/'}, this.options, options);
+ this._wantsHashChange = this.options.hashChange !== false;
+ this._wantsPushState = !!this.options.pushState;
+ this._hasPushState = !!(this.options.pushState && window.history && window.history.pushState);
+ var fragment = this.getFragment();
+ var docMode = document.documentMode;
+ var oldIE = (isExplorer.exec(navigator.userAgent.toLowerCase()) && (!docMode || docMode <= 7));
+
+ if (oldIE) {
+ this.iframe = $('<iframe src="javascript:0" tabindex="-1" />').hide().appendTo('body')[0].contentWindow;
+ this.navigate(fragment);
+ }
+
+ // Depending on whether we're using pushState or hashes, and whether
+ // 'onhashchange' is supported, determine how we check the URL state.
+ if (this._hasPushState) {
+ $(window).bind('popstate', this.checkUrl);
+ } else if (this._wantsHashChange && ('onhashchange' in window) && !oldIE) {
+ $(window).bind('hashchange', this.checkUrl);
+ } else if (this._wantsHashChange) {
+ this._checkUrlInterval = setInterval(this.checkUrl, this.interval);
+ }
+
+ // Determine if we need to change the base url, for a pushState link
+ // opened by a non-pushState browser.
+ this.fragment = fragment;
+ var loc = window.location;
+ var atRoot = loc.pathname == this.options.root;
+
+ // If we've started off with a route from a `pushState`-enabled browser,
+ // but we're currently in a browser that doesn't support it...
+ if (this._wantsHashChange && this._wantsPushState && !this._hasPushState && !atRoot) {
+ this.fragment = this.getFragment(null, true);
+ window.location.replace(this.options.root + '#' + this.fragment);
+ // Return immediately as browser will do redirect to new url
+ return true;
+
+ // Or if we've started out with a hash-based route, but we're currently
+ // in a browser where it could be `pushState`-based instead...
+ } else if (this._wantsPushState && this._hasPushState && atRoot && loc.hash) {
+ this.fragment = this.getHash().replace(routeStripper, '');
+ window.history.replaceState({}, document.title, loc.protocol + '//' + loc.host + this.options.root + this.fragment);
+ }
+
+ if (!this.options.silent) {
+ return this.loadUrl();
+ }
+ },
+
+ // Disable Backbone.history, perhaps temporarily. Not useful in a real app,
+ // but possibly useful for unit testing Routers.
+ stop: function() {
+ $(window).unbind('popstate', this.checkUrl).unbind('hashchange', this.checkUrl);
+ clearInterval(this._checkUrlInterval);
+ History.started = false;
+ },
+
+ // Add a route to be tested when the fragment changes. Routes added later
+ // may override previous routes.
+ route: function(route, callback) {
+ this.handlers.unshift({route: route, callback: callback});
+ },
+
+ // Checks the current URL to see if it has changed, and if it has,
+ // calls `loadUrl`, normalizing across the hidden iframe.
+ checkUrl: function(e) {
+ var current = this.getFragment();
+ if (current == this.fragment && this.iframe) current = this.getFragment(this.getHash(this.iframe));
+ if (current == this.fragment) return false;
+ if (this.iframe) this.navigate(current);
+ this.loadUrl() || this.loadUrl(this.getHash());
+ },
+
+ // Attempt to load the current URL fragment. If a route succeeds with a
+ // match, returns `true`. If no defined routes matches the fragment,
+ // returns `false`.
+ loadUrl: function(fragmentOverride) {
+ var fragment = this.fragment = this.getFragment(fragmentOverride);
+ var matched = _.any(this.handlers, function(handler) {
+ if (handler.route.test(fragment)) {
+ handler.callback(fragment);
+ return true;
+ }
+ });
+ return matched;
+ },
+
+ // Save a fragment into the hash history, or replace the URL state if the
+ // 'replace' option is passed. You are responsible for properly URL-encoding
+ // the fragment in advance.
+ //
+ // The options object can contain `trigger: true` if you wish to have the
+ // route callback be fired (not usually desirable), or `replace: true`, if
+ // you wish to modify the current URL without adding an entry to the history.
+ navigate: function(fragment, options) {
+ if (!History.started) return false;
+ if (!options || options === true) options = {trigger: options};
+ var frag = (fragment || '').replace(routeStripper, '');
+ if (this.fragment == frag) return;
+
+ // If pushState is available, we use it to set the fragment as a real URL.
+ if (this._hasPushState) {
+ if (frag.indexOf(this.options.root) != 0) frag = this.options.root + frag;
+ this.fragment = frag;
+ window.history[options.replace ? 'replaceState' : 'pushState']({}, document.title, frag);
+
+ // If hash changes haven't been explicitly disabled, update the hash
+ // fragment to store history.
+ } else if (this._wantsHashChange) {
+ this.fragment = frag;
+ this._updateHash(window.location, frag, options.replace);
+ if (this.iframe && (frag != this.getFragment(this.getHash(this.iframe)))) {
+ // Opening and closing the iframe tricks IE7 and earlier to push a history entry on hash-tag change.
+ // When replace is true, we don't want this.
+ if(!options.replace) this.iframe.document.open().close();
+ this._updateHash(this.iframe.location, frag, options.replace);
+ }
+
+ // If you've told us that you explicitly don't want fallback hashchange-
+ // based history, then `navigate` becomes a page refresh.
+ } else {
+ window.location.assign(this.options.root + fragment);
+ }
+ if (options.trigger) this.loadUrl(fragment);
+ },
+
+ // Update the hash location, either replacing the current entry, or adding
+ // a new one to the browser history.
+ _updateHash: function(location, fragment, replace) {
+ if (replace) {
+ location.replace(location.toString().replace(/(javascript:|#).*$/, '') + '#' + fragment);
+ } else {
+ location.hash = fragment;
+ }
+ }
+ });
+
+ // Backbone.View
+ // -------------
+
+ // Creating a Backbone.View creates its initial element outside of the DOM,
+ // if an existing element is not provided...
+ var View = Backbone.View = function(options) {
+ this.cid = _.uniqueId('view');
+ this._configure(options || {});
+ this._ensureElement();
+ this.initialize.apply(this, arguments);
+ this.delegateEvents();
+ };
+
+ // Cached regex to split keys for `delegate`.
+ var delegateEventSplitter = /^(\S+)\s*(.*)$/;
+
+ // List of view options to be merged as properties.
+ var viewOptions = ['model', 'collection', 'el', 'id', 'attributes', 'className', 'tagName'];
+
+ // Set up all inheritable **Backbone.View** properties and methods.
+ _.extend(View.prototype, Events, {
+
+ // The default `tagName` of a View's element is `"div"`.
+ tagName: 'div',
+
+ // jQuery delegate for element lookup, scoped to DOM elements within the
+ // current view. This should be prefered to global lookups where possible.
+ $: function(selector) {
+ return this.$el.find(selector);
+ },
+
+ // Initialize is an empty function by default. Override it with your own
+ // initialization logic.
+ initialize: function(){},
+
+ // **render** is the core function that your view should override, in order
+ // to populate its element (`this.el`), with the appropriate HTML. The
+ // convention is for **render** to always return `this`.
+ render: function() {
+ return this;
+ },
+
+ // Remove this view from the DOM. Note that the view isn't present in the
+ // DOM by default, so calling this method may be a no-op.
+ remove: function() {
+ this.$el.remove();
+ return this;
+ },
+
+ // For small amounts of DOM Elements, where a full-blown template isn't
+ // needed, use **make** to manufacture elements, one at a time.
+ //
+ // var el = this.make('li', {'class': 'row'}, this.model.escape('title'));
+ //
+ make: function(tagName, attributes, content) {
+ var el = document.createElement(tagName);
+ if (attributes) $(el).attr(attributes);
+ if (content) $(el).html(content);
+ return el;
+ },
+
+ // Change the view's element (`this.el` property), including event
+ // re-delegation.
+ setElement: function(element, delegate) {
+ if (this.$el) this.undelegateEvents();
+ this.$el = (element instanceof $) ? element : $(element);
+ this.el = this.$el[0];
+ if (delegate !== false) this.delegateEvents();
+ return this;
+ },
+
+ // Set callbacks, where `this.events` is a hash of
+ //
+ // *{"event selector": "callback"}*
+ //
+ // {
+ // 'mousedown .title': 'edit',
+ // 'click .button': 'save'
+ // 'click .open': function(e) { ... }
+ // }
+ //
+ // pairs. Callbacks will be bound to the view, with `this` set properly.
+ // Uses event delegation for efficiency.
+ // Omitting the selector binds the event to `this.el`.
+ // This only works for delegate-able events: not `focus`, `blur`, and
+ // not `change`, `submit`, and `reset` in Internet Explorer.
+ delegateEvents: function(events) {
+ if (!(events || (events = getValue(this, 'events')))) return;
+ this.undelegateEvents();
+ for (var key in events) {
+ var method = events[key];
+ if (!_.isFunction(method)) method = this[events[key]];
+ if (!method) throw new Error('Method "' + events[key] + '" does not exist');
+ var match = key.match(delegateEventSplitter);
+ var eventName = match[1], selector = match[2];
+ method = _.bind(method, this);
+ eventName += '.delegateEvents' + this.cid;
+ if (selector === '') {
+ this.$el.bind(eventName, method);
+ } else {
+ this.$el.delegate(selector, eventName, method);
+ }
+ }
+ },
+
+ // Clears all callbacks previously bound to the view with `delegateEvents`.
+ // You usually don't need to use this, but may wish to if you have multiple
+ // Backbone views attached to the same DOM element.
+ undelegateEvents: function() {
+ this.$el.unbind('.delegateEvents' + this.cid);
+ },
+
+ // Performs the initial configuration of a View with a set of options.
+ // Keys with special meaning *(model, collection, id, className)*, are
+ // attached directly to the view.
+ _configure: function(options) {
+ if (this.options) options = _.extend({}, this.options, options);
+ for (var i = 0, l = viewOptions.length; i < l; i++) {
+ var attr = viewOptions[i];
+ if (options[attr]) this[attr] = options[attr];
+ }
+ this.options = options;
+ },
+
+ // Ensure that the View has a DOM element to render into.
+ // If `this.el` is a string, pass it through `$()`, take the first
+ // matching element, and re-assign it to `el`. Otherwise, create
+ // an element from the `id`, `className` and `tagName` properties.
+ _ensureElement: function() {
+ if (!this.el) {
+ var attrs = getValue(this, 'attributes') || {};
+ if (this.id) attrs.id = this.id;
+ if (this.className) attrs['class'] = this.className;
+ this.setElement(this.make(this.tagName, attrs), false);
+ } else {
+ this.setElement(this.el, false);
+ }
+ }
+
+ });
+
+ // The self-propagating extend function that Backbone classes use.
+ var extend = function (protoProps, classProps) {
+ var child = inherits(this, protoProps, classProps);
+ child.extend = this.extend;
+ return child;
+ };
+
+ // Set up inheritance for the model, collection, and view.
+ Model.extend = Collection.extend = Router.extend = View.extend = extend;
+
+ // Backbone.sync
+ // -------------
+
+ // Map from CRUD to HTTP for our default `Backbone.sync` implementation.
+ var methodMap = {
+ 'create': 'POST',
+ 'update': 'PUT',
+ 'delete': 'DELETE',
+ 'read': 'GET'
+ };
+
+ // Override this function to change the manner in which Backbone persists
+ // models to the server. You will be passed the type of request, and the
+ // model in question. By default, makes a RESTful Ajax request
+ // to the model's `url()`. Some possible customizations could be:
+ //
+ // * Use `setTimeout` to batch rapid-fire updates into a single request.
+ // * Send up the models as XML instead of JSON.
+ // * Persist models via WebSockets instead of Ajax.
+ //
+ // Turn on `Backbone.emulateHTTP` in order to send `PUT` and `DELETE` requests
+ // as `POST`, with a `_method` parameter containing the true HTTP method,
+ // as well as all requests with the body as `application/x-www-form-urlencoded`
+ // instead of `application/json` with the model in a param named `model`.
+ // Useful when interfacing with server-side languages like **PHP** that make
+ // it difficult to read the body of `PUT` requests.
+ Backbone.sync = function(method, model, options) {
+ var type = methodMap[method];
+
+ // Default options, unless specified.
+ options || (options = {});
+
+ // Default JSON-request options.
+ var params = {type: type, dataType: 'json'};
+
+ // Ensure that we have a URL.
+ if (!options.url) {
+ params.url = getValue(model, 'url') || urlError();
+ }
+
+ // Ensure that we have the appropriate request data.
+ if (!options.data && model && (method == 'create' || method == 'update')) {
+ params.contentType = 'application/json';
+ params.data = JSON.stringify(model.toJSON());
+ }
+
+ // For older servers, emulate JSON by encoding the request into an HTML-form.
+ if (Backbone.emulateJSON) {
+ params.contentType = 'application/x-www-form-urlencoded';
+ params.data = params.data ? {model: params.data} : {};
+ }
+
+ // For older servers, emulate HTTP by mimicking the HTTP method with `_method`
+ // And an `X-HTTP-Method-Override` header.
+ if (Backbone.emulateHTTP) {
+ if (type === 'PUT' || type === 'DELETE') {
+ if (Backbone.emulateJSON) params.data._method = type;
+ params.type = 'POST';
+ params.beforeSend = function(xhr) {
+ xhr.setRequestHeader('X-HTTP-Method-Override', type);
+ };
+ }
+ }
+
+ // Don't process data on a non-GET request.
+ if (params.type !== 'GET' && !Backbone.emulateJSON) {
+ params.processData = false;
+ }
+
+ // Make the request, allowing the user to override any Ajax options.
+ return $.ajax(_.extend(params, options));
+ };
+
+ // Wrap an optional error callback with a fallback error event.
+ Backbone.wrapError = function(onError, originalModel, options) {
+ return function(model, resp) {
+ resp = model === originalModel ? resp : model;
+ if (onError) {
+ onError(originalModel, resp, options);
+ } else {
+ originalModel.trigger('error', originalModel, resp, options);
+ }
+ };
+ };
+
+ // Helpers
+ // -------
+
+ // Shared empty constructor function to aid in prototype-chain creation.
+ var ctor = function(){};
+
+ // Helper function to correctly set up the prototype chain, for subclasses.
+ // Similar to `goog.inherits`, but uses a hash of prototype properties and
+ // class properties to be extended.
+ var inherits = function(parent, protoProps, staticProps) {
+ var child;
+
+ // The constructor function for the new subclass is either defined by you
+ // (the "constructor" property in your `extend` definition), or defaulted
+ // by us to simply call the parent's constructor.
+ if (protoProps && protoProps.hasOwnProperty('constructor')) {
+ child = protoProps.constructor;
+ } else {
+ child = function(){ parent.apply(this, arguments); };
+ }
+
+ // Inherit class (static) properties from parent.
+ _.extend(child, parent);
+
+ // Set the prototype chain to inherit from `parent`, without calling
+ // `parent`'s constructor function.
+ ctor.prototype = parent.prototype;
+ child.prototype = new ctor();
+
+ // Add prototype properties (instance properties) to the subclass,
+ // if supplied.
+ if (protoProps) _.extend(child.prototype, protoProps);
+
+ // Add static properties to the constructor function, if supplied.
+ if (staticProps) _.extend(child, staticProps);
+
+ // Correctly set child's `prototype.constructor`.
+ child.prototype.constructor = child;
+
+ // Set a convenience property in case the parent's prototype is needed later.
+ child.__super__ = parent.prototype;
+
+ return child;
+ };
+
+ // Helper function to get a value from a Backbone object as a property
+ // or as a function.
+ var getValue = function(object, prop) {
+ if (!(object && object[prop])) return null;
+ return _.isFunction(object[prop]) ? object[prop]() : object[prop];
+ };
+
+ // Throw an error when a URL is needed, and none is supplied.
+ var urlError = function() {
+ throw new Error('A "url" property or function must be specified');
+ };
+
+}).call(this); \ No newline at end of file
diff --git a/module/web/static/js/libs/bootstrap-2.1.1.js b/module/web/static/js/libs/bootstrap-2.1.1.js
new file mode 100644
index 000000000..f73fcb8e7
--- /dev/null
+++ b/module/web/static/js/libs/bootstrap-2.1.1.js
@@ -0,0 +1,2027 @@
+/* ===================================================
+ * bootstrap-transition.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#transitions
+ * ===================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ $(function () {
+
+ "use strict"; // jshint ;_;
+
+
+ /* CSS TRANSITION SUPPORT (http://www.modernizr.com/)
+ * ======================================================= */
+
+ $.support.transition = (function () {
+
+ var transitionEnd = (function () {
+
+ var el = document.createElement('bootstrap')
+ , transEndEventNames = {
+ 'WebkitTransition' : 'webkitTransitionEnd'
+ , 'MozTransition' : 'transitionend'
+ , 'OTransition' : 'oTransitionEnd otransitionend'
+ , 'transition' : 'transitionend'
+ }
+ , name
+
+ for (name in transEndEventNames){
+ if (el.style[name] !== undefined) {
+ return transEndEventNames[name]
+ }
+ }
+
+ }())
+
+ return transitionEnd && {
+ end: transitionEnd
+ }
+
+ })()
+
+ })
+
+}(window.jQuery);/* ==========================================================
+ * bootstrap-alert.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#alerts
+ * ==========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* ALERT CLASS DEFINITION
+ * ====================== */
+
+ var dismiss = '[data-dismiss="alert"]'
+ , Alert = function (el) {
+ $(el).on('click', dismiss, this.close)
+ }
+
+ Alert.prototype.close = function (e) {
+ var $this = $(this)
+ , selector = $this.attr('data-target')
+ , $parent
+
+ if (!selector) {
+ selector = $this.attr('href')
+ selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+ }
+
+ $parent = $(selector)
+
+ e && e.preventDefault()
+
+ $parent.length || ($parent = $this.hasClass('alert') ? $this : $this.parent())
+
+ $parent.trigger(e = $.Event('close'))
+
+ if (e.isDefaultPrevented()) return
+
+ $parent.removeClass('in')
+
+ function removeElement() {
+ $parent
+ .trigger('closed')
+ .remove()
+ }
+
+ $.support.transition && $parent.hasClass('fade') ?
+ $parent.on($.support.transition.end, removeElement) :
+ removeElement()
+ }
+
+
+ /* ALERT PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.alert = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('alert')
+ if (!data) $this.data('alert', (data = new Alert(this)))
+ if (typeof option == 'string') data[option].call($this)
+ })
+ }
+
+ $.fn.alert.Constructor = Alert
+
+
+ /* ALERT DATA-API
+ * ============== */
+
+ $(function () {
+ $('body').on('click.alert.data-api', dismiss, Alert.prototype.close)
+ })
+
+}(window.jQuery);/* ============================================================
+ * bootstrap-button.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#buttons
+ * ============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* BUTTON PUBLIC CLASS DEFINITION
+ * ============================== */
+
+ var Button = function (element, options) {
+ this.$element = $(element)
+ this.options = $.extend({}, $.fn.button.defaults, options)
+ }
+
+ Button.prototype.setState = function (state) {
+ var d = 'disabled'
+ , $el = this.$element
+ , data = $el.data()
+ , val = $el.is('input') ? 'val' : 'html'
+
+ state = state + 'Text'
+ data.resetText || $el.data('resetText', $el[val]())
+
+ $el[val](data[state] || this.options[state])
+
+ // push to event loop to allow forms to submit
+ setTimeout(function () {
+ state == 'loadingText' ?
+ $el.addClass(d).attr(d, d) :
+ $el.removeClass(d).removeAttr(d)
+ }, 0)
+ }
+
+ Button.prototype.toggle = function () {
+ var $parent = this.$element.closest('[data-toggle="buttons-radio"]')
+
+ $parent && $parent
+ .find('.active')
+ .removeClass('active')
+
+ this.$element.toggleClass('active')
+ }
+
+
+ /* BUTTON PLUGIN DEFINITION
+ * ======================== */
+
+ $.fn.button = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('button')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('button', (data = new Button(this, options)))
+ if (option == 'toggle') data.toggle()
+ else if (option) data.setState(option)
+ })
+ }
+
+ $.fn.button.defaults = {
+ loadingText: 'loading...'
+ }
+
+ $.fn.button.Constructor = Button
+
+
+ /* BUTTON DATA-API
+ * =============== */
+
+ $(function () {
+ $('body').on('click.button.data-api', '[data-toggle^=button]', function ( e ) {
+ var $btn = $(e.target)
+ if (!$btn.hasClass('btn')) $btn = $btn.closest('.btn')
+ $btn.button('toggle')
+ })
+ })
+
+}(window.jQuery);/* ==========================================================
+ * bootstrap-carousel.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#carousel
+ * ==========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* CAROUSEL CLASS DEFINITION
+ * ========================= */
+
+ var Carousel = function (element, options) {
+ this.$element = $(element)
+ this.options = options
+ this.options.slide && this.slide(this.options.slide)
+ this.options.pause == 'hover' && this.$element
+ .on('mouseenter', $.proxy(this.pause, this))
+ .on('mouseleave', $.proxy(this.cycle, this))
+ }
+
+ Carousel.prototype = {
+
+ cycle: function (e) {
+ if (!e) this.paused = false
+ this.options.interval
+ && !this.paused
+ && (this.interval = setInterval($.proxy(this.next, this), this.options.interval))
+ return this
+ }
+
+ , to: function (pos) {
+ var $active = this.$element.find('.item.active')
+ , children = $active.parent().children()
+ , activePos = children.index($active)
+ , that = this
+
+ if (pos > (children.length - 1) || pos < 0) return
+
+ if (this.sliding) {
+ return this.$element.one('slid', function () {
+ that.to(pos)
+ })
+ }
+
+ if (activePos == pos) {
+ return this.pause().cycle()
+ }
+
+ return this.slide(pos > activePos ? 'next' : 'prev', $(children[pos]))
+ }
+
+ , pause: function (e) {
+ if (!e) this.paused = true
+ if (this.$element.find('.next, .prev').length && $.support.transition.end) {
+ this.$element.trigger($.support.transition.end)
+ this.cycle()
+ }
+ clearInterval(this.interval)
+ this.interval = null
+ return this
+ }
+
+ , next: function () {
+ if (this.sliding) return
+ return this.slide('next')
+ }
+
+ , prev: function () {
+ if (this.sliding) return
+ return this.slide('prev')
+ }
+
+ , slide: function (type, next) {
+ var $active = this.$element.find('.item.active')
+ , $next = next || $active[type]()
+ , isCycling = this.interval
+ , direction = type == 'next' ? 'left' : 'right'
+ , fallback = type == 'next' ? 'first' : 'last'
+ , that = this
+ , e = $.Event('slide', {
+ relatedTarget: $next[0]
+ })
+
+ this.sliding = true
+
+ isCycling && this.pause()
+
+ $next = $next.length ? $next : this.$element.find('.item')[fallback]()
+
+ if ($next.hasClass('active')) return
+
+ if ($.support.transition && this.$element.hasClass('slide')) {
+ this.$element.trigger(e)
+ if (e.isDefaultPrevented()) return
+ $next.addClass(type)
+ $next[0].offsetWidth // force reflow
+ $active.addClass(direction)
+ $next.addClass(direction)
+ this.$element.one($.support.transition.end, function () {
+ $next.removeClass([type, direction].join(' ')).addClass('active')
+ $active.removeClass(['active', direction].join(' '))
+ that.sliding = false
+ setTimeout(function () { that.$element.trigger('slid') }, 0)
+ })
+ } else {
+ this.$element.trigger(e)
+ if (e.isDefaultPrevented()) return
+ $active.removeClass('active')
+ $next.addClass('active')
+ this.sliding = false
+ this.$element.trigger('slid')
+ }
+
+ isCycling && this.cycle()
+
+ return this
+ }
+
+ }
+
+
+ /* CAROUSEL PLUGIN DEFINITION
+ * ========================== */
+
+ $.fn.carousel = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('carousel')
+ , options = $.extend({}, $.fn.carousel.defaults, typeof option == 'object' && option)
+ , action = typeof option == 'string' ? option : options.slide
+ if (!data) $this.data('carousel', (data = new Carousel(this, options)))
+ if (typeof option == 'number') data.to(option)
+ else if (action) data[action]()
+ else if (options.interval) data.cycle()
+ })
+ }
+
+ $.fn.carousel.defaults = {
+ interval: 5000
+ , pause: 'hover'
+ }
+
+ $.fn.carousel.Constructor = Carousel
+
+
+ /* CAROUSEL DATA-API
+ * ================= */
+
+ $(function () {
+ $('body').on('click.carousel.data-api', '[data-slide]', function ( e ) {
+ var $this = $(this), href
+ , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
+ , options = !$target.data('modal') && $.extend({}, $target.data(), $this.data())
+ $target.carousel(options)
+ e.preventDefault()
+ })
+ })
+
+}(window.jQuery);/* =============================================================
+ * bootstrap-collapse.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#collapse
+ * =============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* COLLAPSE PUBLIC CLASS DEFINITION
+ * ================================ */
+
+ var Collapse = function (element, options) {
+ this.$element = $(element)
+ this.options = $.extend({}, $.fn.collapse.defaults, options)
+
+ if (this.options.parent) {
+ this.$parent = $(this.options.parent)
+ }
+
+ this.options.toggle && this.toggle()
+ }
+
+ Collapse.prototype = {
+
+ constructor: Collapse
+
+ , dimension: function () {
+ var hasWidth = this.$element.hasClass('width')
+ return hasWidth ? 'width' : 'height'
+ }
+
+ , show: function () {
+ var dimension
+ , scroll
+ , actives
+ , hasData
+
+ if (this.transitioning) return
+
+ dimension = this.dimension()
+ scroll = $.camelCase(['scroll', dimension].join('-'))
+ actives = this.$parent && this.$parent.find('> .accordion-group > .in')
+
+ if (actives && actives.length) {
+ hasData = actives.data('collapse')
+ if (hasData && hasData.transitioning) return
+ actives.collapse('hide')
+ hasData || actives.data('collapse', null)
+ }
+
+ this.$element[dimension](0)
+ this.transition('addClass', $.Event('show'), 'shown')
+ $.support.transition && this.$element[dimension](this.$element[0][scroll])
+ }
+
+ , hide: function () {
+ var dimension
+ if (this.transitioning) return
+ dimension = this.dimension()
+ this.reset(this.$element[dimension]())
+ this.transition('removeClass', $.Event('hide'), 'hidden')
+ this.$element[dimension](0)
+ }
+
+ , reset: function (size) {
+ var dimension = this.dimension()
+
+ this.$element
+ .removeClass('collapse')
+ [dimension](size || 'auto')
+ [0].offsetWidth
+
+ this.$element[size !== null ? 'addClass' : 'removeClass']('collapse')
+
+ return this
+ }
+
+ , transition: function (method, startEvent, completeEvent) {
+ var that = this
+ , complete = function () {
+ if (startEvent.type == 'show') that.reset()
+ that.transitioning = 0
+ that.$element.trigger(completeEvent)
+ }
+
+ this.$element.trigger(startEvent)
+
+ if (startEvent.isDefaultPrevented()) return
+
+ this.transitioning = 1
+
+ this.$element[method]('in')
+
+ $.support.transition && this.$element.hasClass('collapse') ?
+ this.$element.one($.support.transition.end, complete) :
+ complete()
+ }
+
+ , toggle: function () {
+ this[this.$element.hasClass('in') ? 'hide' : 'show']()
+ }
+
+ }
+
+
+ /* COLLAPSIBLE PLUGIN DEFINITION
+ * ============================== */
+
+ $.fn.collapse = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('collapse')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('collapse', (data = new Collapse(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.collapse.defaults = {
+ toggle: true
+ }
+
+ $.fn.collapse.Constructor = Collapse
+
+
+ /* COLLAPSIBLE DATA-API
+ * ==================== */
+
+ $(function () {
+ $('body').on('click.collapse.data-api', '[data-toggle=collapse]', function (e) {
+ var $this = $(this), href
+ , target = $this.attr('data-target')
+ || e.preventDefault()
+ || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') //strip for ie7
+ , option = $(target).data('collapse') ? 'toggle' : $this.data()
+ $this[$(target).hasClass('in') ? 'addClass' : 'removeClass']('collapsed')
+ $(target).collapse(option)
+ })
+ })
+
+}(window.jQuery);/* ============================================================
+ * bootstrap-dropdown.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#dropdowns
+ * ============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* DROPDOWN CLASS DEFINITION
+ * ========================= */
+
+ var toggle = '[data-toggle=dropdown]'
+ , Dropdown = function (element) {
+ var $el = $(element).on('click.dropdown.data-api', this.toggle)
+ $('html').on('click.dropdown.data-api', function () {
+ $el.parent().removeClass('open')
+ })
+ }
+
+ Dropdown.prototype = {
+
+ constructor: Dropdown
+
+ , toggle: function (e) {
+ var $this = $(this)
+ , $parent
+ , isActive
+
+ if ($this.is('.disabled, :disabled')) return
+
+ $parent = getParent($this)
+
+ isActive = $parent.hasClass('open')
+
+ clearMenus()
+
+ if (!isActive) {
+ $parent.toggleClass('open')
+ $this.focus()
+ }
+
+ return false
+ }
+
+ , keydown: function (e) {
+ var $this
+ , $items
+ , $active
+ , $parent
+ , isActive
+ , index
+
+ if (!/(38|40|27)/.test(e.keyCode)) return
+
+ $this = $(this)
+
+ e.preventDefault()
+ e.stopPropagation()
+
+ if ($this.is('.disabled, :disabled')) return
+
+ $parent = getParent($this)
+
+ isActive = $parent.hasClass('open')
+
+ if (!isActive || (isActive && e.keyCode == 27)) return $this.click()
+
+ $items = $('[role=menu] li:not(.divider) a', $parent)
+
+ if (!$items.length) return
+
+ index = $items.index($items.filter(':focus'))
+
+ if (e.keyCode == 38 && index > 0) index-- // up
+ if (e.keyCode == 40 && index < $items.length - 1) index++ // down
+ if (!~index) index = 0
+
+ $items
+ .eq(index)
+ .focus()
+ }
+
+ }
+
+ function clearMenus() {
+ getParent($(toggle))
+ .removeClass('open')
+ }
+
+ function getParent($this) {
+ var selector = $this.attr('data-target')
+ , $parent
+
+ if (!selector) {
+ selector = $this.attr('href')
+ selector = selector && /#/.test(selector) && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+ }
+
+ $parent = $(selector)
+ $parent.length || ($parent = $this.parent())
+
+ return $parent
+ }
+
+
+ /* DROPDOWN PLUGIN DEFINITION
+ * ========================== */
+
+ $.fn.dropdown = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('dropdown')
+ if (!data) $this.data('dropdown', (data = new Dropdown(this)))
+ if (typeof option == 'string') data[option].call($this)
+ })
+ }
+
+ $.fn.dropdown.Constructor = Dropdown
+
+
+ /* APPLY TO STANDARD DROPDOWN ELEMENTS
+ * =================================== */
+
+ $(function () {
+ $('html')
+ .on('click.dropdown.data-api touchstart.dropdown.data-api', clearMenus)
+ $('body')
+ .on('click.dropdown touchstart.dropdown.data-api', '.dropdown form', function (e) { e.stopPropagation() })
+ .on('click.dropdown.data-api touchstart.dropdown.data-api' , toggle, Dropdown.prototype.toggle)
+ .on('keydown.dropdown.data-api touchstart.dropdown.data-api', toggle + ', [role=menu]' , Dropdown.prototype.keydown)
+ })
+
+}(window.jQuery);/* =========================================================
+ * bootstrap-modal.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#modals
+ * =========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================= */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* MODAL CLASS DEFINITION
+ * ====================== */
+
+ var Modal = function (element, options) {
+ this.options = options
+ this.$element = $(element)
+ .delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this))
+ this.options.remote && this.$element.find('.modal-body').load(this.options.remote)
+ }
+
+ Modal.prototype = {
+
+ constructor: Modal
+
+ , toggle: function () {
+ return this[!this.isShown ? 'show' : 'hide']()
+ }
+
+ , show: function () {
+ var that = this
+ , e = $.Event('show')
+
+ this.$element.trigger(e)
+
+ if (this.isShown || e.isDefaultPrevented()) return
+
+ $('body').addClass('modal-open')
+
+ this.isShown = true
+
+ this.escape()
+
+ this.backdrop(function () {
+ var transition = $.support.transition && that.$element.hasClass('fade')
+
+ if (!that.$element.parent().length) {
+ that.$element.appendTo(document.body) //don't move modals dom position
+ }
+
+ that.$element
+ .show()
+
+ if (transition) {
+ that.$element[0].offsetWidth // force reflow
+ }
+
+ that.$element
+ .addClass('in')
+ .attr('aria-hidden', false)
+ .focus()
+
+ that.enforceFocus()
+
+ transition ?
+ that.$element.one($.support.transition.end, function () { that.$element.trigger('shown') }) :
+ that.$element.trigger('shown')
+
+ })
+ }
+
+ , hide: function (e) {
+ e && e.preventDefault()
+
+ var that = this
+
+ e = $.Event('hide')
+
+ this.$element.trigger(e)
+
+ if (!this.isShown || e.isDefaultPrevented()) return
+
+ this.isShown = false
+
+ $('body').removeClass('modal-open')
+
+ this.escape()
+
+ $(document).off('focusin.modal')
+
+ this.$element
+ .removeClass('in')
+ .attr('aria-hidden', true)
+
+ $.support.transition && this.$element.hasClass('fade') ?
+ this.hideWithTransition() :
+ this.hideModal()
+ }
+
+ , enforceFocus: function () {
+ var that = this
+ $(document).on('focusin.modal', function (e) {
+ if (that.$element[0] !== e.target && !that.$element.has(e.target).length) {
+ that.$element.focus()
+ }
+ })
+ }
+
+ , escape: function () {
+ var that = this
+ if (this.isShown && this.options.keyboard) {
+ this.$element.on('keyup.dismiss.modal', function ( e ) {
+ e.which == 27 && that.hide()
+ })
+ } else if (!this.isShown) {
+ this.$element.off('keyup.dismiss.modal')
+ }
+ }
+
+ , hideWithTransition: function () {
+ var that = this
+ , timeout = setTimeout(function () {
+ that.$element.off($.support.transition.end)
+ that.hideModal()
+ }, 500)
+
+ this.$element.one($.support.transition.end, function () {
+ clearTimeout(timeout)
+ that.hideModal()
+ })
+ }
+
+ , hideModal: function (that) {
+ this.$element
+ .hide()
+ .trigger('hidden')
+
+ this.backdrop()
+ }
+
+ , removeBackdrop: function () {
+ this.$backdrop.remove()
+ this.$backdrop = null
+ }
+
+ , backdrop: function (callback) {
+ var that = this
+ , animate = this.$element.hasClass('fade') ? 'fade' : ''
+
+ if (this.isShown && this.options.backdrop) {
+ var doAnimate = $.support.transition && animate
+
+ this.$backdrop = $('<div class="modal-backdrop ' + animate + '" />')
+ .appendTo(document.body)
+
+ if (this.options.backdrop != 'static') {
+ this.$backdrop.click($.proxy(this.hide, this))
+ }
+
+ if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
+
+ this.$backdrop.addClass('in')
+
+ doAnimate ?
+ this.$backdrop.one($.support.transition.end, callback) :
+ callback()
+
+ } else if (!this.isShown && this.$backdrop) {
+ this.$backdrop.removeClass('in')
+
+ $.support.transition && this.$element.hasClass('fade')?
+ this.$backdrop.one($.support.transition.end, $.proxy(this.removeBackdrop, this)) :
+ this.removeBackdrop()
+
+ } else if (callback) {
+ callback()
+ }
+ }
+ }
+
+
+ /* MODAL PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.modal = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('modal')
+ , options = $.extend({}, $.fn.modal.defaults, $this.data(), typeof option == 'object' && option)
+ if (!data) $this.data('modal', (data = new Modal(this, options)))
+ if (typeof option == 'string') data[option]()
+ else if (options.show) data.show()
+ })
+ }
+
+ $.fn.modal.defaults = {
+ backdrop: true
+ , keyboard: true
+ , show: true
+ }
+
+ $.fn.modal.Constructor = Modal
+
+
+ /* MODAL DATA-API
+ * ============== */
+
+ $(function () {
+ $('body').on('click.modal.data-api', '[data-toggle="modal"]', function ( e ) {
+ var $this = $(this)
+ , href = $this.attr('href')
+ , $target = $($this.attr('data-target') || (href && href.replace(/.*(?=#[^\s]+$)/, ''))) //strip for ie7
+ , option = $target.data('modal') ? 'toggle' : $.extend({ remote: !/#/.test(href) && href }, $target.data(), $this.data())
+
+ e.preventDefault()
+
+ $target
+ .modal(option)
+ .one('hide', function () {
+ $this.focus()
+ })
+ })
+ })
+
+}(window.jQuery);/* ===========================================================
+ * bootstrap-tooltip.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#tooltips
+ * Inspired by the original jQuery.tipsy by Jason Frame
+ * ===========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* TOOLTIP PUBLIC CLASS DEFINITION
+ * =============================== */
+
+ var Tooltip = function (element, options) {
+ this.init('tooltip', element, options)
+ }
+
+ Tooltip.prototype = {
+
+ constructor: Tooltip
+
+ , init: function (type, element, options) {
+ var eventIn
+ , eventOut
+
+ this.type = type
+ this.$element = $(element)
+ this.options = this.getOptions(options)
+ this.enabled = true
+
+ if (this.options.trigger == 'click') {
+ this.$element.on('click.' + this.type, this.options.selector, $.proxy(this.toggle, this))
+ } else if (this.options.trigger != 'manual') {
+ eventIn = this.options.trigger == 'hover' ? 'mouseenter' : 'focus'
+ eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur'
+ this.$element.on(eventIn + '.' + this.type, this.options.selector, $.proxy(this.enter, this))
+ this.$element.on(eventOut + '.' + this.type, this.options.selector, $.proxy(this.leave, this))
+ }
+
+ this.options.selector ?
+ (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
+ this.fixTitle()
+ }
+
+ , getOptions: function (options) {
+ options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data())
+
+ if (options.delay && typeof options.delay == 'number') {
+ options.delay = {
+ show: options.delay
+ , hide: options.delay
+ }
+ }
+
+ return options
+ }
+
+ , enter: function (e) {
+ var self = $(e.currentTarget)[this.type](this._options).data(this.type)
+
+ if (!self.options.delay || !self.options.delay.show) return self.show()
+
+ clearTimeout(this.timeout)
+ self.hoverState = 'in'
+ this.timeout = setTimeout(function() {
+ if (self.hoverState == 'in') self.show()
+ }, self.options.delay.show)
+ }
+
+ , leave: function (e) {
+ var self = $(e.currentTarget)[this.type](this._options).data(this.type)
+
+ if (this.timeout) clearTimeout(this.timeout)
+ if (!self.options.delay || !self.options.delay.hide) return self.hide()
+
+ self.hoverState = 'out'
+ this.timeout = setTimeout(function() {
+ if (self.hoverState == 'out') self.hide()
+ }, self.options.delay.hide)
+ }
+
+ , show: function () {
+ var $tip
+ , inside
+ , pos
+ , actualWidth
+ , actualHeight
+ , placement
+ , tp
+
+ if (this.hasContent() && this.enabled) {
+ $tip = this.tip()
+ this.setContent()
+
+ if (this.options.animation) {
+ $tip.addClass('fade')
+ }
+
+ placement = typeof this.options.placement == 'function' ?
+ this.options.placement.call(this, $tip[0], this.$element[0]) :
+ this.options.placement
+
+ inside = /in/.test(placement)
+
+ $tip
+ .remove()
+ .css({ top: 0, left: 0, display: 'block' })
+ .appendTo(inside ? this.$element : document.body)
+
+ pos = this.getPosition(inside)
+
+ actualWidth = $tip[0].offsetWidth
+ actualHeight = $tip[0].offsetHeight
+
+ switch (inside ? placement.split(' ')[1] : placement) {
+ case 'bottom':
+ tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2}
+ break
+ case 'top':
+ tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2}
+ break
+ case 'left':
+ tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth}
+ break
+ case 'right':
+ tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width}
+ break
+ }
+
+ $tip
+ .css(tp)
+ .addClass(placement)
+ .addClass('in')
+ }
+ }
+
+ , setContent: function () {
+ var $tip = this.tip()
+ , title = this.getTitle()
+
+ $tip.find('.tooltip-inner')[this.options.html ? 'html' : 'text'](title)
+ $tip.removeClass('fade in top bottom left right')
+ }
+
+ , hide: function () {
+ var that = this
+ , $tip = this.tip()
+
+ $tip.removeClass('in')
+
+ function removeWithAnimation() {
+ var timeout = setTimeout(function () {
+ $tip.off($.support.transition.end).remove()
+ }, 500)
+
+ $tip.one($.support.transition.end, function () {
+ clearTimeout(timeout)
+ $tip.remove()
+ })
+ }
+
+ $.support.transition && this.$tip.hasClass('fade') ?
+ removeWithAnimation() :
+ $tip.remove()
+
+ return this
+ }
+
+ , fixTitle: function () {
+ var $e = this.$element
+ if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') {
+ $e.attr('data-original-title', $e.attr('title') || '').removeAttr('title')
+ }
+ }
+
+ , hasContent: function () {
+ return this.getTitle()
+ }
+
+ , getPosition: function (inside) {
+ return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), {
+ width: this.$element[0].offsetWidth
+ , height: this.$element[0].offsetHeight
+ })
+ }
+
+ , getTitle: function () {
+ var title
+ , $e = this.$element
+ , o = this.options
+
+ title = $e.attr('data-original-title')
+ || (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)
+
+ return title
+ }
+
+ , tip: function () {
+ return this.$tip = this.$tip || $(this.options.template)
+ }
+
+ , validate: function () {
+ if (!this.$element[0].parentNode) {
+ this.hide()
+ this.$element = null
+ this.options = null
+ }
+ }
+
+ , enable: function () {
+ this.enabled = true
+ }
+
+ , disable: function () {
+ this.enabled = false
+ }
+
+ , toggleEnabled: function () {
+ this.enabled = !this.enabled
+ }
+
+ , toggle: function () {
+ this[this.tip().hasClass('in') ? 'hide' : 'show']()
+ }
+
+ , destroy: function () {
+ this.hide().$element.off('.' + this.type).removeData(this.type)
+ }
+
+ }
+
+
+ /* TOOLTIP PLUGIN DEFINITION
+ * ========================= */
+
+ $.fn.tooltip = function ( option ) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('tooltip')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('tooltip', (data = new Tooltip(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.tooltip.Constructor = Tooltip
+
+ $.fn.tooltip.defaults = {
+ animation: true
+ , placement: 'top'
+ , selector: false
+ , template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>'
+ , trigger: 'hover'
+ , title: ''
+ , delay: 0
+ , html: true
+ }
+
+}(window.jQuery);
+/* ===========================================================
+ * bootstrap-popover.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#popovers
+ * ===========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * =========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* POPOVER PUBLIC CLASS DEFINITION
+ * =============================== */
+
+ var Popover = function (element, options) {
+ this.init('popover', element, options)
+ }
+
+
+ /* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js
+ ========================================== */
+
+ Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, {
+
+ constructor: Popover
+
+ , setContent: function () {
+ var $tip = this.tip()
+ , title = this.getTitle()
+ , content = this.getContent()
+
+ $tip.find('.popover-title')[this.options.html ? 'html' : 'text'](title)
+ $tip.find('.popover-content > *')[this.options.html ? 'html' : 'text'](content)
+
+ $tip.removeClass('fade top bottom left right in')
+ }
+
+ , hasContent: function () {
+ return this.getTitle() || this.getContent()
+ }
+
+ , getContent: function () {
+ var content
+ , $e = this.$element
+ , o = this.options
+
+ content = $e.attr('data-content')
+ || (typeof o.content == 'function' ? o.content.call($e[0]) : o.content)
+
+ return content
+ }
+
+ , tip: function () {
+ if (!this.$tip) {
+ this.$tip = $(this.options.template)
+ }
+ return this.$tip
+ }
+
+ , destroy: function () {
+ this.hide().$element.off('.' + this.type).removeData(this.type)
+ }
+
+ })
+
+
+ /* POPOVER PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.popover = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('popover')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('popover', (data = new Popover(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.popover.Constructor = Popover
+
+ $.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, {
+ placement: 'right'
+ , trigger: 'click'
+ , content: ''
+ , template: '<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>'
+ })
+
+}(window.jQuery);/* =============================================================
+ * bootstrap-scrollspy.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#scrollspy
+ * =============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* SCROLLSPY CLASS DEFINITION
+ * ========================== */
+
+ function ScrollSpy(element, options) {
+ var process = $.proxy(this.process, this)
+ , $element = $(element).is('body') ? $(window) : $(element)
+ , href
+ this.options = $.extend({}, $.fn.scrollspy.defaults, options)
+ this.$scrollElement = $element.on('scroll.scroll-spy.data-api', process)
+ this.selector = (this.options.target
+ || ((href = $(element).attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
+ || '') + ' .nav li > a'
+ this.$body = $('body')
+ this.refresh()
+ this.process()
+ }
+
+ ScrollSpy.prototype = {
+
+ constructor: ScrollSpy
+
+ , refresh: function () {
+ var self = this
+ , $targets
+
+ this.offsets = $([])
+ this.targets = $([])
+
+ $targets = this.$body
+ .find(this.selector)
+ .map(function () {
+ var $el = $(this)
+ , href = $el.data('target') || $el.attr('href')
+ , $href = /^#\w/.test(href) && $(href)
+ return ( $href
+ && $href.length
+ && [[ $href.position().top, href ]] ) || null
+ })
+ .sort(function (a, b) { return a[0] - b[0] })
+ .each(function () {
+ self.offsets.push(this[0])
+ self.targets.push(this[1])
+ })
+ }
+
+ , process: function () {
+ var scrollTop = this.$scrollElement.scrollTop() + this.options.offset
+ , scrollHeight = this.$scrollElement[0].scrollHeight || this.$body[0].scrollHeight
+ , maxScroll = scrollHeight - this.$scrollElement.height()
+ , offsets = this.offsets
+ , targets = this.targets
+ , activeTarget = this.activeTarget
+ , i
+
+ if (scrollTop >= maxScroll) {
+ return activeTarget != (i = targets.last()[0])
+ && this.activate ( i )
+ }
+
+ for (i = offsets.length; i--;) {
+ activeTarget != targets[i]
+ && scrollTop >= offsets[i]
+ && (!offsets[i + 1] || scrollTop <= offsets[i + 1])
+ && this.activate( targets[i] )
+ }
+ }
+
+ , activate: function (target) {
+ var active
+ , selector
+
+ this.activeTarget = target
+
+ $(this.selector)
+ .parent('.active')
+ .removeClass('active')
+
+ selector = this.selector
+ + '[data-target="' + target + '"],'
+ + this.selector + '[href="' + target + '"]'
+
+ active = $(selector)
+ .parent('li')
+ .addClass('active')
+
+ if (active.parent('.dropdown-menu').length) {
+ active = active.closest('li.dropdown').addClass('active')
+ }
+
+ active.trigger('activate')
+ }
+
+ }
+
+
+ /* SCROLLSPY PLUGIN DEFINITION
+ * =========================== */
+
+ $.fn.scrollspy = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('scrollspy')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('scrollspy', (data = new ScrollSpy(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.scrollspy.Constructor = ScrollSpy
+
+ $.fn.scrollspy.defaults = {
+ offset: 10
+ }
+
+
+ /* SCROLLSPY DATA-API
+ * ================== */
+
+ $(window).on('load', function () {
+ $('[data-spy="scroll"]').each(function () {
+ var $spy = $(this)
+ $spy.scrollspy($spy.data())
+ })
+ })
+
+}(window.jQuery);/* ========================================================
+ * bootstrap-tab.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#tabs
+ * ========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ======================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* TAB CLASS DEFINITION
+ * ==================== */
+
+ var Tab = function (element) {
+ this.element = $(element)
+ }
+
+ Tab.prototype = {
+
+ constructor: Tab
+
+ , show: function () {
+ var $this = this.element
+ , $ul = $this.closest('ul:not(.dropdown-menu)')
+ , selector = $this.attr('data-target')
+ , previous
+ , $target
+ , e
+
+ if (!selector) {
+ selector = $this.attr('href')
+ selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+ }
+
+ if ( $this.parent('li').hasClass('active') ) return
+
+ previous = $ul.find('.active a').last()[0]
+
+ e = $.Event('show', {
+ relatedTarget: previous
+ })
+
+ $this.trigger(e)
+
+ if (e.isDefaultPrevented()) return
+
+ $target = $(selector)
+
+ this.activate($this.parent('li'), $ul)
+ this.activate($target, $target.parent(), function () {
+ $this.trigger({
+ type: 'shown'
+ , relatedTarget: previous
+ })
+ })
+ }
+
+ , activate: function ( element, container, callback) {
+ var $active = container.find('> .active')
+ , transition = callback
+ && $.support.transition
+ && $active.hasClass('fade')
+
+ function next() {
+ $active
+ .removeClass('active')
+ .find('> .dropdown-menu > .active')
+ .removeClass('active')
+
+ element.addClass('active')
+
+ if (transition) {
+ element[0].offsetWidth // reflow for transition
+ element.addClass('in')
+ } else {
+ element.removeClass('fade')
+ }
+
+ if ( element.parent('.dropdown-menu') ) {
+ element.closest('li.dropdown').addClass('active')
+ }
+
+ callback && callback()
+ }
+
+ transition ?
+ $active.one($.support.transition.end, next) :
+ next()
+
+ $active.removeClass('in')
+ }
+ }
+
+
+ /* TAB PLUGIN DEFINITION
+ * ===================== */
+
+ $.fn.tab = function ( option ) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('tab')
+ if (!data) $this.data('tab', (data = new Tab(this)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.tab.Constructor = Tab
+
+
+ /* TAB DATA-API
+ * ============ */
+
+ $(function () {
+ $('body').on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) {
+ e.preventDefault()
+ $(this).tab('show')
+ })
+ })
+
+}(window.jQuery);/* =============================================================
+ * bootstrap-typeahead.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#typeahead
+ * =============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function($){
+
+ "use strict"; // jshint ;_;
+
+
+ /* TYPEAHEAD PUBLIC CLASS DEFINITION
+ * ================================= */
+
+ var Typeahead = function (element, options) {
+ this.$element = $(element)
+ this.options = $.extend({}, $.fn.typeahead.defaults, options)
+ this.matcher = this.options.matcher || this.matcher
+ this.sorter = this.options.sorter || this.sorter
+ this.highlighter = this.options.highlighter || this.highlighter
+ this.updater = this.options.updater || this.updater
+ this.$menu = $(this.options.menu).appendTo('body')
+ this.source = this.options.source
+ this.shown = false
+ this.listen()
+ }
+
+ Typeahead.prototype = {
+
+ constructor: Typeahead
+
+ , select: function () {
+ var val = this.$menu.find('.active').attr('data-value')
+ this.$element
+ .val(this.updater(val))
+ .change()
+ return this.hide()
+ }
+
+ , updater: function (item) {
+ return item
+ }
+
+ , show: function () {
+ var pos = $.extend({}, this.$element.offset(), {
+ height: this.$element[0].offsetHeight
+ })
+
+ this.$menu.css({
+ top: pos.top + pos.height
+ , left: pos.left
+ })
+
+ this.$menu.show()
+ this.shown = true
+ return this
+ }
+
+ , hide: function () {
+ this.$menu.hide()
+ this.shown = false
+ return this
+ }
+
+ , lookup: function (event) {
+ var items
+
+ this.query = this.$element.val()
+
+ if (!this.query || this.query.length < this.options.minLength) {
+ return this.shown ? this.hide() : this
+ }
+
+ items = $.isFunction(this.source) ? this.source(this.query, $.proxy(this.process, this)) : this.source
+
+ return items ? this.process(items) : this
+ }
+
+ , process: function (items) {
+ var that = this
+
+ items = $.grep(items, function (item) {
+ return that.matcher(item)
+ })
+
+ items = this.sorter(items)
+
+ if (!items.length) {
+ return this.shown ? this.hide() : this
+ }
+
+ return this.render(items.slice(0, this.options.items)).show()
+ }
+
+ , matcher: function (item) {
+ return ~item.toLowerCase().indexOf(this.query.toLowerCase())
+ }
+
+ , sorter: function (items) {
+ var beginswith = []
+ , caseSensitive = []
+ , caseInsensitive = []
+ , item
+
+ while (item = items.shift()) {
+ if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item)
+ else if (~item.indexOf(this.query)) caseSensitive.push(item)
+ else caseInsensitive.push(item)
+ }
+
+ return beginswith.concat(caseSensitive, caseInsensitive)
+ }
+
+ , highlighter: function (item) {
+ var query = this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&')
+ return item.replace(new RegExp('(' + query + ')', 'ig'), function ($1, match) {
+ return '<strong>' + match + '</strong>'
+ })
+ }
+
+ , render: function (items) {
+ var that = this
+
+ items = $(items).map(function (i, item) {
+ i = $(that.options.item).attr('data-value', item)
+ i.find('a').html(that.highlighter(item))
+ return i[0]
+ })
+
+ items.first().addClass('active')
+ this.$menu.html(items)
+ return this
+ }
+
+ , next: function (event) {
+ var active = this.$menu.find('.active').removeClass('active')
+ , next = active.next()
+
+ if (!next.length) {
+ next = $(this.$menu.find('li')[0])
+ }
+
+ next.addClass('active')
+ }
+
+ , prev: function (event) {
+ var active = this.$menu.find('.active').removeClass('active')
+ , prev = active.prev()
+
+ if (!prev.length) {
+ prev = this.$menu.find('li').last()
+ }
+
+ prev.addClass('active')
+ }
+
+ , listen: function () {
+ this.$element
+ .on('blur', $.proxy(this.blur, this))
+ .on('keypress', $.proxy(this.keypress, this))
+ .on('keyup', $.proxy(this.keyup, this))
+
+ if ($.browser.chrome || $.browser.webkit || $.browser.msie) {
+ this.$element.on('keydown', $.proxy(this.keydown, this))
+ }
+
+ this.$menu
+ .on('click', $.proxy(this.click, this))
+ .on('mouseenter', 'li', $.proxy(this.mouseenter, this))
+ }
+
+ , move: function (e) {
+ if (!this.shown) return
+
+ switch(e.keyCode) {
+ case 9: // tab
+ case 13: // enter
+ case 27: // escape
+ e.preventDefault()
+ break
+
+ case 38: // up arrow
+ e.preventDefault()
+ this.prev()
+ break
+
+ case 40: // down arrow
+ e.preventDefault()
+ this.next()
+ break
+ }
+
+ e.stopPropagation()
+ }
+
+ , keydown: function (e) {
+ this.suppressKeyPressRepeat = !~$.inArray(e.keyCode, [40,38,9,13,27])
+ this.move(e)
+ }
+
+ , keypress: function (e) {
+ if (this.suppressKeyPressRepeat) return
+ this.move(e)
+ }
+
+ , keyup: function (e) {
+ switch(e.keyCode) {
+ case 40: // down arrow
+ case 38: // up arrow
+ break
+
+ case 9: // tab
+ case 13: // enter
+ if (!this.shown) return
+ this.select()
+ break
+
+ case 27: // escape
+ if (!this.shown) return
+ this.hide()
+ break
+
+ default:
+ this.lookup()
+ }
+
+ e.stopPropagation()
+ e.preventDefault()
+ }
+
+ , blur: function (e) {
+ var that = this
+ setTimeout(function () { that.hide() }, 150)
+ }
+
+ , click: function (e) {
+ e.stopPropagation()
+ e.preventDefault()
+ this.select()
+ }
+
+ , mouseenter: function (e) {
+ this.$menu.find('.active').removeClass('active')
+ $(e.currentTarget).addClass('active')
+ }
+
+ }
+
+
+ /* TYPEAHEAD PLUGIN DEFINITION
+ * =========================== */
+
+ $.fn.typeahead = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('typeahead')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('typeahead', (data = new Typeahead(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.typeahead.defaults = {
+ source: []
+ , items: 8
+ , menu: '<ul class="typeahead dropdown-menu"></ul>'
+ , item: '<li><a href="#"></a></li>'
+ , minLength: 1
+ }
+
+ $.fn.typeahead.Constructor = Typeahead
+
+
+ /* TYPEAHEAD DATA-API
+ * ================== */
+
+ $(function () {
+ $('body').on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) {
+ var $this = $(this)
+ if ($this.data('typeahead')) return
+ e.preventDefault()
+ $this.typeahead($this.data())
+ })
+ })
+
+}(window.jQuery);
+/* ==========================================================
+ * bootstrap-affix.js v2.1.1
+ * http://twitter.github.com/bootstrap/javascript.html#affix
+ * ==========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* AFFIX CLASS DEFINITION
+ * ====================== */
+
+ var Affix = function (element, options) {
+ this.options = $.extend({}, $.fn.affix.defaults, options)
+ this.$window = $(window).on('scroll.affix.data-api', $.proxy(this.checkPosition, this))
+ this.$element = $(element)
+ this.checkPosition()
+ }
+
+ Affix.prototype.checkPosition = function () {
+ if (!this.$element.is(':visible')) return
+
+ var scrollHeight = $(document).height()
+ , scrollTop = this.$window.scrollTop()
+ , position = this.$element.offset()
+ , offset = this.options.offset
+ , offsetBottom = offset.bottom
+ , offsetTop = offset.top
+ , reset = 'affix affix-top affix-bottom'
+ , affix
+
+ if (typeof offset != 'object') offsetBottom = offsetTop = offset
+ if (typeof offsetTop == 'function') offsetTop = offset.top()
+ if (typeof offsetBottom == 'function') offsetBottom = offset.bottom()
+
+ affix = this.unpin != null && (scrollTop + this.unpin <= position.top) ?
+ false : offsetBottom != null && (position.top + this.$element.height() >= scrollHeight - offsetBottom) ?
+ 'bottom' : offsetTop != null && scrollTop <= offsetTop ?
+ 'top' : false
+
+ if (this.affixed === affix) return
+
+ this.affixed = affix
+ this.unpin = affix == 'bottom' ? position.top - scrollTop : null
+
+ this.$element.removeClass(reset).addClass('affix' + (affix ? '-' + affix : ''))
+ }
+
+
+ /* AFFIX PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.affix = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('affix')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('affix', (data = new Affix(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.affix.Constructor = Affix
+
+ $.fn.affix.defaults = {
+ offset: 0
+ }
+
+
+ /* AFFIX DATA-API
+ * ============== */
+
+ $(window).on('load', function () {
+ $('[data-spy="affix"]').each(function () {
+ var $spy = $(this)
+ , data = $spy.data()
+
+ data.offset = data.offset || {}
+
+ data.offsetBottom && (data.offset.bottom = data.offsetBottom)
+ data.offsetTop && (data.offset.top = data.offsetTop)
+
+ $spy.affix(data)
+ })
+ })
+
+
+}(window.jQuery); \ No newline at end of file
diff --git a/module/web/static/js/libs/jquery-1.8.0.js b/module/web/static/js/libs/jquery-1.8.0.js
new file mode 100644
index 000000000..43991b385
--- /dev/null
+++ b/module/web/static/js/libs/jquery-1.8.0.js
@@ -0,0 +1,9227 @@
+/*!
+ * jQuery JavaScript Library v1.8.0
+ * http://jquery.com/
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ *
+ * Copyright 2012 jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: Thu Aug 09 2012 16:24:48 GMT-0400 (Eastern Daylight Time)
+ */
+(function( window, undefined ) {
+var
+ // A central reference to the root jQuery(document)
+ rootjQuery,
+
+ // The deferred used on DOM ready
+ readyList,
+
+ // Use the correct document accordingly with window argument (sandbox)
+ document = window.document,
+ location = window.location,
+ navigator = window.navigator,
+
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ // Save a reference to some core methods
+ core_push = Array.prototype.push,
+ core_slice = Array.prototype.slice,
+ core_indexOf = Array.prototype.indexOf,
+ core_toString = Object.prototype.toString,
+ core_hasOwn = Object.prototype.hasOwnProperty,
+ core_trim = String.prototype.trim,
+
+ // Define a local copy of jQuery
+ jQuery = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context, rootjQuery );
+ },
+
+ // Used for matching numbers
+ core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source,
+
+ // Used for detecting and trimming whitespace
+ core_rnotwhite = /\S/,
+ core_rspace = /\s+/,
+
+ // IE doesn't match non-breaking spaces with \s
+ rtrim = core_rnotwhite.test("\xA0") ? (/^[\s\xA0]+|[\s\xA0]+$/g) : /^\s+|\s+$/g,
+
+ // A simple way to check for HTML strings
+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+ rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,
+
+ // Match a standalone tag
+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/,
+
+ // JSON RegExp
+ rvalidchars = /^[\],:{}\s]*$/,
+ rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+ rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,
+ rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,
+
+ // Matches dashed string for camelizing
+ rmsPrefix = /^-ms-/,
+ rdashAlpha = /-([\da-z])/gi,
+
+ // Used by jQuery.camelCase as callback to replace()
+ fcamelCase = function( all, letter ) {
+ return ( letter + "" ).toUpperCase();
+ },
+
+ // The ready event handler and self cleanup method
+ DOMContentLoaded = function() {
+ if ( document.addEventListener ) {
+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ jQuery.ready();
+ } else if ( document.readyState === "complete" ) {
+ // we're here because readyState === "complete" in oldIE
+ // which is good enough for us to call the dom ready!
+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
+ jQuery.ready();
+ }
+ },
+
+ // [[Class]] -> type pairs
+ class2type = {};
+
+jQuery.fn = jQuery.prototype = {
+ constructor: jQuery,
+ init: function( selector, context, rootjQuery ) {
+ var match, elem, ret, doc;
+
+ // Handle $(""), $(null), $(undefined), $(false)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Handle $(DOMElement)
+ if ( selector.nodeType ) {
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+ }
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = rquickExpr.exec( selector );
+ }
+
+ // Match html or make sure no context is specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] ) {
+ context = context instanceof jQuery ? context[0] : context;
+ doc = ( context && context.nodeType ? context.ownerDocument || context : document );
+
+ // scripts is true for back-compat
+ selector = jQuery.parseHTML( match[1], doc, true );
+ if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {
+ this.attr.call( selector, context, true );
+ }
+
+ return jQuery.merge( this, selector );
+
+ // HANDLE: $(#id)
+ } else {
+ elem = document.getElementById( match[2] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id !== match[2] ) {
+ return rootjQuery.find( selector );
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return ( context || rootjQuery ).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) ) {
+ return rootjQuery.ready( selector );
+ }
+
+ if ( selector.selector !== undefined ) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return jQuery.makeArray( selector, this );
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The current version of jQuery being used
+ jquery: "1.8.0",
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ // The number of elements contained in the matched element set
+ size: function() {
+ return this.length;
+ },
+
+ toArray: function() {
+ return core_slice.call( this );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num == null ?
+
+ // Return a 'clean' array
+ this.toArray() :
+
+ // Return just the object
+ ( num < 0 ? this[ this.length + num ] : this[ num ] );
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems, name, selector ) {
+
+ // Build a new jQuery matched element set
+ var ret = jQuery.merge( this.constructor(), elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ ret.context = this.context;
+
+ if ( name === "find" ) {
+ ret.selector = this.selector + ( this.selector ? " " : "" ) + selector;
+ } else if ( name ) {
+ ret.selector = this.selector + "." + name + "(" + selector + ")";
+ }
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ ready: function( fn ) {
+ // Add the callback
+ jQuery.ready.promise().done( fn );
+
+ return this;
+ },
+
+ eq: function( i ) {
+ i = +i;
+ return i === -1 ?
+ this.slice( i ) :
+ this.slice( i, i + 1 );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ slice: function() {
+ return this.pushStack( core_slice.apply( this, arguments ),
+ "slice", core_slice.call(arguments).join(",") );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor(null);
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: core_push,
+ sort: [].sort,
+ splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+ target = {};
+ }
+
+ // extend jQuery itself if only one argument is passed
+ if ( length === i ) {
+ target = this;
+ --i;
+ }
+
+ for ( ; i < length; i++ ) {
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null ) {
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend({
+ noConflict: function( deep ) {
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
+
+ if ( deep && window.jQuery === jQuery ) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+ },
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+ },
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+
+ // Abort if there are pending holds or we're already ready
+ if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+ return;
+ }
+
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( jQuery.ready, 1 );
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+
+ // Trigger any bound ready events
+ if ( jQuery.fn.trigger ) {
+ jQuery( document ).trigger("ready").off("ready");
+ }
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function( obj ) {
+ return jQuery.type(obj) === "array";
+ },
+
+ isWindow: function( obj ) {
+ return obj != null && obj == obj.window;
+ },
+
+ isNumeric: function( obj ) {
+ return !isNaN( parseFloat(obj) ) && isFinite( obj );
+ },
+
+ type: function( obj ) {
+ return obj == null ?
+ String( obj ) :
+ class2type[ core_toString.call(obj) ] || "object";
+ },
+
+ isPlainObject: function( obj ) {
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ try {
+ // Not own constructor property must be Object
+ if ( obj.constructor &&
+ !core_hasOwn.call(obj, "constructor") &&
+ !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ return false;
+ }
+ } catch ( e ) {
+ // IE8,9 Will throw exceptions on certain host objects #9897
+ return false;
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+
+ var key;
+ for ( key in obj ) {}
+
+ return key === undefined || core_hasOwn.call( obj, key );
+ },
+
+ isEmptyObject: function( obj ) {
+ var name;
+ for ( name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ error: function( msg ) {
+ throw new Error( msg );
+ },
+
+ // data: string of html
+ // context (optional): If specified, the fragment will be created in this context, defaults to document
+ // scripts (optional): If true, will include scripts passed in the html string
+ parseHTML: function( data, context, scripts ) {
+ var parsed;
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+ if ( typeof context === "boolean" ) {
+ scripts = context;
+ context = 0;
+ }
+ context = context || document;
+
+ // Single tag
+ if ( (parsed = rsingleTag.exec( data )) ) {
+ return [ context.createElement( parsed[1] ) ];
+ }
+
+ parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] );
+ return jQuery.merge( [],
+ (parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes );
+ },
+
+ parseJSON: function( data ) {
+ if ( !data || typeof data !== "string") {
+ return null;
+ }
+
+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
+ data = jQuery.trim( data );
+
+ // Attempt to parse using the native JSON parser first
+ if ( window.JSON && window.JSON.parse ) {
+ return window.JSON.parse( data );
+ }
+
+ // Make sure the incoming data is actual JSON
+ // Logic borrowed from http://json.org/json2.js
+ if ( rvalidchars.test( data.replace( rvalidescape, "@" )
+ .replace( rvalidtokens, "]" )
+ .replace( rvalidbraces, "")) ) {
+
+ return ( new Function( "return " + data ) )();
+
+ }
+ jQuery.error( "Invalid JSON: " + data );
+ },
+
+ // Cross-browser xml parsing
+ parseXML: function( data ) {
+ var xml, tmp;
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+ try {
+ if ( window.DOMParser ) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString( data , "text/xml" );
+ } else { // IE
+ xml = new ActiveXObject( "Microsoft.XMLDOM" );
+ xml.async = "false";
+ xml.loadXML( data );
+ }
+ } catch( e ) {
+ xml = undefined;
+ }
+ if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+ return xml;
+ },
+
+ noop: function() {},
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function( data ) {
+ if ( data && core_rnotwhite.test( data ) ) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function( data ) {
+ window[ "eval" ].call( window, data );
+ } )( data );
+ }
+ },
+
+ // Convert dashed to camelCase; used by the css and data modules
+ // Microsoft forgot to hump their vendor prefix (#9572)
+ camelCase: function( string ) {
+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+ },
+
+ // args is for internal usage only
+ each: function( obj, callback, args ) {
+ var name,
+ i = 0,
+ length = obj.length,
+ isObj = length === undefined || jQuery.isFunction( obj );
+
+ if ( args ) {
+ if ( isObj ) {
+ for ( name in obj ) {
+ if ( callback.apply( obj[ name ], args ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.apply( obj[ i++ ], args ) === false ) {
+ break;
+ }
+ }
+ }
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( isObj ) {
+ for ( name in obj ) {
+ if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) {
+ break;
+ }
+ }
+ }
+ }
+
+ return obj;
+ },
+
+ // Use native String.trim function wherever possible
+ trim: core_trim ?
+ function( text ) {
+ return text == null ?
+ "" :
+ core_trim.call( text );
+ } :
+
+ // Otherwise use our own trimming functionality
+ function( text ) {
+ return text == null ?
+ "" :
+ text.toString().replace( rtrim, "" );
+ },
+
+ // results is for internal usage only
+ makeArray: function( arr, results ) {
+ var type,
+ ret = results || [];
+
+ if ( arr != null ) {
+ // The window, strings (and functions) also have 'length'
+ // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
+ type = jQuery.type( arr );
+
+ if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) {
+ core_push.call( ret, arr );
+ } else {
+ jQuery.merge( ret, arr );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, arr, i ) {
+ var len;
+
+ if ( arr ) {
+ if ( core_indexOf ) {
+ return core_indexOf.call( arr, elem, i );
+ }
+
+ len = arr.length;
+ i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;
+
+ for ( ; i < len; i++ ) {
+ // Skip accessing in sparse arrays
+ if ( i in arr && arr[ i ] === elem ) {
+ return i;
+ }
+ }
+ }
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ var l = second.length,
+ i = first.length,
+ j = 0;
+
+ if ( typeof l === "number" ) {
+ for ( ; j < l; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+
+ } else {
+ while ( second[j] !== undefined ) {
+ first[ i++ ] = second[ j++ ];
+ }
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, inv ) {
+ var retVal,
+ ret = [],
+ i = 0,
+ length = elems.length;
+ inv = !!inv;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( ; i < length; i++ ) {
+ retVal = !!callback( elems[ i ], i );
+ if ( inv !== retVal ) {
+ ret.push( elems[ i ] );
+ }
+ }
+
+ return ret;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var value, key,
+ ret = [],
+ i = 0,
+ length = elems.length,
+ // jquery objects are treated as arrays
+ isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ;
+
+ // Go through the array, translating each of the items to their
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( key in elems ) {
+ value = callback( elems[ key ], key, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return ret.concat.apply( [], ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function( fn, context ) {
+ var tmp, args, proxy;
+
+ if ( typeof context === "string" ) {
+ tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !jQuery.isFunction( fn ) ) {
+ return undefined;
+ }
+
+ // Simulated bind
+ args = core_slice.call( arguments, 2 );
+ proxy = function() {
+ return fn.apply( context, args.concat( core_slice.call( arguments ) ) );
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+
+ return proxy;
+ },
+
+ // Multifunctional method to get and set values of a collection
+ // The value/s can optionally be executed if it's a function
+ access: function( elems, fn, key, value, chainable, emptyGet, pass ) {
+ var exec,
+ bulk = key == null,
+ i = 0,
+ length = elems.length;
+
+ // Sets many values
+ if ( key && typeof key === "object" ) {
+ for ( i in key ) {
+ jQuery.access( elems, fn, i, key[i], 1, emptyGet, value );
+ }
+ chainable = 1;
+
+ // Sets one value
+ } else if ( value !== undefined ) {
+ // Optionally, function values get executed if exec is true
+ exec = pass === undefined && jQuery.isFunction( value );
+
+ if ( bulk ) {
+ // Bulk operations only iterate when executing function values
+ if ( exec ) {
+ exec = fn;
+ fn = function( elem, key, value ) {
+ return exec.call( jQuery( elem ), value );
+ };
+
+ // Otherwise they run against the entire set
+ } else {
+ fn.call( elems, value );
+ fn = null;
+ }
+ }
+
+ if ( fn ) {
+ for (; i < length; i++ ) {
+ fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+ }
+ }
+
+ chainable = 1;
+ }
+
+ return chainable ?
+ elems :
+
+ // Gets
+ bulk ?
+ fn.call( elems ) :
+ length ? fn( elems[0], key ) : emptyGet;
+ },
+
+ now: function() {
+ return ( new Date() ).getTime();
+ }
+});
+
+jQuery.ready.promise = function( obj ) {
+ if ( !readyList ) {
+
+ readyList = jQuery.Deferred();
+
+ // Catch cases where $(document).ready() is called after the
+ // browser event has already occurred.
+ if ( document.readyState === "complete" || ( document.readyState !== "loading" && document.addEventListener ) ) {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ setTimeout( jQuery.ready, 1 );
+
+ // Standards-based browsers support DOMContentLoaded
+ } else if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", jQuery.ready, false );
+
+ // If IE event model is used
+ } else {
+ // Ensure firing before onload, maybe late but safe also for iframes
+ document.attachEvent( "onreadystatechange", DOMContentLoaded );
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", jQuery.ready );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var top = false;
+
+ try {
+ top = window.frameElement == null && document.documentElement;
+ } catch(e) {}
+
+ if ( top && top.doScroll ) {
+ (function doScrollCheck() {
+ if ( !jQuery.isReady ) {
+
+ try {
+ // Use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ top.doScroll("left");
+ } catch(e) {
+ return setTimeout( doScrollCheck, 50 );
+ }
+
+ // and execute any waiting functions
+ jQuery.ready();
+ }
+ })();
+ }
+ }
+ }
+ return readyList.promise( obj );
+};
+
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+// String to Object options format cache
+var optionsCache = {};
+
+// Convert String-formatted options into Object-formatted ones and store in cache
+function createOptions( options ) {
+ var object = optionsCache[ options ] = {};
+ jQuery.each( options.split( core_rspace ), function( _, flag ) {
+ object[ flag ] = true;
+ });
+ return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ * options: an optional list of space-separated options that will change how
+ * the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+ // Convert options from String-formatted to Object-formatted if needed
+ // (we check in cache first)
+ options = typeof options === "string" ?
+ ( optionsCache[ options ] || createOptions( options ) ) :
+ jQuery.extend( {}, options );
+
+ var // Last fire value (for non-forgettable lists)
+ memory,
+ // Flag to know if list was already fired
+ fired,
+ // Flag to know if list is currently firing
+ firing,
+ // First callback to fire (used internally by add and fireWith)
+ firingStart,
+ // End of the loop when firing
+ firingLength,
+ // Index of currently firing callback (modified by remove if needed)
+ firingIndex,
+ // Actual callback list
+ list = [],
+ // Stack of fire calls for repeatable lists
+ stack = !options.once && [],
+ // Fire callbacks
+ fire = function( data ) {
+ memory = options.memory && data;
+ fired = true;
+ firingIndex = firingStart || 0;
+ firingStart = 0;
+ firingLength = list.length;
+ firing = true;
+ for ( ; list && firingIndex < firingLength; firingIndex++ ) {
+ if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {
+ memory = false; // To prevent further calls using add
+ break;
+ }
+ }
+ firing = false;
+ if ( list ) {
+ if ( stack ) {
+ if ( stack.length ) {
+ fire( stack.shift() );
+ }
+ } else if ( memory ) {
+ list = [];
+ } else {
+ self.disable();
+ }
+ }
+ },
+ // Actual Callbacks object
+ self = {
+ // Add a callback or a collection of callbacks to the list
+ add: function() {
+ if ( list ) {
+ // First, we save the current length
+ var start = list.length;
+ (function add( args ) {
+ jQuery.each( args, function( _, arg ) {
+ if ( jQuery.isFunction( arg ) && ( !options.unique || !self.has( arg ) ) ) {
+ list.push( arg );
+ } else if ( arg && arg.length ) {
+ // Inspect recursively
+ add( arg );
+ }
+ });
+ })( arguments );
+ // Do we need to add the callbacks to the
+ // current firing batch?
+ if ( firing ) {
+ firingLength = list.length;
+ // With memory, if we're not firing then
+ // we should call right away
+ } else if ( memory ) {
+ firingStart = start;
+ fire( memory );
+ }
+ }
+ return this;
+ },
+ // Remove a callback from the list
+ remove: function() {
+ if ( list ) {
+ jQuery.each( arguments, function( _, arg ) {
+ var index;
+ while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+ list.splice( index, 1 );
+ // Handle firing indexes
+ if ( firing ) {
+ if ( index <= firingLength ) {
+ firingLength--;
+ }
+ if ( index <= firingIndex ) {
+ firingIndex--;
+ }
+ }
+ }
+ });
+ }
+ return this;
+ },
+ // Control if a given callback is in the list
+ has: function( fn ) {
+ return jQuery.inArray( fn, list ) > -1;
+ },
+ // Remove all callbacks from the list
+ empty: function() {
+ list = [];
+ return this;
+ },
+ // Have the list do nothing anymore
+ disable: function() {
+ list = stack = memory = undefined;
+ return this;
+ },
+ // Is it disabled?
+ disabled: function() {
+ return !list;
+ },
+ // Lock the list in its current state
+ lock: function() {
+ stack = undefined;
+ if ( !memory ) {
+ self.disable();
+ }
+ return this;
+ },
+ // Is it locked?
+ locked: function() {
+ return !stack;
+ },
+ // Call all callbacks with the given context and arguments
+ fireWith: function( context, args ) {
+ args = args || [];
+ args = [ context, args.slice ? args.slice() : args ];
+ if ( list && ( !fired || stack ) ) {
+ if ( firing ) {
+ stack.push( args );
+ } else {
+ fire( args );
+ }
+ }
+ return this;
+ },
+ // Call all the callbacks with the given arguments
+ fire: function() {
+ self.fireWith( this, arguments );
+ return this;
+ },
+ // To know if the callbacks have already been called at least once
+ fired: function() {
+ return !!fired;
+ }
+ };
+
+ return self;
+};
+jQuery.extend({
+
+ Deferred: function( func ) {
+ var tuples = [
+ // action, add listener, listener list, final state
+ [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ],
+ [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ],
+ [ "notify", "progress", jQuery.Callbacks("memory") ]
+ ],
+ state = "pending",
+ promise = {
+ state: function() {
+ return state;
+ },
+ always: function() {
+ deferred.done( arguments ).fail( arguments );
+ return this;
+ },
+ then: function( /* fnDone, fnFail, fnProgress */ ) {
+ var fns = arguments;
+ return jQuery.Deferred(function( newDefer ) {
+ jQuery.each( tuples, function( i, tuple ) {
+ var action = tuple[ 0 ],
+ fn = fns[ i ];
+ // deferred[ done | fail | progress ] for forwarding actions to newDefer
+ deferred[ tuple[1] ]( jQuery.isFunction( fn ) ?
+ function() {
+ var returned = fn.apply( this, arguments );
+ if ( returned && jQuery.isFunction( returned.promise ) ) {
+ returned.promise()
+ .done( newDefer.resolve )
+ .fail( newDefer.reject )
+ .progress( newDefer.notify );
+ } else {
+ newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] );
+ }
+ } :
+ newDefer[ action ]
+ );
+ });
+ fns = null;
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ return typeof obj === "object" ? jQuery.extend( obj, promise ) : promise;
+ }
+ },
+ deferred = {};
+
+ // Keep pipe for back-compat
+ promise.pipe = promise.then;
+
+ // Add list-specific methods
+ jQuery.each( tuples, function( i, tuple ) {
+ var list = tuple[ 2 ],
+ stateString = tuple[ 3 ];
+
+ // promise[ done | fail | progress ] = list.add
+ promise[ tuple[1] ] = list.add;
+
+ // Handle state
+ if ( stateString ) {
+ list.add(function() {
+ // state = [ resolved | rejected ]
+ state = stateString;
+
+ // [ reject_list | resolve_list ].disable; progress_list.lock
+ }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );
+ }
+
+ // deferred[ resolve | reject | notify ] = list.fire
+ deferred[ tuple[0] ] = list.fire;
+ deferred[ tuple[0] + "With" ] = list.fireWith;
+ });
+
+ // Make the deferred a promise
+ promise.promise( deferred );
+
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( subordinate /* , ..., subordinateN */ ) {
+ var i = 0,
+ resolveValues = core_slice.call( arguments ),
+ length = resolveValues.length,
+
+ // the count of uncompleted subordinates
+ remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,
+
+ // the master Deferred. If resolveValues consist of only a single Deferred, just use that.
+ deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
+
+ // Update function for both resolve and progress values
+ updateFunc = function( i, contexts, values ) {
+ return function( value ) {
+ contexts[ i ] = this;
+ values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value;
+ if( values === progressValues ) {
+ deferred.notifyWith( contexts, values );
+ } else if ( !( --remaining ) ) {
+ deferred.resolveWith( contexts, values );
+ }
+ };
+ },
+
+ progressValues, progressContexts, resolveContexts;
+
+ // add listeners to Deferred subordinates; treat others as resolved
+ if ( length > 1 ) {
+ progressValues = new Array( length );
+ progressContexts = new Array( length );
+ resolveContexts = new Array( length );
+ for ( ; i < length; i++ ) {
+ if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {
+ resolveValues[ i ].promise()
+ .done( updateFunc( i, resolveContexts, resolveValues ) )
+ .fail( deferred.reject )
+ .progress( updateFunc( i, progressContexts, progressValues ) );
+ } else {
+ --remaining;
+ }
+ }
+ }
+
+ // if we're not waiting on anything, resolve the master
+ if ( !remaining ) {
+ deferred.resolveWith( resolveContexts, resolveValues );
+ }
+
+ return deferred.promise();
+ }
+});
+jQuery.support = (function() {
+
+ var support,
+ all,
+ a,
+ select,
+ opt,
+ input,
+ fragment,
+ eventName,
+ i,
+ isSupported,
+ clickFn,
+ div = document.createElement("div");
+
+ // Preliminary tests
+ div.setAttribute( "className", "t" );
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+
+ all = div.getElementsByTagName("*");
+ a = div.getElementsByTagName("a")[ 0 ];
+ a.style.cssText = "top:1px;float:left;opacity:.5";
+
+ // Can't get basic test support
+ if ( !all || !all.length || !a ) {
+ return {};
+ }
+
+ // First batch of supports tests
+ select = document.createElement("select");
+ opt = select.appendChild( document.createElement("option") );
+ input = div.getElementsByTagName("input")[ 0 ];
+
+ support = {
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: ( div.firstChild.nodeType === 3 ),
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName("tbody").length,
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName("link").length,
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText instead)
+ style: /top/.test( a.getAttribute("style") ),
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: ( a.getAttribute("href") === "/a" ),
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ opacity: /^0.5/.test( a.style.opacity ),
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
+
+ // Make sure that if no value is specified for a checkbox
+ // that it defaults to "on".
+ // (WebKit defaults to "" instead)
+ checkOn: ( input.value === "on" ),
+
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ optSelected: opt.selected,
+
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ getSetAttribute: div.className !== "t",
+
+ // Tests for enctype support on a form(#6743)
+ enctype: !!document.createElement("form").enctype,
+
+ // Makes sure cloning an html5 element does not cause problems
+ // Where outerHTML is undefined, this still works
+ html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>",
+
+ // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode
+ boxModel: ( document.compatMode === "CSS1Compat" ),
+
+ // Will be defined later
+ submitBubbles: true,
+ changeBubbles: true,
+ focusinBubbles: false,
+ deleteExpando: true,
+ noCloneEvent: true,
+ inlineBlockNeedsLayout: false,
+ shrinkWrapBlocks: false,
+ reliableMarginRight: true,
+ boxSizingReliable: true,
+ pixelPosition: false
+ };
+
+ // Make sure checked status is properly cloned
+ input.checked = true;
+ support.noCloneChecked = input.cloneNode( true ).checked;
+
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
+
+ // Test to see if it's possible to delete an expando from an element
+ // Fails in Internet Explorer
+ try {
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
+ }
+
+ if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
+ div.attachEvent( "onclick", clickFn = function() {
+ // Cloning a node shouldn't copy over any
+ // bound event handlers (IE does this)
+ support.noCloneEvent = false;
+ });
+ div.cloneNode( true ).fireEvent("onclick");
+ div.detachEvent( "onclick", clickFn );
+ }
+
+ // Check if a radio maintains its value
+ // after being appended to the DOM
+ input = document.createElement("input");
+ input.value = "t";
+ input.setAttribute( "type", "radio" );
+ support.radioValue = input.value === "t";
+
+ input.setAttribute( "checked", "checked" );
+
+ // #11217 - WebKit loses check when the name is after the checked attribute
+ input.setAttribute( "name", "t" );
+
+ div.appendChild( input );
+ fragment = document.createDocumentFragment();
+ fragment.appendChild( div.lastChild );
+
+ // WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ support.appendChecked = input.checked;
+
+ fragment.removeChild( input );
+ fragment.appendChild( div );
+
+ // Technique from Juriy Zaytsev
+ // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/
+ // We only care about the case where non-standard event systems
+ // are used, namely in IE. Short-circuiting here helps us to
+ // avoid an eval call (in setAttribute) which can cause CSP
+ // to go haywire. See: https://developer.mozilla.org/en/Security/CSP
+ if ( div.attachEvent ) {
+ for ( i in {
+ submit: true,
+ change: true,
+ focusin: true
+ }) {
+ eventName = "on" + i;
+ isSupported = ( eventName in div );
+ if ( !isSupported ) {
+ div.setAttribute( eventName, "return;" );
+ isSupported = ( typeof div[ eventName ] === "function" );
+ }
+ support[ i + "Bubbles" ] = isSupported;
+ }
+ }
+
+ // Run tests that need a body at doc ready
+ jQuery(function() {
+ var container, div, tds, marginDiv,
+ divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;",
+ body = document.getElementsByTagName("body")[0];
+
+ if ( !body ) {
+ // Return for frameset docs that don't have a body
+ return;
+ }
+
+ container = document.createElement("div");
+ container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px";
+ body.insertBefore( container, body.firstChild );
+
+ // Construct the test element
+ div = document.createElement("div");
+ container.appendChild( div );
+
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ // (only IE 8 fails this test)
+ div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName("td");
+ tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none";
+ isSupported = ( tds[ 0 ].offsetHeight === 0 );
+
+ tds[ 0 ].style.display = "";
+ tds[ 1 ].style.display = "none";
+
+ // Check if empty table cells still have offsetWidth/Height
+ // (IE <= 8 fail this test)
+ support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
+
+ // Check box-sizing and margin behavior
+ div.innerHTML = "";
+ div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;";
+ support.boxSizing = ( div.offsetWidth === 4 );
+ support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 );
+
+ // NOTE: To any future maintainer, window.getComputedStyle was used here
+ // instead of getComputedStyle because it gave a better gzip size.
+ // The difference between window.getComputedStyle and getComputedStyle is
+ // 7 bytes
+ if ( window.getComputedStyle ) {
+ support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%";
+ support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px";
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. For more
+ // info see bug #3333
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ marginDiv = document.createElement("div");
+ marginDiv.style.cssText = div.style.cssText = divReset;
+ marginDiv.style.marginRight = marginDiv.style.width = "0";
+ div.style.width = "1px";
+ div.appendChild( marginDiv );
+ support.reliableMarginRight =
+ !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight );
+ }
+
+ if ( typeof div.style.zoom !== "undefined" ) {
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ // (IE < 8 does this)
+ div.innerHTML = "";
+ div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1";
+ support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 );
+
+ // Check if elements with layout shrink-wrap their children
+ // (IE 6 does this)
+ div.style.display = "block";
+ div.style.overflow = "visible";
+ div.innerHTML = "<div></div>";
+ div.firstChild.style.width = "5px";
+ support.shrinkWrapBlocks = ( div.offsetWidth !== 3 );
+
+ container.style.zoom = 1;
+ }
+
+ // Null elements to avoid leaks in IE
+ body.removeChild( container );
+ container = div = tds = marginDiv = null;
+ });
+
+ // Null elements to avoid leaks in IE
+ fragment.removeChild( div );
+ all = a = select = opt = input = fragment = div = null;
+
+ return support;
+})();
+var rbrace = /^(?:\{.*\}|\[.*\])$/,
+ rmultiDash = /([A-Z])/g;
+
+jQuery.extend({
+ cache: {},
+
+ deletedIds: [],
+
+ // Please use with caution
+ uuid: 0,
+
+ // Unique for each copy of jQuery on the page
+ // Non-digits removed to match rinlinejQuery
+ expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
+
+ // The following elements throw uncatchable exceptions if you
+ // attempt to add expando properties to them.
+ noData: {
+ "embed": true,
+ // Ban all objects except for Flash (which handle expandos)
+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
+ "applet": true
+ },
+
+ hasData: function( elem ) {
+ elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+ return !!elem && !isEmptyDataObject( elem );
+ },
+
+ data: function( elem, name, data, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var thisCache, ret,
+ internalKey = jQuery.expando,
+ getByName = typeof name === "string",
+
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
+
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey;
+
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) {
+ return;
+ }
+
+ if ( !id ) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if ( isNode ) {
+ elem[ internalKey ] = id = jQuery.deletedIds.pop() || ++jQuery.uuid;
+ } else {
+ id = internalKey;
+ }
+ }
+
+ if ( !cache[ id ] ) {
+ cache[ id ] = {};
+
+ // Avoids exposing jQuery metadata on plain JS objects when the object
+ // is serialized using JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if ( typeof name === "object" || typeof name === "function" ) {
+ if ( pvt ) {
+ cache[ id ] = jQuery.extend( cache[ id ], name );
+ } else {
+ cache[ id ].data = jQuery.extend( cache[ id ].data, name );
+ }
+ }
+
+ thisCache = cache[ id ];
+
+ // jQuery data() is stored in a separate object inside the object's internal data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data.
+ if ( !pvt ) {
+ if ( !thisCache.data ) {
+ thisCache.data = {};
+ }
+
+ thisCache = thisCache.data;
+ }
+
+ if ( data !== undefined ) {
+ thisCache[ jQuery.camelCase( name ) ] = data;
+ }
+
+ // Check for both converted-to-camel and non-converted data property names
+ // If a data property was specified
+ if ( getByName ) {
+
+ // First Try to find as-is property data
+ ret = thisCache[ name ];
+
+ // Test for null|undefined property data
+ if ( ret == null ) {
+
+ // Try to find the camelCased property
+ ret = thisCache[ jQuery.camelCase( name ) ];
+ }
+ } else {
+ ret = thisCache;
+ }
+
+ return ret;
+ },
+
+ removeData: function( elem, name, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var thisCache, i, l,
+
+ isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
+ id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if ( !cache[ id ] ) {
+ return;
+ }
+
+ if ( name ) {
+
+ thisCache = pvt ? cache[ id ] : cache[ id ].data;
+
+ if ( thisCache ) {
+
+ // Support array or space separated string names for data keys
+ if ( !jQuery.isArray( name ) ) {
+
+ // try the string as a key before any manipulation
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+
+ // split the camel cased version by spaces unless a key with the spaces exists
+ name = jQuery.camelCase( name );
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+ name = name.split(" ");
+ }
+ }
+ }
+
+ for ( i = 0, l = name.length; i < l; i++ ) {
+ delete thisCache[ name[i] ];
+ }
+
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) {
+ return;
+ }
+ }
+ }
+
+ // See jQuery.data for more information
+ if ( !pvt ) {
+ delete cache[ id ].data;
+
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if ( !isEmptyDataObject( cache[ id ] ) ) {
+ return;
+ }
+ }
+
+ // Destroy the cache
+ if ( isNode ) {
+ jQuery.cleanData( [ elem ], true );
+
+ // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
+ } else if ( jQuery.support.deleteExpando || cache != cache.window ) {
+ delete cache[ id ];
+
+ // When all else fails, null
+ } else {
+ cache[ id ] = null;
+ }
+ },
+
+ // For internal use only.
+ _data: function( elem, name, data ) {
+ return jQuery.data( elem, name, data, true );
+ },
+
+ // A method for determining if a DOM node can handle the data expando
+ acceptData: function( elem ) {
+ var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ];
+
+ // nodes accept data unless otherwise specified; rejection can be conditional
+ return !noData || noData !== true && elem.getAttribute("classid") === noData;
+ }
+});
+
+jQuery.fn.extend({
+ data: function( key, value ) {
+ var parts, part, attr, name, l,
+ elem = this[0],
+ i = 0,
+ data = null;
+
+ // Gets all values
+ if ( key === undefined ) {
+ if ( this.length ) {
+ data = jQuery.data( elem );
+
+ if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) {
+ attr = elem.attributes;
+ for ( l = attr.length; i < l; i++ ) {
+ name = attr[i].name;
+
+ if ( name.indexOf( "data-" ) === 0 ) {
+ name = jQuery.camelCase( name.substring(5) );
+
+ dataAttr( elem, name, data[ name ] );
+ }
+ }
+ jQuery._data( elem, "parsedAttrs", true );
+ }
+ }
+
+ return data;
+ }
+
+ // Sets multiple values
+ if ( typeof key === "object" ) {
+ return this.each(function() {
+ jQuery.data( this, key );
+ });
+ }
+
+ parts = key.split( ".", 2 );
+ parts[1] = parts[1] ? "." + parts[1] : "";
+ part = parts[1] + "!";
+
+ return jQuery.access( this, function( value ) {
+
+ if ( value === undefined ) {
+ data = this.triggerHandler( "getData" + part, [ parts[0] ] );
+
+ // Try to fetch any internally stored data first
+ if ( data === undefined && elem ) {
+ data = jQuery.data( elem, key );
+ data = dataAttr( elem, key, data );
+ }
+
+ return data === undefined && parts[1] ?
+ this.data( parts[0] ) :
+ data;
+ }
+
+ parts[1] = value;
+ this.each(function() {
+ var self = jQuery( this );
+
+ self.triggerHandler( "setData" + part, parts );
+ jQuery.data( this, key, value );
+ self.triggerHandler( "changeData" + part, parts );
+ });
+ }, null, value, arguments.length > 1, null, false );
+ },
+
+ removeData: function( key ) {
+ return this.each(function() {
+ jQuery.removeData( this, key );
+ });
+ }
+});
+
+function dataAttr( elem, key, data ) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+
+ var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
+
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ // Only convert to a number if it doesn't change the string
+ +data + "" === data ? +data :
+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
+ data;
+ } catch( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data( elem, key, data );
+
+ } else {
+ data = undefined;
+ }
+ }
+
+ return data;
+}
+
+// checks a cache object for emptiness
+function isEmptyDataObject( obj ) {
+ var name;
+ for ( name in obj ) {
+
+ // if the public data object is empty, the private is still empty
+ if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) {
+ continue;
+ }
+ if ( name !== "toJSON" ) {
+ return false;
+ }
+ }
+
+ return true;
+}
+jQuery.extend({
+ queue: function( elem, type, data ) {
+ var queue;
+
+ if ( elem ) {
+ type = ( type || "fx" ) + "queue";
+ queue = jQuery._data( elem, type );
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !queue || jQuery.isArray(data) ) {
+ queue = jQuery._data( elem, type, jQuery.makeArray(data) );
+ } else {
+ queue.push( data );
+ }
+ }
+ return queue || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ fn = queue.shift(),
+ hooks = jQuery._queueHooks( elem, type ),
+ next = function() {
+ jQuery.dequeue( elem, type );
+ };
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ }
+
+ if ( fn ) {
+
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift( "inprogress" );
+ }
+
+ // clear up the last queue stop function
+ delete hooks.stop;
+ fn.call( elem, next, hooks );
+ }
+ if ( !queue.length && hooks ) {
+ hooks.empty.fire();
+ }
+ },
+
+ // not intended for public consumption - generates a queueHooks object, or returns the current one
+ _queueHooks: function( elem, type ) {
+ var key = type + "queueHooks";
+ return jQuery._data( elem, key ) || jQuery._data( elem, key, {
+ empty: jQuery.Callbacks("once memory").add(function() {
+ jQuery.removeData( elem, type + "queue", true );
+ jQuery.removeData( elem, key, true );
+ })
+ });
+ }
+});
+
+jQuery.fn.extend({
+ queue: function( type, data ) {
+ var setter = 2;
+
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ setter--;
+ }
+
+ if ( arguments.length < setter ) {
+ return jQuery.queue( this[0], type );
+ }
+
+ return data === undefined ?
+ this :
+ this.each(function() {
+ var queue = jQuery.queue( this, type, data );
+
+ // ensure a hooks for this queue
+ jQuery._queueHooks( this, type );
+
+ if ( type === "fx" && queue[0] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ dequeue: function( type ) {
+ return this.each(function() {
+ jQuery.dequeue( this, type );
+ });
+ },
+ // Based off of the plugin by Clint Helfers, with permission.
+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
+ delay: function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function( next, hooks ) {
+ var timeout = setTimeout( next, time );
+ hooks.stop = function() {
+ clearTimeout( timeout );
+ };
+ });
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, obj ) {
+ var tmp,
+ count = 1,
+ defer = jQuery.Deferred(),
+ elements = this,
+ i = this.length,
+ resolve = function() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ };
+
+ if ( typeof type !== "string" ) {
+ obj = type;
+ type = undefined;
+ }
+ type = type || "fx";
+
+ while( i-- ) {
+ if ( (tmp = jQuery._data( elements[ i ], type + "queueHooks" )) && tmp.empty ) {
+ count++;
+ tmp.empty.add( resolve );
+ }
+ }
+ resolve();
+ return defer.promise( obj );
+ }
+});
+var nodeHook, boolHook, fixSpecified,
+ rclass = /[\t\r\n]/g,
+ rreturn = /\r/g,
+ rtype = /^(?:button|input)$/i,
+ rfocusable = /^(?:button|input|object|select|textarea)$/i,
+ rclickable = /^a(?:rea|)$/i,
+ rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
+ getSetAttribute = jQuery.support.getSetAttribute;
+
+jQuery.fn.extend({
+ attr: function( name, value ) {
+ return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 );
+ },
+
+ removeAttr: function( name ) {
+ return this.each(function() {
+ jQuery.removeAttr( this, name );
+ });
+ },
+
+ prop: function( name, value ) {
+ return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 );
+ },
+
+ removeProp: function( name ) {
+ name = jQuery.propFix[ name ] || name;
+ return this.each(function() {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[ name ] = undefined;
+ delete this[ name ];
+ } catch( e ) {}
+ });
+ },
+
+ addClass: function( value ) {
+ var classNames, i, l, elem,
+ setClass, c, cl;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).addClass( value.call(this, j, this.className) );
+ });
+ }
+
+ if ( value && typeof value === "string" ) {
+ classNames = value.split( core_rspace );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.nodeType === 1 ) {
+ if ( !elem.className && classNames.length === 1 ) {
+ elem.className = value;
+
+ } else {
+ setClass = " " + elem.className + " ";
+
+ for ( c = 0, cl = classNames.length; c < cl; c++ ) {
+ if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) {
+ setClass += classNames[ c ] + " ";
+ }
+ }
+ elem.className = jQuery.trim( setClass );
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function( value ) {
+ var removes, className, elem, c, cl, i, l;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).removeClass( value.call(this, j, this.className) );
+ });
+ }
+ if ( (value && typeof value === "string") || value === undefined ) {
+ removes = ( value || "" ).split( core_rspace );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ elem = this[ i ];
+ if ( elem.nodeType === 1 && elem.className ) {
+
+ className = (" " + elem.className + " ").replace( rclass, " " );
+
+ // loop over each item in the removal list
+ for ( c = 0, cl = removes.length; c < cl; c++ ) {
+ // Remove until there is nothing to remove,
+ while ( className.indexOf(" " + removes[ c ] + " ") > -1 ) {
+ className = className.replace( " " + removes[ c ] + " " , " " );
+ }
+ }
+ elem.className = value ? jQuery.trim( className ) : "";
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value,
+ isBool = typeof stateVal === "boolean";
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( i ) {
+ jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
+ });
+ }
+
+ return this.each(function() {
+ if ( type === "string" ) {
+ // toggle individual class names
+ var className,
+ i = 0,
+ self = jQuery( this ),
+ state = stateVal,
+ classNames = value.split( core_rspace );
+
+ while ( (className = classNames[ i++ ]) ) {
+ // check each className given, space separated list
+ state = isBool ? state : !self.hasClass( className );
+ self[ state ? "addClass" : "removeClass" ]( className );
+ }
+
+ } else if ( type === "undefined" || type === "boolean" ) {
+ if ( this.className ) {
+ // store className if set
+ jQuery._data( this, "__className__", this.className );
+ }
+
+ // toggle whole className
+ this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+ }
+ });
+ },
+
+ hasClass: function( selector ) {
+ var className = " " + selector + " ",
+ i = 0,
+ l = this.length;
+ for ( ; i < l; i++ ) {
+ if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+ return true;
+ }
+ }
+
+ return false;
+ },
+
+ val: function( value ) {
+ var hooks, ret, isFunction,
+ elem = this[0];
+
+ if ( !arguments.length ) {
+ if ( elem ) {
+ hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ return typeof ret === "string" ?
+ // handle most common string cases
+ ret.replace(rreturn, "") :
+ // handle cases where value is null/undef or number
+ ret == null ? "" : ret;
+ }
+
+ return;
+ }
+
+ isFunction = jQuery.isFunction( value );
+
+ return this.each(function( i ) {
+ var val,
+ self = jQuery(this);
+
+ if ( this.nodeType !== 1 ) {
+ return;
+ }
+
+ if ( isFunction ) {
+ val = value.call( this, i, self.val() );
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+ } else if ( typeof val === "number" ) {
+ val += "";
+ } else if ( jQuery.isArray( val ) ) {
+ val = jQuery.map(val, function ( value ) {
+ return value == null ? "" : value + "";
+ });
+ }
+
+ hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ valHooks: {
+ option: {
+ get: function( elem ) {
+ // attributes.value is undefined in Blackberry 4.7 but
+ // uses .value. See #6932
+ var val = elem.attributes.value;
+ return !val || val.specified ? elem.value : elem.text;
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value, i, max, option,
+ index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type === "select-one";
+
+ // Nothing was selected
+ if ( index < 0 ) {
+ return null;
+ }
+
+ // Loop through all the selected options
+ i = one ? index : 0;
+ max = one ? index + 1 : options.length;
+ for ( ; i < max; i++ ) {
+ option = options[ i ];
+
+ // Don't return options that are disabled or in a disabled optgroup
+ if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
+ (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
+
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ // Fixes Bug #2551 -- select.val() broken in IE after form.reset()
+ if ( one && !values.length && options.length ) {
+ return jQuery( options[ index ] ).val();
+ }
+
+ return values;
+ },
+
+ set: function( elem, value ) {
+ var values = jQuery.makeArray( value );
+
+ jQuery(elem).find("option").each(function() {
+ this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+ });
+
+ if ( !values.length ) {
+ elem.selectedIndex = -1;
+ }
+ return values;
+ }
+ }
+ },
+
+ // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9
+ attrFn: {},
+
+ attr: function( elem, name, value, pass ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) {
+ return jQuery( elem )[ name ]( value );
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( typeof elem.getAttribute === "undefined" ) {
+ return jQuery.prop( elem, name, value );
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ // All attributes are lowercase
+ // Grab necessary hook if one is defined
+ if ( notxml ) {
+ name = name.toLowerCase();
+ hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook );
+ }
+
+ if ( value !== undefined ) {
+
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+ return;
+
+ } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ elem.setAttribute( name, "" + value );
+ return value;
+ }
+
+ } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+
+ ret = elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret === null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function( elem, value ) {
+ var propName, attrNames, name, isBool,
+ i = 0;
+
+ if ( value && elem.nodeType === 1 ) {
+
+ attrNames = value.split( core_rspace );
+
+ for ( ; i < attrNames.length; i++ ) {
+ name = attrNames[ i ];
+
+ if ( name ) {
+ propName = jQuery.propFix[ name ] || name;
+ isBool = rboolean.test( name );
+
+ // See #9699 for explanation of this approach (setting first, then removal)
+ // Do not do this for boolean attributes (see #10870)
+ if ( !isBool ) {
+ jQuery.attr( elem, name, "" );
+ }
+ elem.removeAttribute( getSetAttribute ? name : propName );
+
+ // Set corresponding property to false for boolean attributes
+ if ( isBool && propName in elem ) {
+ elem[ propName ] = false;
+ }
+ }
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( rtype.test( elem.nodeName ) && elem.parentNode ) {
+ jQuery.error( "type property can't be changed" );
+ } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to it's default in case type is set after value
+ // This is for element creation
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ },
+ // Use the value property for back compat
+ // Use the nodeHook for button elements in IE6/7 (#1954)
+ value: {
+ get: function( elem, name ) {
+ if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
+ return nodeHook.get( elem, name );
+ }
+ return name in elem ?
+ elem.value :
+ null;
+ },
+ set: function( elem, value, name ) {
+ if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
+ return nodeHook.set( elem, value, name );
+ }
+ // Does not return so that setAttribute is also used
+ elem.value = value;
+ }
+ }
+ },
+
+ propFix: {
+ tabindex: "tabIndex",
+ readonly: "readOnly",
+ "for": "htmlFor",
+ "class": "className",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ cellpadding: "cellPadding",
+ rowspan: "rowSpan",
+ colspan: "colSpan",
+ usemap: "useMap",
+ frameborder: "frameBorder",
+ contenteditable: "contentEditable"
+ },
+
+ prop: function( elem, name, value ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set properties on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ if ( notxml ) {
+ // Fix name and attach hooks
+ name = jQuery.propFix[ name ] || name;
+ hooks = jQuery.propHooks[ name ];
+ }
+
+ if ( value !== undefined ) {
+ if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ return ( elem[ name ] = value );
+ }
+
+ } else {
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+ return elem[ name ];
+ }
+ }
+ },
+
+ propHooks: {
+ tabIndex: {
+ get: function( elem ) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ var attributeNode = elem.getAttributeNode("tabindex");
+
+ return attributeNode && attributeNode.specified ?
+ parseInt( attributeNode.value, 10 ) :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ undefined;
+ }
+ }
+ }
+});
+
+// Hook for boolean attributes
+boolHook = {
+ get: function( elem, name ) {
+ // Align boolean attributes with corresponding properties
+ // Fall back to attribute presence where some booleans are not supported
+ var attrNode,
+ property = jQuery.prop( elem, name );
+ return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ?
+ name.toLowerCase() :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ var propName;
+ if ( value === false ) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else {
+ // value is true since we know at this point it's type boolean and not false
+ // Set boolean attributes to the same name and set the DOM property
+ propName = jQuery.propFix[ name ] || name;
+ if ( propName in elem ) {
+ // Only set the IDL specifically if it already exists on the element
+ elem[ propName ] = true;
+ }
+
+ elem.setAttribute( name, name.toLowerCase() );
+ }
+ return name;
+ }
+};
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !getSetAttribute ) {
+
+ fixSpecified = {
+ name: true,
+ id: true,
+ coords: true
+ };
+
+ // Use this for any attribute in IE6/7
+ // This fixes almost every IE6/7 issue
+ nodeHook = jQuery.valHooks.button = {
+ get: function( elem, name ) {
+ var ret;
+ ret = elem.getAttributeNode( name );
+ return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ?
+ ret.value :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ // Set the existing or create a new attribute node
+ var ret = elem.getAttributeNode( name );
+ if ( !ret ) {
+ ret = document.createAttribute( name );
+ elem.setAttributeNode( ret );
+ }
+ return ( ret.value = value + "" );
+ }
+ };
+
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each([ "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ set: function( elem, value ) {
+ if ( value === "" ) {
+ elem.setAttribute( name, "auto" );
+ return value;
+ }
+ }
+ });
+ });
+
+ // Set contenteditable to false on removals(#10429)
+ // Setting to empty string throws an error as an invalid value
+ jQuery.attrHooks.contenteditable = {
+ get: nodeHook.get,
+ set: function( elem, value, name ) {
+ if ( value === "" ) {
+ value = "false";
+ }
+ nodeHook.set( elem, value, name );
+ }
+ };
+}
+
+
+// Some attributes require a special call on IE
+if ( !jQuery.support.hrefNormalized ) {
+ jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ get: function( elem ) {
+ var ret = elem.getAttribute( name, 2 );
+ return ret === null ? undefined : ret;
+ }
+ });
+ });
+}
+
+if ( !jQuery.support.style ) {
+ jQuery.attrHooks.style = {
+ get: function( elem ) {
+ // Return undefined in the case of empty string
+ // Normalize to lowercase since IE uppercases css property names
+ return elem.style.cssText.toLowerCase() || undefined;
+ },
+ set: function( elem, value ) {
+ return ( elem.style.cssText = "" + value );
+ }
+ };
+}
+
+// Safari mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+if ( !jQuery.support.optSelected ) {
+ jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
+ get: function( elem ) {
+ var parent = elem.parentNode;
+
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ return null;
+ }
+ });
+}
+
+// IE6/7 call enctype encoding
+if ( !jQuery.support.enctype ) {
+ jQuery.propFix.enctype = "encoding";
+}
+
+// Radios and checkboxes getter/setter
+if ( !jQuery.support.checkOn ) {
+ jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ get: function( elem ) {
+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ }
+ };
+ });
+}
+jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
+ set: function( elem, value ) {
+ if ( jQuery.isArray( value ) ) {
+ return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
+ }
+ }
+ });
+});
+var rformElems = /^(?:textarea|input|select)$/i,
+ rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/,
+ rhoverHack = /(?:^|\s)hover(\.\S+|)\b/,
+ rkeyEvent = /^key/,
+ rmouseEvent = /^(?:mouse|contextmenu)|click/,
+ rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+ hoverHack = function( events ) {
+ return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" );
+ };
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+ add: function( elem, types, handler, data, selector ) {
+
+ var elemData, eventHandle, events,
+ t, tns, type, namespaces, handleObj,
+ handleObjIn, handlers, special;
+
+ // Don't attach events to noData or text/comment nodes (allow plain objects tho)
+ if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ selector = handleObjIn.selector;
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ events = elemData.events;
+ if ( !events ) {
+ elemData.events = events = {};
+ }
+ eventHandle = elemData.handle;
+ if ( !eventHandle ) {
+ elemData.handle = eventHandle = function( e ) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
+ jQuery.event.dispatch.apply( eventHandle.elem, arguments ) :
+ undefined;
+ };
+ // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
+ eventHandle.elem = elem;
+ }
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ types = jQuery.trim( hoverHack(types) ).split( " " );
+ for ( t = 0; t < types.length; t++ ) {
+
+ tns = rtypenamespace.exec( types[t] ) || [];
+ type = tns[1];
+ namespaces = ( tns[2] || "" ).split( "." ).sort();
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[ type ] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[ type ] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend({
+ type: type,
+ origType: tns[1],
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ namespace: namespaces.join(".")
+ }, handleObjIn );
+
+ // Init the event handler queue if we're the first
+ handlers = events[ type ];
+ if ( !handlers ) {
+ handlers = events[ type ] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener/attachEvent if the special events handler returns false
+ if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+ // Bind the global event handler to the element
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle, false );
+
+ } else if ( elem.attachEvent ) {
+ elem.attachEvent( "on" + type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if ( selector ) {
+ handlers.splice( handlers.delegateCount++, 0, handleObj );
+ } else {
+ handlers.push( handleObj );
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ global: {},
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, selector, mappedTypes ) {
+
+ var t, tns, type, origType, namespaces, origCount,
+ j, events, special, eventType, handleObj,
+ elemData = jQuery.hasData( elem ) && jQuery._data( elem );
+
+ if ( !elemData || !(events = elemData.events) ) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = jQuery.trim( hoverHack( types || "" ) ).split(" ");
+ for ( t = 0; t < types.length; t++ ) {
+ tns = rtypenamespace.exec( types[t] ) || [];
+ type = origType = tns[1];
+ namespaces = tns[2];
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if ( !type ) {
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+ type = ( selector? special.delegateType : special.bindType ) || type;
+ eventType = events[ type ] || [];
+ origCount = eventType.length;
+ namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
+
+ // Remove matching events
+ for ( j = 0; j < eventType.length; j++ ) {
+ handleObj = eventType[ j ];
+
+ if ( ( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !namespaces || namespaces.test( handleObj.namespace ) ) &&
+ ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
+ eventType.splice( j--, 1 );
+
+ if ( handleObj.selector ) {
+ eventType.delegateCount--;
+ }
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if ( eventType.length === 0 && origCount !== eventType.length ) {
+ if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ delete events[ type ];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ delete elemData.handle;
+
+ // removeData also checks for emptiness and clears the expando if empty
+ // so use it instead of delete
+ jQuery.removeData( elem, "events", true );
+ }
+ },
+
+ // Events that are safe to short-circuit if no handlers are attached.
+ // Native DOM events should not be added, they may have inline handlers.
+ customEvent: {
+ "getData": true,
+ "setData": true,
+ "changeData": true
+ },
+
+ trigger: function( event, data, elem, onlyHandlers ) {
+ // Don't do events on text and comment nodes
+ if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) {
+ return;
+ }
+
+ // Event object or event type
+ var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType,
+ type = event.type || event,
+ namespaces = [];
+
+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
+ if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+ return;
+ }
+
+ if ( type.indexOf( "!" ) >= 0 ) {
+ // Exclusive events trigger only for the exact event (no namespaces)
+ type = type.slice(0, -1);
+ exclusive = true;
+ }
+
+ if ( type.indexOf( "." ) >= 0 ) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+
+ if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) {
+ // No jQuery handlers for this event type, and it can't have inline handlers
+ return;
+ }
+
+ // Caller can pass in an Event, Object, or just an event type string
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[ jQuery.expando ] ? event :
+ // Object literal
+ new jQuery.Event( type, event ) :
+ // Just the event type (string)
+ new jQuery.Event( type );
+
+ event.type = type;
+ event.isTrigger = true;
+ event.exclusive = exclusive;
+ event.namespace = namespaces.join( "." );
+ event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
+ ontype = type.indexOf( ":" ) < 0 ? "on" + type : "";
+
+ // Handle a global trigger
+ if ( !elem ) {
+
+ // TODO: Stop taunting the data cache; remove global events and always attach to document
+ cache = jQuery.cache;
+ for ( i in cache ) {
+ if ( cache[ i ].events && cache[ i ].events[ type ] ) {
+ jQuery.event.trigger( event, data, cache[ i ].handle.elem, true );
+ }
+ }
+ return;
+ }
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ if ( !event.target ) {
+ event.target = elem;
+ }
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data != null ? jQuery.makeArray( data ) : [];
+ data.unshift( event );
+
+ // Allow special events to draw outside the lines
+ special = jQuery.event.special[ type ] || {};
+ if ( special.trigger && special.trigger.apply( elem, data ) === false ) {
+ return;
+ }
+
+ // Determine event propagation path in advance, per W3C events spec (#9951)
+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+ eventPath = [[ elem, special.bindType || type ]];
+ if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
+
+ bubbleType = special.delegateType || type;
+ cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode;
+ for ( old = elem; cur; cur = cur.parentNode ) {
+ eventPath.push([ cur, bubbleType ]);
+ old = cur;
+ }
+
+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
+ if ( old === (elem.ownerDocument || document) ) {
+ eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]);
+ }
+ }
+
+ // Fire handlers on the event path
+ for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) {
+
+ cur = eventPath[i][0];
+ event.type = eventPath[i][1];
+
+ handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" );
+ if ( handle ) {
+ handle.apply( cur, data );
+ }
+ // Note that this is a bare JS function and not a jQuery handler
+ handle = ontype && cur[ ontype ];
+ if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) {
+ event.preventDefault();
+ }
+ }
+ event.type = type;
+
+ // If nobody prevented the default action, do it now
+ if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+ if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) &&
+ !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
+
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction() check here because IE6/7 fails that test.
+ // Don't do default actions on window, that's where global variables be (#6170)
+ // IE<9 dies on focus/blur to hidden element (#1486)
+ if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) {
+
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ old = elem[ ontype ];
+
+ if ( old ) {
+ elem[ ontype ] = null;
+ }
+
+ // Prevent re-triggering of the same event, since we already bubbled it above
+ jQuery.event.triggered = type;
+ elem[ type ]();
+ jQuery.event.triggered = undefined;
+
+ if ( old ) {
+ elem[ ontype ] = old;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ dispatch: function( event ) {
+
+ // Make a writable jQuery.Event from the native event object
+ event = jQuery.event.fix( event || window.event );
+
+ var i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related,
+ handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []),
+ delegateCount = handlers.delegateCount,
+ args = [].slice.call( arguments ),
+ run_all = !event.exclusive && !event.namespace,
+ special = jQuery.event.special[ event.type ] || {},
+ handlerQueue = [];
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[0] = event;
+ event.delegateTarget = this;
+
+ // Call the preDispatch hook for the mapped type, and let it bail if desired
+ if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+ return;
+ }
+
+ // Determine handlers that should run if there are delegated events
+ // Avoid non-left-click bubbling in Firefox (#3861)
+ if ( delegateCount && !(event.button && event.type === "click") ) {
+
+ // Pregenerate a single jQuery object for reuse with .is()
+ jqcur = jQuery(this);
+ jqcur.context = this;
+
+ for ( cur = event.target; cur != this; cur = cur.parentNode || this ) {
+
+ // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #xxxx)
+ if ( cur.disabled !== true || event.type !== "click" ) {
+ selMatch = {};
+ matches = [];
+ jqcur[0] = cur;
+ for ( i = 0; i < delegateCount; i++ ) {
+ handleObj = handlers[ i ];
+ sel = handleObj.selector;
+
+ if ( selMatch[ sel ] === undefined ) {
+ selMatch[ sel ] = jqcur.is( sel );
+ }
+ if ( selMatch[ sel ] ) {
+ matches.push( handleObj );
+ }
+ }
+ if ( matches.length ) {
+ handlerQueue.push({ elem: cur, matches: matches });
+ }
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ if ( handlers.length > delegateCount ) {
+ handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) });
+ }
+
+ // Run delegates first; they may want to stop propagation beneath us
+ for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) {
+ matched = handlerQueue[ i ];
+ event.currentTarget = matched.elem;
+
+ for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) {
+ handleObj = matched.matches[ j ];
+
+ // Triggered event must either 1) be non-exclusive and have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
+ if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) {
+
+ event.data = handleObj.data;
+ event.handleObj = handleObj;
+
+ ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
+ .apply( matched.elem, args );
+
+ if ( ret !== undefined ) {
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ // Call the postDispatch hook for the mapped type
+ if ( special.postDispatch ) {
+ special.postDispatch.call( this, event );
+ }
+
+ return event.result;
+ },
+
+ // Includes some event props shared by KeyEvent and MouseEvent
+ // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 ***
+ props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
+
+ fixHooks: {},
+
+ keyHooks: {
+ props: "char charCode key keyCode".split(" "),
+ filter: function( event, original ) {
+
+ // Add which for key events
+ if ( event.which == null ) {
+ event.which = original.charCode != null ? original.charCode : original.keyCode;
+ }
+
+ return event;
+ }
+ },
+
+ mouseHooks: {
+ props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
+ filter: function( event, original ) {
+ var eventDoc, doc, body,
+ button = original.button,
+ fromElement = original.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && original.clientX != null ) {
+ eventDoc = event.target.ownerDocument || document;
+ doc = eventDoc.documentElement;
+ body = eventDoc.body;
+
+ event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
+ event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
+ }
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && fromElement ) {
+ event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && button !== undefined ) {
+ event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
+ }
+
+ return event;
+ }
+ },
+
+ fix: function( event ) {
+ if ( event[ jQuery.expando ] ) {
+ return event;
+ }
+
+ // Create a writable copy of the event object and normalize some properties
+ var i, prop,
+ originalEvent = event,
+ fixHook = jQuery.event.fixHooks[ event.type ] || {},
+ copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
+
+ event = jQuery.Event( originalEvent );
+
+ for ( i = copy.length; i; ) {
+ prop = copy[ --i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2)
+ if ( !event.target ) {
+ event.target = originalEvent.srcElement || document;
+ }
+
+ // Target should not be a text node (#504, Safari)
+ if ( event.target.nodeType === 3 ) {
+ event.target = event.target.parentNode;
+ }
+
+ // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8)
+ event.metaKey = !!event.metaKey;
+
+ return fixHook.filter? fixHook.filter( event, originalEvent ) : event;
+ },
+
+ special: {
+ ready: {
+ // Make sure the ready event is setup
+ setup: jQuery.bindReady
+ },
+
+ load: {
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+
+ focus: {
+ delegateType: "focusin"
+ },
+ blur: {
+ delegateType: "focusout"
+ },
+
+ beforeunload: {
+ setup: function( data, namespaces, eventHandle ) {
+ // We only want to do this special case on windows
+ if ( jQuery.isWindow( this ) ) {
+ this.onbeforeunload = eventHandle;
+ }
+ },
+
+ teardown: function( namespaces, eventHandle ) {
+ if ( this.onbeforeunload === eventHandle ) {
+ this.onbeforeunload = null;
+ }
+ }
+ }
+ },
+
+ simulate: function( type, elem, event, bubble ) {
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ var e = jQuery.extend(
+ new jQuery.Event(),
+ event,
+ { type: type,
+ isSimulated: true,
+ originalEvent: {}
+ }
+ );
+ if ( bubble ) {
+ jQuery.event.trigger( e, null, elem );
+ } else {
+ jQuery.event.dispatch.call( elem, e );
+ }
+ if ( e.isDefaultPrevented() ) {
+ event.preventDefault();
+ }
+ }
+};
+
+// Some plugins are using, but it's undocumented/deprecated and will be removed.
+// The 1.7 special event interface should provide all the hooks needed now.
+jQuery.event.handle = jQuery.event.dispatch;
+
+jQuery.removeEvent = document.removeEventListener ?
+ function( elem, type, handle ) {
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle, false );
+ }
+ } :
+ function( elem, type, handle ) {
+ var name = "on" + type;
+
+ if ( elem.detachEvent ) {
+
+ // #8545, #7054, preventing memory leaks for custom events in IE6-8 –
+ // detachEvent needed property on element, by name of that event, to properly expose it to GC
+ if ( typeof elem[ name ] === "undefined" ) {
+ elem[ name ] = null;
+ }
+
+ elem.detachEvent( name, handle );
+ }
+ };
+
+jQuery.Event = function( src, props ) {
+ // Allow instantiation without the 'new' keyword
+ if ( !(this instanceof jQuery.Event) ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false ||
+ src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || jQuery.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+function returnFalse() {
+ return false;
+}
+function returnTrue() {
+ return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ preventDefault: function() {
+ this.isDefaultPrevented = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+
+ // if preventDefault exists run it on the original event
+ if ( e.preventDefault ) {
+ e.preventDefault();
+
+ // otherwise set the returnValue property of the original event to false (IE)
+ } else {
+ e.returnValue = false;
+ }
+ },
+ stopPropagation: function() {
+ this.isPropagationStopped = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+ // if stopPropagation exists run it on the original event
+ if ( e.stopPropagation ) {
+ e.stopPropagation();
+ }
+ // otherwise set the cancelBubble property of the original event to true (IE)
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function() {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ },
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse
+};
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function( event ) {
+ var ret,
+ target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj,
+ selector = handleObj.selector;
+
+ // For mousenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply( this, arguments );
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+});
+
+// IE submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+ jQuery.event.special.submit = {
+ setup: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Lazy-add a submit handler when a descendant form may potentially be submitted
+ jQuery.event.add( this, "click._submit keypress._submit", function( e ) {
+ // Node name check avoids a VML-related crash in IE (#9807)
+ var elem = e.target,
+ form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined;
+ if ( form && !jQuery._data( form, "_submit_attached" ) ) {
+ jQuery.event.add( form, "submit._submit", function( event ) {
+ event._submit_bubble = true;
+ });
+ jQuery._data( form, "_submit_attached", true );
+ }
+ });
+ // return undefined since we don't need an event listener
+ },
+
+ postDispatch: function( event ) {
+ // If form was submitted by the user, bubble the event up the tree
+ if ( event._submit_bubble ) {
+ delete event._submit_bubble;
+ if ( this.parentNode && !event.isTrigger ) {
+ jQuery.event.simulate( "submit", this.parentNode, event, true );
+ }
+ }
+ },
+
+ teardown: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Remove delegated handlers; cleanData eventually reaps submit handlers attached above
+ jQuery.event.remove( this, "._submit" );
+ }
+ };
+}
+
+// IE change delegation and checkbox/radio fix
+if ( !jQuery.support.changeBubbles ) {
+
+ jQuery.event.special.change = {
+
+ setup: function() {
+
+ if ( rformElems.test( this.nodeName ) ) {
+ // IE doesn't fire change on a check/radio until blur; trigger it on click
+ // after a propertychange. Eat the blur-change in special.change.handle.
+ // This still fires onchange a second time for check/radio after blur.
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ jQuery.event.add( this, "propertychange._change", function( event ) {
+ if ( event.originalEvent.propertyName === "checked" ) {
+ this._just_changed = true;
+ }
+ });
+ jQuery.event.add( this, "click._change", function( event ) {
+ if ( this._just_changed && !event.isTrigger ) {
+ this._just_changed = false;
+ }
+ // Allow triggered, simulated change events (#11500)
+ jQuery.event.simulate( "change", this, event, true );
+ });
+ }
+ return false;
+ }
+ // Delegated event; lazy-add a change handler on descendant inputs
+ jQuery.event.add( this, "beforeactivate._change", function( e ) {
+ var elem = e.target;
+
+ if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) {
+ jQuery.event.add( elem, "change._change", function( event ) {
+ if ( this.parentNode && !event.isSimulated && !event.isTrigger ) {
+ jQuery.event.simulate( "change", this.parentNode, event, true );
+ }
+ });
+ jQuery._data( elem, "_change_attached", true );
+ }
+ });
+ },
+
+ handle: function( event ) {
+ var elem = event.target;
+
+ // Swallow native change events from checkbox/radio, we already triggered them above
+ if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) {
+ return event.handleObj.handler.apply( this, arguments );
+ }
+ },
+
+ teardown: function() {
+ jQuery.event.remove( this, "._change" );
+
+ return rformElems.test( this.nodeName );
+ }
+ };
+}
+
+// Create "bubbling" focus and blur events
+if ( !jQuery.support.focusinBubbles ) {
+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler while someone wants focusin/focusout
+ var attaches = 0,
+ handler = function( event ) {
+ jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
+ };
+
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ if ( attaches++ === 0 ) {
+ document.addEventListener( orig, handler, true );
+ }
+ },
+ teardown: function() {
+ if ( --attaches === 0 ) {
+ document.removeEventListener( orig, handler, true );
+ }
+ }
+ };
+ });
+}
+
+jQuery.fn.extend({
+
+ on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
+ var origFn, type;
+
+ // Types can be a map of types/handlers
+ if ( typeof types === "object" ) {
+ // ( types-Object, selector, data )
+ if ( typeof selector !== "string" ) { // && selector != null
+ // ( types-Object, data )
+ data = data || selector;
+ selector = undefined;
+ }
+ for ( type in types ) {
+ this.on( type, selector, data, types[ type ], one );
+ }
+ return this;
+ }
+
+ if ( data == null && fn == null ) {
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if ( fn == null ) {
+ if ( typeof selector === "string" ) {
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ } else if ( !fn ) {
+ return this;
+ }
+
+ if ( one === 1 ) {
+ origFn = fn;
+ fn = function( event ) {
+ // Can use an empty set, since event contains the info
+ jQuery().off( event );
+ return origFn.apply( this, arguments );
+ };
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return this.each( function() {
+ jQuery.event.add( this, types, fn, data, selector );
+ });
+ },
+ one: function( types, selector, data, fn ) {
+ return this.on( types, selector, data, fn, 1 );
+ },
+ off: function( types, selector, fn ) {
+ var handleObj, type;
+ if ( types && types.preventDefault && types.handleObj ) {
+ // ( event ) dispatched jQuery.Event
+ handleObj = types.handleObj;
+ jQuery( types.delegateTarget ).off(
+ handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if ( typeof types === "object" ) {
+ // ( types-object [, selector] )
+ for ( type in types ) {
+ this.off( type, selector, types[ type ] );
+ }
+ return this;
+ }
+ if ( selector === false || typeof selector === "function" ) {
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ }
+ return this.each(function() {
+ jQuery.event.remove( this, types, fn, selector );
+ });
+ },
+
+ bind: function( types, data, fn ) {
+ return this.on( types, null, data, fn );
+ },
+ unbind: function( types, fn ) {
+ return this.off( types, null, fn );
+ },
+
+ live: function( types, data, fn ) {
+ jQuery( this.context ).on( types, this.selector, data, fn );
+ return this;
+ },
+ die: function( types, fn ) {
+ jQuery( this.context ).off( types, this.selector || "**", fn );
+ return this;
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.on( types, selector, data, fn );
+ },
+ undelegate: function( selector, types, fn ) {
+ // ( namespace ) or ( selector, types [, fn] )
+ return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector || "**", fn );
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function() {
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+ triggerHandler: function( type, data ) {
+ if ( this[0] ) {
+ return jQuery.event.trigger( type, data, this[0], true );
+ }
+ },
+
+ toggle: function( fn ) {
+ // Save reference to arguments for access in closure
+ var args = arguments,
+ guid = fn.guid || jQuery.guid++,
+ i = 0,
+ toggler = function( event ) {
+ // Figure out which function to execute
+ var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+ jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ lastToggle ].apply( this, arguments ) || false;
+ };
+
+ // link all the functions, so any of them can unbind this click handler
+ toggler.guid = guid;
+ while ( i < args.length ) {
+ args[ i++ ].guid = guid;
+ }
+
+ return this.click( toggler );
+ },
+
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ }
+});
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( data, fn ) {
+ if ( fn == null ) {
+ fn = data;
+ data = null;
+ }
+
+ return arguments.length > 0 ?
+ this.on( name, null, data, fn ) :
+ this.trigger( name );
+ };
+
+ if ( rkeyEvent.test( name ) ) {
+ jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks;
+ }
+
+ if ( rmouseEvent.test( name ) ) {
+ jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks;
+ }
+});
+/*!
+ * Sizzle CSS Selector Engine
+ * Copyright 2012 jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://sizzlejs.com/
+ */
+(function( window, undefined ) {
+
+var cachedruns,
+ dirruns,
+ sortOrder,
+ siblingCheck,
+ assertGetIdNotName,
+
+ document = window.document,
+ docElem = document.documentElement,
+
+ strundefined = "undefined",
+ hasDuplicate = false,
+ baseHasDuplicate = true,
+ done = 0,
+ slice = [].slice,
+ push = [].push,
+
+ expando = ( "sizcache" + Math.random() ).replace( ".", "" ),
+
+ // Regex
+
+ // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+ // http://www.w3.org/TR/css3-syntax/#characters
+ characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",
+
+ // Loosely modeled on CSS identifier characters
+ // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors)
+ // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+ identifier = characterEncoding.replace( "w", "w#" ),
+
+ // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
+ operators = "([*^$|!~]?=)",
+ attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
+ "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",
+ pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|((?:[^,]|\\\\,|(?:,(?=[^\\[]*\\]))|(?:,(?=[^\\(]*\\))))*))\\)|)",
+ pos = ":(nth|eq|gt|lt|first|last|even|odd)(?:\\((\\d*)\\)|)(?=[^-]|$)",
+ combinators = whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*",
+ groups = "(?=[^\\x20\\t\\r\\n\\f])(?:\\\\.|" + attributes + "|" + pseudos.replace( 2, 7 ) + "|[^\\\\(),])+",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
+
+ rcombinators = new RegExp( "^" + combinators ),
+
+ // All simple (non-comma) selectors, excluding insignifant trailing whitespace
+ rgroups = new RegExp( groups + "?(?=" + whitespace + "*,|$)", "g" ),
+
+ // A selector, or everything after leading whitespace
+ // Optionally followed in either case by a ")" for terminating sub-selectors
+ rselector = new RegExp( "^(?:(?!,)(?:(?:^|,)" + whitespace + "*" + groups + ")*?|" + whitespace + "*(.*?))(\\)|$)" ),
+
+ // All combinators and selector components (attribute test, tag, pseudo, etc.), the latter appearing together when consecutive
+ rtokens = new RegExp( groups.slice( 19, -6 ) + "\\x20\\t\\r\\n\\f>+~])+|" + combinators, "g" ),
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,
+
+ rsibling = /[\x20\t\r\n\f]*[+~]/,
+ rendsWithNot = /:not\($/,
+
+ rheader = /h\d/i,
+ rinputs = /input|select|textarea|button/i,
+
+ rbackslash = /\\(?!\\)/g,
+
+ matchExpr = {
+ "ID": new RegExp( "^#(" + characterEncoding + ")" ),
+ "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ),
+ "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ),
+ "TAG": new RegExp( "^(" + characterEncoding.replace( "[-", "[-\\*" ) + ")" ),
+ "ATTR": new RegExp( "^" + attributes ),
+ "PSEUDO": new RegExp( "^" + pseudos ),
+ "CHILD": new RegExp( "^:(only|nth|last|first)-child(?:\\(" + whitespace +
+ "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+ "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+ "POS": new RegExp( pos, "ig" ),
+ // For use in libraries implementing .is()
+ "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" )
+ },
+
+ classCache = {},
+ cachedClasses = [],
+ compilerCache = {},
+ cachedSelectors = [],
+
+ // Mark a function for use in filtering
+ markFunction = function( fn ) {
+ fn.sizzleFilter = true;
+ return fn;
+ },
+
+ // Returns a function to use in pseudos for input types
+ createInputFunction = function( type ) {
+ return function( elem ) {
+ // Check the input's nodeName and type
+ return elem.nodeName.toLowerCase() === "input" && elem.type === type;
+ };
+ },
+
+ // Returns a function to use in pseudos for buttons
+ createButtonFunction = function( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && elem.type === type;
+ };
+ },
+
+ // Used for testing something on an element
+ assert = function( fn ) {
+ var pass = false,
+ div = document.createElement("div");
+ try {
+ pass = fn( div );
+ } catch (e) {}
+ // release memory in IE
+ div = null;
+ return pass;
+ },
+
+ // Check if attributes should be retrieved by attribute nodes
+ assertAttributes = assert(function( div ) {
+ div.innerHTML = "<select></select>";
+ var type = typeof div.lastChild.getAttribute("multiple");
+ // IE8 returns a string for some attributes even when not present
+ return type !== "boolean" && type !== "string";
+ }),
+
+ // Check if getElementById returns elements by name
+ // Check if getElementsByName privileges form controls or returns elements by ID
+ assertUsableName = assert(function( div ) {
+ // Inject content
+ div.id = expando + 0;
+ div.innerHTML = "<a name='" + expando + "'></a><div name='" + expando + "'></div>";
+ docElem.insertBefore( div, docElem.firstChild );
+
+ // Test
+ var pass = document.getElementsByName &&
+ // buggy browsers will return fewer than the correct 2
+ document.getElementsByName( expando ).length ===
+ // buggy browsers will return more than the correct 0
+ 2 + document.getElementsByName( expando + 0 ).length;
+ assertGetIdNotName = !document.getElementById( expando );
+
+ // Cleanup
+ docElem.removeChild( div );
+
+ return pass;
+ }),
+
+ // Check if the browser returns only elements
+ // when doing getElementsByTagName("*")
+ assertTagNameNoComments = assert(function( div ) {
+ div.appendChild( document.createComment("") );
+ return div.getElementsByTagName("*").length === 0;
+ }),
+
+ // Check if getAttribute returns normalized href attributes
+ assertHrefNotNormalized = assert(function( div ) {
+ div.innerHTML = "<a href='#'></a>";
+ return div.firstChild && typeof div.firstChild.getAttribute !== strundefined &&
+ div.firstChild.getAttribute("href") === "#";
+ }),
+
+ // Check if getElementsByClassName can be trusted
+ assertUsableClassName = assert(function( div ) {
+ // Opera can't find a second classname (in 9.6)
+ div.innerHTML = "<div class='hidden e'></div><div class='hidden'></div>";
+ if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
+ return false;
+ }
+
+ // Safari caches class attributes, doesn't catch changes (in 3.2)
+ div.lastChild.className = "e";
+ return div.getElementsByClassName("e").length !== 1;
+ });
+
+var Sizzle = function( selector, context, results, seed ) {
+ results = results || [];
+ context = context || document;
+ var match, elem, xml, m,
+ nodeType = context.nodeType;
+
+ if ( nodeType !== 1 && nodeType !== 9 ) {
+ return [];
+ }
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ xml = isXML( context );
+
+ if ( !xml && !seed ) {
+ if ( (match = rquickExpr.exec( selector )) ) {
+ // Speed-up: Sizzle("#ID")
+ if ( (m = match[1]) ) {
+ if ( nodeType === 9 ) {
+ elem = context.getElementById( m );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE, Opera, and Webkit return items
+ // by name instead of ID
+ if ( elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ } else {
+ return results;
+ }
+ } else {
+ // Context is not a document
+ if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&
+ contains( context, elem ) && elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ }
+
+ // Speed-up: Sizzle("TAG")
+ } else if ( match[2] ) {
+ push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) );
+ return results;
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) {
+ push.apply( results, slice.call(context.getElementsByClassName( m ), 0) );
+ return results;
+ }
+ }
+ }
+
+ // All others
+ return select( selector, context, results, seed, xml );
+};
+
+var Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ match: matchExpr,
+
+ order: [ "ID", "TAG" ],
+
+ attrHandle: {},
+
+ createPseudo: markFunction,
+
+ find: {
+ "ID": assertGetIdNotName ?
+ function( id, context, xml ) {
+ if ( typeof context.getElementById !== strundefined && !xml ) {
+ var m = context.getElementById( id );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ } :
+ function( id, context, xml ) {
+ if ( typeof context.getElementById !== strundefined && !xml ) {
+ var m = context.getElementById( id );
+
+ return m ?
+ m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ?
+ [m] :
+ undefined :
+ [];
+ }
+ },
+
+ "TAG": assertTagNameNoComments ?
+ function( tag, context ) {
+ if ( typeof context.getElementsByTagName !== strundefined ) {
+ return context.getElementsByTagName( tag );
+ }
+ } :
+ function( tag, context ) {
+ var results = context.getElementsByTagName( tag );
+
+ // Filter out possible comments
+ if ( tag === "*" ) {
+ var elem,
+ tmp = [],
+ i = 0;
+
+ for ( ; (elem = results[i]); i++ ) {
+ if ( elem.nodeType === 1 ) {
+ tmp.push( elem );
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ }
+ },
+
+ relative: {
+ ">": { dir: "parentNode", first: true },
+ " ": { dir: "parentNode" },
+ "+": { dir: "previousSibling", first: true },
+ "~": { dir: "previousSibling" }
+ },
+
+ preFilter: {
+ "ATTR": function( match ) {
+ match[1] = match[1].replace( rbackslash, "" );
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" );
+
+ if ( match[2] === "~=" ) {
+ match[3] = " " + match[3] + " ";
+ }
+
+ return match.slice( 0, 4 );
+ },
+
+ "CHILD": function( match ) {
+ /* matches from matchExpr.CHILD
+ 1 type (only|nth|...)
+ 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 3 xn-component of xn+y argument ([+-]?\d*n|)
+ 4 sign of xn-component
+ 5 x of xn-component
+ 6 sign of y-component
+ 7 y of y-component
+ */
+ match[1] = match[1].toLowerCase();
+
+ if ( match[1] === "nth" ) {
+ // nth-child requires argument
+ if ( !match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) );
+ match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" );
+
+ // other types prohibit arguments
+ } else if ( match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function( match ) {
+ var argument,
+ unquoted = match[4];
+
+ if ( matchExpr["CHILD"].test( match[0] ) ) {
+ return null;
+ }
+
+ // Relinquish our claim on characters in `unquoted` from a closing parenthesis on
+ if ( unquoted && (argument = rselector.exec( unquoted )) && argument.pop() ) {
+
+ match[0] = match[0].slice( 0, argument[0].length - unquoted.length - 1 );
+ unquoted = argument[0].slice( 0, -1 );
+ }
+
+ // Quoted or unquoted, we have the full argument
+ // Return only captures needed by the pseudo filter method (type and argument)
+ match.splice( 2, 3, unquoted || match[3] );
+ return match;
+ }
+ },
+
+ filter: {
+ "ID": assertGetIdNotName ?
+ function( id ) {
+ id = id.replace( rbackslash, "" );
+ return function( elem ) {
+ return elem.getAttribute("id") === id;
+ };
+ } :
+ function( id ) {
+ id = id.replace( rbackslash, "" );
+ return function( elem ) {
+ var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
+ return node && node.value === id;
+ };
+ },
+
+ "TAG": function( nodeName ) {
+ if ( nodeName === "*" ) {
+ return function() { return true; };
+ }
+ nodeName = nodeName.replace( rbackslash, "" ).toLowerCase();
+
+ return function( elem ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function( className ) {
+ var pattern = classCache[ className ];
+ if ( !pattern ) {
+ pattern = classCache[ className ] = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" );
+ cachedClasses.push( className );
+ // Avoid too large of a cache
+ if ( cachedClasses.length > Expr.cacheLength ) {
+ delete classCache[ cachedClasses.shift() ];
+ }
+ }
+ return function( elem ) {
+ return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" );
+ };
+ },
+
+ "ATTR": function( name, operator, check ) {
+ if ( !operator ) {
+ return function( elem ) {
+ return Sizzle.attr( elem, name ) != null;
+ };
+ }
+
+ return function( elem ) {
+ var result = Sizzle.attr( elem, name ),
+ value = result + "";
+
+ if ( result == null ) {
+ return operator === "!=";
+ }
+
+ switch ( operator ) {
+ case "=":
+ return value === check;
+ case "!=":
+ return value !== check;
+ case "^=":
+ return check && value.indexOf( check ) === 0;
+ case "*=":
+ return check && value.indexOf( check ) > -1;
+ case "$=":
+ return check && value.substr( value.length - check.length ) === check;
+ case "~=":
+ return ( " " + value + " " ).indexOf( check ) > -1;
+ case "|=":
+ return value === check || value.substr( 0, check.length + 1 ) === check + "-";
+ }
+ };
+ },
+
+ "CHILD": function( type, argument, first, last ) {
+
+ if ( type === "nth" ) {
+ var doneName = done++;
+
+ return function( elem ) {
+ var parent, diff,
+ count = 0,
+ node = elem;
+
+ if ( first === 1 && last === 0 ) {
+ return true;
+ }
+
+ parent = elem.parentNode;
+
+ if ( parent && (parent[ expando ] !== doneName || !elem.sizset) ) {
+ for ( node = parent.firstChild; node; node = node.nextSibling ) {
+ if ( node.nodeType === 1 ) {
+ node.sizset = ++count;
+ if ( node === elem ) {
+ break;
+ }
+ }
+ }
+
+ parent[ expando ] = doneName;
+ }
+
+ diff = elem.sizset - last;
+
+ if ( first === 0 ) {
+ return diff === 0;
+
+ } else {
+ return ( diff % first === 0 && diff / first >= 0 );
+ }
+ };
+ }
+
+ return function( elem ) {
+ var node = elem;
+
+ switch ( type ) {
+ case "only":
+ case "first":
+ while ( (node = node.previousSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ if ( type === "first" ) {
+ return true;
+ }
+
+ node = elem;
+
+ /* falls through */
+ case "last":
+ while ( (node = node.nextSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ return true;
+ }
+ };
+ },
+
+ "PSEUDO": function( pseudo, argument, context, xml ) {
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ var fn = Expr.pseudos[ pseudo ] || Expr.pseudos[ pseudo.toLowerCase() ];
+
+ if ( !fn ) {
+ Sizzle.error( "unsupported pseudo: " + pseudo );
+ }
+
+ // The user may set fn.sizzleFilter to indicate
+ // that arguments are needed to create the filter function
+ // just as Sizzle does
+ if ( !fn.sizzleFilter ) {
+ return fn;
+ }
+
+ return fn( argument, context, xml );
+ }
+ },
+
+ pseudos: {
+ "not": markFunction(function( selector, context, xml ) {
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var matcher = compile( selector.replace( rtrim, "$1" ), context, xml );
+ return function( elem ) {
+ return !matcher( elem );
+ };
+ }),
+
+ "enabled": function( elem ) {
+ return elem.disabled === false;
+ },
+
+ "disabled": function( elem ) {
+ return elem.disabled === true;
+ },
+
+ "checked": function( elem ) {
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+ },
+
+ "selected": function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ "parent": function( elem ) {
+ return !Expr.pseudos["empty"]( elem );
+ },
+
+ "empty": function( elem ) {
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)),
+ // not comment, processing instructions, or others
+ // Thanks to Diego Perini for the nodeName shortcut
+ // Greater than "@" means alpha characters (specifically not starting with "#" or "?")
+ var nodeType;
+ elem = elem.firstChild;
+ while ( elem ) {
+ if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) {
+ return false;
+ }
+ elem = elem.nextSibling;
+ }
+ return true;
+ },
+
+ "contains": markFunction(function( text ) {
+ return function( elem ) {
+ return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
+ };
+ }),
+
+ "has": markFunction(function( selector ) {
+ return function( elem ) {
+ return Sizzle( selector, elem ).length > 0;
+ };
+ }),
+
+ "header": function( elem ) {
+ return rheader.test( elem.nodeName );
+ },
+
+ "text": function( elem ) {
+ var type, attr;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" &&
+ (type = elem.type) === "text" &&
+ ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type );
+ },
+
+ // Input types
+ "radio": createInputFunction("radio"),
+ "checkbox": createInputFunction("checkbox"),
+ "file": createInputFunction("file"),
+ "password": createInputFunction("password"),
+ "image": createInputFunction("image"),
+
+ "submit": createButtonFunction("submit"),
+ "reset": createButtonFunction("reset"),
+
+ "button": function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "input": function( elem ) {
+ return rinputs.test( elem.nodeName );
+ },
+
+ "focus": function( elem ) {
+ var doc = elem.ownerDocument;
+ return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href);
+ },
+
+ "active": function( elem ) {
+ return elem === elem.ownerDocument.activeElement;
+ }
+ },
+
+ setFilters: {
+ "first": function( elements, argument, not ) {
+ return not ? elements.slice( 1 ) : [ elements[0] ];
+ },
+
+ "last": function( elements, argument, not ) {
+ var elem = elements.pop();
+ return not ? elements : [ elem ];
+ },
+
+ "even": function( elements, argument, not ) {
+ var results = [],
+ i = not ? 1 : 0,
+ len = elements.length;
+ for ( ; i < len; i = i + 2 ) {
+ results.push( elements[i] );
+ }
+ return results;
+ },
+
+ "odd": function( elements, argument, not ) {
+ var results = [],
+ i = not ? 0 : 1,
+ len = elements.length;
+ for ( ; i < len; i = i + 2 ) {
+ results.push( elements[i] );
+ }
+ return results;
+ },
+
+ "lt": function( elements, argument, not ) {
+ return not ? elements.slice( +argument ) : elements.slice( 0, +argument );
+ },
+
+ "gt": function( elements, argument, not ) {
+ return not ? elements.slice( 0, +argument + 1 ) : elements.slice( +argument + 1 );
+ },
+
+ "eq": function( elements, argument, not ) {
+ var elem = elements.splice( +argument, 1 );
+ return not ? elements : elem;
+ }
+ }
+};
+
+// Deprecated
+Expr.setFilters["nth"] = Expr.setFilters["eq"];
+
+// Back-compat
+Expr.filters = Expr.pseudos;
+
+// IE6/7 return a modified href
+if ( !assertHrefNotNormalized ) {
+ Expr.attrHandle = {
+ "href": function( elem ) {
+ return elem.getAttribute( "href", 2 );
+ },
+ "type": function( elem ) {
+ return elem.getAttribute("type");
+ }
+ };
+}
+
+// Add getElementsByName if usable
+if ( assertUsableName ) {
+ Expr.order.push("NAME");
+ Expr.find["NAME"] = function( name, context ) {
+ if ( typeof context.getElementsByName !== strundefined ) {
+ return context.getElementsByName( name );
+ }
+ };
+}
+
+// Add getElementsByClassName if usable
+if ( assertUsableClassName ) {
+ Expr.order.splice( 1, 0, "CLASS" );
+ Expr.find["CLASS"] = function( className, context, xml ) {
+ if ( typeof context.getElementsByClassName !== strundefined && !xml ) {
+ return context.getElementsByClassName( className );
+ }
+ };
+}
+
+// If slice is not available, provide a backup
+try {
+ slice.call( docElem.childNodes, 0 )[0].nodeType;
+} catch ( e ) {
+ slice = function( i ) {
+ var elem, results = [];
+ for ( ; (elem = this[i]); i++ ) {
+ results.push( elem );
+ }
+ return results;
+ };
+}
+
+var isXML = Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+// Element contains another
+var contains = Sizzle.contains = docElem.compareDocumentPosition ?
+ function( a, b ) {
+ return !!( a.compareDocumentPosition( b ) & 16 );
+ } :
+ docElem.contains ?
+ function( a, b ) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) );
+ } :
+ function( a, b ) {
+ while ( (b = b.parentNode) ) {
+ if ( b === a ) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+var getText = Sizzle.getText = function( elem ) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if ( nodeType ) {
+ if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (see #11153)
+ if ( typeof elem.textContent === "string" ) {
+ return elem.textContent;
+ } else {
+ // Traverse its children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+ // Do not include comment or processing instruction nodes
+ } else {
+
+ // If no nodeType, this is expected to be an array
+ for ( ; (node = elem[i]); i++ ) {
+ // Do not traverse comment nodes
+ ret += getText( node );
+ }
+ }
+ return ret;
+};
+
+Sizzle.attr = function( elem, name ) {
+ var attr,
+ xml = isXML( elem );
+
+ if ( !xml ) {
+ name = name.toLowerCase();
+ }
+ if ( Expr.attrHandle[ name ] ) {
+ return Expr.attrHandle[ name ]( elem );
+ }
+ if ( assertAttributes || xml ) {
+ return elem.getAttribute( name );
+ }
+ attr = elem.getAttributeNode( name );
+ return attr ?
+ typeof elem[ name ] === "boolean" ?
+ elem[ name ] ? name : null :
+ attr.specified ? attr.value : null :
+ null;
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+// Check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+// Thus far that includes Google Chrome.
+[0, 0].sort(function() {
+ return (baseHasDuplicate = 0);
+});
+
+
+if ( docElem.compareDocumentPosition ) {
+ sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ return ( !a.compareDocumentPosition || !b.compareDocumentPosition ?
+ a.compareDocumentPosition :
+ a.compareDocumentPosition(b) & 4
+ ) ? -1 : 1;
+ };
+
+} else {
+ sortOrder = function( a, b ) {
+ // The nodes are identical, we can exit early
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+
+ // Fallback to using sourceIndex (in IE) if it's available on both nodes
+ } else if ( a.sourceIndex && b.sourceIndex ) {
+ return a.sourceIndex - b.sourceIndex;
+ }
+
+ var al, bl,
+ ap = [],
+ bp = [],
+ aup = a.parentNode,
+ bup = b.parentNode,
+ cur = aup;
+
+ // If the nodes are siblings (or identical) we can do a quick check
+ if ( aup === bup ) {
+ return siblingCheck( a, b );
+
+ // If no parents were found then the nodes are disconnected
+ } else if ( !aup ) {
+ return -1;
+
+ } else if ( !bup ) {
+ return 1;
+ }
+
+ // Otherwise they're somewhere else in the tree so we need
+ // to build up a full list of the parentNodes for comparison
+ while ( cur ) {
+ ap.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ cur = bup;
+
+ while ( cur ) {
+ bp.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ al = ap.length;
+ bl = bp.length;
+
+ // Start walking down the tree looking for a discrepancy
+ for ( var i = 0; i < al && i < bl; i++ ) {
+ if ( ap[i] !== bp[i] ) {
+ return siblingCheck( ap[i], bp[i] );
+ }
+ }
+
+ // We ended someplace up the tree so do a sibling check
+ return i === al ?
+ siblingCheck( a, bp[i], -1 ) :
+ siblingCheck( ap[i], b, 1 );
+ };
+
+ siblingCheck = function( a, b, ret ) {
+ if ( a === b ) {
+ return ret;
+ }
+
+ var cur = a.nextSibling;
+
+ while ( cur ) {
+ if ( cur === b ) {
+ return -1;
+ }
+
+ cur = cur.nextSibling;
+ }
+
+ return 1;
+ };
+}
+
+// Document sorting and removing duplicates
+Sizzle.uniqueSort = function( results ) {
+ var elem,
+ i = 1;
+
+ if ( sortOrder ) {
+ hasDuplicate = baseHasDuplicate;
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ for ( ; (elem = results[i]); i++ ) {
+ if ( elem === results[ i - 1 ] ) {
+ results.splice( i--, 1 );
+ }
+ }
+ }
+ }
+
+ return results;
+};
+
+function multipleContexts( selector, contexts, results, seed ) {
+ var i = 0,
+ len = contexts.length;
+ for ( ; i < len; i++ ) {
+ Sizzle( selector, contexts[i], results, seed );
+ }
+}
+
+function handlePOSGroup( selector, posfilter, argument, contexts, seed, not ) {
+ var results,
+ fn = Expr.setFilters[ posfilter.toLowerCase() ];
+
+ if ( !fn ) {
+ Sizzle.error( posfilter );
+ }
+
+ if ( selector || !(results = seed) ) {
+ multipleContexts( selector || "*", contexts, (results = []), seed );
+ }
+
+ return results.length > 0 ? fn( results, argument, not ) : [];
+}
+
+function handlePOS( selector, context, results, seed, groups ) {
+ var match, not, anchor, ret, elements, currentContexts, part, lastIndex,
+ i = 0,
+ len = groups.length,
+ rpos = matchExpr["POS"],
+ // This is generated here in case matchExpr["POS"] is extended
+ rposgroups = new RegExp( "^" + rpos.source + "(?!" + whitespace + ")", "i" ),
+ // This is for making sure non-participating
+ // matching groups are represented cross-browser (IE6-8)
+ setUndefined = function() {
+ var i = 1,
+ len = arguments.length - 2;
+ for ( ; i < len; i++ ) {
+ if ( arguments[i] === undefined ) {
+ match[i] = undefined;
+ }
+ }
+ };
+
+ for ( ; i < len; i++ ) {
+ // Reset regex index to 0
+ rpos.exec("");
+ selector = groups[i];
+ ret = [];
+ anchor = 0;
+ elements = seed;
+ while ( (match = rpos.exec( selector )) ) {
+ lastIndex = rpos.lastIndex = match.index + match[0].length;
+ if ( lastIndex > anchor ) {
+ part = selector.slice( anchor, match.index );
+ anchor = lastIndex;
+ currentContexts = [ context ];
+
+ if ( rcombinators.test(part) ) {
+ if ( elements ) {
+ currentContexts = elements;
+ }
+ elements = seed;
+ }
+
+ if ( (not = rendsWithNot.test( part )) ) {
+ part = part.slice( 0, -5 ).replace( rcombinators, "$&*" );
+ }
+
+ if ( match.length > 1 ) {
+ match[0].replace( rposgroups, setUndefined );
+ }
+ elements = handlePOSGroup( part, match[1], match[2], currentContexts, elements, not );
+ }
+ }
+
+ if ( elements ) {
+ ret = ret.concat( elements );
+
+ if ( (part = selector.slice( anchor )) && part !== ")" ) {
+ if ( rcombinators.test(part) ) {
+ multipleContexts( part, ret, results, seed );
+ } else {
+ Sizzle( part, context, results, seed ? seed.concat(elements) : elements );
+ }
+ } else {
+ push.apply( results, ret );
+ }
+ } else {
+ Sizzle( selector, context, results, seed );
+ }
+ }
+
+ // Do not sort if this is a single filter
+ return len === 1 ? results : Sizzle.uniqueSort( results );
+}
+
+function tokenize( selector, context, xml ) {
+ var tokens, soFar, type,
+ groups = [],
+ i = 0,
+
+ // Catch obvious selector issues: terminal ")"; nonempty fallback match
+ // rselector never fails to match *something*
+ match = rselector.exec( selector ),
+ matched = !match.pop() && !match.pop(),
+ selectorGroups = matched && selector.match( rgroups ) || [""],
+
+ preFilters = Expr.preFilter,
+ filters = Expr.filter,
+ checkContext = !xml && context !== document;
+
+ for ( ; (soFar = selectorGroups[i]) != null && matched; i++ ) {
+ groups.push( tokens = [] );
+
+ // Need to make sure we're within a narrower context if necessary
+ // Adding a descendant combinator will generate what is needed
+ if ( checkContext ) {
+ soFar = " " + soFar;
+ }
+
+ while ( soFar ) {
+ matched = false;
+
+ // Combinators
+ if ( (match = rcombinators.exec( soFar )) ) {
+ soFar = soFar.slice( match[0].length );
+
+ // Cast descendant combinators to space
+ matched = tokens.push({ part: match.pop().replace( rtrim, " " ), captures: match });
+ }
+
+ // Filters
+ for ( type in filters ) {
+ if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
+ (match = preFilters[ type ]( match, context, xml )) ) ) {
+
+ soFar = soFar.slice( match.shift().length );
+ matched = tokens.push({ part: type, captures: match });
+ }
+ }
+
+ if ( !matched ) {
+ break;
+ }
+ }
+ }
+
+ if ( !matched ) {
+ Sizzle.error( selector );
+ }
+
+ return groups;
+}
+
+function addCombinator( matcher, combinator, context ) {
+ var dir = combinator.dir,
+ doneName = done++;
+
+ if ( !matcher ) {
+ // If there is no matcher to check, check against the context
+ matcher = function( elem ) {
+ return elem === context;
+ };
+ }
+ return combinator.first ?
+ function( elem, context ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 ) {
+ return matcher( elem, context ) && elem;
+ }
+ }
+ } :
+ function( elem, context ) {
+ var cache,
+ dirkey = doneName + "." + dirruns,
+ cachedkey = dirkey + "." + cachedruns;
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 ) {
+ if ( (cache = elem[ expando ]) === cachedkey ) {
+ return elem.sizset;
+ } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) {
+ if ( elem.sizset ) {
+ return elem;
+ }
+ } else {
+ elem[ expando ] = cachedkey;
+ if ( matcher( elem, context ) ) {
+ elem.sizset = true;
+ return elem;
+ }
+ elem.sizset = false;
+ }
+ }
+ }
+ };
+}
+
+function addMatcher( higher, deeper ) {
+ return higher ?
+ function( elem, context ) {
+ var result = deeper( elem, context );
+ return result && higher( result === true ? elem : result, context );
+ } :
+ deeper;
+}
+
+// ["TAG", ">", "ID", " ", "CLASS"]
+function matcherFromTokens( tokens, context, xml ) {
+ var token, matcher,
+ i = 0;
+
+ for ( ; (token = tokens[i]); i++ ) {
+ if ( Expr.relative[ token.part ] ) {
+ matcher = addCombinator( matcher, Expr.relative[ token.part ], context );
+ } else {
+ token.captures.push( context, xml );
+ matcher = addMatcher( matcher, Expr.filter[ token.part ].apply( null, token.captures ) );
+ }
+ }
+
+ return matcher;
+}
+
+function matcherFromGroupMatchers( matchers ) {
+ return function( elem, context ) {
+ var matcher,
+ j = 0;
+ for ( ; (matcher = matchers[j]); j++ ) {
+ if ( matcher(elem, context) ) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+var compile = Sizzle.compile = function( selector, context, xml ) {
+ var tokens, group, i,
+ cached = compilerCache[ selector ];
+
+ // Return a cached group function if already generated (context dependent)
+ if ( cached && cached.context === context ) {
+ return cached;
+ }
+
+ // Generate a function of recursive functions that can be used to check each element
+ group = tokenize( selector, context, xml );
+ for ( i = 0; (tokens = group[i]); i++ ) {
+ group[i] = matcherFromTokens( tokens, context, xml );
+ }
+
+ // Cache the compiled function
+ cached = compilerCache[ selector ] = matcherFromGroupMatchers( group );
+ cached.context = context;
+ cached.runs = cached.dirruns = 0;
+ cachedSelectors.push( selector );
+ // Ensure only the most recent are cached
+ if ( cachedSelectors.length > Expr.cacheLength ) {
+ delete compilerCache[ cachedSelectors.shift() ];
+ }
+ return cached;
+};
+
+Sizzle.matches = function( expr, elements ) {
+ return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+ return Sizzle( expr, null, null, [ elem ] ).length > 0;
+};
+
+var select = function( selector, context, results, seed, xml ) {
+ // Remove excessive whitespace
+ selector = selector.replace( rtrim, "$1" );
+ var elements, matcher, i, len, elem, token,
+ type, findContext, notTokens,
+ match = selector.match( rgroups ),
+ tokens = selector.match( rtokens ),
+ contextNodeType = context.nodeType;
+
+ // POS handling
+ if ( matchExpr["POS"].test(selector) ) {
+ return handlePOS( selector, context, results, seed, match );
+ }
+
+ if ( seed ) {
+ elements = slice.call( seed, 0 );
+
+ // To maintain document order, only narrow the
+ // set if there is one group
+ } else if ( match && match.length === 1 ) {
+
+ // Take a shortcut and set the context if the root selector is an ID
+ if ( tokens.length > 1 && contextNodeType === 9 && !xml &&
+ (match = matchExpr["ID"].exec( tokens[0] )) ) {
+
+ context = Expr.find["ID"]( match[1], context, xml )[0];
+ if ( !context ) {
+ return results;
+ }
+
+ selector = selector.slice( tokens.shift().length );
+ }
+
+ findContext = ( (match = rsibling.exec( tokens[0] )) && !match.index && context.parentNode ) || context;
+
+ // Get the last token, excluding :not
+ notTokens = tokens.pop();
+ token = notTokens.split(":not")[0];
+
+ for ( i = 0, len = Expr.order.length; i < len; i++ ) {
+ type = Expr.order[i];
+
+ if ( (match = matchExpr[ type ].exec( token )) ) {
+ elements = Expr.find[ type ]( (match[1] || "").replace( rbackslash, "" ), findContext, xml );
+
+ if ( elements == null ) {
+ continue;
+ }
+
+ if ( token === notTokens ) {
+ selector = selector.slice( 0, selector.length - notTokens.length ) +
+ token.replace( matchExpr[ type ], "" );
+
+ if ( !selector ) {
+ push.apply( results, slice.call(elements, 0) );
+ }
+ }
+ break;
+ }
+ }
+ }
+
+ // Only loop over the given elements once
+ // If selector is empty, we're already done
+ if ( selector ) {
+ matcher = compile( selector, context, xml );
+ dirruns = matcher.dirruns++;
+
+ if ( elements == null ) {
+ elements = Expr.find["TAG"]( "*", (rsibling.test( selector ) && context.parentNode) || context );
+ }
+ for ( i = 0; (elem = elements[i]); i++ ) {
+ cachedruns = matcher.runs++;
+ if ( matcher(elem, context) ) {
+ results.push( elem );
+ }
+ }
+ }
+
+ return results;
+};
+
+if ( document.querySelectorAll ) {
+ (function() {
+ var disconnectedMatch,
+ oldSelect = select,
+ rescape = /'|\\/g,
+ rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,
+ rbuggyQSA = [],
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ // A support test would require too much code (would include document ready)
+ // just skip matchesSelector for :active
+ rbuggyMatches = [":active"],
+ matches = docElem.matchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.webkitMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector;
+
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert(function( div ) {
+ div.innerHTML = "<select><option selected></option></select>";
+
+ // IE8 - Some boolean attributes are not treated correctly
+ if ( !div.querySelectorAll("[selected]").length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" );
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here (do not put tests after this one)
+ if ( !div.querySelectorAll(":checked").length ) {
+ rbuggyQSA.push(":checked");
+ }
+ });
+
+ assert(function( div ) {
+
+ // Opera 10-12/IE9 - ^= $= *= and empty values
+ // Should not select anything
+ div.innerHTML = "<p test=''></p>";
+ if ( div.querySelectorAll("[test^='']").length ) {
+ rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" );
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here (do not put tests after this one)
+ div.innerHTML = "<input type='hidden'>";
+ if ( !div.querySelectorAll(":enabled").length ) {
+ rbuggyQSA.push(":enabled", ":disabled");
+ }
+ });
+
+ rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
+
+ select = function( selector, context, results, seed, xml ) {
+ // Only use querySelectorAll when not filtering,
+ // when this is not xml,
+ // and when no QSA bugs apply
+ if ( !seed && !xml && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
+ if ( context.nodeType === 9 ) {
+ try {
+ push.apply( results, slice.call(context.querySelectorAll( selector ), 0) );
+ return results;
+ } catch(qsaError) {}
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ var old = context.getAttribute("id"),
+ nid = old || expando,
+ newContext = rsibling.test( selector ) && context.parentNode || context;
+
+ if ( old ) {
+ nid = nid.replace( rescape, "\\$&" );
+ } else {
+ context.setAttribute( "id", nid );
+ }
+
+ try {
+ push.apply( results, slice.call( newContext.querySelectorAll(
+ selector.replace( rgroups, "[id='" + nid + "'] $&" )
+ ), 0 ) );
+ return results;
+ } catch(qsaError) {
+ } finally {
+ if ( !old ) {
+ context.removeAttribute("id");
+ }
+ }
+ }
+ }
+
+ return oldSelect( selector, context, results, seed, xml );
+ };
+
+ if ( matches ) {
+ assert(function( div ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ disconnectedMatch = matches.call( div, "div" );
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ try {
+ matches.call( div, "[test!='']:sizzle" );
+ rbuggyMatches.push( Expr.match.PSEUDO );
+ } catch ( e ) {}
+ });
+
+ // rbuggyMatches always contains :active, so no need for a length check
+ rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") );
+
+ Sizzle.matchesSelector = function( elem, expr ) {
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace( rattributeQuotes, "='$1']" );
+
+ // rbuggyMatches always contains :active, so no need for an existence check
+ if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && (!rbuggyQSA || !rbuggyQSA.test( expr )) ) {
+ try {
+ var ret = matches.call( elem, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11 ) {
+ return ret;
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle( expr, null, null, [ elem ] ).length > 0;
+ };
+ }
+ })();
+}
+
+// Override sizzle attribute retrieval
+Sizzle.attr = jQuery.attr;
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.pseudos;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+})( window );
+var runtil = /Until$/,
+ rparentsprev = /^(?:parents|prev(?:Until|All))/,
+ isSimple = /^.[^:#\[\.,]*$/,
+ rneedsContext = jQuery.expr.match.needsContext,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.fn.extend({
+ find: function( selector ) {
+ var i, l, length, n, r, ret,
+ self = this;
+
+ if ( typeof selector !== "string" ) {
+ return jQuery( selector ).filter(function() {
+ for ( i = 0, l = self.length; i < l; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ });
+ }
+
+ ret = this.pushStack( "", "find", selector );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ length = ret.length;
+ jQuery.find( selector, this[i], ret );
+
+ if ( i > 0 ) {
+ // Make sure that the results are unique
+ for ( n = length; n < ret.length; n++ ) {
+ for ( r = 0; r < length; r++ ) {
+ if ( ret[r] === ret[n] ) {
+ ret.splice(n--, 1);
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ return ret;
+ },
+
+ has: function( target ) {
+ var i,
+ targets = jQuery( target, this ),
+ len = targets.length;
+
+ return this.filter(function() {
+ for ( i = 0; i < len; i++ ) {
+ if ( jQuery.contains( this, targets[i] ) ) {
+ return true;
+ }
+ }
+ });
+ },
+
+ not: function( selector ) {
+ return this.pushStack( winnow(this, selector, false), "not", selector);
+ },
+
+ filter: function( selector ) {
+ return this.pushStack( winnow(this, selector, true), "filter", selector );
+ },
+
+ is: function( selector ) {
+ return !!selector && (
+ typeof selector === "string" ?
+ // If this is a positional/relative selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ rneedsContext.test( selector ) ?
+ jQuery( selector, this.context ).index( this[0] ) >= 0 :
+ jQuery.filter( selector, this ).length > 0 :
+ this.filter( selector ).length > 0 );
+ },
+
+ closest: function( selectors, context ) {
+ var cur,
+ i = 0,
+ l = this.length,
+ ret = [],
+ pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ?
+ jQuery( selectors, context || this.context ) :
+ 0;
+
+ for ( ; i < l; i++ ) {
+ cur = this[i];
+
+ while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
+ ret.push( cur );
+ break;
+ }
+ cur = cur.parentNode;
+ }
+ }
+
+ ret = ret.length > 1 ? jQuery.unique( ret ) : ret;
+
+ return this.pushStack( ret, "closest", selectors );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+
+ // No argument, return index in parent
+ if ( !elem ) {
+ return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1;
+ }
+
+ // index in selector
+ if ( typeof elem === "string" ) {
+ return jQuery.inArray( this[0], jQuery( elem ) );
+ }
+
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this );
+ },
+
+ add: function( selector, context ) {
+ var set = typeof selector === "string" ?
+ jQuery( selector, context ) :
+ jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
+ all = jQuery.merge( this.get(), set );
+
+ return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+ all :
+ jQuery.unique( all ) );
+ },
+
+ addBack: function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter(selector)
+ );
+ }
+});
+
+jQuery.fn.andSelf = jQuery.fn.addBack;
+
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+ return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
+
+function sibling( cur, dir ) {
+ do {
+ cur = cur[ dir ];
+ } while ( cur && cur.nodeType !== 1 );
+
+ return cur;
+}
+
+jQuery.each({
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return jQuery.dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return sibling( elem, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return sibling( elem, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return jQuery.dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return jQuery.dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );
+ },
+ children: function( elem ) {
+ return jQuery.sibling( elem.firstChild );
+ },
+ contents: function( elem ) {
+ return jQuery.nodeName( elem, "iframe" ) ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.merge( [], elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var ret = jQuery.map( this, fn, until );
+
+ if ( !runtil.test( name ) ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ ret = jQuery.filter( selector, ret );
+ }
+
+ ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
+
+ if ( this.length > 1 && rparentsprev.test( name ) ) {
+ ret = ret.reverse();
+ }
+
+ return this.pushStack( ret, name, core_slice.call( arguments ).join(",") );
+ };
+});
+
+jQuery.extend({
+ filter: function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return elems.length === 1 ?
+ jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
+ jQuery.find.matches(expr, elems);
+ },
+
+ dir: function( elem, dir, until ) {
+ var matched = [],
+ cur = elem[ dir ];
+
+ while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+ if ( cur.nodeType === 1 ) {
+ matched.push( cur );
+ }
+ cur = cur[dir];
+ }
+ return matched;
+ },
+
+ sibling: function( n, elem ) {
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ r.push( n );
+ }
+ }
+
+ return r;
+ }
+});
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, keep ) {
+
+ // Can't pass null or undefined to indexOf in Firefox 4
+ // Set to 0 to skip string check
+ qualifier = qualifier || 0;
+
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ var retVal = !!qualifier.call( elem, i, elem );
+ return retVal === keep;
+ });
+
+ } else if ( qualifier.nodeType ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ return ( elem === qualifier ) === keep;
+ });
+
+ } else if ( typeof qualifier === "string" ) {
+ var filtered = jQuery.grep(elements, function( elem ) {
+ return elem.nodeType === 1;
+ });
+
+ if ( isSimple.test( qualifier ) ) {
+ return jQuery.filter(qualifier, filtered, !keep);
+ } else {
+ qualifier = jQuery.filter( qualifier, filtered );
+ }
+ }
+
+ return jQuery.grep(elements, function( elem, i ) {
+ return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep;
+ });
+}
+function createSafeFragment( document ) {
+ var list = nodeNames.split( "|" ),
+ safeFrag = document.createDocumentFragment();
+
+ if ( safeFrag.createElement ) {
+ while ( list.length ) {
+ safeFrag.createElement(
+ list.pop()
+ );
+ }
+ }
+ return safeFrag;
+}
+
+var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
+ "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
+ rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g,
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnoInnerhtml = /<(?:script|style|link)/i,
+ rnocache = /<(?:script|object|embed|option|style)/i,
+ rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
+ rcheckableType = /^(?:checkbox|radio)$/,
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /\/(java|ecma)script/i,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)|[\]\-]{2}>\s*$/g,
+ wrapMap = {
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+ legend: [ 1, "<fieldset>", "</fieldset>" ],
+ thead: [ 1, "<table>", "</table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+ area: [ 1, "<map>", "</map>" ],
+ _default: [ 0, "", "" ]
+ },
+ safeFragment = createSafeFragment( document ),
+ fragmentDiv = safeFragment.appendChild( document.createElement("div") );
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
+// unless wrapped in a div with non-breaking characters in front of it.
+if ( !jQuery.support.htmlSerialize ) {
+ wrapMap._default = [ 1, "X<div>", "</div>" ];
+}
+
+jQuery.fn.extend({
+ text: function( value ) {
+ return jQuery.access( this, function( value ) {
+ return value === undefined ?
+ jQuery.text( this ) :
+ this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) );
+ }, null, value, arguments.length );
+ },
+
+ wrapAll: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapAll( html.call(this, i) );
+ });
+ }
+
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+ if ( this[0].parentNode ) {
+ wrap.insertBefore( this[0] );
+ }
+
+ wrap.map(function() {
+ var elem = this;
+
+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+ elem = elem.firstChild;
+ }
+
+ return elem;
+ }).append( this );
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapInner( html.call(this, i) );
+ });
+ }
+
+ return this.each(function() {
+ var self = jQuery( this ),
+ contents = self.contents();
+
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ });
+ },
+
+ wrap: function( html ) {
+ var isFunction = jQuery.isFunction( html );
+
+ return this.each(function(i) {
+ jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
+ });
+ },
+
+ unwrap: function() {
+ return this.parent().each(function() {
+ if ( !jQuery.nodeName( this, "body" ) ) {
+ jQuery( this ).replaceWith( this.childNodes );
+ }
+ }).end();
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 ) {
+ this.appendChild( elem );
+ }
+ });
+ },
+
+ prepend: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 ) {
+ this.insertBefore( elem, this.firstChild );
+ }
+ });
+ },
+
+ before: function() {
+ if ( !isDisconnected( this[0] ) ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this );
+ });
+ }
+
+ if ( arguments.length ) {
+ var set = jQuery.clean( arguments );
+ return this.pushStack( jQuery.merge( set, this ), "before", this.selector );
+ }
+ },
+
+ after: function() {
+ if ( !isDisconnected( this[0] ) ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ });
+ }
+
+ if ( arguments.length ) {
+ var set = jQuery.clean( arguments );
+ return this.pushStack( jQuery.merge( this, set ), "after", this.selector );
+ }
+ },
+
+ // keepData is for internal use only--do not document
+ remove: function( selector, keepData ) {
+ var elem,
+ i = 0;
+
+ for ( ; (elem = this[i]) != null; i++ ) {
+ if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+ if ( !keepData && elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ jQuery.cleanData( [ elem ] );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+ }
+ }
+
+ return this;
+ },
+
+ empty: function() {
+ var elem,
+ i = 0;
+
+ for ( ; (elem = this[i]) != null; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ }
+
+ // Remove any remaining nodes
+ while ( elem.firstChild ) {
+ elem.removeChild( elem.firstChild );
+ }
+ }
+
+ return this;
+ },
+
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map( function () {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ });
+ },
+
+ html: function( value ) {
+ return jQuery.access( this, function( value ) {
+ var elem = this[0] || {},
+ i = 0,
+ l = this.length;
+
+ if ( value === undefined ) {
+ return elem.nodeType === 1 ?
+ elem.innerHTML.replace( rinlinejQuery, "" ) :
+ undefined;
+ }
+
+ // See if we can take a shortcut and just use innerHTML
+ if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+ ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) &&
+ ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&
+ !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) {
+
+ value = value.replace( rxhtmlTag, "<$1></$2>" );
+
+ try {
+ for (; i < l; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ elem = this[i] || {};
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName( "*" ) );
+ elem.innerHTML = value;
+ }
+ }
+
+ elem = 0;
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch(e) {}
+ }
+
+ if ( elem ) {
+ this.empty().append( value );
+ }
+ }, null, value, arguments.length );
+ },
+
+ replaceWith: function( value ) {
+ if ( !isDisconnected( this[0] ) ) {
+ // Make sure that the elements are removed from the DOM before they are inserted
+ // this can help fix replacing a parent with child elements
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function(i) {
+ var self = jQuery(this), old = self.html();
+ self.replaceWith( value.call( this, i, old ) );
+ });
+ }
+
+ if ( typeof value !== "string" ) {
+ value = jQuery( value ).detach();
+ }
+
+ return this.each(function() {
+ var next = this.nextSibling,
+ parent = this.parentNode;
+
+ jQuery( this ).remove();
+
+ if ( next ) {
+ jQuery(next).before( value );
+ } else {
+ jQuery(parent).append( value );
+ }
+ });
+ }
+
+ return this.length ?
+ this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) :
+ this;
+ },
+
+ detach: function( selector ) {
+ return this.remove( selector, true );
+ },
+
+ domManip: function( args, table, callback ) {
+
+ // Flatten any nested arrays
+ args = [].concat.apply( [], args );
+
+ var results, first, fragment, iNoClone,
+ i = 0,
+ value = args[0],
+ scripts = [],
+ l = this.length;
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) {
+ return this.each(function() {
+ jQuery(this).domManip( args, table, callback );
+ });
+ }
+
+ if ( jQuery.isFunction(value) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ args[0] = value.call( this, i, table ? self.html() : undefined );
+ self.domManip( args, table, callback );
+ });
+ }
+
+ if ( this[0] ) {
+ results = jQuery.buildFragment( args, this, scripts );
+ fragment = results.fragment;
+ first = fragment.firstChild;
+
+ if ( fragment.childNodes.length === 1 ) {
+ fragment = first;
+ }
+
+ if ( first ) {
+ table = table && jQuery.nodeName( first, "tr" );
+
+ // Use the original fragment for the last item instead of the first because it can end up
+ // being emptied incorrectly in certain situations (#8070).
+ // Fragments from the fragment cache must always be cloned and never used in place.
+ for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) {
+ callback.call(
+ table && jQuery.nodeName( this[i], "table" ) ?
+ findOrAppend( this[i], "tbody" ) :
+ this[i],
+ i === iNoClone ?
+ fragment :
+ jQuery.clone( fragment, true, true )
+ );
+ }
+ }
+
+ // Fix #11809: Avoid leaking memory
+ fragment = first = null;
+
+ if ( scripts.length ) {
+ jQuery.each( scripts, function( i, elem ) {
+ if ( elem.src ) {
+ if ( jQuery.ajax ) {
+ jQuery.ajax({
+ url: elem.src,
+ type: "GET",
+ dataType: "script",
+ async: false,
+ global: false,
+ "throws": true
+ });
+ } else {
+ jQuery.error("no ajax");
+ }
+ } else {
+ jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+ });
+ }
+ }
+
+ return this;
+ }
+});
+
+function findOrAppend( elem, tag ) {
+ return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) );
+}
+
+function cloneCopyEvent( src, dest ) {
+
+ if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+ return;
+ }
+
+ var type, i, l,
+ oldData = jQuery._data( src ),
+ curData = jQuery._data( dest, oldData ),
+ events = oldData.events;
+
+ if ( events ) {
+ delete curData.handle;
+ curData.events = {};
+
+ for ( type in events ) {
+ for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type, events[ type ][ i ] );
+ }
+ }
+ }
+
+ // make the cloned public data object a copy from the original
+ if ( curData.data ) {
+ curData.data = jQuery.extend( {}, curData.data );
+ }
+}
+
+function cloneFixAttributes( src, dest ) {
+ var nodeName;
+
+ // We do not need to do anything for non-Elements
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ // clearAttributes removes the attributes, which we don't want,
+ // but also removes the attachEvent events, which we *do* want
+ if ( dest.clearAttributes ) {
+ dest.clearAttributes();
+ }
+
+ // mergeAttributes, in contrast, only merges back on the
+ // original attributes, not the events
+ if ( dest.mergeAttributes ) {
+ dest.mergeAttributes( src );
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ if ( nodeName === "object" ) {
+ // IE6-10 improperly clones children of object elements using classid.
+ // IE10 throws NoModificationAllowedError if parent is null, #12132.
+ if ( dest.parentNode ) {
+ dest.outerHTML = src.outerHTML;
+ }
+
+ // This path appears unavoidable for IE9. When cloning an object
+ // element in IE9, the outerHTML strategy above is not sufficient.
+ // If the src has innerHTML and the destination does not,
+ // copy the src.innerHTML into the dest.innerHTML. #10324
+ if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) {
+ dest.innerHTML = src.innerHTML;
+ }
+
+ } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+
+ dest.defaultChecked = dest.checked = src.checked;
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if ( dest.value !== src.value ) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if ( nodeName === "option" ) {
+ dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+
+ // IE blanks contents when cloning scripts
+ } else if ( nodeName === "script" && dest.text !== src.text ) {
+ dest.text = src.text;
+ }
+
+ // Event data gets referenced instead of copied if the expando
+ // gets copied too
+ dest.removeAttribute( jQuery.expando );
+}
+
+jQuery.buildFragment = function( args, context, scripts ) {
+ var fragment, cacheable, cachehit,
+ first = args[ 0 ];
+
+ // Set context from what may come in as undefined or a jQuery collection or a node
+ context = context || document;
+ context = (context[0] || context).ownerDocument || context[0] || context;
+
+ // Ensure that an attr object doesn't incorrectly stand in as a document object
+ // Chrome and Firefox seem to allow this to occur and will throw exception
+ // Fixes #8950
+ if ( typeof context.createDocumentFragment === "undefined" ) {
+ context = document;
+ }
+
+ // Only cache "small" (1/2 KB) HTML strings that are associated with the main document
+ // Cloning options loses the selected state, so don't cache them
+ // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+ // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+ // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501
+ if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document &&
+ first.charAt(0) === "<" && !rnocache.test( first ) &&
+ (jQuery.support.checkClone || !rchecked.test( first )) &&
+ (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) {
+
+ // Mark cacheable and look for a hit
+ cacheable = true;
+ fragment = jQuery.fragments[ first ];
+ cachehit = fragment !== undefined;
+ }
+
+ if ( !fragment ) {
+ fragment = context.createDocumentFragment();
+ jQuery.clean( args, context, fragment, scripts );
+
+ // Update the cache, but only store false
+ // unless this is a second parsing of the same content
+ if ( cacheable ) {
+ jQuery.fragments[ first ] = cachehit && fragment;
+ }
+ }
+
+ return { fragment: fragment, cacheable: cacheable };
+};
+
+jQuery.fragments = {};
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var elems,
+ i = 0,
+ ret = [],
+ insert = jQuery( selector ),
+ l = insert.length,
+ parent = this.length === 1 && this[0].parentNode;
+
+ if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) {
+ insert[ original ]( this[0] );
+ return this;
+ } else {
+ for ( ; i < l; i++ ) {
+ elems = ( i > 0 ? this.clone(true) : this ).get();
+ jQuery( insert[i] )[ original ]( elems );
+ ret = ret.concat( elems );
+ }
+
+ return this.pushStack( ret, name, insert.selector );
+ }
+ };
+});
+
+function getAll( elem ) {
+ if ( typeof elem.getElementsByTagName !== "undefined" ) {
+ return elem.getElementsByTagName( "*" );
+
+ } else if ( typeof elem.querySelectorAll !== "undefined" ) {
+ return elem.querySelectorAll( "*" );
+
+ } else {
+ return [];
+ }
+}
+
+// Used in clean, fixes the defaultChecked property
+function fixDefaultChecked( elem ) {
+ if ( rcheckableType.test( elem.type ) ) {
+ elem.defaultChecked = elem.checked;
+ }
+}
+
+jQuery.extend({
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var srcElements,
+ destElements,
+ i,
+ clone;
+
+ if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) {
+ clone = elem.cloneNode( true );
+
+ // IE<=8 does not properly clone detached, unknown element nodes
+ } else {
+ fragmentDiv.innerHTML = elem.outerHTML;
+ fragmentDiv.removeChild( clone = fragmentDiv.firstChild );
+ }
+
+ if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+ // IE copies events bound via attachEvent when using cloneNode.
+ // Calling detachEvent on the clone will also remove the events
+ // from the original. In order to get around this, we use some
+ // proprietary methods to clear the events. Thanks to MooTools
+ // guys for this hotness.
+
+ cloneFixAttributes( elem, clone );
+
+ // Using Sizzle here is crazy slow, so we use getElementsByTagName instead
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ // Weird iteration because IE will replace the length property
+ // with an element if you are cloning the body and one of the
+ // elements on the page has a name or id of "length"
+ for ( i = 0; srcElements[i]; ++i ) {
+ // Ensure that the destination node is not null; Fixes #9587
+ if ( destElements[i] ) {
+ cloneFixAttributes( srcElements[i], destElements[i] );
+ }
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ cloneCopyEvent( elem, clone );
+
+ if ( deepDataAndEvents ) {
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ for ( i = 0; srcElements[i]; ++i ) {
+ cloneCopyEvent( srcElements[i], destElements[i] );
+ }
+ }
+ }
+
+ srcElements = destElements = null;
+
+ // Return the cloned set
+ return clone;
+ },
+
+ clean: function( elems, context, fragment, scripts ) {
+ var j, safe, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags,
+ i = 0,
+ ret = [];
+
+ // Ensure that context is a document
+ if ( !context || typeof context.createDocumentFragment === "undefined" ) {
+ context = document;
+ }
+
+ // Use the already-created safe fragment if context permits
+ for ( safe = context === document && safeFragment; (elem = elems[i]) != null; i++ ) {
+ if ( typeof elem === "number" ) {
+ elem += "";
+ }
+
+ if ( !elem ) {
+ continue;
+ }
+
+ // Convert html string into DOM nodes
+ if ( typeof elem === "string" ) {
+ if ( !rhtml.test( elem ) ) {
+ elem = context.createTextNode( elem );
+ } else {
+ // Ensure a safe container in which to render the html
+ safe = safe || createSafeFragment( context );
+ div = div || safe.appendChild( context.createElement("div") );
+
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(rxhtmlTag, "<$1></$2>");
+
+ // Go to html and back, then peel off extra wrappers
+ tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase();
+ wrap = wrapMap[ tag ] || wrapMap._default;
+ depth = wrap[0];
+ div.innerHTML = wrap[1] + elem + wrap[2];
+
+ // Move to the right depth
+ while ( depth-- ) {
+ div = div.lastChild;
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ hasBody = rtbody.test(elem);
+ tbody = tag === "table" && !hasBody ?
+ div.firstChild && div.firstChild.childNodes :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !hasBody ?
+ div.childNodes :
+ [];
+
+ for ( j = tbody.length - 1; j >= 0 ; --j ) {
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ }
+ }
+ }
+
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+ }
+
+ elem = div.childNodes;
+
+ // Remember the top-level container for proper cleanup
+ div = safe.lastChild;
+ }
+ }
+
+ if ( elem.nodeType ) {
+ ret.push( elem );
+ } else {
+ ret = jQuery.merge( ret, elem );
+ }
+ }
+
+ // Fix #11356: Clear elements from safeFragment
+ if ( div ) {
+ safe.removeChild( div );
+ elem = div = safe = null;
+ }
+
+ // Reset defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ if ( !jQuery.support.appendChecked ) {
+ for ( i = 0; (elem = ret[i]) != null; i++ ) {
+ if ( jQuery.nodeName( elem, "input" ) ) {
+ fixDefaultChecked( elem );
+ } else if ( typeof elem.getElementsByTagName !== "undefined" ) {
+ jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked );
+ }
+ }
+ }
+
+ // Append elements to a provided document fragment
+ if ( fragment ) {
+ // Special handling of each script element
+ handleScript = function( elem ) {
+ // Check if we consider it executable
+ if ( !elem.type || rscriptType.test( elem.type ) ) {
+ // Detach the script and store it in the scripts array (if provided) or the fragment
+ // Return truthy to indicate that it has been handled
+ return scripts ?
+ scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) :
+ fragment.appendChild( elem );
+ }
+ };
+
+ for ( i = 0; (elem = ret[i]) != null; i++ ) {
+ // Check if we're done after handling an executable script
+ if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) {
+ // Append to fragment and handle embedded scripts
+ fragment.appendChild( elem );
+ if ( typeof elem.getElementsByTagName !== "undefined" ) {
+ // handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration
+ jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript );
+
+ // Splice the scripts into ret after their former ancestor and advance our index beyond them
+ ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
+ i += jsTags.length;
+ }
+ }
+ }
+ }
+
+ return ret;
+ },
+
+ cleanData: function( elems, /* internal */ acceptData ) {
+ var data, id, elem, type,
+ i = 0,
+ internalKey = jQuery.expando,
+ cache = jQuery.cache,
+ deleteExpando = jQuery.support.deleteExpando,
+ special = jQuery.event.special;
+
+ for ( ; (elem = elems[i]) != null; i++ ) {
+
+ if ( acceptData || jQuery.acceptData( elem ) ) {
+
+ id = elem[ internalKey ];
+ data = id && cache[ id ];
+
+ if ( data ) {
+ if ( data.events ) {
+ for ( type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent( elem, type, data.handle );
+ }
+ }
+ }
+
+ // Remove cache only if it was not already removed by jQuery.event.remove
+ if ( cache[ id ] ) {
+
+ delete cache[ id ];
+
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
+ if ( deleteExpando ) {
+ delete elem[ internalKey ];
+
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( internalKey );
+
+ } else {
+ elem[ internalKey ] = null;
+ }
+
+ jQuery.deletedIds.push( id );
+ }
+ }
+ }
+ }
+ }
+});
+// Limit scope pollution from any deprecated API
+(function() {
+
+var matched, browser;
+
+// Use of jQuery.browser is frowned upon.
+// More details: http://api.jquery.com/jQuery.browser
+// jQuery.uaMatch maintained for back-compat
+jQuery.uaMatch = function( ua ) {
+ ua = ua.toLowerCase();
+
+ var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) ||
+ /(webkit)[ \/]([\w.]+)/.exec( ua ) ||
+ /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) ||
+ /(msie) ([\w.]+)/.exec( ua ) ||
+ ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) ||
+ [];
+
+ return {
+ browser: match[ 1 ] || "",
+ version: match[ 2 ] || "0"
+ };
+};
+
+matched = jQuery.uaMatch( navigator.userAgent );
+browser = {};
+
+if ( matched.browser ) {
+ browser[ matched.browser ] = true;
+ browser.version = matched.version;
+}
+
+// Deprecated, use jQuery.browser.webkit instead
+// Maintained for back-compat only
+if ( browser.webkit ) {
+ browser.safari = true;
+}
+
+jQuery.browser = browser;
+
+jQuery.sub = function() {
+ function jQuerySub( selector, context ) {
+ return new jQuerySub.fn.init( selector, context );
+ }
+ jQuery.extend( true, jQuerySub, this );
+ jQuerySub.superclass = this;
+ jQuerySub.fn = jQuerySub.prototype = this();
+ jQuerySub.fn.constructor = jQuerySub;
+ jQuerySub.sub = this.sub;
+ jQuerySub.fn.init = function init( selector, context ) {
+ if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) {
+ context = jQuerySub( context );
+ }
+
+ return jQuery.fn.init.call( this, selector, context, rootjQuerySub );
+ };
+ jQuerySub.fn.init.prototype = jQuerySub.fn;
+ var rootjQuerySub = jQuerySub(document);
+ return jQuerySub;
+};
+
+})();
+var curCSS, iframe, iframeDoc,
+ ralpha = /alpha\([^)]*\)/i,
+ ropacity = /opacity=([^)]*)/,
+ rposition = /^(top|right|bottom|left)$/,
+ rmargin = /^margin/,
+ rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ),
+ rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ),
+ rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ),
+ elemdisplay = {},
+
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+ cssNormalTransform = {
+ letterSpacing: 0,
+ fontWeight: 400,
+ lineHeight: 1
+ },
+
+ cssExpand = [ "Top", "Right", "Bottom", "Left" ],
+ cssPrefixes = [ "Webkit", "O", "Moz", "ms" ],
+
+ eventsToggle = jQuery.fn.toggle;
+
+// return a css property mapped to a potentially vendor prefixed property
+function vendorPropName( style, name ) {
+
+ // shortcut for names that are not vendor prefixed
+ if ( name in style ) {
+ return name;
+ }
+
+ // check for vendor prefixed names
+ var capName = name.charAt(0).toUpperCase() + name.slice(1),
+ origName = name,
+ i = cssPrefixes.length;
+
+ while ( i-- ) {
+ name = cssPrefixes[ i ] + capName;
+ if ( name in style ) {
+ return name;
+ }
+ }
+
+ return origName;
+}
+
+function isHidden( elem, el ) {
+ elem = el || elem;
+ return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem );
+}
+
+function showHide( elements, show ) {
+ var elem, display,
+ values = [],
+ index = 0,
+ length = elements.length;
+
+ for ( ; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+ values[ index ] = jQuery._data( elem, "olddisplay" );
+ if ( show ) {
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if ( !values[ index ] && elem.style.display === "none" ) {
+ elem.style.display = "";
+ }
+
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if ( elem.style.display === "" && isHidden( elem ) ) {
+ values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) );
+ }
+ } else {
+ display = curCSS( elem, "display" );
+
+ if ( !values[ index ] && display !== "none" ) {
+ jQuery._data( elem, "olddisplay", display );
+ }
+ }
+ }
+
+ // Set the display of most of the elements in a second loop
+ // to avoid the constant reflow
+ for ( index = 0; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+ if ( !show || elem.style.display === "none" || elem.style.display === "" ) {
+ elem.style.display = show ? values[ index ] || "" : "none";
+ }
+ }
+
+ return elements;
+}
+
+jQuery.fn.extend({
+ css: function( name, value ) {
+ return jQuery.access( this, function( elem, name, value ) {
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
+ }, name, value, arguments.length > 1 );
+ },
+ show: function() {
+ return showHide( this, true );
+ },
+ hide: function() {
+ return showHide( this );
+ },
+ toggle: function( state, fn2 ) {
+ var bool = typeof state === "boolean";
+
+ if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) {
+ return eventsToggle.apply( this, arguments );
+ }
+
+ return this.each(function() {
+ if ( bool ? state : isHidden( this ) ) {
+ jQuery( this ).show();
+ } else {
+ jQuery( this ).hide();
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity" );
+ return ret === "" ? "1" : ret;
+
+ }
+ }
+ }
+ },
+
+ // Exclude the following css properties to add px
+ cssNumber: {
+ "fillOpacity": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, hooks,
+ origName = jQuery.camelCase( name ),
+ style = elem.style;
+
+ name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
+
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if ( type === "string" && (ret = rrelNum.exec( value )) ) {
+ value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) );
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // Make sure that NaN and null values aren't set. See: #7116
+ if ( value == null || type === "number" && isNaN( value ) ) {
+ return;
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
+ value += "px";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) {
+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+ // Fixes bug #5509
+ try {
+ style[ name ] = value;
+ } catch(e) {}
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
+ }
+ },
+
+ css: function( elem, name, numeric, extra ) {
+ var val, num, hooks,
+ origName = jQuery.camelCase( name );
+
+ // Make sure that we're working with the right name
+ name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks ) {
+ val = hooks.get( elem, true, extra );
+ }
+
+ // Otherwise, if a way to get the computed value exists, use that
+ if ( val === undefined ) {
+ val = curCSS( elem, name );
+ }
+
+ //convert "normal" to computed value
+ if ( val === "normal" && name in cssNormalTransform ) {
+ val = cssNormalTransform[ name ];
+ }
+
+ // Return, converting to number if forced or a qualifier was provided and val looks numeric
+ if ( numeric || extra !== undefined ) {
+ num = parseFloat( val );
+ return numeric || jQuery.isNumeric( num ) ? num || 0 : val;
+ }
+ return val;
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var ret, name,
+ old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ ret = callback.call( elem );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
+
+ return ret;
+ }
+});
+
+// NOTE: To any future maintainer, we've used both window.getComputedStyle
+// and getComputedStyle here to produce a better gzip size
+if ( window.getComputedStyle ) {
+ curCSS = function( elem, name ) {
+ var ret, width, minWidth, maxWidth,
+ computed = getComputedStyle( elem, null ),
+ style = elem.style;
+
+ if ( computed ) {
+
+ ret = computed[ name ];
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
+ ret = jQuery.style( elem, name );
+ }
+
+ // A tribute to the "awesome hack by Dean Edwards"
+ // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right
+ // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
+ // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
+ if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) {
+ width = style.width;
+ minWidth = style.minWidth;
+ maxWidth = style.maxWidth;
+
+ style.minWidth = style.maxWidth = style.width = ret;
+ ret = computed.width;
+
+ style.width = width;
+ style.minWidth = minWidth;
+ style.maxWidth = maxWidth;
+ }
+ }
+
+ return ret;
+ };
+} else if ( document.documentElement.currentStyle ) {
+ curCSS = function( elem, name ) {
+ var left, rsLeft,
+ ret = elem.currentStyle && elem.currentStyle[ name ],
+ style = elem.style;
+
+ // Avoid setting ret to empty string here
+ // so we don't default to auto
+ if ( ret == null && style && style[ name ] ) {
+ ret = style[ name ];
+ }
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ // but not position css attributes, as those are proportional to the parent element instead
+ // and we can't measure the parent instead because it might trigger a "stacking dolls" problem
+ if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) {
+
+ // Remember the original values
+ left = style.left;
+ rsLeft = elem.runtimeStyle && elem.runtimeStyle.left;
+
+ // Put in the new values to get a computed value out
+ if ( rsLeft ) {
+ elem.runtimeStyle.left = elem.currentStyle.left;
+ }
+ style.left = name === "fontSize" ? "1em" : ret;
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ if ( rsLeft ) {
+ elem.runtimeStyle.left = rsLeft;
+ }
+ }
+
+ return ret === "" ? "auto" : ret;
+ };
+}
+
+function setPositiveNumber( elem, value, subtract ) {
+ var matches = rnumsplit.exec( value );
+ return matches ?
+ Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) :
+ value;
+}
+
+function augmentWidthOrHeight( elem, name, extra, isBorderBox ) {
+ var i = extra === ( isBorderBox ? "border" : "content" ) ?
+ // If we already have the right measurement, avoid augmentation
+ 4 :
+ // Otherwise initialize for horizontal or vertical properties
+ name === "width" ? 1 : 0,
+
+ val = 0;
+
+ for ( ; i < 4; i += 2 ) {
+ // both box models exclude margin, so add it if we want it
+ if ( extra === "margin" ) {
+ // we use jQuery.css instead of curCSS here
+ // because of the reliableMarginRight CSS hook!
+ val += jQuery.css( elem, extra + cssExpand[ i ], true );
+ }
+
+ // From this point on we use curCSS for maximum performance (relevant in animations)
+ if ( isBorderBox ) {
+ // border-box includes padding, so remove it if we want content
+ if ( extra === "content" ) {
+ val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0;
+ }
+
+ // at this point, extra isn't border nor margin, so remove border
+ if ( extra !== "margin" ) {
+ val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0;
+ }
+ } else {
+ // at this point, extra isn't content, so add padding
+ val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0;
+
+ // at this point, extra isn't content nor padding, so add border
+ if ( extra !== "padding" ) {
+ val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0;
+ }
+ }
+ }
+
+ return val;
+}
+
+function getWidthOrHeight( elem, name, extra ) {
+
+ // Start with offset property, which is equivalent to the border-box value
+ var val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+ valueIsBorderBox = true,
+ isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box";
+
+ if ( val <= 0 ) {
+ // Fall back to computed then uncomputed css if necessary
+ val = curCSS( elem, name );
+ if ( val < 0 || val == null ) {
+ val = elem.style[ name ];
+ }
+
+ // Computed unit is not pixels. Stop here and return.
+ if ( rnumnonpx.test(val) ) {
+ return val;
+ }
+
+ // we need the check for style in case a browser which returns unreliable values
+ // for getComputedStyle silently falls back to the reliable elem.style
+ valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] );
+
+ // Normalize "", auto, and prepare for extra
+ val = parseFloat( val ) || 0;
+ }
+
+ // use the active box-sizing model to add/subtract irrelevant styles
+ return ( val +
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra || ( isBorderBox ? "border" : "content" ),
+ valueIsBorderBox
+ )
+ ) + "px";
+}
+
+
+// Try to determine the default display value of an element
+function css_defaultDisplay( nodeName ) {
+ if ( elemdisplay[ nodeName ] ) {
+ return elemdisplay[ nodeName ];
+ }
+
+ var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ),
+ display = elem.css("display");
+ elem.remove();
+
+ // If the simple way fails,
+ // get element's real default display by attaching it to a temp iframe
+ if ( display === "none" || display === "" ) {
+ // Use the already-created iframe if possible
+ iframe = document.body.appendChild(
+ iframe || jQuery.extend( document.createElement("iframe"), {
+ frameBorder: 0,
+ width: 0,
+ height: 0
+ })
+ );
+
+ // Create a cacheable copy of the iframe document on first call.
+ // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML
+ // document to it; WebKit & Firefox won't allow reusing the iframe document.
+ if ( !iframeDoc || !iframe.createElement ) {
+ iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document;
+ iframeDoc.write("<!doctype html><html><body>");
+ iframeDoc.close();
+ }
+
+ elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) );
+
+ display = curCSS( elem, "display" );
+ document.body.removeChild( iframe );
+ }
+
+ // Store the correct default display
+ elemdisplay[ nodeName ] = display;
+
+ return display;
+}
+
+jQuery.each([ "height", "width" ], function( i, name ) {
+ jQuery.cssHooks[ name ] = {
+ get: function( elem, computed, extra ) {
+ if ( computed ) {
+ if ( elem.offsetWidth !== 0 || curCSS( elem, "display" ) !== "none" ) {
+ return getWidthOrHeight( elem, name, extra );
+ } else {
+ return jQuery.swap( elem, cssShow, function() {
+ return getWidthOrHeight( elem, name, extra );
+ });
+ }
+ }
+ },
+
+ set: function( elem, value, extra ) {
+ return setPositiveNumber( elem, value, extra ?
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra,
+ jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"
+ ) : 0
+ );
+ }
+ };
+});
+
+if ( !jQuery.support.opacity ) {
+ jQuery.cssHooks.opacity = {
+ get: function( elem, computed ) {
+ // IE uses filters for opacity
+ return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
+ ( 0.01 * parseFloat( RegExp.$1 ) ) + "" :
+ computed ? "1" : "";
+ },
+
+ set: function( elem, value ) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle,
+ opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
+
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
+
+ // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
+ if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" &&
+ style.removeAttribute ) {
+
+ // Setting style.filter to null, "" & " " still leave "filter:" in the cssText
+ // if "filter:" is present at all, clearType is disabled, we want to avoid this
+ // style.removeAttribute is IE Only, but so apparently is this code path...
+ style.removeAttribute( "filter" );
+
+ // if there there is no filter style applied in a css rule, we are done
+ if ( currentStyle && !currentStyle.filter ) {
+ return;
+ }
+ }
+
+ // otherwise, set new filter values
+ style.filter = ralpha.test( filter ) ?
+ filter.replace( ralpha, opacity ) :
+ filter + " " + opacity;
+ }
+ };
+}
+
+// These hooks cannot be added until DOM ready because the support test
+// for it is not run until after DOM ready
+jQuery(function() {
+ if ( !jQuery.support.reliableMarginRight ) {
+ jQuery.cssHooks.marginRight = {
+ get: function( elem, computed ) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ return jQuery.swap( elem, { "display": "inline-block" }, function() {
+ if ( computed ) {
+ return curCSS( elem, "marginRight" );
+ }
+ });
+ }
+ };
+ }
+
+ // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+ // getComputedStyle returns percent when specified for top/left/bottom/right
+ // rather than make the css module depend on the offset module, we just check for it here
+ if ( !jQuery.support.pixelPosition && jQuery.fn.position ) {
+ jQuery.each( [ "top", "left" ], function( i, prop ) {
+ jQuery.cssHooks[ prop ] = {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ var ret = curCSS( elem, prop );
+ // if curCSS returns percentage, fallback to offset
+ return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret;
+ }
+ }
+ };
+ });
+ }
+
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.hidden = function( elem ) {
+ return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none");
+ };
+
+ jQuery.expr.filters.visible = function( elem ) {
+ return !jQuery.expr.filters.hidden( elem );
+ };
+}
+
+// These hooks are used by animate to expand properties
+jQuery.each({
+ margin: "",
+ padding: "",
+ border: "Width"
+}, function( prefix, suffix ) {
+ jQuery.cssHooks[ prefix + suffix ] = {
+ expand: function( value ) {
+ var i,
+
+ // assumes a single number if not a string
+ parts = typeof value === "string" ? value.split(" ") : [ value ],
+ expanded = {};
+
+ for ( i = 0; i < 4; i++ ) {
+ expanded[ prefix + cssExpand[ i ] + suffix ] =
+ parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+ }
+
+ return expanded;
+ }
+ };
+
+ if ( !rmargin.test( prefix ) ) {
+ jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+ }
+});
+var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
+ rselectTextarea = /^(?:select|textarea)/i;
+
+jQuery.fn.extend({
+ serialize: function() {
+ return jQuery.param( this.serializeArray() );
+ },
+ serializeArray: function() {
+ return this.map(function(){
+ return this.elements ? jQuery.makeArray( this.elements ) : this;
+ })
+ .filter(function(){
+ return this.name && !this.disabled &&
+ ( this.checked || rselectTextarea.test( this.nodeName ) ||
+ rinput.test( this.type ) );
+ })
+ .map(function( i, elem ){
+ var val = jQuery( this ).val();
+
+ return val == null ?
+ null :
+ jQuery.isArray( val ) ?
+ jQuery.map( val, function( val, i ){
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }) :
+ { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }).get();
+ }
+});
+
+//Serialize an array of form elements or a set of
+//key/values into a query string
+jQuery.param = function( a, traditional ) {
+ var prefix,
+ s = [],
+ add = function( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value );
+ s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ });
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join( "&" ).replace( r20, "+" );
+};
+
+function buildParams( prefix, obj, traditional, add ) {
+ var name;
+
+ if ( jQuery.isArray( obj ) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+ // If array item is non-scalar (array or object), encode its
+ // numeric index to resolve deserialization ambiguity issues.
+ // Note that rack (as of 1.0.0) can't currently deserialize
+ // nested arrays properly, and attempting to do so may cause
+ // a server error. Possible fixes are to modify rack's
+ // deserialization algorithm or to provide an option or flag
+ // to force array serialization to be shallow.
+ buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add );
+ }
+ });
+
+ } else if ( !traditional && jQuery.type( obj ) === "object" ) {
+ // Serialize object item.
+ for ( name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+ }
+
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
+var // Document location
+ ajaxLocation,
+ // Document location segments
+ ajaxLocParts,
+
+ rhash = /#.*$/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+ rquery = /\?/,
+ rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
+ rts = /([?&])_=[^&]*/,
+ rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,
+
+ // Keep a copy of the old load method
+ _load = jQuery.fn.load,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+ allTypes = ["*/"] + ["*"];
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+try {
+ ajaxLocation = location.href;
+} catch( e ) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement( "a" );
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ var dataType, list, placeBefore,
+ dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ),
+ i = 0,
+ length = dataTypes.length;
+
+ if ( jQuery.isFunction( func ) ) {
+ // For each dataType in the dataTypeExpression
+ for ( ; i < length; i++ ) {
+ dataType = dataTypes[ i ];
+ // We control if we're asked to add before
+ // any existing element
+ placeBefore = /^\+/.test( dataType );
+ if ( placeBefore ) {
+ dataType = dataType.substr( 1 ) || "*";
+ }
+ list = structure[ dataType ] = structure[ dataType ] || [];
+ // then we add to the structure accordingly
+ list[ placeBefore ? "unshift" : "push" ]( func );
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
+ dataType /* internal */, inspected /* internal */ ) {
+
+ dataType = dataType || options.dataTypes[ 0 ];
+ inspected = inspected || {};
+
+ inspected[ dataType ] = true;
+
+ var selection,
+ list = structure[ dataType ],
+ i = 0,
+ length = list ? list.length : 0,
+ executeOnly = ( structure === prefilters );
+
+ for ( ; i < length && ( executeOnly || !selection ); i++ ) {
+ selection = list[ i ]( options, originalOptions, jqXHR );
+ // If we got redirected to another dataType
+ // we try there if executing only and not done already
+ if ( typeof selection === "string" ) {
+ if ( !executeOnly || inspected[ selection ] ) {
+ selection = undefined;
+ } else {
+ options.dataTypes.unshift( selection );
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, selection, inspected );
+ }
+ }
+ }
+ // If we're only executing or nothing was selected
+ // we try the catchall dataType if not done already
+ if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, "*", inspected );
+ }
+ // unnecessary when only executing (prefilters)
+ // but it'll be ignored by the caller in that case
+ return selection;
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+function ajaxExtend( target, src ) {
+ var key, deep,
+ flatOptions = jQuery.ajaxSettings.flatOptions || {};
+ for ( key in src ) {
+ if ( src[ key ] !== undefined ) {
+ ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
+ }
+ }
+ if ( deep ) {
+ jQuery.extend( true, target, deep );
+ }
+}
+
+jQuery.fn.load = function( url, params, callback ) {
+ if ( typeof url !== "string" && _load ) {
+ return _load.apply( this, arguments );
+ }
+
+ // Don't do a request if no elements are being requested
+ if ( !this.length ) {
+ return this;
+ }
+
+ var selector, type, response,
+ self = this,
+ off = url.indexOf(" ");
+
+ if ( off >= 0 ) {
+ selector = url.slice( off, url.length );
+ url = url.slice( 0, off );
+ }
+
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if ( typeof params === "object" ) {
+ type = "POST";
+ }
+
+ // Request the remote document
+ jQuery.ajax({
+ url: url,
+
+ // if "type" variable is undefined, then "GET" method will be used
+ type: type,
+ dataType: "html",
+ data: params,
+ complete: function( jqXHR, status ) {
+ if ( callback ) {
+ self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] );
+ }
+ }
+ }).done(function( responseText ) {
+
+ // Save response for use in complete callback
+ response = arguments;
+
+ // See if a selector was specified
+ self.html( selector ?
+
+ // Create a dummy div to hold the results
+ jQuery("<div>")
+
+ // inject the contents of the document in, removing the scripts
+ // to avoid any 'Permission Denied' errors in IE
+ .append( responseText.replace( rscript, "" ) )
+
+ // Locate the specified elements
+ .find( selector ) :
+
+ // If not, just inject the full result
+ responseText );
+
+ });
+
+ return this;
+};
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
+ jQuery.fn[ o ] = function( f ){
+ return this.on( o, f );
+ };
+});
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+ // shift arguments if data argument was omitted
+ if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ return jQuery.ajax({
+ type: method,
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ };
+});
+
+jQuery.extend({
+
+ getScript: function( url, callback ) {
+ return jQuery.get( url, undefined, callback, "script" );
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get( url, data, callback, "json" );
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function( target, settings ) {
+ if ( settings ) {
+ // Building a settings object
+ ajaxExtend( target, jQuery.ajaxSettings );
+ } else {
+ // Extending ajaxSettings
+ settings = target;
+ target = jQuery.ajaxSettings;
+ }
+ ajaxExtend( target, settings );
+ return target;
+ },
+
+ ajaxSettings: {
+ url: ajaxLocation,
+ isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
+ global: true,
+ type: "GET",
+ contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+ processData: true,
+ async: true,
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ throws: false,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ xml: "application/xml, text/xml",
+ html: "text/html",
+ text: "text/plain",
+ json: "application/json, text/javascript",
+ "*": allTypes
+ },
+
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText"
+ },
+
+ // List of data converters
+ // 1) key format is "source_type destination_type" (a single space in-between)
+ // 2) the catchall symbol "*" can be used for source_type
+ converters: {
+
+ // Convert anything to text
+ "* text": window.String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ },
+
+ // For options that shouldn't be deep extended:
+ // you can add your own custom options here if
+ // and when you create one that shouldn't be
+ // deep extended (see ajaxExtend)
+ flatOptions: {
+ context: true,
+ url: true
+ }
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var // ifModified key
+ ifModifiedKey,
+ // Response headers
+ responseHeadersString,
+ responseHeaders,
+ // transport
+ transport,
+ // timeout handle
+ timeoutTimer,
+ // Cross-domain detection vars
+ parts,
+ // To know if global events are to be dispatched
+ fireGlobals,
+ // Loop variable
+ i,
+ // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events
+ // It's the callbackContext if one was provided in the options
+ // and if it's a DOM node or a jQuery collection
+ globalEventContext = callbackContext !== s &&
+ ( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
+ jQuery( callbackContext ) : jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery.Callbacks( "once memory" ),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // The jqXHR state
+ state = 0,
+ // Default abort message
+ strAbort = "canceled",
+ // Fake xhr
+ jqXHR = {
+
+ readyState: 0,
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ if ( !state ) {
+ var lname = name.toLowerCase();
+ name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( state === 2 ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while( ( match = rheaders.exec( responseHeadersString ) ) ) {
+ responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match === undefined ? null : match;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( !state ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ statusText = statusText || strAbort;
+ if ( transport ) {
+ transport.abort( statusText );
+ }
+ done( 0, statusText );
+ return this;
+ }
+ };
+
+ // Callback for when everything is done
+ // It is defined here because jslint complains if it is declared
+ // at the end of the function (which would be more logical and readable)
+ function done( status, nativeStatusText, responses, headers ) {
+ var isSuccess, success, error, response, modified,
+ statusText = nativeStatusText;
+
+ // Called once
+ if ( state === 2 ) {
+ return;
+ }
+
+ // State is "done" now
+ state = 2;
+
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ clearTimeout( timeoutTimer );
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status > 0 ? 4 : 0;
+
+ // Get response data
+ if ( responses ) {
+ response = ajaxHandleResponses( s, jqXHR, responses );
+ }
+
+ // If successful, handle type chaining
+ if ( status >= 200 && status < 300 || status === 304 ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+
+ modified = jqXHR.getResponseHeader("Last-Modified");
+ if ( modified ) {
+ jQuery.lastModified[ ifModifiedKey ] = modified;
+ }
+ modified = jqXHR.getResponseHeader("Etag");
+ if ( modified ) {
+ jQuery.etag[ ifModifiedKey ] = modified;
+ }
+ }
+
+ // If not modified
+ if ( status === 304 ) {
+
+ statusText = "notmodified";
+ isSuccess = true;
+
+ // If we have data
+ } else {
+
+ isSuccess = ajaxConvert( s, response );
+ statusText = isSuccess.state;
+ success = isSuccess.data;
+ error = isSuccess.error;
+ isSuccess = !error;
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if ( !statusText || status ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = "" + ( nativeStatusText || statusText );
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ }
+ }
+
+ // Attach deferreds
+ deferred.promise( jqXHR );
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+ jqXHR.complete = completeDeferred.add;
+
+ // Status-dependent callbacks
+ jqXHR.statusCode = function( map ) {
+ if ( map ) {
+ var tmp;
+ if ( state < 2 ) {
+ for ( tmp in map ) {
+ statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
+ }
+ } else {
+ tmp = map[ jqXHR.status ];
+ jqXHR.always( tmp );
+ }
+ }
+ return this;
+ };
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace );
+
+ // Determine if a cross-domain request is in order
+ if ( s.crossDomain == null ) {
+ parts = rurl.exec( s.url.toLowerCase() );
+ s.crossDomain = !!( parts &&
+ ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
+ ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
+ ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+ );
+ }
+
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefilter, stop there
+ if ( state === 2 ) {
+ return jqXHR;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
+ // Watch for a new set of requests
+ if ( fireGlobals && jQuery.active++ === 0 ) {
+ jQuery.event.trigger( "ajaxStart" );
+ }
+
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
+
+ // If data is available, append data to url
+ if ( s.data ) {
+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
+ // #9682: remove data so that it's not used in an eventual retry
+ delete s.data;
+ }
+
+ // Get ifModifiedKey before adding the anti-cache parameter
+ ifModifiedKey = s.url;
+
+ // Add anti-cache in url if needed
+ if ( s.cache === false ) {
+
+ var ts = jQuery.now(),
+ // try replacing _= if it is there
+ ret = s.url.replace( rts, "$1_=" + ts );
+
+ // if nothing was replaced, add timestamp to the end
+ s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ ifModifiedKey = ifModifiedKey || s.url;
+ if ( jQuery.lastModified[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] );
+ }
+ if ( jQuery.etag[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] );
+ }
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+ s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+ // Abort if not done already and return
+ return jqXHR.abort();
+
+ }
+
+ // aborting is no longer a cancellation
+ strAbort = "abort";
+
+ // Install callbacks on deferreds
+ for ( i in { success: 1, error: 1, complete: 1 } ) {
+ jqXHR[ i ]( s[ i ] );
+ }
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = setTimeout( function(){
+ jqXHR.abort( "timeout" );
+ }, s.timeout );
+ }
+
+ try {
+ state = 1;
+ transport.send( requestHeaders, done );
+ } catch (e) {
+ // Propagate exception as error if not done
+ if ( state < 2 ) {
+ done( -1, e );
+ // Simply rethrow otherwise
+ } else {
+ throw e;
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {}
+
+});
+
+/* Handles responses to an ajax request:
+ * - sets all responseXXX fields accordingly
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+ var ct, type, finalDataType, firstDataType,
+ contents = s.contents,
+ dataTypes = s.dataTypes,
+ responseFields = s.responseFields;
+
+ // Fill responseXXX fields
+ for ( type in responseFields ) {
+ if ( type in responses ) {
+ jqXHR[ responseFields[type] ] = responses[ type ];
+ }
+ }
+
+ // Remove auto dataType and get content-type in the process
+ while( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+ finalDataType = type;
+ break;
+ }
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
+
+// Chain conversions given the request and the original response
+function ajaxConvert( s, response ) {
+
+ var conv, conv2, current, tmp,
+ // Work with a copy of dataTypes in case we need to modify it for conversion
+ dataTypes = s.dataTypes.slice(),
+ prev = dataTypes[ 0 ],
+ converters = {},
+ i = 0;
+
+ // Apply the dataFilter if provided
+ if ( s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ // Create converters map with lowercased keys
+ if ( dataTypes[ 1 ] ) {
+ for ( conv in s.converters ) {
+ converters[ conv.toLowerCase() ] = s.converters[ conv ];
+ }
+ }
+
+ // Convert to each sequential dataType, tolerating list modification
+ for ( ; (current = dataTypes[++i]); ) {
+
+ // There's only work to do if current dataType is non-auto
+ if ( current !== "*" ) {
+
+ // Convert response if prev dataType is non-auto and differs from current
+ if ( prev !== "*" && prev !== current ) {
+
+ // Seek a direct converter
+ conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+ // If none found, seek a pair
+ if ( !conv ) {
+ for ( conv2 in converters ) {
+
+ // If conv2 outputs current
+ tmp = conv2.split(" ");
+ if ( tmp[ 1 ] === current ) {
+
+ // If prev can be converted to accepted input
+ conv = converters[ prev + " " + tmp[ 0 ] ] ||
+ converters[ "* " + tmp[ 0 ] ];
+ if ( conv ) {
+ // Condense equivalence converters
+ if ( conv === true ) {
+ conv = converters[ conv2 ];
+
+ // Otherwise, insert the intermediate dataType
+ } else if ( converters[ conv2 ] !== true ) {
+ current = tmp[ 0 ];
+ dataTypes.splice( i--, 0, current );
+ }
+
+ break;
+ }
+ }
+ }
+ }
+
+ // Apply converter (if not an equivalence)
+ if ( conv !== true ) {
+
+ // Unless errors are allowed to bubble, catch and return them
+ if ( conv && s["throws"] ) {
+ response = conv( response );
+ } else {
+ try {
+ response = conv( response );
+ } catch ( e ) {
+ return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current };
+ }
+ }
+ }
+ }
+
+ // Update prev for next iteration
+ prev = current;
+ }
+ }
+
+ return { state: "success", data: response };
+}
+var oldCallbacks = [],
+ rquestion = /\?/,
+ rjsonp = /(=)\?(?=&|$)|\?\?/,
+ nonce = jQuery.now();
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function() {
+ var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
+ this[ callback ] = true;
+ return callback;
+ }
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var callbackName, overwritten, responseContainer,
+ data = s.data,
+ url = s.url,
+ hasCallback = s.jsonp !== false,
+ replaceInUrl = hasCallback && rjsonp.test( url ),
+ replaceInData = hasCallback && !replaceInUrl && typeof data === "string" &&
+ !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") &&
+ rjsonp.test( data );
+
+ // Handle iff the expected data type is "jsonp" or we have a parameter to set
+ if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) {
+
+ // Get callback name, remembering preexisting value associated with it
+ callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
+ s.jsonpCallback() :
+ s.jsonpCallback;
+ overwritten = window[ callbackName ];
+
+ // Insert callback into url or form data
+ if ( replaceInUrl ) {
+ s.url = url.replace( rjsonp, "$1" + callbackName );
+ } else if ( replaceInData ) {
+ s.data = data.replace( rjsonp, "$1" + callbackName );
+ } else if ( hasCallback ) {
+ s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+ }
+
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( callbackName + " was not called" );
+ }
+ return responseContainer[ 0 ];
+ };
+
+ // force json dataType
+ s.dataTypes[ 0 ] = "json";
+
+ // Install callback
+ window[ callbackName ] = function() {
+ responseContainer = arguments;
+ };
+
+ // Clean-up function (fires after converters)
+ jqXHR.always(function() {
+ // Restore preexisting value
+ window[ callbackName ] = overwritten;
+
+ // Save back as free
+ if ( s[ callbackName ] ) {
+ // make sure that re-using the options doesn't screw things around
+ s.jsonpCallback = originalSettings.jsonpCallback;
+
+ // save the callback name for future use
+ oldCallbacks.push( callbackName );
+ }
+
+ // Call if it was a function and we have a response
+ if ( responseContainer && jQuery.isFunction( overwritten ) ) {
+ overwritten( responseContainer[ 0 ] );
+ }
+
+ responseContainer = overwritten = undefined;
+ });
+
+ // Delegate to script
+ return "script";
+ }
+});
+// Install script dataType
+jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /javascript|ecmascript/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+});
+
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ s.global = false;
+ }
+});
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
+
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
+
+ var script,
+ head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
+
+ return {
+
+ send: function( _, callback ) {
+
+ script = document.createElement( "script" );
+
+ script.async = "async";
+
+ if ( s.scriptCharset ) {
+ script.charset = s.scriptCharset;
+ }
+
+ script.src = s.url;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+ if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if ( head && script.parentNode ) {
+ head.removeChild( script );
+ }
+
+ // Dereference the script
+ script = undefined;
+
+ // Callback if not abort
+ if ( !isAbort ) {
+ callback( 200, "success" );
+ }
+ }
+ };
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709 and #4378).
+ head.insertBefore( script, head.firstChild );
+ },
+
+ abort: function() {
+ if ( script ) {
+ script.onload( 0, 1 );
+ }
+ }
+ };
+ }
+});
+var xhrCallbacks,
+ // #5280: Internet Explorer will keep connections alive if we don't abort on unload
+ xhrOnUnloadAbort = window.ActiveXObject ? function() {
+ // Abort all pending requests
+ for ( var key in xhrCallbacks ) {
+ xhrCallbacks[ key ]( 0, 1 );
+ }
+ } : false,
+ xhrId = 0;
+
+// Functions to create xhrs
+function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch( e ) {}
+}
+
+function createActiveXHR() {
+ try {
+ return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+ } catch( e ) {}
+}
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+ /* Microsoft failed to properly
+ * implement the XMLHttpRequest in IE7 (can't request local files),
+ * so we use the ActiveXObject when it is available
+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+ * we need a fallback.
+ */
+ function() {
+ return !this.isLocal && createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+// Determine support properties
+(function( xhr ) {
+ jQuery.extend( jQuery.support, {
+ ajax: !!xhr,
+ cors: !!xhr && ( "withCredentials" in xhr )
+ });
+})( jQuery.ajaxSettings.xhr() );
+
+// Create transport if the browser can provide an xhr
+if ( jQuery.support.ajax ) {
+
+ jQuery.ajaxTransport(function( s ) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( !s.crossDomain || jQuery.support.cors ) {
+
+ var callback;
+
+ return {
+ send: function( headers, complete ) {
+
+ // Get a new xhr
+ var handle, i,
+ xhr = s.xhr();
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if ( s.username ) {
+ xhr.open( s.type, s.url, s.async, s.username, s.password );
+ } else {
+ xhr.open( s.type, s.url, s.async );
+ }
+
+ // Apply custom fields if provided
+ if ( s.xhrFields ) {
+ for ( i in s.xhrFields ) {
+ xhr[ i ] = s.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( s.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( s.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !s.crossDomain && !headers["X-Requested-With"] ) {
+ headers[ "X-Requested-With" ] = "XMLHttpRequest";
+ }
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ for ( i in headers ) {
+ xhr.setRequestHeader( i, headers[ i ] );
+ }
+ } catch( _ ) {}
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send( ( s.hasContent && s.data ) || null );
+
+ // Listener
+ callback = function( _, isAbort ) {
+
+ var status,
+ statusText,
+ responseHeaders,
+ responses,
+ xml;
+
+ // Firefox throws exceptions when accessing properties
+ // of an xhr when a network error occurred
+ // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+ try {
+
+ // Was never called and is aborted or complete
+ if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+
+ // Only called once
+ callback = undefined;
+
+ // Do not keep as active anymore
+ if ( handle ) {
+ xhr.onreadystatechange = jQuery.noop;
+ if ( xhrOnUnloadAbort ) {
+ delete xhrCallbacks[ handle ];
+ }
+ }
+
+ // If it's an abort
+ if ( isAbort ) {
+ // Abort it manually if needed
+ if ( xhr.readyState !== 4 ) {
+ xhr.abort();
+ }
+ } else {
+ status = xhr.status;
+ responseHeaders = xhr.getAllResponseHeaders();
+ responses = {};
+ xml = xhr.responseXML;
+
+ // Construct response list
+ if ( xml && xml.documentElement /* #4958 */ ) {
+ responses.xml = xml;
+ }
+
+ // When requesting binary data, IE6-9 will throw an exception
+ // on any attempt to access responseText (#11426)
+ try {
+ responses.text = xhr.responseText;
+ } catch( _ ) {
+ }
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch( e ) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if ( !status && s.isLocal && !s.crossDomain ) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if ( status === 1223 ) {
+ status = 204;
+ }
+ }
+ }
+ } catch( firefoxAccessException ) {
+ if ( !isAbort ) {
+ complete( -1, firefoxAccessException );
+ }
+ }
+
+ // Call complete if needed
+ if ( responses ) {
+ complete( status, statusText, responses, responseHeaders );
+ }
+ };
+
+ if ( !s.async ) {
+ // if we're in sync mode we fire the callback
+ callback();
+ } else if ( xhr.readyState === 4 ) {
+ // (IE6 & IE7) if it's in cache and has been
+ // retrieved directly we need to fire the callback
+ setTimeout( callback, 0 );
+ } else {
+ handle = ++xhrId;
+ if ( xhrOnUnloadAbort ) {
+ // Create the active xhrs callbacks list if needed
+ // and attach the unload handler
+ if ( !xhrCallbacks ) {
+ xhrCallbacks = {};
+ jQuery( window ).unload( xhrOnUnloadAbort );
+ }
+ // Add to list of active xhrs callbacks
+ xhrCallbacks[ handle ] = callback;
+ }
+ xhr.onreadystatechange = callback;
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback(0,1);
+ }
+ }
+ };
+ }
+ });
+}
+var fxNow, timerId,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ),
+ rrun = /queueHooks$/,
+ animationPrefilters = [ defaultPrefilter ],
+ tweeners = {
+ "*": [function( prop, value ) {
+ var end, unit, prevScale,
+ tween = this.createTween( prop, value ),
+ parts = rfxnum.exec( value ),
+ target = tween.cur(),
+ start = +target || 0,
+ scale = 1;
+
+ if ( parts ) {
+ end = +parts[2];
+ unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+
+ // We need to compute starting value
+ if ( unit !== "px" && start ) {
+ // Iteratively approximate from a nonzero starting point
+ // Prefer the current property, because this process will be trivial if it uses the same units
+ // Fallback to end or a simple constant
+ start = jQuery.css( tween.elem, prop, true ) || end || 1;
+
+ do {
+ // If previous iteration zeroed out, double until we get *something*
+ // Use a string for doubling factor so we don't accidentally see scale as unchanged below
+ prevScale = scale = scale || ".5";
+
+ // Adjust and apply
+ start = start / scale;
+ jQuery.style( tween.elem, prop, start + unit );
+
+ // Update scale, tolerating zeroes from tween.cur()
+ scale = tween.cur() / target;
+
+ // Stop looping if we've hit the mark or scale is unchanged
+ } while ( scale !== 1 && scale !== prevScale );
+ }
+
+ tween.unit = unit;
+ tween.start = start;
+ // If a +=/-= token was provided, we're doing a relative animation
+ tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end;
+ }
+ return tween;
+ }]
+ };
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ setTimeout(function() {
+ fxNow = undefined;
+ }, 0 );
+ return ( fxNow = jQuery.now() );
+}
+
+function createTweens( animation, props ) {
+ jQuery.each( props, function( prop, value ) {
+ var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ),
+ index = 0,
+ length = collection.length;
+ for ( ; index < length; index++ ) {
+ if ( collection[ index ].call( animation, prop, value ) ) {
+
+ // we're done with this property
+ return;
+ }
+ }
+ });
+}
+
+function Animation( elem, properties, options ) {
+ var result,
+ index = 0,
+ tweenerIndex = 0,
+ length = animationPrefilters.length,
+ deferred = jQuery.Deferred().always( function() {
+ // don't match elem in the :animated selector
+ delete tick.elem;
+ }),
+ tick = function() {
+ var currentTime = fxNow || createFxNow(),
+ remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+ percent = 1 - ( remaining / animation.duration || 0 ),
+ index = 0,
+ length = animation.tweens.length;
+
+ for ( ; index < length ; index++ ) {
+ animation.tweens[ index ].run( percent );
+ }
+
+ deferred.notifyWith( elem, [ animation, percent, remaining ]);
+
+ if ( percent < 1 && length ) {
+ return remaining;
+ } else {
+ deferred.resolveWith( elem, [ animation ] );
+ return false;
+ }
+ },
+ animation = deferred.promise({
+ elem: elem,
+ props: jQuery.extend( {}, properties ),
+ opts: jQuery.extend( true, { specialEasing: {} }, options ),
+ originalProperties: properties,
+ originalOptions: options,
+ startTime: fxNow || createFxNow(),
+ duration: options.duration,
+ tweens: [],
+ createTween: function( prop, end, easing ) {
+ var tween = jQuery.Tween( elem, animation.opts, prop, end,
+ animation.opts.specialEasing[ prop ] || animation.opts.easing );
+ animation.tweens.push( tween );
+ return tween;
+ },
+ stop: function( gotoEnd ) {
+ var index = 0,
+ // if we are going to the end, we want to run all the tweens
+ // otherwise we skip this part
+ length = gotoEnd ? animation.tweens.length : 0;
+
+ for ( ; index < length ; index++ ) {
+ animation.tweens[ index ].run( 1 );
+ }
+
+ // resolve when we played the last frame
+ // otherwise, reject
+ if ( gotoEnd ) {
+ deferred.resolveWith( elem, [ animation, gotoEnd ] );
+ } else {
+ deferred.rejectWith( elem, [ animation, gotoEnd ] );
+ }
+ return this;
+ }
+ }),
+ props = animation.props;
+
+ propFilter( props, animation.opts.specialEasing );
+
+ for ( ; index < length ; index++ ) {
+ result = animationPrefilters[ index ].call( animation, elem, props, animation.opts );
+ if ( result ) {
+ return result;
+ }
+ }
+
+ createTweens( animation, props );
+
+ if ( jQuery.isFunction( animation.opts.start ) ) {
+ animation.opts.start.call( elem, animation );
+ }
+
+ jQuery.fx.timer(
+ jQuery.extend( tick, {
+ anim: animation,
+ queue: animation.opts.queue,
+ elem: elem
+ })
+ );
+
+ // attach callbacks from options
+ return animation.progress( animation.opts.progress )
+ .done( animation.opts.done, animation.opts.complete )
+ .fail( animation.opts.fail )
+ .always( animation.opts.always );
+}
+
+function propFilter( props, specialEasing ) {
+ var index, name, easing, value, hooks;
+
+ // camelCase, specialEasing and expand cssHook pass
+ for ( index in props ) {
+ name = jQuery.camelCase( index );
+ easing = specialEasing[ name ];
+ value = props[ index ];
+ if ( jQuery.isArray( value ) ) {
+ easing = value[ 1 ];
+ value = props[ index ] = value[ 0 ];
+ }
+
+ if ( index !== name ) {
+ props[ name ] = value;
+ delete props[ index ];
+ }
+
+ hooks = jQuery.cssHooks[ name ];
+ if ( hooks && "expand" in hooks ) {
+ value = hooks.expand( value );
+ delete props[ name ];
+
+ // not quite $.extend, this wont overwrite keys already present.
+ // also - reusing 'index' from above because we have the correct "name"
+ for ( index in value ) {
+ if ( !( index in props ) ) {
+ props[ index ] = value[ index ];
+ specialEasing[ index ] = easing;
+ }
+ }
+ } else {
+ specialEasing[ name ] = easing;
+ }
+ }
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+
+ tweener: function( props, callback ) {
+ if ( jQuery.isFunction( props ) ) {
+ callback = props;
+ props = [ "*" ];
+ } else {
+ props = props.split(" ");
+ }
+
+ var prop,
+ index = 0,
+ length = props.length;
+
+ for ( ; index < length ; index++ ) {
+ prop = props[ index ];
+ tweeners[ prop ] = tweeners[ prop ] || [];
+ tweeners[ prop ].unshift( callback );
+ }
+ },
+
+ prefilter: function( callback, prepend ) {
+ if ( prepend ) {
+ animationPrefilters.unshift( callback );
+ } else {
+ animationPrefilters.push( callback );
+ }
+ }
+});
+
+function defaultPrefilter( elem, props, opts ) {
+ var index, prop, value, length, dataShow, tween, hooks, oldfire,
+ anim = this,
+ style = elem.style,
+ orig = {},
+ handled = [],
+ hidden = elem.nodeType && isHidden( elem );
+
+ // handle queue: false promises
+ if ( !opts.queue ) {
+ hooks = jQuery._queueHooks( elem, "fx" );
+ if ( hooks.unqueued == null ) {
+ hooks.unqueued = 0;
+ oldfire = hooks.empty.fire;
+ hooks.empty.fire = function() {
+ if ( !hooks.unqueued ) {
+ oldfire();
+ }
+ };
+ }
+ hooks.unqueued++;
+
+ anim.always(function() {
+ // doing this makes sure that the complete handler will be called
+ // before this completes
+ anim.always(function() {
+ hooks.unqueued--;
+ if ( !jQuery.queue( elem, "fx" ).length ) {
+ hooks.empty.fire();
+ }
+ });
+ });
+ }
+
+ // height/width overflow pass
+ if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) {
+ // Make sure that nothing sneaks out
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height animated
+ if ( jQuery.css( elem, "display" ) === "inline" &&
+ jQuery.css( elem, "float" ) === "none" ) {
+
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) {
+ style.display = "inline-block";
+
+ } else {
+ style.zoom = 1;
+ }
+ }
+ }
+
+ if ( opts.overflow ) {
+ style.overflow = "hidden";
+ if ( !jQuery.support.shrinkWrapBlocks ) {
+ anim.done(function() {
+ style.overflow = opts.overflow[ 0 ];
+ style.overflowX = opts.overflow[ 1 ];
+ style.overflowY = opts.overflow[ 2 ];
+ });
+ }
+ }
+
+
+ // show/hide pass
+ for ( index in props ) {
+ value = props[ index ];
+ if ( rfxtypes.exec( value ) ) {
+ delete props[ index ];
+ if ( value === ( hidden ? "hide" : "show" ) ) {
+ continue;
+ }
+ handled.push( index );
+ }
+ }
+
+ length = handled.length;
+ if ( length ) {
+ dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} );
+ if ( hidden ) {
+ jQuery( elem ).show();
+ } else {
+ anim.done(function() {
+ jQuery( elem ).hide();
+ });
+ }
+ anim.done(function() {
+ var prop;
+ jQuery.removeData( elem, "fxshow", true );
+ for ( prop in orig ) {
+ jQuery.style( elem, prop, orig[ prop ] );
+ }
+ });
+ for ( index = 0 ; index < length ; index++ ) {
+ prop = handled[ index ];
+ tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 );
+ orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop );
+
+ if ( !( prop in dataShow ) ) {
+ dataShow[ prop ] = tween.start;
+ if ( hidden ) {
+ tween.end = tween.start;
+ tween.start = prop === "width" || prop === "height" ? 1 : 0;
+ }
+ }
+ }
+ }
+}
+
+function Tween( elem, options, prop, end, easing ) {
+ return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+ constructor: Tween,
+ init: function( elem, options, prop, end, easing, unit ) {
+ this.elem = elem;
+ this.prop = prop;
+ this.easing = easing || "swing";
+ this.options = options;
+ this.start = this.now = this.cur();
+ this.end = end;
+ this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+ },
+ cur: function() {
+ var hooks = Tween.propHooks[ this.prop ];
+
+ return hooks && hooks.get ?
+ hooks.get( this ) :
+ Tween.propHooks._default.get( this );
+ },
+ run: function( percent ) {
+ var eased,
+ hooks = Tween.propHooks[ this.prop ];
+
+ this.pos = eased = jQuery.easing[ this.easing ]( percent, this.options.duration * percent, 0, 1, this.options.duration );
+ this.now = ( this.end - this.start ) * eased + this.start;
+
+ if ( this.options.step ) {
+ this.options.step.call( this.elem, this.now, this );
+ }
+
+ if ( hooks && hooks.set ) {
+ hooks.set( this );
+ } else {
+ Tween.propHooks._default.set( this );
+ }
+ return this;
+ }
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+ _default: {
+ get: function( tween ) {
+ var result;
+
+ if ( tween.elem[ tween.prop ] != null &&
+ (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) {
+ return tween.elem[ tween.prop ];
+ }
+
+ // passing any value as a 4th parameter to .css will automatically
+ // attempt a parseFloat and fallback to a string if the parse fails
+ // so, simple values such as "10px" are parsed to Float.
+ // complex values such as "rotate(1rad)" are returned as is.
+ result = jQuery.css( tween.elem, tween.prop, false, "" );
+ // Empty strings, null, undefined and "auto" are converted to 0.
+ return !result || result === "auto" ? 0 : result;
+ },
+ set: function( tween ) {
+ // use step hook for back compat - use cssHook if its there - use .style if its
+ // available and use plain properties where available
+ if ( jQuery.fx.step[ tween.prop ] ) {
+ jQuery.fx.step[ tween.prop ]( tween );
+ } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) {
+ jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+ } else {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+ }
+};
+
+// Remove in 2.0 - this supports IE8's panic based approach
+// to setting things on disconnected nodes
+
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+ set: function( tween ) {
+ if ( tween.elem.nodeType && tween.elem.parentNode ) {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+};
+
+jQuery.each([ "toggle", "show", "hide" ], function( i, name ) {
+ var cssFn = jQuery.fn[ name ];
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return speed == null || typeof speed === "boolean" ||
+ // special check for .toggle( handler, handler, ... )
+ ( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ?
+ cssFn.apply( this, arguments ) :
+ this.animate( genFx( name, true ), speed, easing, callback );
+ };
+});
+
+jQuery.fn.extend({
+ fadeTo: function( speed, to, easing, callback ) {
+
+ // show any hidden elements after setting opacity to 0
+ return this.filter( isHidden ).css( "opacity", 0 ).show()
+
+ // animate to the value specified
+ .end().animate({ opacity: to }, speed, easing, callback );
+ },
+ animate: function( prop, speed, easing, callback ) {
+ var empty = jQuery.isEmptyObject( prop ),
+ optall = jQuery.speed( speed, easing, callback ),
+ doAnimation = function() {
+ // Operate on a copy of prop so per-property easing won't be lost
+ var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+
+ // Empty animations resolve immediately
+ if ( empty ) {
+ anim.stop( true );
+ }
+ };
+
+ return empty || optall.queue === false ?
+ this.each( doAnimation ) :
+ this.queue( optall.queue, doAnimation );
+ },
+ stop: function( type, clearQueue, gotoEnd ) {
+ var stopQueue = function( hooks ) {
+ var stop = hooks.stop;
+ delete hooks.stop;
+ stop( gotoEnd );
+ };
+
+ if ( typeof type !== "string" ) {
+ gotoEnd = clearQueue;
+ clearQueue = type;
+ type = undefined;
+ }
+ if ( clearQueue && type !== false ) {
+ this.queue( type || "fx", [] );
+ }
+
+ return this.each(function() {
+ var dequeue = true,
+ index = type != null && type + "queueHooks",
+ timers = jQuery.timers,
+ data = jQuery._data( this );
+
+ if ( index ) {
+ if ( data[ index ] && data[ index ].stop ) {
+ stopQueue( data[ index ] );
+ }
+ } else {
+ for ( index in data ) {
+ if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+ stopQueue( data[ index ] );
+ }
+ }
+ }
+
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
+ timers[ index ].anim.stop( gotoEnd );
+ dequeue = false;
+ timers.splice( index, 1 );
+ }
+ }
+
+ // start the next in the queue if the last step wasn't forced
+ // timers currently will call their complete callbacks, which will dequeue
+ // but only if they were gotoEnd
+ if ( dequeue || !gotoEnd ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ }
+});
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+ var which,
+ attrs = { height: type },
+ i = 0;
+
+ // if we include width, step value is 1 to do all cssExpand values,
+ // if we don't include width, step value is 2 to skip over Left and Right
+ for( ; i < 4 ; i += 2 - includeWidth ) {
+ which = cssExpand[ i ];
+ attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+ }
+
+ if ( includeWidth ) {
+ attrs.opacity = attrs.width = type;
+ }
+
+ return attrs;
+}
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx("show"),
+ slideUp: genFx("hide"),
+ slideToggle: genFx("toggle"),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
+ };
+});
+
+jQuery.speed = function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
+
+ // normalize opt.queue - true/undefined/null -> "fx"
+ if ( opt.queue == null || opt.queue === true ) {
+ opt.queue = "fx";
+ }
+
+ // Queueing
+ opt.old = opt.complete;
+
+ opt.complete = function() {
+ if ( jQuery.isFunction( opt.old ) ) {
+ opt.old.call( this );
+ }
+
+ if ( opt.queue ) {
+ jQuery.dequeue( this, opt.queue );
+ }
+ };
+
+ return opt;
+};
+
+jQuery.easing = {
+ linear: function( p ) {
+ return p;
+ },
+ swing: function( p ) {
+ return 0.5 - Math.cos( p*Math.PI ) / 2;
+ }
+};
+
+jQuery.timers = [];
+jQuery.fx = Tween.prototype.init;
+jQuery.fx.tick = function() {
+ var timer,
+ timers = jQuery.timers,
+ i = 0;
+
+ for ( ; i < timers.length; i++ ) {
+ timer = timers[ i ];
+ // Checks the timer has not already been removed
+ if ( !timer() && timers[ i ] === timer ) {
+ timers.splice( i--, 1 );
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+};
+
+jQuery.fx.timer = function( timer ) {
+ if ( timer() && jQuery.timers.push( timer ) && !timerId ) {
+ timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval );
+ }
+};
+
+jQuery.fx.interval = 13;
+
+jQuery.fx.stop = function() {
+ clearInterval( timerId );
+ timerId = null;
+};
+
+jQuery.fx.speeds = {
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+};
+
+// Back Compat <1.8 extension point
+jQuery.fx.step = {};
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.animated = function( elem ) {
+ return jQuery.grep(jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ }).length;
+ };
+}
+var rroot = /^(?:body|html)$/i;
+
+jQuery.fn.offset = function( options ) {
+ if ( arguments.length ) {
+ return options === undefined ?
+ this :
+ this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ var box, docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, top, left,
+ elem = this[ 0 ],
+ doc = elem && elem.ownerDocument;
+
+ if ( !doc ) {
+ return;
+ }
+
+ if ( (body = doc.body) === elem ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ docElem = doc.documentElement;
+
+ // Make sure we're not dealing with a disconnected DOM node
+ if ( !jQuery.contains( docElem, elem ) ) {
+ return { top: 0, left: 0 };
+ }
+
+ box = elem.getBoundingClientRect();
+ win = getWindow( doc );
+ clientTop = docElem.clientTop || body.clientTop || 0;
+ clientLeft = docElem.clientLeft || body.clientLeft || 0;
+ scrollTop = win.pageYOffset || docElem.scrollTop;
+ scrollLeft = win.pageXOffset || docElem.scrollLeft;
+ top = box.top + scrollTop - clientTop;
+ left = box.left + scrollLeft - clientLeft;
+
+ return { top: top, left: left };
+};
+
+jQuery.offset = {
+
+ bodyOffset: function( body ) {
+ var top = body.offsetTop,
+ left = body.offsetLeft;
+
+ if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) {
+ top += parseFloat( jQuery.css(body, "marginTop") ) || 0;
+ left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
+ }
+
+ return { top: top, left: left };
+ },
+
+ setOffset: function( elem, options, i ) {
+ var position = jQuery.css( elem, "position" );
+
+ // set position first, in-case top/left are set even on static elem
+ if ( position === "static" ) {
+ elem.style.position = "relative";
+ }
+
+ var curElem = jQuery( elem ),
+ curOffset = curElem.offset(),
+ curCSSTop = jQuery.css( elem, "top" ),
+ curCSSLeft = jQuery.css( elem, "left" ),
+ calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
+ props = {}, curPosition = {}, curTop, curLeft;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
+
+ if ( jQuery.isFunction( options ) ) {
+ options = options.call( elem, i, curOffset );
+ }
+
+ if ( options.top != null ) {
+ props.top = ( options.top - curOffset.top ) + curTop;
+ }
+ if ( options.left != null ) {
+ props.left = ( options.left - curOffset.left ) + curLeft;
+ }
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ }
+};
+
+
+jQuery.fn.extend({
+
+ position: function() {
+ if ( !this[0] ) {
+ return;
+ }
+
+ var elem = this[0],
+
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent(),
+
+ // Get correct offsets
+ offset = this.offset(),
+ parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+ // Subtract element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
+ offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
+
+ // Add offsetParent borders
+ parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
+ parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
+
+ // Subtract the two offsets
+ return {
+ top: offset.top - parentOffset.top,
+ left: offset.left - parentOffset.left
+ };
+ },
+
+ offsetParent: function() {
+ return this.map(function() {
+ var offsetParent = this.offsetParent || document.body;
+ while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent || document.body;
+ });
+ }
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) {
+ var top = /Y/.test( prop );
+
+ jQuery.fn[ method ] = function( val ) {
+ return jQuery.access( this, function( elem, method, val ) {
+ var win = getWindow( elem );
+
+ if ( val === undefined ) {
+ return win ? (prop in win) ? win[ prop ] :
+ win.document.documentElement[ method ] :
+ elem[ method ];
+ }
+
+ if ( win ) {
+ win.scrollTo(
+ !top ? val : jQuery( win ).scrollLeft(),
+ top ? val : jQuery( win ).scrollTop()
+ );
+
+ } else {
+ elem[ method ] = val;
+ }
+ }, method, val, arguments.length, null );
+ };
+});
+
+function getWindow( elem ) {
+ return jQuery.isWindow( elem ) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+}
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+ jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) {
+ // margin is only for outerHeight, outerWidth
+ jQuery.fn[ funcName ] = function( margin, value ) {
+ var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+ extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+ return jQuery.access( this, function( elem, type, value ) {
+ var doc;
+
+ if ( jQuery.isWindow( elem ) ) {
+ // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
+ // isn't a whole lot we can do. See pull request at this URL for discussion:
+ // https://github.com/jquery/jquery/pull/764
+ return elem.document.documentElement[ "client" + name ];
+ }
+
+ // Get document width or height
+ if ( elem.nodeType === 9 ) {
+ doc = elem.documentElement;
+
+ // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest
+ // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it.
+ return Math.max(
+ elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+ elem.body[ "offset" + name ], doc[ "offset" + name ],
+ doc[ "client" + name ]
+ );
+ }
+
+ return value === undefined ?
+ // Get width or height on the element, requesting but not forcing parseFloat
+ jQuery.css( elem, type, value, extra ) :
+
+ // Set width or height on the element
+ jQuery.style( elem, type, value, extra );
+ }, type, chainable ? margin : undefined, chainable );
+ };
+ });
+});
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+
+// Expose jQuery as an AMD module, but only for AMD loaders that
+// understand the issues with loading multiple versions of jQuery
+// in a page that all might call define(). The loader will indicate
+// they have special allowances for multiple jQuery versions by
+// specifying define.amd.jQuery = true. Register as a named module,
+// since jQuery can be concatenated with other files that may use define,
+// but not use a proper concatenation script that understands anonymous
+// AMD modules. A named AMD is safest and most robust way to register.
+// Lowercase jquery is used because AMD module names are derived from
+// file names, and jQuery is normally delivered in a lowercase file name.
+// Do this after creating the global so that if an AMD module wants to call
+// noConflict to hide this version of jQuery, it will work.
+if ( typeof define === "function" && define.amd && define.amd.jQuery ) {
+ define( "jquery", [], function () { return jQuery; } );
+}
+
+})( window ); \ No newline at end of file
diff --git a/module/web/static/js/libs/jquery.fastClick-0.2.js b/module/web/static/js/libs/jquery.fastClick-0.2.js
new file mode 100644
index 000000000..49eb75d2a
--- /dev/null
+++ b/module/web/static/js/libs/jquery.fastClick-0.2.js
@@ -0,0 +1,96 @@
+/**
+ * jQuery.fastClick.js
+ *
+ * Work around the 300ms delay for the click event in some mobile browsers.
+ *
+ * Code based on <http://code.google.com/mobile/articles/fast_buttons.html>
+ *
+ * @usage
+ * $('button').fastClick(function() {alert('clicked!');});
+ *
+ * @license Under Creative Commons Attribution 3.0 License
+ * @author Dave Hulbert (dave1010)
+ * @version 0.2 2011-09-20
+ */
+
+/*global document, window, jQuery, Math */
+
+(function($) {
+
+$.fn.fastClick = function(handler) {
+ return $(this).each(function(){
+ $.FastButton($(this)[0], handler);
+ });
+};
+
+$.FastButton = function(element, handler) {
+ var startX, startY;
+
+ var reset = function() {
+ $(element).unbind('touchend');
+ $("body").unbind('touchmove.fastClick');
+ };
+
+ var onClick = function(event) {
+ event.stopPropagation();
+ reset();
+ handler.call(this, event);
+
+ if (event.type === 'touchend') {
+ $.clickbuster.preventGhostClick(startX, startY);
+ }
+ };
+
+ var onTouchMove = function(event) {
+ if (Math.abs(event.originalEvent.touches[0].clientX - startX) > 10 ||
+ Math.abs(event.originalEvent.touches[0].clientY - startY) > 10) {
+ reset();
+ }
+ };
+
+ var onTouchStart = function(event) {
+ event.stopPropagation();
+
+ $(element).bind('touchend', onClick);
+ $("body").bind('touchmove.fastClick', onTouchMove);
+
+ startX = event.originalEvent.touches[0].clientX;
+ startY = event.originalEvent.touches[0].clientY;
+ };
+
+ $(element).bind({
+ touchstart: onTouchStart,
+ click: onClick
+ });
+};
+
+$.clickbuster = {
+ coordinates: [],
+
+ preventGhostClick: function(x, y) {
+ $.clickbuster.coordinates.push(x, y);
+ window.setTimeout($.clickbuster.pop, 2500);
+ },
+
+ pop: function() {
+ $.clickbuster.coordinates.splice(0, 2);
+ },
+
+ onClick: function(event) {
+ var x, y, i;
+ for (i = 0; i < $.clickbuster.coordinates.length; i += 2) {
+ x = $.clickbuster.coordinates[i];
+ y = $.clickbuster.coordinates[i + 1];
+ if (Math.abs(event.clientX - x) < 25 && Math.abs(event.clientY - y) < 25) {
+ event.stopPropagation();
+ event.preventDefault();
+ }
+ }
+ }
+};
+
+$(function(){
+ document.addEventListener('click', $.clickbuster.onClick, true);
+});
+
+}(jQuery));
diff --git a/module/web/static/js/libs/jquery.flot.min.js b/module/web/static/js/libs/jquery.flot.min.js
new file mode 100644
index 000000000..4467fc5d8
--- /dev/null
+++ b/module/web/static/js/libs/jquery.flot.min.js
@@ -0,0 +1,6 @@
+/* Javascript plotting library for jQuery, v. 0.7.
+ *
+ * Released under the MIT license by IOLA, December 2007.
+ *
+ */
+(function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]+=j}return c.normalize()};c.scale=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]*=j}return c.normalize()};c.toString=function(){if(c.a>=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return j<k?k:(j>l?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC<aD.length;++aC){aD[aC].apply(this,aB)}}function F(){for(var aB=0;aB<af.length;++aB){var aC=af[aB];aC.init(aq);if(aC.options){c.extend(true,O,aC.options)}}}function Z(aC){var aB;c.extend(true,O,aC);if(O.xaxis.color==null){O.xaxis.color=O.grid.color}if(O.yaxis.color==null){O.yaxis.color=O.grid.color}if(O.xaxis.tickColor==null){O.xaxis.tickColor=O.grid.tickColor}if(O.yaxis.tickColor==null){O.yaxis.tickColor=O.grid.tickColor}if(O.grid.borderColor==null){O.grid.borderColor=O.grid.color}if(O.grid.tickColor==null){O.grid.tickColor=c.color.parse(O.grid.color).scale("a",0.22).toString()}for(aB=0;aB<Math.max(1,O.xaxes.length);++aB){O.xaxes[aB]=c.extend(true,{},O.xaxis,O.xaxes[aB])}for(aB=0;aB<Math.max(1,O.yaxes.length);++aB){O.yaxes[aB]=c.extend(true,{},O.yaxis,O.yaxes[aB])}if(O.xaxis.noTicks&&O.xaxis.ticks==null){O.xaxis.ticks=O.xaxis.noTicks}if(O.yaxis.noTicks&&O.yaxis.ticks==null){O.yaxis.ticks=O.yaxis.noTicks}if(O.x2axis){O.xaxes[1]=c.extend(true,{},O.xaxis,O.x2axis);O.xaxes[1].position="top"}if(O.y2axis){O.yaxes[1]=c.extend(true,{},O.yaxis,O.y2axis);O.yaxes[1].position="right"}if(O.grid.coloredAreas){O.grid.markings=O.grid.coloredAreas}if(O.grid.coloredAreasColor){O.grid.markingsColor=O.grid.coloredAreasColor}if(O.lines){c.extend(true,O.series.lines,O.lines)}if(O.points){c.extend(true,O.series.points,O.points)}if(O.bars){c.extend(true,O.series.bars,O.bars)}if(O.shadowSize!=null){O.series.shadowSize=O.shadowSize}for(aB=0;aB<O.xaxes.length;++aB){V(p,aB+1).options=O.xaxes[aB]}for(aB=0;aB<O.yaxes.length;++aB){V(aw,aB+1).options=O.yaxes[aB]}for(var aD in ak){if(O.hooks[aD]&&O.hooks[aD].length){ak[aD]=ak[aD].concat(O.hooks[aD])}}an(ak.processOptions,[O])}function aj(aB){Q=Y(aB);ax();z()}function Y(aE){var aC=[];for(var aB=0;aB<aE.length;++aB){var aD=c.extend(true,{},O.series);if(aE[aB].data!=null){aD.data=aE[aB].data;delete aE[aB].data;c.extend(true,aD,aE[aB]);aE[aB].data=aD.data}else{aD.data=aE[aB]}aC.push(aD)}return aC}function aA(aC,aD){var aB=aC[aD+"axis"];if(typeof aB=="object"){aB=aB.n}if(typeof aB!="number"){aB=1}return aB}function m(){return c.grep(p.concat(aw),function(aB){return aB})}function C(aE){var aC={},aB,aD;for(aB=0;aB<p.length;++aB){aD=p[aB];if(aD&&aD.used){aC["x"+aD.n]=aD.c2p(aE.left)}}for(aB=0;aB<aw.length;++aB){aD=aw[aB];if(aD&&aD.used){aC["y"+aD.n]=aD.c2p(aE.top)}}if(aC.x1!==undefined){aC.x=aC.x1}if(aC.y1!==undefined){aC.y=aC.y1}return aC}function ar(aF){var aD={},aC,aE,aB;for(aC=0;aC<p.length;++aC){aE=p[aC];if(aE&&aE.used){aB="x"+aE.n;if(aF[aB]==null&&aE.n==1){aB="x"}if(aF[aB]!=null){aD.left=aE.p2c(aF[aB]);break}}}for(aC=0;aC<aw.length;++aC){aE=aw[aC];if(aE&&aE.used){aB="y"+aE.n;if(aF[aB]==null&&aE.n==1){aB="y"}if(aF[aB]!=null){aD.top=aE.p2c(aF[aB]);break}}}return aD}function V(aC,aB){if(!aC[aB-1]){aC[aB-1]={n:aB,direction:aC==p?"x":"y",options:c.extend(true,{},aC==p?O.xaxis:O.yaxis)}}return aC[aB-1]}function ax(){var aG;var aM=Q.length,aB=[],aE=[];for(aG=0;aG<Q.length;++aG){var aJ=Q[aG].color;if(aJ!=null){--aM;if(typeof aJ=="number"){aE.push(aJ)}else{aB.push(c.color.parse(Q[aG].color))}}}for(aG=0;aG<aE.length;++aG){aM=Math.max(aM,aE[aG]+1)}var aC=[],aF=0;aG=0;while(aC.length<aM){var aI;if(O.colors.length==aG){aI=c.color.make(100,100,100)}else{aI=c.color.parse(O.colors[aG])}var aD=aF%2==1?-1:1;aI.scale("rgb",1+aD*Math.ceil(aF/2)*0.2);aC.push(aI);++aG;if(aG>=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aG<Q.length;++aG){aN=Q[aG];if(aN.color==null){aN.color=aC[aH].toString();++aH}else{if(typeof aN.color=="number"){aN.color=aC[aN.color].toString()}}if(aN.lines.show==null){var aL,aK=true;for(aL in aN){if(aN[aL]&&aN[aL].show){aK=false;break}}if(aK){aN.lines.show=true}}aN.xaxis=V(p,aA(aN,"x"));aN.yaxis=V(aw,aA(aN,"y"))}}function z(){var aO=Number.POSITIVE_INFINITY,aI=Number.NEGATIVE_INFINITY,aB=Number.MAX_VALUE,aU,aS,aR,aN,aD,aJ,aT,aP,aH,aG,aC,a0,aX,aL;function aF(a3,a2,a1){if(a2<a3.datamin&&a2!=-aB){a3.datamin=a2}if(a1>a3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aJ.datapoints={points:[]};an(ak.processRawData,[aJ,aJ.data,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];var aZ=aJ.data,aW=aJ.datapoints.format;if(!aW){aW=[];aW.push({x:true,number:true,required:true});aW.push({y:true,number:true,required:true});if(aJ.bars.show||(aJ.lines.show&&aJ.lines.fill)){aW.push({y:true,number:true,required:false,defaultValue:0});if(aJ.bars.horizontal){delete aW[aW.length-1].y;aW[aW.length-1].x=true}}aJ.datapoints.format=aW}if(aJ.datapoints.pointsize!=null){continue}aJ.datapoints.pointsize=aW.length;aP=aJ.datapoints.pointsize;aT=aJ.datapoints.points;insertSteps=aJ.lines.show&&aJ.lines.steps;aJ.xaxis.used=aJ.yaxis.used=true;for(aS=aR=0;aS<aZ.length;++aS,aR+=aP){aL=aZ[aS];var aE=aL==null;if(!aE){for(aN=0;aN<aP;++aN){a0=aL[aN];aX=aW[aN];if(aX){if(aX.number&&a0!=null){a0=+a0;if(isNaN(a0)){a0=null}else{if(a0==Infinity){a0=aB}else{if(a0==-Infinity){a0=-aB}}}}if(a0==null){if(aX.required){aE=true}if(aX.defaultValue!=null){a0=aX.defaultValue}}}aT[aR+aN]=a0}}if(aE){for(aN=0;aN<aP;++aN){a0=aT[aR+aN];if(a0!=null){aX=aW[aN];if(aX.x){aF(aJ.xaxis,a0,a0)}if(aX.y){aF(aJ.yaxis,a0,a0)}}aT[aR+aN]=null}}else{if(insertSteps&&aR>0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aN<aP;++aN){aT[aR+aP+aN]=aT[aR+aN]}aT[aR+1]=aT[aR-aP+1];aR+=aP}}}}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];an(ak.processDatapoints,[aJ,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aT=aJ.datapoints.points,aP=aJ.datapoints.pointsize;var aK=aO,aQ=aO,aM=aI,aV=aI;for(aS=0;aS<aT.length;aS+=aP){if(aT[aS]==null){continue}for(aN=0;aN<aP;++aN){a0=aT[aS+aN];aX=aW[aN];if(!aX||a0==aB||a0==-aB){continue}if(aX.x){if(a0<aK){aK=a0}if(a0>aM){aM=a0}}if(aX.y){if(a0<aQ){aQ=a0}if(a0>aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('<div style="position:absolute;top:-10000px;'+aL+'font-size:smaller"><div class="'+aD.direction+"Axis "+aD.direction+aD.n+'Axis">'+aM.join("")+"</div></div>").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel" style="float:left;width:'+aK+'px">'+aE+"</div>")}}if(aI.length>0){aI.push('<div style="clear:left"></div>');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel">'+aE+"</div>")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC<Q.length;++aC){aD=Math.max(aD,Q[aC].points.radius+Q[aC].points.lineWidth/2)}}for(var aB in q){q[aB]+=O.grid.borderWidth;q[aB]=Math.max(aD,q[aB])}}h=G-q.left-q.right;w=I-q.bottom-q.top;c.each(aE,function(aF,aG){r(aG)});if(O.grid.show){c.each(allocatedAxes,function(aF,aG){U(aG)});k()}o()}function n(aE){var aF=aE.options,aD=+(aF.min!=null?aF.min:aE.datamin),aB=+(aF.max!=null?aF.max:aE.datamax),aH=aB-aD;if(aH==0){var aC=aB==0?1:0.01;if(aF.min==null){aD-=aC}if(aF.max==null||aF.min!=null){aB+=aC}}else{var aG=aF.autoscaleMargin;if(aG!=null){if(aF.min==null){aD-=aH*aG;if(aD<0&&aE.datamin!=null&&aE.datamin>=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS<aK.length-1;++aS){if(aT<(aK[aS][0]*aJ[aK[aS][1]]+aK[aS+1][0]*aJ[aK[aS+1][1]])/2&&aK[aS][0]*aJ[aK[aS][1]]>=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4<aX.max&&a4!=aY);return a2};aR=function(aV,aY){var a0=new Date(aV);if(aM.timeformat!=null){return c.plot.formatDate(a0,aM.timeformat,aM.monthNames)}var aW=aY.tickSize[0]*aJ[aY.tickSize[1]];var aX=aY.max-aY.min;var aZ=(aM.twelveHourClock)?" %p":"";if(aW<aJ.minute){fmt="%h:%M:%S"+aZ}else{if(aW<aJ.day){if(aX<2*aJ.day){fmt="%h:%M"+aZ}else{fmt="%b %d %h:%M"+aZ}}else{if(aW<aJ.month){fmt="%b %d"}else{if(aW<aJ.year){if(aX<aJ.year){fmt="%b"}else{fmt="%b %y"}}else{fmt="%y"}}}}return c.plot.formatDate(a0,fmt,aM.monthNames)}}else{var aU=aM.tickDecimals;var aP=-Math.floor(Math.log(aT)/Math.LN10);if(aU!=null&&aP>aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO<aM.minTickSize){aO=aM.minTickSize}aG.tickDecimals=Math.max(0,aU!=null?aU:aP);aG.tickSize=aM.tickSize||aO;aB=function(aX){var aZ=[];var a0=a(aX.min,aX.tickSize),aW=0,aV=Number.NaN,aY;do{aY=aV;aV=a0+aW*aX.tickSize;aZ.push(aV);++aW}while(aV<aX.max&&aV!=aY);return aZ};aR=function(aV,aW){return aV.toFixed(aW.tickDecimals)}}if(aM.alignTicksWithAxis!=null){var aF=(aG.direction=="x"?p:aw)[aM.alignTicksWithAxis-1];if(aF&&aF.used&&aF!=aG){var aL=aB(aG);if(aL.length>0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW<aF.ticks.length;++aW){aV=(aF.ticks[aW].v-aF.min)/(aF.max-aF.min);aV=aX.min+aV*(aX.max-aX.min);aY.push(aV)}return aY};if(aG.mode!="time"&&aM.tickDecimals==null){var aE=Math.max(0,-Math.floor(Math.log(aT)/Math.LN10)+1),aD=aB(aG);if(!(aD.length>1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE<aG.length;++aE){var aC=null;var aD=aG[aE];if(typeof aD=="object"){aB=+aD[0];if(aD.length>1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aB<Q.length;++aB){an(ak.drawSeries,[H,Q[aB]]);d(Q[aB])}an(ak.draw,[H]);if(aC.show&&aC.aboveData){ac()}}function D(aB,aI){var aE,aH,aG,aD,aF=m();for(i=0;i<aF.length;++i){aE=aF[i];if(aE.direction==aI){aD=aI+aE.n+"axis";if(!aB[aD]&&aE.n==1){aD=aI+"axis"}if(aB[aD]){aH=aB[aD].from;aG=aB[aD].to;break}}}if(!aB[aD]){aE=aI=="x"?p[0]:aw[0];aH=aB[aI+"1"];aG=aB[aI+"2"]}if(aH!=null&&aG!=null&&aH>aG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aF<aH.length;++aF){var aD=aH[aF],aC=D(aD,"x"),aI=D(aD,"y");if(aC.from==null){aC.from=aC.axis.min}if(aC.to==null){aC.to=aC.axis.max}if(aI.from==null){aI.from=aI.axis.min}if(aI.to==null){aI.to=aI.axis.max}if(aC.to<aC.axis.min||aC.from>aC.axis.max||aI.to<aI.axis.min||aI.from>aI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aE<aK.length;++aE){var aB=aK[aE],aG=aB.box,aQ=aB.tickLength,aN,aL,aP,aJ;if(!aB.show||aB.ticks.length==0){continue}H.strokeStyle=aB.options.tickColor||c.color.parse(aB.options.color).scale("a",0.22).toString();H.lineWidth=1;if(aB.direction=="x"){aN=0;if(aQ=="full"){aL=(aB.position=="top"?0:w)}else{aL=aG.top-q.top+(aB.position=="top"?aG.height:0)}}else{aL=0;if(aQ=="full"){aN=(aB.position=="left"?0:h)}else{aN=aG.left-q.left+(aB.position=="left"?aG.width:0)}}if(!aB.innermost){H.beginPath();aP=aJ=0;if(aB.direction=="x"){aP=h}else{aJ=w}if(H.lineWidth==1){aN=Math.floor(aN)+0.5;aL=Math.floor(aL)+0.5}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ);H.stroke()}H.beginPath();for(aF=0;aF<aB.ticks.length;++aF){var aO=aB.ticks[aF].v;aP=aJ=0;if(aO<aB.min||aO>aB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['<div class="tickLabels" style="font-size:smaller">'];var aJ=m();for(var aD=0;aD<aJ.length;++aD){var aC=aJ[aD],aF=aC.box;if(!aC.show){continue}aG.push('<div class="'+aC.direction+"Axis "+aC.direction+aC.n+'Axis" style="color:'+aC.options.color+'">');for(var aE=0;aE<aC.ticks.length;++aE){var aH=aC.ticks[aE];if(!aH.label||aH.v<aC.min||aH.v>aC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('<div class="tickLabel" style="'+aB.join(";")+'">'+aH.label+"</div>")}aG.push("</div>")}aG.push("</div>");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO<aV.length;aO+=aJ){var aL=aV[aO-aJ],aS=aV[aO-aJ+1],aK=aV[aO],aR=aV[aO+1];if(aL==null||aK==null){continue}if(aS<=aR&&aS<aT.min){if(aR<aT.min){continue}aL=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.min}else{if(aR<=aS&&aR<aT.min){if(aS<aT.min){continue}aK=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.min}}if(aS>=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL<aU.min){if(aK<aU.min){continue}aS=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.min}else{if(aK<=aL&&aK<aU.min){if(aL<aU.min){continue}aR=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.min}}if(aL>=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ<aQ.min){if(aY<aQ.min){continue}aK=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.min}else{if(aY<=aZ&&aY<aQ.min){if(aZ<aQ.min){continue}aJ=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.min}}if(aZ>=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK<aP.min&&aJ>=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ<aP.min&&aK>=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aL<aR.length;aL+=aI){var aP=aR[aL],aO=aR[aL+1];if(aP==null||aP<aT.min||aP>aT.max||aO<aQ.min||aO>aQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aT<aE){aS=aT;aT=aE;aE=aS;aG=true;aB=false}}else{aG=aB=aO=true;aH=false;aE=aN+aI;aT=aN+aQ;aJ=aV;aP=aM;if(aP<aJ){aS=aP;aP=aJ;aJ=aS;aH=true;aO=false}}if(aT<aL.min||aE>aL.max||aP<aK.min||aJ>aK.max){return}if(aE<aL.min){aE=aL.min;aG=false}if(aT>aL.max){aT=aL.max;aB=false}if(aJ<aK.min){aJ=aK.min;aH=false}if(aP>aK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH<aO.length;aH+=aF){if(aO[aH]==null){continue}E(aO[aH],aO[aH+1],aO[aH+2],aI,aL,aG,aK,aN,aM,H,aD.bars.horizontal,aD.bars.lineWidth)}}H.save();H.translate(q.left,q.top);H.lineWidth=aD.bars.lineWidth;H.strokeStyle=aD.color;var aB=aD.bars.align=="left"?0:-aD.bars.barWidth/2;var aE=aD.bars.fill?function(aF,aG){return ae(aD.bars,aD.color,aF,aG)}:null;aC(aD.datapoints,aB,aB+aD.bars.barWidth,0,aE,aD.xaxis,aD.yaxis);H.restore()}function ae(aD,aB,aC,aF){var aE=aD.fill;if(!aE){return null}if(aD.fillColor){return am(aD.fillColor,aC,aF,aB)}var aG=c.color.parse(aB);aG.a=typeof aE=="number"?aE:0.4;aG.normalize();return aG.toString()}function o(){av.find(".legend").remove();if(!O.legend.show){return}var aH=[],aF=false,aN=O.legend.labelFormatter,aM,aJ;for(var aE=0;aE<Q.length;++aE){aM=Q[aE];aJ=aM.label;if(!aJ){continue}if(aE%O.legend.noColumns==0){if(aF){aH.push("</tr>")}aH.push("<tr>");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('<td class="legendColorBox"><div style="border:1px solid '+O.legend.labelBoxBorderColor+';padding:1px"><div style="width:4px;height:0;border:5px solid '+aM.color+';overflow:hidden"></div></div></td><td class="legendLabel">'+aJ+"</td>")}if(aF){aH.push("</tr>")}if(aH.length==0){return}var aL='<table style="font-size:smaller;color:'+O.grid.color+'">'+aH.join("")+"</table>";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('<div class="legend">'+aL.replace('style="','style="position:absolute;'+aI+";")+"</div>").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('<div style="position:absolute;width:'+aB.width()+"px;height:"+aB.height()+"px;"+aI+"background-color:"+aG+';"> </div>').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1];if(aK==null){continue}if(aK-aQ>aC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS<a0){a0=aS;aY=[aW,aU/aT]}}}if(aP.bars.show&&!aY){var aE=aP.bars.align=="left"?0:-aP.bars.barWidth/2,aX=aE+aP.bars.barWidth;for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1],aZ=aV[aU+2];if(aK==null){continue}if(Q[aW].bars.horizontal?(aQ<=Math.max(aZ,aK)&&aQ>=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aG<ab.length;++aG){var aI=ab[aG];if(aI.auto==aC&&!(aK&&aI.series==aK.series&&aI.point[0]==aK.datapoint[0]&&aI.point[1]==aK.datapoint[1])){T(aI.series,aI.point)}}if(aK){x(aK.series,aK.datapoint,aC)}}av.trigger(aC,[aJ,aK])}function f(){if(!M){M=setTimeout(s,30)}}function s(){M=null;A.save();A.clearRect(0,0,G,I);A.translate(q.left,q.top);var aC,aB;for(aC=0;aC<ab.length;++aC){aB=ab[aC];if(aB.series.bars.show){v(aB.series,aB.point)}else{ay(aB.series,aB.point)}}A.restore();an(ak.drawOverlay,[A])}function x(aD,aB,aF){if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){var aE=aD.datapoints.pointsize;aB=aD.datapoints.points.slice(aE*aB,aE*(aB+1))}var aC=al(aD,aB);if(aC==-1){ab.push({series:aD,point:aB,auto:aF});f()}else{if(!aF){ab[aC].auto=false}}}function T(aD,aB){if(aD==null&&aB==null){ab=[];f()}if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){aB=aD.data[aB]}var aC=al(aD,aB);if(aC!=-1){ab.splice(aC,1);f()}}function al(aD,aE){for(var aB=0;aB<ab.length;++aB){var aC=ab[aB];if(aC.series==aD&&aC.point[0]==aE[0]&&aC.point[1]==aE[1]){return aB}}return -1}function ay(aE,aD){var aC=aD[0],aI=aD[1],aH=aE.xaxis,aG=aE.yaxis;if(aC<aH.min||aC>aH.max||aI<aG.min||aI>aG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE<aD;++aE){var aF=aJ.colors[aE];if(typeof aF!="string"){var aG=c.color.parse(aC);if(aF.brightness!=null){aG=aG.scale("rgb",aF.brightness)}if(aF.opacity!=null){aG.a*=aF.opacity}aF=aG.toString()}aI.addColorStop(aE/(aD-1),aF)}return aI}}}c.plot=function(g,e,d){var f=new b(c(g),e,d,c.plot.plugins);return f};c.plot.version="0.7";c.plot.plugins=[];c.plot.formatDate=function(l,f,h){var o=function(d){d=""+d;return d.length==1?"0"+d:d};var e=[];var p=false,j=false;var n=l.getUTCHours();var k=n<12;if(h==null){h=["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}if(f.search(/%p|%P/)!=-1){if(n>12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g<f.length;++g){var m=f.charAt(g);if(p){switch(m){case"h":m=""+n;break;case"H":m=o(n);break;case"M":m=o(l.getUTCMinutes());break;case"S":m=o(l.getUTCSeconds());break;case"d":m=""+l.getUTCDate();break;case"m":m=""+(l.getUTCMonth()+1);break;case"y":m=""+l.getUTCFullYear();break;case"b":m=""+h[l.getUTCMonth()];break;case"p":m=(k)?("am"):("pm");break;case"P":m=(k)?("AM"):("PM");break;case"0":m="";j=true;break}if(m&&j){m=o(m);j=false}e.push(m);if(!j){p=false}}else{if(m=="%"){p=true}else{e.push(m)}}}return e.join("")};function a(e,d){return d*Math.floor(e/d)}})(jQuery); \ No newline at end of file
diff --git a/module/web/static/js/libs/jquery.mobile-1.1.1.min.js b/module/web/static/js/libs/jquery.mobile-1.1.1.min.js
new file mode 100644
index 000000000..70f71928f
--- /dev/null
+++ b/module/web/static/js/libs/jquery.mobile-1.1.1.min.js
@@ -0,0 +1,181 @@
+/*! jQuery Mobile v1.1.1 1981b3f5ec22675ae47df8f0bdf9622e7780e90e jquerymobile.com | jquery.org/license */
+(function(l,t,k){typeof define==="function"&&define.amd?define(["jquery"],function(E){k(E,l,t);return E.mobile}):k(l.jQuery,l,t)})(this,document,function(l,t,k,E){(function(a,c,b,d){function e(a){for(;a&&typeof a.originalEvent!=="undefined";)a=a.originalEvent;return a}function g(b){for(var e={},g,d;b;){g=a.data(b,s);for(d in g)if(g[d])e[d]=e.hasVirtualBinding=true;b=b.parentNode}return e}function f(){y&&(clearTimeout(y),y=0);y=setTimeout(function(){G=y=0;A.length=0;F=false;H=true},a.vmouse.resetTimerDuration)}
+function j(b,g,c){var f,h;if(!(h=c&&c[b])){if(c=!c)a:{for(c=g.target;c;){if((h=a.data(c,s))&&(!b||h[b]))break a;c=c.parentNode}c=null}h=c}if(h){f=g;var c=f.type,j,F;f=a.Event(f);f.type=b;h=f.originalEvent;j=a.event.props;c.search(/^(mouse|click)/)>-1&&(j=w);if(h)for(F=j.length;F;)b=j[--F],f[b]=h[b];if(c.search(/mouse(down|up)|click/)>-1&&!f.which)f.which=1;if(c.search(/^touch/)!==-1&&(b=e(h),c=b.touches,b=b.changedTouches,c=c&&c.length?c[0]:b&&b.length?b[0]:d))for(h=0,len=x.length;h<len;h++)b=x[h],
+f[b]=c[b];a(g.target).trigger(f)}return f}function h(b){var e=a.data(b.target,u);if(!F&&(!G||G!==e))if(e=j("v"+b.type,b))e.isDefaultPrevented()&&b.preventDefault(),e.isPropagationStopped()&&b.stopPropagation(),e.isImmediatePropagationStopped()&&b.stopImmediatePropagation()}function q(b){var c=e(b).touches,d;if(c&&c.length===1&&(d=b.target,c=g(d),c.hasVirtualBinding))G=N++,a.data(d,u,G),y&&(clearTimeout(y),y=0),z=H=false,d=e(b).touches[0],t=d.pageX,C=d.pageY,j("vmouseover",b,c),j("vmousedown",b,c)}
+function o(a){H||(z||j("vmousecancel",a,g(a.target)),z=true,f())}function m(b){if(!H){var c=e(b).touches[0],d=z,h=a.vmouse.moveDistanceThreshold;z=z||Math.abs(c.pageX-t)>h||Math.abs(c.pageY-C)>h;flags=g(b.target);z&&!d&&j("vmousecancel",b,flags);j("vmousemove",b,flags);f()}}function v(a){if(!H){H=true;var b=g(a.target),c;j("vmouseup",a,b);if(!z&&(c=j("vclick",a,b))&&c.isDefaultPrevented())c=e(a).changedTouches[0],A.push({touchID:G,x:c.clientX,y:c.clientY}),F=true;j("vmouseout",a,b);z=false;f()}}function n(b){var b=
+a.data(b,s),e;if(b)for(e in b)if(b[e])return true;return false}function k(){}function p(b){var e=b.substr(1);return{setup:function(){n(this)||a.data(this,s,{});a.data(this,s)[b]=true;l[b]=(l[b]||0)+1;l[b]===1&&J.bind(e,h);a(this).bind(e,k);if(M)l.touchstart=(l.touchstart||0)+1,l.touchstart===1&&J.bind("touchstart",q).bind("touchend",v).bind("touchmove",m).bind("scroll",o)},teardown:function(){--l[b];l[b]||J.unbind(e,h);M&&(--l.touchstart,l.touchstart||J.unbind("touchstart",q).unbind("touchmove",m).unbind("touchend",
+v).unbind("scroll",o));var g=a(this),c=a.data(this,s);c&&(c[b]=false);g.unbind(e,k);n(this)||g.removeData(s)}}}var s="virtualMouseBindings",u="virtualTouchID",c="vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "),x="clientX clientY pageX pageY screenX screenY".split(" "),w=a.event.props.concat(a.event.mouseHooks?a.event.mouseHooks.props:[]),l={},y=0,t=0,C=0,z=false,A=[],F=false,H=false,M="addEventListener"in b,J=a(b),N=1,G=0;a.vmouse={moveDistanceThreshold:10,clickDistanceThreshold:10,
+resetTimerDuration:1500};for(var K=0;K<c.length;K++)a.event.special[c[K]]=p(c[K]);M&&b.addEventListener("click",function(b){var e=A.length,g=b.target,c,d,f,h,j;if(e){c=b.clientX;d=b.clientY;threshold=a.vmouse.clickDistanceThreshold;for(f=g;f;){for(h=0;h<e;h++)if(j=A[h],f===g&&Math.abs(j.x-c)<threshold&&Math.abs(j.y-d)<threshold||a.data(f,u)===j.touchID){b.preventDefault();b.stopPropagation();return}f=f.parentNode}}},true)})(l,t,k);(function(a,c,b){function d(a){a=a||location.href;return"#"+a.replace(/^[^#]*#?(.*)$/,
+"$1")}var e="hashchange",g=k,f,j=a.event.special,h=g.documentMode,q="on"+e in c&&(h===b||h>7);a.fn[e]=function(a){return a?this.bind(e,a):this.trigger(e)};a.fn[e].delay=50;j[e]=a.extend(j[e],{setup:function(){if(q)return false;a(f.start)},teardown:function(){if(q)return false;a(f.stop)}});f=function(){function f(){var b=d(),g=s(n);if(b!==n)p(n=b,g),a(c).trigger(e);else if(g!==n)location.href=location.href.replace(/#.*/,"")+g;j=setTimeout(f,a.fn[e].delay)}var h={},j,n=d(),k=function(a){return a},p=
+k,s=k;h.start=function(){j||f()};h.stop=function(){j&&clearTimeout(j);j=b};a.browser.msie&&!q&&function(){var b,c;h.start=function(){if(!b)c=(c=a.fn[e].src)&&c+d(),b=a('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){c||p(d());f()}).attr("src",c||"javascript:0").insertAfter("body")[0].contentWindow,g.onpropertychange=function(){try{if(event.propertyName==="title")b.document.title=g.title}catch(a){}}};h.stop=k;s=function(){return d(b.location.href)};p=function(c,d){var f=b.document,
+h=a.fn[e].domain;if(c!==d)f.title=g.title,f.open(),h&&f.write('<script>document.domain="'+h+'"<\/script>'),f.close(),b.location.hash=c}}();return h}()})(l,this);(function(a,c){if(a.cleanData){var b=a.cleanData;a.cleanData=function(e){for(var c=0,f;(f=e[c])!=null;c++)a(f).triggerHandler("remove");b(e)}}else{var d=a.fn.remove;a.fn.remove=function(b,c){return this.each(function(){c||(!b||a.filter(b,[this]).length)&&a("*",this).add([this]).each(function(){a(this).triggerHandler("remove")});return d.call(a(this),
+b,c)})}}a.widget=function(b,c,f){var d=b.split(".")[0],h,b=b.split(".")[1];h=d+"-"+b;if(!f)f=c,c=a.Widget;a.expr[":"][h]=function(c){return!!a.data(c,b)};a[d]=a[d]||{};a[d][b]=function(a,b){arguments.length&&this._createWidget(a,b)};c=new c;c.options=a.extend(true,{},c.options);a[d][b].prototype=a.extend(true,c,{namespace:d,widgetName:b,widgetEventPrefix:a[d][b].prototype.widgetEventPrefix||b,widgetBaseClass:h},f);a.widget.bridge(b,a[d][b])};a.widget.bridge=function(b,g){a.fn[b]=function(d){var j=
+typeof d==="string",h=Array.prototype.slice.call(arguments,1),q=this,d=!j&&h.length?a.extend.apply(null,[true,d].concat(h)):d;if(j&&d.charAt(0)==="_")return q;j?this.each(function(){var g=a.data(this,b);if(!g)throw"cannot call methods on "+b+" prior to initialization; attempted to call method '"+d+"'";if(!a.isFunction(g[d]))throw"no such method '"+d+"' for "+b+" widget instance";var j=g[d].apply(g,h);if(j!==g&&j!==c)return q=j,false}):this.each(function(){var c=a.data(this,b);c?c.option(d||{})._init():
+a.data(this,b,new g(d,this))});return q}};a.Widget=function(a,b){arguments.length&&this._createWidget(a,b)};a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(b,c){a.data(c,this.widgetName,this);this.element=a(c);this.options=a.extend(true,{},this.options,this._getCreateOptions(),b);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){var b=
+{};a.metadata&&(b=a.metadata.get(element)[this.widgetName]);return b},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(b,d){var f=b;if(arguments.length===0)return a.extend({},this.options);if(typeof b==="string"){if(d===c)return this.options[b];
+f={};f[b]=d}this._setOptions(f);return this},_setOptions:function(b){var c=this;a.each(b,function(a,b){c._setOption(a,b)});return this},_setOption:function(a,b){this.options[a]=b;a==="disabled"&&this.widget()[b?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",b);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(b,c,d){var j=this.options[b],c=a.Event(c);
+c.type=(b===this.widgetEventPrefix?b:this.widgetEventPrefix+b).toLowerCase();d=d||{};if(c.originalEvent)for(var b=a.event.props.length,h;b;)h=a.event.props[--b],c[h]=c.originalEvent[h];this.element.trigger(c,d);return!(a.isFunction(j)&&j.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(l);(function(a,c){a.widget("mobile.widget",{_createWidget:function(){a.Widget.prototype._createWidget.apply(this,arguments);this._trigger("init")},_getCreateOptions:function(){var b=this.element,d={};
+a.each(this.options,function(a){var g=b.jqmData(a.replace(/[A-Z]/g,function(a){return"-"+a.toLowerCase()}));g!==c&&(d[a]=g)});return d},enhanceWithin:function(b,c){this.enhance(a(this.options.initSelector,a(b)),c)},enhance:function(b,c){var e,g=a(b),g=a.mobile.enhanceable(g);c&&g.length&&(e=(e=a.mobile.closestPageData(g))&&e.keepNativeSelector()||"",g=g.not(e));g[this.widgetName]()},raise:function(a){throw"Widget ["+this.widgetName+"]: "+a;}})})(l);(function(a,c){var b={};a.mobile=a.extend({},{version:"1.1.1",
+ns:"",subPageUrlKey:"ui-page",activePageClass:"ui-page-active",activeBtnClass:"ui-btn-active",focusClass:"ui-focus",ajaxEnabled:true,hashListeningEnabled:true,linkBindingEnabled:true,defaultPageTransition:"fade",maxTransitionWidth:false,minScrollBack:250,touchOverflowEnabled:false,defaultDialogTransition:"pop",loadingMessage:"loading",pageLoadErrorMessage:"Error Loading Page",loadingMessageTextVisible:false,loadingMessageTheme:"a",pageLoadErrorMessageTheme:"e",autoInitializePage:true,pushStateEnabled:true,
+ignoreContentEnabled:false,orientationChangeEnabled:true,buttonMarkup:{hoverDelay:200},keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91},silentScroll:function(b){if(a.type(b)!==
+"number")b=a.mobile.defaultHomeScroll;a.event.special.scrollstart.enabled=false;setTimeout(function(){c.scrollTo(0,b);a(k).trigger("silentscroll",{x:0,y:b})},20);setTimeout(function(){a.event.special.scrollstart.enabled=true},150)},nsNormalizeDict:b,nsNormalize:function(c){return!c?void 0:b[c]||(b[c]=a.camelCase(a.mobile.ns+c))},getInheritedTheme:function(a,b){for(var c=a[0],d="",e=/ui-(bar|body|overlay)-([a-z])\b/,o,m;c;){if((o=c.className||"")&&(m=e.exec(o))&&(d=m[2]))break;c=c.parentNode}return d||
+b||"a"},closestPageData:function(a){return a.closest(':jqmData(role="page"), :jqmData(role="dialog")').data("page")},enhanceable:function(a){return this.haveParents(a,"enhance")},hijackable:function(a){return this.haveParents(a,"ajax")},haveParents:function(b,c){if(!a.mobile.ignoreContentEnabled)return b;for(var d=b.length,e=a(),q,o,m,v=0;v<d;v++){o=b.eq(v);m=false;for(q=b[v];q;){if((q.getAttribute?q.getAttribute("data-"+a.mobile.ns+c):"")==="false"){m=true;break}q=q.parentNode}m||(e=e.add(o))}return e},
+getScreenHeight:function(){return c.innerHeight||a(c).height()}},a.mobile);a.fn.jqmData=function(b,c){var d;typeof b!="undefined"&&(b&&(b=a.mobile.nsNormalize(b)),d=this.data.apply(this,arguments.length<2?[b]:[b,c]));return d};a.jqmData=function(b,c,d){var e;typeof c!="undefined"&&(e=a.data(b,c?a.mobile.nsNormalize(c):c,d));return e};a.fn.jqmRemoveData=function(b){return this.removeData(a.mobile.nsNormalize(b))};a.jqmRemoveData=function(b,c){return a.removeData(b,a.mobile.nsNormalize(c))};a.fn.removeWithDependents=
+function(){a.removeWithDependents(this)};a.removeWithDependents=function(b){b=a(b);(b.jqmData("dependents")||a()).remove();b.remove()};a.fn.addDependents=function(b){a.addDependents(a(this),b)};a.addDependents=function(b,c){var d=a(b).jqmData("dependents")||a();a(b).jqmData("dependents",a.merge(d,c))};a.fn.getEncodedText=function(){return a("<div/>").text(a(this).text()).html()};a.fn.jqmEnhanceable=function(){return a.mobile.enhanceable(this)};a.fn.jqmHijackable=function(){return a.mobile.hijackable(this)};
+var d=a.find,e=/:jqmData\(([^)]*)\)/g;a.find=function(b,c,j,h){b=b.replace(e,"[data-"+(a.mobile.ns||"")+"$1]");return d.call(this,b,c,j,h)};a.extend(a.find,d);a.find.matches=function(b,c){return a.find(b,null,null,c)};a.find.matchesSelector=function(b,c){return a.find(c,null,null,[b]).length>0}})(l,this);(function(a){a(t);var c=a("html");a.mobile.media=function(){var b={},d=a("<div id='jquery-mediatest'></div>"),e=a("<body>").append(d);return function(a){if(!(a in b)){var f=k.createElement("style"),
+j="@media "+a+" { #jquery-mediatest { position:absolute; } }";f.type="text/css";f.styleSheet?f.styleSheet.cssText=j:f.appendChild(k.createTextNode(j));c.prepend(e).prepend(f);b[a]=d.css("position")==="absolute";e.add(f).remove()}return b[a]}}()})(l);(function(a,c){function b(a){var b=a.charAt(0).toUpperCase()+a.substr(1),a=(a+" "+f.join(b+" ")+b).split(" "),d;for(d in a)if(g[a[d]]!==c)return true}function d(a,b,c){var d=k.createElement("div"),c=c?[c]:f,e;for(i=0;i<c.length;i++){var h=c[i],j="-"+h.charAt(0).toLowerCase()+
+h.substr(1)+"-"+a+": "+b+";",h=h.charAt(0).toUpperCase()+h.substr(1)+(a.charAt(0).toUpperCase()+a.substr(1));d.setAttribute("style",j);d.style[h]&&(e=true)}return!!e}var e=a("<body>").prependTo("html"),g=e[0].style,f=["Webkit","Moz","O"],j="palmGetResource"in t,h=t.opera,q=t.operamini&&{}.toString.call(t.operamini)==="[object OperaMini]",o=t.blackberry;a.extend(a.mobile,{browser:{}});a.mobile.browser.ie=function(){for(var a=3,b=k.createElement("div"),c=b.all||[];b.innerHTML="<\!--[if gt IE "+ ++a+
+"]><br><![endif]--\>",c[0];);return a>4?a:!a}();a.extend(a.support,{orientation:"orientation"in t&&"onorientationchange"in t,touch:"ontouchend"in k,cssTransitions:"WebKitTransitionEvent"in t||d("transition","height 100ms linear")&&!h,pushState:"pushState"in history&&"replaceState"in history,mediaquery:a.mobile.media("only all"),cssPseudoElement:!!b("content"),touchOverflow:!!b("overflowScrolling"),cssTransform3d:d("perspective","10px","moz")||a.mobile.media("(-"+f.join("-transform-3d),(-")+"-transform-3d),(transform-3d)"),
+boxShadow:!!b("boxShadow")&&!o,scrollTop:("pageXOffset"in t||"scrollTop"in k.documentElement||"scrollTop"in e[0])&&!j&&!q,dynamicBaseTag:function(){var b=location.protocol+"//"+location.host+location.pathname+"ui-dir/",c=a("head base"),d=null,h="",f;c.length?h=c.attr("href"):c=d=a("<base>",{href:b}).appendTo("head");f=a("<a href='testurl' />").prependTo(e)[0].href;c[0].href=h||location.pathname;d&&d.remove();return f.indexOf(b)===0}(),cssPointerEvents:function(){var a=k.createElement("x"),b=k.documentElement,
+c=t.getComputedStyle;if(!("pointerEvents"in a.style))return false;a.style.pointerEvents="auto";a.style.pointerEvents="x";b.appendChild(a);c=c&&c(a,"").pointerEvents==="auto";b.removeChild(a);return!!c}()});e.remove();j=function(){var a=t.navigator.userAgent;return a.indexOf("Nokia")>-1&&(a.indexOf("Symbian/3")>-1||a.indexOf("Series60/5")>-1)&&a.indexOf("AppleWebKit")>-1&&a.match(/(BrowserNG|NokiaBrowser)\/7\.[0-3]/)}();a.mobile.gradeA=function(){return a.support.mediaquery||a.mobile.browser.ie&&a.mobile.browser.ie>=
+7};a.mobile.ajaxBlacklist=t.blackberry&&!t.WebKitPoint||q||j;j&&a(function(){a("head link[rel='stylesheet']").attr("rel","alternate stylesheet").attr("rel","stylesheet")});a.support.boxShadow||a("html").addClass("ui-mobile-nosupport-boxshadow")})(l);(function(a,c,b){function d(b,c,d){var e=d.type;d.type=c;a.event.handle.call(b,d);d.type=e}a.each("touchstart touchmove touchend orientationchange throttledresize tap taphold swipe swipeleft swiperight scrollstart scrollstop".split(" "),function(b,c){a.fn[c]=
+function(a){return a?this.bind(c,a):this.trigger(c)};a.attrFn[c]=true});var e=a.support.touch,g=e?"touchstart":"mousedown",f=e?"touchend":"mouseup",j=e?"touchmove":"mousemove";a.event.special.scrollstart={enabled:true,setup:function(){function b(a,h){e=h;d(c,e?"scrollstart":"scrollstop",a)}var c=this,e,f;a(c).bind("touchmove scroll",function(c){a.event.special.scrollstart.enabled&&(e||b(c,true),clearTimeout(f),f=setTimeout(function(){b(c,false)},50))})}};a.event.special.tap={setup:function(){var b=
+this,c=a(b);c.bind("vmousedown",function(e){function f(){clearTimeout(p)}function j(){f();c.unbind("vclick",g).unbind("vmouseup",f);a(k).unbind("vmousecancel",j)}function g(a){j();r==a.target&&d(b,"tap",a)}if(e.which&&e.which!==1)return false;var r=e.target,p;c.bind("vmouseup",f).bind("vclick",g);a(k).bind("vmousecancel",j);p=setTimeout(function(){d(b,"taphold",a.Event("taphold",{target:r}))},750)})}};a.event.special.swipe={scrollSupressionThreshold:10,durationThreshold:1E3,horizontalDistanceThreshold:30,
+verticalDistanceThreshold:75,setup:function(){var c=a(this);c.bind(g,function(d){function e(b){if(k){var c=b.originalEvent.touches?b.originalEvent.touches[0]:b;n={time:(new Date).getTime(),coords:[c.pageX,c.pageY]};Math.abs(k.coords[0]-n.coords[0])>a.event.special.swipe.scrollSupressionThreshold&&b.preventDefault()}}var g=d.originalEvent.touches?d.originalEvent.touches[0]:d,k={time:(new Date).getTime(),coords:[g.pageX,g.pageY],origin:a(d.target)},n;c.bind(j,e).one(f,function(){c.unbind(j,e);k&&n&&
+n.time-k.time<a.event.special.swipe.durationThreshold&&Math.abs(k.coords[0]-n.coords[0])>a.event.special.swipe.horizontalDistanceThreshold&&Math.abs(k.coords[1]-n.coords[1])<a.event.special.swipe.verticalDistanceThreshold&&k.origin.trigger("swipe").trigger(k.coords[0]>n.coords[0]?"swipeleft":"swiperight");k=n=b})})}};(function(a,b){function c(){var a=e();a!==f&&(f=a,d.trigger("orientationchange"))}var d=a(b),e,f,j,g,l={0:true,180:true};if(a.support.orientation&&(j=b.innerWidth||a(b).width(),g=b.innerHeight||
+a(b).height(),j=j>g&&j-g>50,g=l[b.orientation],j&&g||!j&&!g))l={"-90":true,90:true};a.event.special.orientationchange={setup:function(){if(a.support.orientation&&a.mobile.orientationChangeEnabled)return false;f=e();d.bind("throttledresize",c)},teardown:function(){if(a.support.orientation&&a.mobile.orientationChangeEnabled)return false;d.unbind("throttledresize",c)},add:function(a){var b=a.handler;a.handler=function(a){a.orientation=e();return b.apply(this,arguments)}}};a.event.special.orientationchange.orientation=
+e=function(){var c=true,c=k.documentElement;return(c=a.support.orientation?l[b.orientation]:c&&c.clientWidth/c.clientHeight<1.1)?"portrait":"landscape"}})(l,c);(function(){a.event.special.throttledresize={setup:function(){a(this).bind("resize",b)},teardown:function(){a(this).unbind("resize",b)}};var b=function(){e=(new Date).getTime();f=e-c;f>=250?(c=e,a(this).trigger("throttledresize")):(d&&clearTimeout(d),d=setTimeout(b,250-f))},c=0,d,e,f})();a.each({scrollstop:"scrollstart",taphold:"tap",swipeleft:"swipe",
+swiperight:"swipe"},function(b,c){a.event.special[b]={setup:function(){a(this).bind(c,a.noop)}}})})(l,this);(function(a){a.widget("mobile.page",a.mobile.widget,{options:{theme:"c",domCache:false,keepNativeDefault:":jqmData(role='none'), :jqmData(role='nojs')"},_create:function(){var a=this;if(a._trigger("beforecreate")===false)return false;a.element.attr("tabindex","0").addClass("ui-page ui-body-"+a.options.theme).bind("pagebeforehide",function(){a.removeContainerBackground()}).bind("pagebeforeshow",
+function(){a.setContainerBackground()})},removeContainerBackground:function(){a.mobile.pageContainer.removeClass("ui-overlay-"+a.mobile.getInheritedTheme(this.element.parent()))},setContainerBackground:function(c){this.options.theme&&a.mobile.pageContainer.addClass("ui-overlay-"+(c||this.options.theme))},keepNativeSelector:function(){var c=this.options;return c.keepNative&&a.trim(c.keepNative)&&c.keepNative!==c.keepNativeDefault?[c.keepNative,c.keepNativeDefault].join(", "):c.keepNativeDefault}})})(l);
+(function(a,c,b){var d=function(d){d===b&&(d=true);return function(b,e,h,q){var k=new a.Deferred,m=e?" reverse":"",l=a.mobile.urlHistory.getActive().lastScroll||a.mobile.defaultHomeScroll,n=a.mobile.getScreenHeight(),r=a.mobile.maxTransitionWidth!==false&&a(c).width()>a.mobile.maxTransitionWidth,p=!a.support.cssTransitions||r||!b||b==="none"||Math.max(a(c).scrollTop(),l)>a.mobile.getMaxScrollForTransition(),s=function(){a.mobile.pageContainer.toggleClass("ui-mobile-viewport-transitioning viewport-"+
+b)},u=function(){a.event.special.scrollstart.enabled=false;c.scrollTo(0,l);setTimeout(function(){a.event.special.scrollstart.enabled=true},150)},x=function(){q.removeClass(a.mobile.activePageClass+" out in reverse "+b).height("")},r=function(){q&&d&&x();h.addClass(a.mobile.activePageClass);a.mobile.focusPage(h);h.height(n+l);u();p||h.animationComplete(w);h.addClass(b+" in"+m);p&&w()},w=function(){d||q&&x();h.removeClass("out in reverse "+b).height("");s();a(c).scrollTop()!==l&&u();k.resolve(b,e,h,
+q,true)};s();q&&!p?(d?q.animationComplete(r):r(),q.height(n+a(c).scrollTop()).addClass(b+" out"+m)):r();return k.promise()}},e=d(),d=d(false);a.mobile.defaultTransitionHandler=e;a.mobile.transitionHandlers={"default":a.mobile.defaultTransitionHandler,sequential:e,simultaneous:d};a.mobile.transitionFallbacks={};a.mobile.getMaxScrollForTransition=a.mobile.getMaxScrollForTransition||function(){return a.mobile.getScreenHeight()*3}})(l,this);(function(a,c){function b(b){l&&(!l.closest(".ui-page-active").length||
+b)&&l.removeClass(a.mobile.activeBtnClass);l=null}function d(){p=false;r.length>0&&a.mobile.changePage.apply(null,r.pop())}function e(b,c,d,e){c&&c.data("page")._trigger("beforehide",null,{nextPage:b});b.data("page")._trigger("beforeshow",null,{prevPage:c||a("")});a.mobile.hidePageLoadingMsg();d&&!a.support.cssTransform3d&&a.mobile.transitionFallbacks[d]&&(d=a.mobile.transitionFallbacks[d]);d=(a.mobile.transitionHandlers[d||"default"]||a.mobile.defaultTransitionHandler)(d,e,b,c);d.done(function(){c&&
+c.data("page")._trigger("hide",null,{nextPage:b});b.data("page")._trigger("show",null,{prevPage:c||a("")})});return d}function g(){var b=a("."+a.mobile.activePageClass),c=parseFloat(b.css("padding-top")),d=parseFloat(b.css("padding-bottom")),e=parseFloat(b.css("border-top-width")),f=parseFloat(b.css("border-bottom-width"));b.css("min-height",y()-c-d-e-f)}function f(b,c){c&&b.attr("data-"+a.mobile.ns+"role",c);b.page()}function j(a){for(;a;){if(typeof a.nodeName==="string"&&a.nodeName.toLowerCase()==
+"a")break;a=a.parentNode}return a}function h(b){var b=a(b).closest(".ui-page").jqmData("url"),c=w.hrefNoHash;if(!b||!m.isPath(b))b=c;return m.makeUrlAbsolute(b,c)}var q=a(t);a("html");var o=a("head"),m={urlParseRE:/^(((([^:\/#\?]+:)?(?:(\/\/)((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?\]\[]+|\[[^\/\]@#?]+\])(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/,parseUrl:function(b){if(a.type(b)==="object")return b;b=m.urlParseRE.exec(b||"")||[];return{href:b[0]||"",hrefNoHash:b[1]||
+"",hrefNoSearch:b[2]||"",domain:b[3]||"",protocol:b[4]||"",doubleSlash:b[5]||"",authority:b[6]||"",username:b[8]||"",password:b[9]||"",host:b[10]||"",hostname:b[11]||"",port:b[12]||"",pathname:b[13]||"",directory:b[14]||"",filename:b[15]||"",search:b[16]||"",hash:b[17]||""}},makePathAbsolute:function(a,b){if(a&&a.charAt(0)==="/")return a;for(var a=a||"",c=(b=b?b.replace(/^\/|(\/[^\/]*|[^\/]+)$/g,""):"")?b.split("/"):[],d=a.split("/"),e=0;e<d.length;e++){var f=d[e];switch(f){case ".":break;case "..":c.length&&
+c.pop();break;default:c.push(f)}}return"/"+c.join("/")},isSameDomain:function(a,b){return m.parseUrl(a).domain===m.parseUrl(b).domain},isRelativeUrl:function(a){return m.parseUrl(a).protocol===""},isAbsoluteUrl:function(a){return m.parseUrl(a).protocol!==""},makeUrlAbsolute:function(a,b){if(!m.isRelativeUrl(a))return a;var c=m.parseUrl(a),d=m.parseUrl(b),e=c.protocol||d.protocol,f=c.protocol?c.doubleSlash:c.doubleSlash||d.doubleSlash,h=c.authority||d.authority,j=c.pathname!=="",g=m.makePathAbsolute(c.pathname||
+d.filename,d.pathname);return e+f+h+g+(c.search||!j&&d.search||"")+c.hash},addSearchParams:function(b,c){var d=m.parseUrl(b),e=typeof c==="object"?a.param(c):c,f=d.search||"?";return d.hrefNoSearch+f+(f.charAt(f.length-1)!=="?"?"&":"")+e+(d.hash||"")},convertUrlToDataUrl:function(a){var b=m.parseUrl(a);if(m.isEmbeddedPage(b))return b.hash.split(s)[0].replace(/^#/,"");else if(m.isSameDomain(b,w))return b.hrefNoHash.replace(w.domain,"").split(s)[0];return a},get:function(a){if(a===c)a=location.hash;
+return m.stripHash(a).replace(/[^\/]*\.[^\/*]+$/,"")},getFilePath:function(b){var c="&"+a.mobile.subPageUrlKey;return b&&b.split(c)[0].split(s)[0]},set:function(a){location.hash=a},isPath:function(a){return/\//.test(a)},clean:function(a){return a.replace(w.domain,"")},stripHash:function(a){return a.replace(/^#/,"")},cleanHash:function(a){return m.stripHash(a.replace(/\?.*$/,"").replace(s,""))},isHashValid:function(a){return/^#[^#]+$/.test(a)},isExternal:function(a){a=m.parseUrl(a);return a.protocol&&
+a.domain!==x.domain?true:false},hasProtocol:function(a){return/^(:?\w+:)/.test(a)},isFirstPageUrl:function(b){var b=m.parseUrl(m.makeUrlAbsolute(b,w)),d=a.mobile.firstPage,d=d&&d[0]?d[0].id:c;return(b.hrefNoHash===x.hrefNoHash||D&&b.hrefNoHash===w.hrefNoHash)&&(!b.hash||b.hash==="#"||d&&b.hash.replace(/^#/,"")===d)},isEmbeddedPage:function(a){a=m.parseUrl(a);return a.protocol!==""?a.hash&&(a.hrefNoHash===x.hrefNoHash||D&&a.hrefNoHash===w.hrefNoHash):/^#/.test(a.href)},isPermittedCrossDomainRequest:function(b,
+c){return a.mobile.allowCrossDomainPages&&b.protocol==="file:"&&c.search(/^https?:/)!=-1}},l=null,n={stack:[],activeIndex:0,getActive:function(){return n.stack[n.activeIndex]},getPrev:function(){return n.stack[n.activeIndex-1]},getNext:function(){return n.stack[n.activeIndex+1]},addNew:function(a,b,c,d,e){n.getNext()&&n.clearForward();n.stack.push({url:a,transition:b,title:c,pageUrl:d,role:e});n.activeIndex=n.stack.length-1},clearForward:function(){n.stack=n.stack.slice(0,n.activeIndex+1)},directHashChange:function(b){var d,
+e,f;this.getActive();a.each(n.stack,function(a,c){b.currentUrl===c.url&&(d=a<n.activeIndex,e=!d,f=a)});this.activeIndex=f!==c?f:this.activeIndex;d?(b.either||b.isBack)(true):e&&(b.either||b.isForward)(false)},ignoreNextHashChange:false},r=[],p=false,s="&ui-state=dialog",u=o.children("base"),x=m.parseUrl(location.href),w=u.length?m.parseUrl(m.makeUrlAbsolute(u.attr("href"),x.href)):x,D=x.hrefNoHash!==w.hrefNoHash,y=a.mobile.getScreenHeight,B=a.support.dynamicBaseTag?{element:u.length?u:a("<base>",
+{href:w.hrefNoHash}).prependTo(o),set:function(a){B.element.attr("href",m.makeUrlAbsolute(a,w))},reset:function(){B.element.attr("href",w.hrefNoHash)}}:c;a.mobile.focusPage=function(a){var b=a.find("[autofocus]"),c=a.find(".ui-title:eq(0)");b.length?b.focus():c.length?c.focus():a.focus()};var C=true,z,A;z=function(){if(C){var b=a.mobile.urlHistory.getActive();if(b){var c=q.scrollTop();b.lastScroll=c<a.mobile.minScrollBack?a.mobile.defaultHomeScroll:c}}};A=function(){setTimeout(z,100)};q.bind(a.support.pushState?
+"popstate":"hashchange",function(){C=false});q.one(a.support.pushState?"popstate":"hashchange",function(){C=true});q.one("pagecontainercreate",function(){a.mobile.pageContainer.bind("pagechange",function(){C=true;q.unbind("scrollstop",A);q.bind("scrollstop",A)})});q.bind("scrollstop",A);a.fn.animationComplete=function(b){return a.support.cssTransitions?a(this).one("webkitAnimationEnd animationend",b):(setTimeout(b,0),a(this))};a.mobile.path=m;a.mobile.base=B;a.mobile.urlHistory=n;a.mobile.dialogHashKey=
+s;a.mobile.allowCrossDomainPages=false;a.mobile.getDocumentUrl=function(b){return b?a.extend({},x):x.href};a.mobile.getDocumentBase=function(b){return b?a.extend({},w):w.href};a.mobile._bindPageRemove=function(){var b=a(this);!b.data("page").options.domCache&&b.is(":jqmData(external-page='true')")&&b.bind("pagehide.remove",function(){var b=a(this),c=new a.Event("pageremove");b.trigger(c);c.isDefaultPrevented()||b.removeWithDependents()})};a.mobile.loadPage=function(b,d){var e=a.Deferred(),j=a.extend({},
+a.mobile.loadPage.defaults,d),g=null,q=null,k=m.makeUrlAbsolute(b,a.mobile.activePage&&h(a.mobile.activePage)||w.hrefNoHash);if(j.data&&j.type==="get")k=m.addSearchParams(k,j.data),j.data=c;if(j.data&&j.type==="post")j.reloadPage=true;var n=m.getFilePath(k),o=m.convertUrlToDataUrl(k);j.pageContainer=j.pageContainer||a.mobile.pageContainer;g=j.pageContainer.children(":jqmData(url='"+o+"')");g.length===0&&o&&!m.isPath(o)&&(g=j.pageContainer.children("#"+o).attr("data-"+a.mobile.ns+"url",o));if(g.length===
+0)if(a.mobile.firstPage&&m.isFirstPageUrl(n))a.mobile.firstPage.parent().length&&(g=a(a.mobile.firstPage));else if(m.isEmbeddedPage(n))return e.reject(k,d),e.promise();B&&B.reset();if(g.length){if(!j.reloadPage)return f(g,j.role),e.resolve(k,d,g),e.promise();q=g}var l=j.pageContainer,u=new a.Event("pagebeforeload"),p={url:b,absUrl:k,dataUrl:o,deferred:e,options:j};l.trigger(u,p);if(u.isDefaultPrevented())return e.promise();if(j.showLoadMsg)var r=setTimeout(function(){a.mobile.showPageLoadingMsg()},
+j.loadMsgDelay);!a.mobile.allowCrossDomainPages&&!m.isSameDomain(x,k)?e.reject(k,d):a.ajax({url:n,type:j.type,data:j.data,dataType:"html",success:function(c,h,x){var l=a("<div></div>"),u=c.match(/<title[^>]*>([^<]*)/)&&RegExp.$1,w=RegExp("\\bdata-"+a.mobile.ns+"url=[\"']?([^\"'>]*)[\"']?");RegExp("(<[^>]+\\bdata-"+a.mobile.ns+"role=[\"']?page[\"']?[^>]*>)").test(c)&&RegExp.$1&&w.test(RegExp.$1)&&RegExp.$1&&(b=n=m.getFilePath(RegExp.$1));B&&B.set(n);l.get(0).innerHTML=c;g=l.find(":jqmData(role='page'), :jqmData(role='dialog')").first();
+g.length||(g=a("<div data-"+a.mobile.ns+"role='page'>"+c.split(/<\/?body[^>]*>/gmi)[1]+"</div>"));u&&!g.jqmData("title")&&(~u.indexOf("&")&&(u=a("<div>"+u+"</div>").text()),g.jqmData("title",u));if(!a.support.dynamicBaseTag){var s=m.get(n);g.find("[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]").each(function(){var b=a(this).is("[href]")?"href":a(this).is("[src]")?"src":"action",c=a(this).attr(b),c=c.replace(location.protocol+"//"+location.host+location.pathname,"");/^(\w+:|#|\/)/.test(c)||
+a(this).attr(b,s+c)})}g.attr("data-"+a.mobile.ns+"url",m.convertUrlToDataUrl(n)).attr("data-"+a.mobile.ns+"external-page",true).appendTo(j.pageContainer);g.one("pagecreate",a.mobile._bindPageRemove);f(g,j.role);k.indexOf("&"+a.mobile.subPageUrlKey)>-1&&(g=j.pageContainer.children(":jqmData(url='"+o+"')"));j.showLoadMsg&&(clearTimeout(r),a.mobile.hidePageLoadingMsg());p.xhr=x;p.textStatus=h;p.page=g;j.pageContainer.trigger("pageload",p);e.resolve(k,d,g,q)},error:function(b,c,f){B&&B.set(m.get());p.xhr=
+b;p.textStatus=c;p.errorThrown=f;b=new a.Event("pageloadfailed");j.pageContainer.trigger(b,p);b.isDefaultPrevented()||(j.showLoadMsg&&(clearTimeout(r),a.mobile.hidePageLoadingMsg(),a.mobile.showPageLoadingMsg(a.mobile.pageLoadErrorMessageTheme,a.mobile.pageLoadErrorMessage,true),setTimeout(a.mobile.hidePageLoadingMsg,1500)),e.reject(k,d))}});return e.promise()};a.mobile.loadPage.defaults={type:"get",data:c,reloadPage:false,role:c,showLoadMsg:false,pageContainer:c,loadMsgDelay:50};a.mobile.changePage=
+function(j,g){if(p)r.unshift(arguments);else{var h=a.extend({},a.mobile.changePage.defaults,g);h.pageContainer=h.pageContainer||a.mobile.pageContainer;h.fromPage=h.fromPage||a.mobile.activePage;var q=h.pageContainer,o=new a.Event("pagebeforechange"),l={toPage:j,options:h};q.trigger(o,l);if(!o.isDefaultPrevented())if(j=l.toPage,p=true,typeof j=="string")a.mobile.loadPage(j,h).done(function(b,c,d,e){p=false;c.duplicateCachedPage=e;a.mobile.changePage(d,c)}).fail(function(){p=false;b(true);d();h.pageContainer.trigger("pagechangefailed",
+l)});else{if(j[0]===a.mobile.firstPage[0]&&!h.dataUrl)h.dataUrl=x.hrefNoHash;var o=h.fromPage,u=h.dataUrl&&m.convertUrlToDataUrl(h.dataUrl)||j.jqmData("url"),w=u;m.getFilePath(u);var v=n.getActive(),t=n.activeIndex===0,y=0,D=k.title,B=h.role==="dialog"||j.jqmData("role")==="dialog";if(o&&o[0]===j[0]&&!h.allowSamePageTransition)p=false,q.trigger("pagechange",l),h.fromHashChange&&n.directHashChange({currentUrl:u,isBack:function(){},isForward:function(){}});else{f(j,h.role);h.fromHashChange&&n.directHashChange({currentUrl:u,
+isBack:function(){y=-1},isForward:function(){y=1}});try{k.activeElement&&k.activeElement.nodeName.toLowerCase()!="body"?a(k.activeElement).blur():a("input:focus, textarea:focus, select:focus").blur()}catch(z){}var C=false;if(B&&v){if(v.url.indexOf(s)>-1&&!a.mobile.activePage.is(".ui-dialog"))h.changeHash=false,C=true;u=(v.url||"")+s;n.activeIndex===0&&u===n.initialDst&&(u+=s)}if(h.changeHash!==false&&u)n.ignoreNextHashChange=true,m.set(u);var A=!v?D:j.jqmData("title")||j.children(":jqmData(role='header')").find(".ui-title").getEncodedText();
+A&&D==k.title&&(D=A);j.jqmData("title")||j.jqmData("title",D);h.transition=h.transition||(y&&!t?v.transition:c)||(B?a.mobile.defaultDialogTransition:a.mobile.defaultPageTransition);!y&&!C&&n.addNew(u,h.transition,D,w,h.role);k.title=n.getActive().title;a.mobile.activePage=j;h.reverse=h.reverse||y<0;e(j,o,h.transition,h.reverse).done(function(c,e,f,g,m){b();h.duplicateCachedPage&&h.duplicateCachedPage.remove();m||a.mobile.focusPage(j);d();q.trigger("pagechange",l)})}}}};a.mobile.changePage.defaults=
+{transition:c,reverse:false,changeHash:true,fromHashChange:false,role:c,duplicateCachedPage:c,pageContainer:c,showLoadMsg:true,dataUrl:c,fromPage:c,allowSamePageTransition:false};a.mobile.navreadyDeferred=a.Deferred();a.mobile.navreadyDeferred.done(function(){a(k).delegate("form","submit",function(b){var c=a(this);if(a.mobile.ajaxEnabled&&!c.is(":jqmData(ajax='false')")&&c.jqmHijackable().length){var d=c.attr("method"),e=c.attr("target"),j=c.attr("action");if(!j&&(j=h(c),j===w.hrefNoHash))j=x.hrefNoSearch;
+j=m.makeUrlAbsolute(j,h(c));m.isExternal(j)&&!m.isPermittedCrossDomainRequest(x,j)||e||(a.mobile.changePage(j,{type:d&&d.length&&d.toLowerCase()||"get",data:c.serialize(),transition:c.jqmData("transition"),direction:c.jqmData("direction"),reloadPage:true}),b.preventDefault())}});a(k).bind("vclick",function(c){if(!(c.which>1)&&a.mobile.linkBindingEnabled&&(c=j(c.target),a(c).jqmHijackable().length&&c&&m.parseUrl(c.getAttribute("href")||"#").hash!=="#"))b(true),l=a(c).closest(".ui-btn").not(".ui-disabled"),
+l.addClass(a.mobile.activeBtnClass)});a(k).bind("click",function(d){if(a.mobile.linkBindingEnabled){var e=j(d.target),f=a(e),g;if(e&&!(d.which>1)&&f.jqmHijackable().length){g=function(){t.setTimeout(function(){b(true)},200)};if(f.is(":jqmData(rel='back')"))return t.history.back(),false;var k=h(f),e=m.makeUrlAbsolute(f.attr("href")||"#",k);if(!a.mobile.ajaxEnabled&&!m.isEmbeddedPage(e))g();else{if(e.search("#")!=-1)if(e=e.replace(/[^#]*#/,""))e=m.isPath(e)?m.makeUrlAbsolute(e,k):m.makeUrlAbsolute("#"+
+e,x.hrefNoHash);else{d.preventDefault();return}f.is("[rel='external']")||f.is(":jqmData(ajax='false')")||f.is("[target]")||m.isExternal(e)&&!m.isPermittedCrossDomainRequest(x,e)?g():(g=f.jqmData("transition"),k=(k=f.jqmData("direction"))&&k==="reverse"||f.jqmData("back"),f=f.attr("data-"+a.mobile.ns+"rel")||c,a.mobile.changePage(e,{transition:g,reverse:k,role:f}),d.preventDefault())}}}});a(k).delegate(".ui-page","pageshow.prefetch",function(){var b=[];a(this).find("a:jqmData(prefetch)").each(function(){var c=
+a(this),d=c.attr("href");d&&a.inArray(d,b)===-1&&(b.push(d),a.mobile.loadPage(d,{role:c.attr("data-"+a.mobile.ns+"rel")}))})});a.mobile._handleHashChange=function(b){var d=m.stripHash(b),e={transition:a.mobile.urlHistory.stack.length===0?"none":c,changeHash:false,fromHashChange:true};if(0===n.stack.length)n.initialDst=d;if(!a.mobile.hashListeningEnabled||n.ignoreNextHashChange)n.ignoreNextHashChange=false;else{if(n.stack.length>1&&d.indexOf(s)>-1&&n.initialDst!==d)if(a.mobile.activePage.is(".ui-dialog"))n.directHashChange({currentUrl:d,
+either:function(b){var c=a.mobile.urlHistory.getActive();d=c.pageUrl;a.extend(e,{role:c.role,transition:c.transition,reverse:b})}});else{n.directHashChange({currentUrl:d,isBack:function(){t.history.back()},isForward:function(){t.history.forward()}});return}d?(d=typeof d==="string"&&!m.isPath(d)?m.makeUrlAbsolute("#"+d,w):d,a.mobile.changePage(d,e)):a.mobile.changePage(a.mobile.firstPage,e)}};q.bind("hashchange",function(){a.mobile._handleHashChange(location.hash)});a(k).bind("pageshow",g);a(t).bind("throttledresize",
+g)})})(l);(function(a,c){var b={},d=a(c),e=a.mobile.path.parseUrl(location.href),g=a.Deferred(),f=a.Deferred();a(k).ready(a.proxy(f,"resolve"));a(k).one("mobileinit",a.proxy(g,"resolve"));a.extend(b,{initialFilePath:e.pathname+e.search,hashChangeTimeout:200,hashChangeEnableTimer:E,initialHref:e.hrefNoHash,state:function(){return{hash:location.hash||"#"+b.initialFilePath,title:k.title,initialHref:b.initialHref}},resetUIKeys:function(b){var c="&"+a.mobile.subPageUrlKey,d=b.indexOf(a.mobile.dialogHashKey);
+d>-1?b=b.slice(0,d)+"#"+b.slice(d):b.indexOf(c)>-1&&(b=b.split(c).join("#"+c));return b},nextHashChangePrevented:function(c){a.mobile.urlHistory.ignoreNextHashChange=c;b.onHashChangeDisabled=c},onHashChange:function(){if(!b.onHashChangeDisabled){var c,d;c=location.hash;var e=a.mobile.path.isPath(c),f=e?location.href:a.mobile.getDocumentUrl();c=e?c.replace("#",""):c;d=b.state();c=a.mobile.path.makeUrlAbsolute(c,f);e&&(c=b.resetUIKeys(c));history.replaceState(d,k.title,c)}},onPopState:function(c){if(c=
+c.originalEvent.state)clearTimeout(b.hashChangeEnableTimer),b.nextHashChangePrevented(false),a.mobile._handleHashChange(c.hash),b.nextHashChangePrevented(true),b.hashChangeEnableTimer=setTimeout(function(){b.nextHashChangePrevented(false)},b.hashChangeTimeout)},init:function(){d.bind("hashchange",b.onHashChange);d.bind("popstate",b.onPopState);location.hash===""&&history.replaceState(b.state(),k.title,location.href)}});a.when(f,g,a.mobile.navreadyDeferred).done(function(){a.mobile.pushStateEnabled&&
+a.support.pushState&&b.init()})})(l,this);l.mobile.transitionFallbacks.pop="fade";(function(a){a.mobile.transitionHandlers.slide=a.mobile.transitionHandlers.simultaneous;a.mobile.transitionFallbacks.slide="fade"})(l,this);l.mobile.transitionFallbacks.slidedown="fade";l.mobile.transitionFallbacks.slideup="fade";l.mobile.transitionFallbacks.flip="fade";l.mobile.transitionFallbacks.flow="fade";l.mobile.transitionFallbacks.turn="fade";(function(a){a.mobile.page.prototype.options.degradeInputs={color:false,
+date:false,datetime:false,"datetime-local":false,email:false,month:false,number:false,range:"number",search:"text",tel:false,time:false,url:false,week:false};a(k).bind("pagecreate create",function(c){var b=a.mobile.closestPageData(a(c.target)),d;if(b)d=b.options,a(c.target).find("input").not(b.keepNativeSelector()).each(function(){var b=a(this),c=this.getAttribute("type"),f=d.degradeInputs[c]||"text";if(d.degradeInputs[c]){var j=a("<div>").html(b.clone()).html(),h=j.indexOf(" type=")>-1;b.replaceWith(j.replace(h?
+/\s+type=["']?\w+['"]?/:/\/?>/,' type="'+f+'" data-'+a.mobile.ns+'type="'+c+'"'+(h?"":">")))}})})})(l);(function(a,c){a.widget("mobile.dialog",a.mobile.widget,{options:{closeBtnText:"Close",overlayTheme:"a",initSelector:":jqmData(role='dialog')"},_create:function(){var b=this,c=this.element,e=a("<a href='#' data-"+a.mobile.ns+"icon='delete' data-"+a.mobile.ns+"iconpos='notext'>"+this.options.closeBtnText+"</a>"),g=a("<div/>",{role:"dialog","class":"ui-dialog-contain ui-corner-all ui-overlay-shadow"});
+c.addClass("ui-dialog ui-overlay-"+this.options.overlayTheme);c.wrapInner(g).children().find(":jqmData(role='header')").prepend(e).end().children(":first-child").addClass("ui-corner-top").end().children(":last-child").addClass("ui-corner-bottom");e.bind("click",function(){b.close()});c.bind("vclick submit",function(b){var b=a(b.target).closest(b.type==="vclick"?"a":"form"),c;b.length&&!b.jqmData("transition")&&(c=a.mobile.urlHistory.getActive()||{},b.attr("data-"+a.mobile.ns+"transition",c.transition||
+a.mobile.defaultDialogTransition).attr("data-"+a.mobile.ns+"direction","reverse"))}).bind("pagehide",function(){b._isClosed=false;a(this).find("."+a.mobile.activeBtnClass).not(".ui-slider-bg").removeClass(a.mobile.activeBtnClass)}).bind("pagebeforeshow",function(){b.options.overlayTheme&&b.element.page("removeContainerBackground").page("setContainerBackground",b.options.overlayTheme)})},close:function(){if(!this._isClosed)this._isClosed=true,a.mobile.hashListeningEnabled?c.history.back():a.mobile.changePage(a.mobile.urlHistory.getPrev().url)}});
+a(k).delegate(a.mobile.dialog.prototype.options.initSelector,"pagecreate",function(){a.mobile.dialog.prototype.enhance(this)})})(l,this);(function(a){a.mobile.page.prototype.options.backBtnText="Back";a.mobile.page.prototype.options.addBackBtn=false;a.mobile.page.prototype.options.backBtnTheme=null;a.mobile.page.prototype.options.headerTheme="a";a.mobile.page.prototype.options.footerTheme="a";a.mobile.page.prototype.options.contentTheme=null;a(k).bind("pagecreate",function(c){var b=a(c.target),d=
+b.data("page").options,e=b.jqmData("role"),g=d.theme;a(":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')",b).jqmEnhanceable().each(function(){var c=a(this),j=c.jqmData("role"),h=c.jqmData("theme"),k=h||d.contentTheme||e==="dialog"&&g,o;c.addClass("ui-"+j);if(j==="header"||j==="footer"){var m=h||(j==="header"?d.headerTheme:d.footerTheme)||g;c.addClass("ui-bar-"+m).attr("role",j==="header"?"banner":"contentinfo");j==="header"&&(h=c.children("a"),o=h.hasClass("ui-btn-left"),
+k=h.hasClass("ui-btn-right"),o=o||h.eq(0).not(".ui-btn-right").addClass("ui-btn-left").length,k||h.eq(1).addClass("ui-btn-right"));d.addBackBtn&&j==="header"&&a(".ui-page").length>1&&b.jqmData("url")!==a.mobile.path.stripHash(location.hash)&&!o&&a("<a href='javascript:void(0);' class='ui-btn-left' data-"+a.mobile.ns+"rel='back' data-"+a.mobile.ns+"icon='arrow-l'>"+d.backBtnText+"</a>").attr("data-"+a.mobile.ns+"theme",d.backBtnTheme||m).prependTo(c);c.children("h1, h2, h3, h4, h5, h6").addClass("ui-title").attr({role:"heading",
+"aria-level":"1"})}else j==="content"&&(k&&c.addClass("ui-body-"+k),c.attr("role","main"))})})})(l);(function(a){a.fn.fieldcontain=function(){return this.addClass("ui-field-contain ui-body ui-br").contents().filter(function(){return this.nodeType===3&&!/\S/.test(this.nodeValue)}).remove()};a(k).bind("pagecreate create",function(c){a(":jqmData(role='fieldcontain')",c.target).jqmEnhanceable().fieldcontain()})})(l);(function(a){a.fn.grid=function(c){return this.each(function(){var b=a(this),d=a.extend({grid:null},
+c),e=b.children(),g={solo:1,a:2,b:3,c:4,d:5},d=d.grid;if(!d)if(e.length<=5)for(var f in g)g[f]===e.length&&(d=f);else d="a",b.addClass("ui-grid-duo");g=g[d];b.addClass("ui-grid-"+d);e.filter(":nth-child("+g+"n+1)").addClass("ui-block-a");g>1&&e.filter(":nth-child("+g+"n+2)").addClass("ui-block-b");g>2&&e.filter(":nth-child(3n+3)").addClass("ui-block-c");g>3&&e.filter(":nth-child(4n+4)").addClass("ui-block-d");g>4&&e.filter(":nth-child(5n+5)").addClass("ui-block-e")})}})(l);(function(a){a(k).bind("pagecreate create",
+function(c){a(":jqmData(role='nojs')",c.target).addClass("ui-nojs")})})(l);(function(a,c){function b(a){for(var b;a;){if((b=typeof a.className==="string"&&a.className+" ")&&b.indexOf("ui-btn ")>-1&&b.indexOf("ui-disabled ")<0)break;a=a.parentNode}return a}a.fn.buttonMarkup=function(b){for(var b=b&&a.type(b)=="object"?b:{},g=0;g<this.length;g++){var f=this.eq(g),j=f[0],h=a.extend({},a.fn.buttonMarkup.defaults,{icon:b.icon!==c?b.icon:f.jqmData("icon"),iconpos:b.iconpos!==c?b.iconpos:f.jqmData("iconpos"),
+theme:b.theme!==c?b.theme:f.jqmData("theme")||a.mobile.getInheritedTheme(f,"c"),inline:b.inline!==c?b.inline:f.jqmData("inline"),shadow:b.shadow!==c?b.shadow:f.jqmData("shadow"),corners:b.corners!==c?b.corners:f.jqmData("corners"),iconshadow:b.iconshadow!==c?b.iconshadow:f.jqmData("iconshadow"),mini:b.mini!==c?b.mini:f.jqmData("mini")},b),q="ui-btn-inner",o,m,l,n,r,p;a.each(h,function(b,c){j.setAttribute("data-"+a.mobile.ns+b,c);f.jqmData(b,c)});(p=a.data(j.tagName==="INPUT"||j.tagName==="BUTTON"?
+j.parentNode:j,"buttonElements"))?(j=p.outer,f=a(j),l=p.inner,n=p.text,a(p.icon).remove(),p.icon=null):(l=k.createElement(h.wrapperEls),n=k.createElement(h.wrapperEls));r=h.icon?k.createElement("span"):null;d&&!p&&d();if(!h.theme)h.theme=a.mobile.getInheritedTheme(f,"c");o="ui-btn ui-btn-up-"+h.theme;o+=h.inline?" ui-btn-inline":"";o+=h.shadow?" ui-shadow":"";o+=h.corners?" ui-btn-corner-all":"";h.mini!==c&&(o+=h.mini?" ui-mini":" ui-fullsize");h.inline!==c&&(o+=h.inline===false?" ui-btn-block":" ui-btn-inline");
+if(h.icon)h.icon="ui-icon-"+h.icon,h.iconpos=h.iconpos||"left",m="ui-icon "+h.icon,h.iconshadow&&(m+=" ui-icon-shadow");h.iconpos&&(o+=" ui-btn-icon-"+h.iconpos,h.iconpos=="notext"&&!f.attr("title")&&f.attr("title",f.getEncodedText()));q+=h.corners?" ui-btn-corner-all":"";h.iconpos&&h.iconpos==="notext"&&!f.attr("title")&&f.attr("title",f.getEncodedText());p&&f.removeClass(p.bcls||"");f.removeClass("ui-link").addClass(o);l.className=q;n.className="ui-btn-text";p||l.appendChild(n);if(r&&(r.className=
+m,!p||!p.icon))r.appendChild(k.createTextNode("\u00a0")),l.appendChild(r);for(;j.firstChild&&!p;)n.appendChild(j.firstChild);p||j.appendChild(l);p={bcls:o,outer:j,inner:l,text:n,icon:r};a.data(j,"buttonElements",p);a.data(l,"buttonElements",p);a.data(n,"buttonElements",p);r&&a.data(r,"buttonElements",p)}return this};a.fn.buttonMarkup.defaults={corners:true,shadow:true,iconshadow:true,wrapperEls:"span"};var d=function(){var c=a.mobile.buttonMarkup.hoverDelay,g,f;a(k).bind({"vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart":function(d){var h,
+k=a(b(d.target)),d=d.type;if(k.length)if(h=k.attr("data-"+a.mobile.ns+"theme"),d==="vmousedown")a.support.touch?g=setTimeout(function(){k.removeClass("ui-btn-up-"+h).addClass("ui-btn-down-"+h)},c):k.removeClass("ui-btn-up-"+h).addClass("ui-btn-down-"+h);else if(d==="vmousecancel"||d==="vmouseup")k.removeClass("ui-btn-down-"+h).addClass("ui-btn-up-"+h);else if(d==="vmouseover"||d==="focus")a.support.touch?f=setTimeout(function(){k.removeClass("ui-btn-up-"+h).addClass("ui-btn-hover-"+h)},c):k.removeClass("ui-btn-up-"+
+h).addClass("ui-btn-hover-"+h);else if(d==="vmouseout"||d==="blur"||d==="scrollstart")k.removeClass("ui-btn-hover-"+h+" ui-btn-down-"+h).addClass("ui-btn-up-"+h),g&&clearTimeout(g),f&&clearTimeout(f)},"focusin focus":function(c){a(b(c.target)).addClass(a.mobile.focusClass)},"focusout blur":function(c){a(b(c.target)).removeClass(a.mobile.focusClass)}});d=null};a(k).bind("pagecreate create",function(b){a(":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a",
+b.target).not(".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')").buttonMarkup()})})(l);(function(a){a.widget("mobile.collapsible",a.mobile.widget,{options:{expandCueText:" click to expand contents",collapseCueText:" click to collapse contents",collapsed:true,heading:"h1,h2,h3,h4,h5,h6,legend",theme:null,contentTheme:null,iconTheme:"d",mini:false,initSelector:":jqmData(role='collapsible')"},_create:function(){var c=this.element,b=this.options,d=c.addClass("ui-collapsible"),e=c.children(b.heading).first(),
+g=d.wrapInner("<div class='ui-collapsible-content'></div>").find(".ui-collapsible-content"),f=c.closest(":jqmData(role='collapsible-set')").addClass("ui-collapsible-set");e.is("legend")&&(e=a("<div role='heading'>"+e.html()+"</div>").insertBefore(e),e.next().remove());if(f.length){if(!b.theme)b.theme=f.jqmData("theme")||a.mobile.getInheritedTheme(f,"c");if(!b.contentTheme)b.contentTheme=f.jqmData("content-theme");if(!b.iconPos)b.iconPos=f.jqmData("iconpos");if(!b.mini)b.mini=f.jqmData("mini")}g.addClass(b.contentTheme?
+"ui-body-"+b.contentTheme:"");e.insertBefore(g).addClass("ui-collapsible-heading").append("<span class='ui-collapsible-heading-status'></span>").wrapInner("<a href='#' class='ui-collapsible-heading-toggle'></a>").find("a").first().buttonMarkup({shadow:false,corners:false,iconpos:c.jqmData("iconpos")||b.iconPos||"left",icon:"plus",mini:b.mini,theme:b.theme}).add(".ui-btn-inner",c).addClass("ui-corner-top ui-corner-bottom");d.bind("expand collapse",function(c){if(!c.isDefaultPrevented()){c.preventDefault();
+var h=a(this),c=c.type==="collapse",k=b.contentTheme;e.toggleClass("ui-collapsible-heading-collapsed",c).find(".ui-collapsible-heading-status").text(c?b.expandCueText:b.collapseCueText).end().find(".ui-icon").toggleClass("ui-icon-minus",!c).toggleClass("ui-icon-plus",c).end().find("a").first().removeClass(a.mobile.activeBtnClass);h.toggleClass("ui-collapsible-collapsed",c);g.toggleClass("ui-collapsible-content-collapsed",c).attr("aria-hidden",c);if(k&&(!f.length||d.jqmData("collapsible-last")))e.find("a").first().add(e.find(".ui-btn-inner")).toggleClass("ui-corner-bottom",
+c),g.toggleClass("ui-corner-bottom",!c);g.trigger("updatelayout")}}).trigger(b.collapsed?"collapse":"expand");e.bind("tap",function(){e.find("a").first().addClass(a.mobile.activeBtnClass)}).bind("click",function(a){var b=e.is(".ui-collapsible-heading-collapsed")?"expand":"collapse";d.trigger(b);a.preventDefault();a.stopPropagation()})}});a(k).bind("pagecreate create",function(c){a.mobile.collapsible.prototype.enhanceWithin(c.target)})})(l);(function(a,c){a.widget("mobile.collapsibleset",a.mobile.widget,
+{options:{initSelector:":jqmData(role='collapsible-set')"},_create:function(){var b=this.element.addClass("ui-collapsible-set"),d=this.options;if(!d.theme)d.theme=a.mobile.getInheritedTheme(b,"c");if(!d.contentTheme)d.contentTheme=b.jqmData("content-theme");if(!d.corners)d.corners=b.jqmData("corners")===c?true:false;b.jqmData("collapsiblebound")||b.jqmData("collapsiblebound",true).bind("expand collapse",function(b){var c=b.type==="collapse",b=a(b.target).closest(".ui-collapsible"),d=b.data("collapsible");
+d.options.contentTheme&&b.jqmData("collapsible-last")&&(b.find(d.options.heading).first().find("a").first().toggleClass("ui-corner-bottom",c).find(".ui-btn-inner").toggleClass("ui-corner-bottom",c),b.find(".ui-collapsible-content").toggleClass("ui-corner-bottom",!c))}).bind("expand",function(b){a(b.target).closest(".ui-collapsible").siblings(".ui-collapsible").trigger("collapse")})},_init:function(){this.refresh()},refresh:function(){var b=this.options,c=this.element.children(":jqmData(role='collapsible')");
+a.mobile.collapsible.prototype.enhance(c.not(".ui-collapsible"));c.each(function(){a(this).find(a.mobile.collapsible.prototype.options.heading).find("a").first().removeClass("ui-corner-top ui-corner-bottom").find(".ui-btn-inner").removeClass("ui-corner-top ui-corner-bottom")});c.first().find("a").first().addClass(b.corners?"ui-corner-top":"").find(".ui-btn-inner").addClass("ui-corner-top");c.last().jqmData("collapsible-last",true).find("a").first().addClass(b.corners?"ui-corner-bottom":"").find(".ui-btn-inner").addClass("ui-corner-bottom")}});
+a(k).bind("pagecreate create",function(b){a.mobile.collapsibleset.prototype.enhanceWithin(b.target)})})(l);(function(a,c){a.widget("mobile.navbar",a.mobile.widget,{options:{iconpos:"top",grid:null,initSelector:":jqmData(role='navbar')"},_create:function(){var b=this.element,d=b.find("a"),e=d.filter(":jqmData(icon)").length?this.options.iconpos:c;b.addClass("ui-navbar ui-mini").attr("role","navigation").find("ul").jqmEnhanceable().grid({grid:this.options.grid});d.buttonMarkup({corners:false,shadow:false,
+inline:true,iconpos:e});b.delegate("a","vclick",function(b){a(b.target).hasClass("ui-disabled")||(d.removeClass(a.mobile.activeBtnClass),a(this).addClass(a.mobile.activeBtnClass))});b.closest(".ui-page").bind("pagebeforeshow",function(){d.filter(".ui-state-persist").addClass(a.mobile.activeBtnClass)})}});a(k).bind("pagecreate create",function(b){a.mobile.navbar.prototype.enhanceWithin(b.target)})})(l);(function(a){var c={};a.widget("mobile.listview",a.mobile.widget,{options:{theme:null,countTheme:"c",
+headerTheme:"b",dividerTheme:"b",splitIcon:"arrow-r",splitTheme:"b",inset:false,initSelector:":jqmData(role='listview')"},_create:function(){var a="";a+=this.options.inset?" ui-listview-inset ui-corner-all ui-shadow ":"";this.element.addClass(function(c,e){return e+" ui-listview "+a});this.refresh(true)},_removeCorners:function(a,c){a=a.add(a.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb"));c==="top"?a.removeClass("ui-corner-top ui-corner-tr ui-corner-tl"):c==="bottom"?a.removeClass("ui-corner-bottom ui-corner-br ui-corner-bl"):
+a.removeClass("ui-corner-top ui-corner-tr ui-corner-tl ui-corner-bottom ui-corner-br ui-corner-bl")},_refreshCorners:function(a){var c,e;this.options.inset&&(c=this.element.children("li"),e=a?c.not(".ui-screen-hidden"):c.filter(":visible"),this._removeCorners(c),c=e.first().addClass("ui-corner-top"),c.add(c.find(".ui-btn-inner").not(".ui-li-link-alt span:first-child")).addClass("ui-corner-top").end().find(".ui-li-link-alt, .ui-li-link-alt span:first-child").addClass("ui-corner-tr").end().find(".ui-li-thumb").not(".ui-li-icon").addClass("ui-corner-tl"),
+e=e.last().addClass("ui-corner-bottom"),e.add(e.find(".ui-btn-inner")).find(".ui-li-link-alt").addClass("ui-corner-br").end().find(".ui-li-thumb").not(".ui-li-icon").addClass("ui-corner-bl"));a||this.element.trigger("updatelayout")},_findFirstElementByTagName:function(a,c,e,g){var f={};for(f[e]=f[g]=true;a;){if(f[a.nodeName])return a;a=a[c]}return null},_getChildrenByTagName:function(b,c,e){var g=[],f={};f[c]=f[e]=true;for(b=b.firstChild;b;)f[b.nodeName]&&g.push(b),b=b.nextSibling;return a(g)},_addThumbClasses:function(b){var c,
+e,g=b.length;for(c=0;c<g;c++)e=a(this._findFirstElementByTagName(b[c].firstChild,"nextSibling","img","IMG")),e.length&&(e.addClass("ui-li-thumb"),a(this._findFirstElementByTagName(e[0].parentNode,"parentNode","li","LI")).addClass(e.is(".ui-li-icon")?"ui-li-has-icon":"ui-li-has-thumb"))},refresh:function(b){this.parentPage=this.element.closest(".ui-page");this._createSubPages();var c=this.options,e=this.element,g=e.jqmData("dividertheme")||c.dividerTheme,f=e.jqmData("splittheme"),j=e.jqmData("spliticon"),
+h=this._getChildrenByTagName(e[0],"li","LI"),l=a.support.cssPseudoElement||!a.nodeName(e[0],"ol")?0:1,o={},m,v,n,r,p,s,u;l&&e.find(".ui-li-dec").remove();if(!c.theme)c.theme=a.mobile.getInheritedTheme(this.element,"c");for(var x=0,w=h.length;x<w;x++){m=h.eq(x);v="ui-li";if(b||!m.hasClass("ui-li"))n=m.jqmData("theme")||c.theme,r=this._getChildrenByTagName(m[0],"a","A"),s=m.jqmData("role")==="list-divider",r.length&&!s?(s=m.jqmData("icon"),m.buttonMarkup({wrapperEls:"div",shadow:false,corners:false,
+iconpos:"right",icon:r.length>1||s===false?false:s||"arrow-r",theme:n}),s!=false&&r.length==1&&m.addClass("ui-li-has-arrow"),r.first().removeClass("ui-link").addClass("ui-link-inherit"),r.length>1&&(v+=" ui-li-has-alt",r=r.last(),p=f||r.jqmData("theme")||c.splitTheme,u=r.jqmData("icon"),r.appendTo(m).attr("title",r.getEncodedText()).addClass("ui-li-link-alt").empty().buttonMarkup({shadow:false,corners:false,theme:n,icon:false,iconpos:"notext"}).find(".ui-btn-inner").append(a(k.createElement("span")).buttonMarkup({shadow:true,
+corners:true,theme:p,iconpos:"notext",icon:u||s||j||c.splitIcon})))):s?(v+=" ui-li-divider ui-bar-"+g,m.attr("role","heading"),l&&(l=1)):v+=" ui-li-static ui-body-"+n;l&&v.indexOf("ui-li-divider")<0&&(n=m.is(".ui-li-static:first")?m:m.find(".ui-link-inherit"),n.addClass("ui-li-jsnumbering").prepend("<span class='ui-li-dec'>"+l++ +". </span>"));o[v]||(o[v]=[]);o[v].push(m[0])}for(v in o)a(o[v]).addClass(v).children(".ui-btn-inner").addClass(v);e.find("h1, h2, h3, h4, h5, h6").addClass("ui-li-heading").end().find("p, dl").addClass("ui-li-desc").end().find(".ui-li-aside").each(function(){var b=
+a(this);b.prependTo(b.parent())}).end().find(".ui-li-count").each(function(){a(this).closest("li").addClass("ui-li-has-count")}).addClass("ui-btn-up-"+(e.jqmData("counttheme")||this.options.countTheme)+" ui-btn-corner-all");this._addThumbClasses(h);this._addThumbClasses(e.find(".ui-link-inherit"));this._refreshCorners(b)},_idStringEscape:function(a){return a.replace(/[^a-zA-Z0-9]/g,"-")},_createSubPages:function(){var b=this.element,d=b.closest(".ui-page"),e=d.jqmData("url"),g=e||d[0][a.expando],
+f=b.attr("id"),j=this.options,h="data-"+a.mobile.ns,k=this,l=d.find(":jqmData(role='footer')").jqmData("id"),m;typeof c[g]==="undefined"&&(c[g]=-1);f=f||++c[g];a(b.find("li>ul, li>ol").toArray().reverse()).each(function(c){var d=a(this),g=d.attr("id")||f+"-"+c,c=d.parent(),k=a(d.prevAll().toArray().reverse()),k=k.length?k:a("<span>"+a.trim(c.contents()[0].nodeValue)+"</span>"),q=k.first().getEncodedText(),g=(e||"")+"&"+a.mobile.subPageUrlKey+"="+g,u=d.jqmData("theme")||j.theme,x=d.jqmData("counttheme")||
+b.jqmData("counttheme")||j.countTheme;m=true;d.detach().wrap("<div "+h+"role='page' "+h+"url='"+g+"' "+h+"theme='"+u+"' "+h+"count-theme='"+x+"'><div "+h+"role='content'></div></div>").parent().before("<div "+h+"role='header' "+h+"theme='"+j.headerTheme+"'><div class='ui-title'>"+q+"</div></div>").after(l?a("<div "+h+"role='footer' "+h+"id='"+l+"'>"):"").parent().appendTo(a.mobile.pageContainer).page();d=c.find("a:first");d.length||(d=a("<a/>").html(k||q).prependTo(c.empty()));d.attr("href","#"+g)}).listview();
+m&&d.is(":jqmData(external-page='true')")&&d.data("page").options.domCache===false&&d.unbind("pagehide.remove").bind("pagehide.remove",function(b,c){var f=c.nextPage,h=new a.Event("pageremove");c.nextPage&&(f=f.jqmData("url"),f.indexOf(e+"&"+a.mobile.subPageUrlKey)!==0&&(k.childPages().remove(),d.trigger(h),h.isDefaultPrevented()||d.removeWithDependents()))})},childPages:function(){var b=this.parentPage.jqmData("url");return a(":jqmData(url^='"+b+"&"+a.mobile.subPageUrlKey+"')")}});a(k).bind("pagecreate create",
+function(b){a.mobile.listview.prototype.enhanceWithin(b.target)})})(l);(function(a,c){a.widget("mobile.checkboxradio",a.mobile.widget,{options:{theme:null,initSelector:"input[type='checkbox'],input[type='radio']"},_create:function(){var b=this,d=this.element,e=a(d).closest("label"),g=e.length?e:a(d).closest("form,fieldset,:jqmData(role='page'),:jqmData(role='dialog')").find("label").filter("[for='"+d[0].id+"']"),f=d[0].type,e=d.jqmData("mini")||d.closest("form,fieldset").jqmData("mini"),j=f+"-on",
+h=f+"-off",l=d.parents(":jqmData(type='horizontal')").length?c:h,o=d.jqmData("iconpos")||d.closest("form,fieldset").jqmData("iconpos");if(!(f!=="checkbox"&&f!=="radio")){a.extend(this,{label:g,inputtype:f,checkedClass:"ui-"+j+(l?"":" "+a.mobile.activeBtnClass),uncheckedClass:"ui-"+h,checkedicon:"ui-icon-"+j,uncheckedicon:"ui-icon-"+h});if(!this.options.theme)this.options.theme=a.mobile.getInheritedTheme(this.element,"c");g.buttonMarkup({theme:this.options.theme,icon:l,shadow:false,mini:e,iconpos:o});
+e=k.createElement("div");e.className="ui-"+f;d.add(g).wrapAll(e);g.bind({vmouseover:function(b){a(this).parent().is(".ui-disabled")&&b.stopPropagation()},vclick:function(a){if(d.is(":disabled"))a.preventDefault();else return b._cacheVals(),d.prop("checked",f==="radio"&&true||!d.prop("checked")),d.triggerHandler("click"),b._getInputSet().not(d).prop("checked",false),b._updateAll(),false}});d.bind({vmousedown:function(){b._cacheVals()},vclick:function(){var c=a(this);c.is(":checked")?(c.prop("checked",
+true),b._getInputSet().not(c).prop("checked",false)):c.prop("checked",false);b._updateAll()},focus:function(){g.addClass(a.mobile.focusClass)},blur:function(){g.removeClass(a.mobile.focusClass)}});this.refresh()}},_cacheVals:function(){this._getInputSet().each(function(){a(this).jqmData("cacheVal",this.checked)})},_getInputSet:function(){return this.inputtype==="checkbox"?this.element:this.element.closest("form,fieldset,:jqmData(role='page')").find("input[name='"+this.element[0].name+"'][type='"+
+this.inputtype+"']")},_updateAll:function(){var b=this;this._getInputSet().each(function(){var c=a(this);(this.checked||b.inputtype==="checkbox")&&c.trigger("change")}).checkboxradio("refresh")},refresh:function(){var a=this.element[0],c=this.label,e=c.find(".ui-icon");a.checked?(c.addClass(this.checkedClass).removeClass(this.uncheckedClass),e.addClass(this.checkedicon).removeClass(this.uncheckedicon)):(c.removeClass(this.checkedClass).addClass(this.uncheckedClass),e.removeClass(this.checkedicon).addClass(this.uncheckedicon));
+a.disabled?this.disable():this.enable()},disable:function(){this.element.prop("disabled",true).parent().addClass("ui-disabled")},enable:function(){this.element.prop("disabled",false).parent().removeClass("ui-disabled")}});a(k).bind("pagecreate create",function(b){a.mobile.checkboxradio.prototype.enhanceWithin(b.target,true)})})(l);(function(a,c){a.widget("mobile.button",a.mobile.widget,{options:{theme:null,icon:null,iconpos:null,inline:false,corners:true,shadow:true,iconshadow:true,initSelector:"button, [type='button'], [type='submit'], [type='reset'], [type='image']",
+mini:false},_create:function(){var b=this.element,d,e=this.options,g;g="";var f;if(b[0].tagName==="A")!b.hasClass("ui-btn")&&b.buttonMarkup();else{if(!this.options.theme)this.options.theme=a.mobile.getInheritedTheme(this.element,"c");~b[0].className.indexOf("ui-btn-left")&&(g="ui-btn-left");~b[0].className.indexOf("ui-btn-right")&&(g="ui-btn-right");if(b.attr("type")==="submit"||b.attr("type")==="reset")g?g+=" ui-submit":g="ui-submit";a("label[for='"+b.attr("id")+"']").addClass("ui-submit");d=this.button=
+a("<div></div>").text(b.text()||b.val()).insertBefore(b).buttonMarkup({theme:e.theme,icon:e.icon,iconpos:e.iconpos,inline:e.inline,corners:e.corners,shadow:e.shadow,iconshadow:e.iconshadow,mini:e.mini}).addClass(g).append(b.addClass("ui-btn-hidden"));e=b.attr("type");g=b.attr("name");e!=="button"&&e!=="reset"&&g&&b.bind("vclick",function(){f===c&&(f=a("<input>",{type:"hidden",name:b.attr("name"),value:b.attr("value")}).insertBefore(b),a(k).one("submit",function(){f.remove();f=c}))});b.bind({focus:function(){d.addClass(a.mobile.focusClass)},
+blur:function(){d.removeClass(a.mobile.focusClass)}});this.refresh()}},enable:function(){this.element.attr("disabled",false);this.button.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.button.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)},refresh:function(){var b=this.element;b.prop("disabled")?this.disable():this.enable();a(this.button.data("buttonElements").text).text(b.text()||
+b.val())}});a(k).bind("pagecreate create",function(b){a.mobile.button.prototype.enhanceWithin(b.target,true)})})(l);(function(a){a.fn.controlgroup=function(c){function b(a,b){a.removeClass("ui-btn-corner-all ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-controlgroup-last ui-shadow").eq(0).addClass(b[0]).end().last().addClass(b[1]).addClass("ui-controlgroup-last")}return this.each(function(){var d=a(this),e=a.extend({direction:d.jqmData("type")||"vertical",shadow:false,excludeInvisible:true,
+mini:d.jqmData("mini")},c),g=d.children("legend"),f=e.direction=="horizontal"?["ui-corner-left","ui-corner-right"]:["ui-corner-top","ui-corner-bottom"];d.find("input").first().attr("type");d.wrapInner("<div class='ui-controlgroup-controls'></div>");g.length&&(a("<div role='heading' class='ui-controlgroup-label'>"+g.html()+"</div>").insertBefore(d.children(0)),g.remove());d.addClass("ui-corner-all ui-controlgroup ui-controlgroup-"+e.direction);b(d.find(".ui-btn"+(e.excludeInvisible?":visible":"")).not(".ui-slider-handle"),
+f);b(d.find(".ui-btn-inner"),f);e.shadow&&d.addClass("ui-shadow");e.mini&&d.addClass("ui-mini")})}})(l);(function(a){a(k).bind("pagecreate create",function(c){a(c.target).find("a").jqmEnhanceable().not(".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')").addClass("ui-link")})})(l);(function(a){var c=a("meta[name=viewport]"),b=c.attr("content"),d=b+",maximum-scale=1, user-scalable=no",e=b+",maximum-scale=10, user-scalable=yes",g=/(user-scalable[\s]*=[\s]*no)|(maximum-scale[\s]*=[\s]*1)[$,\s]/.test(b);
+a.mobile.zoom=a.extend({},{enabled:!g,locked:false,disable:function(b){if(!g&&!a.mobile.zoom.locked)c.attr("content",d),a.mobile.zoom.enabled=false,a.mobile.zoom.locked=b||false},enable:function(b){if(!g&&(!a.mobile.zoom.locked||b===true))c.attr("content",e),a.mobile.zoom.enabled=true,a.mobile.zoom.locked=false},restore:function(){if(!g)c.attr("content",b),a.mobile.zoom.enabled=true}})})(l);(function(a){a.widget("mobile.textinput",a.mobile.widget,{options:{theme:null,preventFocusZoom:/iPhone|iPad|iPod/.test(navigator.platform)&&
+navigator.userAgent.indexOf("AppleWebKit")>-1,initSelector:"input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea, input[type='time'], input[type='date'], input[type='month'], input[type='week'], input[type='datetime'], input[type='datetime-local'], input[type='color'], input:not([type])",clearSearchButtonText:"clear text"},_create:function(){var c=
+this.element,b=this.options,d=b.theme||a.mobile.getInheritedTheme(this.element,"c"),e=" ui-body-"+d,g=c.jqmData("mini")==true,f=g?" ui-mini":"",j,h;a("label[for='"+c.attr("id")+"']").addClass("ui-input-text");j=c.addClass("ui-input-text ui-body-"+d);typeof c[0].autocorrect!=="undefined"&&!a.support.touchOverflow&&(c[0].setAttribute("autocorrect","off"),c[0].setAttribute("autocomplete","off"));c.is("[type='search'],:jqmData(type='search')")?(j=c.wrap("<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield"+
+e+f+"'></div>").parent(),h=a("<a href='#' class='ui-input-clear' title='"+b.clearSearchButtonText+"'>"+b.clearSearchButtonText+"</a>").bind("click",function(a){c.val("").focus().trigger("change");h.addClass("ui-input-clear-hidden");a.preventDefault()}).appendTo(j).buttonMarkup({icon:"delete",iconpos:"notext",corners:true,shadow:true,mini:g}),d=function(){setTimeout(function(){h.toggleClass("ui-input-clear-hidden",!c.val())},0)},d(),c.bind("paste cut keyup focus change blur",d)):c.addClass("ui-corner-all ui-shadow-inset"+
+e+f);c.focus(function(){j.addClass(a.mobile.focusClass)}).blur(function(){j.removeClass(a.mobile.focusClass)}).bind("focus",function(){b.preventFocusZoom&&a.mobile.zoom.disable(true)}).bind("blur",function(){b.preventFocusZoom&&a.mobile.zoom.enable(true)});if(c.is("textarea")){var l=function(){var a=c[0].scrollHeight;c[0].clientHeight<a&&c.height(a+15)},o;c.keyup(function(){clearTimeout(o);o=setTimeout(l,100)});a(k).one("pagechange",l);a.trim(c.val())&&a(t).load(l)}},disable:function(){(this.element.attr("disabled",
+true).is("[type='search'],:jqmData(type='search')")?this.element.parent():this.element).addClass("ui-disabled")},enable:function(){(this.element.attr("disabled",false).is("[type='search'],:jqmData(type='search')")?this.element.parent():this.element).removeClass("ui-disabled")}});a(k).bind("pagecreate create",function(c){a.mobile.textinput.prototype.enhanceWithin(c.target,true)})})(l);(function(a){a.mobile.listview.prototype.options.filter=false;a.mobile.listview.prototype.options.filterPlaceholder=
+"Filter items...";a.mobile.listview.prototype.options.filterTheme="c";a.mobile.listview.prototype.options.filterCallback=function(a,b){return a.toLowerCase().indexOf(b)===-1};a(k).delegate(":jqmData(role='listview')","listviewcreate",function(){var c=a(this),b=c.data("listview");if(b.options.filter){var d=a("<form>",{"class":"ui-listview-filter ui-bar-"+b.options.filterTheme,role:"search"});a("<input>",{placeholder:b.options.filterPlaceholder}).attr("data-"+a.mobile.ns+"type","search").jqmData("lastval",
+"").bind("keyup change",function(){var d=a(this),g=this.value.toLowerCase(),f=null,f=d.jqmData("lastval")+"",j=false,h="";d.jqmData("lastval",g);f=g.length<f.length||g.indexOf(f)!==0?c.children():c.children(":not(.ui-screen-hidden)");if(g){for(var k=f.length-1;k>=0;k--)d=a(f[k]),h=d.jqmData("filtertext")||d.text(),d.is("li:jqmData(role=list-divider)")?(d.toggleClass("ui-filter-hidequeue",!j),j=false):b.options.filterCallback(h,g)?d.toggleClass("ui-filter-hidequeue",true):j=true;f.filter(":not(.ui-filter-hidequeue)").toggleClass("ui-screen-hidden",
+false);f.filter(".ui-filter-hidequeue").toggleClass("ui-screen-hidden",true).toggleClass("ui-filter-hidequeue",false)}else f.toggleClass("ui-screen-hidden",false);b._refreshCorners()}).appendTo(d).textinput();b.options.inset&&d.addClass("ui-listview-filter-inset");d.bind("submit",function(){return false}).insertBefore(c)}})})(l);(function(a,c){a.widget("mobile.slider",a.mobile.widget,{options:{theme:null,trackTheme:null,disabled:false,initSelector:"input[type='range'], :jqmData(type='range'), :jqmData(role='slider')",
+mini:false},_create:function(){var b=this,d=this.element,e=a.mobile.getInheritedTheme(d,"c"),g=this.options.theme||e,e=this.options.trackTheme||e,f=d[0].nodeName.toLowerCase(),j=f=="select"?"ui-slider-switch":"",h=d.attr("id"),l=a("[for='"+h+"']"),o=l.attr("id")||h+"-label",l=l.attr("id",o),m=function(){return f=="input"?parseFloat(d.val()):d[0].selectedIndex},v=f=="input"?parseFloat(d.attr("min")):0,n=f=="input"?parseFloat(d.attr("max")):d.find("option").length-1,r=t.parseFloat(d.attr("step")||1),
+p=this.options.inline||d.jqmData("inline")==true?" ui-slider-inline":"",s=this.options.mini||d.jqmData("mini")?" ui-slider-mini":"",u=k.createElement("a"),x=a(u),h=k.createElement("div"),w=a(h),D=d.jqmData("highlight")&&f!="select"?function(){var b=k.createElement("div");b.className="ui-slider-bg "+a.mobile.activeBtnClass+" ui-btn-corner-all";return a(b).prependTo(w)}():false;u.setAttribute("href","#");h.setAttribute("role","application");h.className=["ui-slider ",j," ui-btn-down-",e," ui-btn-corner-all",
+p,s].join("");u.className="ui-slider-handle";h.appendChild(u);x.buttonMarkup({corners:true,theme:g,shadow:true}).attr({role:"slider","aria-valuemin":v,"aria-valuemax":n,"aria-valuenow":m(),"aria-valuetext":m(),title:m(),"aria-labelledby":o});a.extend(this,{slider:w,handle:x,valuebg:D,dragging:false,beforeStart:null,userModified:false,mouseMoved:false});if(f=="select"){g=k.createElement("div");g.className="ui-slider-inneroffset";j=0;for(o=h.childNodes.length;j<o;j++)g.appendChild(h.childNodes[j]);
+h.appendChild(g);x.addClass("ui-slider-handle-snapping");g=d.find("option");h=0;for(j=g.length;h<j;h++)o=!h?"b":"a",p=!h?" ui-btn-down-"+e:" "+a.mobile.activeBtnClass,k.createElement("div"),s=k.createElement("span"),s.className=["ui-slider-label ui-slider-label-",o,p," ui-btn-corner-all"].join(""),s.setAttribute("role","img"),s.appendChild(k.createTextNode(g[h].innerHTML)),a(s).prependTo(w);b._labels=a(".ui-slider-label",w)}l.addClass("ui-slider");d.addClass(f==="input"?"ui-slider-input":"ui-slider-switch").change(function(){b.mouseMoved||
+b.refresh(m(),true)}).keyup(function(){b.refresh(m(),true,true)}).blur(function(){b.refresh(m(),true)});a(k).bind("vmousemove",function(a){if(b.dragging)return b.mouseMoved=true,f==="select"&&x.removeClass("ui-slider-handle-snapping"),b.refresh(a),b.userModified=b.beforeStart!==d[0].selectedIndex,false});w.bind("vmousedown",function(a){b.dragging=true;b.userModified=false;b.mouseMoved=false;if(f==="select")b.beforeStart=d[0].selectedIndex;b.refresh(a);return false}).bind("vclick",false);w.add(k).bind("vmouseup",
+function(){if(b.dragging)return b.dragging=false,f==="select"&&(x.addClass("ui-slider-handle-snapping"),b.mouseMoved?b.userModified?b.refresh(b.beforeStart==0?1:0):b.refresh(b.beforeStart):b.refresh(b.beforeStart==0?1:0)),b.mouseMoved=false});w.insertAfter(d);f=="select"&&this.handle.bind({focus:function(){w.addClass(a.mobile.focusClass)},blur:function(){w.removeClass(a.mobile.focusClass)}});this.handle.bind({vmousedown:function(){a(this).focus()},vclick:false,keydown:function(c){var d=m();if(!b.options.disabled){switch(c.keyCode){case a.mobile.keyCode.HOME:case a.mobile.keyCode.END:case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:if(c.preventDefault(),
+!b._keySliding)b._keySliding=true,a(this).addClass("ui-state-active")}switch(c.keyCode){case a.mobile.keyCode.HOME:b.refresh(v);break;case a.mobile.keyCode.END:b.refresh(n);break;case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:b.refresh(d+r);break;case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:b.refresh(d-r)}}},keyup:function(){if(b._keySliding)b._keySliding=false,a(this).removeClass("ui-state-active")}});this.refresh(c,c,true)},
+refresh:function(b,c,e){(this.options.disabled||this.element.attr("disabled"))&&this.disable();var g=this.element,f=g[0].nodeName.toLowerCase(),j=f==="input"?parseFloat(g.attr("min")):0,h=f==="input"?parseFloat(g.attr("max")):g.find("option").length-1,k=f==="input"&&parseFloat(g.attr("step"))>0?parseFloat(g.attr("step")):1;if(typeof b==="object"){if(!this.dragging||b.pageX<this.slider.offset().left-8||b.pageX>this.slider.offset().left+this.slider.width()+8)return;b=Math.round((b.pageX-this.slider.offset().left)/
+this.slider.width()*100)}else b==null&&(b=f==="input"?parseFloat(g.val()||0):g[0].selectedIndex),b=(parseFloat(b)-j)/(h-j)*100;if(!isNaN(b)){b<0&&(b=0);b>100&&(b=100);var l=b/100*(h-j)+j,m=(l-j)%k;l-=m;Math.abs(m)*2>=k&&(l+=m>0?k:-k);l=parseFloat(l.toFixed(5));l<j&&(l=j);l>h&&(l=h);this.handle.css("left",b+"%");this.handle.attr({"aria-valuenow":f==="input"?l:g.find("option").eq(l).attr("value"),"aria-valuetext":f==="input"?l:g.find("option").eq(l).getEncodedText(),title:f==="input"?l:g.find("option").eq(l).getEncodedText()});
+this.valuebg&&this.valuebg.css("width",b+"%");if(this._labels){var j=this.handle.width()/this.slider.width()*100,t=b&&j+(100-j)*b/100,n=b===100?0:Math.min(j+100-t,100);this._labels.each(function(){var b=a(this).is(".ui-slider-label-a");a(this).width((b?t:n)+"%")})}if(!e)e=false,f==="input"?(e=g.val()!==l,g.val(l)):(e=g[0].selectedIndex!==l,g[0].selectedIndex=l),!c&&e&&g.trigger("change")}},enable:function(){this.element.attr("disabled",false);this.slider.removeClass("ui-disabled").attr("aria-disabled",
+false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.slider.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)}});a(k).bind("pagecreate create",function(b){a.mobile.slider.prototype.enhanceWithin(b.target,true)})})(l);(function(a){a.widget("mobile.selectmenu",a.mobile.widget,{options:{theme:null,disabled:false,icon:"arrow-d",iconpos:"right",inline:false,corners:true,shadow:true,iconshadow:true,overlayTheme:"a",
+hidePlaceholderMenuItems:true,closeText:"Close",nativeMenu:true,preventFocusZoom:/iPhone|iPad|iPod/.test(navigator.platform)&&navigator.userAgent.indexOf("AppleWebKit")>-1,initSelector:"select:not(:jqmData(role='slider'))",mini:false},_button:function(){return a("<div/>")},_setDisabled:function(a){this.element.attr("disabled",a);this.button.attr("aria-disabled",a);return this._setOption("disabled",a)},_focusButton:function(){var a=this;setTimeout(function(){a.button.focus()},40)},_selectOptions:function(){return this.select.find("option")},
+_preExtension:function(){var c="";~this.element[0].className.indexOf("ui-btn-left")&&(c=" ui-btn-left");~this.element[0].className.indexOf("ui-btn-right")&&(c=" ui-btn-right");this.select=this.element.wrap("<div class='ui-select"+c+"'>");this.selectID=this.select.attr("id");this.label=a("label[for='"+this.selectID+"']").addClass("ui-select");this.isMultiple=this.select[0].multiple;if(!this.options.theme)this.options.theme=a.mobile.getInheritedTheme(this.select,"c")},_create:function(){this._preExtension();
+this._trigger("beforeCreate");this.button=this._button();var c=this,b=this.options,d=b.inline||this.select.jqmData("inline"),e=b.mini||this.select.jqmData("mini"),g=b.icon?b.iconpos||this.select.jqmData("iconpos"):false,d=this.button.text(a(this.select[0].options.item(this.select[0].selectedIndex==-1?0:this.select[0].selectedIndex)).text()).insertBefore(this.select).buttonMarkup({theme:b.theme,icon:b.icon,iconpos:g,inline:d,corners:b.corners,shadow:b.shadow,iconshadow:b.iconshadow,mini:e});b.nativeMenu&&
+t.opera&&t.opera.version&&d.addClass("ui-select-nativeonly");if(this.isMultiple)this.buttonCount=a("<span>").addClass("ui-li-count ui-btn-up-c ui-btn-corner-all").hide().appendTo(d.addClass("ui-li-has-count"));(b.disabled||this.element.attr("disabled"))&&this.disable();this.select.change(function(){c.refresh()});this.build()},build:function(){var c=this;this.select.appendTo(c.button).bind("vmousedown",function(){c.button.addClass(a.mobile.activeBtnClass)}).bind("focus",function(){c.button.addClass(a.mobile.focusClass)}).bind("blur",
+function(){c.button.removeClass(a.mobile.focusClass)}).bind("focus vmouseover",function(){c.button.trigger("vmouseover")}).bind("vmousemove",function(){c.button.removeClass(a.mobile.activeBtnClass)}).bind("change blur vmouseout",function(){c.button.trigger("vmouseout").removeClass(a.mobile.activeBtnClass)}).bind("change blur",function(){c.button.removeClass("ui-btn-down-"+c.options.theme)});c.button.bind("vmousedown",function(){c.options.preventFocusZoom&&a.mobile.zoom.disable(true)}).bind("mouseup",
+function(){c.options.preventFocusZoom&&a.mobile.zoom.enable(true)})},selected:function(){return this._selectOptions().filter(":selected")},selectedIndices:function(){var a=this;return this.selected().map(function(){return a._selectOptions().index(this)}).get()},setButtonText:function(){var c=this,b=this.selected();this.button.find(".ui-btn-text").text(function(){return!c.isMultiple?b.text():b.length?b.map(function(){return a(this).text()}).get().join(", "):c.placeholder})},setButtonCount:function(){var a=
+this.selected();this.isMultiple&&this.buttonCount[a.length>1?"show":"hide"]().text(a.length)},refresh:function(){this.setButtonText();this.setButtonCount()},open:a.noop,close:a.noop,disable:function(){this._setDisabled(true);this.button.addClass("ui-disabled")},enable:function(){this._setDisabled(false);this.button.removeClass("ui-disabled")}});a(k).bind("pagecreate create",function(c){a.mobile.selectmenu.prototype.enhanceWithin(c.target,true)})})(l);(function(a){var c=function(b){var c=b.selectID,
+e=b.label,g=b.select.closest(".ui-page"),f=a("<div>",{"class":"ui-selectmenu-screen ui-screen-hidden"}).appendTo(g),j=b._selectOptions(),h=b.isMultiple=b.select[0].multiple,l=c+"-button",o=c+"-menu",m=a("<div data-"+a.mobile.ns+"role='dialog' data-"+a.mobile.ns+"theme='"+b.options.theme+"' data-"+a.mobile.ns+"overlay-theme='"+b.options.overlayTheme+"'><div data-"+a.mobile.ns+"role='header'><div class='ui-title'>"+e.getEncodedText()+"</div></div><div data-"+a.mobile.ns+"role='content'></div></div>"),
+v=a("<div>",{"class":"ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-"+b.options.overlayTheme+" "+a.mobile.defaultDialogTransition}).insertAfter(f),n=a("<ul>",{"class":"ui-selectmenu-list",id:o,role:"listbox","aria-labelledby":l}).attr("data-"+a.mobile.ns+"theme",b.options.theme).appendTo(v),r=a("<div>",{"class":"ui-header ui-bar-"+b.options.theme}).prependTo(v),p=a("<h1>",{"class":"ui-title"}).appendTo(r),s;b.isMultiple&&(s=a("<a>",{text:b.options.closeText,href:"#","class":"ui-btn-left"}).attr("data-"+
+a.mobile.ns+"iconpos","notext").attr("data-"+a.mobile.ns+"icon","delete").appendTo(r).buttonMarkup());a.extend(b,{select:b.select,selectID:c,buttonId:l,menuId:o,thisPage:g,menuPage:m,label:e,screen:f,selectOptions:j,isMultiple:h,theme:b.options.theme,listbox:v,list:n,header:r,headerTitle:p,headerClose:s,menuPageContent:void 0,menuPageClose:void 0,placeholder:"",build:function(){var c=this;c.refresh();c.select.attr("tabindex","-1").focus(function(){a(this).blur();c.button.focus()});c.button.bind("vclick keydown",
+function(b){if(b.type=="vclick"||b.keyCode&&(b.keyCode===a.mobile.keyCode.ENTER||b.keyCode===a.mobile.keyCode.SPACE))c.open(),b.preventDefault()});c.list.attr("role","listbox").bind("focusin",function(b){a(b.target).attr("tabindex","0").trigger("vmouseover")}).bind("focusout",function(b){a(b.target).attr("tabindex","-1").trigger("vmouseout")}).delegate("li:not(.ui-disabled, .ui-li-divider)","click",function(d){var e=c.select[0].selectedIndex,f=c.list.find("li:not(.ui-li-divider)").index(this),h=c._selectOptions().eq(f)[0];
+h.selected=c.isMultiple?!h.selected:true;c.isMultiple&&a(this).find(".ui-icon").toggleClass("ui-icon-checkbox-on",h.selected).toggleClass("ui-icon-checkbox-off",!h.selected);(c.isMultiple||e!==f)&&c.select.trigger("change");c.isMultiple?c.list.find("li:not(.ui-li-divider)").eq(f).addClass("ui-btn-down-"+b.options.theme).find("a").first().focus():c.close();d.preventDefault()}).keydown(function(c){var d=a(c.target),e=d.closest("li");switch(c.keyCode){case 38:return c=e.prev().not(".ui-selectmenu-placeholder"),
+c.is(".ui-li-divider")&&(c=c.prev()),c.length&&(d.blur().attr("tabindex","-1"),c.addClass("ui-btn-down-"+b.options.theme).find("a").first().focus()),false;case 40:return c=e.next(),c.is(".ui-li-divider")&&(c=c.next()),c.length&&(d.blur().attr("tabindex","-1"),c.addClass("ui-btn-down-"+b.options.theme).find("a").first().focus()),false;case 13:case 32:return d.trigger("click"),false}});c.menuPage.bind("pagehide",function(){c.list.appendTo(c.listbox);c._focusButton();a.mobile._bindPageRemove.call(c.thisPage)});
+c.screen.bind("vclick",function(){c.close()});c.isMultiple&&c.headerClose.click(function(){if(c.menuType=="overlay")return c.close(),false});c.thisPage.addDependents(this.menuPage)},_isRebuildRequired:function(){var a=this.list.find("li");return this._selectOptions().text()!==a.text()},selected:function(){return this._selectOptions().filter(":selected:not(:jqmData(placeholder='true'))")},refresh:function(b){var c=this,d;(b||this._isRebuildRequired())&&c._buildList();d=this.selectedIndices();c.setButtonText();
+c.setButtonCount();c.list.find("li:not(.ui-li-divider)").removeClass(a.mobile.activeBtnClass).attr("aria-selected",false).each(function(b){a.inArray(b,d)>-1&&(b=a(this),b.attr("aria-selected",true),c.isMultiple?b.find(".ui-icon").removeClass("ui-icon-checkbox-off").addClass("ui-icon-checkbox-on"):b.is(".ui-selectmenu-placeholder")?b.next().addClass(a.mobile.activeBtnClass):b.addClass(a.mobile.activeBtnClass))})},close:function(){if(!this.options.disabled&&this.isOpen)this.menuType=="page"?t.history.back():
+(this.screen.addClass("ui-screen-hidden"),this.listbox.addClass("ui-selectmenu-hidden").removeAttr("style").removeClass("in"),this.list.appendTo(this.listbox),this._focusButton()),this.isOpen=false},open:function(){function c(){var e=d.list.find("."+a.mobile.activeBtnClass+" a");e.length===0&&(e=d.list.find("li.ui-btn:not(:jqmData(placeholder='true')) a"));e.first().focus().closest("li").addClass("ui-btn-down-"+b.options.theme)}if(!this.options.disabled){var d=this,e=a(t),f=d.list.parent(),h=f.outerHeight(),
+f=f.outerWidth();a(".ui-page-active");var g=e.scrollTop(),j=d.button.offset().top,l=e.height(),e=e.width();d.button.addClass(a.mobile.activeBtnClass);setTimeout(function(){d.button.removeClass(a.mobile.activeBtnClass)},300);if(h>l-80||!a.support.scrollTop){d.menuPage.appendTo(a.mobile.pageContainer).page();d.menuPageContent=m.find(".ui-content");d.menuPageClose=m.find(".ui-header a");d.thisPage.unbind("pagehide.remove");if(g==0&&j>l)d.thisPage.one("pagehide",function(){a(this).jqmData("lastScroll",
+j)});d.menuPage.one("pageshow",function(){c();d.isOpen=true});d.menuType="page";d.menuPageContent.append(d.list);d.menuPage.find("div .ui-title").text(d.label.text());a.mobile.changePage(d.menuPage,{transition:a.mobile.defaultDialogTransition})}else{d.menuType="overlay";d.screen.height(a(k).height()).removeClass("ui-screen-hidden");var n=j-g,o=g+l-j,q=h/2,p=parseFloat(d.list.parent().css("max-width")),h=n>h/2&&o>h/2?j+d.button.outerHeight()/2-q:n>o?g+l-h-30:g+30;f<p?g=(e-f)/2:(g=d.button.offset().left+
+d.button.outerWidth()/2-f/2,g<30?g=30:g+f>e&&(g=e-f-30));d.listbox.append(d.list).removeClass("ui-selectmenu-hidden").css({top:h,left:g}).addClass("in");c();d.isOpen=true}}},_buildList:function(){var b=this.options,c=this.placeholder,d=true,e=this.isMultiple?"checkbox-off":"false";this.list.empty().filter(".ui-listview").listview("destroy");var f=this.select.find("option"),h=f.length,g=this.select[0],j="data-"+a.mobile.ns,l=j+"option-index",m=j+"icon",n=j+"role";j+="placeholder";for(var o=k.createDocumentFragment(),
+q=false,p,t=0;t<h;t++,q=false){var s=f[t],r=a(s),v=s.parentNode,E=r.text(),I=k.createElement("a"),L=[];I.setAttribute("href","#");I.appendChild(k.createTextNode(E));v!==g&&v.nodeName.toLowerCase()==="optgroup"&&(v=v.getAttribute("label"),v!=p&&(p=k.createElement("li"),p.setAttribute(n,"list-divider"),p.setAttribute("role","option"),p.setAttribute("tabindex","-1"),p.appendChild(k.createTextNode(v)),o.appendChild(p),p=v));if(d&&(!s.getAttribute("value")||E.length==0||r.jqmData("placeholder")))if(d=
+false,q=true,s.setAttribute(j,true),b.hidePlaceholderMenuItems&&L.push("ui-selectmenu-placeholder"),!c)c=this.placeholder=E;r=k.createElement("li");s.disabled&&(L.push("ui-disabled"),r.setAttribute("aria-disabled",true));r.setAttribute(l,t);r.setAttribute(m,e);q&&r.setAttribute(j,true);r.className=L.join(" ");r.setAttribute("role","option");I.setAttribute("tabindex","-1");r.appendChild(I);o.appendChild(r)}this.list[0].appendChild(o);!this.isMultiple&&!c.length?this.header.hide():this.headerTitle.text(this.placeholder);
+this.list.listview()},_button:function(){return a("<a>",{href:"#",role:"button",id:this.buttonId,"aria-haspopup":"true","aria-owns":this.menuId})}})};a(k).bind("selectmenubeforecreate",function(b){b=a(b.target).data("selectmenu");b.options.nativeMenu||c(b)})})(l);(function(a){a.widget("mobile.fixedtoolbar",a.mobile.widget,{options:{visibleOnPageShow:true,disablePageZoom:true,transition:"slide",fullscreen:false,tapToggle:true,tapToggleBlacklist:"a, button, input, select, textarea, .ui-header-fixed, .ui-footer-fixed",
+hideDuringFocus:"input, textarea, select",updatePagePadding:true,trackPersistentToolbars:true,supportBlacklist:function(){var a=navigator.userAgent,b=navigator.platform,d=a.match(/AppleWebKit\/([0-9]+)/),d=!!d&&d[1],e=a.match(/Fennec\/([0-9]+)/),e=!!e&&e[1],g=a.match(/Opera Mobi\/([0-9]+)/),f=!!g&&g[1];return(b.indexOf("iPhone")>-1||b.indexOf("iPad")>-1||b.indexOf("iPod")>-1)&&d&&d<534||t.operamini&&{}.toString.call(t.operamini)==="[object OperaMini]"||g&&f<7458||a.indexOf("Android")>-1&&d&&d<533||
+e&&e<6||"palmGetResource"in t&&d&&d<534||a.indexOf("MeeGo")>-1&&a.indexOf("NokiaBrowser/8.5.0")>-1?true:false},initSelector:":jqmData(position='fixed')"},_create:function(){var a=this.options,b=this.element,d=b.is(":jqmData(role='header')")?"header":"footer",e=b.closest(".ui-page");a.supportBlacklist()?this.destroy():(b.addClass("ui-"+d+"-fixed"),a.fullscreen?(b.addClass("ui-"+d+"-fullscreen"),e.addClass("ui-page-"+d+"-fullscreen")):e.addClass("ui-page-"+d+"-fixed"),this._addTransitionClass(),this._bindPageEvents(),
+this._bindToggleHandlers())},_addTransitionClass:function(){var a=this.options.transition;a&&a!=="none"&&(a==="slide"&&(a=this.element.is(".ui-header")?"slidedown":"slideup"),this.element.addClass(a))},_bindPageEvents:function(){var c=this,b=c.options;c.element.closest(".ui-page").bind("pagebeforeshow",function(){b.disablePageZoom&&a.mobile.zoom.disable(true);b.visibleOnPageShow||c.hide(true)}).bind("webkitAnimationStart animationstart updatelayout",function(){b.updatePagePadding&&c.updatePagePadding(this)}).bind("pageshow",
+function(){var d=this;c.updatePagePadding(d);b.updatePagePadding&&a(t).bind("throttledresize."+c.widgetName,function(){c.updatePagePadding(d)})}).bind("pagebeforehide",function(d,e){b.disablePageZoom&&a.mobile.zoom.enable(true);b.updatePagePadding&&a(t).unbind("throttledresize."+c.widgetName);if(b.trackPersistentToolbars){var g=a(".ui-footer-fixed:jqmData(id)",this),f=a(".ui-header-fixed:jqmData(id)",this),j=g.length&&e.nextPage&&a(".ui-footer-fixed:jqmData(id='"+g.jqmData("id")+"')",e.nextPage),
+h=f.length&&e.nextPage&&a(".ui-header-fixed:jqmData(id='"+f.jqmData("id")+"')",e.nextPage),j=j||a();if(j.length||h.length)j.add(h).appendTo(a.mobile.pageContainer),e.nextPage.one("pageshow",function(){j.add(h).appendTo(this)})}})},_visible:true,updatePagePadding:function(c){var b=this.element,d=b.is(".ui-header");this.options.fullscreen||(c=c||b.closest(".ui-page"),a(c).css("padding-"+(d?"top":"bottom"),b.outerHeight()))},_useTransition:function(c){var b=this.element,d=a(t).scrollTop(),e=b.height(),
+g=b.closest(".ui-page").height(),f=a.mobile.getScreenHeight(),b=b.is(":jqmData(role='header')")?"header":"footer";return!c&&(this.options.transition&&this.options.transition!=="none"&&(b==="header"&&!this.options.fullscreen&&d>e||b==="footer"&&!this.options.fullscreen&&d+f<g-e)||this.options.fullscreen)},show:function(a){var b=this.element;this._useTransition(a)?b.removeClass("out ui-fixed-hidden").addClass("in"):b.removeClass("ui-fixed-hidden");this._visible=true},hide:function(a){var b=this.element,
+d="out"+(this.options.transition==="slide"?" reverse":"");this._useTransition(a)?b.addClass(d).removeClass("in").animationComplete(function(){b.addClass("ui-fixed-hidden").removeClass(d)}):b.addClass("ui-fixed-hidden").removeClass(d);this._visible=false},toggle:function(){this[this._visible?"hide":"show"]()},_bindToggleHandlers:function(){var c=this,b=c.options;c.element.closest(".ui-page").bind("vclick",function(d){b.tapToggle&&!a(d.target).closest(b.tapToggleBlacklist).length&&c.toggle()}).bind("focusin focusout",
+function(d){if(screen.width<500&&a(d.target).is(b.hideDuringFocus)&&!a(d.target).closest(".ui-header-fixed, .ui-footer-fixed").length)c[d.type==="focusin"&&c._visible?"hide":"show"]()})},destroy:function(){this.element.removeClass("ui-header-fixed ui-footer-fixed ui-header-fullscreen ui-footer-fullscreen in out fade slidedown slideup ui-fixed-hidden");this.element.closest(".ui-page").removeClass("ui-page-header-fixed ui-page-footer-fixed ui-page-header-fullscreen ui-page-footer-fullscreen")}});a(k).bind("pagecreate create",
+function(c){a(c.target).jqmData("fullscreen")&&a(a.mobile.fixedtoolbar.prototype.options.initSelector,c.target).not(":jqmData(fullscreen)").jqmData("fullscreen",true);a.mobile.fixedtoolbar.prototype.enhanceWithin(c.target)})})(l);(function(a,c){if(/iPhone|iPad|iPod/.test(navigator.platform)&&navigator.userAgent.indexOf("AppleWebKit")>-1){var b=a.mobile.zoom,d,e,g,f,j;a(c).bind("orientationchange.iosorientationfix",b.enable).bind("devicemotion.iosorientationfix",function(a){d=a.originalEvent;j=d.accelerationIncludingGravity;
+e=Math.abs(j.x);g=Math.abs(j.y);f=Math.abs(j.z);!c.orientation&&(e>7||(f>6&&g<8||f<8&&g>6)&&e>5)?b.enabled&&b.disable():b.enabled||b.enable()})}})(l,this);(function(a,c){function b(){var b=a("."+a.mobile.activeBtnClass).first();j.css({top:a.support.scrollTop&&f.scrollTop()+f.height()/2||b.length&&b.offset().top||100})}function d(){var c=j.offset(),e=f.scrollTop(),g=a.mobile.getScreenHeight();if(c.top<e||c.top-e>g)j.addClass("ui-loader-fakefix"),b(),f.unbind("scroll",d).bind("scroll",b)}function e(){g.removeClass("ui-mobile-rendering")}
+var g=a("html");a("head");var f=a(c);a(c.document).trigger("mobileinit");if(a.mobile.gradeA()){if(a.mobile.ajaxBlacklist)a.mobile.ajaxEnabled=false;g.addClass("ui-mobile ui-mobile-rendering");setTimeout(e,5E3);var j=a("<div class='ui-loader'><span class='ui-icon ui-icon-loading'></span><h1></h1></div>");a.extend(a.mobile,{showPageLoadingMsg:function(b,c,e){g.addClass("ui-loading");if(a.mobile.loadingMessage){var k=e||a.mobile.loadingMessageTextVisible;b=b||a.mobile.loadingMessageTheme;j.attr("class",
+"ui-loader ui-corner-all ui-body-"+(b||"a")+" ui-loader-"+(k?"verbose":"default")+(e?" ui-loader-textonly":"")).find("h1").text(c||a.mobile.loadingMessage).end().appendTo(a.mobile.pageContainer);d();f.bind("scroll",d)}},hidePageLoadingMsg:function(){g.removeClass("ui-loading");a.mobile.loadingMessage&&j.removeClass("ui-loader-fakefix");a(c).unbind("scroll",b);a(c).unbind("scroll",d)},initializePage:function(){var b=a(":jqmData(role='page'), :jqmData(role='dialog')");b.length||(b=a("body").wrapInner("<div data-"+
+a.mobile.ns+"role='page'></div>").children(0));b.each(function(){var b=a(this);b.jqmData("url")||b.attr("data-"+a.mobile.ns+"url",b.attr("id")||location.pathname+location.search)});a.mobile.firstPage=b.first();a.mobile.pageContainer=b.first().parent().addClass("ui-mobile-viewport");f.trigger("pagecontainercreate");a.mobile.showPageLoadingMsg();e();!a.mobile.hashListeningEnabled||!a.mobile.path.isHashValid(location.hash)||!a(location.hash+':jqmData(role="page")').length&&!a.mobile.path.isPath(location.hash)?
+a.mobile.changePage(a.mobile.firstPage,{transition:"none",reverse:true,changeHash:false,fromHashChange:true}):f.trigger("hashchange",[true])}});a.mobile.navreadyDeferred.resolve();a(function(){c.scrollTo(0,1);a.mobile.defaultHomeScroll=!a.support.scrollTop||a(c).scrollTop()===1?0:1;a.fn.controlgroup&&a(k).bind("pagecreate create",function(b){a(":jqmData(role='controlgroup')",b.target).jqmEnhanceable().controlgroup({excludeInvisible:false})});a.mobile.autoInitializePage&&a.mobile.initializePage();
+f.load(a.mobile.silentScroll);a.support.cssPointerEvents||a(k).delegate(".ui-disabled","vclick",function(a){a.preventDefault();a.stopImmediatePropagation()})})}})(l,this)});
diff --git a/module/web/static/js/libs/jquery.omniwindow.js b/module/web/static/js/libs/jquery.omniwindow.js
new file mode 100644
index 000000000..e1f0b8f77
--- /dev/null
+++ b/module/web/static/js/libs/jquery.omniwindow.js
@@ -0,0 +1,141 @@
+// jQuery OmniWindow plugin
+// @version: 0.7.0
+// @author: Rudenka Alexander (mur.mailbox@gmail.com)
+// @license: MIT
+
+;(function($) {
+ "use strict";
+ $.fn.extend({
+ omniWindow: function(options) {
+
+ options = $.extend(true, {
+ animationsPriority: {
+ show: ['overlay', 'modal'],
+ hide: ['modal', 'overlay']
+ },
+ overlay: {
+ selector: '.ow-overlay',
+ hideClass: 'ow-closed',
+ animations: {
+ show: function(subjects, internalCallback) { return internalCallback(subjects); },
+ hide: function(subjects, internalCallback) { return internalCallback(subjects); },
+ internal: {
+ show: function(subjects){ subjects.overlay.removeClass(options.overlay.hideClass); },
+ hide: function(subjects){ subjects.overlay.addClass(options.overlay.hideClass); }
+ }
+ }
+ },
+ modal: {
+ hideClass: 'ow-closed',
+ animations: {
+ show: function(subjects, internalCallback) { return internalCallback(subjects); },
+ hide: function(subjects, internalCallback) { return internalCallback(subjects); },
+ internal: {
+ show: function(subjects){ subjects.modal.removeClass(options.modal.hideClass); },
+ hide: function(subjects){ subjects.modal.addClass(options.modal.hideClass); }
+ }
+ },
+ internal: {
+ stateAttribute: 'ow-active'
+ }
+ },
+ eventsNames: {
+ show: 'show.ow',
+ hide: 'hide.ow',
+ internal: {
+ overlayClick: 'click.ow',
+ keyboardKeyUp: 'keyup.ow'
+ }
+ },
+ callbacks: { // Callbacks execution chain
+ beforeShow: function(subjects, internalCallback) { return internalCallback(subjects); }, // 1 (stop if retruns false)
+ positioning: function(subjects, internalCallback) { return internalCallback(subjects); }, // 2
+ afterShow: function(subjects, internalCallback) { return internalCallback(subjects); }, // 3
+ beforeHide: function(subjects, internalCallback) { return internalCallback(subjects); }, // 4 (stop if retruns false)
+ afterHide: function(subjects, internalCallback) { return internalCallback(subjects); }, // 5
+ internal: {
+ beforeShow: function(subjects) {
+ if (subjects.modal.data(options.modal.internal.stateAttribute)) {
+ return false;
+ } else {
+ subjects.modal.data(options.modal.internal.stateAttribute, true);
+ return true;
+ }
+ },
+ afterShow: function(subjects) {
+ $(document).on(options.eventsNames.internal.keyboardKeyUp, function(e) {
+ if (e.keyCode === 27) { // if the key pressed is the ESC key
+ subjects.modal.trigger(options.eventsNames.hide);
+ }
+ });
+
+ subjects.overlay.on(options.eventsNames.internal.overlayClick, function(){
+ subjects.modal.trigger(options.eventsNames.hide);
+ });
+ },
+ positioning: function(subjects) {
+ subjects.modal.css('margin-left', Math.round(subjects.modal.outerWidth() / -2));
+ },
+ beforeHide: function(subjects) {
+ if (subjects.modal.data(options.modal.internal.stateAttribute)) {
+ subjects.modal.data(options.modal.internal.stateAttribute, false);
+ return true;
+ } else {
+ return false;
+ }
+ },
+ afterHide: function(subjects) {
+ subjects.overlay.off(options.eventsNames.internal.overlayClick);
+ $(document).off(options.eventsNames.internal.keyboardKeyUp);
+
+ subjects.overlay.css('display', ''); // clear inline styles after jQ animations
+ subjects.modal.css('display', '');
+ }
+ }
+ }
+ }, options);
+
+ var animate = function(process, subjects, callbackName) {
+ var first = options.animationsPriority[process][0],
+ second = options.animationsPriority[process][1];
+
+ options[first].animations[process](subjects, function(subjs) { // call USER's FIRST animation (depends on priority)
+ options[first].animations.internal[process](subjs); // call internal FIRST animation
+
+ options[second].animations[process](subjects, function(subjs) { // call USER's SECOND animation
+ options[second].animations.internal[process](subjs); // call internal SECOND animation
+
+ // then we need to call USER's
+ // afterShow of afterHide callback
+ options.callbacks[callbackName](subjects, options.callbacks.internal[callbackName]);
+ });
+ });
+ };
+
+ var showModal = function(subjects) {
+ if (!options.callbacks.beforeShow(subjects, options.callbacks.internal.beforeShow)) { return; } // cancel showing if beforeShow callback return false
+
+ options.callbacks.positioning(subjects, options.callbacks.internal.positioning);
+
+ animate('show', subjects, 'afterShow');
+ };
+
+ var hideModal = function(subjects) {
+ if (!options.callbacks.beforeHide(subjects, options.callbacks.internal.beforeHide)) { return; } // cancel hiding if beforeHide callback return false
+
+ animate('hide', subjects, 'afterHide');
+ };
+
+
+ var $overlay = $(options.overlay.selector);
+
+ return this.each(function() {
+ var $modal = $(this);
+ var subjects = {modal: $modal, overlay: $overlay};
+
+ $modal.bind(options.eventsNames.show, function(){ showModal(subjects); })
+ .bind(options.eventsNames.hide, function(){ hideModal(subjects); });
+ });
+ }
+ });
+})(jQuery); \ No newline at end of file
diff --git a/module/web/static/js/libs/jquery.transit-0.1.3.js b/module/web/static/js/libs/jquery.transit-0.1.3.js
new file mode 100644
index 000000000..2314f2ca2
--- /dev/null
+++ b/module/web/static/js/libs/jquery.transit-0.1.3.js
@@ -0,0 +1,658 @@
+/*!
+ * jQuery Transit - CSS3 transitions and transformations
+ * Copyright(c) 2011 Rico Sta. Cruz <rico@ricostacruz.com>
+ * MIT Licensed.
+ *
+ * http://ricostacruz.com/jquery.transit
+ * http://github.com/rstacruz/jquery.transit
+ */
+
+(function($) {
+ "use strict";
+
+ $.transit = {
+ version: "0.1.3",
+
+ // Map of $.css() keys to values for 'transitionProperty'.
+ // See https://developer.mozilla.org/en/CSS/CSS_transitions#Properties_that_can_be_animated
+ propertyMap: {
+ marginLeft : 'margin',
+ marginRight : 'margin',
+ marginBottom : 'margin',
+ marginTop : 'margin',
+ paddingLeft : 'padding',
+ paddingRight : 'padding',
+ paddingBottom : 'padding',
+ paddingTop : 'padding'
+ },
+
+ // Will simply transition "instantly" if false
+ enabled: true,
+
+ // Set this to false if you don't want to use the transition end property.
+ useTransitionEnd: false
+ };
+
+ var div = document.createElement('div');
+ var support = {};
+
+ // Helper function to get the proper vendor property name.
+ // (`transition` => `WebkitTransition`)
+ function getVendorPropertyName(prop) {
+ var prefixes = ['Moz', 'Webkit', 'O', 'ms'];
+ var prop_ = prop.charAt(0).toUpperCase() + prop.substr(1);
+
+ if (prop in div.style) { return prop; }
+
+ for (var i=0; i<prefixes.length; ++i) {
+ var vendorProp = prefixes[i] + prop_;
+ if (vendorProp in div.style) { return vendorProp; }
+ }
+ }
+
+ // Helper function to check if transform3D is supported.
+ // Should return true for Webkits and Firefox 10+.
+ function checkTransform3dSupport() {
+ div.style[support.transform] = '';
+ div.style[support.transform] = 'rotateY(90deg)';
+ return div.style[support.transform] !== '';
+ }
+
+ var isChrome = navigator.userAgent.toLowerCase().indexOf('chrome') > -1;
+
+ // Check for the browser's transitions support.
+ // You can access this in jQuery's `$.support.transition`.
+ // As per [jQuery's cssHooks documentation](http://api.jquery.com/jQuery.cssHooks/),
+ // we set $.support.transition to a string of the actual property name used.
+ support.transition = getVendorPropertyName('transition');
+ support.transitionDelay = getVendorPropertyName('transitionDelay');
+ support.transform = getVendorPropertyName('transform');
+ support.transformOrigin = getVendorPropertyName('transformOrigin');
+ support.transform3d = checkTransform3dSupport();
+
+ $.extend($.support, support);
+
+ var eventNames = {
+ 'MozTransition': 'transitionend',
+ 'OTransition': 'oTransitionEnd',
+ 'WebkitTransition': 'webkitTransitionEnd',
+ 'msTransition': 'MSTransitionEnd'
+ };
+
+ // Detect the 'transitionend' event needed.
+ var transitionEnd = support.transitionEnd = eventNames[support.transition] || null;
+
+ // Avoid memory leak in IE.
+ div = null;
+
+ // ## $.cssEase
+ // List of easing aliases that you can use with `$.fn.transition`.
+ $.cssEase = {
+ '_default': 'ease',
+ 'in': 'ease-in',
+ 'out': 'ease-out',
+ 'in-out': 'ease-in-out',
+ 'snap': 'cubic-bezier(0,1,.5,1)'
+ };
+
+ // ## 'transform' CSS hook
+ // Allows you to use the `transform` property in CSS.
+ //
+ // $("#hello").css({ transform: "rotate(90deg)" });
+ //
+ // $("#hello").css('transform');
+ // //=> { rotate: '90deg' }
+ //
+ $.cssHooks.transform = {
+ // The getter returns a `Transform` object.
+ get: function(elem) {
+ return $(elem).data('transform');
+ },
+
+ // The setter accepts a `Transform` object or a string.
+ set: function(elem, v) {
+ var value = v;
+
+ if (!(value instanceof Transform)) {
+ value = new Transform(value);
+ }
+
+ // We've seen the 3D version of Scale() not work in Chrome when the
+ // element being scaled extends outside of the viewport. Thus, we're
+ // forcing Chrome to not use the 3d transforms as well. Not sure if
+ // translate is affectede, but not risking it. Detection code from
+ // http://davidwalsh.name/detecting-google-chrome-javascript
+ if (support.transform === 'WebkitTransform' && !isChrome) {
+ elem.style[support.transform] = value.toString(true);
+ } else {
+ elem.style[support.transform] = value.toString();
+ }
+
+ $(elem).data('transform', value);
+ }
+ };
+
+ // ## 'transformOrigin' CSS hook
+ // Allows the use for `transformOrigin` to define where scaling and rotation
+ // is pivoted.
+ //
+ // $("#hello").css({ transformOrigin: '0 0' });
+ //
+ $.cssHooks.transformOrigin = {
+ get: function(elem) {
+ return elem.style[support.transformOrigin];
+ },
+ set: function(elem, value) {
+ elem.style[support.transformOrigin] = value;
+ }
+ };
+
+ // ## 'transition' CSS hook
+ // Allows you to use the `transition` property in CSS.
+ //
+ // $("#hello").css({ transition: 'all 0 ease 0' });
+ //
+ $.cssHooks.transition = {
+ get: function(elem) {
+ return elem.style[support.transition];
+ },
+ set: function(elem, value) {
+ elem.style[support.transition] = value;
+ }
+ };
+
+ // ## Other CSS hooks
+ // Allows you to rotate, scale and translate.
+ registerCssHook('scale');
+ registerCssHook('translate');
+ registerCssHook('rotate');
+ registerCssHook('rotateX');
+ registerCssHook('rotateY');
+ registerCssHook('rotate3d');
+ registerCssHook('perspective');
+ registerCssHook('skewX');
+ registerCssHook('skewY');
+ registerCssHook('x', true);
+ registerCssHook('y', true);
+
+ // ## Transform class
+ // This is the main class of a transformation property that powers
+ // `$.fn.css({ transform: '...' })`.
+ //
+ // This is, in essence, a dictionary object with key/values as `-transform`
+ // properties.
+ //
+ // var t = new Transform("rotate(90) scale(4)");
+ //
+ // t.rotate //=> "90deg"
+ // t.scale //=> "4,4"
+ //
+ // Setters are accounted for.
+ //
+ // t.set('rotate', 4)
+ // t.rotate //=> "4deg"
+ //
+ // Convert it to a CSS string using the `toString()` and `toString(true)` (for WebKit)
+ // functions.
+ //
+ // t.toString() //=> "rotate(90deg) scale(4,4)"
+ // t.toString(true) //=> "rotate(90deg) scale3d(4,4,0)" (WebKit version)
+ //
+ function Transform(str) {
+ if (typeof str === 'string') { this.parse(str); }
+ return this;
+ }
+
+ Transform.prototype = {
+ // ### setFromString()
+ // Sets a property from a string.
+ //
+ // t.setFromString('scale', '2,4');
+ // // Same as set('scale', '2', '4');
+ //
+ setFromString: function(prop, val) {
+ var args =
+ (typeof val === 'string') ? val.split(',') :
+ (val.constructor === Array) ? val :
+ [ val ];
+
+ args.unshift(prop);
+
+ Transform.prototype.set.apply(this, args);
+ },
+
+ // ### set()
+ // Sets a property.
+ //
+ // t.set('scale', 2, 4);
+ //
+ set: function(prop) {
+ var args = Array.prototype.slice.apply(arguments, [1]);
+ if (this.setter[prop]) {
+ this.setter[prop].apply(this, args);
+ } else {
+ this[prop] = args.join(',');
+ }
+ },
+
+ get: function(prop) {
+ if (this.getter[prop]) {
+ return this.getter[prop].apply(this);
+ } else {
+ return this[prop] || 0;
+ }
+ },
+
+ setter: {
+ // ### rotate
+ //
+ // .css({ rotate: 30 })
+ // .css({ rotate: "30" })
+ // .css({ rotate: "30deg" })
+ // .css({ rotate: "30deg" })
+ //
+ rotate: function(theta) {
+ this.rotate = unit(theta, 'deg');
+ },
+
+ rotateX: function(theta) {
+ this.rotateX = unit(theta, 'deg');
+ },
+
+ rotateY: function(theta) {
+ this.rotateY = unit(theta, 'deg');
+ },
+
+ // ### scale
+ //
+ // .css({ scale: 9 }) //=> "scale(9,9)"
+ // .css({ scale: '3,2' }) //=> "scale(3,2)"
+ //
+ scale: function(x, y) {
+ if (y === undefined) { y = x; }
+ this.scale = x + "," + y;
+ },
+
+ // ### skewX + skewY
+ skewX: function(x) {
+ this.skewX = unit(x, 'deg');
+ },
+
+ skewY: function(y) {
+ this.skewY = unit(y, 'deg');
+ },
+
+ // ### perspectvie
+ perspective: function(dist) {
+ this.perspective = unit(dist, 'px');
+ },
+
+ // ### x / y
+ // Translations. Notice how this keeps the other value.
+ //
+ // .css({ x: 4 }) //=> "translate(4px, 0)"
+ // .css({ y: 10 }) //=> "translate(4px, 10px)"
+ //
+ x: function(x) {
+ this.set('translate', x, null);
+ },
+
+ y: function(y) {
+ this.set('translate', null, y);
+ },
+
+ // ### translate
+ // Notice how this keeps the other value.
+ //
+ // .css({ translate: '2, 5' }) //=> "translate(2px, 5px)"
+ //
+ translate: function(x, y) {
+ if (this._translateX === undefined) { this._translateX = 0; }
+ if (this._translateY === undefined) { this._translateY = 0; }
+
+ if (x !== null) { this._translateX = unit(x, 'px'); }
+ if (y !== null) { this._translateY = unit(y, 'px'); }
+
+ this.translate = this._translateX + "," + this._translateY;
+ }
+ },
+
+ getter: {
+ x: function() {
+ return this._translateX || 0;
+ },
+
+ y: function() {
+ return this._translateY || 0;
+ },
+
+ scale: function() {
+ var s = (this.scale || "1,1").split(',');
+ if (s[0]) { s[0] = parseFloat(s[0]); }
+ if (s[1]) { s[1] = parseFloat(s[1]); }
+
+ // "2.5,2.5" => 2.5
+ // "2.5,1" => [2.5,1]
+ return (s[0] === s[1]) ? s[0] : s;
+ },
+
+ rotate3d: function() {
+ var s = (this.rotate3d || "0,0,0,0deg").split(',');
+ for (var i=0; i<=3; ++i) {
+ if (s[i]) { s[i] = parseFloat(s[i]); }
+ }
+ if (s[3]) { s[3] = unit(s[3], 'deg'); }
+
+ return s;
+ }
+ },
+
+ // ### parse()
+ // Parses from a string. Called on constructor.
+ parse: function(str) {
+ var self = this;
+ str.replace(/([a-zA-Z0-9]+)\((.*?)\)/g, function(x, prop, val) {
+ self.setFromString(prop, val);
+ });
+ },
+
+ // ### toString()
+ // Converts to a `transition` CSS property string. If `use3d` is given,
+ // it converts to a `-webkit-transition` CSS property string instead.
+ toString: function(use3d) {
+ var re = [];
+
+ for (var i in this) {
+ if (this.hasOwnProperty(i)) {
+ // Don't use 3D transformations if the browser can't support it.
+ if ((!support.transform3d) && (
+ (i === 'rotateX') ||
+ (i === 'rotateY') ||
+ (i === 'perspective') ||
+ (i === 'transformOrigin'))) { continue; }
+
+ if (i[0] !== '_') {
+ if (use3d && (i === 'scale')) {
+ re.push(i + "3d(" + this[i] + ",1)");
+ } else if (use3d && (i === 'translate')) {
+ re.push(i + "3d(" + this[i] + ",0)");
+ } else {
+ re.push(i + "(" + this[i] + ")");
+ }
+ }
+ }
+ }
+
+ return re.join(" ");
+ }
+ };
+
+ function callOrQueue(self, queue, fn) {
+ if (queue === true) {
+ self.queue(fn);
+ } else if (queue) {
+ self.queue(queue, fn);
+ } else {
+ fn();
+ }
+ }
+
+ // ### getProperties(dict)
+ // Returns properties (for `transition-property`) for dictionary `props`. The
+ // value of `props` is what you would expect in `$.css(...)`.
+ function getProperties(props) {
+ var re = [];
+
+ $.each(props, function(key) {
+ key = $.camelCase(key); // Convert "text-align" => "textAlign"
+ key = $.transit.propertyMap[key] || key;
+ key = uncamel(key); // Convert back to dasherized
+
+ if ($.inArray(key, re) === -1) { re.push(key); }
+ });
+
+ return re;
+ }
+
+ // ### getTransition()
+ // Returns the transition string to be used for the `transition` CSS property.
+ //
+ // Example:
+ //
+ // getTransition({ opacity: 1, rotate: 30 }, 500, 'ease');
+ // //=> 'opacity 500ms ease, -webkit-transform 500ms ease'
+ //
+ function getTransition(properties, duration, easing, delay) {
+ // Get the CSS properties needed.
+ var props = getProperties(properties);
+
+ // Account for aliases (`in` => `ease-in`).
+ if ($.cssEase[easing]) { easing = $.cssEase[easing]; }
+
+ // Build the duration/easing/delay attributes for it.
+ var attribs = '' + toMS(duration) + ' ' + easing;
+ if (parseInt(delay, 10) > 0) { attribs += ' ' + toMS(delay); }
+
+ // For more properties, add them this way:
+ // "margin 200ms ease, padding 200ms ease, ..."
+ var transitions = [];
+ $.each(props, function(i, name) {
+ transitions.push(name + ' ' + attribs);
+ });
+
+ return transitions.join(', ');
+ }
+
+ // ## $.fn.transition
+ // Works like $.fn.animate(), but uses CSS transitions.
+ //
+ // $("...").transition({ opacity: 0.1, scale: 0.3 });
+ //
+ // // Specific duration
+ // $("...").transition({ opacity: 0.1, scale: 0.3 }, 500);
+ //
+ // // With duration and easing
+ // $("...").transition({ opacity: 0.1, scale: 0.3 }, 500, 'in');
+ //
+ // // With callback
+ // $("...").transition({ opacity: 0.1, scale: 0.3 }, function() { ... });
+ //
+ // // With everything
+ // $("...").transition({ opacity: 0.1, scale: 0.3 }, 500, 'in', function() { ... });
+ //
+ // // Alternate syntax
+ // $("...").transition({
+ // opacity: 0.1,
+ // duration: 200,
+ // delay: 40,
+ // easing: 'in',
+ // complete: function() { /* ... */ }
+ // });
+ //
+ $.fn.transition = $.fn.transit = function(properties, duration, easing, callback) {
+ var self = this;
+ var delay = 0;
+ var queue = true;
+
+ // Account for `.transition(properties, callback)`.
+ if (typeof duration === 'function') {
+ callback = duration;
+ duration = undefined;
+ }
+
+ // Account for `.transition(properties, duration, callback)`.
+ if (typeof easing === 'function') {
+ callback = easing;
+ easing = undefined;
+ }
+
+ // Alternate syntax.
+ if (typeof properties.easing !== 'undefined') {
+ easing = properties.easing;
+ delete properties.easing;
+ }
+
+ if (typeof properties.duration !== 'undefined') {
+ duration = properties.duration;
+ delete properties.duration;
+ }
+
+ if (typeof properties.complete !== 'undefined') {
+ callback = properties.complete;
+ delete properties.complete;
+ }
+
+ if (typeof properties.queue !== 'undefined') {
+ queue = properties.queue;
+ delete properties.queue;
+ }
+
+ if (typeof properties.delay !== 'undefined') {
+ delay = properties.delay;
+ delete properties.delay;
+ }
+
+ // Set defaults. (`400` duration, `ease` easing)
+ if (typeof duration === 'undefined') { duration = $.fx.speeds._default; }
+ if (typeof easing === 'undefined') { easing = $.cssEase._default; }
+
+ duration = toMS(duration);
+
+ // Build the `transition` property.
+ var transitionValue = getTransition(properties, duration, easing, delay);
+
+ // Compute delay until callback.
+ // If this becomes 0, don't bother setting the transition property.
+ var work = $.transit.enabled && support.transition;
+ var i = work ? (parseInt(duration, 10) + parseInt(delay, 10)) : 0;
+
+ // If there's nothing to do...
+ if (i === 0) {
+ var fn = function(next) {
+ self.css(properties);
+ if (callback) { callback.apply(self); }
+ if (next) { next(); }
+ };
+
+ callOrQueue(self, queue, fn);
+ return self;
+ }
+
+ // Save the old transitions of each element so we can restore it later.
+ var oldTransitions = {};
+
+ var run = function(nextCall) {
+ var bound = false;
+
+ // Prepare the callback.
+ var cb = function() {
+ if (bound) { self.unbind(transitionEnd, cb); }
+
+ if (i > 0) {
+ self.each(function() {
+ this.style[support.transition] = (oldTransitions[this] || null);
+ });
+ }
+
+ if (typeof callback === 'function') { callback.apply(self); }
+ if (typeof nextCall === 'function') { nextCall(); }
+ };
+
+ if ((i > 0) && (transitionEnd) && ($.transit.useTransitionEnd)) {
+ // Use the 'transitionend' event if it's available.
+ bound = true;
+ self.bind(transitionEnd, cb);
+ } else {
+ // Fallback to timers if the 'transitionend' event isn't supported.
+ window.setTimeout(cb, i);
+ }
+
+ // Apply transitions.
+ self.each(function() {
+ if (i > 0) {
+ this.style[support.transition] = transitionValue;
+ }
+ $(this).css(properties);
+ });
+ };
+
+ // Defer running. This allows the browser to paint any pending CSS it hasn't
+ // painted yet before doing the transitions.
+ var deferredRun = function(next) {
+ var i = 0;
+
+ // Durations that are too slow will get transitions mixed up.
+ // (Tested on Mac/FF 7.0.1)
+ if ((support.transition === 'MozTransition') && (i < 25)) { i = 25; }
+
+ window.setTimeout(function() { run(next); }, i);
+ };
+
+ // Use jQuery's fx queue.
+ callOrQueue(self, queue, deferredRun);
+
+ // Chainability.
+ return this;
+ };
+
+ function registerCssHook(prop, isPixels) {
+ // For certain properties, the 'px' should not be implied.
+ if (!isPixels) { $.cssNumber[prop] = true; }
+
+ $.transit.propertyMap[prop] = support.transform;
+
+ $.cssHooks[prop] = {
+ get: function(elem) {
+ var t = $(elem).css('transform') || new Transform();
+ return t.get(prop);
+ },
+
+ set: function(elem, value) {
+ var t = $(elem).css('transform');
+ t = (typeof t === 'string' || t === null) ? new Transform() : t;
+ t.setFromString(prop, value);
+ $(elem).css({ transform: t });
+ }
+ };
+ }
+
+ // ### uncamel(str)
+ // Converts a camelcase string to a dasherized string.
+ // (`marginLeft` => `margin-left`)
+ function uncamel(str) {
+ return str.replace(/([A-Z])/g, function(letter) { return '-' + letter.toLowerCase(); });
+ }
+
+ // ### unit(number, unit)
+ // Ensures that number `number` has a unit. If no unit is found, assume the
+ // default is `unit`.
+ //
+ // unit(2, 'px') //=> "2px"
+ // unit("30deg", 'rad') //=> "30deg"
+ //
+ function unit(i, units) {
+ if ((typeof i === "string") && (!i.match(/^[\-0-9\.]+$/))) {
+ return i;
+ } else {
+ return "" + i + units;
+ }
+ }
+
+ // ### toMS(duration)
+ // Converts given `duration` to a millisecond string.
+ //
+ // toMS('fast') //=> '400ms'
+ // toMS(10) //=> '10ms'
+ //
+ function toMS(duration) {
+ var i = duration;
+
+ // Allow for string durations like 'fast'.
+ if ($.fx.speeds[i]) { i = $.fx.speeds[i]; }
+
+ return unit(i, 'ms');
+ }
+
+ // Export some functions for testable-ness.
+ $.transit.getTransitionValue = getTransition;
+})(jQuery);
diff --git a/module/web/static/js/libs/jqueryui/accordion.js b/module/web/static/js/libs/jqueryui/accordion.js
new file mode 100644
index 000000000..b5a0a9dd0
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/accordion.js
@@ -0,0 +1,614 @@
+define(['jquery','./core','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Accordion 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.accordion", {
+ options: {
+ active: 0,
+ animated: "slide",
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() === location.href.toLowerCase();
+ }
+ },
+
+ _create: function() {
+ var self = this,
+ options = self.options;
+
+ self.running = 0;
+
+ self.element
+ .addClass( "ui-accordion ui-widget ui-helper-reset" )
+ // in lack of child-selectors in CSS
+ // we need to mark top-LIs in a UL-accordion for some IE-fix
+ .children( "li" )
+ .addClass( "ui-accordion-li-fix" );
+
+ self.headers = self.element.find( options.header )
+ .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
+ .bind( "mouseenter.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ })
+ .bind( "mouseleave.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .bind( "focus.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-focus" );
+ })
+ .bind( "blur.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ self.headers.next()
+ .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
+
+ if ( options.navigation ) {
+ var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
+ if ( current.length ) {
+ var header = current.closest( ".ui-accordion-header" );
+ if ( header.length ) {
+ // anchor within header
+ self.active = header;
+ } else {
+ // anchor within content
+ self.active = current.closest( ".ui-accordion-content" ).prev();
+ }
+ }
+ }
+
+ self.active = self._findActive( self.active || options.active )
+ .addClass( "ui-state-default ui-state-active" )
+ .toggleClass( "ui-corner-all" )
+ .toggleClass( "ui-corner-top" );
+ self.active.next().addClass( "ui-accordion-content-active" );
+
+ self._createIcons();
+ self.resize();
+
+ // ARIA
+ self.element.attr( "role", "tablist" );
+
+ self.headers
+ .attr( "role", "tab" )
+ .bind( "keydown.accordion", function( event ) {
+ return self._keydown( event );
+ })
+ .next()
+ .attr( "role", "tabpanel" );
+
+ self.headers
+ .not( self.active || "" )
+ .attr({
+ "aria-expanded": "false",
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if ( !self.active.length ) {
+ self.headers.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ self.active
+ .attr({
+ "aria-expanded": "true",
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ }
+
+ // only need links in tab order for Safari
+ if ( !$.browser.safari ) {
+ self.headers.find( "a" ).attr( "tabIndex", -1 );
+ }
+
+ if ( options.event ) {
+ self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
+ self._clickHandler.call( self, event, this );
+ event.preventDefault();
+ });
+ }
+ },
+
+ _createIcons: function() {
+ var options = this.options;
+ if ( options.icons ) {
+ $( "<span></span>" )
+ .addClass( "ui-icon " + options.icons.header )
+ .prependTo( this.headers );
+ this.active.children( ".ui-icon" )
+ .toggleClass(options.icons.header)
+ .toggleClass(options.icons.headerSelected);
+ this.element.addClass( "ui-accordion-icons" );
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children( ".ui-icon" ).remove();
+ this.element.removeClass( "ui-accordion-icons" );
+ },
+
+ destroy: function() {
+ var options = this.options;
+
+ this.element
+ .removeClass( "ui-accordion ui-widget ui-helper-reset" )
+ .removeAttr( "role" );
+
+ this.headers
+ .unbind( ".accordion" )
+ .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-selected" )
+ .removeAttr( "tabIndex" );
+
+ this.headers.find( "a" ).removeAttr( "tabIndex" );
+ this._destroyIcons();
+ var contents = this.headers.next()
+ .css( "display", "" )
+ .removeAttr( "role" )
+ .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
+ if ( options.autoHeight || options.fillHeight ) {
+ contents.css( "height", "" );
+ }
+
+ return $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ if ( key == "active" ) {
+ this.activate( value );
+ }
+ if ( key == "icons" ) {
+ this._destroyIcons();
+ if ( value ) {
+ this._createIcons();
+ }
+ }
+ // #5332 - opacity doesn't cascade to positioned elements in IE
+ // so we need to add the disabled class to the headers and panels
+ if ( key == "disabled" ) {
+ this.headers.add(this.headers.next())
+ [ value ? "addClass" : "removeClass" ](
+ "ui-accordion-disabled ui-state-disabled" );
+ }
+ },
+
+ _keydown: function( event ) {
+ if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+ return;
+ }
+
+ var keyCode = $.ui.keyCode,
+ length = this.headers.length,
+ currentIndex = this.headers.index( event.target ),
+ toFocus = false;
+
+ switch ( event.keyCode ) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler( { target: event.target }, event.target );
+ event.preventDefault();
+ }
+
+ if ( toFocus ) {
+ $( event.target ).attr( "tabIndex", -1 );
+ $( toFocus ).attr( "tabIndex", 0 );
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+ },
+
+ resize: function() {
+ var options = this.options,
+ maxHeight;
+
+ if ( options.fillSpace ) {
+ if ( $.browser.msie ) {
+ var defOverflow = this.element.parent().css( "overflow" );
+ this.element.parent().css( "overflow", "hidden");
+ }
+ maxHeight = this.element.parent().height();
+ if ($.browser.msie) {
+ this.element.parent().css( "overflow", defOverflow );
+ }
+
+ this.headers.each(function() {
+ maxHeight -= $( this ).outerHeight( true );
+ });
+
+ this.headers.next()
+ .each(function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ })
+ .css( "overflow", "auto" );
+ } else if ( options.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next()
+ .each(function() {
+ maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ })
+ .height( maxHeight );
+ }
+
+ return this;
+ },
+
+ activate: function( index ) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive( index )[ 0 ];
+ this._clickHandler( { target: active }, active );
+
+ return this;
+ },
+
+ _findActive: function( selector ) {
+ return selector
+ ? typeof selector === "number"
+ ? this.headers.filter( ":eq(" + selector + ")" )
+ : this.headers.not( this.headers.not( selector ) )
+ : selector === false
+ ? $( [] )
+ : this.headers.filter( ":eq(0)" );
+ },
+
+ // TODO isn't event.target enough? why the separate target argument?
+ _clickHandler: function( event, target ) {
+ var options = this.options;
+ if ( options.disabled ) {
+ return;
+ }
+
+ // called only when using activate(false) to close all parts programmatically
+ if ( !event.target ) {
+ if ( !options.collapsible ) {
+ return;
+ }
+ this.active
+ .removeClass( "ui-state-active ui-corner-top" )
+ .addClass( "ui-state-default ui-corner-all" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.headerSelected )
+ .addClass( options.icons.header );
+ this.active.next().addClass( "ui-accordion-content-active" );
+ var toHide = this.active.next(),
+ data = {
+ options: options,
+ newHeader: $( [] ),
+ oldHeader: options.active,
+ newContent: $( [] ),
+ oldContent: toHide
+ },
+ toShow = ( this.active = $( [] ) );
+ this._toggle( toShow, toHide, data );
+ return;
+ }
+
+ // get the click target
+ var clicked = $( event.currentTarget || target ),
+ clickedIsActive = clicked[0] === this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ options.active = options.collapsible && clickedIsActive ?
+ false :
+ this.headers.index( clicked );
+
+ // if animations are still active, or the active header is the target, ignore click
+ if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+ return;
+ }
+
+ // find elements to show and hide
+ var active = this.active,
+ toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: options,
+ newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ // when the call to ._toggle() comes after the class changes
+ // it causes a very odd bug in IE 8 (see #6720)
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle( toShow, toHide, data, clickedIsActive, down );
+
+ // switch classes
+ active
+ .removeClass( "ui-state-active ui-corner-top" )
+ .addClass( "ui-state-default ui-corner-all" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.headerSelected )
+ .addClass( options.icons.header );
+ if ( !clickedIsActive ) {
+ clicked
+ .removeClass( "ui-state-default ui-corner-all" )
+ .addClass( "ui-state-active ui-corner-top" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.header )
+ .addClass( options.icons.headerSelected );
+ clicked
+ .next()
+ .addClass( "ui-accordion-content-active" );
+ }
+
+ return;
+ },
+
+ _toggle: function( toShow, toHide, data, clickedIsActive, down ) {
+ var self = this,
+ options = self.options;
+
+ self.toShow = toShow;
+ self.toHide = toHide;
+ self.data = data;
+
+ var complete = function() {
+ if ( !self ) {
+ return;
+ }
+ return self._completed.apply( self, arguments );
+ };
+
+ // trigger changestart event
+ self._trigger( "changestart", null, self.data );
+
+ // count elements to animate
+ self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if ( options.animated ) {
+ var animOptions = {};
+
+ if ( options.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $( [] ),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: options.autoHeight || options.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: options.autoHeight || options.fillSpace
+ };
+ }
+
+ if ( !options.proxied ) {
+ options.proxied = options.animated;
+ }
+
+ if ( !options.proxiedDuration ) {
+ options.proxiedDuration = options.duration;
+ }
+
+ options.animated = $.isFunction( options.proxied ) ?
+ options.proxied( animOptions ) :
+ options.proxied;
+
+ options.duration = $.isFunction( options.proxiedDuration ) ?
+ options.proxiedDuration( animOptions ) :
+ options.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = options.duration,
+ easing = options.animated;
+
+ if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
+ easing = "slide";
+ }
+ if ( !animations[ easing ] ) {
+ animations[ easing ] = function( options ) {
+ this.slide( options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[ easing ]( animOptions );
+ } else {
+ if ( options.collapsible && clickedIsActive ) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete( true );
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev()
+ .attr({
+ "aria-expanded": "false",
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .blur();
+ toShow.prev()
+ .attr({
+ "aria-expanded": "true",
+ "aria-selected": "true",
+ tabIndex: 0
+ })
+ .focus();
+ },
+
+ _completed: function( cancel ) {
+ this.running = cancel ? 0 : --this.running;
+ if ( this.running ) {
+ return;
+ }
+
+ if ( this.options.clearStyle ) {
+ this.toShow.add( this.toHide ).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass( "ui-accordion-content-active" );
+ // Work around for rendering bug in IE (#5421)
+ if ( this.toHide.length ) {
+ this.toHide.parent()[0].className = this.toHide.parent()[0].className;
+ }
+
+ this._trigger( "change", null, this.data );
+ }
+});
+
+$.extend( $.ui.accordion, {
+ version: "1.8.23",
+ animations: {
+ slide: function( options, additions ) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions );
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({
+ height: "show",
+ paddingTop: "show",
+ paddingBottom: "show"
+ }, options );
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({
+ height: "hide",
+ paddingTop: "hide",
+ paddingBottom: "hide"
+ }, options );
+ return;
+ }
+ var overflow = options.toShow.css( "overflow" ),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( s.parent().width()
+ - parseFloat( s.css( "paddingLeft" ) )
+ - parseFloat( s.css( "paddingRight" ) )
+ - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 )
+ - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) );
+
+ $.each( fxAttrs, function( i, prop ) {
+ hideProps[ prop ] = "hide";
+
+ var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
+ showProps[ prop ] = {
+ value: parts[ 1 ],
+ unit: parts[ 2 ] || "px"
+ };
+ });
+ options.toShow.css({ height: 0, overflow: "hidden" }).show();
+ options.toHide
+ .filter( ":hidden" )
+ .each( options.complete )
+ .end()
+ .filter( ":visible" )
+ .animate( hideProps, {
+ step: function( now, settings ) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if ( settings.prop == "height" ) {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ ( settings.now - settings.start ) / ( settings.end - settings.start );
+ }
+
+ options.toShow[ 0 ].style[ settings.prop ] =
+ ( percentDone * showProps[ settings.prop ].value )
+ + showProps[ settings.prop ].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css( "height", "" );
+ }
+ options.toShow.css({
+ width: originalWidth,
+ overflow: overflow
+ });
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function( options ) {
+ this.slide( options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+
+})( jQuery );
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/autocomplete.js b/module/web/static/js/libs/jqueryui/autocomplete.js
new file mode 100644
index 000000000..dd6bf1119
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/autocomplete.js
@@ -0,0 +1,634 @@
+define(['jquery','./core','./widget','./position'], function (jQuery) {
+/*!
+ * jQuery UI Autocomplete 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+ options: {
+ appendTo: "body",
+ autoFocus: false,
+ delay: 300,
+ minLength: 1,
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ source: null
+ },
+
+ pending: 0,
+
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument,
+ suppressKeyPress;
+ this.isMultiLine = this.element.is( "textarea" );
+
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) {
+ return;
+ }
+
+ suppressKeyPress = false;
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._keyEvent( "previous", event );
+ break;
+ case keyCode.DOWN:
+ self._keyEvent( "next", event );
+ break;
+ case keyCode.ENTER:
+ case keyCode.NUMPAD_ENTER:
+ // when menu is open and has focus
+ if ( self.menu.active ) {
+ // #6055 - Opera still allows the keypress to occur
+ // which causes forms to submit
+ suppressKeyPress = true;
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select( event );
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ // only search if the value has changed
+ if ( self.term != self.element.val() ) {
+ self.selectedItem = null;
+ self.search( null, event );
+ }
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "keypress.autocomplete", function( event ) {
+ if ( suppressKeyPress ) {
+ suppressKeyPress = false;
+ event.preventDefault();
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ self.selectedItem = null;
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ self.closing = setTimeout(function() {
+ self.close( event );
+ self._change( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( $( this.options.appendTo || "body", doc )[0] )
+ // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
+ .mousedown(function( event ) {
+ // clicking on the scrollbar causes focus to shift to the body
+ // but we can't detect a mouseup or a click immediately afterward
+ // so we have to track the next mousedown and close the menu if
+ // the user clicks somewhere outside of the autocomplete
+ var menuElement = self.menu.element[ 0 ];
+ if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+ setTimeout(function() {
+ $( document ).one( 'mousedown', function( event ) {
+ if ( event.target !== self.element[ 0 ] &&
+ event.target !== menuElement &&
+ !$.ui.contains( menuElement, event.target ) ) {
+ self.close();
+ }
+ });
+ }, 1 );
+ }
+
+ // use another timeout to make sure the blur-event-handler on the input was already triggered
+ setTimeout(function() {
+ clearTimeout( self.closing );
+ }, 13);
+ })
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", event, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( /^key/.test(event.originalEvent.type) ) {
+ self.element.val( item.value );
+ }
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" ),
+ previous = self.previous;
+
+ // only trigger when focus was lost (click on menu)
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ self.previous = previous;
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ setTimeout(function() {
+ self.previous = previous;
+ self.selectedItem = item;
+ }, 1);
+ }
+
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ self.term = self.element.val();
+
+ self.close( event );
+ self.selectedItem = item;
+ },
+ blur: function( event, ui ) {
+ // don't set the value of the text field if it's already correct
+ // this prevents moving the cursor unnecessarily
+ if ( self.menu.element.is(":visible") &&
+ ( self.element.val() !== self.term ) ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ self.beforeunloadHandler = function() {
+ self.element.removeAttr( "autocomplete" );
+ };
+ $( window ).bind( "beforeunload", self.beforeunloadHandler );
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $( window ).unbind( "beforeunload", this.beforeunloadHandler );
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ if ( key === "appendTo" ) {
+ this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+ }
+ if ( key === "disabled" && value && this.xhr ) {
+ this.xhr.abort();
+ }
+ },
+
+ _initSource: function() {
+ var self = this,
+ array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter(array, request.term) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ if ( self.xhr ) {
+ self.xhr.abort();
+ }
+ self.xhr = $.ajax({
+ url: url,
+ data: request,
+ dataType: "json",
+ success: function( data, status ) {
+ response( data );
+ },
+ error: function() {
+ response( [] );
+ }
+ });
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+
+ // always save the actual value, not the one passed as an argument
+ this.term = this.element.val();
+
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger( "search", event ) === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.pending++;
+ this.element.addClass( "ui-autocomplete-loading" );
+
+ this.source( { term: value }, this._response() );
+ },
+
+ _response: function() {
+ var that = this,
+ index = ++requestIndex;
+
+ return function( content ) {
+ if ( index === requestIndex ) {
+ that.__response( content );
+ }
+
+ that.pending--;
+ if ( !that.pending ) {
+ that.element.removeClass( "ui-autocomplete-loading" );
+ }
+ };
+ },
+
+ __response: function( content ) {
+ if ( !this.options.disabled && content && content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ },
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this.menu.element.hide();
+ this.menu.deactivate();
+ this._trigger( "close", event );
+ }
+ },
+
+ _change: function( event ) {
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 );
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+
+ // size and position menu
+ ul.show();
+ this._resizeMenu();
+ ul.position( $.extend({
+ of: this.element
+ }, this.options.position ));
+
+ if ( this.options.autoFocus ) {
+ this.menu.next( new $.Event("mouseover") );
+ }
+ },
+
+ _resizeMenu: function() {
+ var ul = this.menu.element;
+ ul.outerWidth( Math.max(
+ // Firefox wraps long text (possibly a rounding bug)
+ // so we add 1px to avoid the wrapping (#7513)
+ ul.width( "" ).outerWidth() + 1,
+ this.element.outerWidth()
+ ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
+ },
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( $( "<a></a>" ).text( item.label ) )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
+ }
+ this.menu[ direction ]( event );
+ },
+
+ widget: function() {
+ return this.menu.element;
+ },
+ _keyEvent: function( keyEvent, event ) {
+ if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+ this._move( keyEvent, event );
+
+ // prevents moving cursor to beginning/end of the text field in some browsers
+ event.preventDefault();
+ }
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+ return;
+ }
+ // temporary
+ event.preventDefault();
+ self.select( event );
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
+
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function( event ) {
+ self.activate( event, $(this).parent() );
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
+
+ activate: function( event, item ) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.scrollTop(),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.scrollTop( scroll + offset);
+ } else if (offset >= elementHeight) {
+ this.element.scrollTop( scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", event, { item: item });
+ },
+
+ deactivate: function() {
+ if (!this.active) { return; }
+
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
+
+ next: function(event) {
+ this.move("next", ".ui-menu-item:first", event);
+ },
+
+ previous: function(event) {
+ this.move("prev", ".ui-menu-item:last", event);
+ },
+
+ first: function() {
+ return this.active && !this.active.prevAll(".ui-menu-item").length;
+ },
+
+ last: function() {
+ return this.active && !this.active.nextAll(".ui-menu-item").length;
+ },
+
+ move: function(direction, edge, event) {
+ if (!this.active) {
+ this.activate(event, this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+ if (next.length) {
+ this.activate(event, next);
+ } else {
+ this.activate(event, this.element.children(edge));
+ }
+ },
+
+ // TODO merge with previousPage
+ nextPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(event, this.element.children(".ui-menu-item:first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children(".ui-menu-item").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(".ui-menu-item:last");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(".ui-menu-item")
+ .filter(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
+
+ // TODO merge with nextPage
+ previousPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(event, this.element.children(".ui-menu-item:last"));
+ return;
+ }
+
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children(".ui-menu-item").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(".ui-menu-item:first");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(".ui-menu-item")
+ .filter(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
+
+ hasScroll: function() {
+ return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
+ },
+
+ select: function( event ) {
+ this._trigger("selected", event, { item: this.active });
+ }
+});
+
+}(jQuery));
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/button.js b/module/web/static/js/libs/jqueryui/button.js
new file mode 100644
index 000000000..efc824f71
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/button.js
@@ -0,0 +1,417 @@
+define(['jquery','./core','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Button 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var lastActive, startXPos, startYPos, clickDragged,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ stateClasses = "ui-state-hover ui-state-active ",
+ typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+ formResetHandler = function() {
+ var buttons = $( this ).find( ":ui-button" );
+ setTimeout(function() {
+ buttons.button( "refresh" );
+ }, 1 );
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ options: {
+ disabled: null,
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
+
+ if ( typeof this.options.disabled !== "boolean" ) {
+ this.options.disabled = !!this.element.propAttr( "disabled" );
+ } else {
+ this.element.propAttr( "disabled", this.options.disabled );
+ }
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "click.button", function( event ) {
+ if ( options.disabled ) {
+ event.preventDefault();
+ event.stopImmediatePropagation();
+ }
+ });
+
+ this.element
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ self.buttonElement.addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ self.buttonElement.removeClass( focusClass );
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ if ( clickDragged ) {
+ return;
+ }
+ self.refresh();
+ });
+ // if mouse moves between mousedown and mouseup (drag) set clickDragged flag
+ // prevents issue where button state changes but checkbox/radio checked state
+ // does not in Firefox (see ticket #6970)
+ this.buttonElement
+ .bind( "mousedown.button", function( event ) {
+ if ( options.disabled ) {
+ return;
+ }
+ clickDragged = false;
+ startXPos = event.pageX;
+ startYPos = event.pageY;
+ })
+ .bind( "mouseup.button", function( event ) {
+ if ( options.disabled ) {
+ return;
+ }
+ if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
+ clickDragged = true;
+ }
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled || clickDragged ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled || clickDragged ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", "true" );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", "false" );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ this._resetButton();
+ },
+
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ var ancestor = this.element.parents().filter(":last"),
+ labelSelector = "label[for='" + this.element.attr("id") + "']";
+ this.buttonElement = ancestor.find( labelSelector );
+ if ( !this.buttonElement.length ) {
+ ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+ this.buttonElement = ancestor.filter( labelSelector );
+ if ( !this.buttonElement.length ) {
+ this.buttonElement = ancestor.find( labelSelector );
+ }
+ }
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.propAttr( "disabled", true );
+ } else {
+ this.element.propAttr( "disabled", false );
+ }
+ return;
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", "true" );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", "false" );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", "true" );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", "false" );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement.removeClass( typeClasses ),
+ buttonText = $( "<span></span>", this.element[0].ownerDocument )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary,
+ buttonClasses = [];
+
+ if ( icons.primary || icons.secondary ) {
+ if ( this.options.text ) {
+ buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+ }
+
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+
+ if ( !this.options.text ) {
+ buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonClasses.push( "ui-button-text-only" );
+ }
+ buttonElement.addClass( buttonClasses.join( " " ) );
+ }
+});
+
+$.widget( "ui.buttonset", {
+ options: {
+ items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+ },
+
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ var rtl = this.element.css( "direction" ) === "rtl";
+
+ this.buttons = this.element.find( this.options.items )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
+ .end()
+ .end();
+ },
+
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" );
+
+ $.Widget.prototype.destroy.call( this );
+ }
+});
+
+}( jQuery ) );
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/core.js b/module/web/static/js/libs/jqueryui/core.js
new file mode 100644
index 000000000..771316b5a
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/core.js
@@ -0,0 +1,337 @@
+define(['jquery'], function (jQuery) {
+/*!
+ * jQuery UI 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function( $, undefined ) {
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+ return;
+}
+
+$.extend( $.ui, {
+ version: "1.8.23",
+
+ keyCode: {
+ ALT: 18,
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ COMMAND: 91,
+ COMMAND_LEFT: 91, // COMMAND
+ COMMAND_RIGHT: 93,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ MENU: 93, // COMMAND_RIGHT
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38,
+ WINDOWS: 91 // COMMAND
+ }
+});
+
+// plugins
+$.fn.extend({
+ propAttr: $.fn.prop || $.fn.attr,
+
+ _focus: $.fn.focus,
+ focus: function( delay, fn ) {
+ return typeof delay === "number" ?
+ this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $( elem ).focus();
+ if ( fn ) {
+ fn.call( elem );
+ }
+ }, delay );
+ }) :
+ this._focus.apply( this, arguments );
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function( zIndex ) {
+ if ( zIndex !== undefined ) {
+ return this.css( "zIndex", zIndex );
+ }
+
+ if ( this.length ) {
+ var elem = $( this[ 0 ] ), position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ },
+
+ disableSelection: function() {
+ return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+ ".ui-disableSelection", function( event ) {
+ event.preventDefault();
+ });
+ },
+
+ enableSelection: function() {
+ return this.unbind( ".ui-disableSelection" );
+ }
+});
+
+// support: jQuery <1.8
+if ( !$( "<a>" ).outerWidth( 1 ).jquery ) {
+ $.each( [ "Width", "Height" ], function( i, name ) {
+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
+
+ function reduce( elem, size, border, margin ) {
+ $.each( side, function() {
+ size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
+ if ( border ) {
+ size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
+ }
+ if ( margin ) {
+ size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
+ }
+ });
+ return size;
+ }
+
+ $.fn[ "inner" + name ] = function( size ) {
+ if ( size === undefined ) {
+ return orig[ "inner" + name ].call( this );
+ }
+
+ return this.each(function() {
+ $( this ).css( type, reduce( this, size ) + "px" );
+ });
+ };
+
+ $.fn[ "outer" + name] = function( size, margin ) {
+ if ( typeof size !== "number" ) {
+ return orig[ "outer" + name ].call( this, size );
+ }
+
+ return this.each(function() {
+ $( this).css( type, reduce( this, size, true, margin ) + "px" );
+ });
+ };
+ });
+}
+
+// selectors
+function focusable( element, isTabIndexNotNaN ) {
+ var nodeName = element.nodeName.toLowerCase();
+ if ( "area" === nodeName ) {
+ var map = element.parentNode,
+ mapName = map.name,
+ img;
+ if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+ return false;
+ }
+ img = $( "img[usemap=#" + mapName + "]" )[0];
+ return !!img && visible( img );
+ }
+ return ( /input|select|textarea|button|object/.test( nodeName )
+ ? !element.disabled
+ : "a" == nodeName
+ ? element.href || isTabIndexNotNaN
+ : isTabIndexNotNaN)
+ // the element and all of its ancestors must be visible
+ && visible( element );
+}
+
+function visible( element ) {
+ return !$( element ).parents().andSelf().filter(function() {
+ return $.curCSS( this, "visibility" ) === "hidden" ||
+ $.expr.filters.hidden( this );
+ }).length;
+}
+
+$.extend( $.expr[ ":" ], {
+ data: $.expr.createPseudo ?
+ $.expr.createPseudo(function( dataName ) {
+ return function( elem ) {
+ return !!$.data( elem, dataName );
+ };
+ }) :
+ // support: jQuery <1.8
+ function( elem, i, match ) {
+ return !!$.data( elem, match[ 3 ] );
+ },
+
+ focusable: function( element ) {
+ return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
+ },
+
+ tabbable: function( element ) {
+ var tabIndex = $.attr( element, "tabindex" ),
+ isTabIndexNaN = isNaN( tabIndex );
+ return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
+ }
+});
+
+// support
+$(function() {
+ var body = document.body,
+ div = body.appendChild( div = document.createElement( "div" ) );
+
+ // access offsetHeight before setting the style to prevent a layout bug
+ // in IE 9 which causes the elemnt to continue to take up space even
+ // after it is removed from the DOM (#8026)
+ div.offsetHeight;
+
+ $.extend( div.style, {
+ minHeight: "100px",
+ height: "auto",
+ padding: 0,
+ borderWidth: 0
+ });
+
+ $.support.minHeight = div.offsetHeight === 100;
+ $.support.selectstart = "onselectstart" in div;
+
+ // set display to none to avoid a layout bug in IE
+ // http://dev.jquery.com/ticket/4014
+ body.removeChild( div ).style.display = "none";
+});
+
+// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css
+if ( !$.curCSS ) {
+ $.curCSS = $.css;
+}
+
+
+
+
+
+// deprecated
+$.extend( $.ui, {
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function( module, option, set ) {
+ var proto = $.ui[ module ].prototype;
+ for ( var i in set ) {
+ proto.plugins[ i ] = proto.plugins[ i ] || [];
+ proto.plugins[ i ].push( [ option, set[ i ] ] );
+ }
+ },
+ call: function( instance, name, args ) {
+ var set = instance.plugins[ name ];
+ if ( !set || !instance.element[ 0 ].parentNode ) {
+ return;
+ }
+
+ for ( var i = 0; i < set.length; i++ ) {
+ if ( instance.options[ set[ i ][ 0 ] ] ) {
+ set[ i ][ 1 ].apply( instance.element, args );
+ }
+ }
+ }
+ },
+
+ // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
+ contains: function( a, b ) {
+ return document.compareDocumentPosition ?
+ a.compareDocumentPosition( b ) & 16 :
+ a !== b && a.contains( b );
+ },
+
+ // only used by resizable
+ hasScroll: function( el, a ) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ( $( el ).css( "overflow" ) === "hidden") {
+ return false;
+ }
+
+ var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+ has = false;
+
+ if ( el[ scroll ] > 0 ) {
+ return true;
+ }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[ scroll ] = 1;
+ has = ( el[ scroll ] > 0 );
+ el[ scroll ] = 0;
+ return has;
+ },
+
+ // these are odd functions, fix the API or move into individual plugins
+ isOverAxis: function( x, reference, size ) {
+ //Determines when x coordinate is over "b" element axis
+ return ( x > reference ) && ( x < ( reference + size ) );
+ },
+ isOver: function( y, x, top, left, height, width ) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+ }
+});
+
+})( jQuery );
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/datepicker.js b/module/web/static/js/libs/jqueryui/datepicker.js
new file mode 100644
index 000000000..331cbd60e
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/datepicker.js
@@ -0,0 +1,1857 @@
+define(['jquery','./core'], function (jQuery) {
+/*!
+ * jQuery UI Datepicker 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function( $, undefined ) {
+
+$.extend($.ui, { datepicker: { version: "1.8.23" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+var instActive;
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'fadeIn', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'fast', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false, // True to size the input for the date format, false to leave as is
+ disabled: false // The initial disabled state
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'));
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ //Keep track of the maximum number of rows displayed (see #7043)
+ maxRows: 4,
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = 'dp' + this.uuid;
+ }
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
+ if( inst.settings.disabled ) {
+ this._disableDatepicker( target );
+ }
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) {
+ $.datepicker._hideDatepicker();
+ $.datepicker._showDatepicker(input[0]);
+ } else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+ }
+ inst.input.attr('size', this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
+ if( inst.settings.disabled ) {
+ this._disableDatepicker( target );
+ }
+ // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
+ // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
+ inst.dpDiv.css( "display", "block" );
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ this.uuid += 1;
+ var id = 'dp' + this.uuid;
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ removeAttr("disabled");
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ attr("disabled", "disabled");
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ extendRemove(inst.settings, settings);
+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+ if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined)
+ inst.settings.minDate = this._formatDate(inst, minDate);
+ if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined)
+ inst.settings.maxDate = this._formatDate(inst, maxDate);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDate(inst, date);
+ this._updateAlternate(inst);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
+ $.datepicker._currentClass + ')', inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ var onSelect = $.datepicker._get(inst, 'onSelect');
+ if (onSelect) {
+ var dateStr = $.datepicker._formatDate(inst);
+
+ // trigger custom callback
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
+ }
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (err) {
+ $.datepicker.log(err);
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ If false returned from beforeShow event handler do not show.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ if ( inst && $.datepicker._datepickerShowing ) {
+ $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] );
+ }
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
+ if(beforeShowSettings === false){
+ //false
+ return;
+ }
+ extendRemove(inst.settings, beforeShowSettings);
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ //to avoid flashes on Firefox
+ inst.dpDiv.empty();
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
+ if( !! cover.length ){
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ cover.css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ }
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ $.datepicker._datepickerShowing = true;
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ self.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ instActive = inst; // for delegate hover events
+ inst.dpDiv.empty().append(this._generateHTML(inst));
+ this._attachHandlers(inst);
+ var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
+ if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6
+ cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ }
+ inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ // #6694 - don't focus the input if it's already focused
+ // this breaks the change event in IE
+ inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement)
+ inst.input.focus();
+ // deffered render of the years select (to avoid flashes on Firefox)
+ if( inst.yearshtml ){
+ var origyearshtml = inst.yearshtml;
+ setTimeout(function(){
+ //assure that inst.yearshtml didn't change.
+ if( origyearshtml === inst.yearshtml && inst.yearshtml ){
+ inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml);
+ }
+ origyearshtml = inst.yearshtml = null;
+ }, 0);
+ }
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft());
+ var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ this._datepickerShowing = false;
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]);
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+
+ var $target = $(event.target),
+ inst = $.datepicker._getInst($target[0]);
+
+ if ( ( ( $target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.closest("." + $.datepicker._triggerClass).length &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) ||
+ ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) )
+ $.datepicker._hideDatepicker();
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ var isDoubled = lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
+ return [ [k, v] ];
+ }).sort(function (a, b) {
+ return -(a[1].length - b[1].length);
+ });
+ var index = -1;
+ $.each(names, function (i, pair) {
+ var name = pair[1];
+ if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) {
+ index = pair[0];
+ iValue += name.length;
+ return false;
+ }
+ });
+ if (index != -1)
+ return index + 1;
+ else
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (iValue < value.length){
+ throw "Extra/unparsed characters found in date: " + value.substring(iValue);
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/00
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
+ newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate);
+ if (newDate) {
+ newDate.setHours(0);
+ newDate.setMinutes(0);
+ newDate.setSeconds(0);
+ newDate.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(newDate);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !date;
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = newDate.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Attach the onxxx handlers. These are declared statically so
+ * they work with static code transformers like Caja.
+ */
+ _attachHandlers: function(inst) {
+ var stepMonths = this._get(inst, 'stepMonths');
+ var id = '#' + inst.id.replace( /\\\\/g, "\\" );
+ inst.dpDiv.find('[data-handler]').map(function () {
+ var handler = {
+ prev: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M');
+ },
+ next: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M');
+ },
+ hide: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker();
+ },
+ today: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id);
+ },
+ selectDay: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this);
+ return false;
+ },
+ selectMonth: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M');
+ return false;
+ },
+ selectYear: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y');
+ return false;
+ }
+ };
+ $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]);
+ });
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" data-handler="prev" data-event="click"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" data-handler="next" data-event="click"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" data-handler="hide" data-event="click">' +
+ this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" data-handler="today" data-event="click"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ this.maxRows = 4;
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
+ var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
+ this.maxRows = numRows;
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' data-handler="selectDay" data-event="click" data-month="' + printDate.getMonth() + '" data-year="' + printDate.getFullYear() + '"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? '&#xa0;' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" data-handler="selectMonth" data-event="change">';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? '&#xa0;' : '');
+ // year selection
+ if ( !inst.yearshtml ) {
+ inst.yearshtml = '';
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ inst.yearshtml += '<select class="ui-datepicker-year" data-handler="selectYear" data-event="change">';
+ for (; year <= endYear; year++) {
+ inst.yearshtml += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ inst.yearshtml += '</select>';
+
+ html += inst.yearshtml;
+ inst.yearshtml = null;
+ }
+ }
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? '&#xa0;' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var newDate = (minDate && date < minDate ? minDate : date);
+ newDate = (maxDate && newDate > maxDate ? maxDate : newDate);
+ return newDate;
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function bindHover(dpDiv) {
+ var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a';
+ return dpDiv.bind('mouseout', function(event) {
+ var elem = $( event.target ).closest( selector );
+ if ( !elem.length ) {
+ return;
+ }
+ elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" );
+ })
+ .bind('mouseover', function(event) {
+ var elem = $( event.target ).closest( selector );
+ if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) ||
+ !elem.length ) {
+ return;
+ }
+ elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ elem.addClass('ui-state-hover');
+ if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover');
+ if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover');
+ });
+}
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Verify an empty collection wasn't passed - Fixes #6976 */
+ if ( !this.length ) {
+ return this;
+ }
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8.23";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/dialog.js b/module/web/static/js/libs/jqueryui/dialog.js
new file mode 100644
index 000000000..87e91c0a4
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/dialog.js
@@ -0,0 +1,869 @@
+define(['jquery','./core','./widget','./button','./draggable','./mouse','./position','./resizable'], function (jQuery) {
+/*!
+ * jQuery UI Dialog 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function( $, undefined ) {
+
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ',
+ sizeRelatedOptions = {
+ buttons: true,
+ height: true,
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true,
+ width: true
+ },
+ resizableRelatedOptions = {
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true
+ };
+
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: {
+ my: 'center',
+ at: 'center',
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
+ },
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
+ // #5742 - .attr() might return a DOMElement
+ if ( typeof this.originalTitle !== "string" ) {
+ this.originalTitle = "";
+ }
+
+ this.options.title = this.options.title || this.originalTitle;
+ var self = this,
+ options = self.options,
+
+ title = options.title || '&#160;',
+ titleId = $.ui.dialog.getTitleId(self.element),
+
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
+
+ self._createButtons(options.buttons);
+ self._isOpen = false;
+
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
+
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
+
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ close: function(event) {
+ var self = this,
+ maxZ, thisZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ self._isOpen = false;
+
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
+
+ $.ui.dialog.overlay.resize();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ thisZ = $(this).css('z-index');
+ if(!isNaN(thisZ)) {
+ maxZ = Math.max(maxZ, thisZ);
+ }
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ }
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
+
+ return self;
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
+
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ if ( options.modal ) {
+ uiDialog.bind( "keydown.ui-dialog", function( event ) {
+ if ( event.keyCode !== $.ui.keyCode.TAB ) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $(self.element.find(':tabbable').get().concat(
+ uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
+ uiDialog.get()))).eq(0).focus();
+
+ self._isOpen = true;
+ self._trigger('open');
+
+ return self;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ ),
+ uiButtonSet = $( "<div></div>" )
+ .addClass( "ui-dialog-buttonset" )
+ .appendTo( uiDialogButtonPane );
+
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, props) {
+ props = $.isFunction( props ) ?
+ { click: props, text: name } :
+ props;
+ var button = $('<button type="button"></button>')
+ .click(function() {
+ props.click.apply(self.element[0], arguments);
+ })
+ .appendTo(uiButtonSet);
+ // can't use .attr( props, true ) with jQuery 1.3.2.
+ $.each( props, function( key, value ) {
+ if ( key === "click" ) {
+ return;
+ }
+ if ( key in button ) {
+ button[ key ]( value );
+ } else {
+ button.attr( key, value );
+ }
+ });
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
+
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
+
+ if (position) {
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+ // if (typeof position == 'string' || $.isArray(position)) {
+ // myAt = $.isArray(position) ? position : position.split(' ');
+
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+
+ position = {
+ my: myAt.join(" "),
+ at: myAt.join(" "),
+ offset: offset.join(" ")
+ };
+ }
+
+ position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+ } else {
+ position = $.ui.dialog.prototype.options.position;
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position($.extend({ of: window }, position));
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOptions: function( options ) {
+ var self = this,
+ resizableOptions = {},
+ resize = false;
+
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+
+ if ( key in sizeRelatedOptions ) {
+ resize = true;
+ }
+ if ( key in resizableRelatedOptions ) {
+ resizableOptions[ key ] = value;
+ }
+ });
+
+ if ( resize ) {
+ this._size();
+ }
+ if ( this.uiDialog.is( ":data(resizable)" ) ) {
+ this.uiDialog.resizable( "option", resizableOptions );
+ }
+ },
+
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // ensure that we always pass a string
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ var isDraggable = uiDialog.is( ":data(draggable)" );
+ if ( isDraggable && !value ) {
+ uiDialog.draggable( "destroy" );
+ }
+
+ if ( !isDraggable && value ) {
+ self._makeDraggable();
+ }
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ var isResizable = uiDialog.is( ":data(resizable)" );
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply(self, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight,
+ minContentHeight,
+ isVisible = this.uiDialog.is( ":visible" );
+
+ // reset content sizing
+ this.element.show().css({
+ width: 'auto',
+ minHeight: 0,
+ height: 0
+ });
+
+ if (options.minWidth > options.width) {
+ options.width = options.minWidth;
+ }
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+ minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+
+ if ( options.height === "auto" ) {
+ // only needed for IE6 support
+ if ( $.support.minHeight ) {
+ this.element.css({
+ minHeight: minContentHeight,
+ height: "auto"
+ });
+ } else {
+ this.uiDialog.show();
+ var autoHeight = this.element.css( "height", "auto" ).height();
+ if ( !isVisible ) {
+ this.uiDialog.hide();
+ }
+ this.element.height( Math.max( autoHeight, minContentHeight ) );
+ }
+ } else {
+ this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+ }
+
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.8.23",
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ // we cannot return true when we don't want to cancel the event (#3523)
+ if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+ return false;
+ }
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ var indexOf = $.inArray($el, this.instances);
+ if (indexOf != -1){
+ this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+ }
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE
+ if ( $.browser.msie ) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/draggable.js b/module/web/static/js/libs/jqueryui/draggable.js
new file mode 100644
index 000000000..17163fe9e
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/draggable.js
@@ -0,0 +1,836 @@
+define(['jquery','./core','./mouse','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Draggable 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ if ( o.iframeFix ) {
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ }
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ this.helper.addClass("ui-draggable-dragging");
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
+ if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
+
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is no longer in the DOM don't bother to continue (see #8269)
+ var element = this.element[0], elementInDom = false;
+ while ( element && (element = element.parentNode) ) {
+ if (element == document ) {
+ elementInDom = true;
+ }
+ }
+ if ( !elementInDom && this.options.helper === "original" )
+ return false;
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ _mouseUp: function(event) {
+ if (this.options.iframeFix === true) {
+ $("div.ui-draggable-iframeFix").each(function() {
+ this.parentNode.removeChild(this);
+ }); //Remove frame helpers
+ }
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
+ if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
+
+ return $.ui.mouse.prototype._mouseUp.call(this, event);
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0),
+ right: (parseInt(this.element.css("marginRight"),10) || 0),
+ bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+ o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+ (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var c = $(o.containment);
+ var ce = c[0]; if(!ce) return;
+ var co = c.offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+ (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+ (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+ (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
+ ];
+ this.relative_container = c;
+
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+ var containment;
+ if(this.containment) {
+ if (this.relative_container){
+ var co = this.relative_container.offset();
+ containment = [ this.containment[0] + co.left,
+ this.containment[1] + co.top,
+ this.containment[2] + co.left,
+ this.containment[3] + co.top ];
+ }
+ else {
+ containment = this.containment;
+ }
+
+ if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
+ var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
+ pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
+ pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.draggable, {
+ version: "1.8.23"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/droppable.js b/module/web/static/js/libs/jqueryui/droppable.js
new file mode 100644
index 000000000..e16574638
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/droppable.js
@@ -0,0 +1,299 @@
+define(['jquery','./core','./widget','./mouse','./draggable'], function (jQuery) {
+/*!
+ * jQuery UI Droppable 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.droppable", {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+
+ if(key == 'accept') {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.8.23"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l <= x1 && x2 <= r
+ && t <= y1 && y2 <= b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = this._drop.call(this, event) || dropped;
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ dragStart: function( draggable, event ) {
+ //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
+ draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() {
+ if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+ });
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ },
+ dragStop: function( draggable, event ) {
+ draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" );
+ //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
+ if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/blind.js b/module/web/static/js/libs/jqueryui/effects/blind.js
new file mode 100644
index 000000000..c00004566
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/blind.js
@@ -0,0 +1,52 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Blind 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/bounce.js b/module/web/static/js/libs/jqueryui/effects/bounce.js
new file mode 100644
index 000000000..41d1c6885
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/bounce.js
@@ -0,0 +1,81 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Bounce 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight(true) / 3 : el.outerWidth(true) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/clip.js b/module/web/static/js/libs/jqueryui/effects/clip.js
new file mode 100644
index 000000000..7ff13d5d1
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/clip.js
@@ -0,0 +1,57 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Clip 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/core.js b/module/web/static/js/libs/jqueryui/effects/core.js
new file mode 100644
index 000000000..9900118aa
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/core.js
@@ -0,0 +1,615 @@
+define(['jquery'], function (jQuery) {
+/*!
+ * jQuery UI Effects 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($, undefined) {
+
+$.effects = {};
+
+
+
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
+ }
+
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css
+ color = ($.curCSS || $.css)(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
+
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
+
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
+
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
+
+ return diff;
+}
+
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
+
+ return this.queue(function() {
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('class') || "";
+
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('class', className);
+
+ that.animate(styleDifference(originalStyle, newStyle), {
+ queue: false,
+ duration: duration,
+ easing: easing,
+ complete: function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
+ }
+ if (callback) { callback.apply(this, arguments); }
+ $.dequeue( this );
+ }
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ }
+ },
+
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+$.extend($.effects, {
+ version: "1.8.23",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ }),
+ active = document.activeElement;
+
+ // support: Firefox
+ // Firefox incorrectly exposes anonymous content
+ // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+ try {
+ active.id;
+ } catch( e ) {
+ active = document.body;
+ }
+
+ element.wrap( wrapper );
+
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+ $( active ).focus();
+ }
+
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
+ }
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function(element) {
+ var parent,
+ active = document.activeElement;
+
+ if (element.parent().is('.ui-effects-wrapper')) {
+ parent = element.parent().replaceWith(element);
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+ $( active ).focus();
+ }
+ return parent;
+ }
+
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ var unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+
+ options = options || {};
+
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
+
+ callback = callback || options.complete;
+
+ return [effect, options, speed, callback];
+}
+
+function standardSpeed( speed ) {
+ // valid standard speeds
+ if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
+ return true;
+ }
+
+ // invalid strings - treat as "normal" speed
+ if ( typeof speed === "string" && !$.effects[ speed ] ) {
+ return true;
+ }
+
+ return false;
+}
+
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects take actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ mode = args2.options.mode,
+ effectMethod = $.effects[effect];
+
+ if ( $.fx.off || !effectMethod ) {
+ // delegate to the original method (e.g., .show()) if possible
+ if ( mode ) {
+ return this[ mode ]( args2.duration, args2.callback );
+ } else {
+ return this.each(function() {
+ if ( args2.callback ) {
+ args2.callback.call( this );
+ }
+ });
+ }
+ }
+
+ return effectMethod.call(this, args2);
+ },
+
+ _show: $.fn.show,
+ show: function(speed) {
+ if ( standardSpeed( speed ) ) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if ( standardSpeed( speed ) ) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // jQuery core overloads toggle and creates _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+// based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
+
+var baseEasings = {};
+
+$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
+ baseEasings[ name ] = function( p ) {
+ return Math.pow( p, i + 2 );
+ };
+});
+
+$.extend( baseEasings, {
+ Sine: function ( p ) {
+ return 1 - Math.cos( p * Math.PI / 2 );
+ },
+ Circ: function ( p ) {
+ return 1 - Math.sqrt( 1 - p * p );
+ },
+ Elastic: function( p ) {
+ return p === 0 || p === 1 ? p :
+ -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 );
+ },
+ Back: function( p ) {
+ return p * p * ( 3 * p - 2 );
+ },
+ Bounce: function ( p ) {
+ var pow2,
+ bounce = 4;
+
+ while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
+ return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
+ }
+});
+
+$.each( baseEasings, function( name, easeIn ) {
+ $.easing[ "easeIn" + name ] = easeIn;
+ $.easing[ "easeOut" + name ] = function( p ) {
+ return 1 - easeIn( 1 - p );
+ };
+ $.easing[ "easeInOut" + name ] = function( p ) {
+ return p < .5 ?
+ easeIn( p * 2 ) / 2 :
+ easeIn( p * -2 + 2 ) / -2 + 1;
+ };
+});
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/drop.js b/module/web/static/js/libs/jqueryui/effects/drop.js
new file mode 100644
index 000000000..2ee4cf6d2
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/drop.js
@@ -0,0 +1,53 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Drop 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) / 2 : el.outerWidth( true ) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/explode.js b/module/web/static/js/libs/jqueryui/effects/explode.js
new file mode 100644
index 000000000..e7f3024a7
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/explode.js
@@ -0,0 +1,82 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Explode 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/fade.js b/module/web/static/js/libs/jqueryui/effects/fade.js
new file mode 100644
index 000000000..c31973c74
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/fade.js
@@ -0,0 +1,35 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Fade 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.fade = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide');
+
+ elem.animate({ opacity: mode }, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/fold.js b/module/web/static/js/libs/jqueryui/effects/fold.js
new file mode 100644
index 000000000..540c77c16
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/fold.js
@@ -0,0 +1,59 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Fold 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/highlight.js b/module/web/static/js/libs/jqueryui/effects/highlight.js
new file mode 100644
index 000000000..f7a2f2bcd
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/highlight.js
@@ -0,0 +1,53 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Highlight 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/pulsate.js b/module/web/static/js/libs/jqueryui/effects/pulsate.js
new file mode 100644
index 000000000..95105801c
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/pulsate.js
@@ -0,0 +1,54 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Pulsate 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ times = ((o.options.times || 5) * 2) - 1,
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
+ }
+
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
+ }
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
+ }
+
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
+
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/scale.js b/module/web/static/js/libs/jqueryui/effects/scale.js
new file mode 100644
index 000000000..1f31ed36e
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/scale.js
@@ -0,0 +1,181 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Scale 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
+
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity'];
+ var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ var child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/shake.js b/module/web/static/js/libs/jqueryui/effects/shake.js
new file mode 100644
index 000000000..9f615050b
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/shake.js
@@ -0,0 +1,60 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Shake 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/slide.js b/module/web/static/js/libs/jqueryui/effects/slide.js
new file mode 100644
index 000000000..d39877fa9
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/slide.js
@@ -0,0 +1,53 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Slide 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) : el.outerWidth( true ));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/effects/transfer.js b/module/web/static/js/libs/jqueryui/effects/transfer.js
new file mode 100644
index 000000000..5704255ab
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/effects/transfer.js
@@ -0,0 +1,48 @@
+define(['jquery','./effects/core'], function (jQuery) {
+/*!
+ * jQuery UI Effects Transfer 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/mouse.js b/module/web/static/js/libs/jqueryui/mouse.js
new file mode 100644
index 000000000..e2f1695bc
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/mouse.js
@@ -0,0 +1,170 @@
+define(['jquery','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Mouse 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var mouseHandled = false;
+$( document ).mouseup( function( e ) {
+ mouseHandled = false;
+});
+
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, self.widgetName + '.preventClickEvent');
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+ if ( this._mouseMoveDelegate ) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+ }
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ if( mouseHandled ) { return };
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ // event.target.nodeName works around a bug in IE 8 with
+ // disabled inputs (#7620)
+ elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // Click event may never have fired (Gecko & Opera)
+ if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, this.widgetName + '.preventClickEvent');
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ event.preventDefault();
+
+ mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+
+ if (event.target == this._mouseDownEvent.target) {
+ $.data(event.target, this.widgetName + '.preventClickEvent', true);
+ }
+
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/position.js b/module/web/static/js/libs/jqueryui/position.js
new file mode 100644
index 000000000..0b4b33656
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/position.js
@@ -0,0 +1,311 @@
+define(['jquery'], function (jQuery) {
+/*!
+ * jQuery UI Position 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ verticalPositions = /top|center|bottom/,
+ center = "center",
+ support = {},
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ targetElem = target[0],
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( targetElem.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ // TODO: use $.isWindow() in 1.9
+ } else if ( targetElem.setTimeout ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( targetElem.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [center] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ center ].concat( pos ) :
+ [ center, center ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if ( options.at[0] === center ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === center ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
+ marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
+ collisionWidth = elemWidth + marginLeft +
+ ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
+ collisionHeight = elemHeight + marginTop +
+ ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+ position = $.extend( {}, basePosition ),
+ collisionPosition;
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === center ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === center ) {
+ position.top -= elemHeight / 2;
+ }
+
+ // prevent fractions if jQuery version doesn't support them (see #5280)
+ if ( !support.fractions ) {
+ position.left = Math.round( position.left );
+ position.top = Math.round( position.top );
+ }
+
+ collisionPosition = {
+ left: position.left - marginLeft,
+ top: position.top - marginTop
+ };
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ collisionPosition: collisionPosition,
+ collisionWidth: collisionWidth,
+ collisionHeight: collisionHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === center ) {
+ return;
+ }
+ var win = $( window ),
+ over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ atOffset = data.at[ 0 ] === "left" ?
+ data.targetWidth :
+ -data.targetWidth,
+ offset = -2 * data.offset[ 0 ];
+ position.left += data.collisionPosition.left < 0 ?
+ myOffset + atOffset + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === center ) {
+ return;
+ }
+ var win = $( window ),
+ over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += data.collisionPosition.top < 0 ?
+ myOffset + atOffset + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ if ( $.isFunction( options ) ) {
+ return this.each(function( i ) {
+ $( this ).offset( options.call( this, i, $( this ).offset() ) );
+ });
+ }
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css
+if ( !$.curCSS ) {
+ $.curCSS = $.css;
+}
+
+// fraction support test (older versions of jQuery don't support fractions)
+(function () {
+ var body = document.getElementsByTagName( "body" )[ 0 ],
+ div = document.createElement( "div" ),
+ testElement, testElementParent, testElementStyle, offset, offsetTotal;
+
+ //Create a "fake body" for testing based on method used in jQuery.support
+ testElement = document.createElement( body ? "div" : "body" );
+ testElementStyle = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0,
+ background: "none"
+ };
+ if ( body ) {
+ $.extend( testElementStyle, {
+ position: "absolute",
+ left: "-1000px",
+ top: "-1000px"
+ });
+ }
+ for ( var i in testElementStyle ) {
+ testElement.style[ i ] = testElementStyle[ i ];
+ }
+ testElement.appendChild( div );
+ testElementParent = body || document.documentElement;
+ testElementParent.insertBefore( testElement, testElementParent.firstChild );
+
+ div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;";
+
+ offset = $( div ).offset( function( _, offset ) {
+ return offset;
+ }).offset();
+
+ testElement.innerHTML = "";
+ testElementParent.removeChild( testElement );
+
+ offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 );
+ support.fractions = offsetTotal > 21 && offsetTotal < 22;
+})();
+
+}( jQuery ));
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/progressbar.js b/module/web/static/js/libs/jqueryui/progressbar.js
new file mode 100644
index 000000000..fceee99fa
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/progressbar.js
@@ -0,0 +1,112 @@
+define(['jquery','./core','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Progressbar 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0,
+ max: 100
+ },
+
+ min: 0,
+
+ _create: function() {
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this.min,
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this.oldValue = this._value();
+ this._refreshValue();
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+
+ $.Widget.prototype.destroy.apply( this, arguments );
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this._value();
+ }
+
+ this._setOption( "value", newValue );
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "value" ) {
+ this.options.value = value;
+ this._refreshValue();
+ if ( this._value() === this.options.max ) {
+ this._trigger( "complete" );
+ }
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ return Math.min( this.options.max, Math.max( this.min, val ) );
+ },
+
+ _percentage: function() {
+ return 100 * this._value() / this.options.max;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ var percentage = this._percentage();
+
+ if ( this.oldValue !== value ) {
+ this.oldValue = value;
+ this._trigger( "change" );
+ }
+
+ this.valueDiv
+ .toggle( value > this.min )
+ .toggleClass( "ui-corner-right", value === this.options.max )
+ .width( percentage.toFixed(0) + "%" );
+ this.element.attr( "aria-valuenow", value );
+ }
+});
+
+$.extend( $.ui.progressbar, {
+ version: "1.8.23"
+});
+
+})( jQuery );
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/resizable.js b/module/web/static/js/libs/jqueryui/resizable.js
new file mode 100644
index 000000000..4b0900140
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/resizable.js
@@ -0,0 +1,810 @@
+define(['jquery','./core','./mouse','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Resizable 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // Apply zIndex to all handles - see #7960
+ axis.css({ zIndex: o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ if (o.disabled) return;
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (o.disabled) return;
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.after(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var handle = false;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
+ }
+
+ return !this.options.disabled && handle;
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ // Put this in the mouseDrag handler since the user can start pressing shift while resizing
+ this._updateVirtualBoundaries(event.shiftKey);
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateVirtualBoundaries: function(forceAspectRatio) {
+ var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
+
+ b = {
+ minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
+ maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
+ minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
+ maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
+ };
+
+ if(this._aspectRatio || forceAspectRatio) {
+ // We want to create an enclosing box whose aspect ration is the requested one
+ // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
+ pMinWidth = b.minHeight * this.aspectRatio;
+ pMinHeight = b.minWidth / this.aspectRatio;
+ pMaxWidth = b.maxHeight * this.aspectRatio;
+ pMaxHeight = b.maxWidth / this.aspectRatio;
+
+ if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
+ if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
+ if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
+ if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
+ }
+ this._vBoundaries = b;
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (isNumber(data.height)) data.width = (data.height * this.aspectRatio);
+ else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+$.extend($.ui.resizable, {
+ version: "1.8.23"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _store = function (exp) {
+ $(exp).each(function() {
+ var el = $(this);
+ el.data("resizable-alsoresize", {
+ width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+ left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function (exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
+ css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+
+ $.each(css, function (i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function (event, ui) {
+ $(this).removeData("resizable-alsoresize");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/selectable.js b/module/web/static/js/libs/jqueryui/selectable.js
new file mode 100644
index 000000000..abefc9d2c
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/selectable.js
@@ -0,0 +1,270 @@
+define(['jquery','./core','./mouse','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Selectable 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.addClass("ui-selectee");
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $("<div class='ui-selectable-helper'></div>");
+ },
+
+ destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey && !event.ctrlKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected');
+ selectee.$element
+ .removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+ .addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+ selectee.unselecting = !doSelect;
+ selectee.selecting = doSelect;
+ selectee.selected = doSelect;
+ // selectable (UN)SELECTING callback
+ if (doSelect) {
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ } else {
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+$.extend($.ui.selectable, {
+ version: "1.8.23"
+});
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/slider.js b/module/web/static/js/libs/jqueryui/slider.js
new file mode 100644
index 000000000..be11afcdf
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/slider.js
@@ -0,0 +1,665 @@
+define(['jquery','./core','./mouse','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Slider 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
+
+ _create: function() {
+ var self = this,
+ o = this.options,
+ existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
+ handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
+ handleCount = ( o.values && o.values.length ) || 1,
+ handles = [];
+
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" +
+ ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
+
+ this.range = $([]);
+
+ if ( o.range ) {
+ if ( o.range === true ) {
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ }
+ if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ }
+ }
+
+ this.range = $( "<div></div>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" +
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ " ui-widget-header" +
+ ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
+ }
+
+ for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
+ handles.push( handle );
+ }
+
+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ }, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ this.handles.each(function( i ) {
+ $( this ).data( "index.ui-slider-handle", i );
+ });
+
+ this.handles
+ .keydown(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" ),
+ allowed,
+ curVal,
+ newVal,
+ step;
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ event.preventDefault();
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ allowed = self._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = self.options.step;
+ if ( self.options.values && self.options.values.length ) {
+ curVal = newVal = self.values( index );
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === self._valueMax() ) {
+ return;
+ }
+ newVal = self._trimAlignValue( curVal + step );
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === self._valueMin() ) {
+ return;
+ }
+ newVal = self._trimAlignValue( curVal - step );
+ break;
+ }
+
+ self._slide( event, index, newVal );
+ })
+ .keyup(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" );
+
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ self._stop( event, index );
+ self._change( event, index );
+ $( this ).removeClass( "ui-state-active" );
+ }
+
+ });
+
+ this._refreshValue();
+
+ this._animateOff = false;
+ },
+
+ destroy: function() {
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-slider-disabled" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" )
+ .removeData( "slider" )
+ .unbind( ".slider" );
+
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function( event ) {
+ var o = this.options,
+ position,
+ normValue,
+ distance,
+ closestHandle,
+ self,
+ index,
+ allowed,
+ offset,
+ mouseOverHandle;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ self = this;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - self.values(i) );
+ if ( distance > thisDistance ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if( o.range === true && this.values(1) === o.min ) {
+ index += 1;
+ closestHandle = $( this.handles[index] );
+ }
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
+
+ if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+ this._slide( event, index, normValue );
+ }
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function( event ) {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
+ },
+
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+ return this._trigger( "start", event, uiHash );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
+
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
+ },
+
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "stop", event, uiHash );
+ },
+
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "change", event, uiHash );
+ }
+ },
+
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ return;
+ }
+
+ return this._value();
+ },
+
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
+
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ return;
+ }
+
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
+ } else {
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
+
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.propAttr( "disabled", true );
+ this.element.addClass( "ui-disabled" );
+ } else {
+ this.handles.propAttr( "disabled", false );
+ this.element.removeClass( "ui-disabled" );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
+
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
+ }
+
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val <= this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val >= this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
+ valModStep = (val - this._valueMin()) % step,
+ alignValue = val - valModStep;
+
+ if ( Math.abs(valModStep) * 2 >= step ) {
+ alignValue += ( valModStep > 0 ) ? step : ( -step );
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var oRange = this.options.range,
+ o = this.options,
+ self = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ valPercent,
+ _set = {},
+ lastValPercent,
+ value,
+ valueMin,
+ valueMax;
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i, j ) {
+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( self.options.range === true ) {
+ if ( self.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+
+});
+
+$.extend( $.ui.slider, {
+ version: "1.8.23"
+});
+
+}(jQuery));
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/sortable.js b/module/web/static/js/libs/jqueryui/sortable.js
new file mode 100644
index 000000000..ae808d561
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/sortable.js
@@ -0,0 +1,1087 @@
+define(['jquery','./core','./mouse','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Sortable 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ ready: false,
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are being displayed horizontally
+ this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ //We're ready to go
+ this.ready = true
+
+ },
+
+ destroy: function() {
+ $.Widget.prototype.destroy.call( this );
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData(this.widgetName + "-item");
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget()
+ [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(this, arguments);
+ }
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+ var that = this;
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, that.widgetName + '-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp({ target: null });
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ if (this.placeholder) {
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ if(!str.length && o.key) {
+ str.push(o.key + '=');
+ }
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], this.widgetName);
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], this.widgetName);
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
+ continue;
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top;
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ this.direction = (cur - base > 0) ? 'down' : 'up';
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ originalPosition: self.originalPosition,
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+});
+
+$.extend($.ui.sortable, {
+ version: "1.8.23"
+});
+
+})(jQuery);
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/tabs.js b/module/web/static/js/libs/jqueryui/tabs.js
new file mode 100644
index 000000000..335aadf83
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/tabs.js
@@ -0,0 +1,760 @@
+define(['jquery','./core','./widget'], function (jQuery) {
+/*!
+ * jQuery UI Tabs 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var tabId = 0,
+ listId = 0;
+
+function getNextTabId() {
+ return ++tabId;
+}
+
+function getNextListId() {
+ return ++listId;
+}
+
+$.widget( "ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: "click",
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: "ui-tabs-",
+ load: null,
+ panelTemplate: "<div></div>",
+ remove: null,
+ select: null,
+ show: null,
+ spinner: "<em>Loading&#8230;</em>",
+ tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
+ },
+
+ _create: function() {
+ this._tabify( true );
+ },
+
+ _setOption: function( key, value ) {
+ if ( key == "selected" ) {
+ if (this.options.collapsible && value == this.options.selected ) {
+ return;
+ }
+ this.select( value );
+ } else {
+ this.options[ key ] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function( a ) {
+ return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
+ this.options.idPrefix + getNextTabId();
+ },
+
+ _sanitizeSelector: function( hash ) {
+ // we need this because an id may contain a ":"
+ return hash.replace( /:/g, "\\:" );
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie ||
+ ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
+ return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
+ },
+
+ _ui: function( tab, panel ) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index( tab )
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter( ".ui-state-processing" )
+ .removeClass( "ui-state-processing" )
+ .find( "span:data(label.tabs)" )
+ .each(function() {
+ var el = $( this );
+ el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
+ });
+ },
+
+ _tabify: function( init ) {
+ var self = this,
+ o = this.options,
+ fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+
+ this.list = this.element.find( "ol,ul" ).eq( 0 );
+ this.lis = $( " > li:has(a[href])", this.list );
+ this.anchors = this.lis.map(function() {
+ return $( "a", this )[ 0 ];
+ });
+ this.panels = $( [] );
+
+ this.anchors.each(function( i, a ) {
+ var href = $( a ).attr( "href" );
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split( "#" )[ 0 ],
+ baseEl;
+ if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
+ ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if ( fragmentId.test( href ) ) {
+ self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
+ // remote tab
+ // prevent loading the page itself if href is just "#"
+ } else if ( href && href !== "#" ) {
+ // required for restore on destroy
+ $.data( a, "href.tabs", href );
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
+
+ var id = self._tabId( a );
+ a.href = "#" + id;
+ var $panel = self.element.find( "#" + id );
+ if ( !$panel.length ) {
+ $panel = $( o.panelTemplate )
+ .attr( "id", id )
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .insertAfter( self.panels[ i - 1 ] || self.list );
+ $panel.data( "destroy.tabs", true );
+ }
+ self.panels = self.panels.add( $panel );
+ // invalid tab href
+ } else {
+ o.disabled.push( i );
+ }
+ });
+
+ // initialization from scratch
+ if ( init ) {
+ // attach necessary classes for styling
+ this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
+ this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+ this.lis.addClass( "ui-state-default ui-corner-top" );
+ this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if ( o.selected === undefined ) {
+ if ( location.hash ) {
+ this.anchors.each(function( i, a ) {
+ if ( a.hash == location.hash ) {
+ o.selected = i;
+ return false;
+ }
+ });
+ }
+ if ( typeof o.selected !== "number" && o.cookie ) {
+ o.selected = parseInt( self._cookie(), 10 );
+ }
+ if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
+ o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ }
+ o.selected = o.selected || ( this.lis.length ? 0 : -1 );
+ } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
+ ? o.selected
+ : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique( o.disabled.concat(
+ $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
+ return self.lis.index( n );
+ })
+ ) ).sort();
+
+ if ( $.inArray( o.selected, o.disabled ) != -1 ) {
+ o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
+ }
+
+ // highlight selected tab
+ this.panels.addClass( "ui-tabs-hide" );
+ this.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ // check for length avoids error when initializing empty list
+ if ( o.selected >= 0 && this.anchors.length ) {
+ self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
+ this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue( "tabs", function() {
+ self._trigger( "show", null,
+ self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
+ });
+
+ this.load( o.selected );
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ // TODO: namespace this event
+ $( window ).bind( "unload", function() {
+ self.lis.add( self.anchors ).unbind( ".tabs" );
+ self.lis = self.anchors = self.panels = null;
+ });
+ // update selected after add/remove
+ } else {
+ o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ }
+
+ // update collapsible
+ // TODO: use .toggleClass()
+ this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
+
+ // set or update cookie after init and add/remove respectively
+ if ( o.cookie ) {
+ this._cookie( o.selected, o.cookie );
+ }
+
+ // disable tabs
+ for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
+ $( li )[ $.inArray( i, o.disabled ) != -1 &&
+ // TODO: use .toggleClass()
+ !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+ }
+
+ // reset cache if switching from cached to not cached
+ if ( o.cache === false ) {
+ this.anchors.removeData( "cache.tabs" );
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add( this.anchors ).unbind( ".tabs" );
+
+ if ( o.event !== "mouseover" ) {
+ var addState = function( state, el ) {
+ if ( el.is( ":not(.ui-state-disabled)" ) ) {
+ el.addClass( "ui-state-" + state );
+ }
+ };
+ var removeState = function( state, el ) {
+ el.removeClass( "ui-state-" + state );
+ };
+ this.lis.bind( "mouseover.tabs" , function() {
+ addState( "hover", $( this ) );
+ });
+ this.lis.bind( "mouseout.tabs", function() {
+ removeState( "hover", $( this ) );
+ });
+ this.anchors.bind( "focus.tabs", function() {
+ addState( "focus", $( this ).closest( "li" ) );
+ });
+ this.anchors.bind( "blur.tabs", function() {
+ removeState( "focus", $( this ).closest( "li" ) );
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if ( o.fx ) {
+ if ( $.isArray( o.fx ) ) {
+ hideFx = o.fx[ 0 ];
+ showFx = o.fx[ 1 ];
+ } else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle( $el, fx ) {
+ $el.css( "display", "" );
+ if ( !$.support.opacity && fx.opacity ) {
+ $el[ 0 ].style.removeAttribute( "filter" );
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx
+ ? function( clicked, $show ) {
+ $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+ $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
+ .animate( showFx, showFx.duration || "normal", function() {
+ resetStyle( $show, showFx );
+ self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ });
+ }
+ : function( clicked, $show ) {
+ $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+ $show.removeClass( "ui-tabs-hide" );
+ self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx
+ ? function( clicked, $hide ) {
+ $hide.animate( hideFx, hideFx.duration || "normal", function() {
+ self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ $hide.addClass( "ui-tabs-hide" );
+ resetStyle( $hide, hideFx );
+ self.element.dequeue( "tabs" );
+ });
+ }
+ : function( clicked, $hide, $show ) {
+ self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ $hide.addClass( "ui-tabs-hide" );
+ self.element.dequeue( "tabs" );
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind( o.event + ".tabs", function() {
+ var el = this,
+ $li = $(el).closest( "li" ),
+ $hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
+ $show = self.element.find( self._sanitizeSelector( el.hash ) );
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
+ $li.hasClass( "ui-state-disabled" ) ||
+ $li.hasClass( "ui-state-processing" ) ||
+ self.panels.filter( ":animated" ).length ||
+ self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index( this );
+
+ self.abort();
+
+ // if tab may be closed
+ if ( o.collapsible ) {
+ if ( $li.hasClass( "ui-tabs-selected" ) ) {
+ o.selected = -1;
+
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ self.element.queue( "tabs", function() {
+ hideTab( el, $hide );
+ }).dequeue( "tabs" );
+
+ this.blur();
+ return false;
+ } else if ( !$hide.length ) {
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ self.element.queue( "tabs", function() {
+ showTab( el, $show );
+ });
+
+ // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+ self.load( self.anchors.index( this ) );
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ // show new tab
+ if ( $show.length ) {
+ if ( $hide.length ) {
+ self.element.queue( "tabs", function() {
+ hideTab( el, $hide );
+ });
+ }
+ self.element.queue( "tabs", function() {
+ showTab( el, $show );
+ });
+
+ self.load( self.anchors.index( this ) );
+ } else {
+ throw "jQuery UI Tabs: Mismatching fragment identifier.";
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ( $.browser.msie ) {
+ this.blur();
+ }
+ });
+
+ // disable click in any case
+ this.anchors.bind( "click.tabs", function(){
+ return false;
+ });
+ },
+
+ _getIndex: function( index ) {
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ // also sanitizes numerical indexes to valid values.
+ if ( typeof index == "string" ) {
+ index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) );
+ }
+
+ return index;
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element
+ .unbind( ".tabs" )
+ .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
+ .removeData( "tabs" );
+
+ this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+
+ this.anchors.each(function() {
+ var href = $.data( this, "href.tabs" );
+ if ( href ) {
+ this.href = href;
+ }
+ var $this = $( this ).unbind( ".tabs" );
+ $.each( [ "href", "load", "cache" ], function( i, prefix ) {
+ $this.removeData( prefix + ".tabs" );
+ });
+ });
+
+ this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
+ if ( $.data( this, "destroy.tabs" ) ) {
+ $( this ).remove();
+ } else {
+ $( this ).removeClass([
+ "ui-state-default",
+ "ui-corner-top",
+ "ui-tabs-selected",
+ "ui-state-active",
+ "ui-state-hover",
+ "ui-state-focus",
+ "ui-state-disabled",
+ "ui-tabs-panel",
+ "ui-widget-content",
+ "ui-corner-bottom",
+ "ui-tabs-hide"
+ ].join( " " ) );
+ }
+ });
+
+ if ( o.cookie ) {
+ this._cookie( null, o.cookie );
+ }
+
+ return this;
+ },
+
+ add: function( url, label, index ) {
+ if ( index === undefined ) {
+ index = this.anchors.length;
+ }
+
+ var self = this,
+ o = this.options,
+ $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
+ id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
+
+ $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
+
+ // try to find an existing element before creating a new one
+ var $panel = self.element.find( "#" + id );
+ if ( !$panel.length ) {
+ $panel = $( o.panelTemplate )
+ .attr( "id", id )
+ .data( "destroy.tabs", true );
+ }
+ $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
+
+ if ( index >= this.lis.length ) {
+ $li.appendTo( this.list );
+ $panel.appendTo( this.list[ 0 ].parentNode );
+ } else {
+ $li.insertBefore( this.lis[ index ] );
+ $panel.insertBefore( this.panels[ index ] );
+ }
+
+ o.disabled = $.map( o.disabled, function( n, i ) {
+ return n >= index ? ++n : n;
+ });
+
+ this._tabify();
+
+ if ( this.anchors.length == 1 ) {
+ o.selected = 0;
+ $li.addClass( "ui-tabs-selected ui-state-active" );
+ $panel.removeClass( "ui-tabs-hide" );
+ this.element.queue( "tabs", function() {
+ self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
+ });
+
+ this.load( 0 );
+ }
+
+ this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
+
+ remove: function( index ) {
+ index = this._getIndex( index );
+ var o = this.options,
+ $li = this.lis.eq( index ).remove(),
+ $panel = this.panels.eq( index ).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
+ this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+ }
+
+ o.disabled = $.map(
+ $.grep( o.disabled, function(n, i) {
+ return n != index;
+ }),
+ function( n, i ) {
+ return n >= index ? --n : n;
+ });
+
+ this._tabify();
+
+ this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
+ return this;
+ },
+
+ enable: function( index ) {
+ index = this._getIndex( index );
+ var o = this.options;
+ if ( $.inArray( index, o.disabled ) == -1 ) {
+ return;
+ }
+
+ this.lis.eq( index ).removeClass( "ui-state-disabled" );
+ o.disabled = $.grep( o.disabled, function( n, i ) {
+ return n != index;
+ });
+
+ this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
+
+ disable: function( index ) {
+ index = this._getIndex( index );
+ var self = this, o = this.options;
+ // cannot disable already selected tab
+ if ( index != o.selected ) {
+ this.lis.eq( index ).addClass( "ui-state-disabled" );
+
+ o.disabled.push( index );
+ o.disabled.sort();
+
+ this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ }
+
+ return this;
+ },
+
+ select: function( index ) {
+ index = this._getIndex( index );
+ if ( index == -1 ) {
+ if ( this.options.collapsible && this.options.selected != -1 ) {
+ index = this.options.selected;
+ } else {
+ return this;
+ }
+ }
+ this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
+ return this;
+ },
+
+ load: function( index ) {
+ index = this._getIndex( index );
+ var self = this,
+ o = this.options,
+ a = this.anchors.eq( index )[ 0 ],
+ url = $.data( a, "load.tabs" );
+
+ this.abort();
+
+ // not remote or from cache
+ if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
+ this.element.dequeue( "tabs" );
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq( index ).addClass( "ui-state-processing" );
+
+ if ( o.spinner ) {
+ var span = $( "span", a );
+ span.data( "label.tabs", span.html() ).html( o.spinner );
+ }
+
+ this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
+ url: url,
+ success: function( r, s ) {
+ self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
+
+ // take care of tab labels
+ self._cleanup();
+
+ if ( o.cache ) {
+ $.data( a, "cache.tabs", true );
+ }
+
+ self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+ try {
+ o.ajaxOptions.success( r, s );
+ }
+ catch ( e ) {}
+ },
+ error: function( xhr, s, e ) {
+ // take care of tab labels
+ self._cleanup();
+
+ self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error( xhr, s, index, a );
+ }
+ catch ( e ) {}
+ }
+ } ) );
+
+ // last, so that load event is fired before show...
+ self.element.dequeue( "tabs" );
+
+ return this;
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue( [] );
+ this.panels.stop( false, true );
+
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
+
+ // terminate pending requests from other tabs
+ if ( this.xhr ) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
+ },
+
+ url: function( index, url ) {
+ this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
+ return this;
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+});
+
+$.extend( $.ui.tabs, {
+ version: "1.8.23"
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend( $.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function( ms, continuing ) {
+ var self = this,
+ o = this.options;
+
+ var rotate = self._rotate || ( self._rotate = function( e ) {
+ clearTimeout( self.rotation );
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms );
+
+ if ( e ) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || ( self._unrotate = !continuing
+ ? function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ }
+ : function( e ) {
+ rotate();
+ });
+
+ // start rotation
+ if ( ms ) {
+ this.element.bind( "tabsshow", rotate );
+ this.anchors.bind( o.event + ".tabs", stop );
+ rotate();
+ // stop rotation
+ } else {
+ clearTimeout( self.rotation );
+ this.element.unbind( "tabsshow", rotate );
+ this.anchors.unbind( o.event + ".tabs", stop );
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})( jQuery );
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/jqueryui/widget.js b/module/web/static/js/libs/jqueryui/widget.js
new file mode 100644
index 000000000..9c6dc93a8
--- /dev/null
+++ b/module/web/static/js/libs/jqueryui/widget.js
@@ -0,0 +1,275 @@
+define(['jquery'], function (jQuery) {
+/*!
+ * jQuery UI Widget 1.8.23
+ *
+ * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+ var _cleanData = $.cleanData;
+ $.cleanData = function( elems ) {
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ try {
+ $( elem ).triggerHandler( "remove" );
+ // http://bugs.jquery.com/ticket/8235
+ } catch( e ) {}
+ }
+ _cleanData( elems );
+ };
+} else {
+ var _remove = $.fn.remove;
+ $.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( [ this ] ).each(function() {
+ try {
+ $( this ).triggerHandler( "remove" );
+ // http://bugs.jquery.com/ticket/8235
+ } catch( e ) {}
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+ };
+}
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( true, {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ // TODO: add this back in 1.9 and use $.error() (see #5972)
+// if ( !instance ) {
+// throw "cannot call methods on " + name + " prior to initialization; " +
+// "attempted to call method '" + options + "'";
+// }
+// if ( !$.isFunction( instance[options] ) ) {
+// throw "no such method '" + options + "' for " + name + " widget instance";
+// }
+// var methodValue = instance[ options ].apply( instance, args );
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ instance.option( options || {} )._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ $.data( element, this.widgetName, this );
+ this.element = $( element );
+ this.options = $.extend( true, {},
+ this.options,
+ this._getCreateOptions(),
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._trigger( "create" );
+ this._init();
+ },
+ _getCreateOptions: function() {
+ return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, this.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ this._setOptions( options );
+
+ return this;
+ },
+ _setOptions: function( options ) {
+ var self = this;
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return this;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var prop, orig,
+ callback = this.options[ type ];
+
+ data = data || {};
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ // the original event may come from any element
+ // so we need to reset the target on the new event
+ event.target = this.element[ 0 ];
+
+ // copy original event properties over to the new event
+ orig = event.originalEvent;
+ if ( orig ) {
+ for ( prop in orig ) {
+ if ( !( prop in event ) ) {
+ event[ prop ] = orig[ prop ];
+ }
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/libs/less-1.3.0.min.js b/module/web/static/js/libs/less-1.3.0.min.js
new file mode 100644
index 000000000..309bf550d
--- /dev/null
+++ b/module/web/static/js/libs/less-1.3.0.min.js
@@ -0,0 +1,9 @@
+//
+// LESS - Leaner CSS v1.3.0
+// http://lesscss.org
+//
+// Copyright (c) 2009-2011, Alexis Sellier
+// Licensed under the Apache 2.0 License.
+//
+(function(a,b){function c(b){return a.less[b.split("/")[1]]}function l(){var a=document.getElementsByTagName("style");for(var b=0;b<a.length;b++)a[b].type.match(j)&&(new d.Parser).parse(a[b].innerHTML||"",function(c,d){var e=d.toCSS(),f=a[b];f.type="text/css",f.styleSheet?f.styleSheet.cssText=e:f.innerHTML=e})}function m(a,b){for(var c=0;c<d.sheets.length;c++)n(d.sheets[c],a,b,d.sheets.length-(c+1))}function n(b,c,e,f){var h=a.location.href.replace(/[#?].*$/,""),i=b.href.replace(/\?.*$/,""),j=g&&g.getItem(i),k=g&&g.getItem(i+":timestamp"),l={css:j,timestamp:k};/^(https?|file):/.test(i)||(i.charAt(0)=="/"?i=a.location.protocol+"//"+a.location.host+i:i=h.slice(0,h.lastIndexOf("/")+1)+i);var m=i.match(/([^\/]+)$/)[1];q(b.href,b.type,function(a,g){if(!e&&l&&g&&(new Date(g)).valueOf()===(new Date(l.timestamp)).valueOf())p(l.css,b),c(null,null,a,b,{local:!0,remaining:f});else try{(new d.Parser({optimization:d.optimization,paths:[i.replace(/[\w\.-]+$/,"")],mime:b.type,filename:m})).parse(a,function(d,e){if(d)return u(d,i);try{c(d,e,a,b,{local:!1,lastModified:g,remaining:f}),s(document.getElementById("less-error-message:"+o(i)))}catch(d){u(d,i)}})}catch(h){u(h,i)}},function(a,b){throw new Error("Couldn't load "+b+" ("+a+")")})}function o(a){return a.replace(/^[a-z]+:\/\/?[^\/]+/,"").replace(/^\//,"").replace(/\?.*$/,"").replace(/\.[^\.\/]+$/,"").replace(/[^\.\w-]+/g,"-").replace(/\./g,":")}function p(a,b,c){var d,e=b.href?b.href.replace(/\?.*$/,""):"",f="less:"+(b.title||o(e));(d=document.getElementById(f))===null&&(d=document.createElement("style"),d.type="text/css",d.media=b.media||"screen",d.id=f,document.getElementsByTagName("head")[0].appendChild(d));if(d.styleSheet)try{d.styleSheet.cssText=a}catch(h){throw new Error("Couldn't reassign styleSheet.cssText.")}else(function(a){d.childNodes.length>0?d.firstChild.nodeValue!==a.nodeValue&&d.replaceChild(a,d.firstChild):d.appendChild(a)})(document.createTextNode(a));c&&g&&(t("saving "+e+" to cache."),g.setItem(e,a),g.setItem(e+":timestamp",c))}function q(a,b,c,e){function i(b,c,d){b.status>=200&&b.status<300?c(b.responseText,b.getResponseHeader("Last-Modified")):typeof d=="function"&&d(b.status,a)}var g=r(),h=f?!1:d.async;typeof g.overrideMimeType=="function"&&g.overrideMimeType("text/css"),g.open("GET",a,h),g.setRequestHeader("Accept",b||"text/x-less, text/css; q=0.9, */*; q=0.5"),g.send(null),f?g.status===0||g.status>=200&&g.status<300?c(g.responseText):e(g.status,a):h?g.onreadystatechange=function(){g.readyState==4&&i(g,c,e)}:i(g,c,e)}function r(){if(a.XMLHttpRequest)return new XMLHttpRequest;try{return new ActiveXObject("MSXML2.XMLHTTP.3.0")}catch(b){return t("browser doesn't support AJAX."),null}}function s(a){return a&&a.parentNode.removeChild(a)}function t(a){d.env=="development"&&typeof console!="undefined"&&console.log("less: "+a)}function u(a,b){var c="less-error-message:"+o(b),e='<li><label>{line}</label><pre class="{class}">{content}</pre></li>',f=document.createElement("div"),g,h,i=[],j=a.filename||b;f.id=c,f.className="less-error-message",h="<h3>"+(a.message||"There is an error in your .less file")+"</h3>"+'<p>in <a href="'+j+'">'+j+"</a> ";var k=function(a,b,c){a.extract[b]&&i.push(e.replace(/\{line\}/,parseInt(a.line)+(b-1)).replace(/\{class\}/,c).replace(/\{content\}/,a.extract[b]))};a.stack?h+="<br/>"+a.stack.split("\n").slice(1).join("<br/>"):a.extract&&(k(a,0,""),k(a,1,"line"),k(a,2,""),h+="on line "+a.line+", column "+(a.column+1)+":</p>"+"<ul>"+i.join("")+"</ul>"),f.innerHTML=h,p([".less-error-message ul, .less-error-message li {","list-style-type: none;","margin-right: 15px;","padding: 4px 0;","margin: 0;","}",".less-error-message label {","font-size: 12px;","margin-right: 15px;","padding: 4px 0;","color: #cc7777;","}",".less-error-message pre {","color: #dd6666;","padding: 4px 0;","margin: 0;","display: inline-block;","}",".less-error-message pre.line {","color: #ff0000;","}",".less-error-message h3 {","font-size: 20px;","font-weight: bold;","padding: 15px 0 5px 0;","margin: 0;","}",".less-error-message a {","color: #10a","}",".less-error-message .error {","color: red;","font-weight: bold;","padding-bottom: 2px;","border-bottom: 1px dashed red;","}"].join("\n"),{title:"error-message"}),f.style.cssText=["font-family: Arial, sans-serif","border: 1px solid #e00","background-color: #eee","border-radius: 5px","-webkit-border-radius: 5px","-moz-border-radius: 5px","color: #e00","padding: 15px","margin-bottom: 15px"].join(";"),d.env=="development"&&(g=setInterval(function(){document.body&&(document.getElementById(c)?document.body.replaceChild(f,document.getElementById(c)):document.body.insertBefore(f,document.body.firstChild),clearInterval(g))},10))}typeof define=="function"&&define.amd&&define("less",[],function(){return d}),Array.isArray||(Array.isArray=function(a){return Object.prototype.toString.call(a)==="[object Array]"||a instanceof Array}),Array.prototype.forEach||(Array.prototype.forEach=function(a,b){var c=this.length>>>0;for(var d=0;d<c;d++)d in this&&a.call(b,this[d],d,this)}),Array.prototype.map||(Array.prototype.map=function(a){var b=this.length>>>0,c=new Array(b),d=arguments[1];for(var e=0;e<b;e++)e in this&&(c[e]=a.call(d,this[e],e,this));return c}),Array.prototype.filter||(Array.prototype.filter=function(a){var b=[],c=arguments[1];for(var d=0;d<this.length;d++)a.call(c,this[d])&&b.push(this[d]);return b}),Array.prototype.reduce||(Array.prototype.reduce=function(a){var b=this.length>>>0,c=0;if(b===0&&arguments.length===1)throw new TypeError;if(arguments.length>=2)var d=arguments[1];else do{if(c in this){d=this[c++];break}if(++c>=b)throw new TypeError}while(!0);for(;c<b;c++)c in this&&(d=a.call(null,d,this[c],c,this));return d}),Array.prototype.indexOf||(Array.prototype.indexOf=function(a){var b=this.length,c=arguments[1]||0;if(!b)return-1;if(c>=b)return-1;c<0&&(c+=b);for(;c<b;c++){if(!Object.prototype.hasOwnProperty.call(this,c))continue;if(a===this[c])return c}return-1}),Object.keys||(Object.keys=function(a){var b=[];for(var c in a)Object.prototype.hasOwnProperty.call(a,c)&&b.push(c);return b}),String.prototype.trim||(String.prototype.trim=function(){return String(this).replace(/^\s\s*/,"").replace(/\s\s*$/,"")});var d,e;typeof environment=="object"&&{}.toString.call(environment)==="[object Environment]"?(typeof a=="undefined"?d={}:d=a.less={},e=d.tree={},d.mode="rhino"):typeof a=="undefined"?(d=exports,e=c("./tree"),d.mode="node"):(typeof a.less=="undefined"&&(a.less={}),d=a.less,e=a.less.tree={},d.mode="browser"),d.Parser=function v(a){function q(){h=k[g],i=f,l=f}function r(){k[g]=h,f=i,l=f}function s(){f>l&&(k[g]=k[g].slice(f-l),l=f)}function t(a){var c,d,e,h,i,j,n,o;if(a instanceof Function)return a.call(m.parsers);if(typeof a=="string")c=b.charAt(f)===a?a:null,e=1,s();else{s();if(c=a.exec(k[g]))e=c[0].length;else return null}if(c){o=f+=e,j=f+k[g].length-e;while(f<j){h=b.charCodeAt(f);if(h!==32&&h!==10&&h!==9)break;f++}return k[g]=k[g].slice(e+(f-o)),l=f,k[g].length===0&&g<k.length-1&&g++,typeof c=="string"?c:c.length===1?c[0]:c}}function u(a,c){var d=t(a);if(!d)v(c||(typeof a=="string"?"expected '"+a+"' got '"+b.charAt(f)+"'":"unexpected token"));else return d}function v(a,b){throw{index:f,type:b||"Syntax",message:a}}function w(a){return typeof a=="string"?b.charAt(f)===a:a.test(k[g])?!0:!1}function x(a){return d.mode==="node"?c("path").basename(a):a.match(/[^\/]+$/)[0]}function y(a,c){return a.filename&&c.filename&&a.filename!==c.filename?m.imports.contents[x(a.filename)]:b}function z(a,b){for(var c=a,d=-1;c>=0&&b.charAt(c)!=="\n";c--)d++;return{line:typeof a=="number"?(b.slice(0,a).match(/\n/g)||"").length:null,column:d}}function A(a,b){var c=y(a,b),d=z(a.index,c),e=d.line,f=d.column,g=c.split("\n");this.type=a.type||"Syntax",this.message=a.message,this.filename=a.filename||b.filename,this.index=a.index,this.line=typeof e=="number"?e+1:null,this.callLine=a.call&&z(a.call,c).line+1,this.callExtract=g[z(a.call,c).line],this.stack=a.stack,this.column=f,this.extract=[g[e-1],g[e],g[e+1]]}var b,f,g,h,i,j,k,l,m,n=this,o=function(){},p=this.imports={paths:a&&a.paths||[],queue:[],files:{},contents:{},mime:a&&a.mime,error:null,push:function(b,c){var e=this;this.queue.push(b),d.Parser.importer(b,this.paths,function(a,d,f){e.queue.splice(e.queue.indexOf(b),1),e.files[b]=d,e.contents[b]=f,a&&!e.error&&(e.error=a),c(a,d),e.queue.length===0&&o()},a)}};return this.env=a=a||{},this.optimization="optimization"in this.env?this.env.optimization:1,this.env.filename=this.env.filename||null,m={imports:p,parse:function(h,i){var n,p,q,r,s,u,v=[],w,x=null;f=g=l=j=0,b=h.replace(/\r\n/g,"\n"),k=function(c){var d=0,e=/[^"'`\{\}\/\(\)\\]+/g,f=/\/\*(?:[^*]|\*+[^\/*])*\*+\/|\/\/.*/g,g=/"((?:[^"\\\r\n]|\\.)*)"|'((?:[^'\\\r\n]|\\.)*)'|`((?:[^`\\\r\n]|\\.)*)`/g,h=0,i,j=c[0],k;for(var l=0,m,n;l<b.length;l++){e.lastIndex=l,(i=e.exec(b))&&i.index===l&&(l+=i[0].length,j.push(i[0])),m=b.charAt(l),f.lastIndex=g.lastIndex=l,(i=g.exec(b))&&i.index===l&&(l+=i[0].length,j.push(i[0]),m=b.charAt(l)),!k&&m==="/"&&(n=b.charAt(l+1),(n==="/"||n==="*")&&(i=f.exec(b))&&i.index===l&&(l+=i[0].length,j.push(i[0]),m=b.charAt(l)));switch(m){case"{":if(!k){h++,j.push(m);break};case"}":if(!k){h--,j.push(m),c[++d]=j=[];break};case"(":if(!k){k=!0,j.push(m);break};case")":if(k){k=!1,j.push(m);break};default:j.push(m)}}return h>0&&(x=new A({index:l,type:"Parse",message:"missing closing `}`",filename:a.filename},a)),c.map(function(a){return a.join("")})}([[]]);if(x)return i(x);try{n=new e.Ruleset([],t(this.parsers.primary)),n.root=!0}catch(y){return i(new A(y,a))}n.toCSS=function(b){var f,g,h;return function(f,g){var h=[],i;f=f||{},typeof g=="object"&&!Array.isArray(g)&&(g=Object.keys(g).map(function(a){var b=g[a];return b instanceof e.Value||(b instanceof e.Expression||(b=new e.Expression([b])),b=new e.Value([b])),new e.Rule("@"+a,b,!1,0)}),h=[new e.Ruleset(null,g)]);try{var j=b.call(this,{frames:h}).toCSS([],{compress:f.compress||!1})}catch(k){throw new A(k,a)}if(i=m.imports.error)throw i instanceof A?i:new A(i,a);return f.yuicompress&&d.mode==="node"?c("./cssmin").compressor.cssmin(j):f.compress?j.replace(/(\s)+/g,"$1"):j}}(n.eval);if(f<b.length-1){f=j,u=b.split("\n"),s=(b.slice(0,f).match(/\n/g)||"").length+1;for(var z=f,B=-1;z>=0&&b.charAt(z)!=="\n";z--)B++;x={type:"Parse",message:"Syntax Error on line "+s,index:f,filename:a.filename,line:s,column:B,extract:[u[s-2],u[s-1],u[s]]}}this.imports.queue.length>0?o=function(){i(x,n)}:i(x,n)},parsers:{primary:function(){var a,b=[];while((a=t(this.mixin.definition)||t(this.rule)||t(this.ruleset)||t(this.mixin.call)||t(this.comment)||t(this.directive))||t(/^[\s\n]+/))a&&b.push(a);return b},comment:function(){var a;if(b.charAt(f)!=="/")return;if(b.charAt(f+1)==="/")return new e.Comment(t(/^\/\/.*/),!0);if(a=t(/^\/\*(?:[^*]|\*+[^\/*])*\*+\/\n?/))return new e.Comment(a)},entities:{quoted:function(){var a,c=f,d;b.charAt(c)==="~"&&(c++,d=!0);if(b.charAt(c)!=='"'&&b.charAt(c)!=="'")return;d&&t("~");if(a=t(/^"((?:[^"\\\r\n]|\\.)*)"|'((?:[^'\\\r\n]|\\.)*)'/))return new e.Quoted(a[0],a[1]||a[2],d)},keyword:function(){var a;if(a=t(/^[_A-Za-z-][_A-Za-z0-9-]*/))return e.colors.hasOwnProperty(a)?new e.Color(e.colors[a].slice(1)):new e.Keyword(a)},call:function(){var b,c,d=f;if(!(b=/^([\w-]+|%|progid:[\w\.]+)\(/.exec(k[g])))return;b=b[1].toLowerCase();if(b==="url")return null;f+=b.length;if(b==="alpha")return t(this.alpha);t("("),c=t(this.entities.arguments);if(!t(")"))return;if(b)return new e.Call(b,c,d,a.filename)},arguments:function(){var a=[],b;while(b=t(this.entities.assignment)||t(this.expression)){a.push(b);if(!t(","))break}return a},literal:function(){return t(this.entities.dimension)||t(this.entities.color)||t(this.entities.quoted)},assignment:function(){var a,b;if((a=t(/^\w+(?=\s?=)/i))&&t("=")&&(b=t(this.entity)))return new e.Assignment(a,b)},url:function(){var a;if(b.charAt(f)!=="u"||!t(/^url\(/))return;return a=t(this.entities.quoted)||t(this.entities.variable)||t(this.entities.dataURI)||t(/^[-\w%@$\/.&=:;#+?~]+/)||"",u(")"),new e.URL(a.value||a.data||a instanceof e.Variable?a:new e.Anonymous(a),p.paths)},dataURI:function(){var a;if(t(/^data:/)){a={},a.mime=t(/^[^\/]+\/[^,;)]+/)||"",a.charset=t(/^;\s*charset=[^,;)]+/)||"",a.base64=t(/^;\s*base64/)||"",a.data=t(/^,\s*[^)]+/);if(a.data)return a}},variable:function(){var c,d=f;if(b.charAt(f)==="@"&&(c=t(/^@@?[\w-]+/)))return new e.Variable(c,d,a.filename)},color:function(){var a;if(b.charAt(f)==="#"&&(a=t(/^#([a-fA-F0-9]{6}|[a-fA-F0-9]{3})/)))return new e.Color(a[1])},dimension:function(){var a,c=b.charCodeAt(f);if(c>57||c<45||c===47)return;if(a=t(/^(-?\d*\.?\d+)(px|%|em|rem|pc|ex|in|deg|s|ms|pt|cm|mm|rad|grad|turn)?/))return new e.Dimension(a[1],a[2])},javascript:function(){var a,c=f,d;b.charAt(c)==="~"&&(c++,d=!0);if(b.charAt(c)!=="`")return;d&&t("~");if(a=t(/^`([^`]*)`/))return new e.JavaScript(a[1],f,d)}},variable:function(){var a;if(b.charAt(f)==="@"&&(a=t(/^(@[\w-]+)\s*:/)))return a[1]},shorthand:function(){var a,b;if(!w(/^[@\w.%-]+\/[@\w.-]+/))return;if((a=t(this.entity))&&t("/")&&(b=t(this.entity)))return new e.Shorthand(a,b)},mixin:{call:function(){var c=[],d,g,h,i=f,j=b.charAt(f),k=!1;if(j!=="."&&j!=="#")return;while(d=t(/^[#.](?:[\w-]|\\(?:[a-fA-F0-9]{1,6} ?|[^a-fA-F0-9]))+/))c.push(new e.Element(g,d,f)),g=t(">");t("(")&&(h=t(this.entities.arguments))&&t(")"),t(this.important)&&(k=!0);if(c.length>0&&(t(";")||w("}")))return new e.mixin.Call(c,h||[],i,a.filename,k)},definition:function(){var a,c=[],d,g,h,i,j,k=!1;if(b.charAt(f)!=="."&&b.charAt(f)!=="#"||w(/^[^{]*(;|})/))return;q();if(d=t(/^([#.](?:[\w-]|\\(?:[a-fA-F0-9]{1,6} ?|[^a-fA-F0-9]))+)\s*\(/)){a=d[1];do{if(b.charAt(f)==="."&&t(/^\.{3}/)){k=!0;break}if(!(h=t(this.entities.variable)||t(this.entities.literal)||t(this.entities.keyword)))break;if(h instanceof e.Variable)if(t(":"))i=u(this.expression,"expected expression"),c.push({name:h.name,value:i});else{if(t(/^\.{3}/)){c.push({name:h.name,variadic:!0}),k=!0;break}c.push({name:h.name})}else c.push({value:h})}while(t(","));u(")"),t(/^when/)&&(j=u(this.conditions,"expected condition")),g=t(this.block);if(g)return new e.mixin.Definition(a,c,g,j,k);r()}}},entity:function(){return t(this.entities.literal)||t(this.entities.variable)||t(this.entities.url)||t(this.entities.call)||t(this.entities.keyword)||t(this.entities.javascript)||t(this.comment)},end:function(){return t(";")||w("}")},alpha:function(){var a;if(!t(/^\(opacity=/i))return;if(a=t(/^\d+/)||t(this.entities.variable))return u(")"),new e.Alpha(a)},element:function(){var a,b,c,d;c=t(this.combinator),a=t(/^(?:\d+\.\d+|\d+)%/)||t(/^(?:[.#]?|:*)(?:[\w-]|\\(?:[a-fA-F0-9]{1,6} ?|[^a-fA-F0-9]))+/)||t("*")||t(this.attribute)||t(/^\([^)@]+\)/),a||t("(")&&(d=t(this.entities.variable))&&t(")")&&(a=new e.Paren(d));if(a)return new e.Element(c,a,f);if(c.value&&c.value.charAt(0)==="&")return new e.Element(c,null,f)},combinator:function(){var a,c=b.charAt(f);if(c===">"||c==="+"||c==="~"){f++;while(b.charAt(f)===" ")f++;return new e.Combinator(c)}if(c==="&"){a="&",f++,b.charAt(f)===" "&&(a="& ");while(b.charAt(f)===" ")f++;return new e.Combinator(a)}return b.charAt(f-1)===" "?new e.Combinator(" "):new e.Combinator(null)},selector:function(){var a,c,d=[],g,h;if(t("("))return a=t(this.entity),u(")"),new e.Selector([new e.Element("",a,f)]);while(c=t(this.element)){g=b.charAt(f),d.push(c);if(g==="{"||g==="}"||g===";"||g===",")break}if(d.length>0)return new e.Selector(d)},tag:function(){return t(/^[a-zA-Z][a-zA-Z-]*[0-9]?/)||t("*")},attribute:function(){var a="",b,c,d;if(!t("["))return;if(b=t(/^[a-zA-Z-]+/)||t(this.entities.quoted))(d=t(/^[|~*$^]?=/))&&(c=t(this.entities.quoted)||t(/^[\w-]+/))?a=[b,d,c.toCSS?c.toCSS():c].join(""):a=b;if(!t("]"))return;if(a)return"["+a+"]"},block:function(){var a;if(t("{")&&(a=t(this.primary))&&t("}"))return a},ruleset:function(){var b=[],c,d,g;q();while(c=t(this.selector)){b.push(c),t(this.comment);if(!t(","))break;t(this.comment)}if(b.length>0&&(d=t(this.block)))return new e.Ruleset(b,d,a.strictImports);j=f,r()},rule:function(){var a,c,d=b.charAt(f),h,l;q();if(d==="."||d==="#"||d==="&")return;if(a=t(this.variable)||t(this.property)){a.charAt(0)!="@"&&(l=/^([^@+\/'"*`(;{}-]*);/.exec(k[g]))?(f+=l[0].length-1,c=new e.Anonymous(l[1])):a==="font"?c=t(this.font):c=t(this.value),h=t(this.important);if(c&&t(this.end))return new e.Rule(a,c,h,i);j=f,r()}},"import":function(){var a,b,c=f;if(t(/^@import\s+/)&&(a=t(this.entities.quoted)||t(this.entities.url))){b=t(this.mediaFeatures);if(t(";"))return new e.Import(a,p,b,c)}},mediaFeature:function(){var a,b,c=[];do if(a=t(this.entities.keyword))c.push(a);else if(t("(")){b=t(this.property),a=t(this.entity);if(!t(")"))return null;if(b&&a)c.push(new e.Paren(new e.Rule(b,a,null,f,!0)));else if(a)c.push(new e.Paren(a));else return null}while(a);if(c.length>0)return new e.Expression(c)},mediaFeatures:function(){var a,b=[];do if(a=t(this.mediaFeature)){b.push(a);if(!t(","))break}else if(a=t(this.entities.variable)){b.push(a);if(!t(","))break}while(a);return b.length>0?b:null},media:function(){var a,b;if(t(/^@media/)){a=t(this.mediaFeatures);if(b=t(this.block))return new e.Media(b,a)}},directive:function(){var a,c,d,g,h,i;if(b.charAt(f)!=="@")return;if(c=t(this["import"])||t(this.media))return c;if(a=t(/^@page|@keyframes/)||t(/^@(?:-webkit-|-moz-|-o-|-ms-)[a-z0-9-]+/)){g=(t(/^[^{]+/)||"").trim();if(d=t(this.block))return new e.Directive(a+" "+g,d)}else if(a=t(/^@[-a-z]+/))if(a==="@font-face"){if(d=t(this.block))return new e.Directive(a,d)}else if((c=t(this.entity))&&t(";"))return new e.Directive(a,c)},font:function(){var a=[],b=[],c,d,f,g;while(g=t(this.shorthand)||t(this.entity))b.push(g);a.push(new e.Expression(b));if(t(","))while(g=t(this.expression)){a.push(g);if(!t(","))break}return new e.Value(a)},value:function(){var a,b=[],c;while(a=t(this.expression)){b.push(a);if(!t(","))break}if(b.length>0)return new e.Value(b)},important:function(){if(b.charAt(f)==="!")return t(/^! *important/)},sub:function(){var a;if(t("(")&&(a=t(this.expression))&&t(")"))return a},multiplication:function(){var a,b,c,d;if(a=t(this.operand)){while(!w(/^\/\*/)&&(c=t("/")||t("*"))&&(b=t(this.operand)))d=new e.Operation(c,[d||a,b]);return d||a}},addition:function(){var a,c,d,g;if(a=t(this.multiplication)){while((d=t(/^[-+]\s+/)||b.charAt(f-1)!=" "&&(t("+")||t("-")))&&(c=t(this.multiplication)))g=new e.Operation(d,[g||a,c]);return g||a}},conditions:function(){var a,b,c=f,d;if(a=t(this.condition)){while(t(",")&&(b=t(this.condition)))d=new e.Condition("or",d||a,b,c);return d||a}},condition:function(){var a,b,c,d,g=f,h=!1;t(/^not/)&&(h=!0),u("(");if(a=t(this.addition)||t(this.entities.keyword)||t(this.entities.quoted))return(d=t(/^(?:>=|=<|[<=>])/))?(b=t(this.addition)||t(this.entities.keyword)||t(this.entities.quoted))?c=new e.Condition(d,a,b,g,h):v("expected expression"):c=new e.Condition("=",a,new e.Keyword("true"),g,h),u(")"),t(/^and/)?new e.Condition("and",c,t(this.condition)):c},operand:function(){var a,c=b.charAt(f+1);b.charAt(f)==="-"&&(c==="@"||c==="(")&&(a=t("-"));var d=t(this.sub)||t(this.entities.dimension)||t(this.entities.color)||t(this.entities.variable)||t(this.entities.call);return a?new e.Operation("*",[new e.Dimension(-1),d]):d},expression:function(){var a,b,c=[],d;while(a=t(this.addition)||t(this.entity))c.push(a);if(c.length>0)return new e.Expression(c)},property:function(){var a;if(a=t(/^(\*?-?[-a-z_0-9]+)\s*:/))return a[1]}}}};if(d.mode==="browser"||d.mode==="rhino")d.Parser.importer=function(a,b,c,d){!/^([a-z]+:)?\//.test(a)&&b.length>0&&(a=b[0]+a),n({href:a,title:a,type:d.mime},function(e){e&&typeof d.errback=="function"?d.errback.call(null,a,b,c,d):c.apply(null,arguments)},!0)};(function(a){function b(b){return a.functions.hsla(b.h,b.s,b.l,b.a)}function c(b){if(b instanceof a.Dimension)return parseFloat(b.unit=="%"?b.value/100:b.value);if(typeof b=="number")return b;throw{error:"RuntimeError",message:"color functions take numbers as parameters"}}function d(a){return Math.min(1,Math.max(0,a))}a.functions={rgb:function(a,b,c){return this.rgba(a,b,c,1)},rgba:function(b,d,e,f){var g=[b,d,e].map(function(a){return c(a)}),f=c(f);return new a.Color(g,f)},hsl:function(a,b,c){return this.hsla(a,b,c,1)},hsla:function(a,b,d,e){function h(a){return a=a<0?a+1:a>1?a-1:a,a*6<1?g+(f-g)*a*6:a*2<1?f:a*3<2?g+(f-g)*(2/3-a)*6:g}a=c(a)%360/360,b=c(b),d=c(d),e=c(e);var f=d<=.5?d*(b+1):d+b-d*b,g=d*2-f;return this.rgba(h(a+1/3)*255,h(a)*255,h(a-1/3)*255,e)},hue:function(b){return new a.Dimension(Math.round(b.toHSL().h))},saturation:function(b){return new a.Dimension(Math.round(b.toHSL().s*100),"%")},lightness:function(b){return new a.Dimension(Math.round(b.toHSL().l*100),"%")},alpha:function(b){return new a.Dimension(b.toHSL().a)},saturate:function(a,c){var e=a.toHSL();return e.s+=c.value/100,e.s=d(e.s),b(e)},desaturate:function(a,c){var e=a.toHSL();return e.s-=c.value/100,e.s=d(e.s),b(e)},lighten:function(a,c){var e=a.toHSL();return e.l+=c.value/100,e.l=d(e.l),b(e)},darken:function(a,c){var e=a.toHSL();return e.l-=c.value/100,e.l=d(e.l),b(e)},fadein:function(a,c){var e=a.toHSL();return e.a+=c.value/100,e.a=d(e.a),b(e)},fadeout:function(a,c){var e=a.toHSL();return e.a-=c.value/100,e.a=d(e.a),b(e)},fade:function(a,c){var e=a.toHSL();return e.a=c.value/100,e.a=d(e.a),b(e)},spin:function(a,c){var d=a.toHSL(),e=(d.h+c.value)%360;return d.h=e<0?360+e:e,b(d)},mix:function(b,c,d){var e=d.value/100,f=e*2-1,g=b.toHSL().a-c.toHSL().a,h=((f*g==-1?f:(f+g)/(1+f*g))+1)/2,i=1-h,j=[b.rgb[0]*h+c.rgb[0]*i,b.rgb[1]*h+c.rgb[1]*i,b.rgb[2]*h+c.rgb[2]*i],k=b.alpha*e+c.alpha*(1-e);return new a.Color(j,k)},greyscale:function(b){return this.desaturate(b,new a.Dimension(100))},e:function(b){return new a.Anonymous(b instanceof a.JavaScript?b.evaluated:b)},escape:function(b){return new a.Anonymous(encodeURI(b.value).replace(/=/g,"%3D").replace(/:/g,"%3A").replace(/#/g,"%23").replace(/;/g,"%3B").replace(/\(/g,"%28").replace(/\)/g,"%29"))},"%":function(b){var c=Array.prototype.slice.call(arguments,1),d=b.value;for(var e=0;e<c.length;e++)d=d.replace(/%[sda]/i,function(a){var b=a.match(/s/i)?c[e].value:c[e].toCSS();return a.match(/[A-Z]$/)?encodeURIComponent(b):b});return d=d.replace(/%%/g,"%"),new a.Quoted('"'+d+'"',d)},round:function(a){return this._math("round",a)},ceil:function(a){return this._math("ceil",a)},floor:function(a){return this._math("floor",a)},_math:function(b,d){if(d instanceof a.Dimension)return new a.Dimension(Math[b](c(d)),d.unit);if(typeof d=="number")return Math[b](d);throw{type:"Argument",message:"argument must be a number"}},argb:function(b){return new a.Anonymous(b.toARGB())},percentage:function(b){return new a.Dimension(b.value*100,"%")},color:function(b){if(b instanceof a.Quoted)return new a.Color(b.value.slice(1));throw{type:"Argument",message:"argument must be a string"}},iscolor:function(b){return this._isa(b,a.Color)},isnumber:function(b){return this._isa(b,a.Dimension)},isstring:function(b){return this._isa(b,a.Quoted)},iskeyword:function(b){return this._isa(b,a.Keyword)},isurl:function(b){return this._isa(b,a.URL)},ispixel:function(b){return b instanceof a.Dimension&&b.unit==="px"?a.True:a.False},ispercentage:function(b){return b instanceof a.Dimension&&b.unit==="%"?a.True:a.False},isem:function(b){return b instanceof a.Dimension&&b.unit==="em"?a.True:a.False},_isa:function(b,c){return b instanceof c?a.True:a.False}}})(c("./tree")),function(a){a.colors={aliceblue:"#f0f8ff",antiquewhite:"#faebd7",aqua:"#00ffff",aquamarine:"#7fffd4",azure:"#f0ffff",beige:"#f5f5dc",bisque:"#ffe4c4",black:"#000000",blanchedalmond:"#ffebcd",blue:"#0000ff",blueviolet:"#8a2be2",brown:"#a52a2a",burlywood:"#deb887",cadetblue:"#5f9ea0",chartreuse:"#7fff00",chocolate:"#d2691e",coral:"#ff7f50",cornflowerblue:"#6495ed",cornsilk:"#fff8dc",crimson:"#dc143c",cyan:"#00ffff",darkblue:"#00008b",darkcyan:"#008b8b",darkgoldenrod:"#b8860b",darkgray:"#a9a9a9",darkgrey:"#a9a9a9",darkgreen:"#006400",darkkhaki:"#bdb76b",darkmagenta:"#8b008b",darkolivegreen:"#556b2f",darkorange:"#ff8c00",darkorchid:"#9932cc",darkred:"#8b0000",darksalmon:"#e9967a",darkseagreen:"#8fbc8f",darkslateblue:"#483d8b",darkslategray:"#2f4f4f",darkslategrey:"#2f4f4f",darkturquoise:"#00ced1",darkviolet:"#9400d3",deeppink:"#ff1493",deepskyblue:"#00bfff",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1e90ff",firebrick:"#b22222",floralwhite:"#fffaf0",forestgreen:"#228b22",fuchsia:"#ff00ff",gainsboro:"#dcdcdc",ghostwhite:"#f8f8ff",gold:"#ffd700",goldenrod:"#daa520",gray:"#808080",grey:"#808080",green:"#008000",greenyellow:"#adff2f",honeydew:"#f0fff0",hotpink:"#ff69b4",indianred:"#cd5c5c",indigo:"#4b0082",ivory:"#fffff0",khaki:"#f0e68c",lavender:"#e6e6fa",lavenderblush:"#fff0f5",lawngreen:"#7cfc00",lemonchiffon:"#fffacd",lightblue:"#add8e6",lightcoral:"#f08080",lightcyan:"#e0ffff",lightgoldenrodyellow:"#fafad2",lightgray:"#d3d3d3",lightgrey:"#d3d3d3",lightgreen:"#90ee90",lightpink:"#ffb6c1",lightsalmon:"#ffa07a",lightseagreen:"#20b2aa",lightskyblue:"#87cefa",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#b0c4de",lightyellow:"#ffffe0",lime:"#00ff00",limegreen:"#32cd32",linen:"#faf0e6",magenta:"#ff00ff",maroon:"#800000",mediumaquamarine:"#66cdaa",mediumblue:"#0000cd",mediumorchid:"#ba55d3",mediumpurple:"#9370d8",mediumseagreen:"#3cb371",mediumslateblue:"#7b68ee",mediumspringgreen:"#00fa9a",mediumturquoise:"#48d1cc",mediumvioletred:"#c71585",midnightblue:"#191970",mintcream:"#f5fffa",mistyrose:"#ffe4e1",moccasin:"#ffe4b5",navajowhite:"#ffdead",navy:"#000080",oldlace:"#fdf5e6",olive:"#808000",olivedrab:"#6b8e23",orange:"#ffa500",orangered:"#ff4500",orchid:"#da70d6",palegoldenrod:"#eee8aa",palegreen:"#98fb98",paleturquoise:"#afeeee",palevioletred:"#d87093",papayawhip:"#ffefd5",peachpuff:"#ffdab9",peru:"#cd853f",pink:"#ffc0cb",plum:"#dda0dd",powderblue:"#b0e0e6",purple:"#800080",red:"#ff0000",rosybrown:"#bc8f8f",royalblue:"#4169e1",saddlebrown:"#8b4513",salmon:"#fa8072",sandybrown:"#f4a460",seagreen:"#2e8b57",seashell:"#fff5ee",sienna:"#a0522d",silver:"#c0c0c0",skyblue:"#87ceeb",slateblue:"#6a5acd",slategray:"#708090",slategrey:"#708090",snow:"#fffafa",springgreen:"#00ff7f",steelblue:"#4682b4",tan:"#d2b48c",teal:"#008080",thistle:"#d8bfd8",tomato:"#ff6347",turquoise:"#40e0d0",violet:"#ee82ee",wheat:"#f5deb3",white:"#ffffff",whitesmoke:"#f5f5f5",yellow:"#ffff00",yellowgreen:"#9acd32"}}(c("./tree")),function(a){a.Alpha=function(a){this.value=a},a.Alpha.prototype={toCSS:function(){return"alpha(opacity="+(this.value.toCSS?this.value.toCSS():this.value)+")"},eval:function(a){return this.value.eval&&(this.value=this.value.eval(a)),this}}}(c("../tree")),function(a){a.Anonymous=function(a){this.value=a.value||a},a.Anonymous.prototype={toCSS:function(){return this.value},eval:function(){return this}}}(c("../tree")),function(a){a.Assignment=function(a,b){this.key=a,this.value=b},a.Assignment.prototype={toCSS:function(){return this.key+"="+(this.value.toCSS?this.value.toCSS():this.value)},eval:function(a){return this.value.eval&&(this.value=this.value.eval(a)),this}}}(c("../tree")),function(a){a.Call=function(a,b,c,d){this.name=a,this.args=b,this.index=c,this.filename=d},a.Call.prototype={eval:function(b){var c=this.args.map(function(a){return a.eval(b)});if(!(this.name in a.functions))return new a.Anonymous(this.name+"("+c.map(function(a){return a.toCSS()}).join(", ")+")");try{return a.functions[this.name].apply(a.functions,c)}catch(d){throw{type:d.type||"Runtime",message:"error evaluating function `"+this.name+"`"+(d.message?": "+d.message:""),index:this.index,filename:this.filename}}},toCSS:function(a){return this.eval(a).toCSS()}}}(c("../tree")),function(a){a.Color=function(a,b){Array.isArray(a)?this.rgb=a:a.length==6?this.rgb=a.match(/.{2}/g).map(function(a){return parseInt(a,16)}):this.rgb=a.split("").map(function(a){return parseInt(a+a,16)}),this.alpha=typeof b=="number"?b:1},a.Color.prototype={eval:function(){return this},toCSS:function(){return this.alpha<1?"rgba("+this.rgb.map(function(a){return Math.round(a)}).concat(this.alpha).join(", ")+")":"#"+this.rgb.map(function(a){return a=Math.round(a),a=(a>255?255:a<0?0:a).toString(16),a.length===1?"0"+a:a}).join("")},operate:function(b,c){var d=[];c instanceof a.Color||(c=c.toColor());for(var e=0;e<3;e++)d[e]=a.operate(b,this.rgb[e],c.rgb[e]);return new a.Color(d,this.alpha+c.alpha)},toHSL:function(){var a=this.rgb[0]/255,b=this.rgb[1]/255,c=this.rgb[2]/255,d=this.alpha,e=Math.max(a,b,c),f=Math.min(a,b,c),g,h,i=(e+f)/2,j=e-f;if(e===f)g=h=0;else{h=i>.5?j/(2-e-f):j/(e+f);switch(e){case a:g=(b-c)/j+(b<c?6:0);break;case b:g=(c-a)/j+2;break;case c:g=(a-b)/j+4}g/=6}return{h:g*360,s:h,l:i,a:d}},toARGB:function(){var a=[Math.round(this.alpha*255)].concat(this.rgb);return"#"+a.map(function(a){return a=Math.round(a),a=(a>255?255:a<0?0:a).toString(16),a.length===1?"0"+a:a}).join("")}}}(c("../tree")),function(a){a.Comment=function(a,b){this.value=a,this.silent=!!b},a.Comment.prototype={toCSS:function(a){return a.compress?"":this.value},eval:function(){return this}}}(c("../tree")),function(a){a.Condition=function(a,b,c,d,e){this.op=a.trim(),this.lvalue=b,this.rvalue=c,this.index=d,this.negate=e},a.Condition.prototype.eval=function(a){var b=this.lvalue.eval(a),c=this.rvalue.eval(a),d=this.index,e,e=function(a){switch(a){case"and":return b&&c;case"or":return b||c;default:if(b.compare)e=b.compare(c);else if(c.compare)e=c.compare(b);else throw{type:"Type",message:"Unable to perform comparison",index:d};switch(e){case-1:return a==="<"||a==="=<";case 0:return a==="="||a===">="||a==="=<";case 1:return a===">"||a===">="}}}(this.op);return this.negate?!e:e}}(c("../tree")),function(a){a.Dimension=function(a,b){this.value=parseFloat(a),this.unit=b||null},a.Dimension.prototype={eval:function(){return this},toColor:function(){return new a.Color([this.value,this.value,this.value])},toCSS:function(){var a=this.value+this.unit;return a},operate:function(b,c){return new a.Dimension(a.operate(b,this.value,c.value),this.unit||c.unit)},compare:function(b){return b instanceof a.Dimension?b.value>this.value?-1:b.value<this.value?1:0:-1}}}(c("../tree")),function(a){a.Directive=function(b,c,d){this.name=b,Array.isArray(c)?(this.ruleset=new a.Ruleset([],c),this.ruleset.allowImports=!0):this.value=c},a.Directive.prototype={toCSS:function(a,b){return this.ruleset?(this.ruleset.root=!0,this.name+(b.compress?"{":" {\n ")+this.ruleset.toCSS(a,b).trim().replace(/\n/g,"\n ")+(b.compress?"}":"\n}\n")):this.name+" "+this.value.toCSS()+";\n"},eval:function(a){return a.frames.unshift(this),this.ruleset=this.ruleset&&this.ruleset.eval(a),a.frames.shift(),this},variable:function(b){return a.Ruleset.prototype.variable.call(this.ruleset,b)},find:function(){return a.Ruleset.prototype.find.apply(this.ruleset,arguments)},rulesets:function(){return a.Ruleset.prototype.rulesets.apply(this.ruleset)}}}(c("../tree")),function(a){a.Element=function(b,c,d){this.combinator=b instanceof a.Combinator?b:new a.Combinator(b),typeof c=="string"?this.value=c.trim():c?this.value=c:this.value="",this.index=d},a.Element.prototype.eval=function(b){return new a.Element(this.combinator,this.value.eval?this.value.eval(b):this.value,this.index)},a.Element.prototype.toCSS=function(a){return this.combinator.toCSS(a||{})+(this.value.toCSS?this.value.toCSS(a):this.value)},a.Combinator=function(a){a===" "?this.value=" ":a==="& "?this.value="& ":this.value=a?a.trim():""},a.Combinator.prototype.toCSS=function(a){return{"":""," ":" ","&":"","& ":" ",":":" :","+":a.compress?"+":" + ","~":a.compress?"~":" ~ ",">":a.compress?">":" > "}[this.value]}}(c("../tree")),function(a){a.Expression=function(a){this.value=a},a.Expression.prototype={eval:function(b){return this.value.length>1?new a.Expression(this.value.map(function(a){return a.eval(b)})):this.value.length===1?this.value[0].eval(b):this},toCSS:function(a){return this.value.map(function(b){return b.toCSS?b.toCSS(a):""}).join(" ")}}}(c("../tree")),function(a){a.Import=function(b,c,d,e){var f=this;this.index=e,this._path=b,this.features=d&&new a.Value(d),b instanceof a.Quoted?this.path=/\.(le?|c)ss(\?.*)?$/.test(b.value)?b.value:b.value+".less":this.path=b.value.value||b.value,this.css=/css(\?.*)?$/.test(this.path),this.css||c.push(this.path,function(b,c){b&&(b.index=e),f.root=c||new a.Ruleset([],[])})},a.Import.prototype={toCSS:function(a){var b=this.features?" "+this.features.toCSS(a):"";return this.css?"@import "+this._path.toCSS()+b+";\n":""},eval:function(b){var c,d=this.features&&this.features.eval(b);if(this.css)return this;c=new a.Ruleset([],this.root.rules.slice(0));for(var e=0;e<c.rules.length;e++)c.rules[e]instanceof a.Import&&Array.prototype
+.splice.apply(c.rules,[e,1].concat(c.rules[e].eval(b)));return this.features?new a.Media(c.rules,this.features.value):c.rules}}}(c("../tree")),function(a){a.JavaScript=function(a,b,c){this.escaped=c,this.expression=a,this.index=b},a.JavaScript.prototype={eval:function(b){var c,d=this,e={},f=this.expression.replace(/@\{([\w-]+)\}/g,function(c,e){return a.jsify((new a.Variable("@"+e,d.index)).eval(b))});try{f=new Function("return ("+f+")")}catch(g){throw{message:"JavaScript evaluation error: `"+f+"`",index:this.index}}for(var h in b.frames[0].variables())e[h.slice(1)]={value:b.frames[0].variables()[h].value,toJS:function(){return this.value.eval(b).toCSS()}};try{c=f.call(e)}catch(g){throw{message:"JavaScript evaluation error: '"+g.name+": "+g.message+"'",index:this.index}}return typeof c=="string"?new a.Quoted('"'+c+'"',c,this.escaped,this.index):Array.isArray(c)?new a.Anonymous(c.join(", ")):new a.Anonymous(c)}}}(c("../tree")),function(a){a.Keyword=function(a){this.value=a},a.Keyword.prototype={eval:function(){return this},toCSS:function(){return this.value},compare:function(b){return b instanceof a.Keyword?b.value===this.value?0:1:-1}},a.True=new a.Keyword("true"),a.False=new a.Keyword("false")}(c("../tree")),function(a){a.Media=function(b,c){var d=new a.Element("&",null,0),e=[new a.Selector([d])];this.features=new a.Value(c),this.ruleset=new a.Ruleset(e,b),this.ruleset.allowImports=!0},a.Media.prototype={toCSS:function(a,b){var c=this.features.toCSS(b);return this.ruleset.root=a.length===0||a[0].multiMedia,"@media "+c+(b.compress?"{":" {\n ")+this.ruleset.toCSS(a,b).trim().replace(/\n/g,"\n ")+(b.compress?"}":"\n}\n")},eval:function(b){b.mediaBlocks||(b.mediaBlocks=[],b.mediaPath=[]);var c=b.mediaBlocks.length;b.mediaPath.push(this),b.mediaBlocks.push(this);var d=new a.Media([],[]);return d.features=this.features.eval(b),b.frames.unshift(this.ruleset),d.ruleset=this.ruleset.eval(b),b.frames.shift(),b.mediaBlocks[c]=d,b.mediaPath.pop(),b.mediaPath.length===0?d.evalTop(b):d.evalNested(b)},variable:function(b){return a.Ruleset.prototype.variable.call(this.ruleset,b)},find:function(){return a.Ruleset.prototype.find.apply(this.ruleset,arguments)},rulesets:function(){return a.Ruleset.prototype.rulesets.apply(this.ruleset)},evalTop:function(b){var c=this;if(b.mediaBlocks.length>1){var d=new a.Element("&",null,0),e=[new a.Selector([d])];c=new a.Ruleset(e,b.mediaBlocks),c.multiMedia=!0}return delete b.mediaBlocks,delete b.mediaPath,c},evalNested:function(b){var c,d,e=b.mediaPath.concat([this]);for(c=0;c<e.length;c++)d=e[c].features instanceof a.Value?e[c].features.value:e[c].features,e[c]=Array.isArray(d)?d:[d];return this.features=new a.Value(this.permute(e).map(function(b){b=b.map(function(b){return b.toCSS?b:new a.Anonymous(b)});for(c=b.length-1;c>0;c--)b.splice(c,0,new a.Anonymous("and"));return new a.Expression(b)})),new a.Ruleset([],[])},permute:function(a){if(a.length===0)return[];if(a.length===1)return a[0];var b=[],c=this.permute(a.slice(1));for(var d=0;d<c.length;d++)for(var e=0;e<a[0].length;e++)b.push([a[0][e]].concat(c[d]));return b}}}(c("../tree")),function(a){a.mixin={},a.mixin.Call=function(b,c,d,e,f){this.selector=new a.Selector(b),this.arguments=c,this.index=d,this.filename=e,this.important=f},a.mixin.Call.prototype={eval:function(a){var b,c,d=[],e=!1;for(var f=0;f<a.frames.length;f++)if((b=a.frames[f].find(this.selector)).length>0){c=this.arguments&&this.arguments.map(function(b){return b.eval(a)});for(var g=0;g<b.length;g++)if(b[g].match(c,a))try{Array.prototype.push.apply(d,b[g].eval(a,this.arguments,this.important).rules),e=!0}catch(h){throw{message:h.message,index:this.index,filename:this.filename,stack:h.stack}}if(e)return d;throw{type:"Runtime",message:"No matching definition was found for `"+this.selector.toCSS().trim()+"("+this.arguments.map(function(a){return a.toCSS()}).join(", ")+")`",index:this.index,filename:this.filename}}throw{type:"Name",message:this.selector.toCSS().trim()+" is undefined",index:this.index,filename:this.filename}}},a.mixin.Definition=function(b,c,d,e,f){this.name=b,this.selectors=[new a.Selector([new a.Element(null,b)])],this.params=c,this.condition=e,this.variadic=f,this.arity=c.length,this.rules=d,this._lookups={},this.required=c.reduce(function(a,b){return!b.name||b.name&&!b.value?a+1:a},0),this.parent=a.Ruleset.prototype,this.frames=[]},a.mixin.Definition.prototype={toCSS:function(){return""},variable:function(a){return this.parent.variable.call(this,a)},variables:function(){return this.parent.variables.call(this)},find:function(){return this.parent.find.apply(this,arguments)},rulesets:function(){return this.parent.rulesets.apply(this)},evalParams:function(b,c){var d=new a.Ruleset(null,[]),e;for(var f=0,g,h;f<this.params.length;f++)if(h=this.params[f].name)if(this.params[f].variadic&&c){e=[];for(var i=f;i<c.length;i++)e.push(c[i].eval(b));d.rules.unshift(new a.Rule(h,(new a.Expression(e)).eval(b)))}else if(g=c&&c[f]||this.params[f].value)d.rules.unshift(new a.Rule(h,g.eval(b)));else throw{type:"Runtime",message:"wrong number of arguments for "+this.name+" ("+c.length+" for "+this.arity+")"};return d},eval:function(b,c,d){var e=this.evalParams(b,c),f,g=[],h,i;for(var j=0;j<Math.max(this.params.length,c&&c.length);j++)g.push(c[j]||this.params[j].value);return e.rules.unshift(new a.Rule("@arguments",(new a.Expression(g)).eval(b))),h=d?this.rules.map(function(b){return new a.Rule(b.name,b.value,"!important",b.index)}):this.rules.slice(0),(new a.Ruleset(null,h)).eval({frames:[this,e].concat(this.frames,b.frames)})},match:function(a,b){var c=a&&a.length||0,d,e;if(!this.variadic){if(c<this.required)return!1;if(c>this.params.length)return!1;if(this.required>0&&c>this.params.length)return!1}if(this.condition&&!this.condition.eval({frames:[this.evalParams(b,a)].concat(b.frames)}))return!1;d=Math.min(c,this.arity);for(var f=0;f<d;f++)if(!this.params[f].name&&a[f].eval(b).toCSS()!=this.params[f].value.eval(b).toCSS())return!1;return!0}}}(c("../tree")),function(a){a.Operation=function(a,b){this.op=a.trim(),this.operands=b},a.Operation.prototype.eval=function(b){var c=this.operands[0].eval(b),d=this.operands[1].eval(b),e;if(c instanceof a.Dimension&&d instanceof a.Color)if(this.op==="*"||this.op==="+")e=d,d=c,c=e;else throw{name:"OperationError",message:"Can't substract or divide a color from a number"};return c.operate(this.op,d)},a.operate=function(a,b,c){switch(a){case"+":return b+c;case"-":return b-c;case"*":return b*c;case"/":return b/c}}}(c("../tree")),function(a){a.Paren=function(a){this.value=a},a.Paren.prototype={toCSS:function(a){return"("+this.value.toCSS(a)+")"},eval:function(b){return new a.Paren(this.value.eval(b))}}}(c("../tree")),function(a){a.Quoted=function(a,b,c,d){this.escaped=c,this.value=b||"",this.quote=a.charAt(0),this.index=d},a.Quoted.prototype={toCSS:function(){return this.escaped?this.value:this.quote+this.value+this.quote},eval:function(b){var c=this,d=this.value.replace(/`([^`]+)`/g,function(d,e){return(new a.JavaScript(e,c.index,!0)).eval(b).value}).replace(/@\{([\w-]+)\}/g,function(d,e){var f=(new a.Variable("@"+e,c.index)).eval(b);return"value"in f?f.value:f.toCSS()});return new a.Quoted(this.quote+d+this.quote,d,this.escaped,this.index)}}}(c("../tree")),function(a){a.Rule=function(b,c,d,e,f){this.name=b,this.value=c instanceof a.Value?c:new a.Value([c]),this.important=d?" "+d.trim():"",this.index=e,this.inline=f||!1,b.charAt(0)==="@"?this.variable=!0:this.variable=!1},a.Rule.prototype.toCSS=function(a){return this.variable?"":this.name+(a.compress?":":": ")+this.value.toCSS(a)+this.important+(this.inline?"":";")},a.Rule.prototype.eval=function(b){return new a.Rule(this.name,this.value.eval(b),this.important,this.index,this.inline)},a.Shorthand=function(a,b){this.a=a,this.b=b},a.Shorthand.prototype={toCSS:function(a){return this.a.toCSS(a)+"/"+this.b.toCSS(a)},eval:function(){return this}}}(c("../tree")),function(a){a.Ruleset=function(a,b,c){this.selectors=a,this.rules=b,this._lookups={},this.strictImports=c},a.Ruleset.prototype={eval:function(b){var c=this.selectors&&this.selectors.map(function(a){return a.eval(b)}),d=new a.Ruleset(c,this.rules.slice(0),this.strictImports);d.root=this.root,d.allowImports=this.allowImports,b.frames.unshift(d);if(d.root||d.allowImports||!d.strictImports)for(var e=0;e<d.rules.length;e++)d.rules[e]instanceof a.Import&&Array.prototype.splice.apply(d.rules,[e,1].concat(d.rules[e].eval(b)));for(var e=0;e<d.rules.length;e++)d.rules[e]instanceof a.mixin.Definition&&(d.rules[e].frames=b.frames.slice(0));for(var e=0;e<d.rules.length;e++)d.rules[e]instanceof a.mixin.Call&&Array.prototype.splice.apply(d.rules,[e,1].concat(d.rules[e].eval(b)));for(var e=0,f;e<d.rules.length;e++)f=d.rules[e],f instanceof a.mixin.Definition||(d.rules[e]=f.eval?f.eval(b):f);return b.frames.shift(),d},match:function(a){return!a||a.length===0},variables:function(){return this._variables?this._variables:this._variables=this.rules.reduce(function(b,c){return c instanceof a.Rule&&c.variable===!0&&(b[c.name]=c),b},{})},variable:function(a){return this.variables()[a]},rulesets:function(){return this._rulesets?this._rulesets:this._rulesets=this.rules.filter(function(b){return b instanceof a.Ruleset||b instanceof a.mixin.Definition})},find:function(b,c){c=c||this;var d=[],e,f,g=b.toCSS();return g in this._lookups?this._lookups[g]:(this.rulesets().forEach(function(e){if(e!==c)for(var g=0;g<e.selectors.length;g++)if(f=b.match(e.selectors[g])){b.elements.length>e.selectors[g].elements.length?Array.prototype.push.apply(d,e.find(new a.Selector(b.elements.slice(1)),c)):d.push(e);break}}),this._lookups[g]=d)},toCSS:function(b,c){var d=[],e=[],f=[],g=[],h,i;this.root||(b.length===0?g=this.selectors.map(function(a){return[a]}):this.joinSelectors(g,b,this.selectors));for(var j=0;j<this.rules.length;j++)i=this.rules[j],i.rules||i instanceof a.Directive||i instanceof a.Media?f.push(i.toCSS(g,c)):i instanceof a.Comment?i.silent||(this.root?f.push(i.toCSS(c)):e.push(i.toCSS(c))):i.toCSS&&!i.variable?e.push(i.toCSS(c)):i.value&&!i.variable&&e.push(i.value.toString());return f=f.join(""),this.root?d.push(e.join(c.compress?"":"\n")):e.length>0&&(h=g.map(function(a){return a.map(function(a){return a.toCSS(c)}).join("").trim()}).join(c.compress?",":",\n"),d.push(h,(c.compress?"{":" {\n ")+e.join(c.compress?"":"\n ")+(c.compress?"}":"\n}\n"))),d.push(f),d.join("")+(c.compress?"\n":"")},joinSelectors:function(a,b,c){for(var d=0;d<c.length;d++)this.joinSelector(a,b,c[d])},joinSelector:function(b,c,d){var e=[],f=[],g=[],h=[],i=!1,j;for(var k=0;k<d.elements.length;k++)j=d.elements[k],j.combinator.value.charAt(0)==="&"&&(i=!0),i?h.push(j):g.push(j);i||(h=g,g=[]),g.length>0&&e.push(new a.Selector(g)),h.length>0&&f.push(new a.Selector(h));for(var l=0;l<c.length;l++)b.push(e.concat(c[l]).concat(f))}}}(c("../tree")),function(a){a.Selector=function(a){this.elements=a,this.elements[0].combinator.value===""&&(this.elements[0].combinator.value=" ")},a.Selector.prototype.match=function(a){var b=this.elements.length,c=a.elements.length,d=Math.min(b,c);if(b<c)return!1;for(var e=0;e<d;e++)if(this.elements[e].value!==a.elements[e].value)return!1;return!0},a.Selector.prototype.eval=function(b){return new a.Selector(this.elements.map(function(a){return a.eval(b)}))},a.Selector.prototype.toCSS=function(a){return this._css?this._css:this._css=this.elements.map(function(b){return typeof b=="string"?" "+b.trim():b.toCSS(a)}).join("")}}(c("../tree")),function(b){b.URL=function(b,c){b.data?this.attrs=b:(typeof a!="undefined"&&!/^(?:https?:\/\/|file:\/\/|data:|\/)/.test(b.value)&&c.length>0&&(b.value=c[0]+(b.value.charAt(0)==="/"?b.value.slice(1):b.value)),this.value=b,this.paths=c)},b.URL.prototype={toCSS:function(){return"url("+(this.attrs?"data:"+this.attrs.mime+this.attrs.charset+this.attrs.base64+this.attrs.data:this.value.toCSS())+")"},eval:function(a){return this.attrs?this:new b.URL(this.value.eval(a),this.paths)}}}(c("../tree")),function(a){a.Value=function(a){this.value=a,this.is="value"},a.Value.prototype={eval:function(b){return this.value.length===1?this.value[0].eval(b):new a.Value(this.value.map(function(a){return a.eval(b)}))},toCSS:function(a){return this.value.map(function(b){return b.toCSS(a)}).join(a.compress?",":", ")}}}(c("../tree")),function(a){a.Variable=function(a,b,c){this.name=a,this.index=b,this.file=c},a.Variable.prototype={eval:function(b){var c,d,e=this.name;e.indexOf("@@")==0&&(e="@"+(new a.Variable(e.slice(1))).eval(b).value);if(c=a.find(b.frames,function(a){if(d=a.variable(e))return d.value.eval(b)}))return c;throw{type:"Name",message:"variable "+e+" is undefined",filename:this.file,index:this.index}}}}(c("../tree")),function(a){a.find=function(a,b){for(var c=0,d;c<a.length;c++)if(d=b.call(a,a[c]))return d;return null},a.jsify=function(a){return Array.isArray(a.value)&&a.value.length>1?"["+a.value.map(function(a){return a.toCSS(!1)}).join(", ")+"]":a.toCSS(!1)}}(c("./tree"));var f=location.protocol==="file:"||location.protocol==="chrome:"||location.protocol==="chrome-extension:"||location.protocol==="resource:";d.env=d.env||(location.hostname=="127.0.0.1"||location.hostname=="0.0.0.0"||location.hostname=="localhost"||location.port.length>0||f?"development":"production"),d.async=!1,d.poll=d.poll||(f?1e3:1500),d.watch=function(){return this.watchMode=!0},d.unwatch=function(){return this.watchMode=!1},d.env==="development"?(d.optimization=0,/!watch/.test(location.hash)&&d.watch(),d.watchTimer=setInterval(function(){d.watchMode&&m(function(a,b,c,d,e){b&&p(b.toCSS(),d,e.lastModified)})},d.poll)):d.optimization=3;var g;try{g=typeof a.localStorage=="undefined"?null:a.localStorage}catch(h){g=null}var i=document.getElementsByTagName("link"),j=/^text\/(x-)?less$/;d.sheets=[];for(var k=0;k<i.length;k++)(i[k].rel==="stylesheet/less"||i[k].rel.match(/stylesheet/)&&i[k].type.match(j))&&d.sheets.push(i[k]);d.refresh=function(a){var b,c;b=c=new Date,m(function(a,d,e,f,g){g.local?t("loading "+f.href+" from cache."):(t("parsed "+f.href+" successfully."),p(d.toCSS(),f,g.lastModified)),t("css for "+f.href+" generated in "+(new Date-c)+"ms"),g.remaining===0&&t("css generated in "+(new Date-b)+"ms"),c=new Date},a),l()},d.refreshStyles=l,d.refresh(d.env==="development")})(window); \ No newline at end of file
diff --git a/module/web/static/js/libs/lodash-0.5.2.js b/module/web/static/js/libs/lodash-0.5.2.js
new file mode 100644
index 000000000..3c5448223
--- /dev/null
+++ b/module/web/static/js/libs/lodash-0.5.2.js
@@ -0,0 +1,4263 @@
+/*!
+ * Lo-Dash v0.5.2 <http://lodash.com>
+ * Copyright 2012 John-David Dalton <http://allyoucanleet.com/>
+ * Based on Underscore.js 1.3.3, copyright 2009-2012 Jeremy Ashkenas, DocumentCloud Inc.
+ * <http://documentcloud.github.com/underscore>
+ * Available under MIT license <http://lodash.com/license>
+ */
+;(function(window, undefined) {
+ 'use strict';
+
+ /**
+ * Used to cache the last `_.templateSettings.evaluate` delimiter to avoid
+ * unnecessarily assigning `reEvaluateDelimiter` a new generated regexp.
+ * Assigned in `_.template`.
+ */
+ var lastEvaluateDelimiter;
+
+ /**
+ * Used to cache the last template `options.variable` to avoid unnecessarily
+ * assigning `reDoubleVariable` a new generated regexp. Assigned in `_.template`.
+ */
+ var lastVariable;
+
+ /**
+ * Used to match potentially incorrect data object references, like `obj.obj`,
+ * in compiled templates. Assigned in `_.template`.
+ */
+ var reDoubleVariable;
+
+ /**
+ * Used to match "evaluate" delimiters, including internal delimiters,
+ * in template text. Assigned in `_.template`.
+ */
+ var reEvaluateDelimiter;
+
+ /** Detect free variable `exports` */
+ var freeExports = typeof exports == 'object' && exports &&
+ (typeof global == 'object' && global && global == global.global && (window = global), exports);
+
+ /** Native prototype shortcuts */
+ var ArrayProto = Array.prototype,
+ BoolProto = Boolean.prototype,
+ ObjectProto = Object.prototype,
+ NumberProto = Number.prototype,
+ StringProto = String.prototype;
+
+ /** Used to generate unique IDs */
+ var idCounter = 0;
+
+ /** Used to restore the original `_` reference in `noConflict` */
+ var oldDash = window._;
+
+ /** Used to detect delimiter values that should be processed by `tokenizeEvaluate` */
+ var reComplexDelimiter = /[-+=!~*%&^<>|{(\/]|\[\D|\b(?:delete|in|instanceof|new|typeof|void)\b/;
+
+ /** Used to match empty string literals in compiled template source */
+ var reEmptyStringLeading = /\b__p \+= '';/g,
+ reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
+ reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
+
+ /** Used to match regexp flags from their coerced string values */
+ var reFlags = /\w*$/;
+
+ /** Used to insert the data object variable into compiled template source */
+ var reInsertVariable = /(?:__e|__t = )\(\s*(?![\d\s"']|this\.)/g;
+
+ /** Used to detect if a method is native */
+ var reNative = RegExp('^' +
+ (ObjectProto.valueOf + '')
+ .replace(/[.*+?^=!:${}()|[\]\/\\]/g, '\\$&')
+ .replace(/valueOf|for [^\]]+/g, '.+?') + '$'
+ );
+
+ /** Used to match tokens in template text */
+ var reToken = /__token__(\d+)/g;
+
+ /** Used to match unescaped characters in strings for inclusion in HTML */
+ var reUnescapedHtml = /[&<"']/g;
+
+ /** Used to match unescaped characters in compiled string literals */
+ var reUnescapedString = /['\n\r\t\u2028\u2029\\]/g;
+
+ /** Used to fix the JScript [[DontEnum]] bug */
+ var shadowed = [
+ 'constructor', 'hasOwnProperty', 'isPrototypeOf', 'propertyIsEnumerable',
+ 'toLocaleString', 'toString', 'valueOf'
+ ];
+
+ /** Used to make template sourceURLs easier to identify */
+ var templateCounter = 0;
+
+ /** Used to replace template delimiters */
+ var token = '__token__';
+
+ /** Used to store tokenized template text snippets */
+ var tokenized = [];
+
+ /** Native method shortcuts */
+ var concat = ArrayProto.concat,
+ hasOwnProperty = ObjectProto.hasOwnProperty,
+ push = ArrayProto.push,
+ propertyIsEnumerable = ObjectProto.propertyIsEnumerable,
+ slice = ArrayProto.slice,
+ toString = ObjectProto.toString;
+
+ /* Native method shortcuts for methods with the same name as other `lodash` methods */
+ var nativeBind = reNative.test(nativeBind = slice.bind) && nativeBind,
+ nativeIsArray = reNative.test(nativeIsArray = Array.isArray) && nativeIsArray,
+ nativeIsFinite = window.isFinite,
+ nativeKeys = reNative.test(nativeKeys = Object.keys) && nativeKeys;
+
+ /** `Object#toString` result shortcuts */
+ var argsClass = '[object Arguments]',
+ arrayClass = '[object Array]',
+ boolClass = '[object Boolean]',
+ dateClass = '[object Date]',
+ funcClass = '[object Function]',
+ numberClass = '[object Number]',
+ objectClass = '[object Object]',
+ regexpClass = '[object RegExp]',
+ stringClass = '[object String]';
+
+ /** Timer shortcuts */
+ var clearTimeout = window.clearTimeout,
+ setTimeout = window.setTimeout;
+
+ /**
+ * Detect the JScript [[DontEnum]] bug:
+ * In IE < 9 an objects own properties, shadowing non-enumerable ones, are
+ * made non-enumerable as well.
+ */
+ var hasDontEnumBug;
+
+ /** Detect if own properties are iterated after inherited properties (IE < 9) */
+ var iteratesOwnLast;
+
+ /** Detect if an `arguments` object's indexes are non-enumerable (IE < 9) */
+ var noArgsEnum = true;
+
+ (function() {
+ var props = [];
+ function ctor() { this.x = 1; }
+ ctor.prototype = { 'valueOf': 1, 'y': 1 };
+ for (var prop in new ctor) { props.push(prop); }
+ for (prop in arguments) { noArgsEnum = !prop; }
+ hasDontEnumBug = (props + '').length < 4;
+ iteratesOwnLast = props[0] != 'x';
+ }(1));
+
+ /** Detect if an `arguments` object's [[Class]] is unresolvable (Firefox < 4, IE < 9) */
+ var noArgsClass = !isArguments(arguments);
+
+ /** Detect if `Array#slice` cannot be used to convert strings to arrays (Opera < 10.52) */
+ var noArraySliceOnStrings = slice.call('x')[0] != 'x';
+
+ /**
+ * Detect lack of support for accessing string characters by index:
+ * IE < 8 can't access characters by index and IE 8 can only access
+ * characters by index on string literals.
+ */
+ var noCharByIndex = ('x'[0] + Object('x')[0]) != 'xx';
+
+ /**
+ * Detect if a node's [[Class]] is unresolvable (IE < 9)
+ * and that the JS engine won't error when attempting to coerce an object to
+ * a string without a `toString` property value of `typeof` "function".
+ */
+ try {
+ var noNodeClass = ({ 'toString': 0 } + '', toString.call(window.document || 0) == objectClass);
+ } catch(e) { }
+
+ /* Detect if `Function#bind` exists and is inferred to be fast (all but V8) */
+ var isBindFast = nativeBind && /\n|Opera/.test(nativeBind + toString.call(window.opera));
+
+ /* Detect if `Object.keys` exists and is inferred to be fast (IE, Opera, V8) */
+ var isKeysFast = nativeKeys && /^.+$|true/.test(nativeKeys + !!window.attachEvent);
+
+ /** Detect if sourceURL syntax is usable without erroring */
+ try {
+ // The JS engine in Adobe products, like InDesign, will throw a syntax error
+ // when it encounters a single line comment beginning with the `@` symbol.
+ // The JS engine in Narwhal will generate the function `function anonymous(){//}`
+ // and throw a syntax error. In IE, `@` symbols are part of its non-standard
+ // conditional compilation support. The `@cc_on` statement activates its support
+ // while the trailing ` !` induces a syntax error to exlude it. Compatibility
+ // modes in IE > 8 require a space before the `!` to induce a syntax error.
+ // See http://msdn.microsoft.com/en-us/library/121hztk3(v=vs.94).aspx
+ var useSourceURL = (Function('//@cc_on !')(), true);
+ } catch(e){ }
+
+ /** Used to identify object classifications that are array-like */
+ var arrayLikeClasses = {};
+ arrayLikeClasses[boolClass] = arrayLikeClasses[dateClass] = arrayLikeClasses[funcClass] =
+ arrayLikeClasses[numberClass] = arrayLikeClasses[objectClass] = arrayLikeClasses[regexpClass] = false;
+ arrayLikeClasses[argsClass] = arrayLikeClasses[arrayClass] = arrayLikeClasses[stringClass] = true;
+
+ /** Used to identify object classifications that `_.clone` supports */
+ var cloneableClasses = {};
+ cloneableClasses[argsClass] = cloneableClasses[funcClass] = false;
+ cloneableClasses[arrayClass] = cloneableClasses[boolClass] = cloneableClasses[dateClass] =
+ cloneableClasses[numberClass] = cloneableClasses[objectClass] = cloneableClasses[regexpClass] =
+ cloneableClasses[stringClass] = true;
+
+ /**
+ * Used to escape characters for inclusion in HTML.
+ * The `>` and `/` characters don't require escaping in HTML and have no
+ * special meaning unless they're part of a tag or an unquoted attribute value
+ * http://mathiasbynens.be/notes/ambiguous-ampersands (semi-related fun fact)
+ */
+ var htmlEscapes = {
+ '&': '&amp;',
+ '<': '&lt;',
+ '"': '&quot;',
+ "'": '&#x27;'
+ };
+
+ /** Used to determine if values are of the language type Object */
+ var objectTypes = {
+ 'boolean': false,
+ 'function': true,
+ 'object': true,
+ 'number': false,
+ 'string': false,
+ 'undefined': false,
+ 'unknown': true
+ };
+
+ /** Used to escape characters for inclusion in compiled string literals */
+ var stringEscapes = {
+ '\\': '\\',
+ "'": "'",
+ '\n': 'n',
+ '\r': 'r',
+ '\t': 't',
+ '\u2028': 'u2028',
+ '\u2029': 'u2029'
+ };
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * The `lodash` function.
+ *
+ * @name _
+ * @constructor
+ * @param {Mixed} value The value to wrap in a `LoDash` instance.
+ * @returns {Object} Returns a `LoDash` instance.
+ */
+ function lodash(value) {
+ // allow invoking `lodash` without the `new` operator
+ return new LoDash(value);
+ }
+
+ /**
+ * Creates a `LoDash` instance that wraps a value to allow chaining.
+ *
+ * @private
+ * @constructor
+ * @param {Mixed} value The value to wrap.
+ */
+ function LoDash(value) {
+ // exit early if already wrapped
+ if (value && value._wrapped) {
+ return value;
+ }
+ this._wrapped = value;
+ }
+
+ /**
+ * By default, the template delimiters used by Lo-Dash are similar to those in
+ * embedded Ruby (ERB). Change the following template settings to use alternative
+ * delimiters.
+ *
+ * @static
+ * @memberOf _
+ * @type Object
+ */
+ lodash.templateSettings = {
+
+ /**
+ * Used to detect `data` property values to be HTML-escaped.
+ *
+ * @static
+ * @memberOf _.templateSettings
+ * @type RegExp
+ */
+ 'escape': /<%-([\s\S]+?)%>/g,
+
+ /**
+ * Used to detect code to be evaluated.
+ *
+ * @static
+ * @memberOf _.templateSettings
+ * @type RegExp
+ */
+ 'evaluate': /<%([\s\S]+?)%>/g,
+
+ /**
+ * Used to detect `data` property values to inject.
+ *
+ * @static
+ * @memberOf _.templateSettings
+ * @type RegExp
+ */
+ 'interpolate': /<%=([\s\S]+?)%>/g,
+
+ /**
+ * Used to reference the data object in the template text.
+ *
+ * @static
+ * @memberOf _.templateSettings
+ * @type String
+ */
+ 'variable': ''
+ };
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * The template used to create iterator functions.
+ *
+ * @private
+ * @param {Obect} data The data object used to populate the text.
+ * @returns {String} Returns the interpolated text.
+ */
+ var iteratorTemplate = template(
+ // conditional strict mode
+ '<% if (useStrict) { %>\'use strict\';\n<% } %>' +
+
+ // the `iteratee` may be reassigned by the `top` snippet
+ 'var index, value, iteratee = <%= firstArg %>, ' +
+ // assign the `result` variable an initial value
+ 'result<% if (init) { %> = <%= init %><% } %>;\n' +
+ // add code to exit early or do so if the first argument is falsey
+ '<%= exit %>;\n' +
+ // add code after the exit snippet but before the iteration branches
+ '<%= top %>;\n' +
+
+ // the following branch is for iterating arrays and array-like objects
+ '<% if (arrayBranch) { %>' +
+ 'var length = iteratee.length; index = -1;' +
+ ' <% if (objectBranch) { %>\nif (length > -1 && length === length >>> 0) {<% } %>' +
+
+ // add support for accessing string characters by index if needed
+ ' <% if (noCharByIndex) { %>\n' +
+ ' if (toString.call(iteratee) == stringClass) {\n' +
+ ' iteratee = iteratee.split(\'\')\n' +
+ ' }' +
+ ' <% } %>\n' +
+
+ ' <%= arrayBranch.beforeLoop %>;\n' +
+ ' while (++index < length) {\n' +
+ ' value = iteratee[index];\n' +
+ ' <%= arrayBranch.inLoop %>\n' +
+ ' }' +
+ ' <% if (objectBranch) { %>\n}<% } %>' +
+ '<% } %>' +
+
+ // the following branch is for iterating an object's own/inherited properties
+ '<% if (objectBranch) { %>' +
+ ' <% if (arrayBranch) { %>\nelse {' +
+
+ // add support for iterating over `arguments` objects if needed
+ ' <% } else if (noArgsEnum) { %>\n' +
+ ' var length = iteratee.length; index = -1;\n' +
+ ' if (length && isArguments(iteratee)) {\n' +
+ ' while (++index < length) {\n' +
+ ' value = iteratee[index += \'\'];\n' +
+ ' <%= objectBranch.inLoop %>\n' +
+ ' }\n' +
+ ' } else {' +
+ ' <% } %>' +
+
+ ' <% if (!hasDontEnumBug) { %>\n' +
+ ' var skipProto = typeof iteratee == \'function\' && \n' +
+ ' propertyIsEnumerable.call(iteratee, \'prototype\');\n' +
+ ' <% } %>' +
+
+ // iterate own properties using `Object.keys` if it's fast
+ ' <% if (isKeysFast && useHas) { %>\n' +
+ ' var ownIndex = -1,\n' +
+ ' ownProps = objectTypes[typeof iteratee] ? nativeKeys(iteratee) : [],\n' +
+ ' length = ownProps.length;\n\n' +
+ ' <%= objectBranch.beforeLoop %>;\n' +
+ ' while (++ownIndex < length) {\n' +
+ ' index = ownProps[ownIndex];\n' +
+ ' <% if (!hasDontEnumBug) { %>if (!(skipProto && index == \'prototype\')) {\n <% } %>' +
+ ' value = iteratee[index];\n' +
+ ' <%= objectBranch.inLoop %>\n' +
+ ' <% if (!hasDontEnumBug) { %>}\n<% } %>' +
+ ' }' +
+
+ // else using a for-in loop
+ ' <% } else { %>\n' +
+ ' <%= objectBranch.beforeLoop %>;\n' +
+ ' for (index in iteratee) {' +
+ ' <% if (hasDontEnumBug) { %>\n' +
+ ' <% if (useHas) { %>if (hasOwnProperty.call(iteratee, index)) {\n <% } %>' +
+ ' value = iteratee[index];\n' +
+ ' <%= objectBranch.inLoop %>;\n' +
+ ' <% if (useHas) { %>}<% } %>' +
+
+ // Firefox < 3.6, Opera > 9.50 - Opera < 11.60, and Safari < 5.1
+ // (if the prototype or a property on the prototype has been set)
+ // incorrectly sets a function's `prototype` property [[Enumerable]]
+ // value to `true`. Because of this Lo-Dash standardizes on skipping
+ // the the `prototype` property of functions regardless of its
+ // [[Enumerable]] value.
+ ' <% } else { %>\n' +
+ ' if (!(skipProto && index == \'prototype\')<% if (useHas) { %> &&\n' +
+ ' hasOwnProperty.call(iteratee, index)<% } %>) {\n' +
+ ' value = iteratee[index];\n' +
+ ' <%= objectBranch.inLoop %>\n' +
+ ' }' +
+ ' <% } %>\n' +
+ ' }' +
+ ' <% } %>' +
+
+ // Because IE < 9 can't set the `[[Enumerable]]` attribute of an
+ // existing property and the `constructor` property of a prototype
+ // defaults to non-enumerable, Lo-Dash skips the `constructor`
+ // property when it infers it's iterating over a `prototype` object.
+ ' <% if (hasDontEnumBug) { %>\n\n' +
+ ' var ctor = iteratee.constructor;\n' +
+ ' <% for (var k = 0; k < 7; k++) { %>\n' +
+ ' index = \'<%= shadowed[k] %>\';\n' +
+ ' if (<%' +
+ ' if (shadowed[k] == \'constructor\') {' +
+ ' %>!(ctor && ctor.prototype === iteratee) && <%' +
+ ' } %>hasOwnProperty.call(iteratee, index)) {\n' +
+ ' value = iteratee[index];\n' +
+ ' <%= objectBranch.inLoop %>\n' +
+ ' }' +
+ ' <% } %>' +
+ ' <% } %>' +
+ ' <% if (arrayBranch || noArgsEnum) { %>\n}<% } %>' +
+ '<% } %>\n' +
+
+ // add code to the bottom of the iteration function
+ '<%= bottom %>;\n' +
+ // finally, return the `result`
+ 'return result'
+ );
+
+ /**
+ * Reusable iterator options shared by
+ * `every`, `filter`, `find`, `forEach`, `forIn`, `forOwn`, `groupBy`, `map`,
+ * `reject`, `some`, and `sortBy`.
+ */
+ var baseIteratorOptions = {
+ 'args': 'collection, callback, thisArg',
+ 'init': 'collection',
+ 'top':
+ 'if (!callback) {\n' +
+ ' callback = identity\n' +
+ '}\n' +
+ 'else if (thisArg) {\n' +
+ ' callback = iteratorBind(callback, thisArg)\n' +
+ '}',
+ 'inLoop': 'if (callback(value, index, collection) === false) return result'
+ };
+
+ /** Reusable iterator options for `countBy`, `groupBy`, and `sortBy` */
+ var countByIteratorOptions = {
+ 'init': '{}',
+ 'top':
+ 'var prop;\n' +
+ 'if (typeof callback != \'function\') {\n' +
+ ' var valueProp = callback;\n' +
+ ' callback = function(value) { return value[valueProp] }\n' +
+ '}\n' +
+ 'else if (thisArg) {\n' +
+ ' callback = iteratorBind(callback, thisArg)\n' +
+ '}',
+ 'inLoop':
+ 'prop = callback(value, index, collection);\n' +
+ '(hasOwnProperty.call(result, prop) ? result[prop]++ : result[prop] = 1)'
+ };
+
+ /** Reusable iterator options for `every` and `some` */
+ var everyIteratorOptions = {
+ 'init': 'true',
+ 'inLoop': 'if (!callback(value, index, collection)) return !result'
+ };
+
+ /** Reusable iterator options for `defaults` and `extend` */
+ var extendIteratorOptions = {
+ 'useHas': false,
+ 'useStrict': false,
+ 'args': 'object',
+ 'init': 'object',
+ 'top':
+ 'for (var argsIndex = 1, argsLength = arguments.length; argsIndex < argsLength; argsIndex++) {\n' +
+ ' if (iteratee = arguments[argsIndex]) {',
+ 'inLoop': 'result[index] = value',
+ 'bottom': ' }\n}'
+ };
+
+ /** Reusable iterator options for `filter`, `reject`, and `where` */
+ var filterIteratorOptions = {
+ 'init': '[]',
+ 'inLoop': 'callback(value, index, collection) && result.push(value)'
+ };
+
+ /** Reusable iterator options for `find`, `forEach`, `forIn`, and `forOwn` */
+ var forEachIteratorOptions = {
+ 'top': 'if (thisArg) callback = iteratorBind(callback, thisArg)'
+ };
+
+ /** Reusable iterator options for `forIn` and `forOwn` */
+ var forOwnIteratorOptions = {
+ 'inLoop': {
+ 'object': baseIteratorOptions.inLoop
+ }
+ };
+
+ /** Reusable iterator options for `invoke`, `map`, `pluck`, and `sortBy` */
+ var mapIteratorOptions = {
+ 'init': '',
+ 'exit': 'if (!collection) return []',
+ 'beforeLoop': {
+ 'array': 'result = Array(length)',
+ 'object': 'result = ' + (isKeysFast ? 'Array(length)' : '[]')
+ },
+ 'inLoop': {
+ 'array': 'result[index] = callback(value, index, collection)',
+ 'object': 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + '(callback(value, index, collection))'
+ }
+ };
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Creates a new function optimized for searching large arrays for a given `value`,
+ * starting at `fromIndex`, using strict equality for comparisons, i.e. `===`.
+ *
+ * @private
+ * @param {Array} array The array to search.
+ * @param {Mixed} value The value to search for.
+ * @param {Number} [fromIndex=0] The index to start searching from.
+ * @param {Number} [largeSize=30] The length at which an array is considered large.
+ * @returns {Boolean} Returns `true` if `value` is found, else `false`.
+ */
+ function cachedContains(array, fromIndex, largeSize) {
+ fromIndex || (fromIndex = 0);
+
+ var length = array.length,
+ isLarge = (length - fromIndex) >= (largeSize || 30),
+ cache = isLarge ? {} : array;
+
+ if (isLarge) {
+ // init value cache
+ var key,
+ index = fromIndex - 1;
+
+ while (++index < length) {
+ // manually coerce `value` to string because `hasOwnProperty`, in some
+ // older versions of Firefox, coerces objects incorrectly
+ key = array[index] + '';
+ (hasOwnProperty.call(cache, key) ? cache[key] : (cache[key] = [])).push(array[index]);
+ }
+ }
+ return function(value) {
+ if (isLarge) {
+ var key = value + '';
+ return hasOwnProperty.call(cache, key) && indexOf(cache[key], value) > -1;
+ }
+ return indexOf(cache, value, fromIndex) > -1;
+ }
+ }
+
+ /**
+ * Creates compiled iteration functions. The iteration function will be created
+ * to iterate over only objects if the first argument of `options.args` is
+ * "object" or `options.inLoop.array` is falsey.
+ *
+ * @private
+ * @param {Object} [options1, options2, ...] The compile options objects.
+ *
+ * useHas - A boolean to specify whether or not to use `hasOwnProperty` checks
+ * in the object loop.
+ *
+ * useStrict - A boolean to specify whether or not to include the ES5
+ * "use strict" directive.
+ *
+ * args - A string of comma separated arguments the iteration function will
+ * accept.
+ *
+ * init - A string to specify the initial value of the `result` variable.
+ *
+ * exit - A string of code to use in place of the default exit-early check
+ * of `if (!arguments[0]) return result`.
+ *
+ * top - A string of code to execute after the exit-early check but before
+ * the iteration branches.
+ *
+ * beforeLoop - A string or object containing an "array" or "object" property
+ * of code to execute before the array or object loops.
+ *
+ * inLoop - A string or object containing an "array" or "object" property
+ * of code to execute in the array or object loops.
+ *
+ * bottom - A string of code to execute after the iteration branches but
+ * before the `result` is returned.
+ *
+ * @returns {Function} Returns the compiled function.
+ */
+ function createIterator() {
+ var object,
+ prop,
+ value,
+ index = -1,
+ length = arguments.length;
+
+ // merge options into a template data object
+ var data = {
+ 'bottom': '',
+ 'exit': '',
+ 'init': '',
+ 'top': '',
+ 'arrayBranch': { 'beforeLoop': '' },
+ 'objectBranch': { 'beforeLoop': '' }
+ };
+
+ while (++index < length) {
+ object = arguments[index];
+ for (prop in object) {
+ value = (value = object[prop]) == null ? '' : value;
+ // keep this regexp explicit for the build pre-process
+ if (/beforeLoop|inLoop/.test(prop)) {
+ if (typeof value == 'string') {
+ value = { 'array': value, 'object': value };
+ }
+ data.arrayBranch[prop] = value.array;
+ data.objectBranch[prop] = value.object;
+ } else {
+ data[prop] = value;
+ }
+ }
+ }
+ // set additional template `data` values
+ var args = data.args,
+ firstArg = /^[^,]+/.exec(args)[0];
+
+ data.firstArg = firstArg;
+ data.hasDontEnumBug = hasDontEnumBug;
+ data.isKeysFast = isKeysFast;
+ data.noArgsEnum = noArgsEnum;
+ data.shadowed = shadowed;
+ data.useHas = data.useHas !== false;
+ data.useStrict = data.useStrict !== false;
+
+ if (!('noCharByIndex' in data)) {
+ data.noCharByIndex = noCharByIndex;
+ }
+ if (!data.exit) {
+ data.exit = 'if (!' + firstArg + ') return result';
+ }
+ if (firstArg != 'collection' || !data.arrayBranch.inLoop) {
+ data.arrayBranch = null;
+ }
+ // create the function factory
+ var factory = Function(
+ 'arrayLikeClasses, ArrayProto, bind, compareAscending, concat, forIn, ' +
+ 'hasOwnProperty, identity, indexOf, isArguments, isArray, isFunction, ' +
+ 'isPlainObject, iteratorBind, objectClass, objectTypes, nativeKeys, ' +
+ 'propertyIsEnumerable, slice, stringClass, toString',
+ 'var callee = function(' + args + ') {\n' + iteratorTemplate(data) + '\n};\n' +
+ 'return callee'
+ );
+ // return the compiled function
+ return factory(
+ arrayLikeClasses, ArrayProto, bind, compareAscending, concat, forIn,
+ hasOwnProperty, identity, indexOf, isArguments, isArray, isFunction,
+ isPlainObject, iteratorBind, objectClass, objectTypes, nativeKeys,
+ propertyIsEnumerable, slice, stringClass, toString
+ );
+ }
+
+ /**
+ * Used by `sortBy` to compare transformed `collection` values, stable sorting
+ * them in ascending order.
+ *
+ * @private
+ * @param {Object} a The object to compare to `b`.
+ * @param {Object} b The object to compare to `a`.
+ * @returns {Number} Returns the sort order indicator of `1` or `-1`.
+ */
+ function compareAscending(a, b) {
+ var ai = a.index,
+ bi = b.index;
+
+ a = a.criteria;
+ b = b.criteria;
+
+ if (a === undefined) {
+ return 1;
+ }
+ if (b === undefined) {
+ return -1;
+ }
+ // ensure a stable sort in V8 and other engines
+ // http://code.google.com/p/v8/issues/detail?id=90
+ return a < b ? -1 : a > b ? 1 : ai < bi ? -1 : 1;
+ }
+
+ /**
+ * Used by `template` to replace tokens with their corresponding code snippets.
+ *
+ * @private
+ * @param {String} match The matched token.
+ * @param {String} index The `tokenized` index of the code snippet.
+ * @returns {String} Returns the code snippet.
+ */
+ function detokenize(match, index) {
+ return tokenized[index];
+ }
+
+ /**
+ * Used by `template` to escape characters for inclusion in compiled
+ * string literals.
+ *
+ * @private
+ * @param {String} match The matched character to escape.
+ * @returns {String} Returns the escaped character.
+ */
+ function escapeStringChar(match) {
+ return '\\' + stringEscapes[match];
+ }
+
+ /**
+ * Used by `escape` to escape characters for inclusion in HTML.
+ *
+ * @private
+ * @param {String} match The matched character to escape.
+ * @returns {String} Returns the escaped character.
+ */
+ function escapeHtmlChar(match) {
+ return htmlEscapes[match];
+ }
+
+ /**
+ * Checks if a given `value` is an object created by the `Object` constructor
+ * assuming objects created by the `Object` constructor have no inherited
+ * enumerable properties and that there are no `Object.prototype` extensions.
+ *
+ * @private
+ * @param {Mixed} value The value to check.
+ * @param {Boolean} [skipArgsCheck=false] Internally used to skip checks for
+ * `arguments` objects.
+ * @returns {Boolean} Returns `true` if the `value` is a plain `Object` object,
+ * else `false`.
+ */
+ function isPlainObject(value, skipArgsCheck) {
+ // avoid non-objects and false positives for `arguments` objects
+ var result = false;
+ if (!(value && typeof value == 'object') || (!skipArgsCheck && isArguments(value))) {
+ return result;
+ }
+ // IE < 9 presents DOM nodes as `Object` objects except they have `toString`
+ // methods that are `typeof` "string" and still can coerce nodes to strings.
+ // Also check that the constructor is `Object` (i.e. `Object instanceof Object`)
+ var ctor = value.constructor;
+ if ((!noNodeClass || !(typeof value.toString != 'function' && typeof (value + '') == 'string')) &&
+ (!isFunction(ctor) || ctor instanceof ctor)) {
+ // IE < 9 iterates inherited properties before own properties. If the first
+ // iterated property is an object's own property then there are no inherited
+ // enumerable properties.
+ if (iteratesOwnLast) {
+ forIn(value, function(objValue, objKey) {
+ result = !hasOwnProperty.call(value, objKey);
+ return false;
+ });
+ return result === false;
+ }
+ // In most environments an object's own properties are iterated before
+ // its inherited properties. If the last iterated property is an object's
+ // own property then there are no inherited enumerable properties.
+ forIn(value, function(objValue, objKey) {
+ result = objKey;
+ });
+ return result === false || hasOwnProperty.call(value, result);
+ }
+ return result;
+ }
+
+ /**
+ * Creates a new function that, when called, invokes `func` with the `this`
+ * binding of `thisArg` and the arguments (value, index, object).
+ *
+ * @private
+ * @param {Function} func The function to bind.
+ * @param {Mixed} [thisArg] The `this` binding of `func`.
+ * @returns {Function} Returns the new bound function.
+ */
+ function iteratorBind(func, thisArg) {
+ return function(value, index, object) {
+ return func.call(thisArg, value, index, object);
+ };
+ }
+
+ /**
+ * A no-operation function.
+ *
+ * @private
+ */
+ function noop() {
+ // no operation performed
+ }
+
+ /**
+ * Used by `template` to replace "escape" template delimiters with tokens.
+ *
+ * @private
+ * @param {String} match The matched template delimiter.
+ * @param {String} value The delimiter value.
+ * @returns {String} Returns a token.
+ */
+ function tokenizeEscape(match, value) {
+ if (match && reComplexDelimiter.test(value)) {
+ return '<e%-' + value + '%>';
+ }
+ var index = tokenized.length;
+ tokenized[index] = "' +\n__e(" + value + ") +\n'";
+ return token + index;
+ }
+
+ /**
+ * Used by `template` to replace "evaluate" template delimiters, or complex
+ * "escape" and "interpolate" delimiters, with tokens.
+ *
+ * @private
+ * @param {String} match The matched template delimiter.
+ * @param {String} escapeValue The complex "escape" delimiter value.
+ * @param {String} interpolateValue The complex "interpolate" delimiter value.
+ * @param {String} [evaluateValue] The "evaluate" delimiter value.
+ * @returns {String} Returns a token.
+ */
+ function tokenizeEvaluate(match, escapeValue, interpolateValue, evaluateValue) {
+ if (evaluateValue) {
+ var index = tokenized.length;
+ tokenized[index] = "';\n" + evaluateValue + ";\n__p += '";
+ return token + index;
+ }
+ return escapeValue
+ ? tokenizeEscape(null, escapeValue)
+ : tokenizeInterpolate(null, interpolateValue);
+ }
+
+ /**
+ * Used by `template` to replace "interpolate" template delimiters with tokens.
+ *
+ * @private
+ * @param {String} match The matched template delimiter.
+ * @param {String} value The delimiter value.
+ * @returns {String} Returns a token.
+ */
+ function tokenizeInterpolate(match, value) {
+ if (match && reComplexDelimiter.test(value)) {
+ return '<e%=' + value + '%>';
+ }
+ var index = tokenized.length;
+ tokenized[index] = "' +\n((__t = (" + value + ")) == null ? '' : __t) +\n'";
+ return token + index;
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Checks if `value` is an `arguments` object.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is an `arguments` object, else `false`.
+ * @example
+ *
+ * (function() { return _.isArguments(arguments); })(1, 2, 3);
+ * // => true
+ *
+ * _.isArguments([1, 2, 3]);
+ * // => false
+ */
+ function isArguments(value) {
+ return toString.call(value) == argsClass;
+ }
+ // fallback for browsers that can't detect `arguments` objects by [[Class]]
+ if (noArgsClass) {
+ isArguments = function(value) {
+ return !!(value && hasOwnProperty.call(value, 'callee'));
+ };
+ }
+
+ /**
+ * Checks if `value` is an array.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is an array, else `false`.
+ * @example
+ *
+ * (function() { return _.isArray(arguments); })();
+ * // => false
+ *
+ * _.isArray([1, 2, 3]);
+ * // => true
+ */
+ var isArray = nativeIsArray || function(value) {
+ return toString.call(value) == arrayClass;
+ };
+
+ /**
+ * Checks if `value` is a function.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a function, else `false`.
+ * @example
+ *
+ * _.isFunction(''.concat);
+ * // => true
+ */
+ function isFunction(value) {
+ return typeof value == 'function';
+ }
+ // fallback for older versions of Chrome and Safari
+ if (isFunction(/x/)) {
+ isFunction = function(value) {
+ return toString.call(value) == funcClass;
+ };
+ }
+
+ /**
+ * A shim implementation of `Object.keys` that produces an array of the given
+ * object's own enumerable property names.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns a new array of property names.
+ */
+ var shimKeys = createIterator({
+ 'args': 'object',
+ 'init': '[]',
+ 'inLoop': 'result.push(index)'
+ });
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Creates a clone of `value`. If `deep` is `true`, all nested objects will
+ * also be cloned otherwise they will be assigned by reference. If a value has
+ * a `clone` method it will be used to perform the clone. Functions, DOM nodes,
+ * `arguments` objects, and objects created by constructors other than `Object`
+ * are **not** cloned unless they have a custom `clone` method.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to clone.
+ * @param {Boolean} deep A flag to indicate a deep clone.
+ * @param {Object} [guard] Internally used to allow this method to work with
+ * others like `_.map` without using their callback `index` argument for `deep`.
+ * @param {Array} [stack=[]] Internally used to keep track of traversed objects
+ * to avoid circular references.
+ * @param {Object} thorough Internally used to indicate whether or not to perform
+ * a more thorough clone of non-object values.
+ * @returns {Mixed} Returns the cloned `value`.
+ * @example
+ *
+ * var stooges = [
+ * { 'name': 'moe', 'age': 40 },
+ * { 'name': 'larry', 'age': 50 },
+ * { 'name': 'curly', 'age': 60 }
+ * ];
+ *
+ * _.clone({ 'name': 'moe' });
+ * // => { 'name': 'moe' }
+ *
+ * var shallow = _.clone(stooges);
+ * shallow[0] === stooges[0];
+ * // => true
+ *
+ * var deep = _.clone(stooges, true);
+ * shallow[0] === stooges[0];
+ * // => false
+ */
+ function clone(value, deep, guard, stack, thorough) {
+ if (value == null) {
+ return value;
+ }
+ if (guard) {
+ deep = false;
+ }
+ // avoid slower checks on primitives
+ thorough || (thorough = { 'value': null });
+ if (thorough.value == null) {
+ // primitives passed from iframes use the primary document's native prototypes
+ thorough.value = !!(BoolProto.clone || NumberProto.clone || StringProto.clone);
+ }
+ // use custom `clone` method if available
+ var isObj = objectTypes[typeof value];
+ if ((isObj || thorough.value) && value.clone && isFunction(value.clone)) {
+ thorough.value = null;
+ return value.clone(deep);
+ }
+ // inspect [[Class]]
+ if (isObj) {
+ // don't clone `arguments` objects, functions, or non-object Objects
+ var className = toString.call(value);
+ if (!cloneableClasses[className] || (noArgsClass && isArguments(value))) {
+ return value;
+ }
+ var isArr = className == arrayClass;
+ isObj = isArr || (className == objectClass ? isPlainObject(value, true) : isObj);
+ }
+ // shallow clone
+ if (!isObj || !deep) {
+ // don't clone functions
+ return isObj
+ ? (isArr ? slice.call(value) : extend({}, value))
+ : value;
+ }
+
+ var ctor = value.constructor;
+ switch (className) {
+ case boolClass:
+ return new ctor(value == true);
+
+ case dateClass:
+ return new ctor(+value);
+
+ case numberClass:
+ case stringClass:
+ return new ctor(value);
+
+ case regexpClass:
+ return ctor(value.source, reFlags.exec(value));
+ }
+
+ // check for circular references and return corresponding clone
+ stack || (stack = []);
+ var length = stack.length;
+ while (length--) {
+ if (stack[length].source == value) {
+ return stack[length].value;
+ }
+ }
+
+ // init cloned object
+ length = value.length;
+ var result = isArr ? ctor(length) : {};
+
+ // add current clone and original source value to the stack of traversed objects
+ stack.push({ 'value': result, 'source': value });
+
+ // recursively populate clone (susceptible to call stack limits)
+ if (isArr) {
+ var index = -1;
+ while (++index < length) {
+ result[index] = clone(value[index], deep, null, stack, thorough);
+ }
+ } else {
+ forOwn(value, function(objValue, key) {
+ result[key] = clone(objValue, deep, null, stack, thorough);
+ });
+ }
+ return result;
+ }
+
+ /**
+ * Assigns enumerable properties of the default object(s) to the `destination`
+ * object for all `destination` properties that resolve to `null`/`undefined`.
+ * Once a property is set, additional defaults of the same property will be
+ * ignored.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The destination object.
+ * @param {Object} [default1, default2, ...] The default objects.
+ * @returns {Object} Returns the destination object.
+ * @example
+ *
+ * var iceCream = { 'flavor': 'chocolate' };
+ * _.defaults(iceCream, { 'flavor': 'vanilla', 'sprinkles': 'rainbow' });
+ * // => { 'flavor': 'chocolate', 'sprinkles': 'rainbow' }
+ */
+ var defaults = createIterator(extendIteratorOptions, {
+ 'inLoop': 'if (result[index] == null) ' + extendIteratorOptions.inLoop
+ });
+
+ /**
+ * Creates a shallow clone of `object` excluding the specified properties.
+ * Property names may be specified as individual arguments or as arrays of
+ * property names.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The source object.
+ * @param {Object} [prop1, prop2, ...] The properties to drop.
+ * @returns {Object} Returns an object without the dropped properties.
+ * @example
+ *
+ * _.drop({ 'name': 'moe', 'age': 40, 'userid': 'moe1' }, 'userid');
+ * // => { 'name': 'moe', 'age': 40 }
+ */
+ var drop = createIterator({
+ 'useHas': false,
+ 'args': 'object',
+ 'init': '{}',
+ 'top': 'var props = concat.apply(ArrayProto, arguments)',
+ 'inLoop': 'if (indexOf(props, index) < 0) result[index] = value'
+ });
+
+ /**
+ * Assigns enumerable properties of the source object(s) to the `destination`
+ * object. Subsequent sources will overwrite propery assignments of previous
+ * sources.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The destination object.
+ * @param {Object} [source1, source2, ...] The source objects.
+ * @returns {Object} Returns the destination object.
+ * @example
+ *
+ * _.extend({ 'name': 'moe' }, { 'age': 40 });
+ * // => { 'name': 'moe', 'age': 40 }
+ */
+ var extend = createIterator(extendIteratorOptions);
+
+ /**
+ * Iterates over `object`'s own and inherited enumerable properties, executing
+ * the `callback` for each property. The `callback` is bound to `thisArg` and
+ * invoked with 3 arguments; (value, key, object). Callbacks may exit iteration
+ * early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The object to iterate over.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * function Dog(name) {
+ * this.name = name;
+ * }
+ *
+ * Dog.prototype.bark = function() {
+ * alert('Woof, woof!');
+ * };
+ *
+ * _.forIn(new Dog('Dagny'), function(value, key) {
+ * alert(key);
+ * });
+ * // => alerts 'name' and 'bark' (order is not guaranteed)
+ */
+ var forIn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions, {
+ 'useHas': false
+ });
+
+ /**
+ * Iterates over `object`'s own enumerable properties, executing the `callback`
+ * for each property. The `callback` is bound to `thisArg` and invoked with 3
+ * arguments; (value, key, object). Callbacks may exit iteration early by
+ * explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The object to iterate over.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * _.forOwn({ '0': 'zero', '1': 'one', 'length': 2 }, function(num, key) {
+ * alert(key);
+ * });
+ * // => alerts '0', '1', and 'length' (order is not guaranteed)
+ */
+ var forOwn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions);
+
+ /**
+ * Creates a sorted array of all enumerable properties, own and inherited,
+ * of `object` that have function values.
+ *
+ * @static
+ * @memberOf _
+ * @alias methods
+ * @category Objects
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns a new array of property names that have function values.
+ * @example
+ *
+ * _.functions(_);
+ * // => ['all', 'any', 'bind', 'bindAll', 'clone', 'compact', 'compose', ...]
+ */
+ var functions = createIterator({
+ 'useHas': false,
+ 'args': 'object',
+ 'init': '[]',
+ 'inLoop': 'if (isFunction(value)) result.push(index)',
+ 'bottom': 'result.sort()'
+ });
+
+ /**
+ * Checks if the specified object `property` exists and is a direct property,
+ * instead of an inherited property.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The object to check.
+ * @param {String} property The property to check for.
+ * @returns {Boolean} Returns `true` if key is a direct property, else `false`.
+ * @example
+ *
+ * _.has({ 'a': 1, 'b': 2, 'c': 3 }, 'b');
+ * // => true
+ */
+ function has(object, property) {
+ return object ? hasOwnProperty.call(object, property) : false;
+ }
+
+ /**
+ * Checks if `value` is a boolean (`true` or `false`) value.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a boolean value, else `false`.
+ * @example
+ *
+ * _.isBoolean(null);
+ * // => false
+ */
+ function isBoolean(value) {
+ return value === true || value === false || toString.call(value) == boolClass;
+ }
+
+ /**
+ * Checks if `value` is a date.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a date, else `false`.
+ * @example
+ *
+ * _.isDate(new Date);
+ * // => true
+ */
+ function isDate(value) {
+ return toString.call(value) == dateClass;
+ }
+
+ /**
+ * Checks if `value` is a DOM element.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a DOM element, else `false`.
+ * @example
+ *
+ * _.isElement(document.body);
+ * // => true
+ */
+ function isElement(value) {
+ return value ? value.nodeType === 1 : false;
+ }
+
+ /**
+ * Checks if `value` is empty. Arrays, strings, or `arguments` objects with a
+ * length of `0` and objects with no own enumerable properties are considered
+ * "empty".
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Array|Object|String} value The value to inspect.
+ * @returns {Boolean} Returns `true` if the `value` is empty, else `false`.
+ * @example
+ *
+ * _.isEmpty([1, 2, 3]);
+ * // => false
+ *
+ * _.isEmpty({});
+ * // => true
+ *
+ * _.isEmpty('');
+ * // => true
+ */
+ var isEmpty = createIterator({
+ 'args': 'value',
+ 'init': 'true',
+ 'top':
+ 'var className = toString.call(value),\n' +
+ ' length = value.length;\n' +
+ 'if (arrayLikeClasses[className]' +
+ (noArgsClass ? ' || isArguments(value)' : '') + ' ||\n' +
+ ' (className == objectClass && length > -1 && length === length >>> 0 &&\n' +
+ ' isFunction(value.splice))' +
+ ') return !length',
+ 'inLoop': {
+ 'object': 'return false'
+ }
+ });
+
+ /**
+ * Performs a deep comparison between two values to determine if they are
+ * equivalent to each other. If a value has an `isEqual` method it will be
+ * used to perform the comparison.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} a The value to compare.
+ * @param {Mixed} b The other value to compare.
+ * @param {Array} [stack=[]] Internally used to keep track of traversed objects
+ * to avoid circular references.
+ * @param {Object} thorough Internally used to indicate whether or not to perform
+ * a more thorough comparison of non-object values.
+ * @returns {Boolean} Returns `true` if the values are equvalent, else `false`.
+ * @example
+ *
+ * var moe = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] };
+ * var clone = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] };
+ *
+ * moe == clone;
+ * // => false
+ *
+ * _.isEqual(moe, clone);
+ * // => true
+ */
+ function isEqual(a, b, stack, thorough) {
+ // a strict comparison is necessary because `null == undefined`
+ if (a == null || b == null) {
+ return a === b;
+ }
+ // avoid slower checks on non-objects
+ thorough || (thorough = { 'value': null });
+ if (thorough.value == null) {
+ // primitives passed from iframes use the primary document's native prototypes
+ thorough.value = !!(BoolProto.isEqual || NumberProto.isEqual || StringProto.isEqual);
+ }
+ if (objectTypes[typeof a] || objectTypes[typeof b] || thorough.value) {
+ // unwrap any LoDash wrapped values
+ if (a._chain) {
+ a = a._wrapped;
+ }
+ if (b._chain) {
+ b = b._wrapped;
+ }
+ // use custom `isEqual` method if available
+ if (a.isEqual && isFunction(a.isEqual)) {
+ thorough.value = null;
+ return a.isEqual(b);
+ }
+ if (b.isEqual && isFunction(b.isEqual)) {
+ thorough.value = null;
+ return b.isEqual(a);
+ }
+ }
+ // exit early for identical values
+ if (a === b) {
+ // treat `+0` vs. `-0` as not equal
+ return a !== 0 || (1 / a == 1 / b);
+ }
+ // compare [[Class]] names
+ var className = toString.call(a);
+ if (className != toString.call(b)) {
+ return false;
+ }
+ switch (className) {
+ case boolClass:
+ case dateClass:
+ // coerce dates and booleans to numbers, dates to milliseconds and booleans
+ // to `1` or `0`, treating invalid dates coerced to `NaN` as not equal
+ return +a == +b;
+
+ case numberClass:
+ // treat `NaN` vs. `NaN` as equal
+ return a != +a
+ ? b != +b
+ // but treat `+0` vs. `-0` as not equal
+ : (a == 0 ? (1 / a == 1 / b) : a == +b);
+
+ case regexpClass:
+ case stringClass:
+ // coerce regexes to strings (http://es5.github.com/#x15.10.6.4)
+ // treat string primitives and their corresponding object instances as equal
+ return a == b + '';
+ }
+ // exit early, in older browsers, if `a` is array-like but not `b`
+ var isArr = arrayLikeClasses[className];
+ if (noArgsClass && !isArr && (isArr = isArguments(a)) && !isArguments(b)) {
+ return false;
+ }
+ // exit for functions and DOM nodes
+ if (!isArr && (className != objectClass || (noNodeClass && (
+ (typeof a.toString != 'function' && typeof (a + '') == 'string') ||
+ (typeof b.toString != 'function' && typeof (b + '') == 'string'))))) {
+ return false;
+ }
+
+ // assume cyclic structures are equal
+ // the algorithm for detecting cyclic structures is adapted from ES 5.1
+ // section 15.12.3, abstract operation `JO` (http://es5.github.com/#x15.12.3)
+ stack || (stack = []);
+ var length = stack.length;
+ while (length--) {
+ if (stack[length] == a) {
+ return true;
+ }
+ }
+
+ var index = -1,
+ result = true,
+ size = 0;
+
+ // add `a` to the stack of traversed objects
+ stack.push(a);
+
+ // recursively compare objects and arrays (susceptible to call stack limits)
+ if (isArr) {
+ // compare lengths to determine if a deep comparison is necessary
+ size = a.length;
+ result = size == b.length;
+
+ if (result) {
+ // deep compare the contents, ignoring non-numeric properties
+ while (size--) {
+ if (!(result = isEqual(a[size], b[size], stack, thorough))) {
+ break;
+ }
+ }
+ }
+ return result;
+ }
+
+ var ctorA = a.constructor,
+ ctorB = b.constructor;
+
+ // non `Object` object instances with different constructors are not equal
+ if (ctorA != ctorB && !(
+ isFunction(ctorA) && ctorA instanceof ctorA &&
+ isFunction(ctorB) && ctorB instanceof ctorB
+ )) {
+ return false;
+ }
+ // deep compare objects
+ for (var prop in a) {
+ if (hasOwnProperty.call(a, prop)) {
+ // count the number of properties.
+ size++;
+ // deep compare each property value.
+ if (!(hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack, thorough))) {
+ return false;
+ }
+ }
+ }
+ // ensure both objects have the same number of properties
+ for (prop in b) {
+ // The JS engine in Adobe products, like InDesign, has a bug that causes
+ // `!size--` to throw an error so it must be wrapped in parentheses.
+ // https://github.com/documentcloud/underscore/issues/355
+ if (hasOwnProperty.call(b, prop) && !(size--)) {
+ // `size` will be `-1` if `b` has more properties than `a`
+ return false;
+ }
+ }
+ // handle JScript [[DontEnum]] bug
+ if (hasDontEnumBug) {
+ while (++index < 7) {
+ prop = shadowed[index];
+ if (hasOwnProperty.call(a, prop) &&
+ !(hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack, thorough))) {
+ return false;
+ }
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Checks if `value` is a finite number.
+ *
+ * Note: This is not the same as native `isFinite`, which will return true for
+ * booleans and other values. See http://es5.github.com/#x15.1.2.5.
+ *
+ * @deprecated
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a finite number, else `false`.
+ * @example
+ *
+ * _.isFinite(-101);
+ * // => true
+ *
+ * _.isFinite('10');
+ * // => false
+ *
+ * _.isFinite(Infinity);
+ * // => false
+ */
+ function isFinite(value) {
+ return nativeIsFinite(value) && toString.call(value) == numberClass;
+ }
+
+ /**
+ * Checks if `value` is the language type of Object.
+ * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject(1);
+ * // => false
+ */
+ function isObject(value) {
+ // check if the value is the ECMAScript language type of Object
+ // http://es5.github.com/#x8
+ // and avoid a V8 bug
+ // http://code.google.com/p/v8/issues/detail?id=2291
+ return value ? objectTypes[typeof value] : false;
+ }
+
+ /**
+ * Checks if `value` is `NaN`.
+ *
+ * Note: This is not the same as native `isNaN`, which will return true for
+ * `undefined` and other values. See http://es5.github.com/#x15.1.2.4.
+ *
+ * @deprecated
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is `NaN`, else `false`.
+ * @example
+ *
+ * _.isNaN(NaN);
+ * // => true
+ *
+ * _.isNaN(new Number(NaN));
+ * // => true
+ *
+ * isNaN(undefined);
+ * // => true
+ *
+ * _.isNaN(undefined);
+ * // => false
+ */
+ function isNaN(value) {
+ // `NaN` as a primitive is the only value that is not equal to itself
+ // (perform the [[Class]] check first to avoid errors with some host objects in IE)
+ return toString.call(value) == numberClass && value != +value
+ }
+
+ /**
+ * Checks if `value` is `null`.
+ *
+ * @deprecated
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is `null`, else `false`.
+ * @example
+ *
+ * _.isNull(null);
+ * // => true
+ *
+ * _.isNull(undefined);
+ * // => false
+ */
+ function isNull(value) {
+ return value === null;
+ }
+
+ /**
+ * Checks if `value` is a number.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a number, else `false`.
+ * @example
+ *
+ * _.isNumber(8.4 * 5;
+ * // => true
+ */
+ function isNumber(value) {
+ return toString.call(value) == numberClass;
+ }
+
+ /**
+ * Checks if `value` is a regular expression.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a regular expression, else `false`.
+ * @example
+ *
+ * _.isRegExp(/moe/);
+ * // => true
+ */
+ function isRegExp(value) {
+ return toString.call(value) == regexpClass;
+ }
+
+ /**
+ * Checks if `value` is a string.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is a string, else `false`.
+ * @example
+ *
+ * _.isString('moe');
+ * // => true
+ */
+ function isString(value) {
+ return toString.call(value) == stringClass;
+ }
+
+ /**
+ * Checks if `value` is `undefined`.
+ *
+ * @deprecated
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Mixed} value The value to check.
+ * @returns {Boolean} Returns `true` if the `value` is `undefined`, else `false`.
+ * @example
+ *
+ * _.isUndefined(void 0);
+ * // => true
+ */
+ function isUndefined(value) {
+ return value === undefined;
+ }
+
+ /**
+ * Creates an array composed of the own enumerable property names of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns a new array of property names.
+ * @example
+ *
+ * _.keys({ 'one': 1, 'two': 2, 'three': 3 });
+ * // => ['one', 'two', 'three'] (order is not guaranteed)
+ */
+ var keys = !nativeKeys ? shimKeys : function(object) {
+ var type = typeof object;
+
+ // avoid iterating over the `prototype` property
+ if (type == 'function' && propertyIsEnumerable.call(object, 'prototype')) {
+ return shimKeys(object);
+ }
+ return object && objectTypes[type]
+ ? nativeKeys(object)
+ : [];
+ };
+
+ /**
+ * Merges enumerable properties of the source object(s) into the `destination`
+ * object. Subsequent sources will overwrite propery assignments of previous
+ * sources.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The destination object.
+ * @param {Object} [source1, source2, ...] The source objects.
+ * @param {Object} [indicator] Internally used to indicate that the `stack`
+ * argument is an array of traversed objects instead of another source object.
+ * @param {Array} [stack=[]] Internally used to keep track of traversed objects
+ * to avoid circular references.
+ * @returns {Object} Returns the destination object.
+ * @example
+ *
+ * var stooges = [
+ * { 'name': 'moe' },
+ * { 'name': 'larry' }
+ * ];
+ *
+ * var ages = [
+ * { 'age': 40 },
+ * { 'age': 50 }
+ * ];
+ *
+ * _.merge(stooges, ages);
+ * // => [{ 'name': 'moe', 'age': 40 }, { 'name': 'larry', 'age': 50 }]
+ */
+ var merge = createIterator(extendIteratorOptions, {
+ 'args': 'object, source, indicator, stack',
+ 'top':
+ 'var destValue, found, isArr, stackLength, recursive = indicator == isPlainObject;\n' +
+ 'if (!recursive) stack = [];\n' +
+ 'for (var argsIndex = 1, argsLength = recursive ? 2 : arguments.length; argsIndex < argsLength; argsIndex++) {\n' +
+ ' if (iteratee = arguments[argsIndex]) {',
+ 'inLoop':
+ 'if (value && ((isArr = isArray(value)) || isPlainObject(value))) {\n' +
+ ' found = false; stackLength = stack.length;\n' +
+ ' while (stackLength--) {\n' +
+ ' if (found = stack[stackLength].source == value) break\n' +
+ ' }\n' +
+ ' if (found) {\n' +
+ ' result[index] = stack[stackLength].value\n' +
+ ' } else {\n' +
+ ' destValue = (destValue = result[index]) && isArr\n' +
+ ' ? (isArray(destValue) ? destValue : [])\n' +
+ ' : (isPlainObject(destValue) ? destValue : {});\n' +
+ ' stack.push({ value: destValue, source: value });\n' +
+ ' result[index] = callee(destValue, value, isPlainObject, stack)\n' +
+ ' }\n' +
+ '} else if (value != null) {\n' +
+ ' result[index] = value\n' +
+ '}'
+ });
+
+ /**
+ * Creates a shallow clone of `object` composed of the specified properties.
+ * Property names may be specified as individual arguments or as arrays of
+ * property names.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The source object.
+ * @param {Object} [prop1, prop2, ...] The properties to pick.
+ * @returns {Object} Returns an object composed of the picked properties.
+ * @example
+ *
+ * _.pick({ 'name': 'moe', 'age': 40, 'userid': 'moe1' }, 'name', 'age');
+ * // => { 'name': 'moe', 'age': 40 }
+ */
+ function pick(object) {
+ var result = {};
+ if (!object) {
+ return result;
+ }
+ var prop,
+ index = 0,
+ props = concat.apply(ArrayProto, arguments),
+ length = props.length;
+
+ // start `index` at `1` to skip `object`
+ while (++index < length) {
+ prop = props[index];
+ if (prop in object) {
+ result[prop] = object[prop];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the size of `value` by returning `value.length` if `value` is an
+ * array, string, or `arguments` object. If `value` is an object, size is
+ * determined by returning the number of own enumerable properties it has.
+ *
+ * @deprecated
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Array|Object|String} value The value to inspect.
+ * @returns {Number} Returns `value.length` or number of own enumerable properties.
+ * @example
+ *
+ * _.size([1, 2]);
+ * // => 2
+ *
+ * _.size({ 'one': 1, 'two': 2, 'three': 3 });
+ * // => 3
+ *
+ * _.size('curly');
+ * // => 5
+ */
+ function size(value) {
+ if (!value) {
+ return 0;
+ }
+ var className = toString.call(value),
+ length = value.length;
+
+ // return `value.length` for `arguments` objects, arrays, strings, and DOM
+ // query collections of libraries like jQuery and MooTools
+ // http://code.google.com/p/fbug/source/browse/branches/firebug1.9/content/firebug/chrome/reps.js?r=12614#653
+ // http://trac.webkit.org/browser/trunk/Source/WebCore/inspector/InjectedScriptSource.js?rev=125186#L609
+ if (arrayLikeClasses[className] || (noArgsClass && isArguments(value)) ||
+ (className == objectClass && length > -1 && length === length >>> 0 && isFunction(value.splice))) {
+ return length;
+ }
+ return keys(value).length;
+ }
+
+ /**
+ * Creates an array composed of the own enumerable property values of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @category Objects
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns a new array of property values.
+ * @example
+ *
+ * _.values({ 'one': 1, 'two': 2, 'three': 3 });
+ * // => [1, 2, 3]
+ */
+ var values = createIterator({
+ 'args': 'object',
+ 'init': '[]',
+ 'inLoop': 'result.push(value)'
+ });
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Checks if a given `target` element is present in a `collection` using strict
+ * equality for comparisons, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @alias include
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Mixed} target The value to check for.
+ * @returns {Boolean} Returns `true` if the `target` element is found, else `false`.
+ * @example
+ *
+ * _.contains([1, 2, 3], 3);
+ * // => true
+ *
+ * _.contains({ 'name': 'moe', 'age': 40 }, 'moe');
+ * // => true
+ *
+ * _.contains('curly', 'ur');
+ * // => true
+ */
+ var contains = createIterator({
+ 'args': 'collection, target',
+ 'init': 'false',
+ 'noCharByIndex': false,
+ 'beforeLoop': {
+ 'array': 'if (toString.call(iteratee) == stringClass) return collection.indexOf(target) > -1'
+ },
+ 'inLoop': 'if (value === target) return true'
+ });
+
+ /**
+ * Creates an object composed of keys returned from running each element of
+ * `collection` through a `callback`. The corresponding value of each key is
+ * the number of times the key was returned by `callback`. The `callback` is
+ * bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection).
+ * The `callback` argument may also be the name of a property to count by (e.g. 'length').
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function|String} callback The function called per iteration or
+ * property name to count by.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * _.countBy([4.3, 6.1, 6.4], function(num) { return Math.floor(num); });
+ * // => { '4': 1, '6': 2 }
+ *
+ * _.countBy([4.3, 6.1, 6.4], function(num) { return this.floor(num); }, Math);
+ * // => { '4': 1, '6': 2 }
+ *
+ * _.countBy(['one', 'two', 'three'], 'length');
+ * // => { '3': 2, '5': 1 }
+ */
+ var countBy = createIterator(baseIteratorOptions, countByIteratorOptions);
+
+ /**
+ * Checks if the `callback` returns a truthy value for **all** elements of a
+ * `collection`. The `callback` is bound to `thisArg` and invoked with 3
+ * arguments; (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @alias all
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Boolean} Returns `true` if all elements pass the callback check, else `false`.
+ * @example
+ *
+ * _.every([true, 1, null, 'yes'], Boolean);
+ * // => false
+ */
+ var every = createIterator(baseIteratorOptions, everyIteratorOptions);
+
+ /**
+ * Examines each element in a `collection`, returning an array of all elements
+ * the `callback` returns truthy for. The `callback` is bound to `thisArg` and
+ * invoked with 3 arguments; (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @alias select
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Array} Returns a new array of elements that passed callback check.
+ * @example
+ *
+ * var evens = _.filter([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; });
+ * // => [2, 4, 6]
+ */
+ var filter = createIterator(baseIteratorOptions, filterIteratorOptions);
+
+ /**
+ * Examines each element in a `collection`, returning the first one the `callback`
+ * returns truthy for. The function returns as soon as it finds an acceptable
+ * element, and does not iterate over the entire `collection`. The `callback` is
+ * bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @alias detect
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Mixed} Returns the element that passed the callback check, else `undefined`.
+ * @example
+ *
+ * var even = _.find([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; });
+ * // => 2
+ */
+ var find = createIterator(baseIteratorOptions, forEachIteratorOptions, {
+ 'init': '',
+ 'inLoop': 'if (callback(value, index, collection)) return value'
+ });
+
+ /**
+ * Iterates over a `collection`, executing the `callback` for each element in
+ * the `collection`. The `callback` is bound to `thisArg` and invoked with 3
+ * arguments; (value, index|key, collection). Callbacks may exit iteration
+ * early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @alias each
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Array|Object} Returns `collection`.
+ * @example
+ *
+ * _([1, 2, 3]).forEach(alert).join(',');
+ * // => alerts each number and returns '1,2,3'
+ *
+ * _.forEach({ 'one': 1, 'two': 2, 'three': 3 }, alert);
+ * // => alerts each number (order is not guaranteed)
+ */
+ var forEach = createIterator(baseIteratorOptions, forEachIteratorOptions);
+
+ /**
+ * Creates an object composed of keys returned from running each element of
+ * `collection` through a `callback`. The corresponding value of each key is an
+ * array of elements passed to `callback` that returned the key. The `callback`
+ * is bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection).
+ * The `callback` argument may also be the name of a property to count by (e.g. 'length').
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function|String} callback The function called per iteration or
+ * property name to group by.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * _.groupBy([4.2, 6.1, 6.4], function(num) { return Math.floor(num); });
+ * // => { '4': [4.2], '6': [6.1, 6.4] }
+ *
+ * _.groupBy([4.2, 6.1, 6.4], function(num) { return this.floor(num); }, Math);
+ * // => { '4': [4.2], '6': [6.1, 6.4] }
+ *
+ * _.groupBy(['one', 'two', 'three'], 'length');
+ * // => { '3': ['one', 'two'], '5': ['three'] }
+ */
+ var groupBy = createIterator(baseIteratorOptions, countByIteratorOptions, {
+ 'inLoop':
+ 'prop = callback(value, index, collection);\n' +
+ '(hasOwnProperty.call(result, prop) ? result[prop] : result[prop] = []).push(value)'
+ });
+
+ /**
+ * Invokes the method named by `methodName` on each element in the `collection`.
+ * Additional arguments will be passed to each invoked method. If `methodName`
+ * is a function it will be invoked for, and `this` bound to, each element
+ * in the `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function|String} methodName The name of the method to invoke or
+ * the function invoked per iteration.
+ * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the method with.
+ * @returns {Array} Returns a new array of values returned from each invoked method.
+ * @example
+ *
+ * _.invoke([[5, 1, 7], [3, 2, 1]], 'sort');
+ * // => [[1, 5, 7], [1, 2, 3]]
+ *
+ * _.invoke([123, 456], String.prototype.split, '');
+ * // => [['1', '2', '3'], ['4', '5', '6']]
+ */
+ var invoke = createIterator(mapIteratorOptions, {
+ 'args': 'collection, methodName',
+ 'top':
+ 'var args = slice.call(arguments, 2),\n' +
+ ' isFunc = typeof methodName == \'function\'',
+ 'inLoop': {
+ 'array':
+ 'result[index] = (isFunc ? methodName : value[methodName]).apply(value, args)',
+ 'object':
+ 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') +
+ '((isFunc ? methodName : value[methodName]).apply(value, args))'
+ }
+ });
+
+ /**
+ * Creates a new array of values by running each element in the `collection`
+ * through a `callback`. The `callback` is bound to `thisArg` and invoked with
+ * 3 arguments; (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @alias collect
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Array} Returns a new array of elements returned by the callback.
+ * @example
+ *
+ * _.map([1, 2, 3], function(num) { return num * 3; });
+ * // => [3, 6, 9]
+ *
+ * _.map({ 'one': 1, 'two': 2, 'three': 3 }, function(num) { return num * 3; });
+ * // => [3, 6, 9] (order is not guaranteed)
+ */
+ var map = createIterator(baseIteratorOptions, mapIteratorOptions);
+
+ /**
+ * Retrieves the value of a specified property from all elements in
+ * the `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {String} property The property to pluck.
+ * @returns {Array} Returns a new array of property values.
+ * @example
+ *
+ * var stooges = [
+ * { 'name': 'moe', 'age': 40 },
+ * { 'name': 'larry', 'age': 50 },
+ * { 'name': 'curly', 'age': 60 }
+ * ];
+ *
+ * _.pluck(stooges, 'name');
+ * // => ['moe', 'larry', 'curly']
+ */
+ var pluck = createIterator(mapIteratorOptions, {
+ 'args': 'collection, property',
+ 'inLoop': {
+ 'array': 'result[index] = value[property]',
+ 'object': 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + '(value[property])'
+ }
+ });
+
+ /**
+ * Boils down a `collection` to a single value. The initial state of the
+ * reduction is `accumulator` and each successive step of it should be returned
+ * by the `callback`. The `callback` is bound to `thisArg` and invoked with 4
+ * arguments; for arrays they are (accumulator, value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @alias foldl, inject
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [accumulator] Initial value of the accumulator.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Mixed} Returns the accumulated value.
+ * @example
+ *
+ * var sum = _.reduce([1, 2, 3], function(memo, num) { return memo + num; });
+ * // => 6
+ */
+ var reduce = createIterator({
+ 'args': 'collection, callback, accumulator, thisArg',
+ 'init': 'accumulator',
+ 'top':
+ 'var noaccum = arguments.length < 3;\n' +
+ 'if (thisArg) callback = iteratorBind(callback, thisArg)',
+ 'beforeLoop': {
+ 'array': 'if (noaccum) result = collection[++index]'
+ },
+ 'inLoop': {
+ 'array':
+ 'result = callback(result, value, index, collection)',
+ 'object':
+ 'result = noaccum\n' +
+ ' ? (noaccum = false, value)\n' +
+ ' : callback(result, value, index, collection)'
+ }
+ });
+
+ /**
+ * The right-associative version of `_.reduce`.
+ *
+ * @static
+ * @memberOf _
+ * @alias foldr
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [accumulator] Initial value of the accumulator.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Mixed} Returns the accumulated value.
+ * @example
+ *
+ * var list = [[0, 1], [2, 3], [4, 5]];
+ * var flat = _.reduceRight(list, function(a, b) { return a.concat(b); }, []);
+ * // => [4, 5, 2, 3, 0, 1]
+ */
+ function reduceRight(collection, callback, accumulator, thisArg) {
+ if (!collection) {
+ return accumulator;
+ }
+
+ var length = collection.length,
+ noaccum = arguments.length < 3;
+
+ if(thisArg) {
+ callback = iteratorBind(callback, thisArg);
+ }
+ // Opera 10.53-10.60 JITted `length >>> 0` returns the wrong value for negative numbers
+ if (length > -1 && length === length >>> 0) {
+ var iteratee = noCharByIndex && toString.call(collection) == stringClass
+ ? collection.split('')
+ : collection;
+
+ if (length && noaccum) {
+ accumulator = iteratee[--length];
+ }
+ while (length--) {
+ accumulator = callback(accumulator, iteratee[length], length, collection);
+ }
+ return accumulator;
+ }
+
+ var prop,
+ props = keys(collection);
+
+ length = props.length;
+ if (length && noaccum) {
+ accumulator = collection[props[--length]];
+ }
+ while (length--) {
+ prop = props[length];
+ accumulator = callback(accumulator, collection[prop], prop, collection);
+ }
+ return accumulator;
+ }
+
+ /**
+ * The opposite of `_.filter`, this method returns the values of a
+ * `collection` that `callback` does **not** return truthy for.
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Array} Returns a new array of elements that did **not** pass the callback check.
+ * @example
+ *
+ * var odds = _.reject([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; });
+ * // => [1, 3, 5]
+ */
+ var reject = createIterator(baseIteratorOptions, filterIteratorOptions, {
+ 'inLoop': '!' + filterIteratorOptions.inLoop
+ });
+
+ /**
+ * Checks if the `callback` returns a truthy value for **any** element of a
+ * `collection`. The function returns as soon as it finds passing value, and
+ * does not iterate over the entire `collection`. The `callback` is bound to
+ * `thisArg` and invoked with 3 arguments; (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @alias any
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Boolean} Returns `true` if any element passes the callback check, else `false`.
+ * @example
+ *
+ * _.some([null, 0, 'yes', false]);
+ * // => true
+ */
+ var some = createIterator(baseIteratorOptions, everyIteratorOptions, {
+ 'init': 'false',
+ 'inLoop': everyIteratorOptions.inLoop.replace('!', '')
+ });
+
+ /**
+ * Creates a new array, stable sorted in ascending order by the results of
+ * running each element of `collection` through a `callback`. The `callback`
+ * is bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection).
+ * The `callback` argument may also be the name of a property to sort by (e.g. 'length').
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Function|String} callback The function called per iteration or
+ * property name to sort by.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Array} Returns a new array of sorted elements.
+ * @example
+ *
+ * _.sortBy([1, 2, 3], function(num) { return Math.sin(num); });
+ * // => [3, 1, 2]
+ *
+ * _.sortBy([1, 2, 3], function(num) { return this.sin(num); }, Math);
+ * // => [3, 1, 2]
+ *
+ * _.sortBy(['larry', 'brendan', 'moe'], 'length');
+ * // => ['moe', 'larry', 'brendan']
+ */
+ var sortBy = createIterator(baseIteratorOptions, countByIteratorOptions, mapIteratorOptions, {
+ 'inLoop': {
+ 'array':
+ 'result[index] = {\n' +
+ ' criteria: callback(value, index, collection),\n' +
+ ' index: index,\n' +
+ ' value: value\n' +
+ '}',
+ 'object':
+ 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + '({\n' +
+ ' criteria: callback(value, index, collection),\n' +
+ ' index: index,\n' +
+ ' value: value\n' +
+ '})'
+ },
+ 'bottom':
+ 'result.sort(compareAscending);\n' +
+ 'length = result.length;\n' +
+ 'while (length--) {\n' +
+ ' result[length] = result[length].value\n' +
+ '}'
+ });
+
+ /**
+ * Converts the `collection`, to an array. Useful for converting the
+ * `arguments` object.
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to convert.
+ * @returns {Array} Returns the new converted array.
+ * @example
+ *
+ * (function() { return _.toArray(arguments).slice(1); })(1, 2, 3, 4);
+ * // => [2, 3, 4]
+ */
+ function toArray(collection) {
+ if (!collection) {
+ return [];
+ }
+ if (collection.toArray && isFunction(collection.toArray)) {
+ return collection.toArray();
+ }
+ var length = collection.length;
+ if (length > -1 && length === length >>> 0) {
+ return (noArraySliceOnStrings ? toString.call(collection) == stringClass : typeof collection == 'string')
+ ? collection.split('')
+ : slice.call(collection);
+ }
+ return values(collection);
+ }
+
+ /**
+ * Examines each element in a `collection`, returning an array of all elements
+ * that contain the given `properties`.
+ *
+ * @static
+ * @memberOf _
+ * @category Collections
+ * @param {Array|Object|String} collection The collection to iterate over.
+ * @param {Object} properties The object of properties/values to filter by.
+ * @returns {Array} Returns a new array of elements that contain the given `properties`.
+ * @example
+ *
+ * var stooges = [
+ * { 'name': 'moe', 'age': 40 },
+ * { 'name': 'larry', 'age': 50 },
+ * { 'name': 'curly', 'age': 60 }
+ * ];
+ *
+ * _.where(stooges, { 'age': 40 });
+ * // => [{ 'name': 'moe', 'age': 40 }]
+ */
+ var where = createIterator(filterIteratorOptions, {
+ 'args': 'collection, properties',
+ 'top':
+ 'var pass, prop, propIndex, props = [];\n' +
+ 'forIn(properties, function(value, prop) { props.push(prop) });\n' +
+ 'var propsLength = props.length',
+ 'inLoop':
+ 'for (pass = true, propIndex = 0; propIndex < propsLength; propIndex++) {\n' +
+ ' prop = props[propIndex];\n' +
+ ' if (!(pass = value[prop] === properties[prop])) break\n' +
+ '}\n' +
+ 'if (pass) result.push(value)'
+ });
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Creates a new array with all falsey values of `array` removed. The values
+ * `false`, `null`, `0`, `""`, `undefined` and `NaN` are all falsey.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to compact.
+ * @returns {Array} Returns a new filtered array.
+ * @example
+ *
+ * _.compact([0, 1, false, 2, '', 3]);
+ * // => [1, 2, 3]
+ */
+ function compact(array) {
+ var result = [];
+ if (!array) {
+ return result;
+ }
+ var index = -1,
+ length = array.length;
+
+ while (++index < length) {
+ if (array[index]) {
+ result.push(array[index]);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates a new array of `array` elements not present in the other arrays
+ * using strict equality for comparisons, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to process.
+ * @param {Array} [array1, array2, ...] Arrays to check.
+ * @returns {Array} Returns a new array of `array` elements not present in the
+ * other arrays.
+ * @example
+ *
+ * _.difference([1, 2, 3, 4, 5], [5, 2, 10]);
+ * // => [1, 3, 4]
+ */
+ function difference(array) {
+ var result = [];
+ if (!array) {
+ return result;
+ }
+ var index = -1,
+ length = array.length,
+ flattened = concat.apply(result, arguments),
+ contains = cachedContains(flattened, length);
+
+ while (++index < length) {
+ if (!contains(array[index])) {
+ result.push(array[index]);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the first element of the `array`. Pass `n` to return the first `n`
+ * elements of the `array`.
+ *
+ * @static
+ * @memberOf _
+ * @alias head, take
+ * @category Arrays
+ * @param {Array} array The array to query.
+ * @param {Number} [n] The number of elements to return.
+ * @param {Object} [guard] Internally used to allow this method to work with
+ * others like `_.map` without using their callback `index` argument for `n`.
+ * @returns {Mixed} Returns the first element or an array of the first `n`
+ * elements of `array`.
+ * @example
+ *
+ * _.first([5, 4, 3, 2, 1]);
+ * // => 5
+ */
+ function first(array, n, guard) {
+ if (array) {
+ return (n == null || guard) ? array[0] : slice.call(array, 0, n);
+ }
+ }
+
+ /**
+ * Flattens a nested array (the nesting can be to any depth). If `shallow` is
+ * truthy, `array` will only be flattened a single level.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to compact.
+ * @param {Boolean} shallow A flag to indicate only flattening a single level.
+ * @returns {Array} Returns a new flattened array.
+ * @example
+ *
+ * _.flatten([1, [2], [3, [[4]]]]);
+ * // => [1, 2, 3, 4];
+ *
+ * _.flatten([1, [2], [3, [[4]]]], true);
+ * // => [1, 2, 3, [[4]]];
+ */
+ function flatten(array, shallow) {
+ var result = [];
+ if (!array) {
+ return result;
+ }
+ var value,
+ index = -1,
+ length = array.length;
+
+ while (++index < length) {
+ value = array[index];
+ if (isArray(value)) {
+ push.apply(result, shallow ? value : flatten(value));
+ } else {
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the index at which the first occurrence of `value` is found using
+ * strict equality for comparisons, i.e. `===`. If the `array` is already
+ * sorted, passing `true` for `isSorted` will run a faster binary search.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to search.
+ * @param {Mixed} value The value to search for.
+ * @param {Boolean|Number} [fromIndex=0] The index to start searching from or
+ * `true` to perform a binary search on a sorted `array`.
+ * @returns {Number} Returns the index of the matched value or `-1`.
+ * @example
+ *
+ * _.indexOf([1, 2, 3, 1, 2, 3], 2);
+ * // => 1
+ *
+ * _.indexOf([1, 2, 3, 1, 2, 3], 2, 3);
+ * // => 4
+ *
+ * _.indexOf([1, 1, 2, 2, 3, 3], 2, true);
+ * // => 2
+ */
+ function indexOf(array, value, fromIndex) {
+ if (!array) {
+ return -1;
+ }
+ var index = -1,
+ length = array.length;
+
+ if (fromIndex) {
+ if (typeof fromIndex == 'number') {
+ index = (fromIndex < 0 ? Math.max(0, length + fromIndex) : fromIndex) - 1;
+ } else {
+ index = sortedIndex(array, value);
+ return array[index] === value ? index : -1;
+ }
+ }
+ while (++index < length) {
+ if (array[index] === value) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * Gets all but the last element of `array`. Pass `n` to exclude the last `n`
+ * elements from the result.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to query.
+ * @param {Number} [n] The number of elements to return.
+ * @param {Object} [guard] Internally used to allow this method to work with
+ * others like `_.map` without using their callback `index` argument for `n`.
+ * @returns {Array} Returns all but the last element or `n` elements of `array`.
+ * @example
+ *
+ * _.initial([3, 2, 1]);
+ * // => [3, 2]
+ */
+ function initial(array, n, guard) {
+ if (!array) {
+ return [];
+ }
+ return slice.call(array, 0, -((n == null || guard) ? 1 : n));
+ }
+
+ /**
+ * Computes the intersection of all the passed-in arrays using strict equality
+ * for comparisons, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} [array1, array2, ...] Arrays to process.
+ * @returns {Array} Returns a new array of unique elements, in order, that are
+ * present in **all** of the arrays.
+ * @example
+ *
+ * _.intersection([1, 2, 3], [101, 2, 1, 10], [2, 1]);
+ * // => [1, 2]
+ */
+ function intersection(array) {
+ var result = [];
+ if (!array) {
+ return result;
+ }
+ var value,
+ index = -1,
+ length = array.length,
+ others = slice.call(arguments, 1),
+ cache = [];
+
+ while (++index < length) {
+ value = array[index];
+ if (indexOf(result, value) < 0 &&
+ every(others, function(other, index) {
+ return (cache[index] || (cache[index] = cachedContains(other)))(value);
+ })) {
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the last element of the `array`. Pass `n` to return the lasy `n`
+ * elementsvof the `array`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to query.
+ * @param {Number} [n] The number of elements to return.
+ * @param {Object} [guard] Internally used to allow this method to work with
+ * others like `_.map` without using their callback `index` argument for `n`.
+ * @returns {Mixed} Returns the last element or an array of the last `n`
+ * elements of `array`.
+ * @example
+ *
+ * _.last([3, 2, 1]);
+ * // => 1
+ */
+ function last(array, n, guard) {
+ if (array) {
+ var length = array.length;
+ return (n == null || guard) ? array[length - 1] : slice.call(array, -n || length);
+ }
+ }
+
+ /**
+ * Gets the index at which the last occurrence of `value` is found using
+ * strict equality for comparisons, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to search.
+ * @param {Mixed} value The value to search for.
+ * @param {Number} [fromIndex=array.length-1] The index to start searching from.
+ * @returns {Number} Returns the index of the matched value or `-1`.
+ * @example
+ *
+ * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2);
+ * // => 4
+ *
+ * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2, 3);
+ * // => 1
+ */
+ function lastIndexOf(array, value, fromIndex) {
+ if (!array) {
+ return -1;
+ }
+ var index = array.length;
+ if (fromIndex && typeof fromIndex == 'number') {
+ index = (fromIndex < 0 ? Math.max(0, index + fromIndex) : Math.min(fromIndex, index - 1)) + 1;
+ }
+ while (index--) {
+ if (array[index] === value) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * Retrieves the maximum value of an `array`. If `callback` is passed,
+ * it will be executed for each value in the `array` to generate the
+ * criterion by which the value is ranked. The `callback` is bound to
+ * `thisArg` and invoked with 3 arguments; (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to iterate over.
+ * @param {Function} [callback] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Mixed} Returns the maximum value.
+ * @example
+ *
+ * var stooges = [
+ * { 'name': 'moe', 'age': 40 },
+ * { 'name': 'larry', 'age': 50 },
+ * { 'name': 'curly', 'age': 60 }
+ * ];
+ *
+ * _.max(stooges, function(stooge) { return stooge.age; });
+ * // => { 'name': 'curly', 'age': 60 };
+ */
+ function max(array, callback, thisArg) {
+ var computed = -Infinity,
+ result = computed;
+
+ if (!array) {
+ return result;
+ }
+ var current,
+ index = -1,
+ length = array.length;
+
+ if (!callback) {
+ while (++index < length) {
+ if (array[index] > result) {
+ result = array[index];
+ }
+ }
+ return result;
+ }
+ if (thisArg) {
+ callback = iteratorBind(callback, thisArg);
+ }
+ while (++index < length) {
+ current = callback(array[index], index, array);
+ if (current > computed) {
+ computed = current;
+ result = array[index];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Retrieves the minimum value of an `array`. If `callback` is passed,
+ * it will be executed for each value in the `array` to generate the
+ * criterion by which the value is ranked. The `callback` is bound to `thisArg`
+ * and invoked with 3 arguments; (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to iterate over.
+ * @param {Function} [callback] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Mixed} Returns the minimum value.
+ * @example
+ *
+ * _.min([10, 5, 100, 2, 1000]);
+ * // => 2
+ */
+ function min(array, callback, thisArg) {
+ var computed = Infinity,
+ result = computed;
+
+ if (!array) {
+ return result;
+ }
+ var current,
+ index = -1,
+ length = array.length;
+
+ if (!callback) {
+ while (++index < length) {
+ if (array[index] < result) {
+ result = array[index];
+ }
+ }
+ return result;
+ }
+ if (thisArg) {
+ callback = iteratorBind(callback, thisArg);
+ }
+ while (++index < length) {
+ current = callback(array[index], index, array);
+ if (current < computed) {
+ computed = current;
+ result = array[index];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates an array of numbers (positive and/or negative) progressing from
+ * `start` up to but not including `stop`. This method is a port of Python's
+ * `range()` function. See http://docs.python.org/library/functions.html#range.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Number} [start=0] The start of the range.
+ * @param {Number} end The end of the range.
+ * @param {Number} [step=1] The value to increment or descrement by.
+ * @returns {Array} Returns a new range array.
+ * @example
+ *
+ * _.range(10);
+ * // => [0, 1, 2, 3, 4, 5, 6, 7, 8, 9]
+ *
+ * _.range(1, 11);
+ * // => [1, 2, 3, 4, 5, 6, 7, 8, 9, 10]
+ *
+ * _.range(0, 30, 5);
+ * // => [0, 5, 10, 15, 20, 25]
+ *
+ * _.range(0, -10, -1);
+ * // => [0, -1, -2, -3, -4, -5, -6, -7, -8, -9]
+ *
+ * _.range(0);
+ * // => []
+ */
+ function range(start, end, step) {
+ start = +start || 0;
+ step = +step || 1;
+
+ if (end == null) {
+ end = start;
+ start = 0;
+ }
+ // use `Array(length)` so V8 will avoid the slower "dictionary" mode
+ // http://www.youtube.com/watch?v=XAqIpGU8ZZk#t=16m27s
+ var index = -1,
+ length = Math.max(0, Math.ceil((end - start) / step)),
+ result = Array(length);
+
+ while (++index < length) {
+ result[index] = start;
+ start += step;
+ }
+ return result;
+ }
+
+ /**
+ * The opposite of `_.initial`, this method gets all but the first value of
+ * `array`. Pass `n` to exclude the first `n` values from the result.
+ *
+ * @static
+ * @memberOf _
+ * @alias tail
+ * @category Arrays
+ * @param {Array} array The array to query.
+ * @param {Number} [n] The number of elements to return.
+ * @param {Object} [guard] Internally used to allow this method to work with
+ * others like `_.map` without using their callback `index` argument for `n`.
+ * @returns {Array} Returns all but the first value or `n` values of `array`.
+ * @example
+ *
+ * _.rest([3, 2, 1]);
+ * // => [2, 1]
+ */
+ function rest(array, n, guard) {
+ if (!array) {
+ return [];
+ }
+ return slice.call(array, (n == null || guard) ? 1 : n);
+ }
+
+ /**
+ * Creates a new array of shuffled `array` values, using a version of the
+ * Fisher-Yates shuffle. See http://en.wikipedia.org/wiki/Fisher-Yates_shuffle.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to shuffle.
+ * @returns {Array} Returns a new shuffled array.
+ * @example
+ *
+ * _.shuffle([1, 2, 3, 4, 5, 6]);
+ * // => [4, 1, 6, 3, 5, 2]
+ */
+ function shuffle(array) {
+ if (!array) {
+ return [];
+ }
+ var rand,
+ index = -1,
+ length = array.length,
+ result = Array(length);
+
+ while (++index < length) {
+ rand = Math.floor(Math.random() * (index + 1));
+ result[index] = result[rand];
+ result[rand] = array[index];
+ }
+ return result;
+ }
+
+ /**
+ * Uses a binary search to determine the smallest index at which the `value`
+ * should be inserted into `array` in order to maintain the sort order of the
+ * sorted `array`. If `callback` is passed, it will be executed for `value` and
+ * each element in `array` to compute their sort ranking. The `callback` is
+ * bound to `thisArg` and invoked with 1 argument; (value).
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to iterate over.
+ * @param {Mixed} value The value to evaluate.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Number} Returns the index at which the value should be inserted
+ * into `array`.
+ * @example
+ *
+ * _.sortedIndex([20, 30, 40], 35);
+ * // => 2
+ *
+ * var dict = {
+ * 'wordToNumber': { 'twenty': 20, 'thirty': 30, 'thirty-five': 35, 'fourty': 40 }
+ * };
+ *
+ * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) {
+ * return dict.wordToNumber[word];
+ * });
+ * // => 2
+ *
+ * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) {
+ * return this.wordToNumber[word];
+ * }, dict);
+ * // => 2
+ */
+ function sortedIndex(array, value, callback, thisArg) {
+ if (!array) {
+ return 0;
+ }
+ var mid,
+ low = 0,
+ high = array.length;
+
+ if (callback) {
+ if (thisArg) {
+ callback = bind(callback, thisArg);
+ }
+ value = callback(value);
+ while (low < high) {
+ mid = (low + high) >>> 1;
+ callback(array[mid]) < value ? low = mid + 1 : high = mid;
+ }
+ } else {
+ while (low < high) {
+ mid = (low + high) >>> 1;
+ array[mid] < value ? low = mid + 1 : high = mid;
+ }
+ }
+ return low;
+ }
+
+ /**
+ * Computes the union of the passed-in arrays using strict equality for
+ * comparisons, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} [array1, array2, ...] Arrays to process.
+ * @returns {Array} Returns a new array of unique values, in order, that are
+ * present in one or more of the arrays.
+ * @example
+ *
+ * _.union([1, 2, 3], [101, 2, 1, 10], [2, 1]);
+ * // => [1, 2, 3, 101, 10]
+ */
+ function union() {
+ var index = -1,
+ result = [],
+ flattened = concat.apply(result, arguments),
+ length = flattened.length;
+
+ while (++index < length) {
+ if (indexOf(result, flattened[index]) < 0) {
+ result.push(flattened[index]);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates a duplicate-value-free version of the `array` using strict equality
+ * for comparisons, i.e. `===`. If the `array` is already sorted, passing `true`
+ * for `isSorted` will run a faster algorithm. If `callback` is passed, each
+ * element of `array` is passed through a callback` before uniqueness is computed.
+ * The `callback` is bound to `thisArg` and invoked with 3 arguments; (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @alias unique
+ * @category Arrays
+ * @param {Array} array The array to process.
+ * @param {Boolean} [isSorted=false] A flag to indicate that the `array` is already sorted.
+ * @param {Function} [callback=identity] The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @returns {Array} Returns a duplicate-value-free array.
+ * @example
+ *
+ * _.uniq([1, 2, 1, 3, 1]);
+ * // => [1, 2, 3]
+ *
+ * _.uniq([1, 1, 2, 2, 3], true);
+ * // => [1, 2, 3]
+ *
+ * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return Math.floor(num); });
+ * // => [1, 2, 3]
+ *
+ * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return this.floor(num); }, Math);
+ * // => [1, 2, 3]
+ */
+ function uniq(array, isSorted, callback, thisArg) {
+ var result = [];
+ if (!array) {
+ return result;
+ }
+ var computed,
+ index = -1,
+ length = array.length,
+ seen = [];
+
+ // juggle arguments
+ if (typeof isSorted == 'function') {
+ thisArg = callback;
+ callback = isSorted;
+ isSorted = false;
+ }
+ if (!callback) {
+ callback = identity;
+ } else if (thisArg) {
+ callback = iteratorBind(callback, thisArg);
+ }
+ while (++index < length) {
+ computed = callback(array[index], index, array);
+ if (isSorted
+ ? !index || seen[seen.length - 1] !== computed
+ : indexOf(seen, computed) < 0
+ ) {
+ seen.push(computed);
+ result.push(array[index]);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates a new array with all occurrences of the passed values removed using
+ * strict equality for comparisons, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} array The array to filter.
+ * @param {Mixed} [value1, value2, ...] Values to remove.
+ * @returns {Array} Returns a new filtered array.
+ * @example
+ *
+ * _.without([1, 2, 1, 0, 3, 1, 4], 0, 1);
+ * // => [2, 3, 4]
+ */
+ function without(array) {
+ var result = [];
+ if (!array) {
+ return result;
+ }
+ var index = -1,
+ length = array.length,
+ contains = cachedContains(arguments, 1, 20);
+
+ while (++index < length) {
+ if (!contains(array[index])) {
+ result.push(array[index]);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Groups the elements of each array at their corresponding indexes. Useful for
+ * separate data sources that are coordinated through matching array indexes.
+ * For a matrix of nested arrays, `_.zip.apply(...)` can transpose the matrix
+ * in a similar fashion.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} [array1, array2, ...] Arrays to process.
+ * @returns {Array} Returns a new array of grouped elements.
+ * @example
+ *
+ * _.zip(['moe', 'larry', 'curly'], [30, 40, 50], [true, false, false]);
+ * // => [['moe', 30, true], ['larry', 40, false], ['curly', 50, false]]
+ */
+ function zip(array) {
+ if (!array) {
+ return [];
+ }
+ var index = -1,
+ length = max(pluck(arguments, 'length')),
+ result = Array(length);
+
+ while (++index < length) {
+ result[index] = pluck(arguments, index);
+ }
+ return result;
+ }
+
+ /**
+ * Creates an object composed from an array of `keys` and an array of `values`.
+ *
+ * @static
+ * @memberOf _
+ * @category Arrays
+ * @param {Array} keys The array of keys.
+ * @param {Array} [values=[]] The array of values.
+ * @returns {Object} Returns an object composed of the given keys and
+ * corresponding values.
+ * @example
+ *
+ * _.zipObject(['moe', 'larry', 'curly'], [30, 40, 50]);
+ * // => { 'moe': 30, 'larry': 40, 'curly': 50 }
+ */
+ function zipObject(keys, values) {
+ if (!keys) {
+ return {};
+ }
+ var index = -1,
+ length = keys.length,
+ result = {};
+
+ values || (values = []);
+ while (++index < length) {
+ result[keys[index]] = values[index];
+ }
+ return result;
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Creates a new function that is restricted to executing only after it is
+ * called `n` times.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Number} n The number of times the function must be called before
+ * it is executed.
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * var renderNotes = _.after(notes.length, render);
+ * _.forEach(notes, function(note) {
+ * note.asyncSave({ 'success': renderNotes });
+ * });
+ * // `renderNotes` is run once, after all notes have saved
+ */
+ function after(n, func) {
+ if (n < 1) {
+ return func();
+ }
+ return function() {
+ if (--n < 1) {
+ return func.apply(this, arguments);
+ }
+ };
+ }
+
+ /**
+ * Creates a new function that, when called, invokes `func` with the `this`
+ * binding of `thisArg` and prepends any additional `bind` arguments to those
+ * passed to the bound function. Lazy defined methods may be bound by passing
+ * the object they are bound to as `func` and the method name as `thisArg`.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function|Object} func The function to bind or the object the method belongs to.
+ * @param {Mixed} [thisArg] The `this` binding of `func` or the method name.
+ * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied.
+ * @returns {Function} Returns the new bound function.
+ * @example
+ *
+ * // basic bind
+ * var func = function(greeting) {
+ * return greeting + ' ' + this.name;
+ * };
+ *
+ * func = _.bind(func, { 'name': 'moe' }, 'hi');
+ * func();
+ * // => 'hi moe'
+ *
+ * // lazy bind
+ * var object = {
+ * 'name': 'moe',
+ * 'greet': function(greeting) {
+ * return greeting + ' ' + this.name;
+ * }
+ * };
+ *
+ * var func = _.bind(object, 'greet', 'hi');
+ * func();
+ * // => 'hi moe'
+ *
+ * object.greet = function(greeting) {
+ * return greeting + ', ' + this.name + '!';
+ * };
+ *
+ * func();
+ * // => 'hi, moe!'
+ */
+ function bind(func, thisArg) {
+ var methodName,
+ isFunc = isFunction(func);
+
+ // juggle arguments
+ if (!isFunc) {
+ methodName = thisArg;
+ thisArg = func;
+ }
+ // use `Function#bind` if it exists and is fast
+ // (in V8 `Function#bind` is slower except when partially applied)
+ else if (isBindFast || (nativeBind && arguments.length > 2)) {
+ return nativeBind.call.apply(nativeBind, arguments);
+ }
+
+ var partialArgs = slice.call(arguments, 2);
+
+ function bound() {
+ // `Function#bind` spec
+ // http://es5.github.com/#x15.3.4.5
+ var args = arguments,
+ thisBinding = thisArg;
+
+ if (!isFunc) {
+ func = thisArg[methodName];
+ }
+ if (partialArgs.length) {
+ args = args.length
+ ? partialArgs.concat(slice.call(args))
+ : partialArgs;
+ }
+ if (this instanceof bound) {
+ // get `func` instance if `bound` is invoked in a `new` expression
+ noop.prototype = func.prototype;
+ thisBinding = new noop;
+
+ // mimic the constructor's `return` behavior
+ // http://es5.github.com/#x13.2.2
+ var result = func.apply(thisBinding, args);
+ return result && objectTypes[typeof result]
+ ? result
+ : thisBinding
+ }
+ return func.apply(thisBinding, args);
+ }
+ return bound;
+ }
+
+ /**
+ * Binds methods on `object` to `object`, overwriting the existing method.
+ * If no method names are provided, all the function properties of `object`
+ * will be bound.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Object} object The object to bind and assign the bound methods to.
+ * @param {String} [methodName1, methodName2, ...] Method names on the object to bind.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var buttonView = {
+ * 'label': 'lodash',
+ * 'onClick': function() { alert('clicked: ' + this.label); }
+ * };
+ *
+ * _.bindAll(buttonView);
+ * jQuery('#lodash_button').on('click', buttonView.onClick);
+ * // => When the button is clicked, `this.label` will have the correct value
+ */
+ var bindAll = createIterator({
+ 'useHas': false,
+ 'useStrict': false,
+ 'args': 'object',
+ 'init': 'object',
+ 'top':
+ 'var funcs = arguments,\n' +
+ ' length = funcs.length;\n' +
+ 'if (length > 1) {\n' +
+ ' for (var index = 1; index < length; index++) {\n' +
+ ' result[funcs[index]] = bind(result[funcs[index]], result)\n' +
+ ' }\n' +
+ ' return result\n' +
+ '}',
+ 'inLoop':
+ 'if (isFunction(result[index])) {\n' +
+ ' result[index] = bind(result[index], result)\n' +
+ '}'
+ });
+
+ /**
+ * Creates a new function that is the composition of the passed functions,
+ * where each function consumes the return value of the function that follows.
+ * In math terms, composing the functions `f()`, `g()`, and `h()` produces `f(g(h()))`.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} [func1, func2, ...] Functions to compose.
+ * @returns {Function} Returns the new composed function.
+ * @example
+ *
+ * var greet = function(name) { return 'hi: ' + name; };
+ * var exclaim = function(statement) { return statement + '!'; };
+ * var welcome = _.compose(exclaim, greet);
+ * welcome('moe');
+ * // => 'hi: moe!'
+ */
+ function compose() {
+ var funcs = arguments;
+ return function() {
+ var args = arguments,
+ length = funcs.length;
+
+ while (length--) {
+ args = [funcs[length].apply(this, args)];
+ }
+ return args[0];
+ };
+ }
+
+ /**
+ * Creates a new function that will delay the execution of `func` until after
+ * `wait` milliseconds have elapsed since the last time it was invoked. Pass
+ * `true` for `immediate` to cause debounce to invoke `func` on the leading,
+ * instead of the trailing, edge of the `wait` timeout. Subsequent calls to
+ * the debounced function will return the result of the last `func` call.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to debounce.
+ * @param {Number} wait The number of milliseconds to delay.
+ * @param {Boolean} immediate A flag to indicate execution is on the leading
+ * edge of the timeout.
+ * @returns {Function} Returns the new debounced function.
+ * @example
+ *
+ * var lazyLayout = _.debounce(calculateLayout, 300);
+ * jQuery(window).on('resize', lazyLayout);
+ */
+ function debounce(func, wait, immediate) {
+ var args,
+ result,
+ thisArg,
+ timeoutId;
+
+ function delayed() {
+ timeoutId = null;
+ if (!immediate) {
+ func.apply(thisArg, args);
+ }
+ }
+
+ return function() {
+ var isImmediate = immediate && !timeoutId;
+ args = arguments;
+ thisArg = this;
+
+ clearTimeout(timeoutId);
+ timeoutId = setTimeout(delayed, wait);
+
+ if (isImmediate) {
+ result = func.apply(thisArg, args);
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Executes the `func` function after `wait` milliseconds. Additional arguments
+ * will be passed to `func` when it is invoked.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to delay.
+ * @param {Number} wait The number of milliseconds to delay execution.
+ * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with.
+ * @returns {Number} Returns the `setTimeout` timeout id.
+ * @example
+ *
+ * var log = _.bind(console.log, console);
+ * _.delay(log, 1000, 'logged later');
+ * // => 'logged later' (Appears after one second.)
+ */
+ function delay(func, wait) {
+ var args = slice.call(arguments, 2);
+ return setTimeout(function() { return func.apply(undefined, args); }, wait);
+ }
+
+ /**
+ * Defers executing the `func` function until the current call stack has cleared.
+ * Additional arguments will be passed to `func` when it is invoked.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to defer.
+ * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with.
+ * @returns {Number} Returns the `setTimeout` timeout id.
+ * @example
+ *
+ * _.defer(function() { alert('deferred'); });
+ * // returns from the function before `alert` is called
+ */
+ function defer(func) {
+ var args = slice.call(arguments, 1);
+ return setTimeout(function() { return func.apply(undefined, args); }, 1);
+ }
+
+ /**
+ * Creates a new function that memoizes the result of `func`. If `resolver` is
+ * passed, it will be used to determine the cache key for storing the result
+ * based on the arguments passed to the memoized function. By default, the first
+ * argument passed to the memoized function is used as the cache key.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to have its output memoized.
+ * @param {Function} [resolver] A function used to resolve the cache key.
+ * @returns {Function} Returns the new memoizing function.
+ * @example
+ *
+ * var fibonacci = _.memoize(function(n) {
+ * return n < 2 ? n : fibonacci(n - 1) + fibonacci(n - 2);
+ * });
+ */
+ function memoize(func, resolver) {
+ var cache = {};
+ return function() {
+ var prop = resolver ? resolver.apply(this, arguments) : arguments[0];
+ return hasOwnProperty.call(cache, prop)
+ ? cache[prop]
+ : (cache[prop] = func.apply(this, arguments));
+ };
+ }
+
+ /**
+ * Creates a new function that is restricted to one execution. Repeat calls to
+ * the function will return the value of the first call.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * var initialize = _.once(createApplication);
+ * initialize();
+ * initialize();
+ * // Application is only created once.
+ */
+ function once(func) {
+ var result,
+ ran = false;
+
+ return function() {
+ if (ran) {
+ return result;
+ }
+ ran = true;
+ result = func.apply(this, arguments);
+
+ // clear the `func` variable so the function may be garbage collected
+ func = null;
+ return result;
+ };
+ }
+
+ /**
+ * Creates a new function that, when called, invokes `func` with any additional
+ * `partial` arguments prepended to those passed to the new function. This method
+ * is similar `bind`, except it does **not** alter the `this` binding.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to partially apply arguments to.
+ * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied.
+ * @returns {Function} Returns the new partially applied function.
+ * @example
+ *
+ * var greet = function(greeting, name) { return greeting + ': ' + name; };
+ * var hi = _.partial(greet, 'hi');
+ * hi('moe');
+ * // => 'hi: moe'
+ */
+ function partial(func) {
+ var args = slice.call(arguments, 1),
+ argsLength = args.length;
+
+ return function() {
+ var result,
+ others = arguments;
+
+ if (others.length) {
+ args.length = argsLength;
+ push.apply(args, others);
+ }
+ result = args.length == 1 ? func.call(this, args[0]) : func.apply(this, args);
+ args.length = argsLength;
+ return result;
+ };
+ }
+
+ /**
+ * Creates a new function that, when executed, will only call the `func`
+ * function at most once per every `wait` milliseconds. If the throttled
+ * function is invoked more than once during the `wait` timeout, `func` will
+ * also be called on the trailing edge of the timeout. Subsequent calls to the
+ * throttled function will return the result of the last `func` call.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Function} func The function to throttle.
+ * @param {Number} wait The number of milliseconds to throttle executions to.
+ * @returns {Function} Returns the new throttled function.
+ * @example
+ *
+ * var throttled = _.throttle(updatePosition, 100);
+ * jQuery(window).on('scroll', throttled);
+ */
+ function throttle(func, wait) {
+ var args,
+ result,
+ thisArg,
+ timeoutId,
+ lastCalled = 0;
+
+ function trailingCall() {
+ lastCalled = new Date;
+ timeoutId = null;
+ func.apply(thisArg, args);
+ }
+
+ return function() {
+ var now = new Date,
+ remain = wait - (now - lastCalled);
+
+ args = arguments;
+ thisArg = this;
+
+ if (remain <= 0) {
+ lastCalled = now;
+ result = func.apply(thisArg, args);
+ }
+ else if (!timeoutId) {
+ timeoutId = setTimeout(trailingCall, remain);
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Creates a new function that passes `value` to the `wrapper` function as its
+ * first argument. Additional arguments passed to the new function are appended
+ * to those passed to the `wrapper` function.
+ *
+ * @static
+ * @memberOf _
+ * @category Functions
+ * @param {Mixed} value The value to wrap.
+ * @param {Function} wrapper The wrapper function.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var hello = function(name) { return 'hello: ' + name; };
+ * hello = _.wrap(hello, function(func) {
+ * return 'before, ' + func('moe') + ', after';
+ * });
+ * hello();
+ * // => 'before, hello: moe, after'
+ */
+ function wrap(value, wrapper) {
+ return function() {
+ var args = [value];
+ if (arguments.length) {
+ push.apply(args, arguments);
+ }
+ return wrapper.apply(this, args);
+ };
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Escapes a string for inclusion in HTML, replacing `&`, `<`, `"`, and `'`
+ * characters.
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {String} string The string to escape.
+ * @returns {String} Returns the escaped string.
+ * @example
+ *
+ * _.escape('Moe, Larry & Curly');
+ * // => "Moe, Larry &amp; Curly"
+ */
+ function escape(string) {
+ return string == null ? '' : (string + '').replace(reUnescapedHtml, escapeHtmlChar);
+ }
+
+ /**
+ * This function returns the first argument passed to it.
+ *
+ * Note: It is used throughout Lo-Dash as a default callback.
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {Mixed} value Any value.
+ * @returns {Mixed} Returns `value`.
+ * @example
+ *
+ * var moe = { 'name': 'moe' };
+ * moe === _.identity(moe);
+ * // => true
+ */
+ function identity(value) {
+ return value;
+ }
+
+ /**
+ * Adds functions properties of `object` to the `lodash` function and chainable
+ * wrapper.
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {Object} object The object of function properties to add to `lodash`.
+ * @example
+ *
+ * _.mixin({
+ * 'capitalize': function(string) {
+ * return string.charAt(0).toUpperCase() + string.slice(1).toLowerCase();
+ * }
+ * });
+ *
+ * _.capitalize('larry');
+ * // => 'Larry'
+ *
+ * _('curly').capitalize();
+ * // => 'Curly'
+ */
+ function mixin(object) {
+ forEach(functions(object), function(methodName) {
+ var func = lodash[methodName] = object[methodName];
+
+ LoDash.prototype[methodName] = function() {
+ var args = [this._wrapped];
+ if (arguments.length) {
+ push.apply(args, arguments);
+ }
+ var result = func.apply(lodash, args);
+ if (this._chain) {
+ result = new LoDash(result);
+ result._chain = true;
+ }
+ return result;
+ };
+ });
+ }
+
+ /**
+ * Reverts the '_' variable to its previous value and returns a reference to
+ * the `lodash` function.
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @returns {Function} Returns the `lodash` function.
+ * @example
+ *
+ * var lodash = _.noConflict();
+ */
+ function noConflict() {
+ window._ = oldDash;
+ return this;
+ }
+
+ /**
+ * Resolves the value of `property` on `object`. If `property` is a function
+ * it will be invoked and its result returned, else the property value is
+ * returned. If `object` is falsey, then `null` is returned.
+ *
+ * @deprecated
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {Object} object The object to inspect.
+ * @param {String} property The property to get the result of.
+ * @returns {Mixed} Returns the resolved value.
+ * @example
+ *
+ * var object = {
+ * 'cheese': 'crumpets',
+ * 'stuff': function() {
+ * return 'nonsense';
+ * }
+ * };
+ *
+ * _.result(object, 'cheese');
+ * // => 'crumpets'
+ *
+ * _.result(object, 'stuff');
+ * // => 'nonsense'
+ */
+ function result(object, property) {
+ // based on Backbone's private `getValue` function
+ // https://github.com/documentcloud/backbone/blob/0.9.2/backbone.js#L1419-1424
+ if (!object) {
+ return null;
+ }
+ var value = object[property];
+ return isFunction(value) ? object[property]() : value;
+ }
+
+ /**
+ * A micro-templating method that handles arbitrary delimiters, preserves
+ * whitespace, and correctly escapes quotes within interpolated code.
+ *
+ * Note: In the development build `_.template` utilizes sourceURLs for easier
+ * debugging. See http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl
+ *
+ * Note: Lo-Dash may be used in Chrome extensions by either creating a `lodash csp`
+ * build and avoiding `_.template` use, or loading Lo-Dash in a sandboxed page.
+ * See http://developer.chrome.com/trunk/extensions/sandboxingEval.html
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {String} text The template text.
+ * @param {Obect} data The data object used to populate the text.
+ * @param {Object} options The options object.
+ * @returns {Function|String} Returns a compiled function when no `data` object
+ * is given, else it returns the interpolated text.
+ * @example
+ *
+ * // using a compiled template
+ * var compiled = _.template('hello: <%= name %>');
+ * compiled({ 'name': 'moe' });
+ * // => 'hello: moe'
+ *
+ * var list = '<% _.forEach(people, function(name) { %> <li><%= name %></li> <% }); %>';
+ * _.template(list, { 'people': ['moe', 'larry', 'curly'] });
+ * // => '<li>moe</li><li>larry</li><li>curly</li>'
+ *
+ * // using the "escape" delimiter to escape HTML in data property values
+ * _.template('<b><%- value %></b>', { 'value': '<script>' });
+ * // => '<b>&lt;script></b>'
+ *
+ * // using the internal `print` function in "evaluate" delimiters
+ * _.template('<% print("Hello " + epithet); %>', { 'epithet': 'stooge' });
+ * // => 'Hello stooge.'
+ *
+ * // using custom template delimiter settings
+ * _.templateSettings = {
+ * 'interpolate': /\{\{(.+?)\}\}/g
+ * };
+ *
+ * _.template('Hello {{ name }}!', { 'name': 'Mustache' });
+ * // => 'Hello Mustache!'
+ *
+ * // using the `variable` option to ensure a with-statement isn't used in the compiled template
+ * var compiled = _.template('hello: <%= data.name %>', null, { 'variable': 'data' });
+ * compiled.source;
+ * // => function(data) {
+ * var __t, __p = '', __e = _.escape;
+ * __p += 'hello: ' + ((__t = ( data.name )) == null ? '' : __t);
+ * return __p;
+ * }
+ *
+ * // using the `source` property to inline compiled templates for meaningful
+ * // line numbers in error messages and a stack trace
+ * fs.writeFileSync(path.join(cwd, 'jst.js'), '\
+ * var JST = {\
+ * "main": ' + _.template(mainText).source + '\
+ * };\
+ * ');
+ */
+ function template(text, data, options) {
+ // based on John Resig's `tmpl` implementation
+ // http://ejohn.org/blog/javascript-micro-templating/
+ // and Laura Doktorova's doT.js
+ // https://github.com/olado/doT
+ options || (options = {});
+ text += '';
+
+ var isEvaluating,
+ result,
+ escapeDelimiter = options.escape,
+ evaluateDelimiter = options.evaluate,
+ interpolateDelimiter = options.interpolate,
+ settings = lodash.templateSettings,
+ variable = options.variable || settings.variable,
+ hasVariable = variable;
+
+ // use default settings if no options object is provided
+ if (escapeDelimiter == null) {
+ escapeDelimiter = settings.escape;
+ }
+ if (evaluateDelimiter == null) {
+ // use `false` as the fallback value, instead of leaving it `undefined`,
+ // so the initial assignment of `reEvaluateDelimiter` will still occur
+ evaluateDelimiter = settings.evaluate || false;
+ }
+ if (interpolateDelimiter == null) {
+ interpolateDelimiter = settings.interpolate;
+ }
+
+ // tokenize delimiters to avoid escaping them
+ if (escapeDelimiter) {
+ text = text.replace(escapeDelimiter, tokenizeEscape);
+ }
+ if (interpolateDelimiter) {
+ text = text.replace(interpolateDelimiter, tokenizeInterpolate);
+ }
+ if (evaluateDelimiter != lastEvaluateDelimiter) {
+ // generate `reEvaluateDelimiter` to match `_.templateSettings.evaluate`
+ // and internal `<e%- %>`, `<e%= %>` delimiters
+ lastEvaluateDelimiter = evaluateDelimiter;
+ reEvaluateDelimiter = RegExp(
+ '<e%-([\\s\\S]+?)%>|<e%=([\\s\\S]+?)%>' +
+ (evaluateDelimiter ? '|' + evaluateDelimiter.source : '')
+ , 'g');
+ }
+ isEvaluating = tokenized.length;
+ text = text.replace(reEvaluateDelimiter, tokenizeEvaluate);
+ isEvaluating = isEvaluating != tokenized.length;
+
+ // escape characters that cannot be included in string literals and
+ // detokenize delimiter code snippets
+ text = "__p += '" + text
+ .replace(reUnescapedString, escapeStringChar)
+ .replace(reToken, detokenize) + "';\n";
+
+ // clear stored code snippets
+ tokenized.length = 0;
+
+ // if `variable` is not specified and the template contains "evaluate"
+ // delimiters, wrap a with-statement around the generated code to add the
+ // data object to the top of the scope chain
+ if (!hasVariable) {
+ variable = lastVariable || 'obj';
+
+ if (isEvaluating) {
+ text = 'with (' + variable + ') {\n' + text + '\n}\n';
+ }
+ else {
+ if (variable != lastVariable) {
+ // generate `reDoubleVariable` to match references like `obj.obj` inside
+ // transformed "escape" and "interpolate" delimiters
+ lastVariable = variable;
+ reDoubleVariable = RegExp('(\\(\\s*)' + variable + '\\.' + variable + '\\b', 'g');
+ }
+ // avoid a with-statement by prepending data object references to property names
+ text = text
+ .replace(reInsertVariable, '$&' + variable + '.')
+ .replace(reDoubleVariable, '$1__d');
+ }
+ }
+
+ // cleanup code by stripping empty strings
+ text = ( isEvaluating ? text.replace(reEmptyStringLeading, '') : text)
+ .replace(reEmptyStringMiddle, '$1')
+ .replace(reEmptyStringTrailing, '$1;');
+
+ // frame code as the function body
+ text = 'function(' + variable + ') {\n' +
+ (hasVariable ? '' : variable + ' || (' + variable + ' = {});\n') +
+ 'var __t, __p = \'\', __e = _.escape' +
+ (isEvaluating
+ ? ', __j = Array.prototype.join;\n' +
+ 'function print() { __p += __j.call(arguments, \'\') }\n'
+ : (hasVariable ? '' : ', __d = ' + variable + '.' + variable + ' || ' + variable) + ';\n'
+ ) +
+ text +
+ 'return __p\n}';
+
+ // add a sourceURL for easier debugging
+ // http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl
+ if (useSourceURL) {
+ text += '\n//@ sourceURL=/lodash/template/source[' + (templateCounter++) + ']';
+ }
+
+ try {
+ result = Function('_', 'return ' + text)(lodash);
+ } catch(e) {
+ // defer syntax errors until the compiled template is executed to allow
+ // examining the `source` property beforehand and for consistency,
+ // because other template related errors occur at execution
+ result = function() { throw e; };
+ }
+
+ if (data) {
+ return result(data);
+ }
+ // provide the compiled function's source via its `toString` method, in
+ // supported environments, or the `source` property as a convenience for
+ // inlining compiled templates during the build process
+ result.source = text;
+ return result;
+ }
+
+ /**
+ * Executes the `callback` function `n` times. The `callback` is bound to
+ * `thisArg` and invoked with 1 argument; (index).
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {Number} n The number of times to execute the callback.
+ * @param {Function} callback The function called per iteration.
+ * @param {Mixed} [thisArg] The `this` binding for the callback.
+ * @example
+ *
+ * _.times(3, function() { genie.grantWish(); });
+ * // => calls `genie.grantWish()` 3 times
+ *
+ * _.times(3, function() { this.grantWish(); }, genie);
+ * // => also calls `genie.grantWish()` 3 times
+ */
+ function times(n, callback, thisArg) {
+ var index = -1;
+ if (thisArg) {
+ while (++index < n) {
+ callback.call(thisArg, index);
+ }
+ } else {
+ while (++index < n) {
+ callback(index);
+ }
+ }
+ }
+
+ /**
+ * Generates a unique id. If `prefix` is passed, the id will be appended to it.
+ *
+ * @static
+ * @memberOf _
+ * @category Utilities
+ * @param {String} [prefix] The value to prefix the id with.
+ * @returns {Number|String} Returns a numeric id if no prefix is passed, else
+ * a string id may be returned.
+ * @example
+ *
+ * _.uniqueId('contact_');
+ * // => 'contact_104'
+ */
+ function uniqueId(prefix) {
+ var id = idCounter++;
+ return prefix ? prefix + id : id;
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Wraps the value in a `lodash` wrapper object.
+ *
+ * @static
+ * @memberOf _
+ * @category Chaining
+ * @param {Mixed} value The value to wrap.
+ * @returns {Object} Returns the wrapper object.
+ * @example
+ *
+ * var stooges = [
+ * { 'name': 'moe', 'age': 40 },
+ * { 'name': 'larry', 'age': 50 },
+ * { 'name': 'curly', 'age': 60 }
+ * ];
+ *
+ * var youngest = _.chain(stooges)
+ * .sortBy(function(stooge) { return stooge.age; })
+ * .map(function(stooge) { return stooge.name + ' is ' + stooge.age; })
+ * .first()
+ * .value();
+ * // => 'moe is 40'
+ */
+ function chain(value) {
+ value = new LoDash(value);
+ value._chain = true;
+ return value;
+ }
+
+ /**
+ * Invokes `interceptor` with the `value` as the first argument, and then
+ * returns `value`. The purpose of this method is to "tap into" a method chain,
+ * in order to perform operations on intermediate results within the chain.
+ *
+ * @static
+ * @memberOf _
+ * @category Chaining
+ * @param {Mixed} value The value to pass to `interceptor`.
+ * @param {Function} interceptor The function to invoke.
+ * @returns {Mixed} Returns `value`.
+ * @example
+ *
+ * _.chain([1,2,3,200])
+ * .filter(function(num) { return num % 2 == 0; })
+ * .tap(alert)
+ * .map(function(num) { return num * num })
+ * .value();
+ * // => // [2, 200] (alerted)
+ * // => [4, 40000]
+ */
+ function tap(value, interceptor) {
+ interceptor(value);
+ return value;
+ }
+
+ /**
+ * Enables method chaining on the wrapper object.
+ *
+ * @name chain
+ * @deprecated
+ * @memberOf _
+ * @category Chaining
+ * @returns {Mixed} Returns the wrapper object.
+ * @example
+ *
+ * _([1, 2, 3]).value();
+ * // => [1, 2, 3]
+ */
+ function wrapperChain() {
+ this._chain = true;
+ return this;
+ }
+
+ /**
+ * Extracts the wrapped value.
+ *
+ * @name value
+ * @memberOf _
+ * @category Chaining
+ * @returns {Mixed} Returns the wrapped value.
+ * @example
+ *
+ * _([1, 2, 3]).value();
+ * // => [1, 2, 3]
+ */
+ function wrapperValue() {
+ return this._wrapped;
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * The semantic version number.
+ *
+ * @static
+ * @memberOf _
+ * @type String
+ */
+ lodash.VERSION = '0.5.2';
+
+ // assign static methods
+ lodash.after = after;
+ lodash.bind = bind;
+ lodash.bindAll = bindAll;
+ lodash.chain = chain;
+ lodash.clone = clone;
+ lodash.compact = compact;
+ lodash.compose = compose;
+ lodash.contains = contains;
+ lodash.countBy = countBy;
+ lodash.debounce = debounce;
+ lodash.defaults = defaults;
+ lodash.defer = defer;
+ lodash.delay = delay;
+ lodash.difference = difference;
+ lodash.drop = drop;
+ lodash.escape = escape;
+ lodash.every = every;
+ lodash.extend = extend;
+ lodash.filter = filter;
+ lodash.find = find;
+ lodash.first = first;
+ lodash.flatten = flatten;
+ lodash.forEach = forEach;
+ lodash.forIn = forIn;
+ lodash.forOwn = forOwn;
+ lodash.functions = functions;
+ lodash.groupBy = groupBy;
+ lodash.has = has;
+ lodash.identity = identity;
+ lodash.indexOf = indexOf;
+ lodash.initial = initial;
+ lodash.intersection = intersection;
+ lodash.invoke = invoke;
+ lodash.isArguments = isArguments;
+ lodash.isArray = isArray;
+ lodash.isBoolean = isBoolean;
+ lodash.isDate = isDate;
+ lodash.isElement = isElement;
+ lodash.isEmpty = isEmpty;
+ lodash.isEqual = isEqual;
+ lodash.isFinite = isFinite;
+ lodash.isFunction = isFunction;
+ lodash.isNaN = isNaN;
+ lodash.isNull = isNull;
+ lodash.isNumber = isNumber;
+ lodash.isObject = isObject;
+ lodash.isRegExp = isRegExp;
+ lodash.isString = isString;
+ lodash.isUndefined = isUndefined;
+ lodash.keys = keys;
+ lodash.last = last;
+ lodash.lastIndexOf = lastIndexOf;
+ lodash.map = map;
+ lodash.max = max;
+ lodash.memoize = memoize;
+ lodash.merge = merge;
+ lodash.min = min;
+ lodash.mixin = mixin;
+ lodash.noConflict = noConflict;
+ lodash.once = once;
+ lodash.partial = partial;
+ lodash.pick = pick;
+ lodash.pluck = pluck;
+ lodash.range = range;
+ lodash.reduce = reduce;
+ lodash.reduceRight = reduceRight;
+ lodash.reject = reject;
+ lodash.rest = rest;
+ lodash.result = result;
+ lodash.shuffle = shuffle;
+ lodash.size = size;
+ lodash.some = some;
+ lodash.sortBy = sortBy;
+ lodash.sortedIndex = sortedIndex;
+ lodash.tap = tap;
+ lodash.template = template;
+ lodash.throttle = throttle;
+ lodash.times = times;
+ lodash.toArray = toArray;
+ lodash.union = union;
+ lodash.uniq = uniq;
+ lodash.uniqueId = uniqueId;
+ lodash.values = values;
+ lodash.where = where;
+ lodash.without = without;
+ lodash.wrap = wrap;
+ lodash.zip = zip;
+ lodash.zipObject = zipObject;
+
+ // assign aliases
+ lodash.all = every;
+ lodash.any = some;
+ lodash.collect = map;
+ lodash.detect = find;
+ lodash.each = forEach;
+ lodash.foldl = reduce;
+ lodash.foldr = reduceRight;
+ lodash.head = first;
+ lodash.include = contains;
+ lodash.inject = reduce;
+ lodash.methods = functions;
+ lodash.select = filter;
+ lodash.tail = rest;
+ lodash.take = first;
+ lodash.unique = uniq;
+
+ // add pseudo private properties used and removed during the build process
+ lodash._iteratorTemplate = iteratorTemplate;
+ lodash._shimKeys = shimKeys;
+
+ /*--------------------------------------------------------------------------*/
+
+ // assign private `LoDash` constructor's prototype
+ LoDash.prototype = lodash.prototype;
+
+ // add all static functions to `LoDash.prototype`
+ mixin(lodash);
+
+ // add `LoDash.prototype.chain` after calling `mixin()` to avoid overwriting
+ // it with the wrapped `lodash.chain`
+ LoDash.prototype.chain = wrapperChain;
+ LoDash.prototype.value = wrapperValue;
+
+ // add all mutator Array functions to the wrapper.
+ forEach(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(methodName) {
+ var func = ArrayProto[methodName];
+
+ LoDash.prototype[methodName] = function() {
+ var value = this._wrapped;
+ func.apply(value, arguments);
+
+ // Firefox < 10, IE compatibility mode, and IE < 9 have buggy Array
+ // `shift()` and `splice()` functions that fail to remove the last element,
+ // `value[0]`, of array-like objects even though the `length` property is
+ // set to `0`. The `shift()` method is buggy in IE 8 compatibility mode,
+ // while `splice()` is buggy regardless of mode in IE < 9 and buggy in
+ // compatibility mode in IE 9.
+ if (value.length === 0) {
+ delete value[0];
+ }
+ if (this._chain) {
+ value = new LoDash(value);
+ value._chain = true;
+ }
+ return value;
+ };
+ });
+
+ // add all accessor Array functions to the wrapper.
+ forEach(['concat', 'join', 'slice'], function(methodName) {
+ var func = ArrayProto[methodName];
+
+ LoDash.prototype[methodName] = function() {
+ var value = this._wrapped,
+ result = func.apply(value, arguments);
+
+ if (this._chain) {
+ result = new LoDash(result);
+ result._chain = true;
+ }
+ return result;
+ };
+ });
+
+ /*--------------------------------------------------------------------------*/
+
+ // expose Lo-Dash
+ // some AMD build optimizers, like r.js, check for specific condition patterns like the following:
+ if (typeof define == 'function' && typeof define.amd == 'object' && define.amd) {
+ // Expose Lo-Dash to the global object even when an AMD loader is present in
+ // case Lo-Dash was injected by a third-party script and not intended to be
+ // loaded as a module. The global assignment can be reverted in the Lo-Dash
+ // module via its `noConflict()` method.
+ window._ = lodash;
+
+ // define as an anonymous module so, through path mapping, it can be
+ // referenced as the "underscore" module
+ define(function() {
+ return lodash;
+ });
+ }
+ // check for `exports` after `define` in case a build optimizer adds an `exports` object
+ else if (freeExports) {
+ // in Node.js or RingoJS v0.8.0+
+ if (typeof module == 'object' && module && module.exports == freeExports) {
+ (module.exports = lodash)._ = lodash;
+ }
+ // in Narwhal or RingoJS v0.7.0-
+ else {
+ freeExports._ = lodash;
+ }
+ }
+ else {
+ // in a browser or Rhino
+ window._ = lodash;
+ }
+}(this));
diff --git a/module/web/static/js/libs/require-2.0.6.js b/module/web/static/js/libs/require-2.0.6.js
new file mode 100644
index 000000000..b592d5f22
--- /dev/null
+++ b/module/web/static/js/libs/require-2.0.6.js
@@ -0,0 +1,2041 @@
+/** vim: et:ts=4:sw=4:sts=4
+ * @license RequireJS 2.0.6 Copyright (c) 2010-2012, The Dojo Foundation All Rights Reserved.
+ * Available via the MIT or new BSD license.
+ * see: http://github.com/jrburke/requirejs for details
+ */
+//Not using strict: uneven strict support in browsers, #392, and causes
+//problems with requirejs.exec()/transpiler plugins that may not be strict.
+/*jslint regexp: true, nomen: true, sloppy: true */
+/*global window, navigator, document, importScripts, jQuery, setTimeout, opera */
+
+var requirejs, require, define;
+(function (global) {
+ var req, s, head, baseElement, dataMain, src,
+ interactiveScript, currentlyAddingScript, mainScript, subPath,
+ version = '2.0.6',
+ commentRegExp = /(\/\*([\s\S]*?)\*\/|([^:]|^)\/\/(.*)$)/mg,
+ cjsRequireRegExp = /[^.]\s*require\s*\(\s*["']([^'"\s]+)["']\s*\)/g,
+ jsSuffixRegExp = /\.js$/,
+ currDirRegExp = /^\.\//,
+ op = Object.prototype,
+ ostring = op.toString,
+ hasOwn = op.hasOwnProperty,
+ ap = Array.prototype,
+ aps = ap.slice,
+ apsp = ap.splice,
+ isBrowser = !!(typeof window !== 'undefined' && navigator && document),
+ isWebWorker = !isBrowser && typeof importScripts !== 'undefined',
+ //PS3 indicates loaded and complete, but need to wait for complete
+ //specifically. Sequence is 'loading', 'loaded', execution,
+ // then 'complete'. The UA check is unfortunate, but not sure how
+ //to feature test w/o causing perf issues.
+ readyRegExp = isBrowser && navigator.platform === 'PLAYSTATION 3' ?
+ /^complete$/ : /^(complete|loaded)$/,
+ defContextName = '_',
+ //Oh the tragedy, detecting opera. See the usage of isOpera for reason.
+ isOpera = typeof opera !== 'undefined' && opera.toString() === '[object Opera]',
+ contexts = {},
+ cfg = {},
+ globalDefQueue = [],
+ useInteractive = false;
+
+ function isFunction(it) {
+ return ostring.call(it) === '[object Function]';
+ }
+
+ function isArray(it) {
+ return ostring.call(it) === '[object Array]';
+ }
+
+ /**
+ * Helper function for iterating over an array. If the func returns
+ * a true value, it will break out of the loop.
+ */
+ function each(ary, func) {
+ if (ary) {
+ var i;
+ for (i = 0; i < ary.length; i += 1) {
+ if (ary[i] && func(ary[i], i, ary)) {
+ break;
+ }
+ }
+ }
+ }
+
+ /**
+ * Helper function for iterating over an array backwards. If the func
+ * returns a true value, it will break out of the loop.
+ */
+ function eachReverse(ary, func) {
+ if (ary) {
+ var i;
+ for (i = ary.length - 1; i > -1; i -= 1) {
+ if (ary[i] && func(ary[i], i, ary)) {
+ break;
+ }
+ }
+ }
+ }
+
+ function hasProp(obj, prop) {
+ return hasOwn.call(obj, prop);
+ }
+
+ /**
+ * Cycles over properties in an object and calls a function for each
+ * property value. If the function returns a truthy value, then the
+ * iteration is stopped.
+ */
+ function eachProp(obj, func) {
+ var prop;
+ for (prop in obj) {
+ if (obj.hasOwnProperty(prop)) {
+ if (func(obj[prop], prop)) {
+ break;
+ }
+ }
+ }
+ }
+
+ /**
+ * Simple function to mix in properties from source into target,
+ * but only if target does not already have a property of the same name.
+ * This is not robust in IE for transferring methods that match
+ * Object.prototype names, but the uses of mixin here seem unlikely to
+ * trigger a problem related to that.
+ */
+ function mixin(target, source, force, deepStringMixin) {
+ if (source) {
+ eachProp(source, function (value, prop) {
+ if (force || !hasProp(target, prop)) {
+ if (deepStringMixin && typeof value !== 'string') {
+ if (!target[prop]) {
+ target[prop] = {};
+ }
+ mixin(target[prop], value, force, deepStringMixin);
+ } else {
+ target[prop] = value;
+ }
+ }
+ });
+ }
+ return target;
+ }
+
+ //Similar to Function.prototype.bind, but the 'this' object is specified
+ //first, since it is easier to read/figure out what 'this' will be.
+ function bind(obj, fn) {
+ return function () {
+ return fn.apply(obj, arguments);
+ };
+ }
+
+ function scripts() {
+ return document.getElementsByTagName('script');
+ }
+
+ //Allow getting a global that expressed in
+ //dot notation, like 'a.b.c'.
+ function getGlobal(value) {
+ if (!value) {
+ return value;
+ }
+ var g = global;
+ each(value.split('.'), function (part) {
+ g = g[part];
+ });
+ return g;
+ }
+
+ function makeContextModuleFunc(func, relMap, enableBuildCallback) {
+ return function () {
+ //A version of a require function that passes a moduleName
+ //value for items that may need to
+ //look up paths relative to the moduleName
+ var args = aps.call(arguments, 0), lastArg;
+ if (enableBuildCallback &&
+ isFunction((lastArg = args[args.length - 1]))) {
+ lastArg.__requireJsBuild = true;
+ }
+ args.push(relMap);
+ return func.apply(null, args);
+ };
+ }
+
+ function addRequireMethods(req, context, relMap) {
+ each([
+ ['toUrl'],
+ ['undef'],
+ ['defined', 'requireDefined'],
+ ['specified', 'requireSpecified']
+ ], function (item) {
+ var prop = item[1] || item[0];
+ req[item[0]] = context ? makeContextModuleFunc(context[prop], relMap) :
+ //If no context, then use default context. Reference from
+ //contexts instead of early binding to default context, so
+ //that during builds, the latest instance of the default
+ //context with its config gets used.
+ function () {
+ var ctx = contexts[defContextName];
+ return ctx[prop].apply(ctx, arguments);
+ };
+ });
+ }
+
+ /**
+ * Constructs an error with a pointer to an URL with more information.
+ * @param {String} id the error ID that maps to an ID on a web page.
+ * @param {String} message human readable error.
+ * @param {Error} [err] the original error, if there is one.
+ *
+ * @returns {Error}
+ */
+ function makeError(id, msg, err, requireModules) {
+ var e = new Error(msg + '\nhttp://requirejs.org/docs/errors.html#' + id);
+ e.requireType = id;
+ e.requireModules = requireModules;
+ if (err) {
+ e.originalError = err;
+ }
+ return e;
+ }
+
+ if (typeof define !== 'undefined') {
+ //If a define is already in play via another AMD loader,
+ //do not overwrite.
+ return;
+ }
+
+ if (typeof requirejs !== 'undefined') {
+ if (isFunction(requirejs)) {
+ //Do not overwrite and existing requirejs instance.
+ return;
+ }
+ cfg = requirejs;
+ requirejs = undefined;
+ }
+
+ //Allow for a require config object
+ if (typeof require !== 'undefined' && !isFunction(require)) {
+ //assume it is a config object.
+ cfg = require;
+ require = undefined;
+ }
+
+ function newContext(contextName) {
+ var inCheckLoaded, Module, context, handlers,
+ checkLoadedTimeoutId,
+ config = {
+ waitSeconds: 7,
+ baseUrl: './',
+ paths: {},
+ pkgs: {},
+ shim: {}
+ },
+ registry = {},
+ undefEvents = {},
+ defQueue = [],
+ defined = {},
+ urlFetched = {},
+ requireCounter = 1,
+ unnormalizedCounter = 1,
+ //Used to track the order in which modules
+ //should be executed, by the order they
+ //load. Important for consistent cycle resolution
+ //behavior.
+ waitAry = [];
+
+ /**
+ * Trims the . and .. from an array of path segments.
+ * It will keep a leading path segment if a .. will become
+ * the first path segment, to help with module name lookups,
+ * which act like paths, but can be remapped. But the end result,
+ * all paths that use this function should look normalized.
+ * NOTE: this method MODIFIES the input array.
+ * @param {Array} ary the array of path segments.
+ */
+ function trimDots(ary) {
+ var i, part;
+ for (i = 0; ary[i]; i += 1) {
+ part = ary[i];
+ if (part === '.') {
+ ary.splice(i, 1);
+ i -= 1;
+ } else if (part === '..') {
+ if (i === 1 && (ary[2] === '..' || ary[0] === '..')) {
+ //End of the line. Keep at least one non-dot
+ //path segment at the front so it can be mapped
+ //correctly to disk. Otherwise, there is likely
+ //no path mapping for a path starting with '..'.
+ //This can still fail, but catches the most reasonable
+ //uses of ..
+ break;
+ } else if (i > 0) {
+ ary.splice(i - 1, 2);
+ i -= 2;
+ }
+ }
+ }
+ }
+
+ /**
+ * Given a relative module name, like ./something, normalize it to
+ * a real name that can be mapped to a path.
+ * @param {String} name the relative name
+ * @param {String} baseName a real name that the name arg is relative
+ * to.
+ * @param {Boolean} applyMap apply the map config to the value. Should
+ * only be done if this normalization is for a dependency ID.
+ * @returns {String} normalized name
+ */
+ function normalize(name, baseName, applyMap) {
+ var pkgName, pkgConfig, mapValue, nameParts, i, j, nameSegment,
+ foundMap, foundI, foundStarMap, starI,
+ baseParts = baseName && baseName.split('/'),
+ normalizedBaseParts = baseParts,
+ map = config.map,
+ starMap = map && map['*'];
+
+ //Adjust any relative paths.
+ if (name && name.charAt(0) === '.') {
+ //If have a base name, try to normalize against it,
+ //otherwise, assume it is a top-level require that will
+ //be relative to baseUrl in the end.
+ if (baseName) {
+ if (config.pkgs[baseName]) {
+ //If the baseName is a package name, then just treat it as one
+ //name to concat the name with.
+ normalizedBaseParts = baseParts = [baseName];
+ } else {
+ //Convert baseName to array, and lop off the last part,
+ //so that . matches that 'directory' and not name of the baseName's
+ //module. For instance, baseName of 'one/two/three', maps to
+ //'one/two/three.js', but we want the directory, 'one/two' for
+ //this normalization.
+ normalizedBaseParts = baseParts.slice(0, baseParts.length - 1);
+ }
+
+ name = normalizedBaseParts.concat(name.split('/'));
+ trimDots(name);
+
+ //Some use of packages may use a . path to reference the
+ //'main' module name, so normalize for that.
+ pkgConfig = config.pkgs[(pkgName = name[0])];
+ name = name.join('/');
+ if (pkgConfig && name === pkgName + '/' + pkgConfig.main) {
+ name = pkgName;
+ }
+ } else if (name.indexOf('./') === 0) {
+ // No baseName, so this is ID is resolved relative
+ // to baseUrl, pull off the leading dot.
+ name = name.substring(2);
+ }
+ }
+
+ //Apply map config if available.
+ if (applyMap && (baseParts || starMap) && map) {
+ nameParts = name.split('/');
+
+ for (i = nameParts.length; i > 0; i -= 1) {
+ nameSegment = nameParts.slice(0, i).join('/');
+
+ if (baseParts) {
+ //Find the longest baseName segment match in the config.
+ //So, do joins on the biggest to smallest lengths of baseParts.
+ for (j = baseParts.length; j > 0; j -= 1) {
+ mapValue = map[baseParts.slice(0, j).join('/')];
+
+ //baseName segment has config, find if it has one for
+ //this name.
+ if (mapValue) {
+ mapValue = mapValue[nameSegment];
+ if (mapValue) {
+ //Match, update name to the new value.
+ foundMap = mapValue;
+ foundI = i;
+ break;
+ }
+ }
+ }
+ }
+
+ if (foundMap) {
+ break;
+ }
+
+ //Check for a star map match, but just hold on to it,
+ //if there is a shorter segment match later in a matching
+ //config, then favor over this star map.
+ if (!foundStarMap && starMap && starMap[nameSegment]) {
+ foundStarMap = starMap[nameSegment];
+ starI = i;
+ }
+ }
+
+ if (!foundMap && foundStarMap) {
+ foundMap = foundStarMap;
+ foundI = starI;
+ }
+
+ if (foundMap) {
+ nameParts.splice(0, foundI, foundMap);
+ name = nameParts.join('/');
+ }
+ }
+
+ return name;
+ }
+
+ function removeScript(name) {
+ if (isBrowser) {
+ each(scripts(), function (scriptNode) {
+ if (scriptNode.getAttribute('data-requiremodule') === name &&
+ scriptNode.getAttribute('data-requirecontext') === context.contextName) {
+ scriptNode.parentNode.removeChild(scriptNode);
+ return true;
+ }
+ });
+ }
+ }
+
+ function hasPathFallback(id) {
+ var pathConfig = config.paths[id];
+ if (pathConfig && isArray(pathConfig) && pathConfig.length > 1) {
+ removeScript(id);
+ //Pop off the first array value, since it failed, and
+ //retry
+ pathConfig.shift();
+ context.undef(id);
+ context.require([id]);
+ return true;
+ }
+ }
+
+ /**
+ * Creates a module mapping that includes plugin prefix, module
+ * name, and path. If parentModuleMap is provided it will
+ * also normalize the name via require.normalize()
+ *
+ * @param {String} name the module name
+ * @param {String} [parentModuleMap] parent module map
+ * for the module name, used to resolve relative names.
+ * @param {Boolean} isNormalized: is the ID already normalized.
+ * This is true if this call is done for a define() module ID.
+ * @param {Boolean} applyMap: apply the map config to the ID.
+ * Should only be true if this map is for a dependency.
+ *
+ * @returns {Object}
+ */
+ function makeModuleMap(name, parentModuleMap, isNormalized, applyMap) {
+ var url, pluginModule, suffix,
+ index = name ? name.indexOf('!') : -1,
+ prefix = null,
+ parentName = parentModuleMap ? parentModuleMap.name : null,
+ originalName = name,
+ isDefine = true,
+ normalizedName = '';
+
+ //If no name, then it means it is a require call, generate an
+ //internal name.
+ if (!name) {
+ isDefine = false;
+ name = '_@r' + (requireCounter += 1);
+ }
+
+ if (index !== -1) {
+ prefix = name.substring(0, index);
+ name = name.substring(index + 1, name.length);
+ }
+
+ if (prefix) {
+ prefix = normalize(prefix, parentName, applyMap);
+ pluginModule = defined[prefix];
+ }
+
+ //Account for relative paths if there is a base name.
+ if (name) {
+ if (prefix) {
+ if (pluginModule && pluginModule.normalize) {
+ //Plugin is loaded, use its normalize method.
+ normalizedName = pluginModule.normalize(name, function (name) {
+ return normalize(name, parentName, applyMap);
+ });
+ } else {
+ normalizedName = normalize(name, parentName, applyMap);
+ }
+ } else {
+ //A regular module.
+ normalizedName = normalize(name, parentName, applyMap);
+ url = context.nameToUrl(normalizedName);
+ }
+ }
+
+ //If the id is a plugin id that cannot be determined if it needs
+ //normalization, stamp it with a unique ID so two matching relative
+ //ids that may conflict can be separate.
+ suffix = prefix && !pluginModule && !isNormalized ?
+ '_unnormalized' + (unnormalizedCounter += 1) :
+ '';
+
+ return {
+ prefix: prefix,
+ name: normalizedName,
+ parentMap: parentModuleMap,
+ unnormalized: !!suffix,
+ url: url,
+ originalName: originalName,
+ isDefine: isDefine,
+ id: (prefix ?
+ prefix + '!' + normalizedName :
+ normalizedName) + suffix
+ };
+ }
+
+ function getModule(depMap) {
+ var id = depMap.id,
+ mod = registry[id];
+
+ if (!mod) {
+ mod = registry[id] = new context.Module(depMap);
+ }
+
+ return mod;
+ }
+
+ function on(depMap, name, fn) {
+ var id = depMap.id,
+ mod = registry[id];
+
+ if (hasProp(defined, id) &&
+ (!mod || mod.defineEmitComplete)) {
+ if (name === 'defined') {
+ fn(defined[id]);
+ }
+ } else {
+ getModule(depMap).on(name, fn);
+ }
+ }
+
+ function onError(err, errback) {
+ var ids = err.requireModules,
+ notified = false;
+
+ if (errback) {
+ errback(err);
+ } else {
+ each(ids, function (id) {
+ var mod = registry[id];
+ if (mod) {
+ //Set error on module, so it skips timeout checks.
+ mod.error = err;
+ if (mod.events.error) {
+ notified = true;
+ mod.emit('error', err);
+ }
+ }
+ });
+
+ if (!notified) {
+ req.onError(err);
+ }
+ }
+ }
+
+ /**
+ * Internal method to transfer globalQueue items to this context's
+ * defQueue.
+ */
+ function takeGlobalQueue() {
+ //Push all the globalDefQueue items into the context's defQueue
+ if (globalDefQueue.length) {
+ //Array splice in the values since the context code has a
+ //local var ref to defQueue, so cannot just reassign the one
+ //on context.
+ apsp.apply(defQueue,
+ [defQueue.length - 1, 0].concat(globalDefQueue));
+ globalDefQueue = [];
+ }
+ }
+
+ /**
+ * Helper function that creates a require function object to give to
+ * modules that ask for it as a dependency. It needs to be specific
+ * per module because of the implication of path mappings that may
+ * need to be relative to the module name.
+ */
+ function makeRequire(mod, enableBuildCallback, altRequire) {
+ var relMap = mod && mod.map,
+ modRequire = makeContextModuleFunc(altRequire || context.require,
+ relMap,
+ enableBuildCallback);
+
+ addRequireMethods(modRequire, context, relMap);
+ modRequire.isBrowser = isBrowser;
+
+ return modRequire;
+ }
+
+ handlers = {
+ 'require': function (mod) {
+ return makeRequire(mod);
+ },
+ 'exports': function (mod) {
+ mod.usingExports = true;
+ if (mod.map.isDefine) {
+ return (mod.exports = defined[mod.map.id] = {});
+ }
+ },
+ 'module': function (mod) {
+ return (mod.module = {
+ id: mod.map.id,
+ uri: mod.map.url,
+ config: function () {
+ return (config.config && config.config[mod.map.id]) || {};
+ },
+ exports: defined[mod.map.id]
+ });
+ }
+ };
+
+ function removeWaiting(id) {
+ //Clean up machinery used for waiting modules.
+ delete registry[id];
+
+ each(waitAry, function (mod, i) {
+ if (mod.map.id === id) {
+ waitAry.splice(i, 1);
+ if (!mod.defined) {
+ context.waitCount -= 1;
+ }
+ return true;
+ }
+ });
+ }
+
+ function findCycle(mod, traced, processed) {
+ var id = mod.map.id,
+ depArray = mod.depMaps,
+ foundModule;
+
+ //Do not bother with unitialized modules or not yet enabled
+ //modules.
+ if (!mod.inited) {
+ return;
+ }
+
+ //Found the cycle.
+ if (traced[id]) {
+ return mod;
+ }
+
+ traced[id] = true;
+
+ //Trace through the dependencies.
+ each(depArray, function (depMap) {
+ var depId = depMap.id,
+ depMod = registry[depId];
+
+ if (!depMod || processed[depId] ||
+ !depMod.inited || !depMod.enabled) {
+ return;
+ }
+
+ return (foundModule = findCycle(depMod, traced, processed));
+ });
+
+ processed[id] = true;
+
+ return foundModule;
+ }
+
+ function forceExec(mod, traced, uninited) {
+ var id = mod.map.id,
+ depArray = mod.depMaps;
+
+ if (!mod.inited || !mod.map.isDefine) {
+ return;
+ }
+
+ if (traced[id]) {
+ return defined[id];
+ }
+
+ traced[id] = mod;
+
+ each(depArray, function (depMap) {
+ var depId = depMap.id,
+ depMod = registry[depId],
+ value;
+
+ if (handlers[depId]) {
+ return;
+ }
+
+ if (depMod) {
+ if (!depMod.inited || !depMod.enabled) {
+ //Dependency is not inited,
+ //so this module cannot be
+ //given a forced value yet.
+ uninited[id] = true;
+ return;
+ }
+
+ //Get the value for the current dependency
+ value = forceExec(depMod, traced, uninited);
+
+ //Even with forcing it may not be done,
+ //in particular if the module is waiting
+ //on a plugin resource.
+ if (!uninited[depId]) {
+ mod.defineDepById(depId, value);
+ }
+ }
+ });
+
+ mod.check(true);
+
+ return defined[id];
+ }
+
+ function modCheck(mod) {
+ mod.check();
+ }
+
+ function checkLoaded() {
+ var map, modId, err, usingPathFallback,
+ waitInterval = config.waitSeconds * 1000,
+ //It is possible to disable the wait interval by using waitSeconds of 0.
+ expired = waitInterval && (context.startTime + waitInterval) < new Date().getTime(),
+ noLoads = [],
+ stillLoading = false,
+ needCycleCheck = true;
+
+ //Do not bother if this call was a result of a cycle break.
+ if (inCheckLoaded) {
+ return;
+ }
+
+ inCheckLoaded = true;
+
+ //Figure out the state of all the modules.
+ eachProp(registry, function (mod) {
+ map = mod.map;
+ modId = map.id;
+
+ //Skip things that are not enabled or in error state.
+ if (!mod.enabled) {
+ return;
+ }
+
+ if (!mod.error) {
+ //If the module should be executed, and it has not
+ //been inited and time is up, remember it.
+ if (!mod.inited && expired) {
+ if (hasPathFallback(modId)) {
+ usingPathFallback = true;
+ stillLoading = true;
+ } else {
+ noLoads.push(modId);
+ removeScript(modId);
+ }
+ } else if (!mod.inited && mod.fetched && map.isDefine) {
+ stillLoading = true;
+ if (!map.prefix) {
+ //No reason to keep looking for unfinished
+ //loading. If the only stillLoading is a
+ //plugin resource though, keep going,
+ //because it may be that a plugin resource
+ //is waiting on a non-plugin cycle.
+ return (needCycleCheck = false);
+ }
+ }
+ }
+ });
+
+ if (expired && noLoads.length) {
+ //If wait time expired, throw error of unloaded modules.
+ err = makeError('timeout', 'Load timeout for modules: ' + noLoads, null, noLoads);
+ err.contextName = context.contextName;
+ return onError(err);
+ }
+
+ //Not expired, check for a cycle.
+ if (needCycleCheck) {
+
+ each(waitAry, function (mod) {
+ if (mod.defined) {
+ return;
+ }
+
+ var cycleMod = findCycle(mod, {}, {}),
+ traced = {};
+
+ if (cycleMod) {
+ forceExec(cycleMod, traced, {});
+
+ //traced modules may have been
+ //removed from the registry, but
+ //their listeners still need to
+ //be called.
+ eachProp(traced, modCheck);
+ }
+ });
+
+ //Now that dependencies have
+ //been satisfied, trigger the
+ //completion check that then
+ //notifies listeners.
+ eachProp(registry, modCheck);
+ }
+
+ //If still waiting on loads, and the waiting load is something
+ //other than a plugin resource, or there are still outstanding
+ //scripts, then just try back later.
+ if ((!expired || usingPathFallback) && stillLoading) {
+ //Something is still waiting to load. Wait for it, but only
+ //if a timeout is not already in effect.
+ if ((isBrowser || isWebWorker) && !checkLoadedTimeoutId) {
+ checkLoadedTimeoutId = setTimeout(function () {
+ checkLoadedTimeoutId = 0;
+ checkLoaded();
+ }, 50);
+ }
+ }
+
+ inCheckLoaded = false;
+ }
+
+ Module = function (map) {
+ this.events = undefEvents[map.id] || {};
+ this.map = map;
+ this.shim = config.shim[map.id];
+ this.depExports = [];
+ this.depMaps = [];
+ this.depMatched = [];
+ this.pluginMaps = {};
+ this.depCount = 0;
+
+ /* this.exports this.factory
+ this.depMaps = [],
+ this.enabled, this.fetched
+ */
+ };
+
+ Module.prototype = {
+ init: function (depMaps, factory, errback, options) {
+ options = options || {};
+
+ //Do not do more inits if already done. Can happen if there
+ //are multiple define calls for the same module. That is not
+ //a normal, common case, but it is also not unexpected.
+ if (this.inited) {
+ return;
+ }
+
+ this.factory = factory;
+
+ if (errback) {
+ //Register for errors on this module.
+ this.on('error', errback);
+ } else if (this.events.error) {
+ //If no errback already, but there are error listeners
+ //on this module, set up an errback to pass to the deps.
+ errback = bind(this, function (err) {
+ this.emit('error', err);
+ });
+ }
+
+ //Do a copy of the dependency array, so that
+ //source inputs are not modified. For example
+ //"shim" deps are passed in here directly, and
+ //doing a direct modification of the depMaps array
+ //would affect that config.
+ this.depMaps = depMaps && depMaps.slice(0);
+ this.depMaps.rjsSkipMap = depMaps.rjsSkipMap;
+
+ this.errback = errback;
+
+ //Indicate this module has be initialized
+ this.inited = true;
+
+ this.ignore = options.ignore;
+
+ //Could have option to init this module in enabled mode,
+ //or could have been previously marked as enabled. However,
+ //the dependencies are not known until init is called. So
+ //if enabled previously, now trigger dependencies as enabled.
+ if (options.enabled || this.enabled) {
+ //Enable this module and dependencies.
+ //Will call this.check()
+ this.enable();
+ } else {
+ this.check();
+ }
+ },
+
+ defineDepById: function (id, depExports) {
+ var i;
+
+ //Find the index for this dependency.
+ each(this.depMaps, function (map, index) {
+ if (map.id === id) {
+ i = index;
+ return true;
+ }
+ });
+
+ return this.defineDep(i, depExports);
+ },
+
+ defineDep: function (i, depExports) {
+ //Because of cycles, defined callback for a given
+ //export can be called more than once.
+ if (!this.depMatched[i]) {
+ this.depMatched[i] = true;
+ this.depCount -= 1;
+ this.depExports[i] = depExports;
+ }
+ },
+
+ fetch: function () {
+ if (this.fetched) {
+ return;
+ }
+ this.fetched = true;
+
+ context.startTime = (new Date()).getTime();
+
+ var map = this.map;
+
+ //If the manager is for a plugin managed resource,
+ //ask the plugin to load it now.
+ if (this.shim) {
+ makeRequire(this, true)(this.shim.deps || [], bind(this, function () {
+ return map.prefix ? this.callPlugin() : this.load();
+ }));
+ } else {
+ //Regular dependency.
+ return map.prefix ? this.callPlugin() : this.load();
+ }
+ },
+
+ load: function () {
+ var url = this.map.url;
+
+ //Regular dependency.
+ if (!urlFetched[url]) {
+ urlFetched[url] = true;
+ context.load(this.map.id, url);
+ }
+ },
+
+ /**
+ * Checks is the module is ready to define itself, and if so,
+ * define it. If the silent argument is true, then it will just
+ * define, but not notify listeners, and not ask for a context-wide
+ * check of all loaded modules. That is useful for cycle breaking.
+ */
+ check: function (silent) {
+ if (!this.enabled || this.enabling) {
+ return;
+ }
+
+ var err, cjsModule,
+ id = this.map.id,
+ depExports = this.depExports,
+ exports = this.exports,
+ factory = this.factory;
+
+ if (!this.inited) {
+ this.fetch();
+ } else if (this.error) {
+ this.emit('error', this.error);
+ } else if (!this.defining) {
+ //The factory could trigger another require call
+ //that would result in checking this module to
+ //define itself again. If already in the process
+ //of doing that, skip this work.
+ this.defining = true;
+
+ if (this.depCount < 1 && !this.defined) {
+ if (isFunction(factory)) {
+ //If there is an error listener, favor passing
+ //to that instead of throwing an error.
+ if (this.events.error) {
+ try {
+ exports = context.execCb(id, factory, depExports, exports);
+ } catch (e) {
+ err = e;
+ }
+ } else {
+ exports = context.execCb(id, factory, depExports, exports);
+ }
+
+ if (this.map.isDefine) {
+ //If setting exports via 'module' is in play,
+ //favor that over return value and exports. After that,
+ //favor a non-undefined return value over exports use.
+ cjsModule = this.module;
+ if (cjsModule &&
+ cjsModule.exports !== undefined &&
+ //Make sure it is not already the exports value
+ cjsModule.exports !== this.exports) {
+ exports = cjsModule.exports;
+ } else if (exports === undefined && this.usingExports) {
+ //exports already set the defined value.
+ exports = this.exports;
+ }
+ }
+
+ if (err) {
+ err.requireMap = this.map;
+ err.requireModules = [this.map.id];
+ err.requireType = 'define';
+ return onError((this.error = err));
+ }
+
+ } else {
+ //Just a literal value
+ exports = factory;
+ }
+
+ this.exports = exports;
+
+ if (this.map.isDefine && !this.ignore) {
+ defined[id] = exports;
+
+ if (req.onResourceLoad) {
+ req.onResourceLoad(context, this.map, this.depMaps);
+ }
+ }
+
+ //Clean up
+ delete registry[id];
+
+ this.defined = true;
+ context.waitCount -= 1;
+ if (context.waitCount === 0) {
+ //Clear the wait array used for cycles.
+ waitAry = [];
+ }
+ }
+
+ //Finished the define stage. Allow calling check again
+ //to allow define notifications below in the case of a
+ //cycle.
+ this.defining = false;
+
+ if (!silent) {
+ if (this.defined && !this.defineEmitted) {
+ this.defineEmitted = true;
+ this.emit('defined', this.exports);
+ this.defineEmitComplete = true;
+ }
+ }
+ }
+ },
+
+ callPlugin: function () {
+ var map = this.map,
+ id = map.id,
+ pluginMap = makeModuleMap(map.prefix, null, false, true);
+
+ on(pluginMap, 'defined', bind(this, function (plugin) {
+ var load, normalizedMap, normalizedMod,
+ name = this.map.name,
+ parentName = this.map.parentMap ? this.map.parentMap.name : null;
+
+ //If current map is not normalized, wait for that
+ //normalized name to load instead of continuing.
+ if (this.map.unnormalized) {
+ //Normalize the ID if the plugin allows it.
+ if (plugin.normalize) {
+ name = plugin.normalize(name, function (name) {
+ return normalize(name, parentName, true);
+ }) || '';
+ }
+
+ normalizedMap = makeModuleMap(map.prefix + '!' + name,
+ this.map.parentMap,
+ false,
+ true);
+ on(normalizedMap,
+ 'defined', bind(this, function (value) {
+ this.init([], function () { return value; }, null, {
+ enabled: true,
+ ignore: true
+ });
+ }));
+ normalizedMod = registry[normalizedMap.id];
+ if (normalizedMod) {
+ if (this.events.error) {
+ normalizedMod.on('error', bind(this, function (err) {
+ this.emit('error', err);
+ }));
+ }
+ normalizedMod.enable();
+ }
+
+ return;
+ }
+
+ load = bind(this, function (value) {
+ this.init([], function () { return value; }, null, {
+ enabled: true
+ });
+ });
+
+ load.error = bind(this, function (err) {
+ this.inited = true;
+ this.error = err;
+ err.requireModules = [id];
+
+ //Remove temp unnormalized modules for this module,
+ //since they will never be resolved otherwise now.
+ eachProp(registry, function (mod) {
+ if (mod.map.id.indexOf(id + '_unnormalized') === 0) {
+ removeWaiting(mod.map.id);
+ }
+ });
+
+ onError(err);
+ });
+
+ //Allow plugins to load other code without having to know the
+ //context or how to 'complete' the load.
+ load.fromText = function (moduleName, text) {
+ /*jslint evil: true */
+ var hasInteractive = useInteractive;
+
+ //Turn off interactive script matching for IE for any define
+ //calls in the text, then turn it back on at the end.
+ if (hasInteractive) {
+ useInteractive = false;
+ }
+
+ //Prime the system by creating a module instance for
+ //it.
+ getModule(makeModuleMap(moduleName));
+
+ req.exec(text);
+
+ if (hasInteractive) {
+ useInteractive = true;
+ }
+
+ //Support anonymous modules.
+ context.completeLoad(moduleName);
+ };
+
+ //Use parentName here since the plugin's name is not reliable,
+ //could be some weird string with no path that actually wants to
+ //reference the parentName's path.
+ plugin.load(map.name, makeRequire(map.parentMap, true, function (deps, cb, er) {
+ deps.rjsSkipMap = true;
+ return context.require(deps, cb, er);
+ }), load, config);
+ }));
+
+ context.enable(pluginMap, this);
+ this.pluginMaps[pluginMap.id] = pluginMap;
+ },
+
+ enable: function () {
+ this.enabled = true;
+
+ if (!this.waitPushed) {
+ waitAry.push(this);
+ context.waitCount += 1;
+ this.waitPushed = true;
+ }
+
+ //Set flag mentioning that the module is enabling,
+ //so that immediate calls to the defined callbacks
+ //for dependencies do not trigger inadvertent load
+ //with the depCount still being zero.
+ this.enabling = true;
+
+ //Enable each dependency
+ each(this.depMaps, bind(this, function (depMap, i) {
+ var id, mod, handler;
+
+ if (typeof depMap === 'string') {
+ //Dependency needs to be converted to a depMap
+ //and wired up to this module.
+ depMap = makeModuleMap(depMap,
+ (this.map.isDefine ? this.map : this.map.parentMap),
+ false,
+ !this.depMaps.rjsSkipMap);
+ this.depMaps[i] = depMap;
+
+ handler = handlers[depMap.id];
+
+ if (handler) {
+ this.depExports[i] = handler(this);
+ return;
+ }
+
+ this.depCount += 1;
+
+ on(depMap, 'defined', bind(this, function (depExports) {
+ this.defineDep(i, depExports);
+ this.check();
+ }));
+
+ if (this.errback) {
+ on(depMap, 'error', this.errback);
+ }
+ }
+
+ id = depMap.id;
+ mod = registry[id];
+
+ //Skip special modules like 'require', 'exports', 'module'
+ //Also, don't call enable if it is already enabled,
+ //important in circular dependency cases.
+ if (!handlers[id] && mod && !mod.enabled) {
+ context.enable(depMap, this);
+ }
+ }));
+
+ //Enable each plugin that is used in
+ //a dependency
+ eachProp(this.pluginMaps, bind(this, function (pluginMap) {
+ var mod = registry[pluginMap.id];
+ if (mod && !mod.enabled) {
+ context.enable(pluginMap, this);
+ }
+ }));
+
+ this.enabling = false;
+
+ this.check();
+ },
+
+ on: function (name, cb) {
+ var cbs = this.events[name];
+ if (!cbs) {
+ cbs = this.events[name] = [];
+ }
+ cbs.push(cb);
+ },
+
+ emit: function (name, evt) {
+ each(this.events[name], function (cb) {
+ cb(evt);
+ });
+ if (name === 'error') {
+ //Now that the error handler was triggered, remove
+ //the listeners, since this broken Module instance
+ //can stay around for a while in the registry/waitAry.
+ delete this.events[name];
+ }
+ }
+ };
+
+ function callGetModule(args) {
+ getModule(makeModuleMap(args[0], null, true)).init(args[1], args[2]);
+ }
+
+ function removeListener(node, func, name, ieName) {
+ //Favor detachEvent because of IE9
+ //issue, see attachEvent/addEventListener comment elsewhere
+ //in this file.
+ if (node.detachEvent && !isOpera) {
+ //Probably IE. If not it will throw an error, which will be
+ //useful to know.
+ if (ieName) {
+ node.detachEvent(ieName, func);
+ }
+ } else {
+ node.removeEventListener(name, func, false);
+ }
+ }
+
+ /**
+ * Given an event from a script node, get the requirejs info from it,
+ * and then removes the event listeners on the node.
+ * @param {Event} evt
+ * @returns {Object}
+ */
+ function getScriptData(evt) {
+ //Using currentTarget instead of target for Firefox 2.0's sake. Not
+ //all old browsers will be supported, but this one was easy enough
+ //to support and still makes sense.
+ var node = evt.currentTarget || evt.srcElement;
+
+ //Remove the listeners once here.
+ removeListener(node, context.onScriptLoad, 'load', 'onreadystatechange');
+ removeListener(node, context.onScriptError, 'error');
+
+ return {
+ node: node,
+ id: node && node.getAttribute('data-requiremodule')
+ };
+ }
+
+ return (context = {
+ config: config,
+ contextName: contextName,
+ registry: registry,
+ defined: defined,
+ urlFetched: urlFetched,
+ waitCount: 0,
+ defQueue: defQueue,
+ Module: Module,
+ makeModuleMap: makeModuleMap,
+
+ /**
+ * Set a configuration for the context.
+ * @param {Object} cfg config object to integrate.
+ */
+ configure: function (cfg) {
+ //Make sure the baseUrl ends in a slash.
+ if (cfg.baseUrl) {
+ if (cfg.baseUrl.charAt(cfg.baseUrl.length - 1) !== '/') {
+ cfg.baseUrl += '/';
+ }
+ }
+
+ //Save off the paths and packages since they require special processing,
+ //they are additive.
+ var pkgs = config.pkgs,
+ shim = config.shim,
+ paths = config.paths,
+ map = config.map;
+
+ //Mix in the config values, favoring the new values over
+ //existing ones in context.config.
+ mixin(config, cfg, true);
+
+ //Merge paths.
+ config.paths = mixin(paths, cfg.paths, true);
+
+ //Merge map
+ if (cfg.map) {
+ config.map = mixin(map || {}, cfg.map, true, true);
+ }
+
+ //Merge shim
+ if (cfg.shim) {
+ eachProp(cfg.shim, function (value, id) {
+ //Normalize the structure
+ if (isArray(value)) {
+ value = {
+ deps: value
+ };
+ }
+ if (value.exports && !value.exports.__buildReady) {
+ value.exports = context.makeShimExports(value.exports);
+ }
+ shim[id] = value;
+ });
+ config.shim = shim;
+ }
+
+ //Adjust packages if necessary.
+ if (cfg.packages) {
+ each(cfg.packages, function (pkgObj) {
+ var location;
+
+ pkgObj = typeof pkgObj === 'string' ? { name: pkgObj } : pkgObj;
+ location = pkgObj.location;
+
+ //Create a brand new object on pkgs, since currentPackages can
+ //be passed in again, and config.pkgs is the internal transformed
+ //state for all package configs.
+ pkgs[pkgObj.name] = {
+ name: pkgObj.name,
+ location: location || pkgObj.name,
+ //Remove leading dot in main, so main paths are normalized,
+ //and remove any trailing .js, since different package
+ //envs have different conventions: some use a module name,
+ //some use a file name.
+ main: (pkgObj.main || 'main')
+ .replace(currDirRegExp, '')
+ .replace(jsSuffixRegExp, '')
+ };
+ });
+
+ //Done with modifications, assing packages back to context config
+ config.pkgs = pkgs;
+ }
+
+ //If there are any "waiting to execute" modules in the registry,
+ //update the maps for them, since their info, like URLs to load,
+ //may have changed.
+ eachProp(registry, function (mod, id) {
+ //If module already has init called, since it is too
+ //late to modify them, and ignore unnormalized ones
+ //since they are transient.
+ if (!mod.inited && !mod.map.unnormalized) {
+ mod.map = makeModuleMap(id);
+ }
+ });
+
+ //If a deps array or a config callback is specified, then call
+ //require with those args. This is useful when require is defined as a
+ //config object before require.js is loaded.
+ if (cfg.deps || cfg.callback) {
+ context.require(cfg.deps || [], cfg.callback);
+ }
+ },
+
+ makeShimExports: function (exports) {
+ var func;
+ if (typeof exports === 'string') {
+ func = function () {
+ return getGlobal(exports);
+ };
+ //Save the exports for use in nodefine checking.
+ func.exports = exports;
+ return func;
+ } else {
+ return function () {
+ return exports.apply(global, arguments);
+ };
+ }
+ },
+
+ requireDefined: function (id, relMap) {
+ return hasProp(defined, makeModuleMap(id, relMap, false, true).id);
+ },
+
+ requireSpecified: function (id, relMap) {
+ id = makeModuleMap(id, relMap, false, true).id;
+ return hasProp(defined, id) || hasProp(registry, id);
+ },
+
+ require: function (deps, callback, errback, relMap) {
+ var moduleName, id, map, requireMod, args;
+ if (typeof deps === 'string') {
+ if (isFunction(callback)) {
+ //Invalid call
+ return onError(makeError('requireargs', 'Invalid require call'), errback);
+ }
+
+ //Synchronous access to one module. If require.get is
+ //available (as in the Node adapter), prefer that.
+ //In this case deps is the moduleName and callback is
+ //the relMap
+ if (req.get) {
+ return req.get(context, deps, callback);
+ }
+
+ //Just return the module wanted. In this scenario, the
+ //second arg (if passed) is just the relMap.
+ moduleName = deps;
+ relMap = callback;
+
+ //Normalize module name, if it contains . or ..
+ map = makeModuleMap(moduleName, relMap, false, true);
+ id = map.id;
+
+ if (!hasProp(defined, id)) {
+ return onError(makeError('notloaded', 'Module name "' +
+ id +
+ '" has not been loaded yet for context: ' +
+ contextName));
+ }
+ return defined[id];
+ }
+
+ //Callback require. Normalize args. if callback or errback is
+ //not a function, it means it is a relMap. Test errback first.
+ if (errback && !isFunction(errback)) {
+ relMap = errback;
+ errback = undefined;
+ }
+ if (callback && !isFunction(callback)) {
+ relMap = callback;
+ callback = undefined;
+ }
+
+ //Any defined modules in the global queue, intake them now.
+ takeGlobalQueue();
+
+ //Make sure any remaining defQueue items get properly processed.
+ while (defQueue.length) {
+ args = defQueue.shift();
+ if (args[0] === null) {
+ return onError(makeError('mismatch', 'Mismatched anonymous define() module: ' + args[args.length - 1]));
+ } else {
+ //args are id, deps, factory. Should be normalized by the
+ //define() function.
+ callGetModule(args);
+ }
+ }
+
+ //Mark all the dependencies as needing to be loaded.
+ requireMod = getModule(makeModuleMap(null, relMap));
+
+ requireMod.init(deps, callback, errback, {
+ enabled: true
+ });
+
+ checkLoaded();
+
+ return context.require;
+ },
+
+ undef: function (id) {
+ //Bind any waiting define() calls to this context,
+ //fix for #408
+ takeGlobalQueue();
+
+ var map = makeModuleMap(id, null, true),
+ mod = registry[id];
+
+ delete defined[id];
+ delete urlFetched[map.url];
+ delete undefEvents[id];
+
+ if (mod) {
+ //Hold on to listeners in case the
+ //module will be attempted to be reloaded
+ //using a different config.
+ if (mod.events.defined) {
+ undefEvents[id] = mod.events;
+ }
+
+ removeWaiting(id);
+ }
+ },
+
+ /**
+ * Called to enable a module if it is still in the registry
+ * awaiting enablement. parent module is passed in for context,
+ * used by the optimizer.
+ */
+ enable: function (depMap, parent) {
+ var mod = registry[depMap.id];
+ if (mod) {
+ getModule(depMap).enable();
+ }
+ },
+
+ /**
+ * Internal method used by environment adapters to complete a load event.
+ * A load event could be a script load or just a load pass from a synchronous
+ * load call.
+ * @param {String} moduleName the name of the module to potentially complete.
+ */
+ completeLoad: function (moduleName) {
+ var found, args, mod,
+ shim = config.shim[moduleName] || {},
+ shExports = shim.exports && shim.exports.exports;
+
+ takeGlobalQueue();
+
+ while (defQueue.length) {
+ args = defQueue.shift();
+ if (args[0] === null) {
+ args[0] = moduleName;
+ //If already found an anonymous module and bound it
+ //to this name, then this is some other anon module
+ //waiting for its completeLoad to fire.
+ if (found) {
+ break;
+ }
+ found = true;
+ } else if (args[0] === moduleName) {
+ //Found matching define call for this script!
+ found = true;
+ }
+
+ callGetModule(args);
+ }
+
+ //Do this after the cycle of callGetModule in case the result
+ //of those calls/init calls changes the registry.
+ mod = registry[moduleName];
+
+ if (!found && !defined[moduleName] && mod && !mod.inited) {
+ if (config.enforceDefine && (!shExports || !getGlobal(shExports))) {
+ if (hasPathFallback(moduleName)) {
+ return;
+ } else {
+ return onError(makeError('nodefine',
+ 'No define call for ' + moduleName,
+ null,
+ [moduleName]));
+ }
+ } else {
+ //A script that does not call define(), so just simulate
+ //the call for it.
+ callGetModule([moduleName, (shim.deps || []), shim.exports]);
+ }
+ }
+
+ checkLoaded();
+ },
+
+ /**
+ * Converts a module name + .extension into an URL path.
+ * *Requires* the use of a module name. It does not support using
+ * plain URLs like nameToUrl.
+ */
+ toUrl: function (moduleNamePlusExt, relModuleMap) {
+ var index = moduleNamePlusExt.lastIndexOf('.'),
+ ext = null;
+
+ if (index !== -1) {
+ ext = moduleNamePlusExt.substring(index, moduleNamePlusExt.length);
+ moduleNamePlusExt = moduleNamePlusExt.substring(0, index);
+ }
+
+ return context.nameToUrl(normalize(moduleNamePlusExt, relModuleMap && relModuleMap.id, true),
+ ext);
+ },
+
+ /**
+ * Converts a module name to a file path. Supports cases where
+ * moduleName may actually be just an URL.
+ * Note that it **does not** call normalize on the moduleName,
+ * it is assumed to have already been normalized. This is an
+ * internal API, not a public one. Use toUrl for the public API.
+ */
+ nameToUrl: function (moduleName, ext) {
+ var paths, pkgs, pkg, pkgPath, syms, i, parentModule, url,
+ parentPath;
+
+ //If a colon is in the URL, it indicates a protocol is used and it is just
+ //an URL to a file, or if it starts with a slash, contains a query arg (i.e. ?)
+ //or ends with .js, then assume the user meant to use an url and not a module id.
+ //The slash is important for protocol-less URLs as well as full paths.
+ if (req.jsExtRegExp.test(moduleName)) {
+ //Just a plain path, not module name lookup, so just return it.
+ //Add extension if it is included. This is a bit wonky, only non-.js things pass
+ //an extension, this method probably needs to be reworked.
+ url = moduleName + (ext || '');
+ } else {
+ //A module that needs to be converted to a path.
+ paths = config.paths;
+ pkgs = config.pkgs;
+
+ syms = moduleName.split('/');
+ //For each module name segment, see if there is a path
+ //registered for it. Start with most specific name
+ //and work up from it.
+ for (i = syms.length; i > 0; i -= 1) {
+ parentModule = syms.slice(0, i).join('/');
+ pkg = pkgs[parentModule];
+ parentPath = paths[parentModule];
+ if (parentPath) {
+ //If an array, it means there are a few choices,
+ //Choose the one that is desired
+ if (isArray(parentPath)) {
+ parentPath = parentPath[0];
+ }
+ syms.splice(0, i, parentPath);
+ break;
+ } else if (pkg) {
+ //If module name is just the package name, then looking
+ //for the main module.
+ if (moduleName === pkg.name) {
+ pkgPath = pkg.location + '/' + pkg.main;
+ } else {
+ pkgPath = pkg.location;
+ }
+ syms.splice(0, i, pkgPath);
+ break;
+ }
+ }
+
+ //Join the path parts together, then figure out if baseUrl is needed.
+ url = syms.join('/');
+ url += (ext || (/\?/.test(url) ? '' : '.js'));
+ url = (url.charAt(0) === '/' || url.match(/^[\w\+\.\-]+:/) ? '' : config.baseUrl) + url;
+ }
+
+ return config.urlArgs ? url +
+ ((url.indexOf('?') === -1 ? '?' : '&') +
+ config.urlArgs) : url;
+ },
+
+ //Delegates to req.load. Broken out as a separate function to
+ //allow overriding in the optimizer.
+ load: function (id, url) {
+ req.load(context, id, url);
+ },
+
+ /**
+ * Executes a module callack function. Broken out as a separate function
+ * solely to allow the build system to sequence the files in the built
+ * layer in the right sequence.
+ *
+ * @private
+ */
+ execCb: function (name, callback, args, exports) {
+ return callback.apply(exports, args);
+ },
+
+ /**
+ * callback for script loads, used to check status of loading.
+ *
+ * @param {Event} evt the event from the browser for the script
+ * that was loaded.
+ */
+ onScriptLoad: function (evt) {
+ //Using currentTarget instead of target for Firefox 2.0's sake. Not
+ //all old browsers will be supported, but this one was easy enough
+ //to support and still makes sense.
+ if (evt.type === 'load' ||
+ (readyRegExp.test((evt.currentTarget || evt.srcElement).readyState))) {
+ //Reset interactive script so a script node is not held onto for
+ //to long.
+ interactiveScript = null;
+
+ //Pull out the name of the module and the context.
+ var data = getScriptData(evt);
+ context.completeLoad(data.id);
+ }
+ },
+
+ /**
+ * Callback for script errors.
+ */
+ onScriptError: function (evt) {
+ var data = getScriptData(evt);
+ if (!hasPathFallback(data.id)) {
+ return onError(makeError('scripterror', 'Script error', evt, [data.id]));
+ }
+ }
+ });
+ }
+
+ /**
+ * Main entry point.
+ *
+ * If the only argument to require is a string, then the module that
+ * is represented by that string is fetched for the appropriate context.
+ *
+ * If the first argument is an array, then it will be treated as an array
+ * of dependency string names to fetch. An optional function callback can
+ * be specified to execute when all of those dependencies are available.
+ *
+ * Make a local req variable to help Caja compliance (it assumes things
+ * on a require that are not standardized), and to give a short
+ * name for minification/local scope use.
+ */
+ req = requirejs = function (deps, callback, errback, optional) {
+
+ //Find the right context, use default
+ var context, config,
+ contextName = defContextName;
+
+ // Determine if have config object in the call.
+ if (!isArray(deps) && typeof deps !== 'string') {
+ // deps is a config object
+ config = deps;
+ if (isArray(callback)) {
+ // Adjust args if there are dependencies
+ deps = callback;
+ callback = errback;
+ errback = optional;
+ } else {
+ deps = [];
+ }
+ }
+
+ if (config && config.context) {
+ contextName = config.context;
+ }
+
+ context = contexts[contextName];
+ if (!context) {
+ context = contexts[contextName] = req.s.newContext(contextName);
+ }
+
+ if (config) {
+ context.configure(config);
+ }
+
+ return context.require(deps, callback, errback);
+ };
+
+ /**
+ * Support require.config() to make it easier to cooperate with other
+ * AMD loaders on globally agreed names.
+ */
+ req.config = function (config) {
+ return req(config);
+ };
+
+ /**
+ * Export require as a global, but only if it does not already exist.
+ */
+ if (!require) {
+ require = req;
+ }
+
+ req.version = version;
+
+ //Used to filter out dependencies that are already paths.
+ req.jsExtRegExp = /^\/|:|\?|\.js$/;
+ req.isBrowser = isBrowser;
+ s = req.s = {
+ contexts: contexts,
+ newContext: newContext
+ };
+
+ //Create default context.
+ req({});
+
+ //Exports some context-sensitive methods on global require, using
+ //default context if no context specified.
+ addRequireMethods(req);
+
+ if (isBrowser) {
+ head = s.head = document.getElementsByTagName('head')[0];
+ //If BASE tag is in play, using appendChild is a problem for IE6.
+ //When that browser dies, this can be removed. Details in this jQuery bug:
+ //http://dev.jquery.com/ticket/2709
+ baseElement = document.getElementsByTagName('base')[0];
+ if (baseElement) {
+ head = s.head = baseElement.parentNode;
+ }
+ }
+
+ /**
+ * Any errors that require explicitly generates will be passed to this
+ * function. Intercept/override it if you want custom error handling.
+ * @param {Error} err the error object.
+ */
+ req.onError = function (err) {
+ throw err;
+ };
+
+ /**
+ * Does the request to load a module for the browser case.
+ * Make this a separate function to allow other environments
+ * to override it.
+ *
+ * @param {Object} context the require context to find state.
+ * @param {String} moduleName the name of the module.
+ * @param {Object} url the URL to the module.
+ */
+ req.load = function (context, moduleName, url) {
+ var config = (context && context.config) || {},
+ node;
+ if (isBrowser) {
+ //In the browser so use a script tag
+ node = config.xhtml ?
+ document.createElementNS('http://www.w3.org/1999/xhtml', 'html:script') :
+ document.createElement('script');
+ node.type = config.scriptType || 'text/javascript';
+ node.charset = 'utf-8';
+ node.async = true;
+
+ node.setAttribute('data-requirecontext', context.contextName);
+ node.setAttribute('data-requiremodule', moduleName);
+
+ //Set up load listener. Test attachEvent first because IE9 has
+ //a subtle issue in its addEventListener and script onload firings
+ //that do not match the behavior of all other browsers with
+ //addEventListener support, which fire the onload event for a
+ //script right after the script execution. See:
+ //https://connect.microsoft.com/IE/feedback/details/648057/script-onload-event-is-not-fired-immediately-after-script-execution
+ //UNFORTUNATELY Opera implements attachEvent but does not follow the script
+ //script execution mode.
+ if (node.attachEvent &&
+ //Check if node.attachEvent is artificially added by custom script or
+ //natively supported by browser
+ //read https://github.com/jrburke/requirejs/issues/187
+ //if we can NOT find [native code] then it must NOT natively supported.
+ //in IE8, node.attachEvent does not have toString()
+ //Note the test for "[native code" with no closing brace, see:
+ //https://github.com/jrburke/requirejs/issues/273
+ !(node.attachEvent.toString && node.attachEvent.toString().indexOf('[native code') < 0) &&
+ !isOpera) {
+ //Probably IE. IE (at least 6-8) do not fire
+ //script onload right after executing the script, so
+ //we cannot tie the anonymous define call to a name.
+ //However, IE reports the script as being in 'interactive'
+ //readyState at the time of the define call.
+ useInteractive = true;
+
+ node.attachEvent('onreadystatechange', context.onScriptLoad);
+ //It would be great to add an error handler here to catch
+ //404s in IE9+. However, onreadystatechange will fire before
+ //the error handler, so that does not help. If addEvenListener
+ //is used, then IE will fire error before load, but we cannot
+ //use that pathway given the connect.microsoft.com issue
+ //mentioned above about not doing the 'script execute,
+ //then fire the script load event listener before execute
+ //next script' that other browsers do.
+ //Best hope: IE10 fixes the issues,
+ //and then destroys all installs of IE 6-9.
+ //node.attachEvent('onerror', context.onScriptError);
+ } else {
+ node.addEventListener('load', context.onScriptLoad, false);
+ node.addEventListener('error', context.onScriptError, false);
+ }
+ node.src = url;
+
+ //For some cache cases in IE 6-8, the script executes before the end
+ //of the appendChild execution, so to tie an anonymous define
+ //call to the module name (which is stored on the node), hold on
+ //to a reference to this node, but clear after the DOM insertion.
+ currentlyAddingScript = node;
+ if (baseElement) {
+ head.insertBefore(node, baseElement);
+ } else {
+ head.appendChild(node);
+ }
+ currentlyAddingScript = null;
+
+ return node;
+ } else if (isWebWorker) {
+ //In a web worker, use importScripts. This is not a very
+ //efficient use of importScripts, importScripts will block until
+ //its script is downloaded and evaluated. However, if web workers
+ //are in play, the expectation that a build has been done so that
+ //only one script needs to be loaded anyway. This may need to be
+ //reevaluated if other use cases become common.
+ importScripts(url);
+
+ //Account for anonymous modules
+ context.completeLoad(moduleName);
+ }
+ };
+
+ function getInteractiveScript() {
+ if (interactiveScript && interactiveScript.readyState === 'interactive') {
+ return interactiveScript;
+ }
+
+ eachReverse(scripts(), function (script) {
+ if (script.readyState === 'interactive') {
+ return (interactiveScript = script);
+ }
+ });
+ return interactiveScript;
+ }
+
+ //Look for a data-main script attribute, which could also adjust the baseUrl.
+ if (isBrowser) {
+ //Figure out baseUrl. Get it from the script tag with require.js in it.
+ eachReverse(scripts(), function (script) {
+ //Set the 'head' where we can append children by
+ //using the script's parent.
+ if (!head) {
+ head = script.parentNode;
+ }
+
+ //Look for a data-main attribute to set main script for the page
+ //to load. If it is there, the path to data main becomes the
+ //baseUrl, if it is not already set.
+ dataMain = script.getAttribute('data-main');
+ if (dataMain) {
+ //Set final baseUrl if there is not already an explicit one.
+ if (!cfg.baseUrl) {
+ //Pull off the directory of data-main for use as the
+ //baseUrl.
+ src = dataMain.split('/');
+ mainScript = src.pop();
+ subPath = src.length ? src.join('/') + '/' : './';
+
+ cfg.baseUrl = subPath;
+ dataMain = mainScript;
+ }
+
+ //Strip off any trailing .js since dataMain is now
+ //like a module name.
+ dataMain = dataMain.replace(jsSuffixRegExp, '');
+
+ //Put the data-main script in the files to load.
+ cfg.deps = cfg.deps ? cfg.deps.concat(dataMain) : [dataMain];
+
+ return true;
+ }
+ });
+ }
+
+ /**
+ * The function that handles definitions of modules. Differs from
+ * require() in that a string for the module should be the first argument,
+ * and the function to execute after dependencies are loaded should
+ * return a value to define the module corresponding to the first argument's
+ * name.
+ */
+ define = function (name, deps, callback) {
+ var node, context;
+
+ //Allow for anonymous functions
+ if (typeof name !== 'string') {
+ //Adjust args appropriately
+ callback = deps;
+ deps = name;
+ name = null;
+ }
+
+ //This module may not have dependencies
+ if (!isArray(deps)) {
+ callback = deps;
+ deps = [];
+ }
+
+ //If no name, and callback is a function, then figure out if it a
+ //CommonJS thing with dependencies.
+ if (!deps.length && isFunction(callback)) {
+ //Remove comments from the callback string,
+ //look for require calls, and pull them into the dependencies,
+ //but only if there are function args.
+ if (callback.length) {
+ callback
+ .toString()
+ .replace(commentRegExp, '')
+ .replace(cjsRequireRegExp, function (match, dep) {
+ deps.push(dep);
+ });
+
+ //May be a CommonJS thing even without require calls, but still
+ //could use exports, and module. Avoid doing exports and module
+ //work though if it just needs require.
+ //REQUIRES the function to expect the CommonJS variables in the
+ //order listed below.
+ deps = (callback.length === 1 ? ['require'] : ['require', 'exports', 'module']).concat(deps);
+ }
+ }
+
+ //If in IE 6-8 and hit an anonymous define() call, do the interactive
+ //work.
+ if (useInteractive) {
+ node = currentlyAddingScript || getInteractiveScript();
+ if (node) {
+ if (!name) {
+ name = node.getAttribute('data-requiremodule');
+ }
+ context = contexts[node.getAttribute('data-requirecontext')];
+ }
+ }
+
+ //Always save off evaluating the def call until the script onload handler.
+ //This allows multiple modules to be in a file without prematurely
+ //tracing dependencies, and allows for anonymous module support,
+ //where the module name is not known until the script onload event
+ //occurs. If no context, use the global queue, and get it processed
+ //in the onscript load callback.
+ (context ? context.defQueue : globalDefQueue).push([name, deps, callback]);
+ };
+
+ define.amd = {
+ jQuery: true
+ };
+
+
+ /**
+ * Executes the text. Normally just uses eval, but can be modified
+ * to use a better, environment-specific call. Only used for transpiling
+ * loader plugins, not for plain JS modules.
+ * @param {String} text the text to execute/evaluate.
+ */
+ req.exec = function (text) {
+ /*jslint evil: true */
+ return eval(text);
+ };
+
+ //Set up with config info.
+ req(cfg);
+}(this));
diff --git a/module/web/static/js/mobile.js b/module/web/static/js/mobile.js
new file mode 100644
index 000000000..58ccf5800
--- /dev/null
+++ b/module/web/static/js/mobile.js
@@ -0,0 +1,42 @@
+// Sets the require.js configuration for your application.
+require.config({
+
+ paths:{
+
+ jquery:"libs/jquery-1.8.0",
+ jqueryui:"libs/jqueryui",
+ flot:"libs/jquery.flot.min",
+ transit:"libs/jquery.transit-0.1.3",
+ fastClick:"libs/jquery.fastClick-0.2",
+ omniwindow: "libs/jquery.omniwindow",
+
+ underscore:"libs/lodash-0.5.2",
+ backbone:"libs/backbone-0.9.2",
+
+ // Require.js Plugins
+ text:"plugins/text-2.0.3"
+
+ },
+
+ // Sets the configuration for your third party scripts that are not AMD compatible
+ shim: {
+
+ "backbone": {
+ deps: ["underscore", "jquery"],
+ exports: "Backbone" //attaches "Backbone" to the window object
+ },
+ transit: ["jquery"],
+ fastClick: ["jquery"]
+
+ } // end Shim Configuration
+
+});
+
+define('mobile', ['routers/mobileRouter', 'transit', 'fastClick'], function(Mobile) {
+
+ var init = function(){
+ var router = new Mobile();
+ };
+
+ return {"init":init};
+}); \ No newline at end of file
diff --git a/module/web/static/js/models/File.js b/module/web/static/js/models/File.js
new file mode 100644
index 000000000..71aa2b84f
--- /dev/null
+++ b/module/web/static/js/models/File.js
@@ -0,0 +1,33 @@
+define(['jquery', 'backbone', 'underscore'], function($, Backbone, _) {
+
+ return Backbone.Model.extend({
+
+ idAttribute: 'fid',
+
+ defaults: {
+ fid: -1,
+ name: null,
+ package: -1,
+ owner: -1,
+ size: -1,
+ status: -1,
+ media: -1,
+ added: -1,
+ fileorder: -1,
+ download: null
+ },
+
+
+ // Model Constructor
+ initialize: function() {
+
+ },
+
+ // Any time a model attribute is set, this method is called
+ validate: function(attrs) {
+
+ }
+
+ });
+
+}); \ No newline at end of file
diff --git a/module/web/static/js/models/Package.js b/module/web/static/js/models/Package.js
new file mode 100644
index 000000000..5a2940c66
--- /dev/null
+++ b/module/web/static/js/models/Package.js
@@ -0,0 +1,76 @@
+define(['jquery', 'backbone', 'underscore', 'collections/FileList', 'require'],
+ function($, Backbone, _, FileList, require) {
+
+ return Backbone.Model.extend({
+
+ idAttribute: 'pid',
+
+ defaults: {
+ pid: -1,
+ name: null,
+ folder: "",
+ root: -1,
+ owner: -1,
+ site: "",
+ comment: "",
+ password: "",
+ added: -1,
+ status: -1,
+ packageorder: -1,
+ stats: null,
+ fids: null,
+ pids: null,
+ files: null, // Collection
+ packs: null // Collection
+ },
+
+ // Model Constructor
+ initialize: function() {
+ },
+
+ // Changes url + method and delegates call to super class
+ fetch: function(options) {
+ options || (options = {});
+ options.url = 'api/getFileTree/' + this.get('pid') + '/false';
+ options.type = "post";
+
+ return Backbone.Model.prototype.fetch.call(this, options);
+ },
+
+ save: function(options) {
+ // TODO
+ },
+
+ destroy: function(options) {
+ options || (options = {});
+ // TODO: as post data
+ options.url = 'api/deletePackages/[' + this.get('pid') + ']';
+ options.type = "post";
+
+ return Backbone.Model.prototype.destroy.call(this, options);
+ },
+
+ parse: function(resp, xhr) {
+ // Package is loaded from tree collection
+ if (_.has(resp, 'root')) {
+ resp.root.files = new FileList(_.values(resp.files));
+ // circular dependencies needs to be avoided
+ var PackageList = require('collections/PackageList');
+ resp.root.packs = new PackageList(_.values(resp.packages));
+ return resp.root;
+ }
+ return Backbone.model.prototype.fetch.call(this, resp, xhr);
+ },
+
+ // Package data is complete when it contains collection for containing files or packs
+ isLoaded: function() {
+ return this.has('files');
+ },
+
+ // Any time a model attribute is set, this method is called
+ validate: function(attrs) {
+
+ }
+
+ });
+ }); \ No newline at end of file
diff --git a/module/web/static/js/models/TreeCollection.js b/module/web/static/js/models/TreeCollection.js
new file mode 100644
index 000000000..6476ea7b5
--- /dev/null
+++ b/module/web/static/js/models/TreeCollection.js
@@ -0,0 +1,38 @@
+define(['jquery', 'backbone', 'underscore', 'models/Package', 'collections/FileList', 'collections/PackageList'],
+ function($, Backbone, _, Package, FileList, PackageList) {
+
+ // TreeCollection
+ // A Model and not a collection, aggregates other collections
+ return Backbone.Model.extend({
+
+ defaults : {
+ root: null,
+ packages: null,
+ files: null
+ },
+
+ initialize: function() {
+
+ },
+
+ fetch: function(options) {
+ options || (options = {});
+ var pid = options.pid || -1;
+
+ // TODO: more options possible
+ options.url = 'api/getFileTree/' + pid + '/false';
+ options.type = "post";
+
+ return Backbone.Model.prototype.fetch.call(this, options);
+ },
+
+ parse: function(resp, xhr) {
+ return {
+ root: new Package(resp.root),
+ packages: new PackageList(_.values(resp.packages)),
+ files: new FileList(_.values(resp.files))
+ };
+ }
+
+ });
+}); \ No newline at end of file
diff --git a/module/web/static/js/plugins/text-2.0.3.js b/module/web/static/js/plugins/text-2.0.3.js
new file mode 100644
index 000000000..bf61a3fe4
--- /dev/null
+++ b/module/web/static/js/plugins/text-2.0.3.js
@@ -0,0 +1,308 @@
+/**
+ * @license RequireJS text 2.0.3 Copyright (c) 2010-2012, The Dojo Foundation All Rights Reserved.
+ * Available via the MIT or new BSD license.
+ * see: http://github.com/requirejs/text for details
+ */
+/*jslint regexp: true */
+/*global require: false, XMLHttpRequest: false, ActiveXObject: false,
+ define: false, window: false, process: false, Packages: false,
+ java: false, location: false */
+
+define(['module'], function (module) {
+ 'use strict';
+
+ var text, fs,
+ progIds = ['Msxml2.XMLHTTP', 'Microsoft.XMLHTTP', 'Msxml2.XMLHTTP.4.0'],
+ xmlRegExp = /^\s*<\?xml(\s)+version=[\'\"](\d)*.(\d)*[\'\"](\s)*\?>/im,
+ bodyRegExp = /<body[^>]*>\s*([\s\S]+)\s*<\/body>/im,
+ hasLocation = typeof location !== 'undefined' && location.href,
+ defaultProtocol = hasLocation && location.protocol && location.protocol.replace(/\:/, ''),
+ defaultHostName = hasLocation && location.hostname,
+ defaultPort = hasLocation && (location.port || undefined),
+ buildMap = [],
+ masterConfig = (module.config && module.config()) || {};
+
+ text = {
+ version: '2.0.3',
+
+ strip: function (content) {
+ //Strips <?xml ...?> declarations so that external SVG and XML
+ //documents can be added to a document without worry. Also, if the string
+ //is an HTML document, only the part inside the body tag is returned.
+ if (content) {
+ content = content.replace(xmlRegExp, "");
+ var matches = content.match(bodyRegExp);
+ if (matches) {
+ content = matches[1];
+ }
+ } else {
+ content = "";
+ }
+ return content;
+ },
+
+ jsEscape: function (content) {
+ return content.replace(/(['\\])/g, '\\$1')
+ .replace(/[\f]/g, "\\f")
+ .replace(/[\b]/g, "\\b")
+ .replace(/[\n]/g, "\\n")
+ .replace(/[\t]/g, "\\t")
+ .replace(/[\r]/g, "\\r")
+ .replace(/[\u2028]/g, "\\u2028")
+ .replace(/[\u2029]/g, "\\u2029");
+ },
+
+ createXhr: masterConfig.createXhr || function () {
+ //Would love to dump the ActiveX crap in here. Need IE 6 to die first.
+ var xhr, i, progId;
+ if (typeof XMLHttpRequest !== "undefined") {
+ return new XMLHttpRequest();
+ } else if (typeof ActiveXObject !== "undefined") {
+ for (i = 0; i < 3; i += 1) {
+ progId = progIds[i];
+ try {
+ xhr = new ActiveXObject(progId);
+ } catch (e) {}
+
+ if (xhr) {
+ progIds = [progId]; // so faster next time
+ break;
+ }
+ }
+ }
+
+ return xhr;
+ },
+
+ /**
+ * Parses a resource name into its component parts. Resource names
+ * look like: module/name.ext!strip, where the !strip part is
+ * optional.
+ * @param {String} name the resource name
+ * @returns {Object} with properties "moduleName", "ext" and "strip"
+ * where strip is a boolean.
+ */
+ parseName: function (name) {
+ var strip = false, index = name.indexOf("."),
+ modName = name.substring(0, index),
+ ext = name.substring(index + 1, name.length);
+
+ index = ext.indexOf("!");
+ if (index !== -1) {
+ //Pull off the strip arg.
+ strip = ext.substring(index + 1, ext.length);
+ strip = strip === "strip";
+ ext = ext.substring(0, index);
+ }
+
+ return {
+ moduleName: modName,
+ ext: ext,
+ strip: strip
+ };
+ },
+
+ xdRegExp: /^((\w+)\:)?\/\/([^\/\\]+)/,
+
+ /**
+ * Is an URL on another domain. Only works for browser use, returns
+ * false in non-browser environments. Only used to know if an
+ * optimized .js version of a text resource should be loaded
+ * instead.
+ * @param {String} url
+ * @returns Boolean
+ */
+ useXhr: function (url, protocol, hostname, port) {
+ var uProtocol, uHostName, uPort,
+ match = text.xdRegExp.exec(url);
+ if (!match) {
+ return true;
+ }
+ uProtocol = match[2];
+ uHostName = match[3];
+
+ uHostName = uHostName.split(':');
+ uPort = uHostName[1];
+ uHostName = uHostName[0];
+
+ return (!uProtocol || uProtocol === protocol) &&
+ (!uHostName || uHostName.toLowerCase() === hostname.toLowerCase()) &&
+ ((!uPort && !uHostName) || uPort === port);
+ },
+
+ finishLoad: function (name, strip, content, onLoad) {
+ content = strip ? text.strip(content) : content;
+ if (masterConfig.isBuild) {
+ buildMap[name] = content;
+ }
+ onLoad(content);
+ },
+
+ load: function (name, req, onLoad, config) {
+ //Name has format: some.module.filext!strip
+ //The strip part is optional.
+ //if strip is present, then that means only get the string contents
+ //inside a body tag in an HTML string. For XML/SVG content it means
+ //removing the <?xml ...?> declarations so the content can be inserted
+ //into the current doc without problems.
+
+ // Do not bother with the work if a build and text will
+ // not be inlined.
+ if (config.isBuild && !config.inlineText) {
+ onLoad();
+ return;
+ }
+
+ masterConfig.isBuild = config.isBuild;
+
+ var parsed = text.parseName(name),
+ nonStripName = parsed.moduleName + '.' + parsed.ext,
+ url = req.toUrl(nonStripName),
+ useXhr = (masterConfig.useXhr) ||
+ text.useXhr;
+
+ //Load the text. Use XHR if possible and in a browser.
+ if (!hasLocation || useXhr(url, defaultProtocol, defaultHostName, defaultPort)) {
+ text.get(url, function (content) {
+ text.finishLoad(name, parsed.strip, content, onLoad);
+ }, function (err) {
+ if (onLoad.error) {
+ onLoad.error(err);
+ }
+ });
+ } else {
+ //Need to fetch the resource across domains. Assume
+ //the resource has been optimized into a JS module. Fetch
+ //by the module name + extension, but do not include the
+ //!strip part to avoid file system issues.
+ req([nonStripName], function (content) {
+ text.finishLoad(parsed.moduleName + '.' + parsed.ext,
+ parsed.strip, content, onLoad);
+ });
+ }
+ },
+
+ write: function (pluginName, moduleName, write, config) {
+ if (buildMap.hasOwnProperty(moduleName)) {
+ var content = text.jsEscape(buildMap[moduleName]);
+ write.asModule(pluginName + "!" + moduleName,
+ "define(function () { return '" +
+ content +
+ "';});\n");
+ }
+ },
+
+ writeFile: function (pluginName, moduleName, req, write, config) {
+ var parsed = text.parseName(moduleName),
+ nonStripName = parsed.moduleName + '.' + parsed.ext,
+ //Use a '.js' file name so that it indicates it is a
+ //script that can be loaded across domains.
+ fileName = req.toUrl(parsed.moduleName + '.' +
+ parsed.ext) + '.js';
+
+ //Leverage own load() method to load plugin value, but only
+ //write out values that do not have the strip argument,
+ //to avoid any potential issues with ! in file names.
+ text.load(nonStripName, req, function (value) {
+ //Use own write() method to construct full module value.
+ //But need to create shell that translates writeFile's
+ //write() to the right interface.
+ var textWrite = function (contents) {
+ return write(fileName, contents);
+ };
+ textWrite.asModule = function (moduleName, contents) {
+ return write.asModule(moduleName, fileName, contents);
+ };
+
+ text.write(pluginName, nonStripName, textWrite, config);
+ }, config);
+ }
+ };
+
+ if (masterConfig.env === 'node' || (!masterConfig.env &&
+ typeof process !== "undefined" &&
+ process.versions &&
+ !!process.versions.node)) {
+ //Using special require.nodeRequire, something added by r.js.
+ fs = require.nodeRequire('fs');
+
+ text.get = function (url, callback) {
+ var file = fs.readFileSync(url, 'utf8');
+ //Remove BOM (Byte Mark Order) from utf8 files if it is there.
+ if (file.indexOf('\uFEFF') === 0) {
+ file = file.substring(1);
+ }
+ callback(file);
+ };
+ } else if (masterConfig.env === 'xhr' || (!masterConfig.env &&
+ text.createXhr())) {
+ text.get = function (url, callback, errback) {
+ var xhr = text.createXhr();
+ xhr.open('GET', url, true);
+
+ //Allow overrides specified in config
+ if (masterConfig.onXhr) {
+ masterConfig.onXhr(xhr, url);
+ }
+
+ xhr.onreadystatechange = function (evt) {
+ var status, err;
+ //Do not explicitly handle errors, those should be
+ //visible via console output in the browser.
+ if (xhr.readyState === 4) {
+ status = xhr.status;
+ if (status > 399 && status < 600) {
+ //An http 4xx or 5xx error. Signal an error.
+ err = new Error(url + ' HTTP status: ' + status);
+ err.xhr = xhr;
+ errback(err);
+ } else {
+ callback(xhr.responseText);
+ }
+ }
+ };
+ xhr.send(null);
+ };
+ } else if (masterConfig.env === 'rhino' || (!masterConfig.env &&
+ typeof Packages !== 'undefined' && typeof java !== 'undefined')) {
+ //Why Java, why is this so awkward?
+ text.get = function (url, callback) {
+ var stringBuffer, line,
+ encoding = "utf-8",
+ file = new java.io.File(url),
+ lineSeparator = java.lang.System.getProperty("line.separator"),
+ input = new java.io.BufferedReader(new java.io.InputStreamReader(new java.io.FileInputStream(file), encoding)),
+ content = '';
+ try {
+ stringBuffer = new java.lang.StringBuffer();
+ line = input.readLine();
+
+ // Byte Order Mark (BOM) - The Unicode Standard, version 3.0, page 324
+ // http://www.unicode.org/faq/utf_bom.html
+
+ // Note that when we use utf-8, the BOM should appear as "EF BB BF", but it doesn't due to this bug in the JDK:
+ // http://bugs.sun.com/bugdatabase/view_bug.do?bug_id=4508058
+ if (line && line.length() && line.charAt(0) === 0xfeff) {
+ // Eat the BOM, since we've already found the encoding on this file,
+ // and we plan to concatenating this buffer with others; the BOM should
+ // only appear at the top of a file.
+ line = line.substring(1);
+ }
+
+ stringBuffer.append(line);
+
+ while ((line = input.readLine()) !== null) {
+ stringBuffer.append(lineSeparator);
+ stringBuffer.append(line);
+ }
+ //Make sure we return a JavaScript string and not a Java string.
+ content = String(stringBuffer.toString()); //String
+ } finally {
+ input.close();
+ }
+ callback(content);
+ };
+ }
+
+ return text;
+});
diff --git a/module/web/static/js/routers/defaultRouter.js b/module/web/static/js/routers/defaultRouter.js
new file mode 100644
index 000000000..95b8de967
--- /dev/null
+++ b/module/web/static/js/routers/defaultRouter.js
@@ -0,0 +1,29 @@
+define(['jquery','backbone','views/headerView'], function($, Backbone, HeaderView){
+
+ var Router = Backbone.Router.extend({
+
+ initialize: function(){
+ Backbone.history.start();
+ },
+
+ // All of your Backbone Routes (add more)
+ routes: {
+
+ // When there is no hash bang on the url, the home method is called
+ '': 'home'
+
+ },
+
+ 'home': function(){
+ // Instantiating mainView and anotherView instances
+ var headerView = new HeaderView();
+
+ // Renders the mainView template
+ headerView.render();
+
+ }
+ });
+
+ // Returns the Router class
+ return Router;
+}); \ No newline at end of file
diff --git a/module/web/static/js/routers/mobileRouter.js b/module/web/static/js/routers/mobileRouter.js
new file mode 100644
index 000000000..7f1f7805e
--- /dev/null
+++ b/module/web/static/js/routers/mobileRouter.js
@@ -0,0 +1,55 @@
+define(['jquery','backbone', 'underscore'], function($, Backbone, _){
+
+ return Backbone.Router.extend({
+
+ initialize: function(){
+ _.bindAll(this, "changePage");
+
+ this.$el = $("#content");
+
+ // Tells Backbone to start watching for hashchange events
+ Backbone.history.start();
+
+ },
+
+ // All of your Backbone Routes (add more)
+ routes: {
+
+ // When there is no hash bang on the url, the home method is called
+ '': 'home'
+
+ },
+
+ 'home': function(){
+
+ var self = this;
+
+ $("#p1").fastClick(function(){
+ self.changePage($("<div class='page' style='background-color: #9acd32;'><h1>Page 1</h1><br>some content<br>sdfdsf<br>sdffg<h3>oiuzz</h3></div>"));
+ });
+
+ $("#p2").bind("click", function(){
+ self.changePage($("<div class='page' style='background-color: blue;'><h1>Page 2</h1><br>some content<br>sdfdsf<br><h2>sdfsdf</h2>sdffg</div>"));
+ });
+
+ },
+
+ changePage: function(content){
+
+ var oldpage = this.$el.find(".page");
+ content.css({x: "100%"});
+ this.$el.append(content);
+ content.transition({x:0}, function(){
+ window.setTimeout(function(){
+ oldpage.remove();
+ }, 400);
+ });
+
+// $("#viewport").transition({x: "100%"}, function(){
+// $("#viewport").html(content);
+// $("#viewport").transition({x: 0});
+// });
+ }
+
+ });
+}); \ No newline at end of file
diff --git a/module/web/static/js/utils/animations.js b/module/web/static/js/utils/animations.js
new file mode 100644
index 000000000..9b1448f61
--- /dev/null
+++ b/module/web/static/js/utils/animations.js
@@ -0,0 +1,36 @@
+define(['jquery', 'underscore', 'transit'], function(jQuery, _) {
+
+ // Overwrite common animations with transitions
+ jQuery.each({
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" }
+ }, function(name, props) {
+ jQuery.fn[ name ] = function(speed, easing, callback) {
+ return this.transition(props, speed, easing, callback);
+ };
+ });
+
+ jQuery.fn._transit = jQuery.fn.transit;
+
+ // Over riding transit plugin to support hide and show
+ // Props retains it properties across multiple calls, therefore props.show value is introduced
+ jQuery.fn.transit = jQuery.fn.transition = function(props, duration, easing, callback) {
+ var self = this;
+ var cb = callback;
+ if (props && (props.opacity === 'hide' || (props.opacity === 0 && props.show === true))) {
+ props.opacity = 0;
+ props.show = true;
+
+ callback = function() {
+ self.css({display: 'none'});
+ if (typeof cb === 'function') { cb.apply(self); }
+ };
+ } else if (props && (props.opacity === 'show' || (props.opacity === 1 && props.show === true))) {
+ props.opacity = 1;
+ props.show = true;
+ this.css({display: 'block'});
+ }
+
+ return this._transit(props, duration, easing, callback);
+ };
+}); \ No newline at end of file
diff --git a/module/web/static/js/utils/lazyRequire.js b/module/web/static/js/utils/lazyRequire.js
new file mode 100644
index 000000000..d20d78610
--- /dev/null
+++ b/module/web/static/js/utils/lazyRequire.js
@@ -0,0 +1,89 @@
+// Define the module.
+define(
+ [
+ "require"
+ ],
+ function( require ){
+
+
+ // Define the states of loading for a given set of modules
+ // within a require() statement.
+ var states = {
+ unloaded: "UNLOADED",
+ loading: "LOADING",
+ loaded: "LOADED"
+ };
+
+
+ // Define the top-level module container. Mostly, we're making
+ // the top-level container a non-Function so that users won't
+ // try to invoke this without calling the once() method below.
+ var lazyRequire = {};
+
+
+ // I will return a new, unique instance of the requrieOnce()
+ // method. Each instance will only call the require() method
+ // once internally.
+ lazyRequire.once = function(){
+
+ // The modules start in an unloaded state before
+ // requireOnce() is invoked by the calling code.
+ var state = states.unloaded;
+ var args;
+
+ var requireOnce = function( dependencies, loadCallback ){
+
+ // Use the module state to determine which method to
+ // invoke (or just to ignore the invocation).
+ if (state === states.loaded){
+ loadCallback.apply(null, args);
+
+ // The modules have not yet been requested - let's
+ // lazy load them.
+ } else if (state !== states.loading){
+
+ // We're about to load the modules asynchronously;
+ // flag the interim state.
+ state = states.loading;
+
+ // Load the modules.
+ require(
+ dependencies,
+ function(){
+
+ args = arguments;
+ loadCallback.apply( null, args );
+ state = states.loaded;
+
+
+ }
+ );
+
+ // RequireJS is currently loading the modules
+ // asynchronously, but they have not finished
+ // loading yet.
+ } else {
+
+ // Simply ignore this call.
+ return;
+
+ }
+
+ };
+
+ // Return the new lazy loader.
+ return( requireOnce );
+
+ };
+
+
+ // -------------------------------------------------- //
+ // -------------------------------------------------- //
+
+
+ // Return the module definition.
+ return( lazyRequire );
+
+
+ }
+); \ No newline at end of file
diff --git a/module/web/static/js/views/fileView.js b/module/web/static/js/views/fileView.js
new file mode 100644
index 000000000..7db8112c8
--- /dev/null
+++ b/module/web/static/js/views/fileView.js
@@ -0,0 +1,20 @@
+define(['jquery', 'backbone', 'underscore'], function($, Backbone, _) {
+
+ // Renders single file item
+ return Backbone.View.extend({
+
+ tagName: 'li',
+ events: {
+
+ },
+
+ initialize: function() {
+ },
+
+ render: function() {
+ this.$el.html(this.model.get('name'));
+ return this;
+ }
+
+ });
+}); \ No newline at end of file
diff --git a/module/web/static/js/views/headerView.js b/module/web/static/js/views/headerView.js
new file mode 100644
index 000000000..21b591a3d
--- /dev/null
+++ b/module/web/static/js/views/headerView.js
@@ -0,0 +1,75 @@
+define(['jquery', 'backbone', 'flot', 'jqueryui/progressbar'], function($, Backbone){
+ // Renders the header with all information
+ return Backbone.View.extend({
+
+ el: 'header',
+
+ events: {
+
+ },
+
+ initialize: function() {
+
+ var totalPoints = 100;
+ var data = [];
+
+ function getRandomData() {
+ if (data.length > 0)
+ data = data.slice(1);
+
+ // do a random walk
+ while (data.length < totalPoints) {
+ var prev = data.length > 0 ? data[data.length - 1] : 50;
+ var y = prev + Math.random() * 10 - 5;
+ if (y < 0)
+ y = 0;
+ if (y > 100)
+ y = 100;
+ data.push(y);
+ }
+
+ // zip the generated y values with the x values
+ var res = [];
+ for (var i = 0; i < data.length; ++i)
+ res.push([i, data[i]])
+ return res;
+ }
+
+ var updateInterval = 1500;
+
+ var speedgraph = $.plot(this.$el.find("#speedgraph"), [getRandomData()], {
+ series:{
+ lines:{ show:true, lineWidth:2 },
+ shadowSize:0,
+ color:"#fee247"
+ },
+ xaxis:{ ticks:[], mode:"time" },
+ yaxis:{ ticks:[], min:0, autoscaleMargin:0.1 },
+ grid:{
+ show:true,
+// borderColor: "#757575",
+ borderColor:"white",
+ borderWidth:1,
+ labelMargin:0,
+ axisMargin:0,
+ minBorderMargin:0
+ }
+ });
+
+ function update() {
+ speedgraph.setData([ getRandomData() ]);
+ // since the axes don't change, we don't need to call plot.setupGrid()
+ speedgraph.draw();
+
+ setTimeout(update, updateInterval);
+ }
+
+ update();
+
+ },
+
+
+ render: function() {
+ }
+ });
+}); \ No newline at end of file
diff --git a/module/web/static/js/views/mobile/my.js b/module/web/static/js/views/mobile/my.js
new file mode 100644
index 000000000..41203e6c5
--- /dev/null
+++ b/module/web/static/js/views/mobile/my.js
@@ -0,0 +1,275 @@
+(function($) {
+ $.widget('mobile.tabbar', $.mobile.navbar, {
+ _create: function() {
+ // Set the theme before we call the prototype, which will
+ // ensure buttonMarkup() correctly grabs the inheritied theme.
+ // We default to the "a" swatch if none is found
+ var theme = this.element.jqmData('theme') || "a";
+ this.element.addClass('ui-footer ui-footer-fixed ui-bar-' + theme);
+
+ // Make sure the page has padding added to it to account for the fixed bar
+ this.element.closest('[data-role="page"]').addClass('ui-page-footer-fixed');
+
+
+ // Call the NavBar _create prototype
+ $.mobile.navbar.prototype._create.call(this);
+ },
+
+ // Set the active URL for the Tab Bar, and highlight that button on the bar
+ setActive: function(url) {
+ // Sometimes the active state isn't properly cleared, so we reset it ourselves
+ this.element.find('a').removeClass('ui-btn-active ui-state-persist');
+ this.element.find('a[href="' + url + '"]').addClass('ui-btn-active ui-state-persist');
+ }
+ });
+
+ $(document).bind('pagecreate create', function(e) {
+ return $(e.target).find(":jqmData(role='tabbar')").tabbar();
+ });
+
+ $(":jqmData(role='page')").live('pageshow', function(e) {
+ // Grab the id of the page that's showing, and select it on the Tab Bar on the page
+ var tabBar, id = $(e.target).attr('id');
+
+ tabBar = $.mobile.activePage.find(':jqmData(role="tabbar")');
+ if(tabBar.length) {
+ tabBar.tabbar('setActive', '#' + id);
+ }
+ });
+
+var attachEvents = function() {
+ var hoverDelay = $.mobile.buttonMarkup.hoverDelay, hov, foc;
+
+ $( document ).bind( {
+ "vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart": function( event ) {
+ var theme,
+ $btn = $( closestEnabledButton( event.target ) ),
+ evt = event.type;
+
+ if ( $btn.length ) {
+ theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+
+ if ( evt === "vmousedown" ) {
+ if ( $.support.touch ) {
+ hov = setTimeout(function() {
+ $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme );
+ }, hoverDelay );
+ } else {
+ $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme );
+ }
+ } else if ( evt === "vmousecancel" || evt === "vmouseup" ) {
+ $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme );
+ } else if ( evt === "vmouseover" || evt === "focus" ) {
+ if ( $.support.touch ) {
+ foc = setTimeout(function() {
+ $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme );
+ }, hoverDelay );
+ } else {
+ $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme );
+ }
+ } else if ( evt === "vmouseout" || evt === "blur" || evt === "scrollstart" ) {
+ $btn.removeClass( "ui-btn-hover-" + theme + " ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme );
+ if ( hov ) {
+ clearTimeout( hov );
+ }
+ if ( foc ) {
+ clearTimeout( foc );
+ }
+ }
+ }
+ },
+ "focusin focus": function( event ){
+ $( closestEnabledButton( event.target ) ).addClass( $.mobile.focusClass );
+ },
+ "focusout blur": function( event ){
+ $( closestEnabledButton( event.target ) ).removeClass( $.mobile.focusClass );
+ }
+ });
+
+ attachEvents = null;
+};
+
+$.fn.buttonMarkup = function( options ) {
+ var $workingSet = this;
+
+ // Enforce options to be of type string
+ options = ( options && ( $.type( options ) == "object" ) )? options : {};
+ for ( var i = 0; i < $workingSet.length; i++ ) {
+ var el = $workingSet.eq( i ),
+ e = el[ 0 ],
+ o = $.extend( {}, $.fn.buttonMarkup.defaults, {
+ icon: options.icon !== undefined ? options.icon : el.jqmData( "icon" ),
+ iconpos: options.iconpos !== undefined ? options.iconpos : el.jqmData( "iconpos" ),
+ theme: options.theme !== undefined ? options.theme : el.jqmData( "theme" ) || $.mobile.getInheritedTheme( el, "c" ),
+ inline: options.inline !== undefined ? options.inline : el.jqmData( "inline" ),
+ shadow: options.shadow !== undefined ? options.shadow : el.jqmData( "shadow" ),
+ corners: options.corners !== undefined ? options.corners : el.jqmData( "corners" ),
+ iconshadow: options.iconshadow !== undefined ? options.iconshadow : el.jqmData( "iconshadow" ),
+ iconsize: options.iconsize !== undefined ? options.iconsize : el.jqmData( "iconsize" ),
+ mini: options.mini !== undefined ? options.mini : el.jqmData( "mini" )
+ }, options ),
+
+ // Classes Defined
+ innerClass = "ui-btn-inner",
+ textClass = "ui-btn-text",
+ buttonClass, iconClass,
+ // Button inner markup
+ buttonInner,
+ buttonText,
+ buttonIcon,
+ buttonElements;
+
+ $.each(o, function(key, value) {
+ e.setAttribute( "data-" + $.mobile.ns + key, value );
+ el.jqmData(key, value);
+ });
+
+ // Check if this element is already enhanced
+ buttonElements = $.data(((e.tagName === "INPUT" || e.tagName === "BUTTON") ? e.parentNode : e), "buttonElements");
+
+ if (buttonElements) {
+ e = buttonElements.outer;
+ el = $(e);
+ buttonInner = buttonElements.inner;
+ buttonText = buttonElements.text;
+ // We will recreate this icon below
+ $(buttonElements.icon).remove();
+ buttonElements.icon = null;
+ }
+ else {
+ buttonInner = document.createElement( o.wrapperEls );
+ buttonText = document.createElement( o.wrapperEls );
+ }
+ buttonIcon = o.icon ? document.createElement( "span" ) : null;
+
+ if ( attachEvents && !buttonElements) {
+ attachEvents();
+ }
+
+ // if not, try to find closest theme container
+ if ( !o.theme ) {
+ o.theme = $.mobile.getInheritedTheme( el, "c" );
+ }
+
+ buttonClass = "ui-btn ui-btn-up-" + o.theme;
+ buttonClass += o.inline ? " ui-btn-inline" : "";
+ buttonClass += o.shadow ? " ui-shadow" : "";
+ buttonClass += o.corners ? " ui-btn-corner-all" : "";
+
+ if ( o.mini !== undefined ) {
+ // Used to control styling in headers/footers, where buttons default to `mini` style.
+ buttonClass += o.mini ? " ui-mini" : " ui-fullsize";
+ }
+
+ if ( o.inline !== undefined ) {
+ // Used to control styling in headers/footers, where buttons default to `mini` style.
+ buttonClass += o.inline === false ? " ui-btn-block" : " ui-btn-inline";
+ }
+
+
+ if ( o.icon ) {
+ o.icon = "ui-icon-" + o.icon;
+ o.iconpos = o.iconpos || "left";
+
+ iconClass = "ui-icon " + o.icon;
+
+ if ( o.iconshadow ) {
+ iconClass += " ui-icon-shadow";
+ }
+
+ if ( o.iconsize ) {
+ iconClass += " ui-iconsize-" + o.iconsize;
+ }
+ }
+
+ if ( o.iconpos ) {
+ buttonClass += " ui-btn-icon-" + o.iconpos;
+
+ if ( o.iconpos == "notext" && !el.attr( "title" ) ) {
+ el.attr( "title", el.getEncodedText() );
+ }
+ }
+
+ innerClass += o.corners ? " ui-btn-corner-all" : "";
+
+ if ( o.iconpos && o.iconpos === "notext" && !el.attr( "title" ) ) {
+ el.attr( "title", el.getEncodedText() );
+ }
+
+ if ( buttonElements ) {
+ el.removeClass( buttonElements.bcls || "" );
+ }
+ el.removeClass( "ui-link" ).addClass( buttonClass );
+
+ buttonInner.className = innerClass;
+
+ buttonText.className = textClass;
+ if ( !buttonElements ) {
+ buttonInner.appendChild( buttonText );
+ }
+ if ( buttonIcon ) {
+ buttonIcon.className = iconClass;
+ if ( !(buttonElements && buttonElements.icon) ) {
+ buttonIcon.appendChild( document.createTextNode("\u00a0") );
+ buttonInner.appendChild( buttonIcon );
+ }
+ }
+
+ while ( e.firstChild && !buttonElements) {
+ buttonText.appendChild( e.firstChild );
+ }
+
+ if ( !buttonElements ) {
+ e.appendChild( buttonInner );
+ }
+
+ // Assign a structure containing the elements of this button to the elements of this button. This
+ // will allow us to recognize this as an already-enhanced button in future calls to buttonMarkup().
+ buttonElements = {
+ bcls : buttonClass,
+ outer : e,
+ inner : buttonInner,
+ text : buttonText,
+ icon : buttonIcon
+ };
+
+ $.data(e, 'buttonElements', buttonElements);
+ $.data(buttonInner, 'buttonElements', buttonElements);
+ $.data(buttonText, 'buttonElements', buttonElements);
+ if (buttonIcon) {
+ $.data(buttonIcon, 'buttonElements', buttonElements);
+ }
+ }
+
+ return this;
+};
+
+$.fn.buttonMarkup.defaults = {
+ corners: true,
+ shadow: true,
+ iconshadow: true,
+ iconsize: 18,
+ wrapperEls: "span"
+};
+
+function closestEnabledButton( element ) {
+ var cname;
+
+ while ( element ) {
+ // Note that we check for typeof className below because the element we
+ // handed could be in an SVG DOM where className on SVG elements is defined to
+ // be of a different type (SVGAnimatedString). We only operate on HTML DOM
+ // elements, so we look for plain "string".
+ cname = ( typeof element.className === 'string' ) && (element.className + ' ');
+ if ( cname && cname.indexOf("ui-btn ") > -1 && cname.indexOf("ui-disabled ") < 0 ) {
+ break;
+ }
+
+ element = element.parentNode;
+ }
+
+ return element;
+}
+
+
+})(jQuery);
diff --git a/module/web/static/js/views/modal/modalView.js b/module/web/static/js/views/modal/modalView.js
new file mode 100644
index 000000000..b20aab57d
--- /dev/null
+++ b/module/web/static/js/views/modal/modalView.js
@@ -0,0 +1,84 @@
+define(['jquery', 'backbone', 'underscore', 'text!tpl/default/modal.html', 'omniwindow'], function($, Backbone, _, template) {
+
+ return Backbone.View.extend({
+
+ events: {
+ 'click .btn-close': 'hide',
+ 'click .close': 'hide'
+ },
+
+ template: _.template(template),
+
+ dialog: null,
+
+ initialize: function() {
+
+ },
+
+ render: function() {
+ this.$el.html(this.template({ content: this.renderContent().html(), header: this.getHeader()}));
+ this.$el.addClass('modal hide');
+ this.$el.css({opacity: 0, scale: 0.7});
+ $("body").append(this.el);
+
+ this.dialog = this.$el.omniWindow({
+ overlay: {
+ selector: '#modal-overlay',
+ hideClass: 'hide',
+ animations: {
+ hide: function(subjects, internalCallback) {
+ subjects.overlay.fadeOut(400, function() {
+ internalCallback(subjects);
+ });
+ },
+ show: function(subjects, internalCallback) {
+ subjects.overlay.fadeIn(250, function() {
+ internalCallback(subjects);
+ });
+ }}},
+ modal: {
+ hideClass: 'hide',
+ animations: {
+ hide: function(subjects, internalCallback) {
+ subjects.modal.transition({opacity: 'hide', scale: 0.7}, 250, function() {
+ internalCallback(subjects);
+ });
+ },
+
+ show: function(subjects, internalCallback) {
+ subjects.modal.transition({opacity: 'show', scale: 1}, 250, function() {
+ internalCallback(subjects);
+ });
+ }}
+ }});
+
+ return this;
+ },
+ renderContent: function() {
+ return $('<h1>Content!</h1>');
+ },
+
+ getHeader: function() {
+ return 'Dialog';
+ },
+
+ show: function() {
+ if (this.dialog === null)
+ this.render();
+
+ this.dialog.trigger('show');
+
+ // TODO: set focus on first element
+ },
+
+ hide: function() {
+ this.dialog.trigger('hide');
+ },
+
+ destroy: function() {
+ this.$el.remove();
+ this.dialog = null;
+ }
+
+ });
+}); \ No newline at end of file
diff --git a/module/web/static/js/views/packageTreeView.js b/module/web/static/js/views/packageTreeView.js
new file mode 100644
index 000000000..30f159cf7
--- /dev/null
+++ b/module/web/static/js/views/packageTreeView.js
@@ -0,0 +1,75 @@
+define(['jquery', 'backbone', 'underscore', 'models/TreeCollection', 'views/packageView', 'views/fileView'],
+ function($, Backbone, _, TreeCollection, packageView, fileView) {
+
+ // Renders whole PackageView
+ return Backbone.View.extend({
+
+ el: '#content',
+
+ events: {
+ 'click #add': 'addPackage',
+ 'keypress #name': 'addOnEnter'
+ },
+
+ initialize: function() {
+ this.tree = new TreeCollection();
+
+ },
+
+ init: function() {
+ var self = this;
+ this.tree.fetch({success: function() {
+ self.render();
+ }});
+ },
+
+ render: function() {
+ var packs = this.tree.get('packages'),
+ files = this.tree.get('files');
+
+ this.$el.append($('<span>Root: ' + this.tree.get('root').get('name') + ' </span>'));
+ this.$el.append($('<input id="name" type="text" size="20">'));
+ this.$el.append($('<a id="add" href="#"> Add</a><br>'));
+
+ var ul = $('<ul></ul>');
+ packs.each(function(pack) {
+ ul.append(new packageView({model: pack}).render().el);
+ });
+
+ this.$el.append(ul);
+ this.$el.append($('<br> Files: ' + files.size() + '<br>'));
+
+ ul = $('<ul></ul>');
+ files.each(function(file) {
+ ul.append(new fileView({model: file}).render().el);
+ });
+
+ this.$el.append(ul);
+
+ return this;
+ },
+
+ addOnEnter: function(e) {
+ if (e.keyCode != 13) return;
+ this.addPackage(e);
+ },
+
+ addPackage: function() {
+ var self = this;
+ var settings = {
+ data: {
+ name: '"' + $('#name').val() + '"',
+ links: '["some link"]'
+ },
+ success: function() {
+ self.tree.fetch({success: function() {
+ self.render();
+ }});
+ }
+ };
+
+ $.ajax('api/addPackage', settings);
+ $('#name').val('');
+ }
+ });
+ }); \ No newline at end of file
diff --git a/module/web/static/js/views/packageView.js b/module/web/static/js/views/packageView.js
new file mode 100644
index 000000000..171325d1f
--- /dev/null
+++ b/module/web/static/js/views/packageView.js
@@ -0,0 +1,60 @@
+define(['jquery', 'backbone', 'underscore', 'views/fileView', 'utils/lazyRequire'],
+ function($, Backbone, _, fileView, lazyLoader) {
+
+ // Renders a single package item
+ return Backbone.View.extend({
+
+ tagName: 'li',
+ events: {
+ 'click .load': 'load',
+ 'click .delete': 'delete',
+ 'click .show-dialog': 'show'
+ },
+
+ modal: null,
+ requireOnce: lazyLoader.once(),
+
+ initialize: function() {
+ this.model.on('change', this.render, this);
+ this.model.on('remove', this.unrender, this);
+ },
+
+ render: function() {
+ this.$el.html('Package ' + this.model.get('pid') + ': ' + this.model.get('name'));
+ this.$el.append($('<a class="load" href="#"> Load</a>'));
+ this.$el.append($('<a class="delete" href="#"> Delete</a>'));
+ this.$el.append($('<a class="show-dialog" href="#"> Show</a>'));
+
+ if (this.model.isLoaded()) {
+ var ul = $('<ul></ul>');
+ this.model.get('files').each(function(file) {
+ ul.append(new fileView({model: file}).render().el);
+ });
+ this.$el.append(ul);
+ }
+ return this;
+ },
+
+ unrender: function() {
+ this.$el.remove();
+ },
+
+ load: function() {
+ this.model.fetch();
+ },
+
+ delete: function() {
+ this.model.destroy();
+ },
+
+ show: function() {
+ var self = this;
+ this.requireOnce(['views/modal/modalView'], function(modalView){
+ if (self.modal === null)
+ self.modal = new modalView();
+
+ self.modal.show();
+ });
+ }
+ });
+}); \ No newline at end of file
diff --git a/module/web/templates/500.html b/module/web/templates/500.html
index e15090b66..8bffe6dbb 100644
--- a/module/web/templates/500.html
+++ b/module/web/templates/500.html
@@ -1,5 +1,4 @@
-<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN"
- "http://www.w3.org/TR/html4/loose.dtd">
+<!doctype html>
<html>
<head>
<title>Server Error</title>
diff --git a/module/web/templates/default/admin.html b/module/web/templates/default/admin.html
deleted file mode 100644
index b049411fd..000000000
--- a/module/web/templates/default/admin.html
+++ /dev/null
@@ -1,98 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block head %}
- <script type="text/javascript" src="media/js/admin.js"></script>
-{% endblock %}
-
-
-{% block title %}{{ _("Administrate") }} - {{ super() }} {% endblock %}
-{% block subtitle %}{{ _("Administrate") }}{% endblock %}
-
-{% block content %}
-
- <a href="#" id="quit-pyload" style="font-size: large; font-weight: bold;">{{_("Quit pyLoad")}}</a> |
- <a href="#" id="restart-pyload" style="font-size: large; font-weight: bold;">{{_("Restart pyLoad")}}</a>
- <br>
- <br>
-
- {{ _("To add user or change passwords use:") }} <b>python pyLoadCore.py -u</b><br>
- {{ _("Important: Admin user have always all permissions!") }}
-
- <form action="" method="POST">
- <table class="settable wide">
- <thead style="font-size: 11px">
- <th>
- {{ _("Name") }}
- </th>
- <th>
- {{ _("Change Password") }}
- </th>
- <th>
- {{ _("Admin") }}
- </th>
- <th>
- {{ _("Permissions") }}
- </th>
- </thead>
-
- {% for name, data in users.iteritems() %}
- <tr>
- <td>{{ name }}</td>
- <td><a class="change_password" href="#" id="change_pw|{{name}}">{{ _("change") }}</a></td>
- <td><input name="{{ name }}|admin" type="checkbox" {% if data.perms.admin %}
- checked="True" {% endif %}"></td>
- <td>
- <select multiple="multiple" size="{{ permlist|length }}" name="{{ name }}|perms">
- {% for perm in permlist %}
- {% if data.perms|getitem(perm) %}
- <option selected="selected">{{ perm }}</option>
- {% else %}
- <option>{{ perm }}</option>
- {% endif %}
- {% endfor %}
- </select>
- </td>
- </tr>
- {% endfor %}
-
-
- </table>
-
- <button class="styled_button" type="submit">{{ _("Submit") }}</button>
- </form>
-{% endblock %}
-{% block hidden %}
- <div id="password_box" class="window_box" style="z-index: 2">
- <form id="password_form" action="/json/change_password" method="POST" enctype="multipart/form-data">
- <h1>{{ _("Change Password") }}</h1>
-
- <p>{{ _("Enter your current and desired Password.") }}</p>
- <label for="user_login">{{ _("User") }}
- <span class="small">{{ _("Your username.") }}</span>
- </label>
- <input id="user_login" name="user_login" type="text" size="20"/>
-
- <label for="login_current_password">{{ _("Current password") }}
- <span class="small">{{ _("The password for this account.") }}</span>
- </label>
- <input id="login_current_password" name="login_current_password" type="password" size="20"/>
-
- <label for="login_new_password">{{ _("New password") }}
- <span class="small">{{ _("The new password.") }}</span>
- </label>
- <input id="login_new_password" name="login_new_password" type="password" size="20"/>
-
- <label for="login_new_password2">{{ _("New password (repeat)") }}
- <span class="small">{{ _("Please repeat the new password.") }}</span>
- </label>
- <input id="login_new_password2" name="login_new_password2" type="password" size="20"/>
-
-
- <button id="login_password_button" type="submit">{{ _("Submit") }}</button>
- <button id="login_password_reset" style="margin-left: 0" type="reset">{{ _("Reset") }}</button>
- <div class="spacer"></div>
-
- </form>
-
- </div>
-{% endblock %}
diff --git a/module/web/templates/default/backbone/modal.html b/module/web/templates/default/backbone/modal.html
new file mode 100644
index 000000000..afc5d7b58
--- /dev/null
+++ b/module/web/templates/default/backbone/modal.html
@@ -0,0 +1,11 @@
+<div class="modal-header">
+ <button type="button" class="close" data-dismiss="modal" aria-hidden="true">&times;</button>
+ <h3><%- header %></h3>
+</div>
+<div class="modal-body">
+ <%- content %>
+</div>
+<div class="modal-footer">
+ <a href="#" class="btn btn-close">Close</a>
+ <a href="#" class="btn btn-primary">Save</a>
+</div> \ No newline at end of file
diff --git a/module/web/templates/default/base.html b/module/web/templates/default/base.html
index 0b20ecdb0..f193db75c 100644
--- a/module/web/templates/default/base.html
+++ b/module/web/templates/default/base.html
@@ -1,180 +1,115 @@
-<?xml version="1.0" ?>
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
- "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
+<!DOCTYPE html>
+<html>
<head>
-
-<meta http-equiv="Content-Type" content="text/html; charset=utf-8"/>
-<link rel="stylesheet" type="text/css" href="/media/default/css/default.css"/>
-<link rel="stylesheet" type="text/css" href="/media/default/css/window.css"/>
-<link rel="stylesheet" type="text/css" href="/media/default/css/MooDialog.css"/>
-
-<script type="text/javascript" src="/media/js/mootools-core-1.4.1.js"></script>
-<script type="text/javascript" src="/media/js/mootools-more-1.4.0.1.js"></script>
-<script type="text/javascript" src="/media/js/MooDialog_static.js"></script>
-<script type="text/javascript" src="/media/js/purr_static.js"></script>
-
-
-<script type="text/javascript" src="/media/js/base.js"></script>
-
-<title>{% block title %}pyLoad {{_("Webinterface")}}{% endblock %}</title>
-
-{% block head %}
-{% endblock %}
+ <meta charset="utf-8">
+ <meta http-equiv="X-UA-Compatible" content="IE=edge,chrome=1">
+ <title>{% block title %}pyLoad {{ _("WebUI") }}{% endblock %}</title>
+ <meta name="description" content="pyLoad {{ _("Webinterface") }}">
+ <meta name="viewport" content="width=device-width">
+
+ <!-- TODO Include this font -->
+ <link href="http://fonts.googleapis.com/css?family=Abel" rel="stylesheet" type="text/css"/>
+ <link href="static/css/bootstrap.css" rel="stylesheet" type="text/css"/>
+ <link href="static/css/font.css" rel="stylesheet" type="text/css"/>
+ <link href="static/css/default/style.less" rel="stylesheet/less" type="text/css" media="screen"/>
+
+
+ <script src="static/js/libs/less-1.3.0.min.js" type="text/javascript"></script>
+ <script type="text/javascript" data-main="static/js/default" src="static/js/libs/require-2.0.6.js"></script>
+ <script>
+ require(['default'], function (App) {
+ App.init();
+ {% block require %}
+ {% endblock %}
+ });
+ </script>
+
+ {% block head %}
+ {% endblock %}
</head>
<body>
-<a class="anchor" name="top" id="top"></a>
-
-<div id="head-panel">
-
-
- <div id="head-search-and-login">
- {% block headpanel %}
-
- {% if user.is_authenticated %}
-
-
-{% if update %}
-<span>
-<span style="font-weight: bold; margin: 0 2px 0 2px;">{{_("pyLoad Update available!")}}</span>
-</span>
-{% endif %}
-
-
-{% if plugins %}
-<span>
-<span style="font-weight: bold; margin: 0 2px 0 2px;">{{_("Plugins updated, please restart!")}}</span>
-</span>
-{% endif %}
-
-<span id="cap_info" style="display: {% if captcha %}inline{%else%}none{% endif %}">
-<img src="/media/default/img/images.png" alt="Captcha:" style="vertical-align:middle; margin:2px" />
-<span style="font-weight: bold; cursor: pointer; margin-right: 2px;">{{_("Captcha waiting")}}</span>
-</span>
-
- <img src="/media/default/img/head-login.png" alt="User:" style="vertical-align:middle; margin:2px" /><span style="padding-right: 2px;">{{user.name}}</span>
- <ul id="user-actions">
- <li><a href="/logout" class="action logout" rel="nofollow">{{_("Logout")}}</a></li>
- {% if user.is_admin %}
- <li><a href="/admin" class="action profile" rel="nofollow">{{_("Administrate")}}</a></li>
- {% endif %}
- <li><a href="/info" class="action info" rel="nofollow">{{_("Info")}}</a></li>
-
- </ul>
-{% else %}
- <span style="padding-right: 2px;">{{_("Please Login!")}}</span>
-{% endif %}
-
- {% endblock %}
- </div>
-
- <a href="/"><img id="head-logo" src="/media/default/img/pyload-logo-edited3.5-new-font-small.png" alt="pyLoad" /></a>
-
- <div id="head-menu">
- <ul>
-
- {% macro selected(name, right=False) -%}
- {% if name in url -%}class="{% if right -%}right {% endif %}selected"{%- endif %}
- {% if not name in url and right -%}class="right"{%- endif %}
- {%- endmacro %}
-
-
- {% block menu %}
- <li>
- <a href="/" title=""><img src="/media/default/img/head-menu-home.png" alt="" /> {{_("Home")}}</a>
- </li>
- <li {{ selected('queue') }}>
- <a href="/queue/" title=""><img src="/media/default/img/head-menu-queue.png" alt="" /> {{_("Queue")}}</a>
- </li>
- <li {{ selected('collector') }}>
- <a href="/collector/" title=""><img src="/media/default/img/head-menu-collector.png" alt="" /> {{_("Collector")}}</a>
- </li>
- <li {{ selected('downloads') }}>
- <a href="/downloads/" title=""><img src="/media/default/img/head-menu-development.png" alt="" /> {{_("Downloads")}}</a>
- </li>
-{# <li {{ selected('filemanager') }}>#}
-{# <a href="/filemanager/" title=""><img src="/media/default/img/head-menu-download.png" alt="" /> {{_("FileManager")}}</a>#}
-{# </li>#}
- <li {{ selected('logs', True) }}>
- <a href="/logs/" class="action index" accesskey="x" rel="nofollow"><img src="/media/default/img/head-menu-index.png" alt="" />{{_("Logs")}}</a>
- </li>
- <li {{ selected('settings', True) }}>
- <a href="/settings/" class="action index" accesskey="x" rel="nofollow"><img src="/media/default/img/head-menu-config.png" alt="" />{{_("Config")}}</a>
- </li>
- {% endblock %}
-
- </ul>
- </div>
-
- <div style="clear:both;"></div>
-</div>
-
-{% if perms.STATUS %}
-<ul id="page-actions2">
- <li id="action_play"><a href="#" class="action play" accesskey="o" rel="nofollow">{{_("Start")}}</a></li>
- <li id="action_stop"><a href="#" class="action stop" accesskey="o" rel="nofollow">{{_("Stop")}}</a></li>
- <li id="action_cancel"><a href="#" class="action cancel" accesskey="o" rel="nofollow">{{_("Cancel")}}</a></li>
- <li id="action_add"><a href="#" class="action add" accesskey="o" rel="nofollow" >{{_("Add")}}</a></li>
-</ul>
-{% endif %}
-
-{% if perms.LIST %}
-<ul id="page-actions">
- <li><span class="time">{{_("Download:")}}</span><a id="time" style=" background-color: {% if status.download %}#8ffc25{% else %} #fc6e26{% endif %}; padding-left: 0cm; padding-right: 0.1cm; "> {% if status.download %}{{_("on")}}{% else %}{{_("off")}}{% endif %}</a></li>
- <li><span class="reconnect">{{_("Reconnect:")}}</span><a id="reconnect" style=" background-color: {% if status.reconnect %}#8ffc25{% else %} #fc6e26{% endif %}; padding-left: 0cm; padding-right: 0.1cm; "> {% if status.reconnect %}{{_("on")}}{% else %}{{_("off")}}{% endif %}</a></li>
- <li><a class="action backlink">{{_("Speed:")}} <b id="speed">{{ status.speed }}</b></a></li>
- <li><a class="action cog">{{_("Active:")}} <b id="aktiv" title="{{_("Active")}}">{{ status.active }}</b> / <b id="aktiv_from" title="{{_("Queued")}}">{{ status.queue }}</b> / <b id="aktiv_total" title="{{_("Total")}}">{{ status.total }}</b></a></li>
- <li><a href="" class="action revisions" accesskey="o" rel="nofollow">{{_("Reload page")}}</a></li>
-</ul>
-{% endif %}
-
-{% block pageactions %}
-{% endblock %}
-<br/>
-
-<div id="body-wrapper" class="dokuwiki">
-
-<div id="content" lang="en" dir="ltr">
-
-<h1>{% block subtitle %}pyLoad - {{_("Webinterface")}}{% endblock %}</h1>
-
-{% block statusbar %}
-{% endblock %}
-
-
-<br/>
-
-<div class="level1" style="clear:both">
-</div>
-<noscript><h1>Enable JavaScript to use the webinterface.</h1></noscript>
-
-{% for message in messages %}
- <b><p>{{message}}</p></b>
-{% endfor %}
-
-<div id="load-indicator" style="opacity: 0; float: right; margin-top: -10px;">
- <img src="/media/default/img/ajax-loader.gif" alt="" style="padding-right: 5px"/>
- {{_("loading")}}
-</div>
-
-{% block content %}
-{% endblock content %}
-
- <hr style="clear: both;" />
-
-<div id="foot">&copy; 2008-2011 pyLoad Team
-<a href="#top" class="action top" accesskey="x"><span>{{_("Back to top")}}</span></a><br />
-<!--<div class="breadcrumbs"></div>-->
-
-</div>
-</div>
-</div>
-
-<div style="display: none;">
- {% include "default/window.html" %}
- {% include "default/captcha.html" %}
- {% block hidden %}
- {% endblock %}
+<div id="wrap">
+ <header>
+ <div class="center">
+ <div class="logo"></div>
+ <span class="title">pyLoad</span>
+
+ {% if user %}
+ <div id="notification_div">
+ No runnings tasks
+ <div class="progress progress-warning progress-striped" id="globalprogress">
+ <div class="bar" style="width: 60%"></div>
+ </div>
+ </div>
+
+ <div class="header_block">
+ <div class="header_icon" id="header_user">
+ <span>{{ user.name }}</span>
+ </div>
+ <div class="header_text">
+ <a href="/logout" id="header_logout">{{ _("Logout") }}</a>
+ </div>
+ </div>
+ <div id="speedgraph"></div>
+ <div class="header_block">
+ <div class="header_icon" id="header_speed">
+ <span class="header_text">500 kb/s</span>
+ </div>
+ <div class="header_icon" id="header_qeuue">
+ <span class="header_text">5 / 125</span>
+ </div>
+ </div>
+ {% endif %}
+ </div>
+ </header>
+ <div id="content">
+ {% for msg in messages %}
+ <p>{{ msg }}</p>
+ {% endfor %}
+
+ {% block content %}
+ {% endblock content %}
+ </div>
</div>
+<footer>
+ <div class="center">
+ <div class="logo"></div>
+ <div class="block copyright">
+ © 2008-2012<br>
+ The pyLoad Team<br>
+ </div>
+
+ <div class="block">
+ <h2 class="block-title">Powered by</h2>
+ asd <br>
+ dsfdsf <br>
+ sdf dsg <br>
+ </div>
+
+ <div class="block">
+ <h2 class="block-title">pyLoad</h2>
+ <a href="/toggle_mobile">{{_("Mobile Version")}}</a> <br>
+ dsfdsf <br>
+ sdf dsg <br>
+ </div>
+
+ <div class="block">
+ <h2 class="block-title">Community</h2>
+ asd <br>
+ dsfdsf <br>
+ sdf dsg <br>
+ </div>
+
+ <div class="block">
+ <h2 class="block-title">Development</h2>
+ asd <br>
+ dsfdsf <br>
+ sdf dsg <br>
+ </div>
+ </div>
+</footer>
+<div id="modal-overlay" class="hide"></div>
+{% block deferred %}
+{% endblock deferred %}
</body>
</html>
diff --git a/module/web/templates/default/captcha.html b/module/web/templates/default/captcha.html
deleted file mode 100644
index 332a9c102..000000000
--- a/module/web/templates/default/captcha.html
+++ /dev/null
@@ -1,42 +0,0 @@
-<!-- Captcha box -->
-<div id="cap_box" class="window_box">
-
- <form id="cap_form" action="/json/set_captcha" method="POST" enctype="multipart/form-data" onsubmit="return false;">
-
- <h1>{{_("Captcha reading")}}</h1>
- <p id="cap_title">{{_("Please read the text on the captcha.")}}</p>
-
- <div id="cap_textual">
-
- <input id="cap_id" name="cap_id" type="hidden" value="" />
-
- <label>{{_("Captcha")}}
- <span class="small">{{_("The captcha.")}}</span>
- </label>
- <span class="cont">
- <img id="cap_textual_img" src="">
- </span>
-
- <label>{{_("Text")}}
- <span class="small">{{_("Input the text on the captcha.")}}</span>
- </label>
- <input id="cap_result" name="cap_result" type="text" size="20" />
-
- </div>
-
- <div id="cap_positional" style="text-align: center">
- <img id="cap_positional_img" src="" style="margin: 10px; cursor:pointer">
- </div>
-
- <div id="button_bar" style="text-align: center">
- <span>
- <button id="cap_submit" type="submit" style="margin-left: 0">{{_("Submit")}}</button>
- <button id="cap_reset" type="reset" style="margin-left: 0">{{_("Close")}}</button>
- </span>
- </div>
-
- <div class="spacer"></div>
-
- </form>
-
-</div> \ No newline at end of file
diff --git a/module/web/templates/default/dashboard.html b/module/web/templates/default/dashboard.html
new file mode 100644
index 000000000..05f5b85a3
--- /dev/null
+++ b/module/web/templates/default/dashboard.html
@@ -0,0 +1,65 @@
+{% extends 'default/base.html' %}
+{% block title %}
+ {{_("Dashboard")}} - {{ super()}}
+{% endblock %}
+
+{% block require %}
+ App.initPackageTree();
+{% endblock %}
+
+{% block content %}
+ <ul id="dash-nav" class="nav nav-pills">
+ <li>
+ <ul class="breadcrumb">
+ <li><a href="#">Home</a> <span class="divider">/</span></li>
+ <li><a href="#">Library</a> <span class="divider">/</span></li>
+ <li class="active">Data</li>
+ </ul>
+ </li>
+
+ <li style="float: right;">
+ <form class="form-search">
+ <div class="input-append">
+ <input type="text" class="span2 search-query">
+ <button type="submit" class="btn">{{ _("Search") }}</button>
+ </div>
+ </form>
+ </li>
+ <li class="dropdown" style="float: right;">
+ <a class="dropdown-toggle"
+ data-toggle="dropdown"
+ href="#">
+ Type
+ <b class="caret"></b>
+ </a>
+ <ul class="dropdown-menu">
+ <li><a>Audio</a></li>
+ <li><a>Video</a></li>
+ <li><a>Archive</a></li>
+ </ul>
+ </li>
+ <li class="dropdown" style="float: right;">
+ <a class="dropdown-toggle"
+ data-toggle="dropdown"
+ href="#">
+ More
+ <b class="caret"></b>
+ </a>
+ <ul class="dropdown-menu">
+ <li><a>Active</a></li>
+ <li><a>Failed</a></li>
+ </ul>
+ </li>
+
+ <li style="float: right;">
+ <a>Failed</a>
+ </li>
+ <li style="float: right;">
+ <a>Unfinished</a>
+ </li>
+ <li class="active" style="float: right;">
+ <a>All</a>
+ </li>
+
+ </ul>
+{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/downloads.html b/module/web/templates/default/downloads.html
deleted file mode 100644
index 450b8a102..000000000
--- a/module/web/templates/default/downloads.html
+++ /dev/null
@@ -1,29 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block title %}Downloads - {{super()}} {% endblock %}
-
-{% block subtitle %}
-{{_("Downloads")}}
-{% endblock %}
-
-{% block content %}
-
-<ul>
- {% for folder in files.folder %}
- <li>
- {{ folder.name }}
- <ul>
- {% for file in folder.files %}
- <li><a href='get/{{ folder.path|escape }}/{{ file|escape }}'>{{file}}</a></li>
- {% endfor %}
- </ul>
- </li>
- {% endfor %}
-
- {% for file in files.files %}
- <li> <a href='get/{{ file|escape }}'>{{ file }}</a></li>
- {% endfor %}
-
-</ul>
-
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/filemanager.html b/module/web/templates/default/filemanager.html
deleted file mode 100644
index 97095c13e..000000000
--- a/module/web/templates/default/filemanager.html
+++ /dev/null
@@ -1,80 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block head %}
-
-<script type="text/javascript" src="/filemanager_ui.js"></script>
-
-<script type="text/javascript">
-
-document.addEvent("domready", function(){
- var fmUI = new FilemanagerUI("url",1);
-});
-</script>
-{% endblock %}
-
-{% block title %}Downloads - {{super()}} {% endblock %}
-
-
-{% block subtitle %}
-{{_("FileManager")}}
-{% endblock %}
-
-{% macro display_file(file) %}
- <li class="file">
- <input type="hidden" name="path" class="path" value="{{ file.path }}" />
- <input type="hidden" name="name" class="name" value="{{ file.name }}" />
- <span>
- <b>{{ file.name }}</b>
- <span class="buttons" style="opacity:0">
- <img title="{{_("Rename Directory")}}" class="rename" style="cursor: pointer" height="12px" src="/media/default/img/pencil.png" />
- &nbsp;&nbsp;
- <img title="{{_("Delete Directory")}}" class="delete" style="margin-left: -10px; cursor: pointer" width="12px" height="12px" src="/media/default/img/delete.png" />
- </span>
- </span>
- </li>
-{%- endmacro %}
-
-{% macro display_folder(fld, open = false) -%}
- <li class="folder">
- <input type="hidden" name="path" class="path" value="{{ fld.path }}" />
- <input type="hidden" name="name" class="name" value="{{ fld.name }}" />
- <span>
- <b>{{ fld.name }}</b>
- <span class="buttons" style="opacity:0">
- <img title="{{_("Rename Directory")}}" class="rename" style="cursor: pointer" height="12px" src="/media/default/img/pencil.png" />
- &nbsp;&nbsp;
- <img title="{{_("Delete Directory")}}" class="delete" style="margin-left: -10px; cursor: pointer" width="12px" height="12px" src="/media/default/img/delete.png" />
- &nbsp;&nbsp;
- <img title="{{_("Add subdirectory")}}" class="mkdir" style="margin-left: -10px; cursor: pointer" width="12px" height="12px" src="/media/default/img/add_folder.png" />
- </span>
- </span>
- {% if (fld.folders|length + fld.files|length) > 0 %}
- {% if open %}
- <ul>
- {% else %}
- <ul style="display:none">
- {% endif %}
- {% for child in fld.folders %}
- {{ display_folder(child) }}
- {% endfor %}
- {% for child in fld.files %}
- {{ display_file(child) }}
- {% endfor %}
- </ul>
- {% else %}
- <div style="display:none">{{ _("Folder is empty") }}</div>
- {% endif %}
- </li>
-{%- endmacro %}
-
-{% block content %}
-
-<div style="clear:both"><!-- --></div>
-
-<ul id="directories-list">
-{{ display_folder(root, true) }}
-</ul>
-
-{% include "default/rename_directory.html" %}
-
-{% endblock %}
diff --git a/module/web/templates/default/filemanager_ui.js b/module/web/templates/default/filemanager_ui.js
deleted file mode 100644
index ed64ab69d..000000000
--- a/module/web/templates/default/filemanager_ui.js
+++ /dev/null
@@ -1,291 +0,0 @@
-var load, rename_box, confirm_box;
-
-document.addEvent("domready", function() {
- load = new Fx.Tween($("load-indicator"), {link: "cancel"});
- load.set("opacity", 0);
-
- rename_box = new Fx.Tween($('rename_box'));
- confirm_box = new Fx.Tween($('confirm_box'));
- $('rename_reset').addEvent('click', function() {
- hide_rename_box()
- });
- $('delete_reset').addEvent('click', function() {
- hide_confirm_box()
- });
-
- /*$('filemanager_actions_list').getChildren("li").each(function(action) {
- var action_name = action.className;
- if(functions[action.className] != undefined)
- {
- action.addEvent('click', functions[action.className]);
- }
- });*/
-});
-
-function indicateLoad() {
- //$("load-indicator").reveal();
- load.start("opacity", 1)
-}
-
-function indicateFinish() {
- load.start("opacity", 0)
-}
-
-function indicateSuccess() {
- indicateFinish();
- notify.alert('{{_("Success")}}.', {
- 'className': 'success'
- });
-}
-
-function indicateFail() {
- indicateFinish();
- notify.alert('{{_("Failed")}}.', {
- 'className': 'error'
- });
-}
-
-function show_rename_box() {
- bg_show();
- $("rename_box").setStyle('display', 'block');
- rename_box.start('opacity', 1)
-}
-
-function hide_rename_box() {
- bg_hide();
- rename_box.start('opacity', 0).chain(function() {
- $('rename_box').setStyle('display', 'none');
- });
-}
-
-function show_confirm_box() {
- bg_show();
- $("confirm_box").setStyle('display', 'block');
- confirm_box.start('opacity', 1)
-}
-
-function hide_confirm_box() {
- bg_hide();
- confirm_box.start('opacity', 0).chain(function() {
- $('confirm_box').setStyle('display', 'none');
- });
-}
-
-var FilemanagerUI = new Class({
- initialize: function(url, type) {
- this.url = url;
- this.type = type;
- this.directories = [];
- this.files = [];
- this.parseChildren();
- },
-
- parseChildren: function() {
- $("directories-list").getChildren("li.folder").each(function(ele) {
- var path = ele.getElements("input.path")[0].get("value");
- var name = ele.getElements("input.name")[0].get("value");
- this.directories.push(new Item(this, path, name, ele))
- }.bind(this));
-
- $("directories-list").getChildren("li.file").each(function(ele) {
- var path = ele.getElements("input.path")[0].get("value");
- var name = ele.getElements("input.name")[0].get("value");
- this.files.push(new Item(this, path, name, ele))
- }.bind(this));
- }
-});
-
-var Item = new Class({
- initialize: function(ui, path, name, ele) {
- this.ui = ui;
- this.path = path;
- this.name = name;
- this.ele = ele;
- this.directories = [];
- this.files = [];
- this.actions = new Array();
- this.actions["delete"] = this.del;
- this.actions["rename"] = this.rename;
- this.actions["mkdir"] = this.mkdir;
- this.parseElement();
-
- var pname = this.ele.getElements("span")[0];
- this.buttons = new Fx.Tween(this.ele.getElements(".buttons")[0], {link: "cancel"});
- this.buttons.set("opacity", 0);
-
- pname.addEvent("mouseenter", function(e) {
- this.buttons.start("opacity", 1)
- }.bind(this));
-
- pname.addEvent("mouseleave", function(e) {
- this.buttons.start("opacity", 0)
- }.bind(this));
-
- },
-
- parseElement: function() {
- this.ele.getChildren('span span.buttons img').each(function(img) {
- img.addEvent('click', this.actions[img.className].bind(this));
- }, this);
-
- //click on the directory name must open the directory itself
- this.ele.getElements('b')[0].addEvent('click', this.toggle.bind(this));
-
- //iterate over child directories
- var uls = this.ele.getElements('ul');
- if(uls.length > 0)
- {
- uls[0].getChildren("li.folder").each(function(fld) {
- var path = fld.getElements("input.path")[0].get("value");
- var name = fld.getElements("input.name")[0].get("value");
- this.directories.push(new Item(this, path, name, fld));
- }.bind(this));
- uls[0].getChildren("li.file").each(function(fld) {
- var path = fld.getElements("input.path")[0].get("value");
- var name = fld.getElements("input.name")[0].get("value");
- this.files.push(new Item(this, path, name, fld));
- }.bind(this));
- }
- },
-
- reorderElements: function() {
- //TODO sort the main ul again (to keep data ordered after renaming something)
- },
-
- del: function(event) {
- $("confirm_form").removeEvents("submit");
- $("confirm_form").addEvent("submit", this.deleteDirectory.bind(this));
-
- $$("#confirm_form p").set('html', '{{_(("Are you sure you want to delete the selected item?"))}}');
-
- show_confirm_box();
- event.stop();
- },
-
- deleteDirectory: function(event) {
- hide_confirm_box();
- new Request.JSON({
- method: 'POST',
- url: "/json/filemanager/delete",
- data: {"path": this.path, "name": this.name},
- onSuccess: function(data) {
- if(data.response == "success")
- {
- new Fx.Tween(this.ele).start('opacity', 0);
- var ul = this.ele.parentNode;
- this.ele.dispose();
- //if this was the only child, add a "empty folder" div
- if(!ul.getChildren('li')[0])
- {
- var div = new Element("div", { 'html': '{{ _("Folder is empty") }}' });
- div.replaces(ul);
- }
-
- indicateSuccess();
- } else
- {
- //error from json code...
- indicateFail();
- }
- }.bind(this),
- onFailure: indicateFail
- }).send();
-
- event.stop();
- },
-
- rename: function(event) {
- $("rename_form").removeEvents("submit");
- $("rename_form").addEvent("submit", this.renameDirectory.bind(this));
-
- $("path").set("value", this.path);
- $("old_name").set("value", this.name);
- $("new_name").set("value", this.name);
-
- show_rename_box();
- event.stop();
- },
-
- renameDirectory: function(event) {
- hide_rename_box();
- new Request.JSON({
- method: 'POST',
- url: "/json/filemanager/rename",
- onSuccess: function(data) {
- if(data.response == "success")
- {
- this.name = $("new_name").get("value");
- this.ele.getElements("b")[0].set('html', $("new_name").get("value"));
- this.reorderElements();
- indicateSuccess();
- } else
- {
- //error from json code...
- indicateFail();
- }
- }.bind(this),
- onFailure: indicateFail
- }).send($("rename_form").toQueryString());
-
- event.stop();
- },
-
- mkdir: function(event) {
- new Request.JSON({
- method: 'POST',
- url: "/json/filemanager/mkdir",
- data: {"path": this.path + "/" + this.name, "name": '{{_("New folder")}}'},
- onSuccess: function(data) {
- if(data.response == "success")
- {
- new Request.HTML({
- method: 'POST',
- url: "/filemanager/get_dir",
- data: {"path": data.path, "name": data.name},
- onSuccess: function(li) {
- //add node as first child of ul
- var ul = this.ele.getChildren('ul')[0];
- if(!ul)
- {
- //remove the "Folder Empty" div
- this.ele.getChildren('div').dispose();
-
- //create new ul to contain subfolder
- ul = new Element("ul");
- ul.inject(this.ele, 'bottom');
- }
- li[0].inject(ul, 'top');
-
- //add directory as a subdirectory of the current item
- this.directories.push(new Item(this.ui, data.path, data.name, ul.firstChild));
- }.bind(this),
- onFailure: indicateFail
- }).send();
- indicateSuccess();
- } else
- {
- //error from json code...
- indicateFail();
- }
- }.bind(this),
- onFailure: indicateFail
- }).send();
-
- event.stop();
- },
-
- toggle: function() {
- var child = this.ele.getElement('ul');
- if(child == null)
- child = this.ele.getElement('div');
-
- if(child != null)
- {
- if (child.getStyle('display') == "block") {
- child.dissolve();
- } else {
- child.reveal();
- }
- }
- }
-});
diff --git a/module/web/templates/default/folder.html b/module/web/templates/default/folder.html
deleted file mode 100644
index b385e80cb..000000000
--- a/module/web/templates/default/folder.html
+++ /dev/null
@@ -1,15 +0,0 @@
-<li class="folder">
- <input type="hidden" name="path" class="path" value="{{ path }}" />
- <input type="hidden" name="name" class="name" value="{{ name }}" />
- <span>
- <b>{{ name }}</b>
- <span class="buttons" style="opacity:0">
- <img title="{{_("Rename Directory")}}" class="rename" style="cursor: pointer" height="12px" src="/media/default/img/pencil.png" />
- &nbsp;&nbsp;
- <img title="{{_("Delete Directory")}}" class="delete" style="margin-left: -10px; cursor: pointer" width="12px" height="12px" src="/media/default/img/delete.png" />
- &nbsp;&nbsp;
- <img title="{{_("Add subdirectory")}}" class="mkdir" style="margin-left: -10px; cursor: pointer" width="12px" height="12px" src="/media/default/img/add_folder.png" />
- </span>
- </span>
- <div style="display:none">{{ _("Folder is empty") }}</div>
-</li> \ No newline at end of file
diff --git a/module/web/templates/default/home.html b/module/web/templates/default/home.html
deleted file mode 100644
index 0efb1bcf8..000000000
--- a/module/web/templates/default/home.html
+++ /dev/null
@@ -1,266 +0,0 @@
-{% extends 'default/base.html' %}
-{% block head %}
-
-<script type="text/javascript">
-
-var em;
-var operafix = (navigator.userAgent.toLowerCase().search("opera") >= 0);
-
-document.addEvent("domready", function(){
- em = new EntryManager();
-});
-
-var EntryManager = new Class({
- initialize: function(){
- this.json = new Request.JSON({
- url: "json/links",
- secure: false,
- async: true,
- onSuccess: this.update.bind(this),
- initialDelay: 0,
- delay: 2500,
- limit: 30000
- });
-
- this.ids = [{% for link in content %}
- {% if forloop.last %}
- {{ link.id }}
- {% else %}
- {{ link.id }},
- {% endif %}
- {% endfor %}];
-
- this.entries = [];
- this.container = $('LinksAktiv');
-
- this.parseFromContent();
-
- this.json.startTimer();
- },
- parseFromContent: function(){
- this.ids.each(function(id,index){
- var entry = new LinkEntry(id);
- entry.parse();
- this.entries.push(entry)
- }, this);
- },
- update: function(data){
-
- try{
- this.ids = this.entries.map(function(item){
- return item.fid
- });
-
- this.ids.filter(function(id){
- return !this.ids.contains(id)
- },data).each(function(id){
- var index = this.ids.indexOf(id);
- this.entries[index].remove();
- this.entries = this.entries.filter(function(item){return item.fid != this},id);
- this.ids = this.ids.erase(id)
- }, this);
-
- data.links.each(function(link, i){
- if (this.ids.contains(link.fid)){
-
- var index = this.ids.indexOf(link.fid);
- this.entries[index].update(link)
-
- }else{
- var entry = new LinkEntry(link.fid);
- entry.insert(link);
- this.entries.push(entry);
- this.ids.push(link.fid);
- this.container.adopt(entry.elements.tr,entry.elements.pgbTr);
- entry.fade.start('opacity', 1);
- entry.fadeBar.start('opacity', 1);
-
- }
- }, this)
- }catch(e){
- //alert(e)
- }
- }
-});
-
-
-var LinkEntry = new Class({
- initialize: function(id){
- this.fid = id;
- this.id = id;
- },
- parse: function(){
- this.elements = {
- tr: $("link_{id}".substitute({id: this.id})),
- name: $("link_{id}_name".substitute({id: this.id})),
- status: $("link_{id}_status".substitute({id: this.id})),
- info: $("link_{id}_info".substitute({id: this.id})),
- bleft: $("link_{id}_bleft".substitute({id: this.id})),
- percent: $("link_{id}_percent".substitute({id: this.id})),
- remove: $("link_{id}_remove".substitute({id: this.id})),
- pgbTr: $("link_{id}_pgb_tr".substitute({id: this.id})),
- pgb: $("link_{id}_pgb".substitute({id: this.id}))
- };
- this.initEffects();
- },
- insert: function(item){
- try{
-
- this.elements = {
- tr: new Element('tr', {
- 'html': '',
- 'styles':{
- 'opacity': 0
- }
- }),
- name: new Element('td', {
- 'html': item.name
- }),
- status: new Element('td', {
- 'html': item.statusmsg
- }),
- info: new Element('td', {
- 'html': item.info
- }),
- bleft: new Element('td', {
- 'html': humanFileSize(item.size)
- }),
- percent: new Element('span', {
- 'html': item.percent+ '% / '+ humanFileSize(item.size-item.bleft)
- }),
- remove: new Element('img',{
- 'src': 'media/default/img/control_cancel.png',
- 'styles':{
- 'vertical-align': 'middle',
- 'margin-right': '-20px',
- 'margin-left': '5px',
- 'margin-top': '-2px',
- 'cursor': 'pointer'
- }
- }),
- pgbTr: new Element('tr', {
- 'html':''
- }),
- pgb: new Element('div', {
- 'html': '&nbsp;',
- 'styles':{
- 'height': '4px',
- 'width': item.percent+'%',
- 'background-color': '#ddd'
- }
- })
- };
-
- this.elements.tr.adopt(this.elements.name,this.elements.status,this.elements.info,this.elements.bleft,new Element('td').adopt(this.elements.percent,this.elements.remove));
- this.elements.pgbTr.adopt(new Element('td',{'colspan':5}).adopt(this.elements.pgb));
- this.initEffects();
- }catch(e){
- alert(e)
- }
- },
- initEffects: function(){
- if(!operafix)
- this.bar = new Fx.Morph(this.elements.pgb, {unit: '%', duration: 5000, link: 'link', fps:30});
- this.fade = new Fx.Tween(this.elements.tr);
- this.fadeBar = new Fx.Tween(this.elements.pgbTr);
-
- this.elements.remove.addEvent('click', function(){
- new Request({method: 'get', url: '/json/abort_link/'+this.id}).send();
- }.bind(this));
-
- },
- update: function(item){
- this.elements.name.set('text', item.name);
- this.elements.status.set('text', item.statusmsg);
- this.elements.info.set('text', item.info);
- this.elements.bleft.set('text', item.format_size);
- this.elements.percent.set('text', item.percent+ '% / '+ humanFileSize(item.size-item.bleft));
- if(!operafix)
- {
- this.bar.start({
- 'width': item.percent,
- 'background-color': [Math.round(120/100*item.percent),100,100].hsbToRgb().rgbToHex()
- });
- }
- else
- {
- this.elements.pgb.set(
- 'styles', {
- 'height': '4px',
- 'width': item.percent+'%',
- 'background-color': [Math.round(120/100*item.percent),100,100].hsbToRgb().rgbToHex(),
- });
- }
- },
- remove: function(){
- this.fade.start('opacity',0).chain(function(){this.elements.tr.dispose();}.bind(this));
- this.fadeBar.start('opacity',0).chain(function(){this.elements.pgbTr.dispose();}.bind(this));
-
- }
- });
-</script>
-
-{% endblock %}
-
-{% block subtitle %}
-{{_("Active Downloads")}}
-{% endblock %}
-
-{% block menu %}
-<li class="selected">
- <a href="/" title=""><img src="/media/default/img/head-menu-home.png" alt="" /> {{_("Home")}}</a>
-</li>
-<li>
- <a href="/queue/" title=""><img src="/media/default/img/head-menu-queue.png" alt="" /> {{_("Queue")}}</a>
-</li>
-<li>
- <a href="/collector/" title=""><img src="/media/default/img/head-menu-collector.png" alt="" /> {{_("Collector")}}</a>
-</li>
-<li>
- <a href="/downloads/" title=""><img src="/media/default/img/head-menu-development.png" alt="" /> {{_("Downloads")}}</a>
-</li>
-{#<li>#}
-{# <a href="/filemanager/" title=""><img src="/media/default/img/head-menu-download.png" alt="" /> {{_("FileManager")}}</a>#}
-{#</li>#}
-<li class="right">
- <a href="/logs/" class="action index" accesskey="x" rel="nofollow"><img src="/media/default/img/head-menu-index.png" alt="" />{{_("Logs")}}</a>
-</li>
-<li class="right">
- <a href="/settings/" class="action index" accesskey="x" rel="nofollow"><img src="/media/default/img/head-menu-config.png" alt="" />{{_("Config")}}</a>
-</li>
-{% endblock %}
-
-{% block content %}
-<table width="100%" class="queue">
- <thead>
- <tr class="header">
- <th>{{_("Name")}}</th>
- <th>{{_("Status")}}</th>
- <th>{{_("Information")}}</th>
- <th>{{_("Size")}}</th>
- <th>{{_("Progress")}}</th>
- </tr>
- </thead>
- <tbody id="LinksAktiv">
-
- {% for link in content %}
- <tr id="link_{{ link.id }}">
- <td id="link_{{ link.id }}_name">{{ link.name }}</td>
- <td id="link_{{ link.id }}_status">{{ link.status }}</td>
- <td id="link_{{ link.id }}_info">{{ link.info }}</td>
- <td id="link_{{ link.id }}_bleft">{{ link.format_size }}</td>
- <td>
- <span id="link_{{ link.id }}_percent">{{ link.percent }}% /{{ link.bleft }}</span>
- <img id="link_{{ link.id }}_remove" style="vertical-align: middle; margin-right: -20px; margin-left: 5px; margin-top: -2px; cursor:pointer;" src="media/default/img/control_cancel.png"/>
- </td>
- </tr>
- <tr id="link_{{ link.id }}_pgb_tr">
- <td colspan="5">
- <div id="link_{{ link.id }}_pgb" class="progressBar" style="background-color: green; height:4px; width: {{ link.percent }}%;">&nbsp;</div>
- </td>
- </tr>
- {% endfor %}
-
- </tbody>
-</table>
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/info.html b/module/web/templates/default/info.html
deleted file mode 100644
index 77ae57376..000000000
--- a/module/web/templates/default/info.html
+++ /dev/null
@@ -1,81 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block head %}
- <script type="text/javascript">
- window.addEvent("domready", function() {
- var ul = new Element('ul#twitter_update_list');
- var script1 = new Element('script[src=http://twitter.com/javascripts/blogger.js][type=text/javascript]');
- var script2 = new Element('script[src=http://twitter.com/statuses/user_timeline/pyLoad.json?callback=twitterCallback2&count=6][type=text/javascript]');
- $("twitter").adopt(ul, script1, script2);
- });
- </script>
-{% endblock %}
-
-{% block title %}{{ _("Information") }} - {{ super() }} {% endblock %}
-{% block subtitle %}{{ _("Information") }}{% endblock %}
-
-{% block content %}
- <h3>{{ _("News") }}</h3>
- <div id="twitter"></div>
-
- <h3>{{ _("Support") }}</h3>
-
- <ul>
- <li style="font-weight:bold;">
- <a href="http://pyload.org/wiki" target="_blank">Wiki</a>
- &nbsp;&nbsp;|&nbsp;&nbsp;
- <a href="http://forum.pyload.org/" target="_blank">Forum</a>
- &nbsp;&nbsp;|&nbsp;&nbsp;
- <a href="http://pyload.org/irc/" target="_blank">Chat</a>
- </li>
- <li style="font-weight:bold;"><a href="http://docs.pyload.org" target="_blank">Documentation</a></li>
- <li style="font-weight:bold;"><a href="https://bitbucket.org/spoob/pyload/overview" target="_blank">Development</a></li>
- <li style="font-weight:bold;"><a href="https://bitbucket.org/spoob/pyload/issues?status=new&status=open" target="_blank">Issue Tracker</a></li>
-
- </ul>
-
- <h3>{{ _("System") }}</h3>
- <table class="system">
- <tr>
- <td>{{ _("Python:") }}</td>
- <td>{{ python }}</td>
- </tr>
- <tr>
- <td>{{ _("OS:") }}</td>
- <td>{{ os }}</td>
- </tr>
- <tr>
- <td>{{ _("pyLoad version:") }}</td>
- <td>{{ version }}</td>
- </tr>
- <tr>
- <td>{{ _("Installation Folder:") }}</td>
- <td>{{ folder }}</td>
- </tr>
- <tr>
- <td>{{ _("Config Folder:") }}</td>
- <td>{{ config }}</td>
- </tr>
- <tr>
- <td>{{ _("Download Folder:") }}</td>
- <td>{{ download }}</td>
- </tr>
- <tr>
- <td>{{ _("Free Space:") }}</td>
- <td>{{ freespace }}</td>
- </tr>
- <tr>
- <td>{{ _("Language:") }}</td>
- <td>{{ language }}</td>
- </tr>
- <tr>
- <td>{{ _("Webinterface Port:") }}</td>
- <td>{{ webif }}</td>
- </tr>
- <tr>
- <td>{{ _("Remote Interface Port:") }}</td>
- <td>{{ remote }}</td>
- </tr>
- </table>
-
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/login.html b/module/web/templates/default/login.html
index 9e91ad309..c8cd78a33 100644
--- a/module/web/templates/default/login.html
+++ b/module/web/templates/default/login.html
@@ -1,36 +1,43 @@
{% extends 'default/base.html' %}
-
{% block title %}{{_("Login")}} - {{super()}} {% endblock %}
-
{% block content %}
-
-<div class="centeralign">
-<form action="" method="post" accept-charset="utf-8" id="login">
- <div class="no">
- <input type="hidden" name="do" value="login" />
- <fieldset>
+<br>
+{% if logout %}
+<div id="logged_out">
+ <b>{{_("You were successfully logged out.")}}</b>
+</div>
+{% endif %}
+<br>
+<div class="login">
+ <form action="/login" method="post" class="form-horizontal">
<legend>Login</legend>
- <label>
- <span>{{_("Username")}}</span>
- <input type="text" size="20" name="username" />
- </label>
- <br />
- <label>
- <span>{{_("Password")}}</span>
- <input type="password" size="20" name="password" />
- </label>
- <br />
- <input type="submit" value="Login" class="button" />
- </fieldset>
- </div>
-</form>
-
+ <div class="control-group">
+ <label class="control-label" for="inputEmail">Username</label>
+ <div class="controls">
+ <input type="text" id="inputEmail" placeholder="Username" name="username">
+ </div>
+ </div>
+ <div class="control-group">
+ <label class="control-label" for="inputPassword">Password</label>
+ <div class="controls">
+ <input type="password" id="inputPassword" placeholder="Password" name="password">
+ </div>
+ </div>
+ <div class="control-group">
+ <div class="controls">
+ <label class="checkbox">
+ <input type="checkbox"> Remember me
+ </label>
+ <button type="submit" class="btn">Login</button>
+ </div>
+ </div>
+ </form>
+</div>
+<br>
+<div style="text-align: center">
{% if errors %}
<p>{{_("Your username and password didn't match. Please try again.")}}</p>
{{ _("To reset your login data or add an user run:") }} <b> python pyLoadCore.py -u</b>
{% endif %}
-
</div>
-<br>
-
-{% endblock %}
+{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/logout.html b/module/web/templates/default/logout.html
deleted file mode 100644
index d3f07472b..000000000
--- a/module/web/templates/default/logout.html
+++ /dev/null
@@ -1,9 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block head %}
-<meta http-equiv="refresh" content="3; url=/">
-{% endblock %}
-
-{% block content %}
-<p><b>{{_("You were successfully logged out.")}}</b></p>
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/logs.html b/module/web/templates/default/logs.html
deleted file mode 100644
index d6288df0e..000000000
--- a/module/web/templates/default/logs.html
+++ /dev/null
@@ -1,41 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block title %}{{_("Logs")}} - {{super()}} {% endblock %}
-{% block subtitle %}{{_("Logs")}}{% endblock %}
-{% block head %}
-<link rel="stylesheet" type="text/css" href="/media/default/css/log.css"/>
-{% endblock %}
-
-{% block content %}
-<div style="clear: both;"></div>
-
-<div class="logpaginator"><a href="{{ "/logs/1" }}">&lt;&lt; {{_("Start")}}</a> <a href="{{ "/logs/" + iprev|string }}">&lt; {{_("prev")}}</a> <a href="{{ "/logs/" + inext|string }}">{{_("next")}} &gt;</a> <a href="/logs/">{{_("End")}} &gt;&gt;</a></div>
-<div class="logperpage">
- <form id="logform1" action="" method="POST">
- <label for="reversed">Reversed:</label>
- <input type="checkbox" name="reversed" onchange="this.form.submit();" {% if reversed %} checked="checked" {% endif %} />&nbsp;
- <label for="perpage">Lines per page:</label>
- <select name="perpage" onchange="this.form.submit();">
- {% for value in perpage_p %}
- <option value="{{value.0}}"{% if value.0 == perpage %} selected="selected" {% endif %}>{{value.1}}</option>
- {% endfor %}
- </select>
- </form>
-</div>
-<div class="logwarn">{{warning}}</div>
-<div style="clear: both;"></div>
-<div class="logdiv">
- <table class="logtable" cellpadding="0" cellspacing="0">
- {% for line in log %}
- <tr><td class="logline">{{line.line}}</td><td>{{line.date}}</td><td class="loglevel">{{line.level}}</td><td>{{line.message}}</td></tr>
- {% endfor %}
- </table>
-</div>
-<div class="logform">
-<form id="logform2" action="" method="POST">
- <label for="from">Jump to time:</label><input type="text" name="from" size="15" value="{{from}}"/>
- <input type="submit" value="ok" />
-</form>
-</div>
-<div style="clear: both; height: 10px;">&nbsp; </div>
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/pathchooser.html b/module/web/templates/default/pathchooser.html
deleted file mode 100644
index d00637055..000000000
--- a/module/web/templates/default/pathchooser.html
+++ /dev/null
@@ -1,76 +0,0 @@
-<html>
-<head>
- <script class="javascript">
- function chosen()
- {
- opener.ifield.value = document.forms[0].p.value;
- close();
- }
- function exit()
- {
- close();
- }
- function setInvalid() {
- document.forms[0].send.disabled = 'disabled';
- document.forms[0].p.style.color = '#FF0000';
- }
- function setValid() {
- document.forms[0].send.disabled = '';
- document.forms[0].p.style.color = '#000000';
- }
- function setFile(file)
- {
- document.forms[0].p.value = file;
- setValid();
-
- }
- </script>
- <link rel="stylesheet" type="text/css" href="/media/default/css/pathchooser.css"/>
-</head>
-<body{% if type == 'file' %}{% if not oldfile %} onload="setInvalid();"{% endif %}{% endif %}>
-<center>
- <div id="paths">
- <form method="get" action="?" onSubmit="chosen();" onReset="exit();">
- <input type="text" name="p" value="{{ oldfile|default(cwd) }}" size="60" onfocus="setValid();">
- <input type="submit" value="Ok" name="send">
- </form>
-
- {% if type == 'folder' %}
- <span class="path_abs_rel">{{_("Path")}}: <a href="{{ "/pathchooser" + cwd|path_make_absolute|quotepath }}"{% if absolute %} style="text-decoration: underline;"{% endif %}>{{_("absolute")}}</a> | <a href="{{ "/pathchooser/" + cwd|path_make_relative|quotepath }}"{% if not absolute %} style="text-decoration: underline;"{% endif %}>{{_("relative")}}</a></span>
- {% else %}
- <span class="path_abs_rel">{{_("Path")}}: <a href="{{ "/filechooser/" + cwd|path_make_absolute|quotepath }}"{% if absolute %} style="text-decoration: underline;"{% endif %}>{{_("absolute")}}</a> | <a href="{{ "/filechooser/" + cwd|path_make_relative|quotepath }}"{% if not absolute %} style="text-decoration: underline;"{% endif %}>{{_("relative")}}</a></span>
- {% endif %}
- </div>
- <table border="0" cellspacing="0" cellpadding="3">
- <tr>
- <th>{{_("name")}}</th>
- <th>{{_("size")}}</th>
- <th>{{_("type")}}</th>
- <th>{{_("last modified")}}</th>
- </tr>
- {% if parentdir %}
- <tr>
- <td colspan="4">
- <a href="{% if type == 'folder' %}{{ "/pathchooser/" + parentdir|quotepath }}{% else %}{{ "/filechooser/" + parentdir|quotepath }}{% endif %}"><span class="parentdir">{{_("parent directory")}}</span></a>
- </td>
- </tr>
- {% endif %}
-{% for file in files %}
- <tr>
- {% if type == 'folder' %}
- <td class="name">{% if file.type == 'dir' %}<a href="{{ "/pathchooser/" + file.fullpath|quotepath }}" title="{{ file.fullpath }}"><span class="path_directory">{{ file.name|truncate(25) }}</span></a>{% else %}<span class="path_file" title="{{ file.fullpath }}">{{ file.name|truncate(25) }}{% endif %}</span></td>
- {% else %}
- <td class="name">{% if file.type == 'dir' %}<a href="{{ "/filechooser/" + file.fullpath|quotepath }}" title="{{ file.fullpath }}"><span class="file_directory">{{ file.name|truncate(25) }}</span></a>{% else %}<a href="#" onclick="setFile('{{ file.fullpath }}');" title="{{ file.fullpath }}"><span class="file_file">{{ file.name|truncate(25) }}{% endif %}</span></a></td>
- {% endif %}
- <td class="size">{{ file.size|float|filesizeformat }}</td>
- <td class="type">{% if file.type == 'dir' %}directory{% else %}{{ file.ext|default("file") }}{% endif %}</td>
- <td class="mtime">{{ file.modified|date("d.m.Y - H:i:s") }}</td>
- <tr>
-<!-- <tr>
- <td colspan="4">{{_("no content")}}</td>
- </tr> -->
-{% endfor %}
- </table>
- </center>
-</body>
-</html> \ No newline at end of file
diff --git a/module/web/templates/default/queue.html b/module/web/templates/default/queue.html
deleted file mode 100644
index c88fa3568..000000000
--- a/module/web/templates/default/queue.html
+++ /dev/null
@@ -1,104 +0,0 @@
-{% extends 'default/base.html' %}
-{% block head %}
-
-<script type="text/javascript" src="/media/js/package_ui.js"></script>
-
-<script type="text/javascript">
-
-document.addEvent("domready", function(){
- var pUI = new PackageUI("url", {{ target }});
-});
-</script>
-{% endblock %}
-
-{% if target %}
- {% set name = _("Queue") %}
-{% else %}
- {% set name = _("Collector") %}
-{% endif %}
-
-{% block title %}{{name}} - {{super()}} {% endblock %}
-{% block subtitle %}{{name}}{% endblock %}
-
-{% block pageactions %}
-<ul id="page-actions-more">
- <li id="del_finished"><a style="padding: 0; font-weight: bold;" href="#">{{_("Delete Finished")}}</a></li>
- <li id="restart_failed"><a style="padding: 0; font-weight: bold;" href="#">{{_("Restart Failed")}}</a></li>
-</ul>
-{% endblock %}
-
-{% block content %}
-{% autoescape true %}
-
-<ul id="package-list" style="list-style: none; padding-left: 0; margin-top: -10px;">
-{% for package in content %}
- <li>
-<div id="package_{{package.pid}}" class="package">
- <div class="order" style="display: none;">{{ package.order }}</div>
-
- <div class="packagename" style="cursor: pointer">
- <img class="package_drag" src="/media/default/img/folder.png" style="cursor: move; margin-bottom: -2px">
- <span class="name">{{package.name}}</span>
- &nbsp;&nbsp;
- <span class="buttons" style="opacity:0">
- <img title="{{_("Delete Package")}}" style="cursor: pointer" width="12px" height="12px" src="/media/default/img/delete.png" />
- &nbsp;&nbsp;
- <img title="{{_("Restart Package")}}" style="margin-left: -10px; cursor: pointer" height="12px" src="/media/default/img/arrow_refresh.png" />
- &nbsp;&nbsp;
- <img title="{{_("Edit Package")}}" style="margin-left: -10px; cursor: pointer" height="12px" src="/media/default/img/pencil.png" />
- &nbsp;&nbsp;
- <img title="{{_("Move Package")}}" style="margin-left: -10px; cursor: pointer" height="12px" src="/media/default/img/package_go.png" />
- </span>
- </div>
- {% set progress = (package.linksdone * 100) / package.linkstotal %}
-
- <div id="progress" style="border-radius: 4px; border: 1px solid #AAAAAA; width: 50%; height: 1em">
- <div style="width: {{ progress }}%; height: 100%; background-color: #add8e6;"></div>
- <label style="font-size: 0.8em; font-weight: bold; padding-left: 5px; position: relative; top: -17px">
- {{ package.sizedone|formatsize }} / {{ package.sizetotal|formatsize }}</label>
- <label style="font-size: 0.8em; font-weight: bold; padding-right: 5px ;float: right; position: relative; top: -17px">
- {{ package.linksdone }} / {{ package.linkstotal }}</label>
- </div>
- <div style="clear: both; margin-bottom: -10px"></div>
-
- <div id="children_{{package.pid}}" style="display: none;" class="children">
- <span class="child_secrow">{{_("Folder:")}} <span class="folder">{{package.folder}}</span> | {{_("Password:")}} <span class="password">{{package.password}}</span></span>
- <ul id="sort_children_{{package.pid}}" style="list-style: none; padding-left: 0">
- </ul>
- </div>
-</div>
- </li>
-{% endfor %}
-</ul>
-{% endautoescape %}
-{% endblock %}
-
-{% block hidden %}
-<div id="pack_box" class="window_box" style="z-index: 2">
- <form id="pack_form" action="/json/edit_package" method="POST" enctype="multipart/form-data">
- <h1>{{_("Edit Package")}}</h1>
- <p>{{_("Edit the package detais below.")}}</p>
- <input name="pack_id" id="pack_id" type="hidden" value=""/>
- <label for="pack_name">{{_("Name")}}
- <span class="small">{{_("The name of the package.")}}</span>
- </label>
- <input id="pack_name" name="pack_name" type="text" size="20" />
-
- <label for="pack_folder">{{_("Folder")}}
- <span class="small">{{_("Name of subfolder for these downloads.")}}</span>
- </label>
- <input id="pack_folder" name="pack_folder" type="text" size="20" />
-
- <label for="pack_pws">{{_("Password")}}
- <span class="small">{{_("List of passwords used for unrar.")}}</span>
- </label>
- <textarea rows="3" name="pack_pws" id="pack_pws"></textarea>
-
- <button type="submit">{{_("Submit")}}</button>
- <button id="pack_reset" style="margin-left: 0" type="reset" >{{_("Reset")}}</button>
- <div class="spacer"></div>
-
- </form>
-
-</div>
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/settings.html b/module/web/templates/default/settings.html
index a4443025a..b7cdb7cb5 100644
--- a/module/web/templates/default/settings.html
+++ b/module/web/templates/default/settings.html
@@ -4,201 +4,33 @@
{% block subtitle %}{{ _("Config") }}{% endblock %}
{% block head %}
- <script type="text/javascript" src="/media/js/tinytab_static.js"></script>
- <script type="text/javascript" src="/media/js/MooDropMenu_static.js"></script>
- <script type="text/javascript" src="/media/js/settings.js"></script>
-
+ <script>
+ $(function() {
+ $( "#toptabs" ).tabs({
+ ajaxOptions: {
+ error: function( xhr, status, index, anchor ) {
+ $( anchor.hash ).html(
+ "Couldn't load this tab." );
+ }
+ }
+ });
+ });
+ </script>
{% endblock %}
{% block content %}
- <ul id="toptabs" class="tabs">
- <li><a class="selected" href="#">{{ _("General") }}</a></li>
- <li><a href="#">{{ _("Plugins") }}</a></li>
- <li><a href="#">{{ _("Accounts") }}</a></li>
- </ul>
-
- <div id="tabsback" style="height: 20px; padding-left: 150px; color: white; font-weight: bold;">
-
- </div>
-
- <span id="tabs-body">
- <!-- General -->
- <span id="general" class="active tabContent">
- <ul class="nav tabs">
- <li class>
- <a>Menu</a>
- <ul id="general-menu">
- {% for entry,name in conf.general %}
- <nobr>
- <li id="general|{{ entry }}">{{ name }}</li>
- </nobr>
- <br>
- {% endfor %}
- </ul>
- </li>
- </ul>
-
- <form id="general_form" action="" method="POST" autocomplete="off">
- <span id="general_form_content">
- <br>
- <h3>&nbsp;&nbsp; {{ _("Choose a section from the menu") }}</h3>
- <br>
- </span>
-
- <input id="general|submit" class="styled_button" type="submit" value="{{_("Submit")}}"/>
- </form>
- </span>
-
- <!-- Plugins -->
- <span id="plugins" class="tabContent">
- <ul class="nav tabs">
- <li class>
- <a>Menu</a>
- <ul id="plugin-menu">
- {% for entry,name in conf.plugin %}
- <nobr>
- <li id="plugin|{{ entry }}">{{ name }}</li>
- </nobr>
- <br>
- {% endfor %}
- </ul>
- </li>
- </ul>
-
-
- <form id="plugin_form" action="" method="POST" autocomplete="off">
-
- <span id="plugin_form_content">
- <br>
- <h3>&nbsp;&nbsp; {{ _("Choose a section from the menu") }}</h3>
- <br>
- </span>
- <input id="plugin|submit" class="styled_button" type="submit" value="{{_("Submit")}}"/>
- </form>
-
- </span>
-
- <!-- Accounts -->
- <span id="accounts" class="tabContent">
- <form id="account_form" action="/json/update_accounts" method="POST">
-
- <table class="settable wide">
-
- <thead>
- <tr>
- <th>{{ _("Plugin") }}</th>
- <th>{{ _("Name") }}</th>
- <th>{{ _("Password") }}</th>
- <th>{{ _("Status") }}</th>
- <th>{{ _("Premium") }}</th>
- <th>{{ _("Valid until") }}</th>
- <th>{{ _("Traffic left") }}</th>
- <th>{{ _("Time") }}</th>
- <th>{{ _("Max Parallel") }}</th>
- <th>{{ _("Delete?") }}</th>
- </tr>
- </thead>
-
-
- {% for account in conf.accs %}
- {% set plugin = account.type %}
- <tr>
- <td>
- <span style="padding:5px">{{ plugin }}</span>
- </td>
-
- <td><label for="{{plugin}}|password;{{account.login}}"
- style="color:#424242;">{{ account.login }}</label></td>
- <td>
- <input id="{{plugin}}|password;{{account.login}}"
- name="{{plugin}}|password;{{account.login}}"
- type="password" value="{{account.password}}" size="12"/>
- </td>
- <td>
- {% if account.valid %}
- <span style="font-weight: bold; color: #006400;">
- {{ _("valid") }}
- {% else %}
- <span style="font-weight: bold; color: #8b0000;">
- {{ _("not valid") }}
- {% endif %}
- </span>
- </td>
- <td>
- {% if account.premium %}
- <span style="font-weight: bold; color: #006400;">
- {{ _("yes") }}
- {% else %}
- <span style="font-weight: bold; color: #8b0000;">
- {{ _("no") }}
- {% endif %}
- </span>
- </td>
- <td>
- <span style="font-weight: bold;">
- {{ account.validuntil }}
- </span>
- </td>
- <td>
- <span style="font-weight: bold;">
- {{ account.trafficleft }}
- </span>
- </td>
- <td>
- <input id="{{plugin}}|time;{{account.login}}"
- name="{{plugin}}|time;{{account.login}}" type="text"
- size="7" value="{{account.time}}"/>
- </td>
- <td>
- <input id="{{plugin}}|limitdl;{{account.login}}"
- name="{{plugin}}|limitdl;{{account.login}}" type="text"
- size="2" value="{{account.limitdl}}"/>
- </td>
- <td>
- <input id="{{plugin}}|delete;{{account.login}}"
- name="{{plugin}}|delete;{{account.login}}" type="checkbox"
- value="True"/>
- </td>
- </tr>
- {% endfor %}
- </table>
-
- <button id="account_submit" type="submit" class="styled_button">{{_("Submit")}}</button>
- <button id="account_add" style="margin-left: 0" type="submit" class="styled_button">{{_("Add")}}</button>
- </form>
- </span>
- </span>
-{% endblock %}
-{% block hidden %}
-<div id="account_box" class="window_box" style="z-index: 2">
-<form id="add_account_form" action="/json/add_account" method="POST" enctype="multipart/form-data">
-<h1>{{_("Add Account")}}</h1>
-<p>{{_("Enter your account data to use premium features.")}}</p>
-<label for="account_login">{{_("Login")}}
-<span class="small">{{_("Your username.")}}</span>
-</label>
-<input id="account_login" name="account_login" type="text" size="20" />
-
-<label for="account_password">{{_("Password")}}
-<span class="small">{{_("The password for this account.")}}</span>
-</label>
-<input id="account_password" name="account_password" type="password" size="20" />
-
-<label for="account_type">{{_("Type")}}
-<span class="small">{{_("Choose the hoster for your account.")}}</span>
-</label>
- <select name=account_type id="account_type">
- {% for type in types|sort %}
- <option value="{{ type }}">{{ type }}</option>
- {% endfor %}
- </select>
-
-<button id="account_add_button" type="submit">{{_("Add")}}</button>
-<button id="account_reset" style="margin-left: 0" type="reset">{{_("Reset")}}</button>
-<div class="spacer"></div>
+<div id="toptabs">
+ <ul>
+ <li><a href="#tabs-1">{{ _("Admin")}}</a></li>
+ <li><a href="ajax/content1.html">{{ _("Addons")}}</a></li>
+ <li><a href="ajax/content1.html">{{ _("Accounts")}}</a></li>
+ <li><a href="ajax/content1.html">{{ _("User")}}</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+</div>
-</form>
-</div>
{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/settings_item.html b/module/web/templates/default/settings_item.html
deleted file mode 100644
index 813383343..000000000
--- a/module/web/templates/default/settings_item.html
+++ /dev/null
@@ -1,48 +0,0 @@
-<table class="settable">
- {% if section.outline %}
- <tr><th colspan="2">{{ section.outline }}</th></tr>
- {% endif %}
- {% for okey, option in section.iteritems() %}
- {% if okey not in ("desc","outline") %}
- <tr>
- <td><label for="{{skey}}|{{okey}}"
- style="color:#424242;">{{ option.desc }}:</label></td>
- <td>
- {% if option.type == "bool" %}
- <select id="{{skey}}|{{okey}}" name="{{skey}}|{{okey}}">
- <option {% if option.value %} selected="selected"
- {% endif %}value="True">{{ _("on") }}</option>
- <option {% if not option.value %} selected="selected"
- {% endif %}value="False">{{ _("off") }}</option>
- </select>
- {% elif ";" in option.type %}
- <select id="{{skey}}|{{okey}}" name="{{skey}}|{{okey}}">
- {% for entry in option.list %}
- <option {% if option.value == entry %}
- selected="selected" {% endif %}>{{ entry }}</option>
- {% endfor %}
- </select>
- {% elif option.type == "folder" %}
- <input name="{{skey}}|{{okey}}" type="text"
- id="{{skey}}|{{okey}}" value="{{option.value}}"/>
- <input name="browsebutton" type="button"
- onclick="ifield = document.getElementById('{{skey}}|{{okey}}'); pathchooser = window.open('{% if option.value %}{{ "/pathchooser/" + option.value|quotepath }}{% else %}{{ pathroot }}{% endif %}', 'pathchooser', 'scrollbars=yes,toolbar=no,menubar=no,statusbar=no,width=650,height=300'); pathchooser.ifield = ifield; window.ifield = ifield;"
- value="{{_("Browse")}}"/>
- {% elif option.type == "file" %}
- <input name="{{skey}}|{{okey}}" type="text"
- id="{{skey}}|{{okey}}" value="{{option.value}}"/>
- <input name="browsebutton" type="button"
- onclick="ifield = document.getElementById('{{skey}}|{{okey}}'); filechooser = window.open('{% if option.value %}{{ "/filechooser/" + option.value|quotepath }}{% else %}{{ fileroot }}{% endif %}', 'filechooser', 'scrollbars=yes,toolbar=no,menubar=no,statusbar=no,width=650,height=300'); filechooser.ifield = ifield; window.ifield = ifield;"
- value="{{_("Browse")}}"/>
- {% elif option.type == "password" %}
- <input id="{{skey}}|{{okey}}" name="{{skey}}|{{okey}}"
- type="password" value="{{option.value}}"/>
- {% else %}
- <input id="{{skey}}|{{okey}}" name="{{skey}}|{{okey}}"
- type="text" value="{{option.value}}"/>
- {% endif %}
- </td>
- </tr>
- {% endif %}
- {% endfor %}
-</table> \ No newline at end of file
diff --git a/module/web/templates/default/setup.html b/module/web/templates/default/setup.html
deleted file mode 100644
index 39ef6f1e8..000000000
--- a/module/web/templates/default/setup.html
+++ /dev/null
@@ -1,13 +0,0 @@
-{% extends 'default/base.html' %}
-
-{% block title %}{{ _("Setup") }} - {{ super() }} {% endblock %}
-{% block subtitle %}{{ _("Setup") }}{% endblock %}
-{% block headpanel %}Welcome to pyLoad{% endblock %}
-{% block menu %}
- <li style="height: 25px"> <!-- Needed to get enough margin -->
- </li>
-{% endblock %}
-
-{% block content %}
- Comming Soon.
-{% endblock %} \ No newline at end of file
diff --git a/module/web/templates/default/window.html b/module/web/templates/default/window.html
deleted file mode 100644
index b61fa7149..000000000
--- a/module/web/templates/default/window.html
+++ /dev/null
@@ -1,46 +0,0 @@
-<iframe id="upload_target" name="upload_target" src="" style="display: none; width:0;height:0"></iframe>
-
-<div id="add_box" class="window_box">
-<form id="add_form" action="/json/add_package" method="POST" enctype="multipart/form-data">
-<h1>{{_("Add Package")}}</h1>
-<p>{{_("Paste your links or upload a container.")}}</p>
-<label for="add_name">{{_("Name")}}
-<span class="small">{{_("The name of the new package.")}}</span>
-</label>
-<input id="add_name" name="add_name" type="text" size="20" />
-
-<label for="add_links">{{_("Links")}}
-<span class="small">{{_("Paste your links here or any text and press the filter button.")}}</span>
-<span class="small"> {{ _("Filter urls") }}
-<img alt="URIParsing" Title="Parse Uri" src="/media/default/img/parseUri.png" style="cursor:pointer; vertical-align: text-bottom;" onclick="parseUri()"/>
-</span>
-
-</label>
-<textarea rows="5" name="add_links" id="add_links"></textarea>
-
-<label for="add_password">{{_("Password")}}
- <span class="small">{{_("Password for RAR-Archive")}}</span>
-</label>
-<input id="add_password" name="add_password" type="text" size="20">
-
-<label>{{_("File")}}
-<span class="small">{{_("Upload a container.")}}</span>
-</label>
-<input type="file" name="add_file" id="add_file"/>
-
-<label for="add_dest">{{_("Destination")}}
-</label>
-<span class="cont">
- {{_("Queue")}}
- <input type="radio" name="add_dest" id="add_dest" value="1" checked="checked"/>
- {{_("Collector")}}
- <input type="radio" name="add_dest" id="add_dest2" value="0"/>
-</span>
-
-<button type="submit">{{_("Add Package")}}</button>
-<button id="add_reset" style="margin-left:0;" type="reset">{{_("Reset")}}</button>
-<div class="spacer"></div>
-
-</form>
-
-</div> \ No newline at end of file
diff --git a/module/web/templates/mobile/base.html b/module/web/templates/mobile/base.html
new file mode 100644
index 000000000..95d824730
--- /dev/null
+++ b/module/web/templates/mobile/base.html
@@ -0,0 +1,41 @@
+<!DOCTYPE html>
+<html>
+<head>
+ <meta charset="utf-8">
+ <title>{% block title %}pyLoad {{ _("Webinterface") }}{% endblock %}</title>
+ <meta name="description" content="">
+ <meta name="HandheldFriendly" content="True">
+ <meta name="MobileOptimized" content="320">
+ <meta name="viewport" content="width=device-width">
+ <meta http-equiv="cleartype" content="on">
+
+ <link rel="shortcut icon" href="img/touch/apple-touch-icon.png">
+ <link href="static/css/font.css" rel="stylesheet" type="text/css"/>
+ {# TODO: Needs cleanup #}
+ <link rel="stylesheet" href="/static/css/mobile/style.css">
+
+ <script type="text/javascript" data-main="static/js/mobile" src="static/js/libs/require-2.0.6.js"></script>
+ {% block head %}
+ {% endblock %}
+</head>
+<body class="viewport">
+<div id="wrap">
+<header>
+ <div class="logo"></div>
+ <span class="title">pyLoad</span>
+</header>
+<div id="content">
+ <h2>Tech Demo</h2>
+ <h3>In Development</h3>
+</div>
+</div>
+<footer>
+ Tab Bar
+</footer>
+<script>
+ require(['mobile'], function (App) {
+ App.init();
+ });
+</script>
+</body>
+</html>
diff --git a/module/web/templates/mobile/login.html b/module/web/templates/mobile/login.html
new file mode 100644
index 000000000..5a1625f43
--- /dev/null
+++ b/module/web/templates/mobile/login.html
@@ -0,0 +1,5 @@
+{% extends 'mobile/base.html' %}
+{% block title %}{{_("Login")}} - {{super()}} {% endblock %}
+{% block content %}
+<h1>Test test sd</h1>
+{% endblock %} \ No newline at end of file
diff --git a/module/web/utils.py b/module/web/utils.py
index a89c87558..967fc3412 100644
--- a/module/web/utils.py
+++ b/module/web/utils.py
@@ -12,104 +12,80 @@
See the GNU General Public License for more details.
You should have received a copy of the GNU General Public License
- along with this plrogram; if not, see <http://www.gnu.org/licenses/>.
+ along with this program; if not, see <http://www.gnu.org/licenses/>.
@author: RaNaN
"""
+import re
from bottle import request, HTTPError, redirect, ServerAdapter
-from webinterface import env, TEMPLATE
-
-from module.Api import has_permission, PERMS, ROLE
+from webinterface import env, TEMPLATE, PYLOAD
+# TODO: useful but needs a rewrite, too
def render_to_response(name, args={}, proc=[]):
for p in proc:
args.update(p())
-
- t = env.get_template(TEMPLATE + "/" + name)
+ if is_mobile():
+ t = env.get_or_select_template(("mobile/" + name,))
+ else:
+ t = env.get_or_select_template((TEMPLATE + "/" + name, "default/" + name))
return t.render(**args)
-def parse_permissions(session):
- perms = dict([(x, False) for x in dir(PERMS) if not x.startswith("_")])
- perms["ADMIN"] = False
- perms["is_admin"] = False
-
- if not session.get("authenticated", False):
- return perms
-
- if session.get("role") == ROLE.ADMIN:
- for k in perms.iterkeys():
- perms[k] = True
-
- elif session.get("perms"):
- p = session.get("perms")
- get_permission(perms, p)
-
- return perms
-
-
-def permlist():
- return [x for x in dir(PERMS) if not x.startswith("_") and x != "ALL"]
-
-
-def get_permission(perms, p):
- """Returns a dict with permission key
-
- :param perms: dictionary
- :param p: bits
- """
- for name in permlist():
- perms[name] = has_permission(p, getattr(PERMS, name))
-
-
-def set_permission(perms):
- """generates permission bits from dictionary
-
- :param perms: dict
- """
- permission = 0
- for name in dir(PERMS):
- if name.startswith("_"): continue
-
- if name in perms and perms[name]:
- permission |= getattr(PERMS, name)
-
- return permission
-
-
-def set_session(request, info):
+def set_session(request, user):
s = request.environ.get('beaker.session')
- s["authenticated"] = True
- s["user_id"] = info["id"]
- s["name"] = info["name"]
- s["role"] = info["role"]
- s["perms"] = info["permission"]
- s["template"] = info["template"]
+ s["uid"] = user.uid
s.save()
-
return s
-
-def parse_userdata(session):
- return {"name": session.get("name", "Anonymous"),
- "is_admin": True if session.get("role", 1) == 0 else False,
- "is_authenticated": session.get("authenticated", False)}
+def get_user_api(s):
+ uid = s.get("uid", None)
+ if uid is not None:
+ api = PYLOAD.withUserContext(uid)
+ return api
+ return None
+
+def is_mobile():
+ if request.get_cookie("mobile"):
+ if request.get_cookie("mobile") == "True":
+ return True
+ else:
+ return False
+ mobile_ua = request.headers.get('User-Agent', '').lower()
+ if mobile_ua.find('opera mini') > 0:
+ return True
+ if mobile_ua.find('windows') > 0:
+ return False
+ if request.headers.get('Accept', '').lower().find('application/vnd.wap.xhtml+xml') > 0:
+ return True
+ if re.search('(up.browser|up.link|mmp|symbian|smartphone|midp|wap|phone|android)', mobile_ua) is not None:
+ return True
+ mobile_ua = mobile_ua[:4]
+ mobile_agents = ['w3c ','acs-','alav','alca','amoi','audi','avan','benq','bird','blac','blaz','brew','cell','cldc','cmd-',
+ 'dang','doco','eric','hipt','inno','ipaq','java','jigs','kddi','keji','leno','lg-c','lg-d','lg-g','lge-',
+ 'maui','maxo','midp','mits','mmef','mobi','mot-','moto','mwbp','nec-','newt','noki','palm','pana','pant',
+ 'phil','play','port','prox','qwap','sage','sams','sany','sch-','sec-','send','seri','sgh-','shar','sie-',
+ 'siem','smal','smar','sony','sph-','symb','t-mo','teli','tim-','tosh','tsm-','upg1','upsi','vk-v','voda',
+ 'wap-','wapa','wapi','wapp','wapr','webc','winw','winw','xda ','xda-']
+ if mobile_ua in mobile_agents:
+ return True
+ return False
def login_required(perm=None):
def _dec(func):
def _view(*args, **kwargs):
s = request.environ.get('beaker.session')
- if s.get("name", None) and s.get("authenticated", False):
+ api = get_user_api(s)
+ if api is not None:
if perm:
- perms = parse_permissions(s)
- if perm not in perms or not perms[perm]:
+ if api.user.hasPermission(perm):
if request.headers.get('X-Requested-With') == 'XMLHttpRequest':
return HTTPError(403, "Forbidden")
else:
return redirect("/nopermission")
+ kwargs["api"] = api
return func(*args, **kwargs)
else:
if request.headers.get('X-Requested-With') == 'XMLHttpRequest':
@@ -122,13 +98,6 @@ def login_required(perm=None):
return _dec
-def toDict(obj):
- ret = {}
- for att in obj.__slots__:
- ret[att] = getattr(obj, att)
- return ret
-
-
class CherryPyWSGI(ServerAdapter):
def run(self, handler):
from wsgiserver import CherryPyWSGIServer
diff --git a/module/web/webinterface.py b/module/web/webinterface.py
index ec8b2e56c..75907a0a8 100644
--- a/module/web/webinterface.py
+++ b/module/web/webinterface.py
@@ -30,7 +30,7 @@ PYLOAD_DIR = abspath(join(PROJECT_DIR, "..", ".."))
sys.path.append(PYLOAD_DIR)
from module import InitHomeDir
-from module.utils import decode, formatSize
+from module.utils import decode, format_size
import bottle
from bottle import run, app
@@ -77,6 +77,7 @@ if not exists(cache):
bcc = FileSystemBytecodeCache(cache, '%s.cache')
loader = PrefixLoader({
"default": FileSystemLoader(join(PROJECT_DIR, "templates", "default")),
+ "mobile": FileSystemLoader(join(PROJECT_DIR, "templates", "mobile")),
'js': FileSystemLoader(join(PROJECT_DIR, 'media', 'js'))
})
@@ -92,7 +93,7 @@ env.filters["path_make_relative"] = path_make_relative
env.filters["path_make_absolute"] = path_make_absolute
env.filters["decode"] = decode
env.filters["type"] = lambda x: str(type(x))
-env.filters["formatsize"] = formatSize
+env.filters["formatsize"] = format_size
env.filters["getitem"] = lambda x, y: x.__getitem__(y)
if PREFIX:
env.filters["url"] = lambda x: x
@@ -121,7 +122,6 @@ if PREFIX:
web = PrefixMiddleware(web, prefix=PREFIX)
import pyload_app
-import json_app
import cnl_app
import api_app
@@ -133,14 +133,14 @@ def run_lightweight(host="0.0.0.0", port="8000"):
run(app=web, host=host, port=port, quiet=True, server="bjoern")
-def run_threaded(host="0.0.0.0", port="8000", theads=3, cert="", key=""):
+def run_threaded(host="0.0.0.0", port="8000", threads=3, cert="", key=""):
from wsgiserver import CherryPyWSGIServer
if cert and key:
CherryPyWSGIServer.ssl_certificate = cert
CherryPyWSGIServer.ssl_private_key = key
- CherryPyWSGIServer.numthreads = theads
+ CherryPyWSGIServer.numthreads = threads
from utils import CherryPyWSGI