From a8f763fb85756f69899f7b3b71c01bb01461ee3c Mon Sep 17 00:00:00 2001 From: RaNaN Date: Fri, 10 Aug 2012 22:12:10 +0200 Subject: beginning new pyload web-ui from scratch --- module/web/static/css/default/style.css | 161 +++++++++++++++++++++ module/web/static/css/font.css | 37 +++++ module/web/static/fonts/Sansation_Bold-webfont.eot | Bin 0 -> 35336 bytes module/web/static/fonts/Sansation_Bold-webfont.ttf | Bin 0 -> 35160 bytes .../web/static/fonts/Sansation_Bold-webfont.woff | Bin 0 -> 18496 bytes .../web/static/fonts/Sansation_Light-webfont.eot | Bin 0 -> 36700 bytes .../web/static/fonts/Sansation_Light-webfont.ttf | Bin 0 -> 36520 bytes .../web/static/fonts/Sansation_Light-webfont.woff | Bin 0 -> 18408 bytes .../web/static/fonts/Sansation_Regular-webfont.eot | Bin 0 -> 36368 bytes .../web/static/fonts/Sansation_Regular-webfont.ttf | Bin 0 -> 36180 bytes .../static/fonts/Sansation_Regular-webfont.woff | Bin 0 -> 18316 bytes module/web/static/img/default/fancy_deboss.png | Bin 0 -> 265 bytes module/web/static/img/default/logo.png | Bin 0 -> 11621 bytes module/web/static/img/default/logo_grey.png | Bin 0 -> 6236 bytes module/web/static/img/default/main-wrapper-bg.png | Bin 0 -> 114902 bytes module/web/static/img/favicon.ico | Bin 0 -> 7206 bytes module/web/static/js/libs/jquery-1.8.0.min.js | 2 + 17 files changed, 200 insertions(+) create mode 100644 module/web/static/css/default/style.css create mode 100644 module/web/static/css/font.css create mode 100644 module/web/static/fonts/Sansation_Bold-webfont.eot create mode 100644 module/web/static/fonts/Sansation_Bold-webfont.ttf create mode 100644 module/web/static/fonts/Sansation_Bold-webfont.woff create mode 100644 module/web/static/fonts/Sansation_Light-webfont.eot create mode 100644 module/web/static/fonts/Sansation_Light-webfont.ttf create mode 100644 module/web/static/fonts/Sansation_Light-webfont.woff create mode 100644 module/web/static/fonts/Sansation_Regular-webfont.eot create mode 100644 module/web/static/fonts/Sansation_Regular-webfont.ttf create mode 100644 module/web/static/fonts/Sansation_Regular-webfont.woff create mode 100644 module/web/static/img/default/fancy_deboss.png create mode 100644 module/web/static/img/default/logo.png create mode 100644 module/web/static/img/default/logo_grey.png create mode 100644 module/web/static/img/default/main-wrapper-bg.png create mode 100644 module/web/static/img/favicon.ico create mode 100644 module/web/static/js/libs/jquery-1.8.0.min.js (limited to 'module/web/static') diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css new file mode 100644 index 000000000..166b8c452 --- /dev/null +++ b/module/web/static/css/default/style.css @@ -0,0 +1,161 @@ + +/* + General + */ + +body { + margin: 0; + padding: 0; + font-family: 'Abel', sans-serif; + font-size: 16px; + color: #757575; + background: url("../../img/default/fancy_deboss.png") repeat scroll 0 0 transparent; +} + +h1, h2, h3 { + margin: 0; + padding: 0; + font-weight: normal; + color: #221D1D; +} + +h1 { + font-size: 2em; +} + +h2 { + font-size: 2.4em; +} + +h3 { + font-size: 1.6em; +} + +p, ul, ol { + margin-top: 0; + line-height: 180%; +} + +ul, ol { +} + +a { + text-decoration: none; + color: #FF7637; +} + +a:hover { +} + +#wrapper { + width: 960px; + margin: 70px auto 0; + padding: 0; +} + +/* + Header +*/ + +header { + background: url("../../img/default/main-wrapper-bg.png") repeat-x; + height: 70px; + position: fixed; + top: 0; + vertical-align: top; + width: 100%; + z-index: 10; +} + +header:before { + position: absolute; + content: ' '; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: transparent; + box-shadow: 0 0 5px black; + z-index: -1; +} + +header div.center { + padding-left: 20px; + padding-right: 20px; +} +header div.center span.title { + color: white; + float: left; + font-family: SansationRegular, sans-serif; + font-size: 40px; + margin-top: 12px; +} +header img.logo { + float: left; + padding-right: 10px; + padding-top: 7px; + width: 120px; +} + +/* + Footer +*/ + +footer { + background: url("../../img/default/main-wrapper-bg.png") repeat-x; + height: 100px; + position: relative; + width: 100%; + z-index: 10; +} + +footer img.logo { + float: left; + padding-top: 12px; + padding-right: 12px; +} + +footer div.center { + padding-top: 10px; + width: 900px; + margin-left: auto; + margin-right: auto; +} + +footer:before { + position: absolute; + content: ' '; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: transparent; + box-shadow: 0 0 5px black; + z-index: -1; +} + +footer .block { + font-size: 12px; + float: left; + margin: 0; + width: 150px; + padding-top: 6px; + padding-right: 30px; +} + +footer .copyright { + text-align: center; + width: auto; + padding-top: 22px; +} + +footer h2 { + background: url("../../img/default/double-line.gif") repeat-x scroll center bottom transparent !important; + color: #FFFFFF; + font-family: SansationLight, sans-serif; + font-size: 16px; + font-weight: normal; + line-height: 16px; + margin: 0; + padding-bottom: 6px; +} \ No newline at end of file diff --git a/module/web/static/css/font.css b/module/web/static/css/font.css new file mode 100644 index 000000000..ee117d43b --- /dev/null +++ b/module/web/static/css/font.css @@ -0,0 +1,37 @@ +/** + * @file + * Font styling + */ + +@font-face { + font-family: 'SansationRegular'; + src: url('../fonts/Sansation_Regular-webfont.eot'); + src: url('../fonts/Sansation_Regular-webfont.eot?#iefix') format('embedded-opentype'), + url('../fonts/Sansation_Regular-webfont.woff') format('woff'), + url('../fonts/Sansation_Regular-webfont.ttf') format('truetype'), + url('../fonts/Sansation_Regular-webfont.svg#SansationRegular') format('svg'); + font-weight: normal; + font-style: normal; +} + +@font-face { + font-family: 'SansationLight'; + src: url('../fonts/Sansation_Light-webfont.eot'); + src: url('../fonts/Sansation_Light-webfont.eot?#iefix') format('embedded-opentype'), + url('../fonts/Sansation_Light-webfont.woff') format('woff'), + url('../fonts/Sansation_Light-webfont.ttf') format('truetype'), + url('../fonts/Sansation_Light-webfont.svg#SansationLight') format('svg'); + font-weight: normal; + font-style: normal; +} + +@font-face { + font-family: 'SansationBold'; + src: url('../fonts/Sansation_Bold-webfont.eot'); + src: url('../fonts/Sansation_Bold-webfont.eot?#iefix') format('embedded-opentype'), + url('../fonts/Sansation_Bold-webfont.woff') format('woff'), + url('../fonts/Sansation_Bold-webfont.ttf') format('truetype'), + url('../fonts/Sansation_Bold-webfont.svg#SansationBold') format('svg'); + font-weight: normal; + font-style: normal; +} \ No newline at end of file diff --git a/module/web/static/fonts/Sansation_Bold-webfont.eot b/module/web/static/fonts/Sansation_Bold-webfont.eot new file mode 100644 index 000000000..43ed2ee31 Binary files /dev/null and b/module/web/static/fonts/Sansation_Bold-webfont.eot differ diff --git a/module/web/static/fonts/Sansation_Bold-webfont.ttf b/module/web/static/fonts/Sansation_Bold-webfont.ttf new file mode 100644 index 000000000..d2e7c4c2a Binary files /dev/null and b/module/web/static/fonts/Sansation_Bold-webfont.ttf differ diff --git a/module/web/static/fonts/Sansation_Bold-webfont.woff b/module/web/static/fonts/Sansation_Bold-webfont.woff new file mode 100644 index 000000000..9ee938d55 Binary files /dev/null and b/module/web/static/fonts/Sansation_Bold-webfont.woff differ diff --git a/module/web/static/fonts/Sansation_Light-webfont.eot b/module/web/static/fonts/Sansation_Light-webfont.eot new file mode 100644 index 000000000..d83fa9cf6 Binary files /dev/null and b/module/web/static/fonts/Sansation_Light-webfont.eot differ diff --git a/module/web/static/fonts/Sansation_Light-webfont.ttf b/module/web/static/fonts/Sansation_Light-webfont.ttf new file mode 100644 index 000000000..64d734bec Binary files /dev/null and b/module/web/static/fonts/Sansation_Light-webfont.ttf differ diff --git a/module/web/static/fonts/Sansation_Light-webfont.woff b/module/web/static/fonts/Sansation_Light-webfont.woff new file mode 100644 index 000000000..5f3dce493 Binary files /dev/null and b/module/web/static/fonts/Sansation_Light-webfont.woff differ diff --git a/module/web/static/fonts/Sansation_Regular-webfont.eot b/module/web/static/fonts/Sansation_Regular-webfont.eot new file mode 100644 index 000000000..46219c9ff Binary files /dev/null and b/module/web/static/fonts/Sansation_Regular-webfont.eot differ diff --git a/module/web/static/fonts/Sansation_Regular-webfont.ttf b/module/web/static/fonts/Sansation_Regular-webfont.ttf new file mode 100644 index 000000000..92f686359 Binary files /dev/null and b/module/web/static/fonts/Sansation_Regular-webfont.ttf differ diff --git a/module/web/static/fonts/Sansation_Regular-webfont.woff b/module/web/static/fonts/Sansation_Regular-webfont.woff new file mode 100644 index 000000000..524b67992 Binary files /dev/null and b/module/web/static/fonts/Sansation_Regular-webfont.woff differ diff --git a/module/web/static/img/default/fancy_deboss.png b/module/web/static/img/default/fancy_deboss.png new file mode 100644 index 000000000..926a762db Binary files /dev/null and b/module/web/static/img/default/fancy_deboss.png differ diff --git a/module/web/static/img/default/logo.png b/module/web/static/img/default/logo.png new file mode 100644 index 000000000..3a59b54aa Binary files /dev/null and b/module/web/static/img/default/logo.png differ diff --git a/module/web/static/img/default/logo_grey.png b/module/web/static/img/default/logo_grey.png new file mode 100644 index 000000000..7061372aa Binary files /dev/null and b/module/web/static/img/default/logo_grey.png differ diff --git a/module/web/static/img/default/main-wrapper-bg.png b/module/web/static/img/default/main-wrapper-bg.png new file mode 100644 index 000000000..68febb6a2 Binary files /dev/null and b/module/web/static/img/default/main-wrapper-bg.png differ diff --git a/module/web/static/img/favicon.ico b/module/web/static/img/favicon.ico new file mode 100644 index 000000000..58b1f4b89 Binary files /dev/null and b/module/web/static/img/favicon.ico differ diff --git a/module/web/static/js/libs/jquery-1.8.0.min.js b/module/web/static/js/libs/jquery-1.8.0.min.js new file mode 100644 index 000000000..f121291c4 --- /dev/null +++ b/module/web/static/js/libs/jquery-1.8.0.min.js @@ -0,0 +1,2 @@ +/*! jQuery v@1.8.0 jquery.com | jquery.org/license */ +(function(a,b){function G(a){var b=F[a]={};return p.each(a.split(s),function(a,c){b[c]=!0}),b}function J(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(I,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:+d+""===d?+d:H.test(d)?p.parseJSON(d):d}catch(f){}p.data(a,c,d)}else d=b}return d}function K(a){var b;for(b in a){if(b==="data"&&p.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function ba(){return!1}function bb(){return!0}function bh(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function bi(a,b){do a=a[b];while(a&&a.nodeType!==1);return a}function bj(a,b,c){b=b||0;if(p.isFunction(b))return p.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return p.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=p.grep(a,function(a){return a.nodeType===1});if(be.test(b))return p.filter(b,d,!c);b=p.filter(b,d)}return p.grep(a,function(a,d){return p.inArray(a,b)>=0===c})}function bk(a){var b=bl.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function bC(a,b){return a.getElementsByTagName(b)[0]||a.appendChild(a.ownerDocument.createElement(b))}function bD(a,b){if(b.nodeType!==1||!p.hasData(a))return;var c,d,e,f=p._data(a),g=p._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;d").appendTo(e.body),c=b.css("display");b.remove();if(c==="none"||c===""){bI=e.body.appendChild(bI||p.extend(e.createElement("iframe"),{frameBorder:0,width:0,height:0}));if(!bJ||!bI.createElement)bJ=(bI.contentWindow||bI.contentDocument).document,bJ.write(""),bJ.close();b=bJ.body.appendChild(bJ.createElement(a)),c=bH(b,"display"),e.body.removeChild(bI)}return bR[a]=c,c}function ch(a,b,c,d){var e;if(p.isArray(b))p.each(b,function(b,e){c||cd.test(a)?d(a,e):ch(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&p.type(b)==="object")for(e in b)ch(a+"["+e+"]",b[e],c,d);else d(a,b)}function cy(a){return function(b,c){typeof b!="string"&&(c=b,b="*");var d,e,f,g=b.toLowerCase().split(s),h=0,i=g.length;if(p.isFunction(c))for(;h)[^>]*$|#([\w\-]*)$)/,v=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,w=/^[\],:{}\s]*$/,x=/(?:^|:|,)(?:\s*\[)+/g,y=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,z=/"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,A=/^-ms-/,B=/-([\da-z])/gi,C=function(a,b){return(b+"").toUpperCase()},D=function(){e.addEventListener?(e.removeEventListener("DOMContentLoaded",D,!1),p.ready()):e.readyState==="complete"&&(e.detachEvent("onreadystatechange",D),p.ready())},E={};p.fn=p.prototype={constructor:p,init:function(a,c,d){var f,g,h,i;if(!a)return this;if(a.nodeType)return this.context=this[0]=a,this.length=1,this;if(typeof a=="string"){a.charAt(0)==="<"&&a.charAt(a.length-1)===">"&&a.length>=3?f=[null,a,null]:f=u.exec(a);if(f&&(f[1]||!c)){if(f[1])return c=c instanceof p?c[0]:c,i=c&&c.nodeType?c.ownerDocument||c:e,a=p.parseHTML(f[1],i,!0),v.test(f[1])&&p.isPlainObject(c)&&this.attr.call(a,c,!0),p.merge(this,a);g=e.getElementById(f[2]);if(g&&g.parentNode){if(g.id!==f[2])return d.find(a);this.length=1,this[0]=g}return this.context=e,this.selector=a,this}return!c||c.jquery?(c||d).find(a):this.constructor(c).find(a)}return p.isFunction(a)?d.ready(a):(a.selector!==b&&(this.selector=a.selector,this.context=a.context),p.makeArray(a,this))},selector:"",jquery:"1.8.0",length:0,size:function(){return this.length},toArray:function(){return k.call(this)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=p.merge(this.constructor(),a);return d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")"),d},each:function(a,b){return p.each(this,a,b)},ready:function(a){return p.ready.promise().done(a),this},eq:function(a){return a=+a,a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(k.apply(this,arguments),"slice",k.call(arguments).join(","))},map:function(a){return this.pushStack(p.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:j,sort:[].sort,splice:[].splice},p.fn.init.prototype=p.fn,p.extend=p.fn.extend=function(){var a,c,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;typeof h=="boolean"&&(k=h,h=arguments[1]||{},i=2),typeof h!="object"&&!p.isFunction(h)&&(h={}),j===i&&(h=this,--i);for(;i0)return;d.resolveWith(e,[p]),p.fn.trigger&&p(e).trigger("ready").off("ready")},isFunction:function(a){return p.type(a)==="function"},isArray:Array.isArray||function(a){return p.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):E[m.call(a)]||"object"},isPlainObject:function(a){if(!a||p.type(a)!=="object"||a.nodeType||p.isWindow(a))return!1;try{if(a.constructor&&!n.call(a,"constructor")&&!n.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||n.call(a,d)},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},error:function(a){throw new Error(a)},parseHTML:function(a,b,c){var d;return!a||typeof a!="string"?null:(typeof b=="boolean"&&(c=b,b=0),b=b||e,(d=v.exec(a))?[b.createElement(d[1])]:(d=p.buildFragment([a],b,c?null:[]),p.merge([],(d.cacheable?p.clone(d.fragment):d.fragment).childNodes)))},parseJSON:function(b){if(!b||typeof b!="string")return null;b=p.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(w.test(b.replace(y,"@").replace(z,"]").replace(x,"")))return(new Function("return "+b))();p.error("Invalid JSON: "+b)},parseXML:function(c){var d,e;if(!c||typeof c!="string")return null;try{a.DOMParser?(e=new DOMParser,d=e.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(f){d=b}return(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&p.error("Invalid XML: "+c),d},noop:function(){},globalEval:function(b){b&&r.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(A,"ms-").replace(B,C)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var e,f=0,g=a.length,h=g===b||p.isFunction(a);if(d){if(h){for(e in a)if(c.apply(a[e],d)===!1)break}else for(;f0&&a[0]&&a[i-1]||i===0||p.isArray(a));if(j)for(;h-1)i.splice(c,1),e&&(c<=g&&g--,c<=h&&h--)}),this},has:function(a){return p.inArray(a,i)>-1},empty:function(){return i=[],this},disable:function(){return i=j=c=b,this},disabled:function(){return!i},lock:function(){return j=b,c||l.disable(),this},locked:function(){return!j},fireWith:function(a,b){return b=b||[],b=[a,b.slice?b.slice():b],i&&(!d||j)&&(e?j.push(b):k(b)),this},fire:function(){return l.fireWith(this,arguments),this},fired:function(){return!!d}};return l},p.extend({Deferred:function(a){var b=[["resolve","done",p.Callbacks("once memory"),"resolved"],["reject","fail",p.Callbacks("once memory"),"rejected"],["notify","progress",p.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return p.Deferred(function(c){p.each(b,function(b,d){var f=d[0],g=a[b];e[d[1]](p.isFunction(g)?function(){var a=g.apply(this,arguments);a&&p.isFunction(a.promise)?a.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[f+"With"](this===e?c:this,[a])}:c[f])}),a=null}).promise()},promise:function(a){return typeof a=="object"?p.extend(a,d):d}},e={};return d.pipe=d.then,p.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[a^1][2].disable,b[2][2].lock),e[f[0]]=g.fire,e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=k.call(arguments),d=c.length,e=d!==1||a&&p.isFunction(a.promise)?d:0,f=e===1?a:p.Deferred(),g=function(a,b,c){return function(d){b[a]=this,c[a]=arguments.length>1?k.call(arguments):d,c===h?f.notifyWith(b,c):--e||f.resolveWith(b,c)}},h,i,j;if(d>1){h=new Array(d),i=new Array(d),j=new Array(d);for(;b
a",c=n.getElementsByTagName("*"),d=n.getElementsByTagName("a")[0],d.style.cssText="top:1px;float:left;opacity:.5";if(!c||!c.length||!d)return{};f=e.createElement("select"),g=f.appendChild(e.createElement("option")),h=n.getElementsByTagName("input")[0],b={leadingWhitespace:n.firstChild.nodeType===3,tbody:!n.getElementsByTagName("tbody").length,htmlSerialize:!!n.getElementsByTagName("link").length,style:/top/.test(d.getAttribute("style")),hrefNormalized:d.getAttribute("href")==="/a",opacity:/^0.5/.test(d.style.opacity),cssFloat:!!d.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:n.className!=="t",enctype:!!e.createElement("form").enctype,html5Clone:e.createElement("nav").cloneNode(!0).outerHTML!=="<:nav>",boxModel:e.compatMode==="CSS1Compat",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,boxSizingReliable:!0,pixelPosition:!1},h.checked=!0,b.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,b.optDisabled=!g.disabled;try{delete n.test}catch(o){b.deleteExpando=!1}!n.addEventListener&&n.attachEvent&&n.fireEvent&&(n.attachEvent("onclick",m=function(){b.noCloneEvent=!1}),n.cloneNode(!0).fireEvent("onclick"),n.detachEvent("onclick",m)),h=e.createElement("input"),h.value="t",h.setAttribute("type","radio"),b.radioValue=h.value==="t",h.setAttribute("checked","checked"),h.setAttribute("name","t"),n.appendChild(h),i=e.createDocumentFragment(),i.appendChild(n.lastChild),b.checkClone=i.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=h.checked,i.removeChild(h),i.appendChild(n);if(n.attachEvent)for(k in{submit:!0,change:!0,focusin:!0})j="on"+k,l=j in n,l||(n.setAttribute(j,"return;"),l=typeof n[j]=="function"),b[k+"Bubbles"]=l;return p(function(){var c,d,f,g,h="padding:0;margin:0;border:0;display:block;overflow:hidden;",i=e.getElementsByTagName("body")[0];if(!i)return;c=e.createElement("div"),c.style.cssText="visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px",i.insertBefore(c,i.firstChild),d=e.createElement("div"),c.appendChild(d),d.innerHTML="
t
",f=d.getElementsByTagName("td"),f[0].style.cssText="padding:0;margin:0;border:0;display:none",l=f[0].offsetHeight===0,f[0].style.display="",f[1].style.display="none",b.reliableHiddenOffsets=l&&f[0].offsetHeight===0,d.innerHTML="",d.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",b.boxSizing=d.offsetWidth===4,b.doesNotIncludeMarginInBodyOffset=i.offsetTop!==1,a.getComputedStyle&&(b.pixelPosition=(a.getComputedStyle(d,null)||{}).top!=="1%",b.boxSizingReliable=(a.getComputedStyle(d,null)||{width:"4px"}).width==="4px",g=e.createElement("div"),g.style.cssText=d.style.cssText=h,g.style.marginRight=g.style.width="0",d.style.width="1px",d.appendChild(g),b.reliableMarginRight=!parseFloat((a.getComputedStyle(g,null)||{}).marginRight)),typeof d.style.zoom!="undefined"&&(d.innerHTML="",d.style.cssText=h+"width:1px;padding:1px;display:inline;zoom:1",b.inlineBlockNeedsLayout=d.offsetWidth===3,d.style.display="block",d.style.overflow="visible",d.innerHTML="
",d.firstChild.style.width="5px",b.shrinkWrapBlocks=d.offsetWidth!==3,c.style.zoom=1),i.removeChild(c),c=d=f=g=null}),i.removeChild(n),c=d=f=g=h=i=n=null,b}();var H=/^(?:\{.*\}|\[.*\])$/,I=/([A-Z])/g;p.extend({cache:{},deletedIds:[],uuid:0,expando:"jQuery"+(p.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){return a=a.nodeType?p.cache[a[p.expando]]:a[p.expando],!!a&&!K(a)},data:function(a,c,d,e){if(!p.acceptData(a))return;var f,g,h=p.expando,i=typeof c=="string",j=a.nodeType,k=j?p.cache:a,l=j?a[h]:a[h]&&h;if((!l||!k[l]||!e&&!k[l].data)&&i&&d===b)return;l||(j?a[h]=l=p.deletedIds.pop()||++p.uuid:l=h),k[l]||(k[l]={},j||(k[l].toJSON=p.noop));if(typeof c=="object"||typeof c=="function")e?k[l]=p.extend(k[l],c):k[l].data=p.extend(k[l].data,c);return f=k[l],e||(f.data||(f.data={}),f=f.data),d!==b&&(f[p.camelCase(c)]=d),i?(g=f[c],g==null&&(g=f[p.camelCase(c)])):g=f,g},removeData:function(a,b,c){if(!p.acceptData(a))return;var d,e,f,g=a.nodeType,h=g?p.cache:a,i=g?a[p.expando]:p.expando;if(!h[i])return;if(b){d=c?h[i]:h[i].data;if(d){p.isArray(b)||(b in d?b=[b]:(b=p.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,f=b.length;e1,null,!1))},removeData:function(a){return this.each(function(){p.removeData(this,a)})}}),p.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=p._data(a,b),c&&(!d||p.isArray(c)?d=p._data(a,b,p.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=p.queue(a,b),d=c.shift(),e=p._queueHooks(a,b),f=function(){p.dequeue(a,b)};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),delete e.stop,d.call(a,f,e)),!c.length&&e&&e.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return p._data(a,c)||p._data(a,c,{empty:p.Callbacks("once memory").add(function(){p.removeData(a,b+"queue",!0),p.removeData(a,c,!0)})})}}),p.fn.extend({queue:function(a,c){var d=2;return typeof a!="string"&&(c=a,a="fx",d--),arguments.length1)},removeAttr:function(a){return this.each(function(){p.removeAttr(this,a)})},prop:function(a,b){return p.access(this,p.prop,a,b,arguments.length>1)},removeProp:function(a){return a=p.propFix[a]||a,this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,f,g,h;if(p.isFunction(a))return this.each(function(b){p(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(s);for(c=0,d=this.length;c-1)d=d.replace(" "+c[f]+" "," ");e.className=a?p.trim(d):""}}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";return p.isFunction(a)?this.each(function(c){p(this).toggleClass(a.call(this,c,this.className,b),b)}):this.each(function(){if(c==="string"){var e,f=0,g=p(this),h=b,i=a.split(s);while(e=i[f++])h=d?h:!g.hasClass(e),g[h?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&p._data(this,"__className__",this.className),this.className=this.className||a===!1?"":p._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c-1)return!0;return!1},val:function(a){var c,d,e,f=this[0];if(!arguments.length){if(f)return c=p.valHooks[f.type]||p.valHooks[f.nodeName.toLowerCase()],c&&"get"in c&&(d=c.get(f,"value"))!==b?d:(d=f.value,typeof d=="string"?d.replace(P,""):d==null?"":d);return}return e=p.isFunction(a),this.each(function(d){var f,g=p(this);if(this.nodeType!==1)return;e?f=a.call(this,d,g.val()):f=a,f==null?f="":typeof f=="number"?f+="":p.isArray(f)&&(f=p.map(f,function(a){return a==null?"":a+""})),c=p.valHooks[this.type]||p.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,f,"value")===b)this.value=f})}}),p.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,f=a.selectedIndex,g=[],h=a.options,i=a.type==="select-one";if(f<0)return null;c=i?f:0,d=i?f+1:h.length;for(;c=0}),c.length||(a.selectedIndex=-1),c}}},attrFn:{},attr:function(a,c,d,e){var f,g,h,i=a.nodeType;if(!a||i===3||i===8||i===2)return;if(e&&p.isFunction(p.fn[c]))return p(a)[c](d);if(typeof a.getAttribute=="undefined")return p.prop(a,c,d);h=i!==1||!p.isXMLDoc(a),h&&(c=c.toLowerCase(),g=p.attrHooks[c]||(T.test(c)?M:L));if(d!==b){if(d===null){p.removeAttr(a,c);return}return g&&"set"in g&&h&&(f=g.set(a,d,c))!==b?f:(a.setAttribute(c,""+d),d)}return g&&"get"in g&&h&&(f=g.get(a,c))!==null?f:(f=a.getAttribute(c),f===null?b:f)},removeAttr:function(a,b){var c,d,e,f,g=0;if(b&&a.nodeType===1){d=b.split(s);for(;g=0}})});var V=/^(?:textarea|input|select)$/i,W=/^([^\.]*|)(?:\.(.+)|)$/,X=/(?:^|\s)hover(\.\S+|)\b/,Y=/^key/,Z=/^(?:mouse|contextmenu)|click/,$=/^(?:focusinfocus|focusoutblur)$/,_=function(a){return p.event.special.hover?a:a.replace(X,"mouseenter$1 mouseleave$1")};p.event={add:function(a,c,d,e,f){var g,h,i,j,k,l,m,n,o,q,r;if(a.nodeType===3||a.nodeType===8||!c||!d||!(g=p._data(a)))return;d.handler&&(o=d,d=o.handler,f=o.selector),d.guid||(d.guid=p.guid++),i=g.events,i||(g.events=i={}),h=g.handle,h||(g.handle=h=function(a){return typeof p!="undefined"&&(!a||p.event.triggered!==a.type)?p.event.dispatch.apply(h.elem,arguments):b},h.elem=a),c=p.trim(_(c)).split(" ");for(j=0;j=0&&(s=s.slice(0,-1),i=!0),s.indexOf(".")>=0&&(t=s.split("."),s=t.shift(),t.sort());if((!f||p.event.customEvent[s])&&!p.event.global[s])return;c=typeof c=="object"?c[p.expando]?c:new p.Event(s,c):new p.Event(s),c.type=s,c.isTrigger=!0,c.exclusive=i,c.namespace=t.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+t.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,m=s.indexOf(":")<0?"on"+s:"";if(!f){h=p.cache;for(j in h)h[j].events&&h[j].events[s]&&p.event.trigger(c,d,h[j].handle.elem,!0);return}c.result=b,c.target||(c.target=f),d=d!=null?p.makeArray(d):[],d.unshift(c),n=p.event.special[s]||{};if(n.trigger&&n.trigger.apply(f,d)===!1)return;q=[[f,n.bindType||s]];if(!g&&!n.noBubble&&!p.isWindow(f)){r=n.delegateType||s,k=$.test(r+s)?f:f.parentNode;for(l=f;k;k=k.parentNode)q.push([k,r]),l=k;l===(f.ownerDocument||e)&&q.push([l.defaultView||l.parentWindow||a,r])}for(j=0;jq&&u.push({elem:this,matches:o.slice(q)});for(d=0;d0?this.on(b,null,a,c):this.trigger(b)},Y.test(b)&&(p.event.fixHooks[b]=p.event.keyHooks),Z.test(b)&&(p.event.fixHooks[b]=p.event.mouseHooks)}),function(a,b){function bd(a,b,c,d){var e=0,f=b.length;for(;e0?h(g,c,f):[]}function bf(a,c,d,e,f){var g,h,i,j,k,l,m,n,p=0,q=f.length,s=L.POS,t=new RegExp("^"+s.source+"(?!"+r+")","i"),u=function(){var a=1,c=arguments.length-2;for(;ai){m=a.slice(i,g.index),i=n,l=[c],B.test(m)&&(k&&(l=k),k=e);if(h=H.test(m))m=m.slice(0,-5).replace(B,"$&*");g.length>1&&g[0].replace(t,u),k=be(m,g[1],g[2],l,k,h)}}k?(j=j.concat(k),(m=a.slice(i))&&m!==")"?B.test(m)?bd(m,j,d,e):Z(m,c,d,e?e.concat(k):k):o.apply(d,j)):Z(a,c,d,e)}return q===1?d:Z.uniqueSort(d)}function bg(a,b,c){var d,e,f,g=[],i=0,j=D.exec(a),k=!j.pop()&&!j.pop(),l=k&&a.match(C)||[""],m=$.preFilter,n=$.filter,o=!c&&b!==h;for(;(e=l[i])!=null&&k;i++){g.push(d=[]),o&&(e=" "+e);while(e){k=!1;if(j=B.exec(e))e=e.slice(j[0].length),k=d.push({part:j.pop().replace(A," "),captures:j});for(f in n)(j=L[f].exec(e))&&(!m[f]||(j=m[f](j,b,c)))&&(e=e.slice(j.shift().length),k=d.push({part:f,captures:j}));if(!k)break}}return k||Z.error(a),g}function bh(a,b,e){var f=b.dir,g=m++;return a||(a=function(a){return a===e}),b.first?function(b,c){while(b=b[f])if(b.nodeType===1)return a(b,c)&&b}:function(b,e){var h,i=g+"."+d,j=i+"."+c;while(b=b[f])if(b.nodeType===1){if((h=b[q])===j)return b.sizset;if(typeof h=="string"&&h.indexOf(i)===0){if(b.sizset)return b}else{b[q]=j;if(a(b,e))return b.sizset=!0,b;b.sizset=!1}}}}function bi(a,b){return a?function(c,d){var e=b(c,d);return e&&a(e===!0?c:e,d)}:b}function bj(a,b,c){var d,e,f=0;for(;d=a[f];f++)$.relative[d.part]?e=bh(e,$.relative[d.part],b):(d.captures.push(b,c),e=bi(e,$.filter[d.part].apply(null,d.captures)));return e}function bk(a){return function(b,c){var d,e=0;for(;d=a[e];e++)if(d(b,c))return!0;return!1}}var c,d,e,f,g,h=a.document,i=h.documentElement,j="undefined",k=!1,l=!0,m=0,n=[].slice,o=[].push,q=("sizcache"+Math.random()).replace(".",""),r="[\\x20\\t\\r\\n\\f]",s="(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",t=s.replace("w","w#"),u="([*^$|!~]?=)",v="\\["+r+"*("+s+")"+r+"*(?:"+u+r+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+t+")|)|)"+r+"*\\]",w=":("+s+")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|((?:[^,]|\\\\,|(?:,(?=[^\\[]*\\]))|(?:,(?=[^\\(]*\\))))*))\\)|)",x=":(nth|eq|gt|lt|first|last|even|odd)(?:\\((\\d*)\\)|)(?=[^-]|$)",y=r+"*([\\x20\\t\\r\\n\\f>+~])"+r+"*",z="(?=[^\\x20\\t\\r\\n\\f])(?:\\\\.|"+v+"|"+w.replace(2,7)+"|[^\\\\(),])+",A=new RegExp("^"+r+"+|((?:^|[^\\\\])(?:\\\\.)*)"+r+"+$","g"),B=new RegExp("^"+y),C=new RegExp(z+"?(?="+r+"*,|$)","g"),D=new RegExp("^(?:(?!,)(?:(?:^|,)"+r+"*"+z+")*?|"+r+"*(.*?))(\\)|$)"),E=new RegExp(z.slice(19,-6)+"\\x20\\t\\r\\n\\f>+~])+|"+y,"g"),F=/^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,G=/[\x20\t\r\n\f]*[+~]/,H=/:not\($/,I=/h\d/i,J=/input|select|textarea|button/i,K=/\\(?!\\)/g,L={ID:new RegExp("^#("+s+")"),CLASS:new RegExp("^\\.("+s+")"),NAME:new RegExp("^\\[name=['\"]?("+s+")['\"]?\\]"),TAG:new RegExp("^("+s.replace("[-","[-\\*")+")"),ATTR:new RegExp("^"+v),PSEUDO:new RegExp("^"+w),CHILD:new RegExp("^:(only|nth|last|first)-child(?:\\("+r+"*(even|odd|(([+-]|)(\\d*)n|)"+r+"*(?:([+-]|)"+r+"*(\\d+)|))"+r+"*\\)|)","i"),POS:new RegExp(x,"ig"),needsContext:new RegExp("^"+r+"*[>+~]|"+x,"i")},M={},N=[],O={},P=[],Q=function(a){return a.sizzleFilter=!0,a},R=function(a){return function(b){return b.nodeName.toLowerCase()==="input"&&b.type===a}},S=function(a){return function(b){var c=b.nodeName.toLowerCase();return(c==="input"||c==="button")&&b.type===a}},T=function(a){var b=!1,c=h.createElement("div");try{b=a(c)}catch(d){}return c=null,b},U=T(function(a){a.innerHTML="";var b=typeof a.lastChild.getAttribute("multiple");return b!=="boolean"&&b!=="string"}),V=T(function(a){a.id=q+0,a.innerHTML="
",i.insertBefore(a,i.firstChild);var b=h.getElementsByName&&h.getElementsByName(q).length===2+h.getElementsByName(q+0).length;return g=!h.getElementById(q),i.removeChild(a),b}),W=T(function(a){return a.appendChild(h.createComment("")),a.getElementsByTagName("*").length===0}),X=T(function(a){return a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!==j&&a.firstChild.getAttribute("href")==="#"}),Y=T(function(a){return a.innerHTML="",!a.getElementsByClassName||a.getElementsByClassName("e").length===0?!1:(a.lastChild.className="e",a.getElementsByClassName("e").length!==1)}),Z=function(a,b,c,d){c=c||[],b=b||h;var e,f,g,i,j=b.nodeType;if(j!==1&&j!==9)return[];if(!a||typeof a!="string")return c;g=ba(b);if(!g&&!d)if(e=F.exec(a))if(i=e[1]){if(j===9){f=b.getElementById(i);if(!f||!f.parentNode)return c;if(f.id===i)return c.push(f),c}else if(b.ownerDocument&&(f=b.ownerDocument.getElementById(i))&&bb(b,f)&&f.id===i)return c.push(f),c}else{if(e[2])return o.apply(c,n.call(b.getElementsByTagName(a),0)),c;if((i=e[3])&&Y&&b.getElementsByClassName)return o.apply(c,n.call(b.getElementsByClassName(i),0)),c}return bm(a,b,c,d,g)},$=Z.selectors={cacheLength:50,match:L,order:["ID","TAG"],attrHandle:{},createPseudo:Q,find:{ID:g?function(a,b,c){if(typeof b.getElementById!==j&&!c){var d=b.getElementById(a);return d&&d.parentNode?[d]:[]}}:function(a,c,d){if(typeof c.getElementById!==j&&!d){var e=c.getElementById(a);return e?e.id===a||typeof e.getAttributeNode!==j&&e.getAttributeNode("id").value===a?[e]:b:[]}},TAG:W?function(a,b){if(typeof b.getElementsByTagName!==j)return b.getElementsByTagName(a)}:function(a,b){var c=b.getElementsByTagName(a);if(a==="*"){var d,e=[],f=0;for(;d=c[f];f++)d.nodeType===1&&e.push(d);return e}return c}},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(K,""),a[3]=(a[4]||a[5]||"").replace(K,""),a[2]==="~="&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),a[1]==="nth"?(a[2]||Z.error(a[0]),a[3]=+(a[3]?a[4]+(a[5]||1):2*(a[2]==="even"||a[2]==="odd")),a[4]=+(a[6]+a[7]||a[2]==="odd")):a[2]&&Z.error(a[0]),a},PSEUDO:function(a){var b,c=a[4];return L.CHILD.test(a[0])?null:(c&&(b=D.exec(c))&&b.pop()&&(a[0]=a[0].slice(0,b[0].length-c.length-1),c=b[0].slice(0,-1)),a.splice(2,3,c||a[3]),a)}},filter:{ID:g?function(a){return a=a.replace(K,""),function(b){return b.getAttribute("id")===a}}:function(a){return a=a.replace(K,""),function(b){var c=typeof b.getAttributeNode!==j&&b.getAttributeNode("id");return c&&c.value===a}},TAG:function(a){return a==="*"?function(){return!0}:(a=a.replace(K,"").toLowerCase(),function(b){return b.nodeName&&b.nodeName.toLowerCase()===a})},CLASS:function(a){var b=M[a];return b||(b=M[a]=new RegExp("(^|"+r+")"+a+"("+r+"|$)"),N.push(a),N.length>$.cacheLength&&delete M[N.shift()]),function(a){return b.test(a.className||typeof a.getAttribute!==j&&a.getAttribute("class")||"")}},ATTR:function(a,b,c){return b?function(d){var e=Z.attr(d,a),f=e+"";if(e==null)return b==="!=";switch(b){case"=":return f===c;case"!=":return f!==c;case"^=":return c&&f.indexOf(c)===0;case"*=":return c&&f.indexOf(c)>-1;case"$=":return c&&f.substr(f.length-c.length)===c;case"~=":return(" "+f+" ").indexOf(c)>-1;case"|=":return f===c||f.substr(0,c.length+1)===c+"-"}}:function(b){return Z.attr(b,a)!=null}},CHILD:function(a,b,c,d){if(a==="nth"){var e=m++;return function(a){var b,f,g=0,h=a;if(c===1&&d===0)return!0;b=a.parentNode;if(b&&(b[q]!==e||!a.sizset)){for(h=b.firstChild;h;h=h.nextSibling)if(h.nodeType===1){h.sizset=++g;if(h===a)break}b[q]=e}return f=a.sizset-d,c===0?f===0:f%c===0&&f/c>=0}}return function(b){var c=b;switch(a){case"only":case"first":while(c=c.previousSibling)if(c.nodeType===1)return!1;if(a==="first")return!0;c=b;case"last":while(c=c.nextSibling)if(c.nodeType===1)return!1;return!0}}},PSEUDO:function(a,b,c,d){var e=$.pseudos[a]||$.pseudos[a.toLowerCase()];return e||Z.error("unsupported pseudo: "+a),e.sizzleFilter?e(b,c,d):e}},pseudos:{not:Q(function(a,b,c){var d=bl(a.replace(A,"$1"),b,c);return function(a){return!d(a)}}),enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&!!a.checked||b==="option"&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},parent:function(a){return!$.pseudos.empty(a)},empty:function(a){var b;a=a.firstChild;while(a){if(a.nodeName>"@"||(b=a.nodeType)===3||b===4)return!1;a=a.nextSibling}return!0},contains:Q(function(a){return function(b){return(b.textContent||b.innerText||bc(b)).indexOf(a)>-1}}),has:Q(function(a){return function(b){return Z(a,b).length>0}}),header:function(a){return I.test(a.nodeName)},text:function(a){var b,c;return a.nodeName.toLowerCase()==="input"&&(b=a.type)==="text"&&((c=a.getAttribute("type"))==null||c.toLowerCase()===b)},radio:R("radio"),checkbox:R("checkbox"),file:R("file"),password:R("password"),image:R("image"),submit:S("submit"),reset:S("reset"),button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&a.type==="button"||b==="button"},input:function(a){return J.test(a.nodeName)},focus:function(a){var b=a.ownerDocument;return a===b.activeElement&&(!b.hasFocus||b.hasFocus())&&(!!a.type||!!a.href)},active:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b,c){return c?a.slice(1):[a[0]]},last:function(a,b,c){var d=a.pop();return c?a:[d]},even:function(a,b,c){var d=[],e=c?1:0,f=a.length;for(;e$.cacheLength&&delete O[P.shift()],g};Z.matches=function(a,b){return Z(a,null,null,b)},Z.matchesSelector=function(a,b){return Z(b,null,null,[a]).length>0};var bm=function(a,b,e,f,g){a=a.replace(A,"$1");var h,i,j,k,l,m,p,q,r,s=a.match(C),t=a.match(E),u=b.nodeType;if(L.POS.test(a))return bf(a,b,e,f,s);if(f)h=n.call(f,0);else if(s&&s.length===1){if(t.length>1&&u===9&&!g&&(s=L.ID.exec(t[0]))){b=$.find.ID(s[1],b,g)[0];if(!b)return e;a=a.slice(t.shift().length)}q=(s=G.exec(t[0]))&&!s.index&&b.parentNode||b,r=t.pop(),m=r.split(":not")[0];for(j=0,k=$.order.length;j",a.querySelectorAll("[selected]").length||e.push("\\["+r+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)"),a.querySelectorAll(":checked").length||e.push(":checked")}),T(function(a){a.innerHTML="

",a.querySelectorAll("[test^='']").length&&e.push("[*^$]="+r+"*(?:\"\"|'')"),a.innerHTML="",a.querySelectorAll(":enabled").length||e.push(":enabled",":disabled")}),e=e.length&&new RegExp(e.join("|")),bm=function(a,d,f,g,h){if(!g&&!h&&(!e||!e.test(a)))if(d.nodeType===9)try{return o.apply(f,n.call(d.querySelectorAll(a),0)),f}catch(i){}else if(d.nodeType===1&&d.nodeName.toLowerCase()!=="object"){var j=d.getAttribute("id"),k=j||q,l=G.test(a)&&d.parentNode||d;j?k=k.replace(c,"\\$&"):d.setAttribute("id",k);try{return o.apply(f,n.call(l.querySelectorAll(a.replace(C,"[id='"+k+"'] $&")),0)),f}catch(i){}finally{j||d.removeAttribute("id")}}return b(a,d,f,g,h)},g&&(T(function(b){a=g.call(b,"div");try{g.call(b,"[test!='']:sizzle"),f.push($.match.PSEUDO)}catch(c){}}),f=new RegExp(f.join("|")),Z.matchesSelector=function(b,c){c=c.replace(d,"='$1']");if(!ba(b)&&!f.test(c)&&(!e||!e.test(c)))try{var h=g.call(b,c);if(h||a||b.document&&b.document.nodeType!==11)return h}catch(i){}return Z(c,null,null,[b]).length>0})}(),Z.attr=p.attr,p.find=Z,p.expr=Z.selectors,p.expr[":"]=p.expr.pseudos,p.unique=Z.uniqueSort,p.text=Z.getText,p.isXMLDoc=Z.isXML,p.contains=Z.contains}(a);var bc=/Until$/,bd=/^(?:parents|prev(?:Until|All))/,be=/^.[^:#\[\.,]*$/,bf=p.expr.match.needsContext,bg={children:!0,contents:!0,next:!0,prev:!0};p.fn.extend({find:function(a){var b,c,d,e,f,g,h=this;if(typeof a!="string")return p(a).filter(function(){for(b=0,c=h.length;b0)for(e=d;e=0:p.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c,d=0,e=this.length,f=[],g=bf.test(a)||typeof a!="string"?p(a,b||this.context):0;for(;d-1:p.find.matchesSelector(c,a)){f.push(c);break}c=c.parentNode}}return f=f.length>1?p.unique(f):f,this.pushStack(f,"closest",a)},index:function(a){return a?typeof a=="string"?p.inArray(this[0],p(a)):p.inArray(a.jquery?a[0]:a,this):this[0]&&this[0].parentNode?this.prevAll().length:-1},add:function(a,b){var c=typeof a=="string"?p(a,b):p.makeArray(a&&a.nodeType?[a]:a),d=p.merge(this.get(),c);return this.pushStack(bh(c[0])||bh(d[0])?d:p.unique(d))},addBack:function(a){return this.add(a==null?this.prevObject:this.prevObject.filter(a))}}),p.fn.andSelf=p.fn.addBack,p.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return p.dir(a,"parentNode")},parentsUntil:function(a,b,c){return p.dir(a,"parentNode",c)},next:function(a){return bi(a,"nextSibling")},prev:function(a){return bi(a,"previousSibling")},nextAll:function(a){return p.dir(a,"nextSibling")},prevAll:function(a){return p.dir(a,"previousSibling")},nextUntil:function(a,b,c){return p.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return p.dir(a,"previousSibling",c)},siblings:function(a){return p.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return p.sibling(a.firstChild)},contents:function(a){return p.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:p.merge([],a.childNodes)}},function(a,b){p.fn[a]=function(c,d){var e=p.map(this,b,c);return bc.test(a)||(d=c),d&&typeof d=="string"&&(e=p.filter(d,e)),e=this.length>1&&!bg[a]?p.unique(e):e,this.length>1&&bd.test(a)&&(e=e.reverse()),this.pushStack(e,a,k.call(arguments).join(","))}}),p.extend({filter:function(a,b,c){return c&&(a=":not("+a+")"),b.length===1?p.find.matchesSelector(b[0],a)?[b[0]]:[]:p.find.matches(a,b)},dir:function(a,c,d){var e=[],f=a[c];while(f&&f.nodeType!==9&&(d===b||f.nodeType!==1||!p(f).is(d)))f.nodeType===1&&e.push(f),f=f[c];return e},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var bl="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",bm=/ jQuery\d+="(?:null|\d+)"/g,bn=/^\s+/,bo=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,bp=/<([\w:]+)/,bq=/]","i"),bv=/^(?:checkbox|radio)$/,bw=/checked\s*(?:[^=]|=\s*.checked.)/i,bx=/\/(java|ecma)script/i,by=/^\s*\s*$/g,bz={option:[1,""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]},bA=bk(e),bB=bA.appendChild(e.createElement("div"));bz.optgroup=bz.option,bz.tbody=bz.tfoot=bz.colgroup=bz.caption=bz.thead,bz.th=bz.td,p.support.htmlSerialize||(bz._default=[1,"X
","
"]),p.fn.extend({text:function(a){return p.access(this,function(a){return a===b?p.text(this):this.empty().append((this[0]&&this[0].ownerDocument||e).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(p.isFunction(a))return this.each(function(b){p(this).wrapAll(a.call(this,b))});if(this[0]){var b=p(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){return p.isFunction(a)?this.each(function(b){p(this).wrapInner(a.call(this,b))}):this.each(function(){var b=p(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=p.isFunction(a);return this.each(function(c){p(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){p.nodeName(this,"body")||p(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){(this.nodeType===1||this.nodeType===11)&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){(this.nodeType===1||this.nodeType===11)&&this.insertBefore(a,this.firstChild)})},before:function(){if(!bh(this[0]))return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=p.clean(arguments);return this.pushStack(p.merge(a,this),"before",this.selector)}},after:function(){if(!bh(this[0]))return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=p.clean(arguments);return this.pushStack(p.merge(this,a),"after",this.selector)}},remove:function(a,b){var c,d=0;for(;(c=this[d])!=null;d++)if(!a||p.filter(a,[c]).length)!b&&c.nodeType===1&&(p.cleanData(c.getElementsByTagName("*")),p.cleanData([c])),c.parentNode&&c.parentNode.removeChild(c);return this},empty:function(){var a,b=0;for(;(a=this[b])!=null;b++){a.nodeType===1&&p.cleanData(a.getElementsByTagName("*"));while(a.firstChild)a.removeChild(a.firstChild)}return this},clone:function(a,b){return a=a==null?!1:a,b=b==null?a:b,this.map(function(){return p.clone(this,a,b)})},html:function(a){return p.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(bm,""):b;if(typeof a=="string"&&!bs.test(a)&&(p.support.htmlSerialize||!bu.test(a))&&(p.support.leadingWhitespace||!bn.test(a))&&!bz[(bp.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(bo,"<$1>");try{for(;d1&&typeof j=="string"&&bw.test(j))return this.each(function(){p(this).domManip(a,c,d)});if(p.isFunction(j))return this.each(function(e){var f=p(this);a[0]=j.call(this,e,c?f.html():b),f.domManip(a,c,d)});if(this[0]){e=p.buildFragment(a,this,k),g=e.fragment,f=g.firstChild,g.childNodes.length===1&&(g=f);if(f){c=c&&p.nodeName(f,"tr");for(h=e.cacheable||l-1;i0?this.clone(!0):this).get(),p(g[e])[b](d),f=f.concat(d);return this.pushStack(f,a,g.selector)}}),p.extend({clone:function(a,b,c){var d,e,f,g;p.support.html5Clone||p.isXMLDoc(a)||!bu.test("<"+a.nodeName+">")?g=a.cloneNode(!0):(bB.innerHTML=a.outerHTML,bB.removeChild(g=bB.firstChild));if((!p.support.noCloneEvent||!p.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!p.isXMLDoc(a)){bE(a,g),d=bF(a),e=bF(g);for(f=0;d[f];++f)e[f]&&bE(d[f],e[f])}if(b){bD(a,g);if(c){d=bF(a),e=bF(g);for(f=0;d[f];++f)bD(d[f],e[f])}}return d=e=null,g},clean:function(a,b,c,d){var f,g,h,i,j,k,l,m,n,o,q,r,s=0,t=[];if(!b||typeof b.createDocumentFragment=="undefined")b=e;for(g=b===e&&bA;(h=a[s])!=null;s++){typeof h=="number"&&(h+="");if(!h)continue;if(typeof h=="string")if(!br.test(h))h=b.createTextNode(h);else{g=g||bk(b),l=l||g.appendChild(b.createElement("div")),h=h.replace(bo,"<$1>"),i=(bp.exec(h)||["",""])[1].toLowerCase(),j=bz[i]||bz._default,k=j[0],l.innerHTML=j[1]+h+j[2];while(k--)l=l.lastChild;if(!p.support.tbody){m=bq.test(h),n=i==="table"&&!m?l.firstChild&&l.firstChild.childNodes:j[1]===""&&!m?l.childNodes:[];for(f=n.length-1;f>=0;--f)p.nodeName(n[f],"tbody")&&!n[f].childNodes.length&&n[f].parentNode.removeChild(n[f])}!p.support.leadingWhitespace&&bn.test(h)&&l.insertBefore(b.createTextNode(bn.exec(h)[0]),l.firstChild),h=l.childNodes,l=g.lastChild}h.nodeType?t.push(h):t=p.merge(t,h)}l&&(g.removeChild(l),h=l=g=null);if(!p.support.appendChecked)for(s=0;(h=t[s])!=null;s++)p.nodeName(h,"input")?bG(h):typeof h.getElementsByTagName!="undefined"&&p.grep(h.getElementsByTagName("input"),bG);if(c){q=function(a){if(!a.type||bx.test(a.type))return d?d.push(a.parentNode?a.parentNode.removeChild(a):a):c.appendChild(a)};for(s=0;(h=t[s])!=null;s++)if(!p.nodeName(h,"script")||!q(h))c.appendChild(h),typeof h.getElementsByTagName!="undefined"&&(r=p.grep(p.merge([],h.getElementsByTagName("script")),q),t.splice.apply(t,[s+1,0].concat(r)),s+=r.length)}return t},cleanData:function(a,b){var c,d,e,f,g=0,h=p.expando,i=p.cache,j=p.support.deleteExpando,k=p.event.special;for(;(e=a[g])!=null;g++)if(b||p.acceptData(e)){d=e[h],c=d&&i[d];if(c){if(c.events)for(f in c.events)k[f]?p.event.remove(e,f):p.removeEvent(e,f,c.handle);i[d]&&(delete i[d],j?delete e[h]:e.removeAttribute?e.removeAttribute(h):e[h]=null,p.deletedIds.push(d))}}}}),function(){var a,b;p.uaMatch=function(a){a=a.toLowerCase();var b=/(chrome)[ \/]([\w.]+)/.exec(a)||/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||a.indexOf("compatible")<0&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},a=p.uaMatch(g.userAgent),b={},a.browser&&(b[a.browser]=!0,b.version=a.version),b.webkit&&(b.safari=!0),p.browser=b,p.sub=function(){function a(b,c){return new a.fn.init(b,c)}p.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function c(c,d){return d&&d instanceof p&&!(d instanceof a)&&(d=a(d)),p.fn.init.call(this,c,d,b)},a.fn.init.prototype=a.fn;var b=a(e);return a}}();var bH,bI,bJ,bK=/alpha\([^)]*\)/i,bL=/opacity=([^)]*)/,bM=/^(top|right|bottom|left)$/,bN=/^margin/,bO=new RegExp("^("+q+")(.*)$","i"),bP=new RegExp("^("+q+")(?!px)[a-z%]+$","i"),bQ=new RegExp("^([-+])=("+q+")","i"),bR={},bS={position:"absolute",visibility:"hidden",display:"block"},bT={letterSpacing:0,fontWeight:400,lineHeight:1},bU=["Top","Right","Bottom","Left"],bV=["Webkit","O","Moz","ms"],bW=p.fn.toggle;p.fn.extend({css:function(a,c){return p.access(this,function(a,c,d){return d!==b?p.style(a,c,d):p.css(a,c)},a,c,arguments.length>1)},show:function(){return bZ(this,!0)},hide:function(){return bZ(this)},toggle:function(a,b){var c=typeof a=="boolean";return p.isFunction(a)&&p.isFunction(b)?bW.apply(this,arguments):this.each(function(){(c?a:bY(this))?p(this).show():p(this).hide()})}}),p.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bH(a,"opacity");return c===""?"1":c}}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":p.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!a||a.nodeType===3||a.nodeType===8||!a.style)return;var f,g,h,i=p.camelCase(c),j=a.style;c=p.cssProps[i]||(p.cssProps[i]=bX(j,i)),h=p.cssHooks[c]||p.cssHooks[i];if(d===b)return h&&"get"in h&&(f=h.get(a,!1,e))!==b?f:j[c];g=typeof d,g==="string"&&(f=bQ.exec(d))&&(d=(f[1]+1)*f[2]+parseFloat(p.css(a,c)),g="number");if(d==null||g==="number"&&isNaN(d))return;g==="number"&&!p.cssNumber[i]&&(d+="px");if(!h||!("set"in h)||(d=h.set(a,d,e))!==b)try{j[c]=d}catch(k){}},css:function(a,c,d,e){var f,g,h,i=p.camelCase(c);return c=p.cssProps[i]||(p.cssProps[i]=bX(a.style,i)),h=p.cssHooks[c]||p.cssHooks[i],h&&"get"in h&&(f=h.get(a,!0,e)),f===b&&(f=bH(a,c)),f==="normal"&&c in bT&&(f=bT[c]),d||e!==b?(g=parseFloat(f),d||p.isNumeric(g)?g||0:f):f},swap:function(a,b,c){var d,e,f={};for(e in b)f[e]=a.style[e],a.style[e]=b[e];d=c.call(a);for(e in b)a.style[e]=f[e];return d}}),a.getComputedStyle?bH=function(a,b){var c,d,e,f,g=getComputedStyle(a,null),h=a.style;return g&&(c=g[b],c===""&&!p.contains(a.ownerDocument.documentElement,a)&&(c=p.style(a,b)),bP.test(c)&&bN.test(b)&&(d=h.width,e=h.minWidth,f=h.maxWidth,h.minWidth=h.maxWidth=h.width=c,c=g.width,h.width=d,h.minWidth=e,h.maxWidth=f)),c}:e.documentElement.currentStyle&&(bH=function(a,b){var c,d,e=a.currentStyle&&a.currentStyle[b],f=a.style;return e==null&&f&&f[b]&&(e=f[b]),bP.test(e)&&!bM.test(b)&&(c=f.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":e,e=f.pixelLeft+"px",f.left=c,d&&(a.runtimeStyle.left=d)),e===""?"auto":e}),p.each(["height","width"],function(a,b){p.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth!==0||bH(a,"display")!=="none"?ca(a,b,d):p.swap(a,bS,function(){return ca(a,b,d)})},set:function(a,c,d){return b$(a,c,d?b_(a,b,d,p.support.boxSizing&&p.css(a,"boxSizing")==="border-box"):0)}}}),p.support.opacity||(p.cssHooks.opacity={get:function(a,b){return bL.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=p.isNumeric(b)?"alpha(opacity="+b*100+")":"",f=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&p.trim(f.replace(bK,""))===""&&c.removeAttribute){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bK.test(f)?f.replace(bK,e):f+" "+e}}),p(function(){p.support.reliableMarginRight||(p.cssHooks.marginRight={get:function(a,b){return p.swap(a,{display:"inline-block"},function(){if(b)return bH(a,"marginRight")})}}),!p.support.pixelPosition&&p.fn.position&&p.each(["top","left"],function(a,b){p.cssHooks[b]={get:function(a,c){if(c){var d=bH(a,b);return bP.test(d)?p(a).position()[b]+"px":d}}}})}),p.expr&&p.expr.filters&&(p.expr.filters.hidden=function(a){return a.offsetWidth===0&&a.offsetHeight===0||!p.support.reliableHiddenOffsets&&(a.style&&a.style.display||bH(a,"display"))==="none"},p.expr.filters.visible=function(a){return!p.expr.filters.hidden(a)}),p.each({margin:"",padding:"",border:"Width"},function(a,b){p.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bU[d]+b]=e[d]||e[d-2]||e[0];return f}},bN.test(a)||(p.cssHooks[a+b].set=b$)});var cc=/%20/g,cd=/\[\]$/,ce=/\r?\n/g,cf=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,cg=/^(?:select|textarea)/i;p.fn.extend({serialize:function(){return p.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?p.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||cg.test(this.nodeName)||cf.test(this.type))}).map(function(a,b){var c=p(this).val();return c==null?null:p.isArray(c)?p.map(c,function(a,c){return{name:b.name,value:a.replace(ce,"\r\n")}}):{name:b.name,value:c.replace(ce,"\r\n")}}).get()}}),p.param=function(a,c){var d,e=[],f=function(a,b){b=p.isFunction(b)?b():b==null?"":b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=p.ajaxSettings&&p.ajaxSettings.traditional);if(p.isArray(a)||a.jquery&&!p.isPlainObject(a))p.each(a,function(){f(this.name,this.value)});else for(d in a)ch(d,a[d],c,f);return e.join("&").replace(cc,"+")};var ci,cj,ck=/#.*$/,cl=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,cm=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,cn=/^(?:GET|HEAD)$/,co=/^\/\//,cp=/\?/,cq=/)<[^<]*)*<\/script>/gi,cr=/([?&])_=[^&]*/,cs=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,ct=p.fn.load,cu={},cv={},cw=["*/"]+["*"];try{ci=f.href}catch(cx){ci=e.createElement("a"),ci.href="",ci=ci.href}cj=cs.exec(ci.toLowerCase())||[],p.fn.load=function(a,c,d){if(typeof a!="string"&&ct)return ct.apply(this,arguments);if(!this.length)return this;var e,f,g,h=this,i=a.indexOf(" ");return i>=0&&(e=a.slice(i,a.length),a=a.slice(0,i)),p.isFunction(c)?(d=c,c=b):typeof c=="object"&&(f="POST"),p.ajax({url:a,type:f,dataType:"html",data:c,complete:function(a,b){d&&h.each(d,g||[a.responseText,b,a])}}).done(function(a){g=arguments,h.html(e?p("
").append(a.replace(cq,"")).find(e):a)}),this},p.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){p.fn[b]=function(a){return this.on(b,a)}}),p.each(["get","post"],function(a,c){p[c]=function(a,d,e,f){return p.isFunction(d)&&(f=f||e,e=d,d=b),p.ajax({type:c,url:a,data:d,success:e,dataType:f})}}),p.extend({getScript:function(a,c){return p.get(a,b,c,"script")},getJSON:function(a,b,c){return p.get(a,b,c,"json")},ajaxSetup:function(a,b){return b?cA(a,p.ajaxSettings):(b=a,a=p.ajaxSettings),cA(a,b),a},ajaxSettings:{url:ci,isLocal:cm.test(cj[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":cw},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":p.parseJSON,"text xml":p.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:cy(cu),ajaxTransport:cy(cv),ajax:function(a,c){function y(a,c,f,i){var k,s,t,u,w,y=c;if(v===2)return;v=2,h&&clearTimeout(h),g=b,e=i||"",x.readyState=a>0?4:0,f&&(u=cB(l,x,f));if(a>=200&&a<300||a===304)l.ifModified&&(w=x.getResponseHeader("Last-Modified"),w&&(p.lastModified[d]=w),w=x.getResponseHeader("Etag"),w&&(p.etag[d]=w)),a===304?(y="notmodified",k=!0):(k=cC(l,u),y=k.state,s=k.data,t=k.error,k=!t);else{t=y;if(!y||a)y="error",a<0&&(a=0)}x.status=a,x.statusText=""+(c||y),k?o.resolveWith(m,[s,y,x]):o.rejectWith(m,[x,y,t]),x.statusCode(r),r=b,j&&n.trigger("ajax"+(k?"Success":"Error"),[x,l,k?s:t]),q.fireWith(m,[x,y]),j&&(n.trigger("ajaxComplete",[x,l]),--p.active||p.event.trigger("ajaxStop"))}typeof a=="object"&&(c=a,a=b),c=c||{};var d,e,f,g,h,i,j,k,l=p.ajaxSetup({},c),m=l.context||l,n=m!==l&&(m.nodeType||m instanceof p)?p(m):p.event,o=p.Deferred(),q=p.Callbacks("once memory"),r=l.statusCode||{},t={},u={},v=0,w="canceled",x={readyState:0,setRequestHeader:function(a,b){if(!v){var c=a.toLowerCase();a=u[c]=u[c]||a,t[a]=b}return this},getAllResponseHeaders:function(){return v===2?e:null},getResponseHeader:function(a){var c;if(v===2){if(!f){f={};while(c=cl.exec(e))f[c[1].toLowerCase()]=c[2]}c=f[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){return v||(l.mimeType=a),this},abort:function(a){return a=a||w,g&&g.abort(a),y(0,a),this}};o.promise(x),x.success=x.done,x.error=x.fail,x.complete=q.add,x.statusCode=function(a){if(a){var b;if(v<2)for(b in a)r[b]=[r[b],a[b]];else b=a[x.status],x.always(b)}return this},l.url=((a||l.url)+"").replace(ck,"").replace(co,cj[1]+"//"),l.dataTypes=p.trim(l.dataType||"*").toLowerCase().split(s),l.crossDomain==null&&(i=cs.exec(l.url.toLowerCase()),l.crossDomain=!(!i||i[1]==cj[1]&&i[2]==cj[2]&&(i[3]||(i[1]==="http:"?80:443))==(cj[3]||(cj[1]==="http:"?80:443)))),l.data&&l.processData&&typeof l.data!="string"&&(l.data=p.param(l.data,l.traditional)),cz(cu,l,c,x);if(v===2)return x;j=l.global,l.type=l.type.toUpperCase(),l.hasContent=!cn.test(l.type),j&&p.active++===0&&p.event.trigger("ajaxStart");if(!l.hasContent){l.data&&(l.url+=(cp.test(l.url)?"&":"?")+l.data,delete l.data),d=l.url;if(l.cache===!1){var z=p.now(),A=l.url.replace(cr,"$1_="+z);l.url=A+(A===l.url?(cp.test(l.url)?"&":"?")+"_="+z:"")}}(l.data&&l.hasContent&&l.contentType!==!1||c.contentType)&&x.setRequestHeader("Content-Type",l.contentType),l.ifModified&&(d=d||l.url,p.lastModified[d]&&x.setRequestHeader("If-Modified-Since",p.lastModified[d]),p.etag[d]&&x.setRequestHeader("If-None-Match",p.etag[d])),x.setRequestHeader("Accept",l.dataTypes[0]&&l.accepts[l.dataTypes[0]]?l.accepts[l.dataTypes[0]]+(l.dataTypes[0]!=="*"?", "+cw+"; q=0.01":""):l.accepts["*"]);for(k in l.headers)x.setRequestHeader(k,l.headers[k]);if(!l.beforeSend||l.beforeSend.call(m,x,l)!==!1&&v!==2){w="abort";for(k in{success:1,error:1,complete:1})x[k](l[k]);g=cz(cv,l,c,x);if(!g)y(-1,"No Transport");else{x.readyState=1,j&&n.trigger("ajaxSend",[x,l]),l.async&&l.timeout>0&&(h=setTimeout(function(){x.abort("timeout")},l.timeout));try{v=1,g.send(t,y)}catch(B){if(v<2)y(-1,B);else throw B}}return x}return x.abort()},active:0,lastModified:{},etag:{}});var cD=[],cE=/\?/,cF=/(=)\?(?=&|$)|\?\?/,cG=p.now();p.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=cD.pop()||p.expando+"_"+cG++;return this[a]=!0,a}}),p.ajaxPrefilter("json jsonp",function(c,d,e){var f,g,h,i=c.data,j=c.url,k=c.jsonp!==!1,l=k&&cF.test(j),m=k&&!l&&typeof i=="string"&&!(c.contentType||"").indexOf("application/x-www-form-urlencoded")&&cF.test(i);if(c.dataTypes[0]==="jsonp"||l||m)return f=c.jsonpCallback=p.isFunction(c.jsonpCallback)?c.jsonpCallback():c.jsonpCallback,g=a[f],l?c.url=j.replace(cF,"$1"+f):m?c.data=i.replace(cF,"$1"+f):k&&(c.url+=(cE.test(j)?"&":"?")+c.jsonp+"="+f),c.converters["script json"]=function(){return h||p.error(f+" was not called"),h[0]},c.dataTypes[0]="json",a[f]=function(){h=arguments},e.always(function(){a[f]=g,c[f]&&(c.jsonpCallback=d.jsonpCallback,cD.push(f)),h&&p.isFunction(g)&&g(h[0]),h=g=b}),"script"}),p.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){return p.globalEval(a),a}}}),p.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),p.ajaxTransport("script",function(a){if(a.crossDomain){var c,d=e.head||e.getElementsByTagName("head")[0]||e.documentElement;return{send:function(f,g){c=e.createElement("script"),c.async="async",a.scriptCharset&&(c.charset=a.scriptCharset),c.src=a.url,c.onload=c.onreadystatechange=function(a,e){if(e||!c.readyState||/loaded|complete/.test(c.readyState))c.onload=c.onreadystatechange=null,d&&c.parentNode&&d.removeChild(c),c=b,e||g(200,"success")},d.insertBefore(c,d.firstChild)},abort:function(){c&&c.onload(0,1)}}}});var cH,cI=a.ActiveXObject?function(){for(var a in cH)cH[a](0,1)}:!1,cJ=0;p.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&cK()||cL()}:cK,function(a){p.extend(p.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(p.ajaxSettings.xhr()),p.support.ajax&&p.ajaxTransport(function(c){if(!c.crossDomain||p.support.cors){var d;return{send:function(e,f){var g,h,i=c.xhr();c.username?i.open(c.type,c.url,c.async,c.username,c.password):i.open(c.type,c.url,c.async);if(c.xhrFields)for(h in c.xhrFields)i[h]=c.xhrFields[h];c.mimeType&&i.overrideMimeType&&i.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(h in e)i.setRequestHeader(h,e[h])}catch(j){}i.send(c.hasContent&&c.data||null),d=function(a,e){var h,j,k,l,m;try{if(d&&(e||i.readyState===4)){d=b,g&&(i.onreadystatechange=p.noop,cI&&delete cH[g]);if(e)i.readyState!==4&&i.abort();else{h=i.status,k=i.getAllResponseHeaders(),l={},m=i.responseXML,m&&m.documentElement&&(l.xml=m);try{l.text=i.responseText}catch(a){}try{j=i.statusText}catch(n){j=""}!h&&c.isLocal&&!c.crossDomain?h=l.text?200:404:h===1223&&(h=204)}}}catch(o){e||f(-1,o)}l&&f(h,j,l,k)},c.async?i.readyState===4?setTimeout(d,0):(g=++cJ,cI&&(cH||(cH={},p(a).unload(cI)),cH[g]=d),i.onreadystatechange=d):d()},abort:function(){d&&d(0,1)}}}});var cM,cN,cO=/^(?:toggle|show|hide)$/,cP=new RegExp("^(?:([-+])=|)("+q+")([a-z%]*)$","i"),cQ=/queueHooks$/,cR=[cX],cS={"*":[function(a,b){var c,d,e,f=this.createTween(a,b),g=cP.exec(b),h=f.cur(),i=+h||0,j=1;if(g){c=+g[2],d=g[3]||(p.cssNumber[a]?"":"px");if(d!=="px"&&i){i=p.css(f.elem,a,!0)||c||1;do e=j=j||".5",i=i/j,p.style(f.elem,a,i+d),j=f.cur()/h;while(j!==1&&j!==e)}f.unit=d,f.start=i,f.end=g[1]?i+(g[1]+1)*c:c}return f}]};p.Animation=p.extend(cV,{tweener:function(a,b){p.isFunction(a)?(b=a,a=["*"]):a=a.split(" ");var c,d=0,e=a.length;for(;d-1,j={},k={},l,m;i?(k=e.position(),l=k.top,m=k.left):(l=parseFloat(g)||0,m=parseFloat(h)||0),p.isFunction(b)&&(b=b.call(a,c,f)),b.top!=null&&(j.top=b.top-f.top+l),b.left!=null&&(j.left=b.left-f.left+m),"using"in b?b.using.call(a,j):e.css(j)}},p.fn.extend({position:function(){if(!this[0])return;var a=this[0],b=this.offsetParent(),c=this.offset(),d=c$.test(b[0].nodeName)?{top:0,left:0}:b.offset();return c.top-=parseFloat(p.css(a,"marginTop"))||0,c.left-=parseFloat(p.css(a,"marginLeft"))||0,d.top+=parseFloat(p.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(p.css(b[0],"borderLeftWidth"))||0,{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||e.body;while(a&&!c$.test(a.nodeName)&&p.css(a,"position")==="static")a=a.offsetParent;return a||e.body})}}),p.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);p.fn[a]=function(e){return p.access(this,function(a,e,f){var g=c_(a);if(f===b)return g?c in g?g[c]:g.document.documentElement[e]:a[e];g?g.scrollTo(d?p(g).scrollLeft():f,d?f:p(g).scrollTop()):a[e]=f},a,e,arguments.length,null)}}),p.each({Height:"height",Width:"width"},function(a,c){p.each({padding:"inner"+a,content:c,"":"outer"+a},function(d,e){p.fn[e]=function(e,f){var g=arguments.length&&(d||typeof e!="boolean"),h=d||(e===!0||f===!0?"margin":"border");return p.access(this,function(c,d,e){var f;return p.isWindow(c)?c.document.documentElement["client"+a]:c.nodeType===9?(f=c.documentElement,Math.max(c.body["scroll"+a],f["scroll"+a],c.body["offset"+a],f["offset"+a],f["client"+a])):e===b?p.css(c,d,e,h):p.style(c,d,e,h)},c,g?e:b,g)}})}),a.jQuery=a.$=p,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return p})})(window); \ No newline at end of file -- cgit v1.2.3 From 4b6e77ad9172b29839b76e29614bf4c0ba81c90d Mon Sep 17 00:00:00 2001 From: RaNaN Date: Sat, 11 Aug 2012 11:36:08 +0200 Subject: show footer at bottom --- module/web/static/css/default/style.css | 26 ++++++++++++++++++++++---- 1 file changed, 22 insertions(+), 4 deletions(-) (limited to 'module/web/static') diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css index 166b8c452..bf5e3e7d9 100644 --- a/module/web/static/css/default/style.css +++ b/module/web/static/css/default/style.css @@ -3,6 +3,14 @@ General */ +* { + margin: 0; +} + +html, body { + height: 100%; +} + body { margin: 0; padding: 0; @@ -47,16 +55,24 @@ a { a:hover { } -#wrapper { - width: 960px; - margin: 70px auto 0; - padding: 0; +#wrap { + min-height: 100%; +} + +#content { + margin-left: 150px; + margin-right: 150px; + padding-bottom: 100px; /* Height of footer */ } /* Header */ +#push { + height: 70px; /* Pushes content down with height of header */ +} + header { background: url("../../img/default/main-wrapper-bg.png") repeat-x; height: 70px; @@ -101,9 +117,11 @@ header img.logo { Footer */ + footer { background: url("../../img/default/main-wrapper-bg.png") repeat-x; height: 100px; + margin-top: -100px; position: relative; width: 100%; z-index: 10; -- cgit v1.2.3 From 94d4d384db7fc06e1dcba42bec9d09cbd51f33cb Mon Sep 17 00:00:00 2001 From: RaNaN Date: Sat, 11 Aug 2012 15:52:15 +0200 Subject: added speedgraph --- module/web/static/css/default/style.css | 10 ++++++++-- module/web/static/js/libs/jquery.flot.min.js | 6 ++++++ 2 files changed, 14 insertions(+), 2 deletions(-) create mode 100644 module/web/static/js/libs/jquery.flot.min.js (limited to 'module/web/static') diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css index bf5e3e7d9..9b2d1768c 100644 --- a/module/web/static/css/default/style.css +++ b/module/web/static/css/default/style.css @@ -104,6 +104,7 @@ header div.center span.title { float: left; font-family: SansationRegular, sans-serif; font-size: 40px; + cursor: default; margin-top: 12px; } header img.logo { @@ -113,11 +114,16 @@ header img.logo { width: 120px; } +#speedgraph { + float: right; + height: 45px; + width: 300px; + margin-top: 12px; +} + /* Footer */ - - footer { background: url("../../img/default/main-wrapper-bg.png") repeat-x; height: 100px; diff --git a/module/web/static/js/libs/jquery.flot.min.js b/module/web/static/js/libs/jquery.flot.min.js new file mode 100644 index 000000000..4467fc5d8 --- /dev/null +++ b/module/web/static/js/libs/jquery.flot.min.js @@ -0,0 +1,6 @@ +/* Javascript plotting library for jQuery, v. 0.7. + * + * Released under the MIT license by IOLA, December 2007. + * + */ +(function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return jl?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aGa3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aNaM){aM=a0}}if(aX.y){if(a0aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('
'+aM.join("")+"
").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF'+aE+"
")}}if(aI.length>0){aI.push('
');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF'+aE+"")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aBaG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aFaC.axis.max||aI.toaI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aEaB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['
'];var aJ=m();for(var aD=0;aD');for(var aE=0;aEaC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('
'+aH.label+"
")}aG.push("
")}aG.push("");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aLaT.max||aOaQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aTaL.max||aPaK.max){return}if(aEaL.max){aT=aL.max;aB=false}if(aJaK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH")}aH.push("");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('")}if(aF){aH.push("")}if(aH.length==0){return}var aL='
'+aJ+"
'+aH.join("")+"
";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('
'+aL.replace('style="','style="position:absolute;'+aI+";")+"
").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('
').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aUaC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aGaH.max||aIaG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g Date: Sat, 11 Aug 2012 18:54:58 +0200 Subject: Added jqueryui & template black-tie --- .../ui-bg_diagonals-thick_8_333333_40x40.png | Bin 0 -> 252 bytes .../images/ui-bg_flat_65_ffffff_40x100.png | Bin 0 -> 178 bytes .../images/ui-bg_glass_40_111111_1x400.png | Bin 0 -> 124 bytes .../images/ui-bg_glass_55_1c1c1c_1x400.png | Bin 0 -> 171 bytes .../ui-bg_highlight-hard_100_f9f9f9_1x100.png | Bin 0 -> 117 bytes .../ui-bg_highlight-hard_40_aaaaaa_1x100.png | Bin 0 -> 100 bytes .../ui-bg_highlight-soft_50_aaaaaa_1x100.png | Bin 0 -> 102 bytes .../images/ui-bg_inset-hard_45_cd0a0a_1x100.png | Bin 0 -> 123 bytes .../images/ui-bg_inset-hard_55_ffeb80_1x100.png | Bin 0 -> 113 bytes .../black-tie/images/ui-icons_222222_256x240.png | Bin 0 -> 4369 bytes .../black-tie/images/ui-icons_4ca300_256x240.png | Bin 0 -> 4369 bytes .../black-tie/images/ui-icons_bbbbbb_256x240.png | Bin 0 -> 5355 bytes .../black-tie/images/ui-icons_ededed_256x240.png | Bin 0 -> 4369 bytes .../black-tie/images/ui-icons_ffcf29_256x240.png | Bin 0 -> 4369 bytes .../black-tie/images/ui-icons_ffffff_256x240.png | Bin 0 -> 4369 bytes .../css/black-tie/jquery-ui-1.8.22.custom.css | 445 +++++++++++++++++++++ .../static/js/libs/jquery-ui-1.8.22.custom.min.js | 125 ++++++ 17 files changed, 570 insertions(+) create mode 100644 module/web/static/css/black-tie/images/ui-bg_diagonals-thick_8_333333_40x40.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_flat_65_ffffff_40x100.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_glass_40_111111_1x400.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_glass_55_1c1c1c_1x400.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_highlight-hard_100_f9f9f9_1x100.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_highlight-hard_40_aaaaaa_1x100.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_highlight-soft_50_aaaaaa_1x100.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_inset-hard_45_cd0a0a_1x100.png create mode 100644 module/web/static/css/black-tie/images/ui-bg_inset-hard_55_ffeb80_1x100.png create mode 100644 module/web/static/css/black-tie/images/ui-icons_222222_256x240.png create mode 100644 module/web/static/css/black-tie/images/ui-icons_4ca300_256x240.png create mode 100644 module/web/static/css/black-tie/images/ui-icons_bbbbbb_256x240.png create mode 100644 module/web/static/css/black-tie/images/ui-icons_ededed_256x240.png create mode 100644 module/web/static/css/black-tie/images/ui-icons_ffcf29_256x240.png create mode 100644 module/web/static/css/black-tie/images/ui-icons_ffffff_256x240.png create mode 100644 module/web/static/css/black-tie/jquery-ui-1.8.22.custom.css create mode 100644 module/web/static/js/libs/jquery-ui-1.8.22.custom.min.js (limited to 'module/web/static') diff --git a/module/web/static/css/black-tie/images/ui-bg_diagonals-thick_8_333333_40x40.png b/module/web/static/css/black-tie/images/ui-bg_diagonals-thick_8_333333_40x40.png new file mode 100644 index 000000000..b84db3b48 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_diagonals-thick_8_333333_40x40.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_flat_65_ffffff_40x100.png b/module/web/static/css/black-tie/images/ui-bg_flat_65_ffffff_40x100.png new file mode 100644 index 000000000..ac8b229af Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_flat_65_ffffff_40x100.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_glass_40_111111_1x400.png b/module/web/static/css/black-tie/images/ui-bg_glass_40_111111_1x400.png new file mode 100644 index 000000000..1ec812773 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_glass_40_111111_1x400.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_glass_55_1c1c1c_1x400.png b/module/web/static/css/black-tie/images/ui-bg_glass_55_1c1c1c_1x400.png new file mode 100644 index 000000000..93db02b0f Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_glass_55_1c1c1c_1x400.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_highlight-hard_100_f9f9f9_1x100.png b/module/web/static/css/black-tie/images/ui-bg_highlight-hard_100_f9f9f9_1x100.png new file mode 100644 index 000000000..4812b8676 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_highlight-hard_100_f9f9f9_1x100.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_highlight-hard_40_aaaaaa_1x100.png b/module/web/static/css/black-tie/images/ui-bg_highlight-hard_40_aaaaaa_1x100.png new file mode 100644 index 000000000..a7aeeb0ae Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_highlight-hard_40_aaaaaa_1x100.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_highlight-soft_50_aaaaaa_1x100.png b/module/web/static/css/black-tie/images/ui-bg_highlight-soft_50_aaaaaa_1x100.png new file mode 100644 index 000000000..a0ffd222d Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_highlight-soft_50_aaaaaa_1x100.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_inset-hard_45_cd0a0a_1x100.png b/module/web/static/css/black-tie/images/ui-bg_inset-hard_45_cd0a0a_1x100.png new file mode 100644 index 000000000..718aa1176 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_inset-hard_45_cd0a0a_1x100.png differ diff --git a/module/web/static/css/black-tie/images/ui-bg_inset-hard_55_ffeb80_1x100.png b/module/web/static/css/black-tie/images/ui-bg_inset-hard_55_ffeb80_1x100.png new file mode 100644 index 000000000..0286bb1d7 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-bg_inset-hard_55_ffeb80_1x100.png differ diff --git a/module/web/static/css/black-tie/images/ui-icons_222222_256x240.png b/module/web/static/css/black-tie/images/ui-icons_222222_256x240.png new file mode 100644 index 000000000..b273ff111 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-icons_222222_256x240.png differ diff --git a/module/web/static/css/black-tie/images/ui-icons_4ca300_256x240.png b/module/web/static/css/black-tie/images/ui-icons_4ca300_256x240.png new file mode 100644 index 000000000..fadab6000 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-icons_4ca300_256x240.png differ diff --git a/module/web/static/css/black-tie/images/ui-icons_bbbbbb_256x240.png b/module/web/static/css/black-tie/images/ui-icons_bbbbbb_256x240.png new file mode 100644 index 000000000..9d71edb08 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-icons_bbbbbb_256x240.png differ diff --git a/module/web/static/css/black-tie/images/ui-icons_ededed_256x240.png b/module/web/static/css/black-tie/images/ui-icons_ededed_256x240.png new file mode 100644 index 000000000..01bb36ba7 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-icons_ededed_256x240.png differ diff --git a/module/web/static/css/black-tie/images/ui-icons_ffcf29_256x240.png b/module/web/static/css/black-tie/images/ui-icons_ffcf29_256x240.png new file mode 100644 index 000000000..c066ff2a0 Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-icons_ffcf29_256x240.png differ diff --git a/module/web/static/css/black-tie/images/ui-icons_ffffff_256x240.png b/module/web/static/css/black-tie/images/ui-icons_ffffff_256x240.png new file mode 100644 index 000000000..42f8f992c Binary files /dev/null and b/module/web/static/css/black-tie/images/ui-icons_ffffff_256x240.png differ diff --git a/module/web/static/css/black-tie/jquery-ui-1.8.22.custom.css b/module/web/static/css/black-tie/jquery-ui-1.8.22.custom.css new file mode 100644 index 000000000..02ebc7961 --- /dev/null +++ b/module/web/static/css/black-tie/jquery-ui-1.8.22.custom.css @@ -0,0 +1,445 @@ +/*! + * jQuery UI CSS Framework 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/*! + * jQuery UI CSS Framework 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,%20Arial,%20sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=333333&bgTextureHeader=08_diagonals_thick.png&bgImgOpacityHeader=8&borderColorHeader=a3a3a3&fcHeader=eeeeee&iconColorHeader=bbbbbb&bgColorContent=f9f9f9&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=cccccc&fcContent=222222&iconColorContent=222222&bgColorDefault=111111&bgTextureDefault=02_glass.png&bgImgOpacityDefault=40&borderColorDefault=777777&fcDefault=e3e3e3&iconColorDefault=ededed&bgColorHover=1c1c1c&bgTextureHover=02_glass.png&bgImgOpacityHover=55&borderColorHover=000000&fcHover=ffffff&iconColorHover=ffffff&bgColorActive=ffffff&bgTextureActive=01_flat.png&bgImgOpacityActive=65&borderColorActive=cccccc&fcActive=222222&iconColorActive=222222&bgColorHighlight=ffeb80&bgTextureHighlight=06_inset_hard.png&bgImgOpacityHighlight=55&borderColorHighlight=ffde2e&fcHighlight=363636&iconColorHighlight=4ca300&bgColorError=cd0a0a&bgTextureError=06_inset_hard.png&bgImgOpacityError=45&borderColorError=9e0505&fcError=ffffff&iconColorError=ffcf29&bgColorOverlay=aaaaaa&bgTextureOverlay=04_highlight_hard.png&bgImgOpacityOverlay=40&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=03_highlight_soft.png&bgImgOpacityShadow=50&opacityShadow=20&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #cccccc; background: #f9f9f9 url(images/ui-bg_highlight-hard_100_f9f9f9_1x100.png) 50% top repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #a3a3a3; background: #333333 url(images/ui-bg_diagonals-thick_8_333333_40x40.png) 50% 50% repeat; color: #eeeeee; font-weight: bold; } +.ui-widget-header a { color: #eeeeee; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #777777; background: #111111 url(images/ui-bg_glass_40_111111_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #e3e3e3; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #e3e3e3; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #000000; background: #1c1c1c url(images/ui-bg_glass_55_1c1c1c_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; } +.ui-state-hover a, .ui-state-hover a:hover { color: #ffffff; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #cccccc; background: #ffffff url(images/ui-bg_flat_65_ffffff_40x100.png) 50% 50% repeat-x; font-weight: normal; color: #222222; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #222222; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #ffde2e; background: #ffeb80 url(images/ui-bg_inset-hard_55_ffeb80_1x100.png) 50% bottom repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #9e0505; background: #cd0a0a url(images/ui-bg_inset-hard_45_cd0a0a_1x100.png) 50% bottom repeat-x; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_bbbbbb_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ededed_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_4ca300_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffcf29_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_highlight-hard_40_aaaaaa_1x100.png) 50% top repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_highlight-soft_50_aaaaaa_1x100.png) 50% top repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*! + * jQuery UI Resizable 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*! + * jQuery UI Selectable 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/*! + * jQuery UI Accordion 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/*! + * jQuery UI Button 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/*! + * jQuery UI Dialog 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/*! + * jQuery UI Slider 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/*! + * jQuery UI Tabs 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/*! + * jQuery UI Progressbar 1.8.22 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/module/web/static/js/libs/jquery-ui-1.8.22.custom.min.js b/module/web/static/js/libs/jquery-ui-1.8.22.custom.min.js new file mode 100644 index 000000000..e36a7f0f6 --- /dev/null +++ b/module/web/static/js/libs/jquery-ui-1.8.22.custom.min.js @@ -0,0 +1,125 @@ +/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.22",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a("").outerWidth(1).jquery||a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(b){return function(c){return!!a.data(c,b)}}):function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.curCSS||(a.curCSS=a.css),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.position.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?a.isFunction(b)?this.each(function(c){a(this).offset(b.call(this,c,a(this).offset()))}):this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.draggable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return this.options.iframeFix===!0&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.lefth[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.toph[3]?j-this.offset.click.toph[2]?k-this.offset.click.left=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f=k&&g<=l||h>=k&&h<=l||gl)&&(e>=i&&e<=j||f>=i&&f<=j||ej);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),ea.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.22"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.selectable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("
")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.righth||i.bottome&&i.rightf&&i.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+jf&&b+ka[this.floating?"width":"height"]?l:f0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.containers[d].floating?this.items[i].item.offset().left:this.items[i].item.offset().top;Math.abs(j-h)0?"down":"up")}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.leftthis.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.topthis.containment[3]?h-this.offset.click.topthis.containment[2]?i-this.offset.click.left=0;f--)a.ui.contains(this.containers[f].element[0],this.currentItem[0])&&!c&&(d.push(function(a){return function(b){a._trigger("receive",b,this._uiHash(this))}}.call(this,this.containers[f])),d.push(function(a){return function(b){a._trigger("update",b,this._uiHash(this))}}.call(this,this.containers[f])))}for(var f=this.containers.length-1;f>=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.22",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.autocomplete.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("
    ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length").data("item.autocomplete",c).append(a("    ").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})})(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend(""),d.secondary&&b.append(""),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.dialog.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},f=a.attrFn||{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0,click:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("
    ")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=a("
    ").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(g);a.each(d,function(a,b){if(a==="click")return;a in f?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.22",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;ic&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.22"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.22"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('
    ')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$(''+c+""),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('').addClass(this._triggerClass).html(g==""?f:$("").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;db&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$(''),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a)),this._attachHandlers(a);var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+(c?0:$(document).scrollLeft()),i=document.documentElement.clientHeight+(c?0:$(document).scrollTop());return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+112?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_attachHandlers:function(a){var b=this._get(a,"stepMonths"),c="#"+a.id;a.dpDiv.find("[data-handler]").map(function(){var a={prev:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,-b,"M")},next:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,+b,"M")},hide:function(){window["DP_jQuery_"+dpuuid].datepicker._hideDatepicker()},today:function(){window["DP_jQuery_"+dpuuid].datepicker._gotoToday(c)},selectDay:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectDay(c,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"M"),!1},selectYear:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"Y"),!1}};$(this).bind(this.getAttribute("data-event"),a[this.getAttribute("data-handler")])})},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&pp)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?''+q+"":e?"":''+q+"",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?''+s+"":e?"":''+s+"",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'",x=d?'
    '+(c?w:"")+(this._isInRange(a,v)?'":"")+(c?"":w)+"
    ":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='
    '+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'
    '+"";var R=z?'":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="=5?' class="ui-datepicker-week-end"':"")+">"+''+C[T]+""}Q+=R+"";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z";var _=z?'":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Ym;_+='",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+""}n++,n>11&&(n=0,o++),Q+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(Y)+""+(bb&&!G?" ":bc?''+Y.getDate()+"":''+Y.getDate()+"")+"
    "+(j?""+(g[0]>0&&N==g[1]-1?'
    ':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
    ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
    ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.22",window["DP_jQuery_"+dpuuid]=$})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.progressbar.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
    ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=(a.curCSS||a.css)(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.22",save:function(a,b){for(var c=0;c").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;try{e.id}catch(f){e=document.body}return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fade.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fold.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.highlight.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.pulsate.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);; \ No newline at end of file -- cgit v1.2.3 From 9e06719452ea67e9dfb431d68a7c7a827bedbaa2 Mon Sep 17 00:00:00 2001 From: RaNaN Date: Sat, 11 Aug 2012 19:07:24 +0200 Subject: fixed layout --- module/web/static/css/default/style.css | 7 +++++++ 1 file changed, 7 insertions(+) (limited to 'module/web/static') diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css index 9b2d1768c..2757501e2 100644 --- a/module/web/static/css/default/style.css +++ b/module/web/static/css/default/style.css @@ -114,11 +114,18 @@ header img.logo { width: 120px; } +.header_block { + float: right; + margin-top: 12px; + margin-right: 12px; +} + #speedgraph { float: right; height: 45px; width: 300px; margin-top: 12px; + font-family: sans-serif } /* -- cgit v1.2.3 From 6dedb2f83c6f322b47addcab76a401818fcb08a2 Mon Sep 17 00:00:00 2001 From: RaNaN Date: Sun, 12 Aug 2012 13:08:35 +0200 Subject: added little icons + backbone.js --- module/web/static/css/default/style.css | 13 +++++-- module/web/static/img/default/double-line.gif | Bin 0 -> 50 bytes .../static/img/default/icon_clock_small_white.png | Bin 0 -> 1523 bytes .../static/img/default/icon_speed_small_white.png | Bin 0 -> 1535 bytes module/web/static/js/libs/backbone-min.js | 38 +++++++++++++++++++++ module/web/static/js/libs/underscore-min.js | 32 +++++++++++++++++ 6 files changed, 81 insertions(+), 2 deletions(-) create mode 100644 module/web/static/img/default/double-line.gif create mode 100644 module/web/static/img/default/icon_clock_small_white.png create mode 100644 module/web/static/img/default/icon_speed_small_white.png create mode 100644 module/web/static/js/libs/backbone-min.js create mode 100644 module/web/static/js/libs/underscore-min.js (limited to 'module/web/static') diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css index 2757501e2..1ff1d4c72 100644 --- a/module/web/static/css/default/style.css +++ b/module/web/static/css/default/style.css @@ -116,8 +116,17 @@ header img.logo { .header_block { float: right; - margin-top: 12px; - margin-right: 12px; + margin: 12px 12px 0; + font-family: SansationRegular, sans-serif; + color: #ffffff; +} +.icon_info { + padding-bottom: 5px; +} + +.icon_info img { + margin-bottom: -4px; + padding-right: 5px; } #speedgraph { diff --git a/module/web/static/img/default/double-line.gif b/module/web/static/img/default/double-line.gif new file mode 100644 index 000000000..e9f4cf971 Binary files /dev/null and b/module/web/static/img/default/double-line.gif differ diff --git a/module/web/static/img/default/icon_clock_small_white.png b/module/web/static/img/default/icon_clock_small_white.png new file mode 100644 index 000000000..b6c3535e8 Binary files /dev/null and b/module/web/static/img/default/icon_clock_small_white.png differ diff --git a/module/web/static/img/default/icon_speed_small_white.png b/module/web/static/img/default/icon_speed_small_white.png new file mode 100644 index 000000000..a82639113 Binary files /dev/null and b/module/web/static/img/default/icon_speed_small_white.png differ diff --git a/module/web/static/js/libs/backbone-min.js b/module/web/static/js/libs/backbone-min.js new file mode 100644 index 000000000..c1c0d4fff --- /dev/null +++ b/module/web/static/js/libs/backbone-min.js @@ -0,0 +1,38 @@ +// Backbone.js 0.9.2 + +// (c) 2010-2012 Jeremy Ashkenas, DocumentCloud Inc. +// Backbone may be freely distributed under the MIT license. +// For all details and documentation: +// http://backbonejs.org +(function(){var l=this,y=l.Backbone,z=Array.prototype.slice,A=Array.prototype.splice,g;g="undefined"!==typeof exports?exports:l.Backbone={};g.VERSION="0.9.2";var f=l._;!f&&"undefined"!==typeof require&&(f=require("underscore"));var i=l.jQuery||l.Zepto||l.ender;g.setDomLibrary=function(a){i=a};g.noConflict=function(){l.Backbone=y;return this};g.emulateHTTP=!1;g.emulateJSON=!1;var p=/\s+/,k=g.Events={on:function(a,b,c){var d,e,f,g,j;if(!b)return this;a=a.split(p);for(d=this._callbacks||(this._callbacks= +{});e=a.shift();)f=(j=d[e])?j.tail:{},f.next=g={},f.context=c,f.callback=b,d[e]={tail:g,next:j?j.next:f};return this},off:function(a,b,c){var d,e,h,g,j,q;if(e=this._callbacks){if(!a&&!b&&!c)return delete this._callbacks,this;for(a=a?a.split(p):f.keys(e);d=a.shift();)if(h=e[d],delete e[d],h&&(b||c))for(g=h.tail;(h=h.next)!==g;)if(j=h.callback,q=h.context,b&&j!==b||c&&q!==c)this.on(d,j,q);return this}},trigger:function(a){var b,c,d,e,f,g;if(!(d=this._callbacks))return this;f=d.all;a=a.split(p);for(g= +z.call(arguments,1);b=a.shift();){if(c=d[b])for(e=c.tail;(c=c.next)!==e;)c.callback.apply(c.context||this,g);if(c=f){e=c.tail;for(b=[b].concat(g);(c=c.next)!==e;)c.callback.apply(c.context||this,b)}}return this}};k.bind=k.on;k.unbind=k.off;var o=g.Model=function(a,b){var c;a||(a={});b&&b.parse&&(a=this.parse(a));if(c=n(this,"defaults"))a=f.extend({},c,a);b&&b.collection&&(this.collection=b.collection);this.attributes={};this._escapedAttributes={};this.cid=f.uniqueId("c");this.changed={};this._silent= +{};this._pending={};this.set(a,{silent:!0});this.changed={};this._silent={};this._pending={};this._previousAttributes=f.clone(this.attributes);this.initialize.apply(this,arguments)};f.extend(o.prototype,k,{changed:null,_silent:null,_pending:null,idAttribute:"id",initialize:function(){},toJSON:function(){return f.clone(this.attributes)},get:function(a){return this.attributes[a]},escape:function(a){var b;if(b=this._escapedAttributes[a])return b;b=this.get(a);return this._escapedAttributes[a]=f.escape(null== +b?"":""+b)},has:function(a){return null!=this.get(a)},set:function(a,b,c){var d,e;f.isObject(a)||null==a?(d=a,c=b):(d={},d[a]=b);c||(c={});if(!d)return this;d instanceof o&&(d=d.attributes);if(c.unset)for(e in d)d[e]=void 0;if(!this._validate(d,c))return!1;this.idAttribute in d&&(this.id=d[this.idAttribute]);var b=c.changes={},h=this.attributes,g=this._escapedAttributes,j=this._previousAttributes||{};for(e in d){a=d[e];if(!f.isEqual(h[e],a)||c.unset&&f.has(h,e))delete g[e],(c.silent?this._silent: +b)[e]=!0;c.unset?delete h[e]:h[e]=a;!f.isEqual(j[e],a)||f.has(h,e)!=f.has(j,e)?(this.changed[e]=a,c.silent||(this._pending[e]=!0)):(delete this.changed[e],delete this._pending[e])}c.silent||this.change(c);return this},unset:function(a,b){(b||(b={})).unset=!0;return this.set(a,null,b)},clear:function(a){(a||(a={})).unset=!0;return this.set(f.clone(this.attributes),a)},fetch:function(a){var a=a?f.clone(a):{},b=this,c=a.success;a.success=function(d,e,f){if(!b.set(b.parse(d,f),a))return!1;c&&c(b,d)}; +a.error=g.wrapError(a.error,b,a);return(this.sync||g.sync).call(this,"read",this,a)},save:function(a,b,c){var d,e;f.isObject(a)||null==a?(d=a,c=b):(d={},d[a]=b);c=c?f.clone(c):{};if(c.wait){if(!this._validate(d,c))return!1;e=f.clone(this.attributes)}a=f.extend({},c,{silent:!0});if(d&&!this.set(d,c.wait?a:c))return!1;var h=this,i=c.success;c.success=function(a,b,e){b=h.parse(a,e);if(c.wait){delete c.wait;b=f.extend(d||{},b)}if(!h.set(b,c))return false;i?i(h,a):h.trigger("sync",h,a,c)};c.error=g.wrapError(c.error, +h,c);b=this.isNew()?"create":"update";b=(this.sync||g.sync).call(this,b,this,c);c.wait&&this.set(e,a);return b},destroy:function(a){var a=a?f.clone(a):{},b=this,c=a.success,d=function(){b.trigger("destroy",b,b.collection,a)};if(this.isNew())return d(),!1;a.success=function(e){a.wait&&d();c?c(b,e):b.trigger("sync",b,e,a)};a.error=g.wrapError(a.error,b,a);var e=(this.sync||g.sync).call(this,"delete",this,a);a.wait||d();return e},url:function(){var a=n(this,"urlRoot")||n(this.collection,"url")||t(); +return this.isNew()?a:a+("/"==a.charAt(a.length-1)?"":"/")+encodeURIComponent(this.id)},parse:function(a){return a},clone:function(){return new this.constructor(this.attributes)},isNew:function(){return null==this.id},change:function(a){a||(a={});var b=this._changing;this._changing=!0;for(var c in this._silent)this._pending[c]=!0;var d=f.extend({},a.changes,this._silent);this._silent={};for(c in d)this.trigger("change:"+c,this,this.get(c),a);if(b)return this;for(;!f.isEmpty(this._pending);){this._pending= +{};this.trigger("change",this,a);for(c in this.changed)!this._pending[c]&&!this._silent[c]&&delete this.changed[c];this._previousAttributes=f.clone(this.attributes)}this._changing=!1;return this},hasChanged:function(a){return!arguments.length?!f.isEmpty(this.changed):f.has(this.changed,a)},changedAttributes:function(a){if(!a)return this.hasChanged()?f.clone(this.changed):!1;var b,c=!1,d=this._previousAttributes,e;for(e in a)if(!f.isEqual(d[e],b=a[e]))(c||(c={}))[e]=b;return c},previous:function(a){return!arguments.length|| +!this._previousAttributes?null:this._previousAttributes[a]},previousAttributes:function(){return f.clone(this._previousAttributes)},isValid:function(){return!this.validate(this.attributes)},_validate:function(a,b){if(b.silent||!this.validate)return!0;var a=f.extend({},this.attributes,a),c=this.validate(a,b);if(!c)return!0;b&&b.error?b.error(this,c,b):this.trigger("error",this,c,b);return!1}});var r=g.Collection=function(a,b){b||(b={});b.model&&(this.model=b.model);b.comparator&&(this.comparator=b.comparator); +this._reset();this.initialize.apply(this,arguments);a&&this.reset(a,{silent:!0,parse:b.parse})};f.extend(r.prototype,k,{model:o,initialize:function(){},toJSON:function(a){return this.map(function(b){return b.toJSON(a)})},add:function(a,b){var c,d,e,g,i,j={},k={},l=[];b||(b={});a=f.isArray(a)?a.slice():[a];c=0;for(d=a.length;c=b))this.iframe=i(''),d.bgiframe.appendTo(e),e.bind("tooltipmove"+f,c.adjust)},adjust:function(){var a=b.get("dimensions"),c=b.plugins.tip,f=d.tip,g,h;h=parseInt(e.css("border-left-width"),10)||0,h={left:-h,top:-h},c&&f&&(g=c.corner.precedance==="x"?["width","left"]:["height","top"],h[g[1]]-=f[g[0]]()),d.bgiframe.css(h).css(a)},destroy:function(){d.bgiframe.remove(),e.unbind(f)}}),c.init()}"use strict";var b=!0,c=!1,d=null,e="x",f="y",g="width",h="height",i="top",j="left",k="bottom",l="right",m="center",n="flip",o="flipinvert",p="shift",q,r,s,t={},u="ui-tooltip",v="ui-widget",w="ui-state-disabled",x="div.qtip."+u,y=u+"-default",z=u+"-focus",A=u+"-hover",B=u+"-fluid",C="-31000px",D="_replacedByqTip",E="oldtitle",F;q=a.fn.qtip=function(e,f,g){var h=(""+e).toLowerCase(),i=d,j=a.makeArray(arguments).slice(1),k=j[j.length-1],l=this[0]?a.data(this[0],"qtip"):d;if(!arguments.length&&l||h==="api")return l;if("string"==typeof e)return this.each(function(){var d=a.data(this,"qtip");if(!d)return b;k&&k.timeStamp&&(d.cache.event=k);if(h!=="option"&&h!=="options"||!f)d[h]&&d[h].apply(d[h],j);else if(a.isPlainObject(f)||g!==undefined)d.set(f,g);else return i=d.get(f),c}),i!==d?i:this;if("object"==typeof e||!arguments.length)return l=H(a.extend(b,{},e)),q.bind.call(this,l,k)},q.bind=function(d,e){return this.each(function(f){function m(b){function d(){k.render(typeof b=="object"||g.show.ready),h.show.add(h.hide).unbind(j)}if(k.cache.disabled)return c;k.cache.event=a.extend({},b),k.cache.target=b?a(b.target):[undefined],g.show.delay>0?(clearTimeout(k.timers.show),k.timers.show=setTimeout(d,g.show.delay),i.show!==i.hide&&h.hide.bind(i.hide,function(){clearTimeout(k.timers.show)})):d()}var g,h,i,j,k,l;l=a.isArray(d.id)?d.id[f]:d.id,l=!l||l===c||l.length<1||t[l]?q.nextid++:t[l]=l,j=".qtip-"+l+"-create",k=J.call(this,l,d);if(k===c)return b;g=k.options,a.each(r,function(){this.initialize==="initialize"&&this(k)}),h={show:g.show.target,hide:g.hide.target},i={show:a.trim(""+g.show.event).replace(/ /g,j+" ")+j,hide:a.trim(""+g.hide.event).replace(/ /g,j+" ")+j},/mouse(over|enter)/i.test(i.show)&&!/mouse(out|leave)/i.test(i.hide)&&(i.hide+=" mouseleave"+j),h.show.bind("mousemove"+j,function(a){s={pageX:a.pageX,pageY:a.pageY,type:"mousemove"},k.cache.onTarget=b}),h.show.bind(i.show,m),(g.show.ready||g.prerender)&&m(e)})},r=q.plugins={Corner:function(a){a=(""+a).replace(/([A-Z])/," $1").replace(/middle/gi,m).toLowerCase(),this.x=(a.match(/left|right/i)||a.match(/center/)||["inherit"])[0].toLowerCase(),this.y=(a.match(/top|bottom|center/i)||["inherit"])[0].toLowerCase();var b=a.charAt(0);this.precedance=b==="t"||b==="b"?f:e,this.string=function(){return this.precedance===f?this.y+this.x:this.x+this.y},this.abbrev=function(){var a=this.x.substr(0,1),b=this.y.substr(0,1);return a===b?a:this.precedance===f?b+a:a+b},this.invertx=function(a){this.x=this.x===j?l:this.x===l?j:a||this.x},this.inverty=function(a){this.y=this.y===i?k:this.y===k?i:a||this.y},this.clone=function(){return{x:this.x,y:this.y,precedance:this.precedance,string:this.string,abbrev:this.abbrev,clone:this.clone,invertx:this.invertx,inverty:this.inverty}}},offset:function(b,c){function j(a,b){d.left+=b*a.scrollLeft(),d.top+=b*a.scrollTop()}var d=b.offset(),e=b.closest("body")[0],f=c,g,h,i;if(f){do f.css("position")!=="static"&&(h=f.position(),d.left-=h.left+(parseInt(f.css("borderLeftWidth"),10)||0)+(parseInt(f.css("marginLeft"),10)||0),d.top-=h.top+(parseInt(f.css("borderTopWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0),!g&&(i=f.css("overflow"))!=="hidden"&&i!=="visible"&&(g=f));while((f=a(f[0].offsetParent)).length);g&&g[0]!==e&&j(g,1)}return d},iOS:parseFloat((""+(/CPU.*OS ([0-9_]{1,5})|(CPU like).*AppleWebKit.*Mobile/i.exec(navigator.userAgent)||[0,""])[1]).replace("undefined","3_2").replace("_",".").replace("_",""))||c,fn:{attr:function(b,c){if(this.length){var d=this[0],e="title",f=a.data(d,"qtip");if(b===e&&f&&"object"==typeof f&&f.options.suppress)return arguments.length<2?a.attr(d,E):(f&&f.options.content.attr===e&&f.cache.attr&&f.set("content.text",c),this.attr(E,c))}return a.fn["attr"+D].apply(this,arguments)},clone:function(b){var c=a([]),d="title",e=a.fn["clone"+D].apply(this,arguments);return b||e.filter("["+E+"]").attr("title",function(){return a.attr(this,E)}).removeAttr(E),e}}},a.each(r.fn,function(c,d){if(!d||a.fn[c+D])return b;var e=a.fn[c+D]=a.fn[c];a.fn[c]=function(){return d.apply(this,arguments)||e.apply(this,arguments)}}),a.ui||(a["cleanData"+D]=a.cleanData,a.cleanData=function(b){for(var c=0,d;(d=b[c])!==undefined;c++)try{a(d).triggerHandler("removeqtip")}catch(e){}a["cleanData"+D](b)}),q.version="@VERSION",q.nextid=0,q.inactiveEvents="click dblclick mousedown mouseup mousemove mouseleave mouseenter".split(" "),q.zindex=15e3,q.defaults={prerender:c,id:c,overwrite:b,suppress:b,content:{text:b,attr:"title",title:{text:c,button:c}},position:{my:"top left",at:"bottom right",target:c,container:c,viewport:c,adjust:{x:0,y:0,mouse:b,resize:b,method:"flip flip"},effect:function(b,d,e){a(this).animate(d,{duration:200,queue:c})}},show:{target:c,event:"mouseenter",effect:b,delay:90,solo:c,ready:c,autofocus:c},hide:{target:c,event:"mouseleave",effect:b,delay:0,fixed:c,inactive:c,leave:"window",distance:c},style:{classes:"",widget:c,width:c,height:c,def:b},events:{render:d,move:d,show:d,hide:d,toggle:d,visible:d,hidden:d,focus:d,blur:d}},r.svg=function(b,c,d,e){var f=a(document),g=c[0],h={width:0,height:0,position:{top:1e10,left:1e10}},i,j,k,l,m;while(!g.getBBox)g=g.parentNode;if(g.getBBox&&g.parentNode){i=g.getBBox(),j=g.getScreenCTM(),k=g.farthestViewportElement||g;if(!k.createSVGPoint)return h;l=k.createSVGPoint(),l.x=i.x,l.y=i.y,m=l.matrixTransform(j),h.position.left=m.x,h.position.top=m.y,l.x+=i.width,l.y+=i.height,m=l.matrixTransform(j),h.width=m.x-h.position.left,h.height=m.y-h.position.top,h.position.left+=f.scrollLeft(),h.position.top+=f.scrollTop()}return h},r.ajax=function(a){var b=a.plugins.ajax;return"object"==typeof b?b:a.plugins.ajax=new K(a)},r.ajax.initialize="render",r.ajax.sanitize=function(a){var b=a.content,c;b&&"ajax"in b&&(c=b.ajax,typeof c!="object"&&(c=a.content.ajax={url:c}),"boolean"!=typeof c.once&&c.once&&(c.once=!!c.once))},a.extend(b,q.defaults,{content:{ajax:{loading:b,once:b}}}),r.tip=function(a){var b=a.plugins.tip;return"object"==typeof b?b:a.plugins.tip=new M(a)},r.tip.initialize="render",r.tip.sanitize=function(a){var c=a.style,d;c&&"tip"in c&&(d=a.style.tip,typeof d!="object"&&(a.style.tip={corner:d}),/string|boolean/i.test(typeof d.corner)||(d.corner=b),typeof d.width!="number"&&delete d.width,typeof d.height!="number"&&delete d.height,typeof d.border!="number"&&d.border!==b&&delete d.border,typeof d.offset!="number"&&delete d.offset)},a.extend(b,q.defaults,{style:{tip:{corner:b,mimic:c,width:6,height:6,border:b,offset:0}}}),r.modal=function(a){var b=a.plugins.modal;return"object"==typeof b?b:a.plugins.modal=new N(a)},r.modal.initialize="render",r.modal.sanitize=function(a){a.show&&(typeof a.show.modal!="object"?a.show.modal={on:!!a.show.modal}:typeof a.show.modal.on=="undefined"&&(a.show.modal.on=b))},r.modal.zindex=q.zindex-200,r.modal.focusable=["a[href]","area[href]","input","select","textarea","button","iframe","object","embed","[tabindex]","[contenteditable]"],a.extend(b,q.defaults,{show:{modal:{on:c,effect:b,blur:b,stealfocus:b,escape:b}}}),r.viewport=function(a,b,c,d,n,q,r){function J(a,c,d,e,f,g,h,i,j){var k=b[f],l=v[a],n=w[a],q=d===p,r=-C.offset[f]+B.offset[f]+B["scroll"+f],s=l===f?j:l===g?-j:-j/2,t=n===f?i:n===g?-i:-i/2,u=E&&E.size?E.size[h]||0:0,x=E&&E.corner&&E.corner.precedance===a&&!q?u:0,y=r-k+x,z=k+j-B[h]-r+x,A=s-(v.precedance===a||l===v[c]?t:0)-(n===m?i/2:0);return q?(x=E&&E.corner&&E.corner.precedance===c?u:0,A=(l===f?1:-1)*s-x,b[f]+=y>0?y:z>0?-z:0,b[f]=Math.max(-C.offset[f]+B.offset[f]+(x&&E.corner[a]===m?E.offset:0),k-A,Math.min(Math.max(-C.offset[f]+B.offset[f]+B[h],k+A),b[f]))):(e*=d===o?2:0,y>0&&(l!==f||z>0)?(b[f]-=A+e,H["invert"+a](f)):z>0&&(l!==g||y>0)&&(b[f]-=(l===m?-A:A)+e,H["invert"+a](g)),b[f]z&&(b[f]=k,H=undefined)),b[f]-k}var s=c.target,t=a.elements.tooltip,v=c.my,w=c.at,x=c.adjust,y=x.method.split(" "),z=y[0],A=y[1]||y[0],B=c.viewport,C=c.container,D=a.cache,E=a.plugins.tip,F={left:0,top:0},G,H,I;if(!B.jquery||s[0]===window||s[0]===document.body||x.method==="none")return F;G=t.css("position")==="fixed",B={elem:B,height:B[(B[0]===window?"h":"outerH")+"eight"](),width:B[(B[0]===window?"w":"outerW")+"idth"](),scrollleft:G?0:B.scrollLeft(),scrolltop:G?0:B.scrollTop(),offset:B.offset()||{left:0,top:0}},C={elem:C,scrollLeft:C.scrollLeft(),scrollTop:C.scrollTop(),offset:C.offset()||{left:0,top:0}};if(z!=="shift"||A!=="shift")H=v.clone();return F={left:z!=="none"?J(e,f,z,x.x,j,l,g,d,q):0,top:A!=="none"?J(f,e,A,x.y,i,k,h,n,r):0},H&&D.lastClass!==(I=u+"-pos-"+H.abbrev())&&t.removeClass(a.cache.lastClass).addClass(a.cache.lastClass=I),F},r.imagemap=function(b,c,d,e){function v(a,b,c){var d=0,e=1,f=1,g=0,h=0,n=a.width,o=a.height;while(n>0&&o>0&&e>0&&f>0){n=Math.floor(n/2),o=Math.floor(o/2),c.x===j?e=n:c.x===l?e=a.width-n:e+=Math.floor(n/2),c.y===i?f=o:c.y===k?f=a.height-o:f+=Math.floor(o/2),d=b.length;while(d--){if(b.length<2)break;g=b[d][0]-a.position.left,h=b[d][1]-a.position.top,(c.x===j&&g>=e||c.x===l&&g<=e||c.x===m&&(ga.width-e)||c.y===i&&h>=f||c.y===k&&h<=f||c.y===m&&(ha.height-f))&&b.splice(d,1)}}return{left:b[0][0],top:b[0][1]}}c.jquery||(c=a(c));var f=b.cache.areas={},g=(c[0].shape||c.attr("shape")).toLowerCase(),h=c[0].coords||c.attr("coords"),n=h.split(","),o=[],p=a('img[usemap="#'+c.parent("map").attr("name")+'"]'),q=p.offset(),r={width:0,height:0,position:{top:1e10,right:0,bottom:0,left:1e10}},s=0,t=0,u;q.left+=Math.ceil((p.outerWidth()-p.width())/2),q.top+=Math.ceil((p.outerHeight()-p.height())/2);if(g==="poly"){s=n.length;while(s--)t=[parseInt(n[--s],10),parseInt(n[s+1],10)],t[0]>r.position.right&&(r.position.right=t[0]),t[0]r.position.bottom&&(r.position.bottom=t[1]),t[1] Date: Tue, 14 Aug 2012 22:34:45 +0200 Subject: added dialog window --- module/web/static/css/default/style.css | 6 +- module/web/static/css/omniwindow.css | 72 +++++++++++++ module/web/static/js/libs/jquery.omniwindow.js | 141 +++++++++++++++++++++++++ 3 files changed, 218 insertions(+), 1 deletion(-) create mode 100644 module/web/static/css/omniwindow.css create mode 100644 module/web/static/js/libs/jquery.omniwindow.js (limited to 'module/web/static') diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css index f882e4a43..87cd60831 100644 --- a/module/web/static/css/default/style.css +++ b/module/web/static/css/default/style.css @@ -157,7 +157,11 @@ header .logo { #globalprogress { height: 8px; - margin: 8px 5px; + margin: 8px 5px 0; +} + +#globalprogress .ui-widget-header { + background: #fee247; } #speedgraph { diff --git a/module/web/static/css/omniwindow.css b/module/web/static/css/omniwindow.css new file mode 100644 index 000000000..12f4d451c --- /dev/null +++ b/module/web/static/css/omniwindow.css @@ -0,0 +1,72 @@ +/* Default class for an overlay */ +.ow-overlay { + content: " "; + height: 100%; + width: 100%; + position: absolute; + left: 0; + top: 0; + background: -moz-radial-gradient(center, ellipse cover, rgba(127,127,0,0) 0%, rgba(127,127,127,0.9) 100%); + background: -webkit-gradient(radial, center center, 0px, center center, 100%, color-stop(0%,rgba(127,127,127,0)), color-stop(100%,rgba(127,127,127,0.9))); + background: -webkit-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); + background: -o-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); + background: -ms-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); + background: radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#007f7f7f', endColorstr='#e67f7f7f',GradientType=1 ); + z-index: 50; + } + +/* Default class for both hidden overlay and modal window */ +.ow-closed { + display: none; +} + +/* Default class for modal window */ +.modal { + left: 50%; + position: fixed; + width: 300px; + height: 300px; + z-index: 100; + background-color: #ffffff; +} + +/* Animations */ +.window-container { + background: #fcfcfc; + opacity: 0; + margin: 8em auto; + width: 500px; + padding: 10px 20px 20px; + text-align: left; + border-radius: 3px; + box-shadow: 0px 0px 30px rgba(0,0,0,0.2); + -webkit-transition: 0.4s ease-out; + -moz-transition: 0.4s ease-out; + -ms-transition: 0.4s ease-out; + -o-transition: 0.4s ease-out; + transition: 0.4s ease-out; +} + +.zoomin { + -webkit-transform: scale(1.2); + -moz-transform: scale(1.2); + -ms-transform: scale(1.2); + transform: scale(1.2); +} + +.zoomout { + -webkit-transform: scale(0.7); + -moz-transform: scale(0.7); + -ms-transform: scale(0.7); + transform: scale(0.7); +} + +.window-container-visible { + -webkit-transform: scale(1); + -moz-transform: scale(1); + -ms-transform: scale(1); + transform: scale(1); + opacity: 1; +} + diff --git a/module/web/static/js/libs/jquery.omniwindow.js b/module/web/static/js/libs/jquery.omniwindow.js new file mode 100644 index 000000000..e1f0b8f77 --- /dev/null +++ b/module/web/static/js/libs/jquery.omniwindow.js @@ -0,0 +1,141 @@ +// jQuery OmniWindow plugin +// @version: 0.7.0 +// @author: Rudenka Alexander (mur.mailbox@gmail.com) +// @license: MIT + +;(function($) { + "use strict"; + $.fn.extend({ + omniWindow: function(options) { + + options = $.extend(true, { + animationsPriority: { + show: ['overlay', 'modal'], + hide: ['modal', 'overlay'] + }, + overlay: { + selector: '.ow-overlay', + hideClass: 'ow-closed', + animations: { + show: function(subjects, internalCallback) { return internalCallback(subjects); }, + hide: function(subjects, internalCallback) { return internalCallback(subjects); }, + internal: { + show: function(subjects){ subjects.overlay.removeClass(options.overlay.hideClass); }, + hide: function(subjects){ subjects.overlay.addClass(options.overlay.hideClass); } + } + } + }, + modal: { + hideClass: 'ow-closed', + animations: { + show: function(subjects, internalCallback) { return internalCallback(subjects); }, + hide: function(subjects, internalCallback) { return internalCallback(subjects); }, + internal: { + show: function(subjects){ subjects.modal.removeClass(options.modal.hideClass); }, + hide: function(subjects){ subjects.modal.addClass(options.modal.hideClass); } + } + }, + internal: { + stateAttribute: 'ow-active' + } + }, + eventsNames: { + show: 'show.ow', + hide: 'hide.ow', + internal: { + overlayClick: 'click.ow', + keyboardKeyUp: 'keyup.ow' + } + }, + callbacks: { // Callbacks execution chain + beforeShow: function(subjects, internalCallback) { return internalCallback(subjects); }, // 1 (stop if retruns false) + positioning: function(subjects, internalCallback) { return internalCallback(subjects); }, // 2 + afterShow: function(subjects, internalCallback) { return internalCallback(subjects); }, // 3 + beforeHide: function(subjects, internalCallback) { return internalCallback(subjects); }, // 4 (stop if retruns false) + afterHide: function(subjects, internalCallback) { return internalCallback(subjects); }, // 5 + internal: { + beforeShow: function(subjects) { + if (subjects.modal.data(options.modal.internal.stateAttribute)) { + return false; + } else { + subjects.modal.data(options.modal.internal.stateAttribute, true); + return true; + } + }, + afterShow: function(subjects) { + $(document).on(options.eventsNames.internal.keyboardKeyUp, function(e) { + if (e.keyCode === 27) { // if the key pressed is the ESC key + subjects.modal.trigger(options.eventsNames.hide); + } + }); + + subjects.overlay.on(options.eventsNames.internal.overlayClick, function(){ + subjects.modal.trigger(options.eventsNames.hide); + }); + }, + positioning: function(subjects) { + subjects.modal.css('margin-left', Math.round(subjects.modal.outerWidth() / -2)); + }, + beforeHide: function(subjects) { + if (subjects.modal.data(options.modal.internal.stateAttribute)) { + subjects.modal.data(options.modal.internal.stateAttribute, false); + return true; + } else { + return false; + } + }, + afterHide: function(subjects) { + subjects.overlay.off(options.eventsNames.internal.overlayClick); + $(document).off(options.eventsNames.internal.keyboardKeyUp); + + subjects.overlay.css('display', ''); // clear inline styles after jQ animations + subjects.modal.css('display', ''); + } + } + } + }, options); + + var animate = function(process, subjects, callbackName) { + var first = options.animationsPriority[process][0], + second = options.animationsPriority[process][1]; + + options[first].animations[process](subjects, function(subjs) { // call USER's FIRST animation (depends on priority) + options[first].animations.internal[process](subjs); // call internal FIRST animation + + options[second].animations[process](subjects, function(subjs) { // call USER's SECOND animation + options[second].animations.internal[process](subjs); // call internal SECOND animation + + // then we need to call USER's + // afterShow of afterHide callback + options.callbacks[callbackName](subjects, options.callbacks.internal[callbackName]); + }); + }); + }; + + var showModal = function(subjects) { + if (!options.callbacks.beforeShow(subjects, options.callbacks.internal.beforeShow)) { return; } // cancel showing if beforeShow callback return false + + options.callbacks.positioning(subjects, options.callbacks.internal.positioning); + + animate('show', subjects, 'afterShow'); + }; + + var hideModal = function(subjects) { + if (!options.callbacks.beforeHide(subjects, options.callbacks.internal.beforeHide)) { return; } // cancel hiding if beforeHide callback return false + + animate('hide', subjects, 'afterHide'); + }; + + + var $overlay = $(options.overlay.selector); + + return this.each(function() { + var $modal = $(this); + var subjects = {modal: $modal, overlay: $overlay}; + + $modal.bind(options.eventsNames.show, function(){ showModal(subjects); }) + .bind(options.eventsNames.hide, function(){ hideModal(subjects); }); + }); + } + }); +})(jQuery); \ No newline at end of file -- cgit v1.2.3 From 90ba0c9f3adccd02b62ec3ca6b4af849a7253d14 Mon Sep 17 00:00:00 2001 From: godofdream Date: Tue, 14 Aug 2012 22:37:58 +0200 Subject: first Design of Queue and Settings --- module/web/static/css/default/queue.css | 82 ++++++++++++++++++++++++ module/web/static/css/default/style.css | 3 +- module/web/static/img/default/arrow_refresh.png | Bin 0 -> 685 bytes module/web/static/img/default/delete.png | Bin 0 -> 715 bytes module/web/static/img/default/folder.png | Bin 0 -> 537 bytes module/web/static/img/default/icon_folder.png | Bin 0 -> 222 bytes module/web/static/img/default/pencil.png | Bin 0 -> 450 bytes 7 files changed, 84 insertions(+), 1 deletion(-) create mode 100644 module/web/static/css/default/queue.css create mode 100644 module/web/static/img/default/arrow_refresh.png create mode 100644 module/web/static/img/default/delete.png create mode 100644 module/web/static/img/default/folder.png create mode 100644 module/web/static/img/default/icon_folder.png create mode 100644 module/web/static/img/default/pencil.png (limited to 'module/web/static') diff --git a/module/web/static/css/default/queue.css b/module/web/static/css/default/queue.css new file mode 100644 index 000000000..645beadae --- /dev/null +++ b/module/web/static/css/default/queue.css @@ -0,0 +1,82 @@ + +#queue-list { + list-style: none; + padding-left: 0; +} + +#page-actions{ + list-style: none; +} + +.pack{ + border: 2px solid #000000; + padding: 0; + -moz-border-radius: 10px; + border-radius: 10px; +} + +.pack_header{ + background: url("../../img/default/main-wrapper-bg.png") repeat-x; + cursor: pointer; + border: 2px solid #000000; + margin: 0px; + height: 23px; + -moz-border-radius-topleft: 10px; + -moz-border-radius-topright: 10px; + -webkit-border-top-left-radius: 10px; + -webkit-border-top-right-radius: 10px; + border-top-left-radius: 10px; + border-top-right-radius: 10px; +} + +.pack_icon{ + cursor: move; + height: 20px; + float: left; + margin-left: 5px; + padding-left: 25px; + background: url("../../img/default/icon_folder.png")no-repeat; +} + +.pack_name{ + vertical-align: middle; + color: #D5D5D5; +} + +.pack_progressbar{ + height: 8px; + margin: 8px 5px; +} + +.pack_toolbar{ + height: 24px; + float: left; + padding-left: 22px; +} + +.pack_toolbar div{ + height: 20px; + float: left; + padding-left: 22px; +} + +.pack_toolbar_delete { + background: url("../../img/default/delete.png")no-repeat; +} + +.pack_toolbar_restart { + background: url("../../img/default/arrow_refresh.png")no-repeat; +} + +.pack_toolbar_edit{ + background: url("../../img/default/pencil.png")no-repeat; +} + +.pack_children{ + display: none; +} + +.sort_children{ + list-style: none; + padding-left: 0; +} \ No newline at end of file diff --git a/module/web/static/css/default/style.css b/module/web/static/css/default/style.css index f882e4a43..90701b121 100644 --- a/module/web/static/css/default/style.css +++ b/module/web/static/css/default/style.css @@ -189,8 +189,9 @@ header .logo { border: 2px solid #000000; padding: 15px; font-size: 17px; - -moz-border-radius: 15px; border-radius: 15px; + -moz-border-radius: 15px; + -webkit-border-radius: 15px; } .login input, .login div{ diff --git a/module/web/static/img/default/arrow_refresh.png b/module/web/static/img/default/arrow_refresh.png new file mode 100644 index 000000000..0de26566d Binary files /dev/null and b/module/web/static/img/default/arrow_refresh.png differ diff --git a/module/web/static/img/default/delete.png b/module/web/static/img/default/delete.png new file mode 100644 index 000000000..08f249365 Binary files /dev/null and b/module/web/static/img/default/delete.png differ diff --git a/module/web/static/img/default/folder.png b/module/web/static/img/default/folder.png new file mode 100644 index 000000000..784e8fa48 Binary files /dev/null and b/module/web/static/img/default/folder.png differ diff --git a/module/web/static/img/default/icon_folder.png b/module/web/static/img/default/icon_folder.png new file mode 100644 index 000000000..31773520a Binary files /dev/null and b/module/web/static/img/default/icon_folder.png differ diff --git a/module/web/static/img/default/pencil.png b/module/web/static/img/default/pencil.png new file mode 100644 index 000000000..0bfecd50e Binary files /dev/null and b/module/web/static/img/default/pencil.png differ -- cgit v1.2.3 From 315192a0ab42b80ec2b83d8450dc91ef7c3ad68e Mon Sep 17 00:00:00 2001 From: godofdream Date: Tue, 14 Aug 2012 23:18:20 +0200 Subject: improved QueueLayout --- module/web/static/css/default/queue.css | 28 +++++++++++++++++++--------- 1 file changed, 19 insertions(+), 9 deletions(-) (limited to 'module/web/static') diff --git a/module/web/static/css/default/queue.css b/module/web/static/css/default/queue.css index 645beadae..23af09403 100644 --- a/module/web/static/css/default/queue.css +++ b/module/web/static/css/default/queue.css @@ -20,7 +20,7 @@ cursor: pointer; border: 2px solid #000000; margin: 0px; - height: 23px; + height: 25px; -moz-border-radius-topleft: 10px; -moz-border-radius-topright: 10px; -webkit-border-top-left-radius: 10px; @@ -33,25 +33,35 @@ cursor: move; height: 20px; float: left; - margin-left: 5px; - padding-left: 25px; + margin: 2px 7px; + padding: 0 0 0 20px; background: url("../../img/default/icon_folder.png")no-repeat; } .pack_name{ + float: left; + vertical-align: middle; + color: #FFFFFF; +} + +.pack_progressbar_wrapper{ + float: left; + margin: 4px auto 4px auto; + text-align: center; vertical-align: middle; - color: #D5D5D5; + width: 50%; + height: 15px; } .pack_progressbar{ - height: 8px; - margin: 8px 5px; + height: 15px; } .pack_toolbar{ - height: 24px; - float: left; - padding-left: 22px; + height: 20px; + float: right; + padding: 0 0 0 20px; + margin: 2px 7px; } .pack_toolbar div{ -- cgit v1.2.3 From 9500f10ed3e9c18529b1bf91e96fa16f9f926a2f Mon Sep 17 00:00:00 2001 From: RaNaN Date: Tue, 14 Aug 2012 23:29:04 +0200 Subject: addjusted animations --- module/web/static/css/omniwindow.css | 5 ++--- 1 file changed, 2 insertions(+), 3 deletions(-) (limited to 'module/web/static') diff --git a/module/web/static/css/omniwindow.css b/module/web/static/css/omniwindow.css index 12f4d451c..2117a77e0 100644 --- a/module/web/static/css/omniwindow.css +++ b/module/web/static/css/omniwindow.css @@ -5,7 +5,7 @@ width: 100%; position: absolute; left: 0; - top: 0; + top: 0; /* TODO change gradient at all browser */ background: -moz-radial-gradient(center, ellipse cover, rgba(127,127,0,0) 0%, rgba(127,127,127,0.9) 100%); background: -webkit-gradient(radial, center center, 0px, center center, 100%, color-stop(0%,rgba(127,127,127,0)), color-stop(100%,rgba(127,127,127,0.9))); background: -webkit-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); @@ -13,7 +13,7 @@ background: -ms-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); background: radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#007f7f7f', endColorstr='#e67f7f7f',GradientType=1 ); - z-index: 50; + z-index: 50; } /* Default class for both hidden overlay and modal window */ @@ -35,7 +35,6 @@ .window-container { background: #fcfcfc; opacity: 0; - margin: 8em auto; width: 500px; padding: 10px 20px 20px; text-align: left; -- cgit v1.2.3 From dc1674c73c7e3ca24ea651e15fa7098199b2a3db Mon Sep 17 00:00:00 2001 From: RaNaN Date: Wed, 15 Aug 2012 17:23:09 +0200 Subject: fancier colors for background --- module/web/static/css/omniwindow.css | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) (limited to 'module/web/static') diff --git a/module/web/static/css/omniwindow.css b/module/web/static/css/omniwindow.css index 2117a77e0..4947ea3c7 100644 --- a/module/web/static/css/omniwindow.css +++ b/module/web/static/css/omniwindow.css @@ -6,7 +6,8 @@ position: absolute; left: 0; top: 0; /* TODO change gradient at all browser */ - background: -moz-radial-gradient(center, ellipse cover, rgba(127,127,0,0) 0%, rgba(127,127,127,0.9) 100%); + background: -moz-radial-gradient(center, ellipse cover, rgba(236,208,66,0) 0%, rgba(40,119,171,0.9) 100%); + /*background: -moz-radial-gradient(center, ellipse cover, rgba(127,127,0,0) 0%, rgba(127,127,127,0.9) 100%);*/ background: -webkit-gradient(radial, center center, 0px, center center, 100%, color-stop(0%,rgba(127,127,127,0)), color-stop(100%,rgba(127,127,127,0.9))); background: -webkit-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); background: -o-radial-gradient(center, ellipse cover, rgba(127,127,127,0) 0%,rgba(127,127,127,0.9) 100%); -- cgit v1.2.3 From d8119f648e63a4728433e67e79d2a99296a8c2c1 Mon Sep 17 00:00:00 2001 From: godofdream Date: Thu, 16 Aug 2012 17:48:39 +0200 Subject: Added Mobile WebIf, some Layouting --- module/web/static/css/default/my.css | 93 +++++++ module/web/static/css/default/queue.css | 54 ++-- module/web/static/css/images/ajax-loader.gif | Bin 0 -> 7825 bytes module/web/static/css/images/ajax-loader.png | Bin 0 -> 340 bytes module/web/static/css/images/icons-18-black.png | Bin 0 -> 1767 bytes module/web/static/css/images/icons-18-white.png | Bin 0 -> 1806 bytes module/web/static/css/images/icons-36-black.png | Bin 0 -> 3611 bytes module/web/static/css/images/icons-36-white.png | Bin 0 -> 3648 bytes module/web/static/css/jquery.mobile-1.1.1.min.css | 2 + .../static/img/default/icon_blank_file_black.png | Bin 0 -> 291 bytes .../web/static/js/libs/jquery.mobile-1.1.1.min.js | 181 ++++++++++++++ module/web/static/js/libs/my.js | 275 +++++++++++++++++++++ 12 files changed, 579 insertions(+), 26 deletions(-) create mode 100644 module/web/static/css/default/my.css create mode 100644 module/web/static/css/images/ajax-loader.gif create mode 100644 module/web/static/css/images/ajax-loader.png create mode 100644 module/web/static/css/images/icons-18-black.png create mode 100644 module/web/static/css/images/icons-18-white.png create mode 100644 module/web/static/css/images/icons-36-black.png create mode 100644 module/web/static/css/images/icons-36-white.png create mode 100644 module/web/static/css/jquery.mobile-1.1.1.min.css create mode 100644 module/web/static/img/default/icon_blank_file_black.png create mode 100644 module/web/static/js/libs/jquery.mobile-1.1.1.min.js create mode 100644 module/web/static/js/libs/my.js (limited to 'module/web/static') diff --git a/module/web/static/css/default/my.css b/module/web/static/css/default/my.css new file mode 100644 index 000000000..2e73c1f35 --- /dev/null +++ b/module/web/static/css/default/my.css @@ -0,0 +1,93 @@ +.text-align-center { + text-align: center; +} +.text-align-right { + text-align: right; +} + +/** CSS for non-standard jQuery Mobile styles or Codiqa components **/ +.split-wrapper { + width: 100%; + min-height: 200px; + clear: both; +} +@media all and (min-width: 650px) { + .content-secondary { + text-align: left; + float: left; + width: 45%; + background: none; + padding: 1.5em 6% 3em 0; + margin: 0; + } + .content-secondary { + background: none; + border-top: none; + } + .content-primary { + width: 45%; + float: right; + margin-right: 1%; + padding-right: 1%; + } + .content-primary ul:first-child { + margin-top: 0; + } + .content-secondary ul.ui-listview, .content-secondary ul.ui-listview-inset { + margin: 0; + } + .content-secondary ul.ui-listview .ui-li-divider, .content-secondary ul.ui-listview .ui-li { + border-radius: 0px; + } + .content-secondary ul.ui-listview .ui-li { + border-left: 0; + border-right: 0; + } + .content-secondary h2 { + position: absolute; + left: -9999px; + } + .content-secondary .ui-li-divider { + padding-top: 1em; + padding-bottom: 1em; + } + .content-secondary { + margin: 0; + padding: 0; + } + +} +@media all and (min-width: 750px){ + .content-secondary { + width: 34%; + } + .content-primary { + width: 60%; + padding-right: 1%; + } + .content-secondary ul.ui-listview-inset { +} + +@media all and (min-width: 1200px){ + .content-secondary { + width: 30%; + padding-right:6%; + margin: 0px 0 20px 5%; + } + .content-secondary ul { + margin: 0; + } + .content-secondary { + margin: 0; + padding: 0; + } + .content-primary { + width: 50%; + margin-right: 5%; + padding-right: 3%; + } + .content-primary { + width: 60%; + } +} + diff --git a/module/web/static/css/default/queue.css b/module/web/static/css/default/queue.css index 23af09403..265432331 100644 --- a/module/web/static/css/default/queue.css +++ b/module/web/static/css/default/queue.css @@ -9,59 +9,61 @@ } .pack{ - border: 2px solid #000000; + border: 2px solid #CFCFCF; padding: 0; - -moz-border-radius: 10px; - border-radius: 10px; } .pack_header{ - background: url("../../img/default/main-wrapper-bg.png") repeat-x; + background-color: #CFCFCF; cursor: pointer; - border: 2px solid #000000; + border: 2px solid #CFCFCF; margin: 0px; height: 25px; - -moz-border-radius-topleft: 10px; - -moz-border-radius-topright: 10px; - -webkit-border-top-left-radius: 10px; - -webkit-border-top-right-radius: 10px; - border-top-left-radius: 10px; - border-top-right-radius: 10px; + } .pack_icon{ + display:inline-block; cursor: move; - height: 20px; - float: left; + height:20px; margin: 2px 7px; padding: 0 0 0 20px; background: url("../../img/default/icon_folder.png")no-repeat; } .pack_name{ - float: left; - vertical-align: middle; - color: #FFFFFF; + display:inline-block; + + top:0px; + margin: 0; + padding:0; + color: #000000; } .pack_progressbar_wrapper{ - float: left; - margin: 4px auto 4px auto; - text-align: center; + display:inline-block; vertical-align: middle; - width: 50%; - height: 15px; + height:9px; + width:50%; + right:15%; + margin-top: 6px; + position:absolute; } .pack_progressbar{ - height: 15px; + display:block; + width:100%; + height: inherit; + text-align: center; + margin: 0; } .pack_toolbar{ - height: 20px; - float: right; - padding: 0 0 0 20px; - margin: 2px 7px; + display:inline-block; + height:inherit; + right:0; + margin: 0; + } .pack_toolbar div{ diff --git a/module/web/static/css/images/ajax-loader.gif b/module/web/static/css/images/ajax-loader.gif new file mode 100644 index 000000000..fd1a189c2 Binary files /dev/null and b/module/web/static/css/images/ajax-loader.gif differ diff --git a/module/web/static/css/images/ajax-loader.png b/module/web/static/css/images/ajax-loader.png new file mode 100644 index 000000000..13b208ddd Binary files /dev/null and b/module/web/static/css/images/ajax-loader.png differ diff --git a/module/web/static/css/images/icons-18-black.png b/module/web/static/css/images/icons-18-black.png new file mode 100644 index 000000000..ce1b758ad Binary files /dev/null and b/module/web/static/css/images/icons-18-black.png differ diff --git a/module/web/static/css/images/icons-18-white.png b/module/web/static/css/images/icons-18-white.png new file mode 100644 index 000000000..1ab012723 Binary files /dev/null and b/module/web/static/css/images/icons-18-white.png differ diff --git a/module/web/static/css/images/icons-36-black.png b/module/web/static/css/images/icons-36-black.png new file mode 100644 index 000000000..1a59d7c37 Binary files /dev/null and b/module/web/static/css/images/icons-36-black.png differ diff --git a/module/web/static/css/images/icons-36-white.png b/module/web/static/css/images/icons-36-white.png new file mode 100644 index 000000000..5647bdc94 Binary files /dev/null and b/module/web/static/css/images/icons-36-white.png differ diff --git a/module/web/static/css/jquery.mobile-1.1.1.min.css b/module/web/static/css/jquery.mobile-1.1.1.min.css new file mode 100644 index 000000000..3bbf55c66 --- /dev/null +++ b/module/web/static/css/jquery.mobile-1.1.1.min.css @@ -0,0 +1,2 @@ +/*! jQuery Mobile v1.1.1 1981b3f5ec22675ae47df8f0bdf9622e7780e90e jquerymobile.com | jquery.org/license */ +.ui-bar-a{border:1px solid #333;background:#111;color:#fff;font-weight:bold;text-shadow:0 -1px 1px #000;background-image:-webkit-gradient(linear,left top,left bottom,from(#3c3c3c),to(#111));background-image:-webkit-linear-gradient(#3c3c3c,#111);background-image:-moz-linear-gradient(#3c3c3c,#111);background-image:-ms-linear-gradient(#3c3c3c,#111);background-image:-o-linear-gradient(#3c3c3c,#111);background-image:linear-gradient(#3c3c3c,#111)}.ui-bar-a,.ui-bar-a input,.ui-bar-a select,.ui-bar-a textarea,.ui-bar-a button{font-family:Helvetica,Arial,sans-serif}.ui-bar-a .ui-link-inherit{color:#fff}.ui-bar-a a.ui-link{color:#7cc4e7;font-weight:bold}.ui-bar-a a.ui-link:visited{color:#2489ce}.ui-bar-a a.ui-link:hover{color:#2489ce}.ui-bar-a a.ui-link:active{color:#2489ce}.ui-body-a,.ui-overlay-a{border:1px solid #444;background:#222;color:#fff;text-shadow:0 1px 1px #111;font-weight:normal;background-image:-webkit-gradient(linear,left top,left bottom,from(#444),to(#222));background-image:-webkit-linear-gradient(#444,#222);background-image:-moz-linear-gradient(#444,#222);background-image:-ms-linear-gradient(#444,#222);background-image:-o-linear-gradient(#444,#222);background-image:linear-gradient(#444,#222)}.ui-overlay-a{background-image:none;border-width:0}.ui-body-a,.ui-body-a input,.ui-body-a select,.ui-body-a textarea,.ui-body-a button{font-family:Helvetica,Arial,sans-serif}.ui-body-a .ui-link-inherit{color:#fff}.ui-body-a .ui-link{color:#2489ce;font-weight:bold}.ui-body-a .ui-link:visited{color:#2489ce}.ui-body-a .ui-link:hover{color:#2489ce}.ui-body-a .ui-link:active{color:#2489ce}.ui-btn-up-a{border:1px solid #111;background:#333;font-weight:bold;color:#fff;text-shadow:0 1px 1px #111;background-image:-webkit-gradient(linear,left top,left bottom,from(#444),to(#2d2d2d));background-image:-webkit-linear-gradient(#444,#2d2d2d);background-image:-moz-linear-gradient(#444,#2d2d2d);background-image:-ms-linear-gradient(#444,#2d2d2d);background-image:-o-linear-gradient(#444,#2d2d2d);background-image:linear-gradient(#444,#2d2d2d)}.ui-btn-up-a:visited,.ui-btn-up-a a.ui-link-inherit{color:#fff}.ui-btn-hover-a{border:1px solid #000;background:#444;font-weight:bold;color:#fff;text-shadow:0 1px 1px #111;background-image:-webkit-gradient(linear,left top,left bottom,from(#555),to(#383838));background-image:-webkit-linear-gradient(#555,#383838);background-image:-moz-linear-gradient(#555,#383838);background-image:-ms-linear-gradient(#555,#383838);background-image:-o-linear-gradient(#555,#383838);background-image:linear-gradient(#555,#383838)}.ui-btn-hover-a:visited,.ui-btn-hover-a:hover,.ui-btn-hover-a a.ui-link-inherit{color:#fff}.ui-btn-down-a{border:1px solid #000;background:#222;font-weight:bold;color:#fff;text-shadow:0 1px 1px #111;background-image:-webkit-gradient(linear,left top,left bottom,from(#202020),to(#2c2c2c));background-image:-webkit-linear-gradient(#202020,#2c2c2c);background-image:-moz-linear-gradient(#202020,#2c2c2c);background-image:-ms-linear-gradient(#202020,#2c2c2c);background-image:-o-linear-gradient(#202020,#2c2c2c);background-image:linear-gradient(#202020,#2c2c2c)}.ui-btn-down-a:visited,.ui-btn-down-a:hover,.ui-btn-down-a a.ui-link-inherit{color:#fff}.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-b{border:1px solid #456f9a;background:#5e87b0;color:#fff;font-weight:bold;text-shadow:0 1px 1px #3e6790;background-image:-webkit-gradient(linear,left top,left bottom,from(#6facd5),to(#497bae));background-image:-webkit-linear-gradient(#6facd5,#497bae);background-image:-moz-linear-gradient(#6facd5,#497bae);background-image:-ms-linear-gradient(#6facd5,#497bae);background-image:-o-linear-gradient(#6facd5,#497bae);background-image:linear-gradient(#6facd5,#497bae)}.ui-bar-b,.ui-bar-b input,.ui-bar-b select,.ui-bar-b textarea,.ui-bar-b button{font-family:Helvetica,Arial,sans-serif}.ui-bar-b .ui-link-inherit{color:#fff}.ui-bar-b a.ui-link{color:#ddf0f8;font-weight:bold}.ui-bar-b a.ui-link:visited{color:#ddf0f8}.ui-bar-b a.ui-link:hover{color:#ddf0f8}.ui-bar-b a.ui-link:active{color:#ddf0f8}.ui-body-b,.ui-overlay-b{border:1px solid #999;background:#f3f3f3;color:#222;text-shadow:0 1px 0 #fff;font-weight:normal;background-image:-webkit-gradient(linear,left top,left bottom,from(#ddd),to(#ccc));background-image:-webkit-linear-gradient(#ddd,#ccc);background-image:-moz-linear-gradient(#ddd,#ccc);background-image:-ms-linear-gradient(#ddd,#ccc);background-image:-o-linear-gradient(#ddd,#ccc);background-image:linear-gradient(#ddd,#ccc)}.ui-overlay-b{background-image:none;border-width:0}.ui-body-b,.ui-body-b input,.ui-body-b select,.ui-body-b textarea,.ui-body-b button{font-family:Helvetica,Arial,sans-serif}.ui-body-b .ui-link-inherit{color:#333}.ui-body-b .ui-link{color:#2489ce;font-weight:bold}.ui-body-b .ui-link:visited{color:#2489ce}.ui-body-b .ui-link:hover{color:#2489ce}.ui-body-b .ui-link:active{color:#2489ce}.ui-btn-up-b{border:1px solid #044062;background:#396b9e;font-weight:bold;color:#fff;text-shadow:0 1px 1px #194b7e;background-image:-webkit-gradient(linear,left top,left bottom,from(#5f9cc5),to(#396b9e));background-image:-webkit-linear-gradient(#5f9cc5,#396b9e);background-image:-moz-linear-gradient(#5f9cc5,#396b9e);background-image:-ms-linear-gradient(#5f9cc5,#396b9e);background-image:-o-linear-gradient(#5f9cc5,#396b9e);background-image:linear-gradient(#5f9cc5,#396b9e)}.ui-btn-up-b:visited,.ui-btn-up-b a.ui-link-inherit{color:#fff}.ui-btn-hover-b{border:1px solid #00415e;background:#4b88b6;font-weight:bold;color:#fff;text-shadow:0 1px 1px #194b7e;background-image:-webkit-gradient(linear,left top,left bottom,from(#6facd5),to(#4272a4));background-image:-webkit-linear-gradient(#6facd5,#4272a4);background-image:-moz-linear-gradient(#6facd5,#4272a4);background-image:-ms-linear-gradient(#6facd5,#4272a4);background-image:-o-linear-gradient(#6facd5,#4272a4);background-image:linear-gradient(#6facd5,#4272a4)}.ui-btn-hover-b:visited,.ui-btn-hover-a:hover,.ui-btn-hover-b a.ui-link-inherit{color:#fff}.ui-btn-down-b{border:1px solid #225377;background:#4e89c5;font-weight:bold;color:#fff;text-shadow:0 1px 1px #194b7e;background-image:-webkit-gradient(linear,left top,left bottom,from(#295b8e),to(#3e79b5));background-image:-webkit-linear-gradient(#295b8e,#3e79b5);background-image:-moz-linear-gradient(#295b8e,#3e79b5);background-image:-ms-linear-gradient(#295b8e,#3e79b5);background-image:-o-linear-gradient(#295b8e,#3e79b5);background-image:linear-gradient(#295b8e,#3e79b5)}.ui-btn-down-b:visited,.ui-btn-down-b:hover,.ui-btn-down-b a.ui-link-inherit{color:#fff}.ui-btn-up-b,.ui-btn-hover-b,.ui-btn-down-b{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-c{border:1px solid #b3b3b3;background:#eee;color:#3e3e3e;font-weight:bold;text-shadow:0 1px 1px #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#f0f0f0),to(#ddd));background-image:-webkit-linear-gradient(#f0f0f0,#ddd);background-image:-moz-linear-gradient(#f0f0f0,#ddd);background-image:-ms-linear-gradient(#f0f0f0,#ddd);background-image:-o-linear-gradient(#f0f0f0,#ddd);background-image:linear-gradient(#f0f0f0,#ddd)}.ui-bar-c .ui-link-inherit{color:#3e3e3e}.ui-bar-c a.ui-link{color:#7cc4e7;font-weight:bold}.ui-bar-c a.ui-link:visited{color:#2489ce}.ui-bar-c a.ui-link:hover{color:#2489ce}.ui-bar-c a.ui-link:active{color:#2489ce}.ui-bar-c,.ui-bar-c input,.ui-bar-c select,.ui-bar-c textarea,.ui-bar-c button{font-family:Helvetica,Arial,sans-serif}.ui-body-c,.ui-overlay-c{border:1px solid #aaa;color:#333;text-shadow:0 1px 0 #fff;background:#f9f9f9;background-image:-webkit-gradient(linear,left top,left bottom,from(#f9f9f9),to(#eee));background-image:-webkit-linear-gradient(#f9f9f9,#eee);background-image:-moz-linear-gradient(#f9f9f9,#eee);background-image:-ms-linear-gradient(#f9f9f9,#eee);background-image:-o-linear-gradient(#f9f9f9,#eee);background-image:linear-gradient(#f9f9f9,#eee)}.ui-overlay-c{background-image:none;border-width:0}.ui-body-c,.ui-body-c input,.ui-body-c select,.ui-body-c textarea,.ui-body-c button{font-family:Helvetica,Arial,sans-serif}.ui-body-c .ui-link-inherit{color:#333}.ui-body-c .ui-link{color:#2489ce;font-weight:bold}.ui-body-c .ui-link:visited{color:#2489ce}.ui-body-c .ui-link:hover{color:#2489ce}.ui-body-c .ui-link:active{color:#2489ce}.ui-btn-up-c{border:1px solid #ccc;background:#eee;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#f1f1f1));background-image:-webkit-linear-gradient(#fff,#f1f1f1);background-image:-moz-linear-gradient(#fff,#f1f1f1);background-image:-ms-linear-gradient(#fff,#f1f1f1);background-image:-o-linear-gradient(#fff,#f1f1f1);background-image:linear-gradient(#fff,#f1f1f1)}.ui-btn-up-c:visited,.ui-btn-up-c a.ui-link-inherit{color:#2f3e46}.ui-btn-hover-c{border:1px solid #bbb;background:#dfdfdf;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#f6f6f6),to(#e0e0e0));background-image:-webkit-linear-gradient(#f6f6f6,#e0e0e0);background-image:-moz-linear-gradient(#f6f6f6,#e0e0e0);background-image:-ms-linear-gradient(#f6f6f6,#e0e0e0);background-image:-o-linear-gradient(#f6f6f6,#e0e0e0);background-image:linear-gradient(#f6f6f6,#e0e0e0)}.ui-btn-hover-c:visited,.ui-btn-hover-c:hover,.ui-btn-hover-c a.ui-link-inherit{color:#2f3e46}.ui-btn-down-c{border:1px solid #bbb;background:#d6d6d6;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#d0d0d0),to(#dfdfdf));background-image:-webkit-linear-gradient(#d0d0d0,#dfdfdf);background-image:-moz-linear-gradient(#d0d0d0,#dfdfdf);background-image:-ms-linear-gradient(#d0d0d0,#dfdfdf);background-image:-o-linear-gradient(#d0d0d0,#dfdfdf);background-image:linear-gradient(#d0d0d0,#dfdfdf)}.ui-btn-down-c:visited,.ui-btn-down-c:hover,.ui-btn-down-c a.ui-link-inherit{color:#2f3e46}.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-d{border:1px solid #bbb;background:#bbb;color:#333;text-shadow:0 1px 0 #eee;background-image:-webkit-gradient(linear,left top,left bottom,from(#ddd),to(#bbb));background-image:-webkit-linear-gradient(#ddd,#bbb);background-image:-moz-linear-gradient(#ddd,#bbb);background-image:-ms-linear-gradient(#ddd,#bbb);background-image:-o-linear-gradient(#ddd,#bbb);background-image:linear-gradient(#ddd,#bbb)}.ui-bar-d,.ui-bar-d input,.ui-bar-d select,.ui-bar-d textarea,.ui-bar-d button{font-family:Helvetica,Arial,sans-serif}.ui-bar-d .ui-link-inherit{color:#333}.ui-bar-d a.ui-link{color:#2489ce;font-weight:bold}.ui-bar-d a.ui-link:visited{color:#2489ce}.ui-bar-d a.ui-link:hover{color:#2489ce}.ui-bar-d a.ui-link:active{color:#2489ce}.ui-body-d,.ui-overlay-d{border:1px solid #bbb;color:#333;text-shadow:0 1px 0 #fff;background:#fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#fff));background-image:-webkit-linear-gradient(#fff,#fff);background-image:-moz-linear-gradient(#fff,#fff);background-image:-ms-linear-gradient(#fff,#fff);background-image:-o-linear-gradient(#fff,#fff);background-image:linear-gradient(#fff,#fff)}.ui-overlay-d{background-image:none;border-width:0}.ui-body-d,.ui-body-d input,.ui-body-d select,.ui-body-d textarea,.ui-body-d button{font-family:Helvetica,Arial,sans-serif}.ui-body-d .ui-link-inherit{color:#333}.ui-body-d .ui-link{color:#2489ce;font-weight:bold}.ui-body-d .ui-link:visited{color:#2489ce}.ui-body-d .ui-link:hover{color:#2489ce}.ui-body-d .ui-link:active{color:#2489ce}.ui-btn-up-d{border:1px solid #bbb;background:#fff;font-weight:bold;color:#333;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fafafa),to(#f6f6f6));background-image:-webkit-linear-gradient(#fafafa,#f6f6f6);background-image:-moz-linear-gradient(#fafafa,#f6f6f6);background-image:-ms-linear-gradient(#fafafa,#f6f6f6);background-image:-o-linear-gradient(#fafafa,#f6f6f6);background-image:linear-gradient(#fafafa,#f6f6f6)}.ui-btn-up-d:visited,.ui-btn-up-d a.ui-link-inherit{color:#333}.ui-btn-hover-d{border:1px solid #aaa;background:#eee;font-weight:bold;color:#333;cursor:pointer;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#eee),to(#fff));background-image:-webkit-linear-gradient(#eee,#fff);background-image:-moz-linear-gradient(#eee,#fff);background-image:-ms-linear-gradient(#eee,#fff);background-image:-o-linear-gradient(#eee,#fff);background-image:linear-gradient(#eee,#fff)}.ui-btn-hover-d:visited,.ui-btn-hover-d:hover,.ui-btn-hover-d a.ui-link-inherit{color:#333}.ui-btn-down-d{border:1px solid #aaa;background:#eee;font-weight:bold;color:#333;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#e5e5e5),to(#f2f2f2));background-image:-webkit-linear-gradient(#e5e5e5,#f2f2f2);background-image:-moz-linear-gradient(#e5e5e5,#f2f2f2);background-image:-ms-linear-gradient(#e5e5e5,#f2f2f2);background-image:-o-linear-gradient(#e5e5e5,#f2f2f2);background-image:linear-gradient(#e5e5e5,#f2f2f2)}.ui-btn-down-d:visited,.ui-btn-down-d:hover,.ui-btn-down-d a.ui-link-inherit{color:#333}.ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d{font-family:Helvetica,Arial,sans-serif;text-decoration:none}.ui-bar-e{border:1px solid #f7c942;background:#fadb4e;color:#333;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fceda7),to(#fbef7e));background-image:-webkit-linear-gradient(#fceda7,#fbef7e);background-image:-moz-linear-gradient(#fceda7,#fbef7e);background-image:-ms-linear-gradient(#fceda7,#fbef7e);background-image:-o-linear-gradient(#fceda7,#fbef7e);background-image:linear-gradient(#fceda7,#fbef7e)}.ui-bar-e,.ui-bar-e input,.ui-bar-e select,.ui-bar-e textarea,.ui-bar-e button{font-family:Helvetica,Arial,sans-serif}.ui-bar-e .ui-link-inherit{color:#333}.ui-bar-e a.ui-link{color:#2489ce;font-weight:bold}.ui-bar-e a.ui-link:visited{color:#2489ce}.ui-bar-e a.ui-link:hover{color:#2489ce}.ui-bar-e a.ui-link:active{color:#2489ce}.ui-body-e,.ui-overlay-e{border:1px solid #f7c942;color:#222;text-shadow:0 1px 0 #fff;background:#fff9df;background-image:-webkit-gradient(linear,left top,left bottom,from(#fffadf),to(#fff3a5));background-image:-webkit-linear-gradient(#fffadf,#fff3a5);background-image:-moz-linear-gradient(#fffadf,#fff3a5);background-image:-ms-linear-gradient(#fffadf,#fff3a5);background-image:-o-linear-gradient(#fffadf,#fff3a5);background-image:linear-gradient(#fffadf,#fff3a5)}.ui-overlay-e{background-image:none;border-width:0}.ui-body-e,.ui-body-e input,.ui-body-e select,.ui-body-e textarea,.ui-body-e button{font-family:Helvetica,Arial,sans-serif}.ui-body-e .ui-link-inherit{color:#333}.ui-body-e .ui-link{color:#2489ce;font-weight:bold}.ui-body-e .ui-link:visited{color:#2489ce}.ui-body-e .ui-link:hover{color:#2489ce}.ui-body-e .ui-link:active{color:#2489ce}.ui-btn-up-e{border:1px solid #f4c63f;background:#fadb4e;font-weight:bold;color:#222;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#ffefaa),to(#ffe155));background-image:-webkit-linear-gradient(#ffefaa,#ffe155);background-image:-moz-linear-gradient(#ffefaa,#ffe155);background-image:-ms-linear-gradient(#ffefaa,#ffe155);background-image:-o-linear-gradient(#ffefaa,#ffe155);background-image:linear-gradient(#ffefaa,#ffe155)}.ui-btn-up-e:visited,.ui-btn-up-e a.ui-link-inherit{color:#222}.ui-btn-hover-e{border:1px solid #f2c43d;background:#fbe26f;font-weight:bold;color:#111;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#fff5ba),to(#fbdd52));background-image:-webkit-linear-gradient(#fff5ba,#fbdd52);background-image:-moz-linear-gradient(#fff5ba,#fbdd52);background-image:-ms-linear-gradient(#fff5ba,#fbdd52);background-image:-o-linear-gradient(#fff5ba,#fbdd52);background-image:linear-gradient(#fff5ba,#fbdd52)}.ui-btn-hover-e:visited,.ui-btn-hover-e:hover,.ui-btn-hover-e a.ui-link-inherit{color:#333}.ui-btn-down-e{border:1px solid #f2c43d;background:#fceda7;font-weight:bold;color:#111;text-shadow:0 1px 0 #fff;background-image:-webkit-gradient(linear,left top,left bottom,from(#f8d94c),to(#fadb4e));background-image:-webkit-linear-gradient(#f8d94c,#fadb4e);background-image:-moz-linear-gradient(#f8d94c,#fadb4e);background-image:-ms-linear-gradient(#f8d94c,#fadb4e);background-image:-o-linear-gradient(#f8d94c,#fadb4e);background-image:linear-gradient(#f8d94c,#fadb4e)}.ui-btn-down-e:visited,.ui-btn-down-e:hover,.ui-btn-down-e a.ui-link-inherit{color:#333}.ui-btn-up-e,.ui-btn-hover-e,.ui-btn-down-e{font-family:Helvetica,Arial,sans-serif;text-decoration:none}a.ui-link-inherit{text-decoration:none!important}.ui-btn-active{border:1px solid #2373a5;background:#5393c5;font-weight:bold;color:#fff;cursor:pointer;text-shadow:0 1px 1px #3373a5;text-decoration:none;background-image:-webkit-gradient(linear,left top,left bottom,from(#5393c5),to(#6facd5));background-image:-webkit-linear-gradient(#5393c5,#6facd5);background-image:-moz-linear-gradient(#5393c5,#6facd5);background-image:-ms-linear-gradient(#5393c5,#6facd5);background-image:-o-linear-gradient(#5393c5,#6facd5);background-image:linear-gradient(#5393c5,#6facd5);font-family:Helvetica,Arial,sans-serif}.ui-btn-active:visited,.ui-btn-active:hover,.ui-btn-active a.ui-link-inherit{color:#fff}.ui-btn-inner{border-top:1px solid #fff;border-color:rgba(255,255,255,.3)}.ui-corner-tl{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em}.ui-corner-tr{-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em}.ui-corner-bl{-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em}.ui-corner-br{-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-top{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em;-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em}.ui-corner-bottom{-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em;-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-right{-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em;-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-left{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em;-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em}.ui-corner-all{-moz-border-radius:.6em;-webkit-border-radius:.6em;border-radius:.6em}.ui-corner-none{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.ui-br{border-bottom:#828282;border-bottom:rgba(130,130,130,.3);border-bottom-width:1px;border-bottom-style:solid}.ui-disabled{opacity:.3}.ui-disabled,.ui-disabled a{cursor:default!important;pointer-events:none}.ui-disabled .ui-btn-text{-ms-filter:"alpha(opacity=30)";filter:alpha(opacity=30);zoom:1}.ui-icon,.ui-icon-searchfield:after{background:#666;background:rgba(0,0,0,.4);background-image:url(images/icons-18-white.png);background-repeat:no-repeat;-moz-border-radius:9px;-webkit-border-radius:9px;border-radius:9px}.ui-icon-alt{background:#fff;background:rgba(255,255,255,.3);background-image:url(images/icons-18-black.png);background-repeat:no-repeat}@media only screen and (-webkit-min-device-pixel-ratio:1.5),only screen and (min--moz-device-pixel-ratio:1.5),only screen and (min-resolution:240dpi){.ui-icon-plus,.ui-icon-minus,.ui-icon-delete,.ui-icon-arrow-r,.ui-icon-arrow-l,.ui-icon-arrow-u,.ui-icon-arrow-d,.ui-icon-check,.ui-icon-gear,.ui-icon-refresh,.ui-icon-forward,.ui-icon-back,.ui-icon-grid,.ui-icon-star,.ui-icon-alert,.ui-icon-info,.ui-icon-home,.ui-icon-search,.ui-icon-searchfield:after,.ui-icon-checkbox-off,.ui-icon-checkbox-on,.ui-icon-radio-off,.ui-icon-radio-on{background-image:url(images/icons-36-white.png);-moz-background-size:776px 18px;-o-background-size:776px 18px;-webkit-background-size:776px 18px;background-size:776px 18px}.ui-icon-alt{background-image:url(images/icons-36-black.png)}}.ui-icon-plus{background-position:-0 50%}.ui-icon-minus{background-position:-36px 50%}.ui-icon-delete{background-position:-72px 50%}.ui-icon-arrow-r{background-position:-108px 50%}.ui-icon-arrow-l{background-position:-144px 50%}.ui-icon-arrow-u{background-position:-180px 50%}.ui-icon-arrow-d{background-position:-216px 50%}.ui-icon-check{background-position:-252px 50%}.ui-icon-gear{background-position:-288px 50%}.ui-icon-refresh{background-position:-324px 50%}.ui-icon-forward{background-position:-360px 50%}.ui-icon-back{background-position:-396px 50%}.ui-icon-grid{background-position:-432px 50%}.ui-icon-star{background-position:-468px 50%}.ui-icon-alert{background-position:-504px 50%}.ui-icon-info{background-position:-540px 50%}.ui-icon-home{background-position:-576px 50%}.ui-icon-search,.ui-icon-searchfield:after{background-position:-612px 50%}.ui-icon-checkbox-off{background-position:-684px 50%}.ui-icon-checkbox-on{background-position:-648px 50%}.ui-icon-radio-off{background-position:-756px 50%}.ui-icon-radio-on{background-position:-720px 50%}.ui-checkbox .ui-icon{-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px}.ui-icon-checkbox-off,.ui-icon-radio-off{background-color:transparent}.ui-checkbox-on .ui-icon,.ui-radio-on .ui-icon{background-color:#4596ce}.ui-icon-loading{background:url(images/ajax-loader.gif);background-size:46px 46px}.ui-btn-corner-tl{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em}.ui-btn-corner-tr{-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em}.ui-btn-corner-bl{-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em}.ui-btn-corner-br{-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-top{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em;-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em}.ui-btn-corner-bottom{-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em;-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-right{-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em;-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-left{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em;-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em}.ui-btn-corner-all{-moz-border-radius:1em;-webkit-border-radius:1em;border-radius:1em}.ui-corner-tl,.ui-corner-tr,.ui-corner-bl,.ui-corner-br,.ui-corner-top,.ui-corner-bottom,.ui-corner-right,.ui-corner-left,.ui-corner-all,.ui-btn-corner-tl,.ui-btn-corner-tr,.ui-btn-corner-bl,.ui-btn-corner-br,.ui-btn-corner-top,.ui-btn-corner-bottom,.ui-btn-corner-right,.ui-btn-corner-left,.ui-btn-corner-all{-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box}.ui-overlay{background:#666;opacity:.5;filter:Alpha(Opacity=50);position:absolute;width:100%;height:100%}.ui-overlay-shadow{-moz-box-shadow:0 0 12px rgba(0,0,0,.6);-webkit-box-shadow:0 0 12px rgba(0,0,0,.6);box-shadow:0 0 12px rgba(0,0,0,.6)}.ui-shadow{-moz-box-shadow:0 1px 4px rgba(0,0,0,.3);-webkit-box-shadow:0 1px 4px rgba(0,0,0,.3);box-shadow:0 1px 4px rgba(0,0,0,.3)}.ui-bar-a .ui-shadow,.ui-bar-b .ui-shadow,.ui-bar-c .ui-shadow{-moz-box-shadow:0 1px 0 rgba(255,255,255,.3);-webkit-box-shadow:0 1px 0 rgba(255,255,255,.3);box-shadow:0 1px 0 rgba(255,255,255,.3)}.ui-shadow-inset{-moz-box-shadow:inset 0 1px 4px rgba(0,0,0,.2);-webkit-box-shadow:inset 0 1px 4px rgba(0,0,0,.2);box-shadow:inset 0 1px 4px rgba(0,0,0,.2)}.ui-icon-shadow{-moz-box-shadow:0 1px 0 rgba(255,255,255,.4);-webkit-box-shadow:0 1px 0 rgba(255,255,255,.4);box-shadow:0 1px 0 rgba(255,255,255,.4)}.ui-btn:focus,.ui-link-inherit:focus{outline:0}.ui-btn.ui-focus{z-index:1}.ui-focus,.ui-btn:focus{-moz-box-shadow:inset 0 0 3px #387bbe,0px 0 9px #387bbe;-webkit-box-shadow:inset 0 0 3px #387bbe,0px 0 9px #387bbe;box-shadow:inset 0 0 3px #387bbe,0px 0 9px #387bbe}.ui-input-text.ui-focus,.ui-input-search.ui-focus{-moz-box-shadow:0 0 12px #387bbe;-webkit-box-shadow:0 0 12px #387bbe;box-shadow:0 0 12px #387bbe}.ui-mobile-nosupport-boxshadow *{-moz-box-shadow:none!important;-webkit-box-shadow:none!important;box-shadow:none!important}.ui-mobile-nosupport-boxshadow .ui-focus,.ui-mobile-nosupport-boxshadow .ui-btn:focus,.ui-mobile-nosupport-boxshadow .ui-link-inherit:focus{outline-width:1px;outline-style:auto}.ui-mobile,.ui-mobile body{height:99.9%}.ui-mobile fieldset,.ui-page{padding:0;margin:0}.ui-mobile a img,.ui-mobile fieldset{border-width:0}.ui-mobile-viewport{margin:0;overflow-x:visible;-webkit-text-size-adjust:none;-ms-text-size-adjust:none;-webkit-tap-highlight-color:rgba(0,0,0,0)}body.ui-mobile-viewport,div.ui-mobile-viewport{overflow-x:hidden}.ui-mobile [data-role=page],.ui-mobile [data-role=dialog],.ui-page{top:0;left:0;width:100%;min-height:100%;position:absolute;display:none;border:0}.ui-mobile .ui-page-active{display:block;overflow:visible}.ui-page{outline:0}@media screen and (orientation:portrait){.ui-mobile,.ui-mobile .ui-page{min-height:420px}}@media screen and (orientation:landscape){.ui-mobile,.ui-mobile .ui-page{min-height:300px}}.ui-loading .ui-loader{display:block}.ui-loader{display:none;z-index:9999999;position:fixed;top:50%;left:50%;border:0}.ui-loader-default{background:0;opacity:.18;width:46px;height:46px;margin-left:-23px;margin-top:-23px}.ui-loader-verbose{width:200px;opacity:.88;box-shadow:0 1px 1px -1px #fff;height:auto;margin-left:-110px;margin-top:-43px;padding:10px}.ui-loader-default h1{font-size:0;width:0;height:0;overflow:hidden}.ui-loader-verbose h1{font-size:16px;margin:0;text-align:center}.ui-loader .ui-icon{background-color:#000;display:block;margin:0;width:44px;height:44px;padding:1px;-webkit-border-radius:36px;-moz-border-radius:36px;border-radius:36px}.ui-loader-verbose .ui-icon{margin:0 auto 10px;opacity:.75}.ui-loader-textonly{padding:15px;margin-left:-115px}.ui-loader-textonly .ui-icon{display:none}.ui-loader-fakefix{position:absolute}.ui-mobile-rendering>*{visibility:hidden}.ui-bar,.ui-body{position:relative;padding:.4em 15px;overflow:hidden;display:block;clear:both}.ui-bar{font-size:16px;margin:0}.ui-bar h1,.ui-bar h2,.ui-bar h3,.ui-bar h4,.ui-bar h5,.ui-bar h6{margin:0;padding:0;font-size:16px;display:inline-block}.ui-header,.ui-footer{position:relative;border-left-width:0;border-right-width:0;zoom:1}.ui-header .ui-btn-left,.ui-header .ui-btn-right,.ui-footer .ui-btn-left,.ui-footer .ui-btn-right{position:absolute;top:3px}.ui-header .ui-btn-left,.ui-footer .ui-btn-left{left:5px}.ui-header .ui-btn-right,.ui-footer .ui-btn-right{right:5px}.ui-footer .ui-btn-icon-notext,.ui-header .ui-btn-icon-notext{top:6px}.ui-header .ui-title,.ui-footer .ui-title{min-height:1.1em;text-align:center;font-size:16px;display:block;margin:.6em 30% .8em;padding:0;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;outline:0!important}.ui-footer .ui-title{margin:.6em 15px .8em}.ui-content{border-width:0;overflow:visible;overflow-x:hidden;padding:15px}.ui-icon{width:18px;height:18px}.ui-nojs{position:absolute;left:-9999px}.ui-hide-label label.ui-input-text,.ui-hide-label label.ui-select,.ui-hide-label label.ui-slider,.ui-hide-label label.ui-submit,.ui-hide-label .ui-controlgroup-label,.ui-hidden-accessible{position:absolute!important;left:-9999px;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px)}.ui-mobile-viewport-transitioning,.ui-mobile-viewport-transitioning .ui-page{width:100%;height:100%;overflow:hidden;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.in{-webkit-animation-timing-function:ease-out;-webkit-animation-duration:350ms;-moz-animation-timing-function:ease-out;-moz-animation-duration:350ms}.out{-webkit-animation-timing-function:ease-in;-webkit-animation-duration:225ms;-moz-animation-timing-function:ease-in;-moz-animation-duration:225}@-webkit-keyframes fadein{from{opacity:0}to{opacity:1}}@-moz-keyframes fadein{from{opacity:0}to{opacity:1}}@-webkit-keyframes fadeout{from{opacity:1}to{opacity:0}}@-moz-keyframes fadeout{from{opacity:1}to{opacity:0}}.fade.out{opacity:0;-webkit-animation-duration:125ms;-webkit-animation-name:fadeout;-moz-animation-duration:125ms;-moz-animation-name:fadeout}.fade.in{opacity:1;-webkit-animation-duration:225ms;-webkit-animation-name:fadein;-moz-animation-duration:225ms;-moz-animation-name:fadein}.pop{-webkit-transform-origin:50% 50%;-moz-transform-origin:50% 50%}.pop.in{-webkit-transform:scale(1);-moz-transform:scale(1);opacity:1;-webkit-animation-name:popin;-moz-animation-name:popin;-webkit-animation-duration:350ms;-moz-animation-duration:350ms}.pop.out{-webkit-animation-name:fadeout;-moz-animation-name:fadeout;opacity:0;-webkit-animation-duration:100ms;-moz-animation-duration:100ms}.pop.in.reverse{-webkit-animation-name:fadein;-moz-animation-name:fadein}.pop.out.reverse{-webkit-transform:scale(.8);-moz-transform:scale(.8);-webkit-animation-name:popout;-moz-animation-name:popout}@-webkit-keyframes popin{from{-webkit-transform:scale(.8);opacity:0}to{-webkit-transform:scale(1);opacity:1}}@-moz-keyframes popin{from{-moz-transform:scale(.8);opacity:0}to{-moz-transform:scale(1);opacity:1}}@-webkit-keyframes popout{from{-webkit-transform:scale(1);opacity:1}to{-webkit-transform:scale(.8);opacity:0}}@-moz-keyframes popout{from{-moz-transform:scale(1);opacity:1}to{-moz-transform:scale(.8);opacity:0}}@-webkit-keyframes slideinfromright{from{-webkit-transform:translateX(100%)}to{-webkit-transform:translateX(0)}}@-moz-keyframes slideinfromright{from{-moz-transform:translateX(100%)}to{-moz-transform:translateX(0)}}@-webkit-keyframes slideinfromleft{from{-webkit-transform:translateX(-100%)}to{-webkit-transform:translateX(0)}}@-moz-keyframes slideinfromleft{from{-moz-transform:translateX(-100%)}to{-moz-transform:translateX(0)}}@-webkit-keyframes slideouttoleft{from{-webkit-transform:translateX(0)}to{-webkit-transform:translateX(-100%)}}@-moz-keyframes slideouttoleft{from{-moz-transform:translateX(0)}to{-moz-transform:translateX(-100%)}}@-webkit-keyframes slideouttoright{from{-webkit-transform:translateX(0)}to{-webkit-transform:translateX(100%)}}@-moz-keyframes slideouttoright{from{-moz-transform:translateX(0)}to{-moz-transform:translateX(100%)}}.slide.out,.slide.in{-webkit-animation-timing-function:ease-out;-webkit-animation-duration:350ms;-moz-animation-timing-function:ease-out;-moz-animation-duration:350ms}.slide.out{-webkit-transform:translateX(-100%);-webkit-animation-name:slideouttoleft;-moz-transform:translateX(-100%);-moz-animation-name:slideouttoleft}.slide.in{-webkit-transform:translateX(0);-webkit-animation-name:slideinfromright;-moz-transform:translateX(0);-moz-animation-name:slideinfromright}.slide.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:slideouttoright;-moz-transform:translateX(100%);-moz-animation-name:slideouttoright}.slide.in.reverse{-webkit-transform:translateX(0);-webkit-animation-name:slideinfromleft;-moz-transform:translateX(0);-moz-animation-name:slideinfromleft}.slidefade.out{-webkit-transform:translateX(-100%);-webkit-animation-name:slideouttoleft;-moz-transform:translateX(-100%);-moz-animation-name:slideouttoleft;-webkit-animation-duration:225ms;-moz-animation-duration:225ms}.slidefade.in{-webkit-transform:translateX(0);-webkit-animation-name:fadein;-moz-transform:translateX(0);-moz-animation-name:fadein;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}.slidefade.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:slideouttoright;-moz-transform:translateX(100%);-moz-animation-name:slideouttoright;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}.slidefade.in.reverse{-webkit-transform:translateX(0);-webkit-animation-name:fadein;-moz-transform:translateX(0);-moz-animation-name:fadein;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}.slidedown.out{-webkit-animation-name:fadeout;-moz-animation-name:fadeout;-webkit-animation-duration:100ms;-moz-animation-duration:100ms}.slidedown.in{-webkit-transform:translateY(0);-webkit-animation-name:slideinfromtop;-moz-transform:translateY(0);-moz-animation-name:slideinfromtop;-webkit-animation-duration:250ms;-moz-animation-duration:250ms}.slidedown.in.reverse{-webkit-animation-name:fadein;-moz-animation-name:fadein;-webkit-animation-duration:150ms;-moz-animation-duration:150ms}.slidedown.out.reverse{-webkit-transform:translateY(-100%);-moz-transform:translateY(-100%);-webkit-animation-name:slideouttotop;-moz-animation-name:slideouttotop;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}@-webkit-keyframes slideinfromtop{from{-webkit-transform:translateY(-100%)}to{-webkit-transform:translateY(0)}}@-moz-keyframes slideinfromtop{from{-moz-transform:translateY(-100%)}to{-moz-transform:translateY(0)}}@-webkit-keyframes slideouttotop{from{-webkit-transform:translateY(0)}to{-webkit-transform:translateY(-100%)}}@-moz-keyframes slideouttotop{from{-moz-transform:translateY(0)}to{-moz-transform:translateY(-100%)}}.slideup.out{-webkit-animation-name:fadeout;-moz-animation-name:fadeout;-webkit-animation-duration:100ms;-moz-animation-duration:100ms}.slideup.in{-webkit-transform:translateY(0);-webkit-animation-name:slideinfrombottom;-moz-transform:translateY(0);-moz-animation-name:slideinfrombottom;-webkit-animation-duration:250ms;-moz-animation-duration:250ms}.slideup.in.reverse{-webkit-animation-name:fadein;-moz-animation-name:fadein;-webkit-animation-duration:150ms;-moz-animation-duration:150ms}.slideup.out.reverse{-webkit-transform:translateY(100%);-moz-transform:translateY(100%);-webkit-animation-name:slideouttobottom;-moz-animation-name:slideouttobottom;-webkit-animation-duration:200ms;-moz-animation-duration:200ms}@-webkit-keyframes slideinfrombottom{from{-webkit-transform:translateY(100%)}to{-webkit-transform:translateY(0)}}@-moz-keyframes slideinfrombottom{from{-moz-transform:translateY(100%)}to{-moz-transform:translateY(0)}}@-webkit-keyframes slideouttobottom{from{-webkit-transform:translateY(0)}to{-webkit-transform:translateY(100%)}}@-moz-keyframes slideouttobottom{from{-moz-transform:translateY(0)}to{-moz-transform:translateY(100%)}}.viewport-flip{-webkit-perspective:1000;-moz-perspective:1000;position:absolute}.flip{-webkit-backface-visibility:hidden;-webkit-transform:translateX(0);-moz-backface-visibility:hidden;-moz-transform:translateX(0)}.flip.out{-webkit-transform:rotateY(-90deg) scale(.9);-webkit-animation-name:flipouttoleft;-webkit-animation-duration:175ms;-moz-transform:rotateY(-90deg) scale(.9);-moz-animation-name:flipouttoleft;-moz-animation-duration:175ms}.flip.in{-webkit-animation-name:flipintoright;-webkit-animation-duration:225ms;-moz-animation-name:flipintoright;-moz-animation-duration:225ms}.flip.out.reverse{-webkit-transform:rotateY(90deg) scale(.9);-webkit-animation-name:flipouttoright;-moz-transform:rotateY(90deg) scale(.9);-moz-animation-name:flipouttoright}.flip.in.reverse{-webkit-animation-name:flipintoleft;-moz-animation-name:flipintoleft}@-webkit-keyframes flipouttoleft{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(-90deg) scale(.9)}}@-moz-keyframes flipouttoleft{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(-90deg) scale(.9)}}@-webkit-keyframes flipouttoright{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(90deg) scale(.9)}}@-moz-keyframes flipouttoright{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(90deg) scale(.9)}}@-webkit-keyframes flipintoleft{from{-webkit-transform:rotateY(-90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoleft{from{-moz-transform:rotateY(-90deg) scale(.9)}to{-moz-transform:rotateY(0)}}@-webkit-keyframes flipintoright{from{-webkit-transform:rotateY(90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoright{from{-moz-transform:rotateY(90deg) scale(.9)}to{-moz-transform:rotateY(0)}}.viewport-turn{-webkit-perspective:1000;-moz-perspective:1000;position:absolute}.turn{-webkit-backface-visibility:hidden;-webkit-transform:translateX(0);-webkit-transform-origin:0 0;-moz-backface-visibility:hidden;-moz-transform:translateX(0);-moz-transform-origin:0 0}.turn.out{-webkit-transform:rotateY(-90deg) scale(.9);-webkit-animation-name:flipouttoleft;-moz-transform:rotateY(-90deg) scale(.9);-moz-animation-name:flipouttoleft;-webkit-animation-duration:125ms;-moz-animation-duration:125ms}.turn.in{-webkit-animation-name:flipintoright;-moz-animation-name:flipintoright;-webkit-animation-duration:250ms;-moz-animation-duration:250ms}.turn.out.reverse{-webkit-transform:rotateY(90deg) scale(.9);-webkit-animation-name:flipouttoright;-moz-transform:rotateY(90deg) scale(.9);-moz-animation-name:flipouttoright}.turn.in.reverse{-webkit-animation-name:flipintoleft;-moz-animation-name:flipintoleft}@-webkit-keyframes flipouttoleft{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(-90deg) scale(.9)}}@-moz-keyframes flipouttoleft{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(-90deg) scale(.9)}}@-webkit-keyframes flipouttoright{from{-webkit-transform:rotateY(0)}to{-webkit-transform:rotateY(90deg) scale(.9)}}@-moz-keyframes flipouttoright{from{-moz-transform:rotateY(0)}to{-moz-transform:rotateY(90deg) scale(.9)}}@-webkit-keyframes flipintoleft{from{-webkit-transform:rotateY(-90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoleft{from{-moz-transform:rotateY(-90deg) scale(.9)}to{-moz-transform:rotateY(0)}}@-webkit-keyframes flipintoright{from{-webkit-transform:rotateY(90deg) scale(.9)}to{-webkit-transform:rotateY(0)}}@-moz-keyframes flipintoright{from{-moz-transform:rotateY(90deg) scale(.9)}to{-moz-transform:rotateY(0)}}.flow{-webkit-transform-origin:50% 30%;-moz-transform-origin:50% 30%;-webkit-box-shadow:0 0 20px rgba(0,0,0,.4);-moz-box-shadow:0 0 20px rgba(0,0,0,.4)}.ui-dialog.flow{-webkit-transform-origin:none;-moz-transform-origin:none;-webkit-box-shadow:none;-moz-box-shadow:none}.flow.out{-webkit-transform:translateX(-100%) scale(.7);-webkit-animation-name:flowouttoleft;-webkit-animation-timing-function:ease;-webkit-animation-duration:350ms;-moz-transform:translateX(-100%) scale(.7);-moz-animation-name:flowouttoleft;-moz-animation-timing-function:ease;-moz-animation-duration:350ms}.flow.in{-webkit-transform:translateX(0) scale(1);-webkit-animation-name:flowinfromright;-webkit-animation-timing-function:ease;-webkit-animation-duration:350ms;-moz-transform:translateX(0) scale(1);-moz-animation-name:flowinfromright;-moz-animation-timing-function:ease;-moz-animation-duration:350ms}.flow.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:flowouttoright;-moz-transform:translateX(100%);-moz-animation-name:flowouttoright}.flow.in.reverse{-webkit-animation-name:flowinfromleft;-moz-animation-name:flowinfromleft}@-webkit-keyframes flowouttoleft{0%{-webkit-transform:translateX(0) scale(1)}60%,70%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(-100%) scale(.7)}}@-moz-keyframes flowouttoleft{0%{-moz-transform:translateX(0) scale(1)}60%,70%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(-100%) scale(.7)}}@-webkit-keyframes flowouttoright{0%{-webkit-transform:translateX(0) scale(1)}60%,70%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(100%) scale(.7)}}@-moz-keyframes flowouttoright{0%{-moz-transform:translateX(0) scale(1)}60%,70%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(100%) scale(.7)}}@-webkit-keyframes flowinfromleft{0%{-webkit-transform:translateX(-100%) scale(.7)}30%,40%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(0) scale(1)}}@-moz-keyframes flowinfromleft{0%{-moz-transform:translateX(-100%) scale(.7)}30%,40%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(0) scale(1)}}@-webkit-keyframes flowinfromright{0%{-webkit-transform:translateX(100%) scale(.7)}30%,40%{-webkit-transform:translateX(0) scale(.7)}100%{-webkit-transform:translateX(0) scale(1)}}@-moz-keyframes flowinfromright{0%{-moz-transform:translateX(100%) scale(.7)}30%,40%{-moz-transform:translateX(0) scale(.7)}100%{-moz-transform:translateX(0) scale(1)}}.ui-grid-a,.ui-grid-b,.ui-grid-c,.ui-grid-d{overflow:hidden}.ui-block-a,.ui-block-b,.ui-block-c,.ui-block-d,.ui-block-e{margin:0;padding:0;border:0;float:left;min-height:1px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.ui-grid-solo .ui-block-a{display:block;float:none}.ui-grid-a .ui-block-a,.ui-grid-a .ui-block-b{width:49.95%}.ui-grid-a>:nth-child(n){width:50%;margin-right:-.5px}.ui-grid-a .ui-block-a{clear:left}.ui-grid-b .ui-block-a,.ui-grid-b .ui-block-b,.ui-grid-b .ui-block-c{width:33.25%}.ui-grid-b>:nth-child(n){width:33.333%;margin-right:-.5px}.ui-grid-b .ui-block-a{clear:left}.ui-grid-c .ui-block-a,.ui-grid-c .ui-block-b,.ui-grid-c .ui-block-c,.ui-grid-c .ui-block-d{width:24.925%}.ui-grid-c>:nth-child(n){width:25%;margin-right:-.5px}.ui-grid-c .ui-block-a{clear:left}.ui-grid-d .ui-block-a,.ui-grid-d .ui-block-b,.ui-grid-d .ui-block-c,.ui-grid-d .ui-block-d,.ui-grid-d .ui-block-e{width:19.925%}.ui-grid-d>:nth-child(n){width:20%}.ui-grid-d .ui-block-a{clear:left}.ui-header-fixed,.ui-footer-fixed{left:0;right:0;width:100%;position:fixed;z-index:1000}.ui-page-pre-in{opacity:0}.ui-header-fixed{top:0}.ui-footer-fixed{bottom:0}.ui-header-fullscreen,.ui-footer-fullscreen{opacity:.9}.ui-page-header-fixed{padding-top:2.6875em}.ui-page-footer-fixed{padding-bottom:2.6875em}.ui-page-header-fullscreen .ui-content,.ui-page-footer-fullscreen .ui-content{padding:0}.ui-fixed-hidden{position:absolute}.ui-page-header-fullscreen .ui-fixed-hidden,.ui-page-footer-fullscreen .ui-fixed-hidden{left:-99999em}.ui-header-fixed .ui-btn,.ui-footer-fixed .ui-btn{z-index:10}.ui-navbar{max-width:100%}.ui-navbar ul{list-style:none;margin:0;padding:0;position:relative;display:block;border:0;max-width:100%;overflow:hidden}.ui-navbar li .ui-btn{display:block;text-align:center;margin:0 -1px 0 0;border-right-width:0}.ui-navbar li .ui-btn-icon-right .ui-icon{right:6px}.ui-navbar li:last-child .ui-btn,.ui-navbar .ui-grid-duo .ui-block-b .ui-btn{margin-right:0;border-right-width:1px}.ui-header .ui-navbar li:last-child .ui-btn,.ui-footer .ui-navbar li:last-child .ui-btn,.ui-header .ui-navbar .ui-grid-duo .ui-block-b .ui-btn,.ui-footer .ui-navbar .ui-grid-duo .ui-block-b .ui-btn{margin-right:-1px;border-right-width:0}.ui-navbar .ui-grid-duo li.ui-block-a:last-child .ui-btn{margin-right:-1px;border-right-width:1px}.ui-header .ui-navbar li .ui-btn,.ui-footer .ui-navbar li .ui-btn{border-top-width:0;border-bottom-width:0}.ui-header .ui-navbar .ui-grid-b li.ui-block-c .ui-btn,.ui-footer .ui-navbar .ui-grid-b li.ui-block-c .ui-btn{margin-right:-5px}.ui-header .ui-navbar .ui-grid-c li.ui-block-d .ui-btn,.ui-footer .ui-navbar .ui-grid-c li.ui-block-d .ui-btn,.ui-header .ui-navbar .ui-grid-d li.ui-block-e .ui-btn,.ui-footer .ui-navbar .ui-grid-d li.ui-block-e .ui-btn{margin-right:-4px}.ui-header .ui-navbar .ui-grid-b li.ui-block-c .ui-btn-icon-right .ui-icon,.ui-footer .ui-navbar .ui-grid-b li.ui-block-c .ui-btn-icon-right .ui-icon,.ui-header .ui-navbar .ui-grid-c li.ui-block-d .ui-btn-icon-right .ui-icon,.ui-footer .ui-navbar .ui-grid-c li.ui-block-d .ui-btn-icon-right .ui-icon,.ui-header .ui-navbar .ui-grid-d li.ui-block-e .ui-btn-icon-right .ui-icon,.ui-footer .ui-navbar .ui-grid-d li.ui-block-e .ui-btn-icon-right .ui-icon{right:8px}.ui-navbar li .ui-btn .ui-btn-inner{padding-top:.7em;padding-bottom:.8em}.ui-navbar li .ui-btn-icon-top .ui-btn-inner{padding-top:30px}.ui-navbar li .ui-btn-icon-bottom .ui-btn-inner{padding-bottom:30px}.ui-btn{display:block;text-align:center;cursor:pointer;position:relative;margin:.5em 0;padding:0}.ui-btn.ui-mini{margin-top:.25em;margin-bottom:.25em}.ui-btn-left,.ui-btn-right,.ui-input-clear,.ui-btn-inline,.ui-grid-a .ui-btn,.ui-grid-b .ui-btn,.ui-grid-c .ui-btn,.ui-grid-d .ui-btn,.ui-grid-e .ui-btn,.ui-grid-solo .ui-btn{margin-right:5px;margin-left:5px}.ui-btn-inner{font-size:16px;padding:.6em 20px;min-width:.75em;display:block;position:relative;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;zoom:1}.ui-btn input,.ui-btn button{z-index:2}.ui-btn-left,.ui-btn-right,.ui-btn-inline{display:inline-block;vertical-align:middle}.ui-btn-block{display:block}.ui-header .ui-btn,.ui-footer .ui-btn{display:inline-block;margin:0}.ui-header .ui-btn-block,.ui-footer .ui-btn-block{display:block}.ui-header .ui-btn-inner,.ui-footer .ui-btn-inner,.ui-mini .ui-btn-inner{font-size:12.5px;padding:.55em 11px .5em}.ui-header .ui-fullsize .ui-btn-inner,.ui-footer .ui-fullsize .ui-btn-inner{font-size:16px;padding:.6em 25px}.ui-btn-icon-notext{width:24px;height:24px}.ui-btn-icon-notext .ui-btn-inner{padding:0;height:100%}.ui-btn-icon-notext .ui-btn-inner .ui-icon{margin:2px 1px 2px 3px;float:left}.ui-btn-text{position:relative;z-index:1;width:100%;-moz-user-select:none;-webkit-user-select:none;-ms-user-select:none}.ui-btn-icon-notext .ui-btn-text{position:absolute;left:-9999px}.ui-btn-icon-left .ui-btn-inner{padding-left:40px}.ui-btn-icon-right .ui-btn-inner{padding-right:40px}.ui-btn-icon-top .ui-btn-inner{padding-top:40px}.ui-btn-icon-bottom .ui-btn-inner{padding-bottom:40px}.ui-header .ui-btn-icon-left .ui-btn-inner,.ui-footer .ui-btn-icon-left .ui-btn-inner,.ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-mini .ui-btn-icon-left .ui-btn-inner{padding-left:30px}.ui-header .ui-btn-icon-right .ui-btn-inner,.ui-footer .ui-btn-icon-right .ui-btn-inner,.ui-mini.ui-btn-icon-right .ui-btn-inner,.ui-mini .ui-btn-icon-right .ui-btn-inner{padding-right:30px}.ui-header .ui-btn-icon-top .ui-btn-inner,.ui-footer .ui-btn-icon-top .ui-btn-inner{padding:30px 3px .5em 3px}.ui-mini.ui-btn-icon-top .ui-btn-inner,.ui-mini .ui-btn-icon-top .ui-btn-inner{padding-top:30px}.ui-header .ui-btn-icon-bottom .ui-btn-inner,.ui-footer .ui-btn-icon-bottom .ui-btn-inner{padding:.55em 3px 30px 3px}.ui-mini.ui-btn-icon-bottom .ui-btn-inner,.ui-mini .ui-btn-icon-bottom .ui-btn-inner{padding-bottom:30px}.ui-btn-icon-notext .ui-icon{display:block;z-index:0}.ui-btn-icon-left>.ui-btn-inner>.ui-icon,.ui-btn-icon-right>.ui-btn-inner>.ui-icon{position:absolute;top:50%;margin-top:-9px}.ui-btn-icon-top .ui-btn-inner .ui-icon,.ui-btn-icon-bottom .ui-btn-inner .ui-icon{position:absolute;left:50%;margin-left:-9px}.ui-btn-icon-left .ui-icon{left:10px}.ui-btn-icon-right .ui-icon{right:10px}.ui-btn-icon-top .ui-icon{top:10px}.ui-btn-icon-bottom .ui-icon{top:auto;bottom:10px}.ui-header .ui-btn-icon-left .ui-icon,.ui-footer .ui-btn-icon-left .ui-icon,.ui-mini.ui-btn-icon-left .ui-icon,.ui-mini .ui-btn-icon-left .ui-icon{left:5px}.ui-header .ui-btn-icon-right .ui-icon,.ui-footer .ui-btn-icon-right .ui-icon,.ui-mini.ui-btn-icon-right .ui-icon,.ui-mini .ui-btn-icon-right .ui-icon{right:5px}.ui-header .ui-btn-icon-top .ui-icon,.ui-footer .ui-btn-icon-top .ui-icon,.ui-mini.ui-btn-icon-top .ui-icon,.ui-mini .ui-btn-icon-top .ui-icon{top:5px}.ui-header .ui-btn-icon-bottom .ui-icon,.ui-footer .ui-btn-icon-bottom .ui-icon,.ui-mini.ui-btn-icon-bottom .ui-icon,.ui-mini .ui-btn-icon-bottom .ui-icon{bottom:5px}.ui-btn-hidden{position:absolute;top:0;left:0;width:100%;height:100%;-webkit-appearance:none;opacity:.1;cursor:pointer;background:#fff;background:rgba(255,255,255,0);filter:Alpha(Opacity=0);font-size:1px;border:0;text-indent:-9999px}.ui-field-contain .ui-btn.ui-submit{margin:0}label.ui-submit{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}@media all and (min-width:450px){.ui-field-contain label.ui-submit{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain .ui-btn.ui-submit{width:60%;display:inline-block;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.ui-hide-label .ui-btn.ui-submit{width:auto}}.ui-collapsible{margin:.5em 0}.ui-collapsible-heading{font-size:16px;display:block;margin:0 -8px;padding:0;border-width:0 0 1px 0;position:relative}.ui-collapsible-heading .ui-btn{text-align:left;margin:0}.ui-collapsible-heading .ui-btn-inner,.ui-collapsible-heading .ui-btn-icon-left .ui-btn-inner{padding-left:40px}.ui-collapsible-heading .ui-btn-icon-right .ui-btn-inner{padding-left:12px;padding-right:40px}.ui-collapsible-heading .ui-btn-icon-top .ui-btn-inner,.ui-collapsible-heading .ui-btn-icon-bottom .ui-btn-inner{padding-right:40px;text-align:center}.ui-collapsible-heading .ui-btn span.ui-btn{position:absolute;left:6px;top:50%;margin:-12px 0 0 0;width:20px;height:20px;padding:1px 0 1px 2px;text-indent:-9999px}.ui-collapsible-heading .ui-btn span.ui-btn .ui-btn-inner{padding:10px 0}.ui-collapsible-heading .ui-btn span.ui-btn .ui-icon{left:0;margin-top:-10px}.ui-collapsible-heading-status{position:absolute;top:-9999px;left:0}.ui-collapsible-content{display:block;margin:0 -8px;padding:10px 16px;border-top:0;background-image:none;font-weight:normal}.ui-collapsible-content-collapsed{display:none}.ui-collapsible-set{margin:.5em 0}.ui-collapsible-set .ui-collapsible{margin:-1px 0 0}.ui-controlgroup,fieldset.ui-controlgroup{padding:0;margin:.5em 0;zoom:1}.ui-controlgroup.ui-mini,fieldset.ui-controlgroup.ui-mini{margin:.25em 0}.ui-field-contain .ui-controlgroup,.ui-field-contain fieldset.ui-controlgroup{margin:0}.ui-bar .ui-controlgroup{margin:0 5px}.ui-controlgroup-label{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .4em}.ui-controlgroup-controls{display:block;width:100%}.ui-controlgroup li{list-style:none}.ui-controlgroup-vertical .ui-btn,.ui-controlgroup-vertical .ui-checkbox,.ui-controlgroup-vertical .ui-radio{margin:0;border-bottom-width:0}.ui-controlgroup-vertical .ui-controlgroup-last{border-bottom-width:1px}.ui-controlgroup-controls label.ui-select{position:absolute;left:-9999px}.ui-controlgroup .ui-btn-icon-notext{width:24px;height:24px}.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner .ui-icon{position:absolute;top:50%;right:50%;margin:-9px -9px 0 0}.ui-controlgroup-horizontal .ui-controlgroup-controls:before,.ui-controlgroup-horizontal .ui-controlgroup-controls:after{content:"";display:table}.ui-controlgroup-horizontal .ui-controlgroup-controls:after{clear:both}.ui-controlgroup-horizontal .ui-controlgroup-controls{zoom:1}.ui-controlgroup-horizontal .ui-btn-inner{text-align:center}.ui-controlgroup-horizontal .ui-btn,.ui-controlgroup-horizontal .ui-select,.ui-controlgroup-horizontal .ui-checkbox,.ui-controlgroup-horizontal .ui-radio{float:left;clear:none;margin:0 -1px 0 0}.ui-controlgroup-horizontal .ui-select .ui-btn,.ui-controlgroup-horizontal .ui-checkbox .ui-btn,.ui-controlgroup-horizontal .ui-radio .ui-btn,.ui-controlgroup-horizontal .ui-checkbox:last-child,.ui-controlgroup-horizontal .ui-radio:last-child{margin-right:0}.ui-controlgroup-horizontal .ui-controlgroup-last{margin-right:0}.ui-controlgroup .ui-checkbox label,.ui-controlgroup .ui-radio label{font-size:16px}@media all and (min-width:450px){.ui-field-contain .ui-controlgroup-label{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain .ui-controlgroup-controls{width:60%;display:inline-block}.ui-field-contain .ui-controlgroup .ui-select{width:100%;display:block}.ui-field-contain .ui-controlgroup-horizontal .ui-select{width:auto}.ui-hide-label .ui-controlgroup-controls{width:100%}}.ui-dialog{background:none!important}.ui-dialog-contain{width:92.5%;max-width:500px;margin:10% auto 15px auto;padding:0}.ui-dialog .ui-header{margin-top:15%;border:0;overflow:hidden}.ui-dialog .ui-header,.ui-dialog .ui-content,.ui-dialog .ui-footer{display:block;position:relative;width:auto}.ui-dialog .ui-header,.ui-dialog .ui-footer{z-index:10;padding:0}.ui-dialog .ui-footer{padding:0 15px}.ui-dialog .ui-content{padding:15px}.ui-dialog{margin-top:-15px}.ui-checkbox,.ui-radio{position:relative;clear:both;margin:0;z-index:1}.ui-checkbox .ui-btn,.ui-radio .ui-btn{margin:.5em 0;text-align:left;z-index:2}.ui-checkbox .ui-btn.ui-mini,.ui-radio .ui-btn.ui-mini{margin:.25em 0}.ui-controlgroup .ui-checkbox .ui-btn,.ui-controlgroup .ui-radio .ui-btn{margin:0}.ui-checkbox .ui-btn-inner,.ui-radio .ui-btn-inner{white-space:normal}.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner{padding-left:45px}.ui-checkbox .ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-left .ui-btn-inner{padding-left:36px}.ui-checkbox .ui-btn-icon-right .ui-btn-inner,.ui-radio .ui-btn-icon-right .ui-btn-inner{padding-right:45px}.ui-checkbox .ui-mini.ui-btn-icon-right .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-right .ui-btn-inner{padding-right:36px}.ui-checkbox .ui-btn-icon-top .ui-btn-inner,.ui-radio .ui-btn-icon-top .ui-btn-inner{padding-right:0;padding-left:0;text-align:center}.ui-checkbox .ui-btn-icon-bottom .ui-btn-inner,.ui-radio .ui-btn-icon-bottom .ui-btn-inner{padding-right:0;padding-left:0;text-align:center}.ui-checkbox .ui-icon,.ui-radio .ui-icon{top:1.1em}.ui-checkbox .ui-btn-icon-left .ui-icon,.ui-radio .ui-btn-icon-left .ui-icon{left:15px}.ui-checkbox .ui-mini.ui-btn-icon-left .ui-icon,.ui-radio .ui-mini.ui-btn-icon-left .ui-icon{left:9px}.ui-checkbox .ui-btn-icon-right .ui-icon,.ui-radio .ui-btn-icon-right .ui-icon{right:15px}.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon,.ui-radio .ui-mini.ui-btn-icon-right .ui-icon{right:9px}.ui-checkbox .ui-btn-icon-top .ui-icon,.ui-radio .ui-btn-icon-top .ui-icon{top:10px}.ui-checkbox .ui-btn-icon-bottom .ui-icon,.ui-radio .ui-btn-icon-bottom .ui-icon{top:auto;bottom:10px}.ui-checkbox .ui-btn-icon-right .ui-icon,.ui-radio .ui-btn-icon-right .ui-icon{right:15px}.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon,.ui-radio .ui-mini.ui-btn-icon-right .ui-icon{right:9px}.ui-checkbox input,.ui-radio input{position:absolute;left:20px;top:50%;width:10px;height:10px;margin:-5px 0 0 0;outline:0!important;z-index:1}.ui-field-contain,fieldset.ui-field-contain{padding:.8em 0;margin:0;border-width:0 0 1px 0;overflow:visible}.ui-field-contain:last-child{border-bottom-width:0}.ui-field-contain{max-width:100%}@media all and (min-width:450px){.ui-field-contain,.ui-mobile fieldset.ui-field-contain{border-width:0;padding:0;margin:1em 0}}.ui-select{display:block;position:relative}.ui-select select{position:absolute;left:-9999px;top:-9999px}.ui-select .ui-btn{overflow:hidden;opacity:1}.ui-field-contain .ui-select .ui-btn{margin:0}.ui-select .ui-btn select{cursor:pointer;-webkit-appearance:none;left:0;top:0;width:100%;min-height:1.5em;min-height:100%;height:3em;max-height:100%;opacity:0;-ms-filter:"alpha(opacity=0)";filter:alpha(opacity=0);z-index:2}.ui-select .ui-disabled{opacity:.3}@-moz-document url-prefix(){.ui-select .ui-btn select{opacity:.0001}}.ui-select .ui-btn.ui-select-nativeonly{border-radius:0}.ui-select .ui-btn.ui-select-nativeonly select{opacity:1;text-indent:0}.ui-select .ui-btn-icon-right .ui-btn-inner,.ui-select .ui-li-has-count .ui-btn-inner{padding-right:45px}.ui-select .ui-mini.ui-btn-icon-right .ui-btn-inner{padding-right:32px}.ui-select .ui-btn-icon-right.ui-li-has-count .ui-btn-inner{padding-right:80px}.ui-select .ui-mini.ui-btn-icon-right.ui-li-has-count .ui-btn-inner{padding-right:67px}.ui-select .ui-btn-icon-right .ui-icon{right:15px}.ui-select .ui-mini.ui-btn-icon-right .ui-icon{right:7px}.ui-select .ui-btn-icon-right.ui-li-has-count .ui-li-count{right:45px}.ui-select .ui-mini.ui-btn-icon-right.ui-li-has-count .ui-li-count{right:32px}label.ui-select{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}.ui-select .ui-btn-text,.ui-selectmenu .ui-btn-text{display:block;min-height:1em;overflow:hidden!important}.ui-select .ui-btn-text{text-overflow:ellipsis}.ui-selectmenu{position:absolute;padding:0;z-index:1100!important;width:80%;max-width:350px;padding:6px}.ui-selectmenu .ui-listview{margin:0}.ui-selectmenu .ui-btn.ui-li-divider{cursor:default}.ui-selectmenu-hidden{top:-99999px;left:-9999px}.ui-selectmenu-screen{position:absolute;top:0;left:0;width:100%;height:100%;z-index:99}.ui-screen-hidden,.ui-selectmenu-list .ui-li .ui-icon{display:none}.ui-selectmenu-list .ui-li .ui-icon{display:block}.ui-li.ui-selectmenu-placeholder{display:none}.ui-selectmenu .ui-header .ui-title{margin:.6em 46px .8em}@media all and (min-width:450px){.ui-field-contain label.ui-select{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain .ui-select{width:60%;display:inline-block}.ui-hide-label .ui-select{width:100%}}.ui-selectmenu .ui-header h1:after{content:'.';visibility:hidden}label.ui-input-text{font-size:16px;line-height:1.4;display:block;font-weight:normal;margin:0 0 .3em}input.ui-input-text,textarea.ui-input-text{background-image:none;padding:.4em;margin:.5em 0;line-height:1.4;font-size:16px;display:block;width:100%;outline:0}input.ui-input-text.ui-mini,textarea.ui-input-text.ui-mini{margin:.25em 0}.ui-field-contain input.ui-input-text,.ui-field-contain textarea.ui-input-text{margin:0}input.ui-input-text,textarea.ui-input-text,.ui-input-search{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}input.ui-input-text{-webkit-appearance:none}textarea.ui-input-text{height:50px;-webkit-transition:height 200ms linear;-moz-transition:height 200ms linear;-o-transition:height 200ms linear;transition:height 200ms linear}.ui-input-search{padding:0 30px;margin:.5em 0;background-image:none;position:relative}.ui-input-search.ui-mini{margin:.25em 0}.ui-field-contain .ui-input-search{margin:0}.ui-icon-searchfield:after{position:absolute;left:7px;top:50%;margin-top:-9px;content:"";width:18px;height:18px;opacity:.5}.ui-input-search input.ui-input-text{border:0;width:98%;padding:.4em 0;margin:0;display:block;background:transparent none;outline:0!important}.ui-input-search .ui-input-clear{position:absolute;right:0;top:50%;margin-top:-13px}.ui-mini .ui-input-clear{right:-3px}.ui-input-search .ui-input-clear-hidden{display:none}input.ui-mini,.ui-mini input,textarea.ui-mini{font-size:14px}textarea.ui-mini{height:45px}@media all and (min-width:450px){.ui-field-contain label.ui-input-text{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain input.ui-input-text,.ui-field-contain textarea.ui-input-text,.ui-field-contain .ui-input-search{width:60%;display:inline-block}.ui-hide-label input.ui-input-text,.ui-hide-label textarea.ui-input-text,.ui-hide-label .ui-input-search{width:100%}.ui-input-search input.ui-input-text{width:98%}}.ui-listview{margin:0;counter-reset:listnumbering}.ui-content .ui-listview{margin:-15px}.ui-content .ui-listview-inset{margin:1em 0}.ui-listview,.ui-li{list-style:none;padding:0}.ui-li,.ui-li.ui-field-contain{display:block;margin:0;position:relative;overflow:visible;text-align:left;border-width:0;border-top-width:1px}.ui-li .ui-btn-text a.ui-link-inherit{text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-divider,.ui-li-static{padding:.5em 15px;font-size:14px;font-weight:bold}.ui-li-divider .ui-btn-text,.ui-li-static .ui-btn-text{font-size:16px}.ui-li-divider .ui-mini .ui-btn-text,.ui-li-static .ui-mini .ui-btn-text{font-size:inherit}.ui-li-divider{counter-reset:listnumbering}ol.ui-listview .ui-link-inherit:before,ol.ui-listview .ui-li-static:before,.ui-li-dec{font-size:.8em;display:inline-block;padding-right:.3em;font-weight:normal;counter-increment:listnumbering;content:counter(listnumbering) ". "}ol.ui-listview .ui-li-jsnumbering:before{content:""!important}.ui-listview-inset .ui-li{border-right-width:1px;border-left-width:1px}.ui-li:last-child,.ui-li.ui-field-contain:last-child{border-bottom-width:1px}.ui-li>.ui-btn-inner{display:block;position:relative;padding:0}.ui-li .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li{padding:.7em 15px;display:block}.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-thumb{min-height:60px;padding-left:100px}.ui-li-has-icon .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-icon{min-height:20px;padding-left:40px}.ui-li-has-count .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-count,.ui-li-divider.ui-li-has-count{padding-right:45px}.ui-li-has-arrow .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-arrow{padding-right:40px}.ui-li-has-arrow.ui-li-has-count .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-arrow.ui-li-has-count{padding-right:75px}.ui-li-heading{font-size:16px;font-weight:bold;display:block;margin:.6em 0;text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-desc{font-size:12px;font-weight:normal;display:block;margin:-.5em 0 .6em;text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-thumb,.ui-listview .ui-li-icon{position:absolute;left:1px;top:0;max-height:80px;max-width:80px}.ui-listview .ui-li-icon{max-height:16px;max-width:16px;left:10px;top:.9em}.ui-li-thumb,.ui-listview .ui-li-icon,.ui-li-content{float:left;margin-right:10px}.ui-li-aside{float:right;width:50%;text-align:right;margin:.3em 0}@media all and (min-width:480px){.ui-li-aside{width:45%}}.ui-li-divider{cursor:default}.ui-li-has-alt .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-alt{padding-right:53px}.ui-li-has-alt.ui-li-has-count .ui-btn-inner a.ui-link-inherit,.ui-li-static.ui-li-has-alt.ui-li-has-count{padding-right:88px}.ui-li-has-count .ui-li-count{position:absolute;font-size:11px;font-weight:bold;padding:.2em .5em;top:50%;margin-top:-.9em;right:10px}.ui-li-has-count.ui-li-divider .ui-li-count,.ui-li-has-count .ui-link-inherit .ui-li-count{margin-top:-.95em}.ui-li-has-arrow.ui-li-has-count .ui-li-count{right:40px}.ui-li-has-alt.ui-li-has-count .ui-li-count{right:53px}.ui-li-link-alt{position:absolute;width:40px;height:100%;border-width:0;border-left-width:1px;top:0;right:0;margin:0;padding:0;z-index:2}.ui-li-link-alt .ui-btn{overflow:hidden;position:absolute;right:8px;top:50%;margin:-13px 0 0 0;border-bottom-width:1px;z-index:-1}.ui-li-link-alt .ui-btn-inner{padding:0;height:100%;position:absolute;width:100%;top:0;left:0}.ui-li-link-alt .ui-btn .ui-icon{right:50%;margin-right:-9px}.ui-li-link-alt .ui-btn-icon-notext .ui-btn-inner .ui-icon{position:absolute;top:50%;margin-top:-9px}.ui-listview * .ui-btn-inner>.ui-btn>.ui-btn-inner{border-top:0}.ui-listview-filter{border-width:0;overflow:hidden;margin:-15px -15px 15px -15px}.ui-listview-filter .ui-input-search{margin:5px;width:auto;display:block}.ui-listview-filter-inset{margin:-15px -5px -15px -5px;background:transparent}.ui-li.ui-screen-hidden{display:none}@media only screen and (min-device-width:768px) and (max-device-width:1024px){.ui-li .ui-btn-text{overflow:visible}}label.ui-slider{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}input.ui-slider-input,.ui-field-contain input.ui-slider-input{display:inline-block;width:50px;background-image:none;padding:.4em;margin:.5em 0;line-height:1.4;font-size:16px;outline:0}input.ui-slider-input.ui-mini,.ui-field-contain input.ui-slider-input.ui-mini{width:45px;margin:.25em 0;font-size:14px}.ui-field-contain input.ui-slider-input{margin:0}input.ui-slider-input,.ui-field-contain input.ui-slider-input{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;-ms-box-sizing:content-box;box-sizing:content-box}select.ui-slider-switch{display:none}div.ui-slider{position:relative;display:inline-block;overflow:visible;height:15px;padding:0;margin:0 2% 0 20px;top:4px;width:65%}div.ui-slider-mini{height:12px;margin-left:10px;top:2px}div.ui-slider-bg{border:0;height:100%;padding-right:8px}.ui-controlgroup a.ui-slider-handle,a.ui-slider-handle{position:absolute;z-index:1;top:50%;width:28px;height:28px;margin-top:-15px;margin-left:-15px;outline:0}a.ui-slider-handle .ui-btn-inner{padding:0;height:100%}div.ui-slider-mini a.ui-slider-handle{height:14px;width:14px;margin:-8px 0 0 -7px}div.ui-slider-mini a.ui-slider-handle .ui-btn-inner{height:30px;width:30px;padding:0;margin:-9px 0 0 -9px;border-top:0}@media all and (min-width:450px){.ui-field-contain label.ui-slider{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.ui-field-contain div.ui-slider{width:43%}.ui-field-contain div.ui-slider-switch{width:5.5em}}div.ui-slider-switch{height:32px;margin-left:0;width:5.8em}a.ui-slider-handle-snapping{-webkit-transition:left 70ms linear;-moz-transition:left 70ms linear}div.ui-slider-switch .ui-slider-handle{margin-top:1px}.ui-slider-inneroffset{margin:0 16px;position:relative;z-index:1}div.ui-slider-switch.ui-slider-mini{width:5em;height:29px}div.ui-slider-switch.ui-slider-mini .ui-slider-inneroffset{margin:0 15px 0 14px}div.ui-slider-switch.ui-slider-mini .ui-slider-handle{width:25px;height:25px;margin:1px 0 0 -13px}div.ui-slider-switch.ui-slider-mini a.ui-slider-handle .ui-btn-inner{height:30px;width:30px;padding:0;margin:0}span.ui-slider-label{position:absolute;text-align:center;width:100%;overflow:hidden;font-size:16px;top:0;line-height:2;min-height:100%;border-width:0;white-space:nowrap}.ui-slider-mini span.ui-slider-label{font-size:14px}span.ui-slider-label-a{z-index:1;left:0;text-indent:-1.5em}span.ui-slider-label-b{z-index:0;right:0;text-indent:1.5em}.ui-slider-inline{width:120px;display:inline-block} \ No newline at end of file diff --git a/module/web/static/img/default/icon_blank_file_black.png b/module/web/static/img/default/icon_blank_file_black.png new file mode 100644 index 000000000..d054a2af7 Binary files /dev/null and b/module/web/static/img/default/icon_blank_file_black.png differ diff --git a/module/web/static/js/libs/jquery.mobile-1.1.1.min.js b/module/web/static/js/libs/jquery.mobile-1.1.1.min.js new file mode 100644 index 000000000..70f71928f --- /dev/null +++ b/module/web/static/js/libs/jquery.mobile-1.1.1.min.js @@ -0,0 +1,181 @@ +/*! jQuery Mobile v1.1.1 1981b3f5ec22675ae47df8f0bdf9622e7780e90e jquerymobile.com | jquery.org/license */ +(function(l,t,k){typeof define==="function"&&define.amd?define(["jquery"],function(E){k(E,l,t);return E.mobile}):k(l.jQuery,l,t)})(this,document,function(l,t,k,E){(function(a,c,b,d){function e(a){for(;a&&typeof a.originalEvent!=="undefined";)a=a.originalEvent;return a}function g(b){for(var e={},g,d;b;){g=a.data(b,s);for(d in g)if(g[d])e[d]=e.hasVirtualBinding=true;b=b.parentNode}return e}function f(){y&&(clearTimeout(y),y=0);y=setTimeout(function(){G=y=0;A.length=0;F=false;H=true},a.vmouse.resetTimerDuration)} +function j(b,g,c){var f,h;if(!(h=c&&c[b])){if(c=!c)a:{for(c=g.target;c;){if((h=a.data(c,s))&&(!b||h[b]))break a;c=c.parentNode}c=null}h=c}if(h){f=g;var c=f.type,j,F;f=a.Event(f);f.type=b;h=f.originalEvent;j=a.event.props;c.search(/^(mouse|click)/)>-1&&(j=w);if(h)for(F=j.length;F;)b=j[--F],f[b]=h[b];if(c.search(/mouse(down|up)|click/)>-1&&!f.which)f.which=1;if(c.search(/^touch/)!==-1&&(b=e(h),c=b.touches,b=b.changedTouches,c=c&&c.length?c[0]:b&&b.length?b[0]:d))for(h=0,len=x.length;hh||Math.abs(c.pageY-C)>h;flags=g(b.target);z&&!d&&j("vmousecancel",b,flags);j("vmousemove",b,flags);f()}}function v(a){if(!H){H=true;var b=g(a.target),c;j("vmouseup",a,b);if(!z&&(c=j("vclick",a,b))&&c.isDefaultPrevented())c=e(a).changedTouches[0],A.push({touchID:G,x:c.clientX,y:c.clientY}),F=true;j("vmouseout",a,b);z=false;f()}}function n(b){var b= +a.data(b,s),e;if(b)for(e in b)if(b[e])return true;return false}function k(){}function p(b){var e=b.substr(1);return{setup:function(){n(this)||a.data(this,s,{});a.data(this,s)[b]=true;l[b]=(l[b]||0)+1;l[b]===1&&J.bind(e,h);a(this).bind(e,k);if(M)l.touchstart=(l.touchstart||0)+1,l.touchstart===1&&J.bind("touchstart",q).bind("touchend",v).bind("touchmove",m).bind("scroll",o)},teardown:function(){--l[b];l[b]||J.unbind(e,h);M&&(--l.touchstart,l.touchstart||J.unbind("touchstart",q).unbind("touchmove",m).unbind("touchend", +v).unbind("scroll",o));var g=a(this),c=a.data(this,s);c&&(c[b]=false);g.unbind(e,k);n(this)||g.removeData(s)}}}var s="virtualMouseBindings",u="virtualTouchID",c="vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "),x="clientX clientY pageX pageY screenX screenY".split(" "),w=a.event.props.concat(a.event.mouseHooks?a.event.mouseHooks.props:[]),l={},y=0,t=0,C=0,z=false,A=[],F=false,H=false,M="addEventListener"in b,J=a(b),N=1,G=0;a.vmouse={moveDistanceThreshold:10,clickDistanceThreshold:10, +resetTimerDuration:1500};for(var K=0;K7);a.fn[e]=function(a){return a?this.bind(e,a):this.trigger(e)};a.fn[e].delay=50;j[e]=a.extend(j[e],{setup:function(){if(q)return false;a(f.start)},teardown:function(){if(q)return false;a(f.stop)}});f=function(){function f(){var b=d(),g=s(n);if(b!==n)p(n=b,g),a(c).trigger(e);else if(g!==n)location.href=location.href.replace(/#.*/,"")+g;j=setTimeout(f,a.fn[e].delay)}var h={},j,n=d(),k=function(a){return a},p= +k,s=k;h.start=function(){j||f()};h.stop=function(){j&&clearTimeout(j);j=b};a.browser.msie&&!q&&function(){var b,c;h.start=function(){if(!b)c=(c=a.fn[e].src)&&c+d(),b=a('':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
    ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
    ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.22",window["DP_jQuery_"+dpuuid]=$})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.progressbar.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
    ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.core.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=(a.curCSS||a.css)(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.22",save:function(a,b){for(var c=0;c").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;try{e.id}catch(f){e=document.body}return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.fade.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.fold.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.highlight.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.pulsate.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);; \ No newline at end of file diff --git a/module/web/static/js/libs/jquery-ui-1.8.22.min.js b/module/web/static/js/libs/jquery-ui-1.8.22.min.js new file mode 100644 index 000000000..e36a7f0f6 --- /dev/null +++ b/module/web/static/js/libs/jquery-ui-1.8.22.min.js @@ -0,0 +1,125 @@ +/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.22",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a("").outerWidth(1).jquery||a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(b){return function(c){return!!a.data(c,b)}}):function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.curCSS||(a.curCSS=a.css),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.position.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?a.isFunction(b)?this.each(function(c){a(this).offset(b.call(this,c,a(this).offset()))}):this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.draggable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return this.options.iframeFix===!0&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.lefth[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.toph[3]?j-this.offset.click.toph[2]?k-this.offset.click.left=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f=k&&g<=l||h>=k&&h<=l||gl)&&(e>=i&&e<=j||f>=i&&f<=j||ej);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),ea.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.22"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.selectable.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("
    ")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.righth||i.bottome&&i.rightf&&i.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+jf&&b+ka[this.floating?"width":"height"]?l:f0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.containers[d].floating?this.items[i].item.offset().left:this.items[i].item.offset().top;Math.abs(j-h)0?"down":"up")}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.leftthis.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.topthis.containment[3]?h-this.offset.click.topthis.containment[2]?i-this.offset.click.left=0;f--)a.ui.contains(this.containers[f].element[0],this.currentItem[0])&&!c&&(d.push(function(a){return function(b){a._trigger("receive",b,this._uiHash(this))}}.call(this,this.containers[f])),d.push(function(a){return function(b){a._trigger("update",b,this._uiHash(this))}}.call(this,this.containers[f])))}for(var f=this.containers.length-1;f>=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.22",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.autocomplete.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("
      ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length").data("item.autocomplete",c).append(a("      ").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})})(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend(""),d.secondary&&b.append(""),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.dialog.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},f=a.attrFn||{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0,click:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("
      ")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("
      ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("
      ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=a("
      ").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(g);a.each(d,function(a,b){if(a==="click")return;a in f?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.22",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;ic&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
      ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
    • #{label}
      • "},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.22"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.22"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('
      ')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$(''+c+""),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('').addClass(this._triggerClass).html(g==""?f:$("").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;db&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$(''),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a)),this._attachHandlers(a);var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+(c?0:$(document).scrollLeft()),i=document.documentElement.clientHeight+(c?0:$(document).scrollTop());return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+112?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_attachHandlers:function(a){var b=this._get(a,"stepMonths"),c="#"+a.id;a.dpDiv.find("[data-handler]").map(function(){var a={prev:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,-b,"M")},next:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,+b,"M")},hide:function(){window["DP_jQuery_"+dpuuid].datepicker._hideDatepicker()},today:function(){window["DP_jQuery_"+dpuuid].datepicker._gotoToday(c)},selectDay:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectDay(c,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"M"),!1},selectYear:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"Y"),!1}};$(this).bind(this.getAttribute("data-event"),a[this.getAttribute("data-handler")])})},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&pp)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?''+q+"":e?"":''+q+"",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?''+s+"":e?"":''+s+"",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'",x=d?'
      '+(c?w:"")+(this._isInRange(a,v)?'":"")+(c?"":w)+"
      ":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='
      '+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'
      '+"";var R=z?'":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="=5?' class="ui-datepicker-week-end"':"")+">"+''+C[T]+""}Q+=R+"";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z";var _=z?'":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Ym;_+='",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+""}n++,n>11&&(n=0,o++),Q+="
      '+this._get(a,"weekHeader")+"
      '+this._get(a,"calculateWeek")(Y)+""+(bb&&!G?" ":bc?''+Y.getDate()+"":''+Y.getDate()+"")+"
      "+(j?""+(g[0]>0&&N==g[1]-1?'
      ':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
      ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
      ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.22",window["DP_jQuery_"+dpuuid]=$})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.progressbar.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
      ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.core.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=(a.curCSS||a.css)(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.22",save:function(a,b){for(var c=0;c").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;try{e.id}catch(f){e=document.body}return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fade.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.fold.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.highlight.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 +* https://github.com/jquery/jquery-ui +* Includes: jquery.effects.pulsate.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ +(function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);; \ No newline at end of file diff --git a/module/web/static/js/libs/lodash-0.4.2.js b/module/web/static/js/libs/lodash-0.4.2.js new file mode 100644 index 000000000..67806db05 --- /dev/null +++ b/module/web/static/js/libs/lodash-0.4.2.js @@ -0,0 +1,3803 @@ +/*! + * Lo-Dash v0.4.2 + * Copyright 2012 John-David Dalton + * Based on Underscore.js 1.3.3, copyright 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. + * + * Available under MIT license + */ +;(function(window, undefined) { + 'use strict'; + + /** + * Used to cache the last `_.templateSettings.evaluate` delimiter to avoid + * unnecessarily assigning `reEvaluateDelimiter` a new generated regexp. + * Assigned in `_.template`. + */ + var lastEvaluateDelimiter; + + /** + * Used to cache the last template `options.variable` to avoid unnecessarily + * assigning `reDoubleVariable` a new generated regexp. Assigned in `_.template`. + */ + var lastVariable; + + /** + * Used to match potentially incorrect data object references, like `obj.obj`, + * in compiled templates. Assigned in `_.template`. + */ + var reDoubleVariable; + + /** + * Used to match "evaluate" delimiters, including internal delimiters, + * in template text. Assigned in `_.template`. + */ + var reEvaluateDelimiter; + + /** Detect free variable `exports` */ + var freeExports = typeof exports == 'object' && exports && + (typeof global == 'object' && global && global == global.global && (window = global), exports); + + /** Native prototype shortcuts */ + var ArrayProto = Array.prototype, + ObjectProto = Object.prototype; + + /** Used to generate unique IDs */ + var idCounter = 0; + + /** Used to restore the original `_` reference in `noConflict` */ + var oldDash = window._; + + /** Used to detect delimiter values that should be processed by `tokenizeEvaluate` */ + var reComplexDelimiter = /[-+=!~*%&^<>|{(\/]|\[\D|\b(?:delete|in|instanceof|new|typeof|void)\b/; + + /** Used to match empty string literals in compiled template source */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to insert the data object variable into compiled template source */ + var reInsertVariable = /(?:__e|__t = )\(\s*(?![\d\s"']|this\.)/g; + + /** Used to detect if a method is native */ + var reNative = RegExp('^' + + (ObjectProto.valueOf + '') + .replace(/[.*+?^=!:${}()|[\]\/\\]/g, '\\$&') + .replace(/valueOf|for [^\]]+/g, '.+?') + '$' + ); + + /** Used to match tokens in template text */ + var reToken = /__token__(\d+)/g; + + /** Used to match unescaped characters in strings for inclusion in HTML */ + var reUnescapedHtml = /[&<"']/g; + + /** Used to match unescaped characters in compiled string literals */ + var reUnescapedString = /['\n\r\t\u2028\u2029\\]/g; + + /** Used to fix the JScript [[DontEnum]] bug */ + var shadowed = [ + 'constructor', 'hasOwnProperty', 'isPrototypeOf', 'propertyIsEnumerable', + 'toLocaleString', 'toString', 'valueOf' + ]; + + /** Used to make template sourceURLs easier to identify */ + var templateCounter = 0; + + /** Used to replace template delimiters */ + var token = '__token__'; + + /** Used to store tokenized template text snippets */ + var tokenized = []; + + /** Native method shortcuts */ + var concat = ArrayProto.concat, + hasOwnProperty = ObjectProto.hasOwnProperty, + push = ArrayProto.push, + propertyIsEnumerable = ObjectProto.propertyIsEnumerable, + slice = ArrayProto.slice, + toString = ObjectProto.toString; + + /* Native method shortcuts for methods with the same name as other `lodash` methods */ + var nativeBind = reNative.test(nativeBind = slice.bind) && nativeBind, + nativeIsArray = reNative.test(nativeIsArray = Array.isArray) && nativeIsArray, + nativeIsFinite = window.isFinite, + nativeKeys = reNative.test(nativeKeys = Object.keys) && nativeKeys; + + /** `Object#toString` result shortcuts */ + var arrayClass = '[object Array]', + boolClass = '[object Boolean]', + dateClass = '[object Date]', + funcClass = '[object Function]', + numberClass = '[object Number]', + regexpClass = '[object RegExp]', + stringClass = '[object String]'; + + /** Timer shortcuts */ + var clearTimeout = window.clearTimeout, + setTimeout = window.setTimeout; + + /** + * Detect the JScript [[DontEnum]] bug: + * In IE < 9 an objects own properties, shadowing non-enumerable ones, are + * made non-enumerable as well. + */ + var hasDontEnumBug = !propertyIsEnumerable.call({ 'valueOf': 0 }, 'valueOf'); + + /** Detect if `Array#slice` cannot be used to convert strings to arrays (Opera < 10.52) */ + var noArraySliceOnStrings = slice.call('x')[0] != 'x'; + + /** + * Detect lack of support for accessing string characters by index: + * IE < 8 can't access characters by index and IE 8 can only access + * characters by index on string literals. + */ + var noCharByIndex = ('x'[0] + Object('x')[0]) != 'xx'; + + /* Detect if `Function#bind` exists and is inferred to be fast (all but V8) */ + var isBindFast = nativeBind && /\n|Opera/.test(nativeBind + toString.call(window.opera)); + + /* Detect if `Object.keys` exists and is inferred to be fast (V8, Opera, IE) */ + var isKeysFast = nativeKeys && /^.+$|true/.test(nativeKeys + !!window.attachEvent); + + /** Detect if sourceURL syntax is usable without erroring */ + try { + // Adobe's and Narwhal's JS engines will error + var useSourceURL = (Function('//@')(), true); + } catch(e){ } + + /** + * Used to escape characters for inclusion in HTML. + * The `>` and `/` characters don't require escaping in HTML and have no + * special meaning unless they're part of a tag or an unquoted attribute value + * http://mathiasbynens.be/notes/ambiguous-ampersands (semi-related fun fact) + */ + var htmlEscapes = { + '&': '&', + '<': '<', + '"': '"', + "'": ''' + }; + + /** Used to determine if values are of the language type Object */ + var objectTypes = { + 'boolean': false, + 'function': true, + 'object': true, + 'number': false, + 'string': false, + 'undefined': false + }; + + /** Used to escape characters for inclusion in compiled string literals */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\t': 't', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; + + /*--------------------------------------------------------------------------*/ + + /** + * The `lodash` function. + * + * @name _ + * @constructor + * @param {Mixed} value The value to wrap in a `LoDash` instance. + * @returns {Object} Returns a `LoDash` instance. + */ + function lodash(value) { + // allow invoking `lodash` without the `new` operator + return new LoDash(value); + } + + /** + * Creates a `LoDash` instance that wraps a value to allow chaining. + * + * @private + * @constructor + * @param {Mixed} value The value to wrap. + */ + function LoDash(value) { + // exit early if already wrapped + if (value && value._wrapped) { + return value; + } + this._wrapped = value; + } + + /** + * By default, Lo-Dash uses embedded Ruby (ERB) style template delimiters, + * change the following template settings to use alternative delimiters. + * + * @static + * @memberOf _ + * @type Object + */ + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @static + * @memberOf _.templateSettings + * @type RegExp + */ + 'escape': /<%-([\s\S]+?)%>/g, + + /** + * Used to detect code to be evaluated. + * + * @static + * @memberOf _.templateSettings + * @type RegExp + */ + 'evaluate': /<%([\s\S]+?)%>/g, + + /** + * Used to detect `data` property values to inject. + * + * @static + * @memberOf _.templateSettings + * @type RegExp + */ + 'interpolate': /<%=([\s\S]+?)%>/g, + + /** + * Used to reference the data object in the template text. + * + * @static + * @memberOf _.templateSettings + * @type String + */ + 'variable': 'obj' + }; + + /*--------------------------------------------------------------------------*/ + + /** + * The template used to create iterator functions. + * + * @private + * @param {Obect} data The data object used to populate the text. + * @returns {String} Returns the interpolated text. + */ + var iteratorTemplate = template( + // conditional strict mode + '<% if (useStrict) { %>\'use strict\';\n<% } %>' + + + // the `iteratee` may be reassigned by the `top` snippet + 'var index, iteratee = <%= firstArg %>, ' + + // assign the `result` variable an initial value + 'result<% if (init) { %> = <%= init %><% } %>;\n' + + // add code to exit early or do so if the first argument is falsey + '<%= exit %>;\n' + + // add code after the exit snippet but before the iteration branches + '<%= top %>;\n' + + + // the following branch is for iterating arrays and array-like objects + '<% if (arrayBranch) { %>' + + 'var length = iteratee.length; index = -1;' + + ' <% if (objectBranch) { %>\nif (length === length >>> 0) {<% } %>' + + + // add support for accessing string characters by index if needed + ' <% if (noCharByIndex) { %>\n' + + ' if (toString.call(iteratee) == stringClass) {\n' + + ' iteratee = iteratee.split(\'\')\n' + + ' }' + + ' <% } %>\n' + + + ' <%= arrayBranch.beforeLoop %>;\n' + + ' while (++index < length) {\n' + + ' <%= arrayBranch.inLoop %>\n' + + ' }' + + ' <% if (objectBranch) { %>\n}<% } %>' + + '<% } %>' + + + // the following branch is for iterating an object's own/inherited properties + '<% if (objectBranch) { %>' + + ' <% if (arrayBranch) { %>\nelse {<% } %>' + + ' <% if (!hasDontEnumBug) { %>\n' + + ' var skipProto = typeof iteratee == \'function\' && \n' + + ' propertyIsEnumerable.call(iteratee, \'prototype\');\n' + + ' <% } %>' + + + // iterate own properties using `Object.keys` if it's fast + ' <% if (isKeysFast && useHas) { %>\n' + + ' var props = nativeKeys(iteratee),\n' + + ' propIndex = -1,\n' + + ' length = props.length;\n\n' + + ' <%= objectBranch.beforeLoop %>;\n' + + ' while (++propIndex < length) {\n' + + ' index = props[propIndex];\n' + + ' if (!(skipProto && index == \'prototype\')) {\n' + + ' <%= objectBranch.inLoop %>\n' + + ' }\n' + + ' }' + + + // else using a for-in loop + ' <% } else { %>\n' + + ' <%= objectBranch.beforeLoop %>;\n' + + ' for (index in iteratee) {' + + ' <% if (hasDontEnumBug) { %>\n' + + ' <% if (useHas) { %>if (hasOwnProperty.call(iteratee, index)) {\n <% } %>' + + ' <%= objectBranch.inLoop %>;\n' + + ' <% if (useHas) { %>}<% } %>' + + ' <% } else { %>\n' + + + // Firefox < 3.6, Opera > 9.50 - Opera < 11.60, and Safari < 5.1 + // (if the prototype or a property on the prototype has been set) + // incorrectly sets a function's `prototype` property [[Enumerable]] + // value to `true`. Because of this Lo-Dash standardizes on skipping + // the the `prototype` property of functions regardless of its + // [[Enumerable]] value. + ' if (!(skipProto && index == \'prototype\')<% if (useHas) { %> &&\n' + + ' hasOwnProperty.call(iteratee, index)<% } %>) {\n' + + ' <%= objectBranch.inLoop %>\n' + + ' }' + + ' <% } %>\n' + + ' }' + + ' <% } %>' + + + // Because IE < 9 can't set the `[[Enumerable]]` attribute of an + // existing property and the `constructor` property of a prototype + // defaults to non-enumerable, Lo-Dash skips the `constructor` + // property when it infers it's iterating over a `prototype` object. + ' <% if (hasDontEnumBug) { %>\n\n' + + ' var ctor = iteratee.constructor;\n' + + ' <% for (var k = 0; k < 7; k++) { %>\n' + + ' index = \'<%= shadowed[k] %>\';\n' + + ' if (<%' + + ' if (shadowed[k] == \'constructor\') {' + + ' %>!(ctor && ctor.prototype === iteratee) && <%' + + ' } %>hasOwnProperty.call(iteratee, index)) {\n' + + ' <%= objectBranch.inLoop %>\n' + + ' }' + + ' <% } %>' + + ' <% } %>' + + ' <% if (arrayBranch) { %>\n}<% } %>' + + '<% } %>\n' + + + // add code to the bottom of the iteration function + '<%= bottom %>;\n' + + // finally, return the `result` + 'return result' + ); + + /** + * Reusable iterator options shared by + * `every`, `filter`, `find`, `forEach`, `forIn`, `forOwn`, `groupBy`, `map`, + * `reject`, `some`, and `sortBy`. + */ + var baseIteratorOptions = { + 'args': 'collection, callback, thisArg', + 'init': 'collection', + 'top': + 'if (!callback) {\n' + + ' callback = identity\n' + + '}\n' + + 'else if (thisArg) {\n' + + ' callback = iteratorBind(callback, thisArg)\n' + + '}', + 'inLoop': 'callback(iteratee[index], index, collection)' + }; + + /** Reusable iterator options for `every` and `some` */ + var everyIteratorOptions = { + 'init': 'true', + 'inLoop': 'if (!callback(iteratee[index], index, collection)) return !result' + }; + + /** Reusable iterator options for `defaults` and `extend` */ + var extendIteratorOptions = { + 'useHas': false, + 'useStrict': false, + 'args': 'object', + 'init': 'object', + 'top': + 'for (var iterateeIndex = 1, length = arguments.length; iterateeIndex < length; iterateeIndex++) {\n' + + ' iteratee = arguments[iterateeIndex];\n' + + (hasDontEnumBug ? ' if (iteratee) {' : ''), + 'inLoop': 'result[index] = iteratee[index]', + 'bottom': (hasDontEnumBug ? ' }\n' : '') + '}' + }; + + /** Reusable iterator options for `filter` and `reject` */ + var filterIteratorOptions = { + 'init': '[]', + 'inLoop': 'callback(iteratee[index], index, collection) && result.push(iteratee[index])' + }; + + /** Reusable iterator options for `find`, `forEach`, `forIn`, and `forOwn` */ + var forEachIteratorOptions = { + 'top': 'if (thisArg) callback = iteratorBind(callback, thisArg)' + }; + + /** Reusable iterator options for `forIn` and `forOwn` */ + var forOwnIteratorOptions = { + 'inLoop': { + 'object': baseIteratorOptions.inLoop + } + }; + + /** Reusable iterator options for `invoke`, `map`, `pluck`, and `sortBy` */ + var mapIteratorOptions = { + 'init': '', + 'exit': 'if (!collection) return []', + 'beforeLoop': { + 'array': 'result = Array(length)', + 'object': 'result = ' + (isKeysFast ? 'Array(length)' : '[]') + }, + 'inLoop': { + 'array': 'result[index] = callback(iteratee[index], index, collection)', + 'object': 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + '(callback(iteratee[index], index, collection))' + } + }; + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a new function optimized for searching large arrays for a given `value`, + * starting at `fromIndex`, using strict equality for comparisons, i.e. `===`. + * + * @private + * @param {Array} array The array to search. + * @param {Mixed} value The value to search for. + * @param {Number} [fromIndex=0] The index to start searching from. + * @param {Number} [largeSize=30] The length at which an array is considered large. + * @returns {Boolean} Returns `true` if `value` is found, else `false`. + */ + function cachedContains(array, fromIndex, largeSize) { + fromIndex || (fromIndex = 0); + + var length = array.length, + isLarge = (length - fromIndex) >= (largeSize || 30), + cache = isLarge ? {} : array; + + if (isLarge) { + // init value cache + var key, + index = fromIndex - 1; + + while (++index < length) { + // manually coerce `value` to string because `hasOwnProperty`, in some + // older versions of Firefox, coerces objects incorrectly + key = array[index] + ''; + (hasOwnProperty.call(cache, key) ? cache[key] : (cache[key] = [])).push(array[index]); + } + } + return function(value) { + if (isLarge) { + var key = value + ''; + return hasOwnProperty.call(cache, key) && indexOf(cache[key], value) > -1; + } + return indexOf(cache, value, fromIndex) > -1; + } + } + + /** + * Creates compiled iteration functions. The iteration function will be created + * to iterate over only objects if the first argument of `options.args` is + * "object" or `options.inLoop.array` is falsey. + * + * @private + * @param {Object} [options1, options2, ...] The compile options objects. + * + * useHas - A boolean to specify whether or not to use `hasOwnProperty` checks + * in the object loop. + * + * useStrict - A boolean to specify whether or not to include the ES5 + * "use strict" directive. + * + * args - A string of comma separated arguments the iteration function will + * accept. + * + * init - A string to specify the initial value of the `result` variable. + * + * exit - A string of code to use in place of the default exit-early check + * of `if (!arguments[0]) return result`. + * + * top - A string of code to execute after the exit-early check but before + * the iteration branches. + * + * beforeLoop - A string or object containing an "array" or "object" property + * of code to execute before the array or object loops. + * + * inLoop - A string or object containing an "array" or "object" property + * of code to execute in the array or object loops. + * + * bottom - A string of code to execute after the iteration branches but + * before the `result` is returned. + * + * @returns {Function} Returns the compiled function. + */ + function createIterator() { + var object, + prop, + value, + index = -1, + length = arguments.length; + + // merge options into a template data object + var data = { + 'bottom': '', + 'exit': '', + 'init': '', + 'top': '', + 'arrayBranch': { 'beforeLoop': '' }, + 'objectBranch': { 'beforeLoop': '' } + }; + + while (++index < length) { + object = arguments[index]; + for (prop in object) { + value = (value = object[prop]) == null ? '' : value; + // keep this regexp explicit for the build pre-process + if (/beforeLoop|inLoop/.test(prop)) { + if (typeof value == 'string') { + value = { 'array': value, 'object': value }; + } + data.arrayBranch[prop] = value.array; + data.objectBranch[prop] = value.object; + } else { + data[prop] = value; + } + } + } + // set additional template `data` values + var args = data.args, + firstArg = /^[^,]+/.exec(args)[0]; + + data.firstArg = firstArg; + data.hasDontEnumBug = hasDontEnumBug; + data.isKeysFast = isKeysFast; + data.shadowed = shadowed; + data.useHas = data.useHas !== false; + data.useStrict = data.useStrict !== false; + + if (!('noCharByIndex' in data)) { + data.noCharByIndex = noCharByIndex; + } + if (!data.exit) { + data.exit = 'if (!' + firstArg + ') return result'; + } + if (firstArg != 'collection' || !data.arrayBranch.inLoop) { + data.arrayBranch = null; + } + // create the function factory + var factory = Function( + 'arrayClass, bind, compareAscending, funcClass, hasOwnProperty, identity, ' + + 'iteratorBind, objectTypes, nativeKeys, propertyIsEnumerable, slice, ' + + 'stringClass, toString', + 'return function(' + args + ') {\n' + iteratorTemplate(data) + '\n}' + ); + // return the compiled function + return factory( + arrayClass, bind, compareAscending, funcClass, hasOwnProperty, identity, + iteratorBind, objectTypes, nativeKeys, propertyIsEnumerable, slice, + stringClass, toString + ); + } + + /** + * Used by `sortBy` to compare transformed values of `collection`, sorting + * them in ascending order. + * + * @private + * @param {Object} a The object to compare to `b`. + * @param {Object} b The object to compare to `a`. + * @returns {Number} Returns `-1` if `a` < `b`, `0` if `a` == `b`, or `1` if `a` > `b`. + */ + function compareAscending(a, b) { + a = a.criteria; + b = b.criteria; + + if (a === undefined) { + return 1; + } + if (b === undefined) { + return -1; + } + return a < b ? -1 : a > b ? 1 : 0; + } + + /** + * Used by `template` to replace tokens with their corresponding code snippets. + * + * @private + * @param {String} match The matched token. + * @param {String} index The `tokenized` index of the code snippet. + * @returns {String} Returns the code snippet. + */ + function detokenize(match, index) { + return tokenized[index]; + } + + /** + * Used by `template` to escape characters for inclusion in compiled + * string literals. + * + * @private + * @param {String} match The matched character to escape. + * @returns {String} Returns the escaped character. + */ + function escapeStringChar(match) { + return '\\' + stringEscapes[match]; + } + + /** + * Used by `escape` to escape characters for inclusion in HTML. + * + * @private + * @param {String} match The matched character to escape. + * @returns {String} Returns the escaped character. + */ + function escapeHtmlChar(match) { + return htmlEscapes[match]; + } + + /** + * Creates a new function that, when called, invokes `func` with the `this` + * binding of `thisArg` and the arguments (value, index, object). + * + * @private + * @param {Function} func The function to bind. + * @param {Mixed} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new bound function. + */ + function iteratorBind(func, thisArg) { + return function(value, index, object) { + return func.call(thisArg, value, index, object); + }; + } + + /** + * A no-operation function. + * + * @private + */ + function noop() { + // no operation performed + } + + /** + * A shim implementation of `Object.keys` that produces an array of the given + * object's own enumerable property names. + * + * @private + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property names. + */ + var shimKeys = createIterator({ + 'args': 'object', + 'exit': 'if (!(object && objectTypes[typeof object])) throw TypeError()', + 'init': '[]', + 'inLoop': 'result.push(index)' + }); + + /** + * Used by `template` to replace "escape" template delimiters with tokens. + * + * @private + * @param {String} match The matched template delimiter. + * @param {String} value The delimiter value. + * @returns {String} Returns a token. + */ + function tokenizeEscape(match, value) { + if (reComplexDelimiter.test(value)) { + return ''; + } + var index = tokenized.length; + tokenized[index] = "' +\n__e(" + value + ") +\n'"; + return token + index; + } + + /** + * Used by `template` to replace "evaluate" template delimiters, or complex + * "escape" and "interpolate" delimiters, with tokens. + * + * @private + * @param {String} match The matched template delimiter. + * @param {String} value The delimiter value. + * @param {String} escapeValue The "escape" delimiter value. + * @param {String} interpolateValue The "interpolate" delimiter value. + * @returns {String} Returns a token. + */ + function tokenizeEvaluate(match, value, escapeValue, interpolateValue) { + var index = tokenized.length; + if (value) { + tokenized[index] = "';\n" + value + ";\n__p += '" + } else if (escapeValue) { + tokenized[index] = "' +\n__e(" + escapeValue + ") +\n'"; + } else if (interpolateValue) { + tokenized[index] = "' +\n((__t = (" + interpolateValue + ")) == null ? '' : __t) +\n'"; + } + return token + index; + } + + /** + * Used by `template` to replace "interpolate" template delimiters with tokens. + * + * @private + * @param {String} match The matched template delimiter. + * @param {String} value The delimiter value. + * @returns {String} Returns a token. + */ + function tokenizeInterpolate(match, value) { + if (reComplexDelimiter.test(value)) { + return ''; + } + var index = tokenized.length; + tokenized[index] = "' +\n((__t = (" + value + ")) == null ? '' : __t) +\n'"; + return token + index; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Checks if a given `target` value is present in a `collection` using strict + * equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @alias include + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Mixed} target The value to check for. + * @returns {Boolean} Returns `true` if `target` value is found, else `false`. + * @example + * + * _.contains([1, 2, 3], 3); + * // => true + * + * _.contains({ 'name': 'moe', 'age': 40 }, 'moe'); + * // => true + * + * _.contains('curly', 'ur'); + * // => true + */ + var contains = createIterator({ + 'args': 'collection, target', + 'init': 'false', + 'noCharByIndex': false, + 'beforeLoop': { + 'array': 'if (toString.call(iteratee) == stringClass) return collection.indexOf(target) > -1' + }, + 'inLoop': 'if (iteratee[index] === target) return true' + }); + + /** + * Checks if the `callback` returns a truthy value for **all** elements of a + * `collection`. The `callback` is bound to `thisArg` and invoked with 3 + * arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias all + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Boolean} Returns `true` if all values pass the callback check, else `false`. + * @example + * + * _.every([true, 1, null, 'yes'], Boolean); + * // => false + */ + var every = createIterator(baseIteratorOptions, everyIteratorOptions); + + /** + * Examines each value in a `collection`, returning an array of all values the + * `callback` returns truthy for. The `callback` is bound to `thisArg` and + * invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias select + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of values that passed callback check. + * @example + * + * var evens = _.filter([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); + * // => [2, 4, 6] + */ + var filter = createIterator(baseIteratorOptions, filterIteratorOptions); + + /** + * Examines each value in a `collection`, returning the first one the `callback` + * returns truthy for. The function returns as soon as it finds an acceptable + * value, and does not iterate over the entire `collection`. The `callback` is + * bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias detect + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the value that passed the callback check, else `undefined`. + * @example + * + * var even = _.find([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); + * // => 2 + */ + var find = createIterator(baseIteratorOptions, forEachIteratorOptions, { + 'init': '', + 'inLoop': 'if (callback(iteratee[index], index, collection)) return iteratee[index]' + }); + + /** + * Iterates over a `collection`, executing the `callback` for each value in the + * `collection`. The `callback` is bound to `thisArg` and invoked with 3 + * arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias each + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array|Object} Returns the `collection`. + * @example + * + * _([1, 2, 3]).forEach(alert).join(','); + * // => alerts each number and returns '1,2,3' + * + * _.forEach({ 'one': 1, 'two': 2, 'three': 3 }, alert); + * // => alerts each number (order is not guaranteed) + */ + var forEach = createIterator(baseIteratorOptions, forEachIteratorOptions); + + /** + * Splits `collection` into sets, grouped by the result of running each value + * through `callback`. The `callback` is bound to `thisArg` and invoked with + * 3 arguments; (value, index|key, collection). The `callback` argument may + * also be the name of a property to group by. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} callback The function called per iteration or + * property name to group by. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns an object of grouped values. + * @example + * + * _.groupBy([1.3, 2.1, 2.4], function(num) { return Math.floor(num); }); + * // => { '1': [1.3], '2': [2.1, 2.4] } + * + * _.groupBy([1.3, 2.1, 2.4], function(num) { return this.floor(num); }, Math); + * // => { '1': [1.3], '2': [2.1, 2.4] } + * + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createIterator(baseIteratorOptions, { + 'init': '{}', + 'top': + 'var prop, isFunc = typeof callback == \'function\';\n' + + 'if (isFunc && thisArg) callback = iteratorBind(callback, thisArg)', + 'inLoop': + 'prop = isFunc\n' + + ' ? callback(iteratee[index], index, collection)\n' + + ' : iteratee[index][callback];\n' + + '(hasOwnProperty.call(result, prop) ? result[prop] : result[prop] = []).push(iteratee[index])' + }); + + /** + * Invokes the method named by `methodName` on each element in the `collection`. + * Additional arguments will be passed to each invoked method. If `methodName` + * is a function it will be invoked for, and `this` bound to, each element + * in the `collection`. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} methodName The name of the method to invoke or + * the function invoked per iteration. + * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the method with. + * @returns {Array} Returns a new array of values returned from each invoked method. + * @example + * + * _.invoke([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invoke([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + var invoke = createIterator(mapIteratorOptions, { + 'args': 'collection, methodName', + 'top': + 'var args = slice.call(arguments, 2),\n' + + ' isFunc = typeof methodName == \'function\'', + 'inLoop': { + 'array': + 'result[index] = (isFunc ? methodName : iteratee[index][methodName])' + + '.apply(iteratee[index], args)', + 'object': + 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + + '((isFunc ? methodName : iteratee[index][methodName]).apply(iteratee[index], args))' + } + }); + + /** + * Produces a new array of values by mapping each element in the `collection` + * through a transformation `callback`. The `callback` is bound to `thisArg` + * and invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias collect + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of values returned by the callback. + * @example + * + * _.map([1, 2, 3], function(num) { return num * 3; }); + * // => [3, 6, 9] + * + * _.map({ 'one': 1, 'two': 2, 'three': 3 }, function(num) { return num * 3; }); + * // => [3, 6, 9] (order is not guaranteed) + */ + var map = createIterator(baseIteratorOptions, mapIteratorOptions); + + /** + * Retrieves the value of a specified property from all elements in + * the `collection`. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {String} property The property to pluck. + * @returns {Array} Returns a new array of property values. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * _.pluck(stooges, 'name'); + * // => ['moe', 'larry', 'curly'] + */ + var pluck = createIterator(mapIteratorOptions, { + 'args': 'collection, property', + 'inLoop': { + 'array': 'result[index] = iteratee[index][property]', + 'object': 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + '(iteratee[index][property])' + } + }); + + /** + * Boils down a `collection` to a single value. The initial state of the + * reduction is `accumulator` and each successive step of it should be returned + * by the `callback`. The `callback` is bound to `thisArg` and invoked with 4 + * arguments; for arrays they are (accumulator, value, index|key, collection). + * + * @static + * @memberOf _ + * @alias foldl, inject + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [accumulator] Initial value of the accumulator. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the accumulated value. + * @example + * + * var sum = _.reduce([1, 2, 3], function(memo, num) { return memo + num; }); + * // => 6 + */ + var reduce = createIterator({ + 'args': 'collection, callback, accumulator, thisArg', + 'init': 'accumulator', + 'top': + 'var noaccum = arguments.length < 3;\n' + + 'if (thisArg) callback = iteratorBind(callback, thisArg)', + 'beforeLoop': { + 'array': 'if (noaccum) result = collection[++index]' + }, + 'inLoop': { + 'array': + 'result = callback(result, iteratee[index], index, collection)', + 'object': + 'result = noaccum\n' + + ' ? (noaccum = false, iteratee[index])\n' + + ' : callback(result, iteratee[index], index, collection)' + } + }); + + /** + * The right-associative version of `_.reduce`. + * + * @static + * @memberOf _ + * @alias foldr + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [accumulator] Initial value of the accumulator. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the accumulated value. + * @example + * + * var list = [[0, 1], [2, 3], [4, 5]]; + * var flat = _.reduceRight(list, function(a, b) { return a.concat(b); }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, callback, accumulator, thisArg) { + if (!collection) { + return accumulator; + } + + var length = collection.length, + noaccum = arguments.length < 3; + + if(thisArg) { + callback = iteratorBind(callback, thisArg); + } + if (length === length >>> 0) { + var iteratee = noCharByIndex && toString.call(collection) == stringClass + ? collection.split('') + : collection; + + if (length && noaccum) { + accumulator = iteratee[--length]; + } + while (length--) { + accumulator = callback(accumulator, iteratee[length], length, collection); + } + return accumulator; + } + + var prop, + props = keys(collection); + + length = props.length; + if (length && noaccum) { + accumulator = collection[props[--length]]; + } + while (length--) { + prop = props[length]; + accumulator = callback(accumulator, collection[prop], prop, collection); + } + return accumulator; + } + + /** + * The opposite of `_.filter`, this method returns the values of a + * `collection` that `callback` does **not** return truthy for. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of values that did **not** pass the callback check. + * @example + * + * var odds = _.reject([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); + * // => [1, 3, 5] + */ + var reject = createIterator(baseIteratorOptions, filterIteratorOptions, { + 'inLoop': '!' + filterIteratorOptions.inLoop + }); + + /** + * Checks if the `callback` returns a truthy value for **any** element of a + * `collection`. The function returns as soon as it finds passing value, and + * does not iterate over the entire `collection`. The `callback` is bound to + * `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias any + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Boolean} Returns `true` if any value passes the callback check, else `false`. + * @example + * + * _.some([null, 0, 'yes', false]); + * // => true + */ + var some = createIterator(baseIteratorOptions, everyIteratorOptions, { + 'init': 'false', + 'inLoop': everyIteratorOptions.inLoop.replace('!', '') + }); + + + /** + * Produces a new sorted array, sorted in ascending order by the results of + * running each element of `collection` through a transformation `callback`. + * The `callback` is bound to `thisArg` and invoked with 3 arguments; + * (value, index|key, collection). The `callback` argument may also be the + * name of a property to sort by (e.g. 'length'). + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} callback The function called per iteration or + * property name to sort by. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of sorted values. + * @example + * + * _.sortBy([1, 2, 3], function(num) { return Math.sin(num); }); + * // => [3, 1, 2] + * + * _.sortBy([1, 2, 3], function(num) { return this.sin(num); }, Math); + * // => [3, 1, 2] + * + * _.sortBy(['larry', 'brendan', 'moe'], 'length'); + * // => ['moe', 'larry', 'brendan'] + */ + var sortBy = createIterator(baseIteratorOptions, mapIteratorOptions, { + 'top': + 'if (typeof callback == \'string\') {\n' + + ' var prop = callback;\n' + + ' callback = function(collection) { return collection[prop] }\n' + + '}\n' + + 'else if (thisArg) {\n' + + ' callback = iteratorBind(callback, thisArg)\n' + + '}', + 'inLoop': { + 'array': + 'result[index] = {\n' + + ' criteria: callback(iteratee[index], index, collection),\n' + + ' value: iteratee[index]\n' + + '}', + 'object': + 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + '({\n' + + ' criteria: callback(iteratee[index], index, collection),\n' + + ' value: iteratee[index]\n' + + '})' + }, + 'bottom': + 'result.sort(compareAscending);\n' + + 'length = result.length;\n' + + 'while (length--) {\n' + + ' result[length] = result[length].value\n' + + '}' + }); + + /** + * Converts the `collection`, into an array. Useful for converting the + * `arguments` object. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to convert. + * @returns {Array} Returns the new converted array. + * @example + * + * (function() { return _.toArray(arguments).slice(1); })(1, 2, 3, 4); + * // => [2, 3, 4] + */ + function toArray(collection) { + if (!collection) { + return []; + } + if (collection.toArray && toString.call(collection.toArray) == funcClass) { + return collection.toArray(); + } + var length = collection.length; + if (length === length >>> 0) { + return (noArraySliceOnStrings ? toString.call(collection) == stringClass : typeof collection == 'string') + ? collection.split('') + : slice.call(collection); + } + return values(collection); + } + + /*--------------------------------------------------------------------------*/ + + /** + * Produces a new array with all falsey values of `array` removed. The values + * `false`, `null`, `0`, `""`, `undefined` and `NaN` are all falsey. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to compact. + * @returns {Array} Returns a new filtered array. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var result = []; + if (!array) { + return result; + } + var index = -1, + length = array.length; + + while (++index < length) { + if (array[index]) { + result.push(array[index]); + } + } + return result; + } + + /** + * Produces a new array of `array` values not present in the other arrays + * using strict equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to process. + * @param {Array} [array1, array2, ...] Arrays to check. + * @returns {Array} Returns a new array of `array` values not present in the + * other arrays. + * @example + * + * _.difference([1, 2, 3, 4, 5], [5, 2, 10]); + * // => [1, 3, 4] + */ + function difference(array) { + var result = []; + if (!array) { + return result; + } + var index = -1, + length = array.length, + flattened = concat.apply(result, arguments), + contains = cachedContains(flattened, length); + + while (++index < length) { + if (!contains(array[index])) { + result.push(array[index]); + } + } + return result; + } + + /** + * Gets the first value of the `array`. Pass `n` to return the first `n` values + * of the `array`. + * + * @static + * @memberOf _ + * @alias head, take + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Mixed} Returns the first value or an array of the first `n` values + * of `array`. + * @example + * + * _.first([5, 4, 3, 2, 1]); + * // => 5 + */ + function first(array, n, guard) { + if (array) { + return (n == null || guard) ? array[0] : slice.call(array, 0, n); + } + } + + /** + * Flattens a nested array (the nesting can be to any depth). If `shallow` is + * truthy, `array` will only be flattened a single level. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to compact. + * @param {Boolean} shallow A flag to indicate only flattening a single level. + * @returns {Array} Returns a new flattened array. + * @example + * + * _.flatten([1, [2], [3, [[4]]]]); + * // => [1, 2, 3, 4]; + * + * _.flatten([1, [2], [3, [[4]]]], true); + * // => [1, 2, 3, [[4]]]; + */ + function flatten(array, shallow) { + var result = []; + if (!array) { + return result; + } + var value, + index = -1, + length = array.length; + + while (++index < length) { + value = array[index]; + if (isArray(value)) { + push.apply(result, shallow ? value : flatten(value)); + } else { + result.push(value); + } + } + return result; + } + + /** + * Gets the index at which the first occurrence of `value` is found using + * strict equality for comparisons, i.e. `===`. If the `array` is already + * sorted, passing `true` for `isSorted` will run a faster binary search. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to search. + * @param {Mixed} value The value to search for. + * @param {Boolean|Number} [fromIndex=0] The index to start searching from or + * `true` to perform a binary search on a sorted `array`. + * @returns {Number} Returns the index of the matched value or `-1`. + * @example + * + * _.indexOf([1, 2, 3, 1, 2, 3], 2); + * // => 1 + * + * _.indexOf([1, 2, 3, 1, 2, 3], 2, 3); + * // => 4 + * + * _.indexOf([1, 1, 2, 2, 3, 3], 2, true); + * // => 2 + */ + function indexOf(array, value, fromIndex) { + if (!array) { + return -1; + } + var index = -1, + length = array.length; + + if (fromIndex) { + if (typeof fromIndex == 'number') { + index = (fromIndex < 0 ? Math.max(0, length + fromIndex) : fromIndex) - 1; + } else { + index = sortedIndex(array, value); + return array[index] === value ? index : -1; + } + } + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * Gets all but the last value of `array`. Pass `n` to exclude the last `n` + * values from the result. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Array} Returns all but the last value or `n` values of `array`. + * @example + * + * _.initial([3, 2, 1]); + * // => [3, 2] + */ + function initial(array, n, guard) { + if (!array) { + return []; + } + return slice.call(array, 0, -((n == null || guard) ? 1 : n)); + } + + /** + * Computes the intersection of all the passed-in arrays. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} [array1, array2, ...] Arrays to process. + * @returns {Array} Returns a new array of unique values, in order, that are + * present in **all** of the arrays. + * @example + * + * _.intersection([1, 2, 3], [101, 2, 1, 10], [2, 1]); + * // => [1, 2] + */ + function intersection(array) { + var result = []; + if (!array) { + return result; + } + var value, + index = -1, + length = array.length, + others = slice.call(arguments, 1), + cache = []; + + while (++index < length) { + value = array[index]; + if (indexOf(result, value) < 0 && + every(others, function(other, index) { + return (cache[index] || (cache[index] = cachedContains(other)))(value); + })) { + result.push(value); + } + } + return result; + } + + /** + * Gets the last value of the `array`. Pass `n` to return the lasy `n` values + * of the `array`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Mixed} Returns the last value or an array of the last `n` values + * of `array`. + * @example + * + * _.last([3, 2, 1]); + * // => 1 + */ + function last(array, n, guard) { + if (array) { + var length = array.length; + return (n == null || guard) ? array[length - 1] : slice.call(array, -n || length); + } + } + + /** + * Gets the index at which the last occurrence of `value` is found using + * strict equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to search. + * @param {Mixed} value The value to search for. + * @param {Number} [fromIndex=array.length-1] The index to start searching from. + * @returns {Number} Returns the index of the matched value or `-1`. + * @example + * + * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2); + * // => 4 + * + * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2, 3); + * // => 1 + */ + function lastIndexOf(array, value, fromIndex) { + if (!array) { + return -1; + } + var index = array.length; + if (fromIndex && typeof fromIndex == 'number') { + index = (fromIndex < 0 ? Math.max(0, index + fromIndex) : Math.min(fromIndex, index - 1)) + 1; + } + while (index--) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * Retrieves the maximum value of an `array`. If `callback` is passed, + * it will be executed for each value in the `array` to generate the + * criterion by which the value is ranked. The `callback` is bound to + * `thisArg` and invoked with 3 arguments; (value, index, array). + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to iterate over. + * @param {Function} [callback] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the maximum value. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * _.max(stooges, function(stooge) { return stooge.age; }); + * // => { 'name': 'curly', 'age': 60 }; + */ + function max(array, callback, thisArg) { + var computed = -Infinity, + result = computed; + + if (!array) { + return result; + } + var current, + index = -1, + length = array.length; + + if (!callback) { + while (++index < length) { + if (array[index] > result) { + result = array[index]; + } + } + return result; + } + if (thisArg) { + callback = iteratorBind(callback, thisArg); + } + while (++index < length) { + current = callback(array[index], index, array); + if (current > computed) { + computed = current; + result = array[index]; + } + } + return result; + } + + /** + * Retrieves the minimum value of an `array`. If `callback` is passed, + * it will be executed for each value in the `array` to generate the + * criterion by which the value is ranked. The `callback` is bound to `thisArg` + * and invoked with 3 arguments; (value, index, array). + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to iterate over. + * @param {Function} [callback] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the minimum value. + * @example + * + * _.min([10, 5, 100, 2, 1000]); + * // => 2 + */ + function min(array, callback, thisArg) { + var computed = Infinity, + result = computed; + + if (!array) { + return result; + } + var current, + index = -1, + length = array.length; + + if (!callback) { + while (++index < length) { + if (array[index] < result) { + result = array[index]; + } + } + return result; + } + if (thisArg) { + callback = iteratorBind(callback, thisArg); + } + while (++index < length) { + current = callback(array[index], index, array); + if (current < computed) { + computed = current; + result = array[index]; + } + } + return result; + } + + /** + * Creates an array of numbers (positive and/or negative) progressing from + * `start` up to but not including `stop`. This method is a port of Python's + * `range()` function. See http://docs.python.org/library/functions.html#range. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Number} [start=0] The start of the range. + * @param {Number} end The end of the range. + * @param {Number} [step=1] The value to increment or descrement by. + * @returns {Array} Returns a new range array. + * @example + * + * _.range(10); + * // => [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] + * + * _.range(1, 11); + * // => [1, 2, 3, 4, 5, 6, 7, 8, 9, 10] + * + * _.range(0, 30, 5); + * // => [0, 5, 10, 15, 20, 25] + * + * _.range(0, -10, -1); + * // => [0, -1, -2, -3, -4, -5, -6, -7, -8, -9] + * + * _.range(0); + * // => [] + */ + function range(start, end, step) { + step || (step = 1); + if (end == null) { + end = start || 0; + start = 0; + } + // use `Array(length)` so V8 will avoid the slower "dictionary" mode + // http://www.youtube.com/watch?v=XAqIpGU8ZZk#t=16m27s + var index = -1, + length = Math.max(0, Math.ceil((end - start) / step)), + result = Array(length); + + while (++index < length) { + result[index] = start; + start += step; + } + return result; + } + + /** + * The opposite of `_.initial`, this method gets all but the first value of + * `array`. Pass `n` to exclude the first `n` values from the result. + * + * @static + * @memberOf _ + * @alias tail + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Array} Returns all but the first value or `n` values of `array`. + * @example + * + * _.rest([3, 2, 1]); + * // => [2, 1] + */ + function rest(array, n, guard) { + if (!array) { + return []; + } + return slice.call(array, (n == null || guard) ? 1 : n); + } + + /** + * Produces a new array of shuffled `array` values, using a version of the + * Fisher-Yates shuffle. See http://en.wikipedia.org/wiki/Fisher-Yates_shuffle. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to shuffle. + * @returns {Array} Returns a new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4, 5, 6]); + * // => [4, 1, 6, 3, 5, 2] + */ + function shuffle(array) { + if (!array) { + return []; + } + var rand, + index = -1, + length = array.length, + result = Array(length); + + while (++index < length) { + rand = Math.floor(Math.random() * (index + 1)); + result[index] = result[rand]; + result[rand] = array[index]; + } + return result; + } + + /** + * Uses a binary search to determine the smallest index at which the `value` + * should be inserted into `array` in order to maintain the sort order of the + * sorted `array`. If `callback` is passed, it will be executed for `value` and + * each element in `array` to compute their sort ranking. The `callback` is + * bound to `thisArg` and invoked with 1 argument; (value). + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to iterate over. + * @param {Mixed} value The value to evaluate. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Number} Returns the index at which the value should be inserted + * into `array`. + * @example + * + * _.sortedIndex([20, 30, 40], 35); + * // => 2 + * + * var dict = { + * 'wordToNumber': { 'twenty': 20, 'thirty': 30, 'thirty-five': 35, 'fourty': 40 } + * }; + * + * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) { + * return dict.wordToNumber[word]; + * }); + * // => 2 + * + * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) { + * return this.wordToNumber[word]; + * }, dict); + * // => 2 + */ + function sortedIndex(array, value, callback, thisArg) { + if (!array) { + return 0; + } + var mid, + low = 0, + high = array.length; + + if (callback) { + if (thisArg) { + callback = bind(callback, thisArg); + } + value = callback(value); + while (low < high) { + mid = (low + high) >>> 1; + callback(array[mid]) < value ? low = mid + 1 : high = mid; + } + } else { + while (low < high) { + mid = (low + high) >>> 1; + array[mid] < value ? low = mid + 1 : high = mid; + } + } + return low; + } + + /** + * Computes the union of the passed-in arrays. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} [array1, array2, ...] Arrays to process. + * @returns {Array} Returns a new array of unique values, in order, that are + * present in one or more of the arrays. + * @example + * + * _.union([1, 2, 3], [101, 2, 1, 10], [2, 1]); + * // => [1, 2, 3, 101, 10] + */ + function union() { + var index = -1, + result = [], + flattened = concat.apply(result, arguments), + length = flattened.length; + + while (++index < length) { + if (indexOf(result, flattened[index]) < 0) { + result.push(flattened[index]); + } + } + return result; + } + + /** + * Produces a duplicate-value-free version of the `array` using strict equality + * for comparisons, i.e. `===`. If the `array` is already sorted, passing `true` + * for `isSorted` will run a faster algorithm. If `callback` is passed, + * each value of `array` is passed through a transformation `callback` before + * uniqueness is computed. The `callback` is bound to `thisArg` and invoked + * with 3 arguments; (value, index, array). + * + * @static + * @memberOf _ + * @alias unique + * @category Arrays + * @param {Array} array The array to process. + * @param {Boolean} [isSorted=false] A flag to indicate that the `array` is already sorted. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a duplicate-value-free array. + * @example + * + * _.uniq([1, 2, 1, 3, 1]); + * // => [1, 2, 3] + * + * _.uniq([1, 1, 2, 2, 3], true); + * // => [1, 2, 3] + * + * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return Math.floor(num); }); + * // => [1, 2, 3] + * + * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return this.floor(num); }, Math); + * // => [1, 2, 3] + */ + function uniq(array, isSorted, callback, thisArg) { + var result = []; + if (!array) { + return result; + } + var computed, + index = -1, + length = array.length, + seen = []; + + // juggle arguments + if (typeof isSorted == 'function') { + thisArg = callback; + callback = isSorted; + isSorted = false; + } + if (!callback) { + callback = identity; + } else if (thisArg) { + callback = iteratorBind(callback, thisArg); + } + while (++index < length) { + computed = callback(array[index], index, array); + if (isSorted + ? !index || seen[seen.length - 1] !== computed + : indexOf(seen, computed) < 0 + ) { + seen.push(computed); + result.push(array[index]); + } + } + return result; + } + + /** + * Produces a new array with all occurrences of the passed values removed using + * strict equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to filter. + * @param {Mixed} [value1, value2, ...] Values to remove. + * @returns {Array} Returns a new filtered array. + * @example + * + * _.without([1, 2, 1, 0, 3, 1, 4], 0, 1); + * // => [2, 3, 4] + */ + function without(array) { + var result = []; + if (!array) { + return result; + } + var index = -1, + length = array.length, + contains = cachedContains(arguments, 1, 20); + + while (++index < length) { + if (!contains(array[index])) { + result.push(array[index]); + } + } + return result; + } + + /** + * Merges the elements of each array at their corresponding indexes. Useful for + * separate data sources that are coordinated through matching array indexes. + * For a matrix of nested arrays, `_.zip.apply(...)` can transpose the matrix + * in a similar fashion. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} [array1, array2, ...] Arrays to process. + * @returns {Array} Returns a new array of merged arrays. + * @example + * + * _.zip(['moe', 'larry', 'curly'], [30, 40, 50], [true, false, false]); + * // => [['moe', 30, true], ['larry', 40, false], ['curly', 50, false]] + */ + function zip(array) { + if (!array) { + return []; + } + var index = -1, + length = max(pluck(arguments, 'length')), + result = Array(length); + + while (++index < length) { + result[index] = pluck(arguments, index); + } + return result; + } + + /** + * Merges an array of `keys` and an array of `values` into a single object. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} keys The array of keys. + * @param {Array} [values=[]] The array of values. + * @returns {Object} Returns an object composed of the given keys and + * corresponding values. + * @example + * + * _.zipObject(['moe', 'larry', 'curly'], [30, 40, 50]); + * // => { 'moe': 30, 'larry': 40, 'curly': 50 } + */ + function zipObject(keys, values) { + if (!keys) { + return {}; + } + var index = -1, + length = keys.length, + result = {}; + + values || (values = []); + while (++index < length) { + result[keys[index]] = values[index]; + } + return result; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a new function that is restricted to executing only after it is + * called `n` times. + * + * @static + * @memberOf _ + * @category Functions + * @param {Number} n The number of times the function must be called before + * it is executed. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var renderNotes = _.after(notes.length, render); + * _.forEach(notes, function(note) { + * note.asyncSave({ 'success': renderNotes }); + * }); + * // `renderNotes` is run once, after all notes have saved + */ + function after(n, func) { + if (n < 1) { + return func(); + } + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a new function that, when called, invokes `func` with the `this` + * binding of `thisArg` and prepends any additional `bind` arguments to those + * passed to the bound function. Lazy defined methods may be bound by passing + * the object they are bound to as `func` and the method name as `thisArg`. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function|Object} func The function to bind or the object the method belongs to. + * @param {Mixed} [thisArg] The `this` binding of `func` or the method name. + * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * // basic bind + * var func = function(greeting) { + * return greeting + ' ' + this.name; + * }; + * + * func = _.bind(func, { 'name': 'moe' }, 'hi'); + * func(); + * // => 'hi moe' + * + * // lazy bind + * var object = { + * 'name': 'moe', + * 'greet': function(greeting) { + * return greeting + ' ' + this.name; + * } + * }; + * + * var func = _.bind(object, 'greet', 'hi'); + * func(); + * // => 'hi moe' + * + * object.greet = function(greeting) { + * return greeting + ', ' + this.name + '!'; + * }; + * + * func(); + * // => 'hi, moe!' + */ + function bind(func, thisArg) { + var methodName, + isFunc = toString.call(func) == funcClass; + + // juggle arguments + if (!isFunc) { + methodName = thisArg; + thisArg = func; + } + // use `Function#bind` if it exists and is fast + // (in V8 `Function#bind` is slower except when partially applied) + else if (isBindFast || (nativeBind && arguments.length > 2)) { + return nativeBind.call.apply(nativeBind, arguments); + } + + var partialArgs = slice.call(arguments, 2); + + function bound() { + // `Function#bind` spec + // http://es5.github.com/#x15.3.4.5 + var args = arguments, + thisBinding = thisArg; + + if (!isFunc) { + func = thisArg[methodName]; + } + if (partialArgs.length) { + args = args.length + ? concat.apply(partialArgs, args) + : partialArgs; + } + if (this instanceof bound) { + // get `func` instance if `bound` is invoked in a `new` expression + noop.prototype = func.prototype; + thisBinding = new noop; + + // mimic the constructor's `return` behavior + // http://es5.github.com/#x13.2.2 + var result = func.apply(thisBinding, args); + return result && objectTypes[typeof result] + ? result + : thisBinding + } + return func.apply(thisBinding, args); + } + return bound; + } + + /** + * Binds methods on `object` to `object`, overwriting the existing method. + * If no method names are provided, all the function properties of `object` + * will be bound. + * + * @static + * @memberOf _ + * @category Functions + * @param {Object} object The object to bind and assign the bound methods to. + * @param {String} [methodName1, methodName2, ...] Method names on the object to bind. + * @returns {Object} Returns the `object`. + * @example + * + * var buttonView = { + * 'label': 'lodash', + * 'onClick': function() { alert('clicked: ' + this.label); } + * }; + * + * _.bindAll(buttonView); + * jQuery('#lodash_button').on('click', buttonView.onClick); + * // => When the button is clicked, `this.label` will have the correct value + */ + var bindAll = createIterator({ + 'useHas': false, + 'useStrict': false, + 'args': 'object', + 'init': 'object', + 'top': + 'var funcs = arguments,\n' + + ' length = funcs.length;\n' + + 'if (length > 1) {\n' + + ' for (var index = 1; index < length; index++)\n' + + ' result[funcs[index]] = bind(result[funcs[index]], result);\n' + + ' return result\n' + + '}', + 'inLoop': + 'if (toString.call(result[index]) == funcClass)' + + ' result[index] = bind(result[index], result)' + }); + + /** + * Creates a new function that is the composition of the passed functions, + * where each function consumes the return value of the function that follows. + * In math terms, composing the functions `f()`, `g()`, and `h()` produces `f(g(h()))`. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} [func1, func2, ...] Functions to compose. + * @returns {Function} Returns the new composed function. + * @example + * + * var greet = function(name) { return 'hi: ' + name; }; + * var exclaim = function(statement) { return statement + '!'; }; + * var welcome = _.compose(exclaim, greet); + * welcome('moe'); + * // => 'hi: moe!' + */ + function compose() { + var funcs = arguments; + return function() { + var args = arguments, + length = funcs.length; + + while (length--) { + args = [funcs[length].apply(this, args)]; + } + return args[0]; + }; + } + + /** + * Creates a new function that will delay the execution of `func` until after + * `wait` milliseconds have elapsed since the last time it was invoked. Pass + * `true` for `immediate` to cause debounce to invoke `func` on the leading, + * instead of the trailing, edge of the `wait` timeout. Subsequent calls to + * the debounced function will return the result of the last `func` call. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to debounce. + * @param {Number} wait The number of milliseconds to delay. + * @param {Boolean} immediate A flag to indicate execution is on the leading + * edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * var lazyLayout = _.debounce(calculateLayout, 300); + * jQuery(window).on('resize', lazyLayout); + */ + function debounce(func, wait, immediate) { + var args, + result, + thisArg, + timeoutId; + + function delayed() { + timeoutId = null; + if (!immediate) { + func.apply(thisArg, args); + } + } + + return function() { + var isImmediate = immediate && !timeoutId; + args = arguments; + thisArg = this; + + clearTimeout(timeoutId); + timeoutId = setTimeout(delayed, wait); + + if (isImmediate) { + result = func.apply(thisArg, args); + } + return result; + }; + } + + /** + * Executes the `func` function after `wait` milliseconds. Additional arguments + * are passed to `func` when it is invoked. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to delay. + * @param {Number} wait The number of milliseconds to delay execution. + * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with. + * @returns {Number} Returns the `setTimeout` timeout id. + * @example + * + * var log = _.bind(console.log, console); + * _.delay(log, 1000, 'logged later'); + * // => 'logged later' (Appears after one second.) + */ + function delay(func, wait) { + var args = slice.call(arguments, 2); + return setTimeout(function() { return func.apply(undefined, args); }, wait); + } + + /** + * Defers executing the `func` function until the current call stack has cleared. + * Additional arguments are passed to `func` when it is invoked. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to defer. + * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with. + * @returns {Number} Returns the `setTimeout` timeout id. + * @example + * + * _.defer(function() { alert('deferred'); }); + * // returns from the function before `alert` is called + */ + function defer(func) { + var args = slice.call(arguments, 1); + return setTimeout(function() { return func.apply(undefined, args); }, 1); + } + + /** + * Creates a new function that memoizes the result of `func`. If `resolver` is + * passed, it will be used to determine the cache key for storing the result + * based on the arguments passed to the memoized function. By default, the first + * argument passed to the memoized function is used as the cache key. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] A function used to resolve the cache key. + * @returns {Function} Returns the new memoizing function. + * @example + * + * var fibonacci = _.memoize(function(n) { + * return n < 2 ? n : fibonacci(n - 1) + fibonacci(n - 2); + * }); + */ + function memoize(func, resolver) { + var cache = {}; + return function() { + var prop = resolver ? resolver.apply(this, arguments) : arguments[0]; + return hasOwnProperty.call(cache, prop) + ? cache[prop] + : (cache[prop] = func.apply(this, arguments)); + }; + } + + /** + * Creates a new function that is restricted to one execution. Repeat calls to + * the function will return the value of the first call. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // Application is only created once. + */ + function once(func) { + var result, + ran = false; + + return function() { + if (ran) { + return result; + } + ran = true; + result = func.apply(this, arguments); + return result; + }; + } + + /** + * Creates a new function that, when called, invokes `func` with any additional + * `partial` arguments prepended to those passed to the partially applied + * function. This method is similar `bind`, except it does **not** alter the + * `this` binding. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to partially apply arguments to. + * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * var greet = function(greeting, name) { return greeting + ': ' + name; }; + * var hi = _.partial(greet, 'hi'); + * hi('moe'); + * // => 'hi: moe' + */ + function partial(func) { + var args = slice.call(arguments, 1), + argsLength = args.length; + + return function() { + var result, + others = arguments; + + if (others.length) { + args.length = argsLength; + push.apply(args, others); + } + result = args.length == 1 ? func.call(this, args[0]) : func.apply(this, args); + args.length = argsLength; + return result; + }; + } + + /** + * Creates a new function that, when executed, will only call the `func` + * function at most once per every `wait` milliseconds. If the throttled + * function is invoked more than once during the `wait` timeout, `func` will + * also be called on the trailing edge of the timeout. Subsequent calls to the + * throttled function will return the result of the last `func` call. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to throttle. + * @param {Number} wait The number of milliseconds to throttle executions to. + * @returns {Function} Returns the new throttled function. + * @example + * + * var throttled = _.throttle(updatePosition, 100); + * jQuery(window).on('scroll', throttled); + */ + function throttle(func, wait) { + var args, + result, + thisArg, + timeoutId, + lastCalled = 0; + + function trailingCall() { + lastCalled = new Date; + timeoutId = null; + func.apply(thisArg, args); + } + + return function() { + var now = new Date, + remain = wait - (now - lastCalled); + + args = arguments; + thisArg = this; + + if (remain <= 0) { + lastCalled = now; + result = func.apply(thisArg, args); + } + else if (!timeoutId) { + timeoutId = setTimeout(trailingCall, remain); + } + return result; + }; + } + + /** + * Create a new function that passes the `func` function to the `wrapper` + * function as its first argument. Additional arguments are appended to those + * passed to the `wrapper` function. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to wrap. + * @param {Function} wrapper The wrapper function. + * @param {Mixed} [arg1, arg2, ...] Arguments to append to those passed to the wrapper. + * @returns {Function} Returns the new function. + * @example + * + * var hello = function(name) { return 'hello: ' + name; }; + * hello = _.wrap(hello, function(func) { + * return 'before, ' + func('moe') + ', after'; + * }); + * hello(); + * // => 'before, hello: moe, after' + */ + function wrap(func, wrapper) { + return function() { + var args = [func]; + if (arguments.length) { + push.apply(args, arguments); + } + return wrapper.apply(this, args); + }; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a shallow clone of the `value`. Any nested objects or arrays will be + * assigned by reference and not cloned. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to clone. + * @returns {Mixed} Returns the cloned `value`. + * @example + * + * _.clone({ 'name': 'moe' }); + * // => { 'name': 'moe' }; + */ + function clone(value) { + return value && objectTypes[typeof value] + ? (isArray(value) ? value.slice() : extend({}, value)) + : value; + } + + /** + * Assigns missing properties on `object` with default values from the defaults + * objects. Once a property is set, additional defaults of the same property + * will be ignored. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to populate. + * @param {Object} [defaults1, defaults2, ...] The defaults objects to apply to `object`. + * @returns {Object} Returns `object`. + * @example + * + * var iceCream = { 'flavor': 'chocolate' }; + * _.defaults(iceCream, { 'flavor': 'vanilla', 'sprinkles': 'rainbow' }); + * // => { 'flavor': 'chocolate', 'sprinkles': 'rainbow' } + */ + var defaults = createIterator(extendIteratorOptions, { + 'inLoop': 'if (result[index] == null) ' + extendIteratorOptions.inLoop + }); + + /** + * Copies enumerable properties from the source objects to the `destination` object. + * Subsequent sources will overwrite propery assignments of previous sources. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The destination object. + * @param {Object} [source1, source2, ...] The source objects. + * @returns {Object} Returns the destination object. + * @example + * + * _.extend({ 'name': 'moe' }, { 'age': 40 }); + * // => { 'name': 'moe', 'age': 40 } + */ + var extend = createIterator(extendIteratorOptions); + + /** + * Iterates over `object`'s own and inherited enumerable properties, executing + * the `callback` for each property. The `callback` is bound to `thisArg` and + * invoked with 3 arguments; (value, key, object). + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns the `object`. + * @example + * + * function Dog(name) { + * this.name = name; + * } + * + * Dog.prototype.bark = function() { + * alert('Woof, woof!'); + * }; + * + * _.forIn(new Dog('Dagny'), function(value, key) { + * alert(key); + * }); + * // => alerts 'name' and 'bark' (order is not guaranteed) + */ + var forIn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions, { + 'useHas': false + }); + + /** + * Iterates over `object`'s own enumerable properties, executing the `callback` + * for each property. The `callback` is bound to `thisArg` and invoked with 3 + * arguments; (value, key, object). + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns the `object`. + * @example + * + * _.forOwn({ '0': 'zero', '1': 'one', 'length': 2 }, function(num, key) { + * alert(key); + * }); + * // => alerts '0', '1', and 'length' (order is not guaranteed) + */ + var forOwn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions); + + /** + * Produces a sorted array of the enumerable properties, own and inherited, + * of `object` that have function values. + * + * @static + * @memberOf _ + * @alias methods + * @category Objects + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property names that have function values. + * @example + * + * _.functions(_); + * // => ['all', 'any', 'bind', 'bindAll', 'clone', 'compact', 'compose', ...] + */ + var functions = createIterator({ + 'useHas': false, + 'args': 'object', + 'init': '[]', + 'inLoop': 'if (toString.call(iteratee[index]) == funcClass) result.push(index)', + 'bottom': 'result.sort()' + }); + + /** + * Checks if the specified object `property` exists and is a direct property, + * instead of an inherited property. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to check. + * @param {String} property The property to check for. + * @returns {Boolean} Returns `true` if key is a direct property, else `false`. + * @example + * + * _.has({ 'a': 1, 'b': 2, 'c': 3 }, 'b'); + * // => true + */ + function has(object, property) { + return hasOwnProperty.call(object, property); + } + + /** + * Checks if `value` is an `arguments` object. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is an `arguments` object, else `false`. + * @example + * + * (function() { return _.isArguments(arguments); })(1, 2, 3); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + var isArguments = function(value) { + return toString.call(value) == '[object Arguments]'; + }; + // fallback for browser like Firefox < 4 and IE < 9 which detect + // `arguments` as `[object Object]` + if (!isArguments(arguments)) { + isArguments = function(value) { + return !!(value && hasOwnProperty.call(value, 'callee')); + }; + } + + /** + * Checks if `value` is an array. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is an array, else `false`. + * @example + * + * (function() { return _.isArray(arguments); })(); + * // => false + * + * _.isArray([1, 2, 3]); + * // => true + */ + var isArray = nativeIsArray || function(value) { + return toString.call(value) == arrayClass; + }; + + /** + * Checks if `value` is a boolean (`true` or `false`) value. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a boolean value, else `false`. + * @example + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return value === true || value === false || toString.call(value) == boolClass; + } + + /** + * Checks if `value` is a date. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a date, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + */ + function isDate(value) { + return toString.call(value) == dateClass; + } + + /** + * Checks if `value` is a DOM element. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + */ + function isElement(value) { + return !!(value && value.nodeType == 1); + } + + /** + * Checks if `value` is empty. Arrays or strings with a length of `0` and + * objects with no own enumerable properties are considered "empty". + * + * @static + * @memberOf _ + * @category Objects + * @param {Array|Object|String} value The value to inspect. + * @returns {Boolean} Returns `true` if the `value` is empty, else `false`. + * @example + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({}); + * // => true + * + * _.isEmpty(''); + * // => true + */ + var isEmpty = createIterator({ + 'args': 'value', + 'init': 'true', + 'top': + 'var className = toString.call(value);\n' + + 'if (className == arrayClass || className == stringClass) return !value.length', + 'inLoop': { + 'object': 'return false' + } + }); + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent to each other. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} a The value to compare. + * @param {Mixed} b The other value to compare. + * @param {Array} [stack] Internally used to keep track of "seen" objects to + * avoid circular references. + * @returns {Boolean} Returns `true` if the values are equvalent, else `false`. + * @example + * + * var moe = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] }; + * var clone = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] }; + * + * moe == clone; + * // => false + * + * _.isEqual(moe, clone); + * // => true + */ + function isEqual(a, b, stack) { + stack || (stack = []); + + // exit early for identical values + if (a === b) { + // treat `+0` vs. `-0` as not equal + return a !== 0 || (1 / a == 1 / b); + } + // a strict comparison is necessary because `undefined == null` + if (a == null || b == null) { + return a === b; + } + // unwrap any wrapped objects + if (a._chain) { + a = a._wrapped; + } + if (b._chain) { + b = b._wrapped; + } + // invoke a custom `isEqual` method if one is provided + if (a.isEqual && toString.call(a.isEqual) == funcClass) { + return a.isEqual(b); + } + if (b.isEqual && toString.call(b.isEqual) == funcClass) { + return b.isEqual(a); + } + // compare [[Class]] names + var className = toString.call(a); + if (className != toString.call(b)) { + return false; + } + switch (className) { + // strings, numbers, dates, and booleans are compared by value + case stringClass: + // primitives and their corresponding object instances are equivalent; + // thus, `'5'` is quivalent to `new String('5')` + return a == String(b); + + case numberClass: + // treat `NaN` vs. `NaN` as equal + return a != +a + ? b != +b + // but treat `+0` vs. `-0` as not equal + : (a == 0 ? (1 / a == 1 / b) : a == +b); + + case boolClass: + case dateClass: + // coerce dates and booleans to numeric values, dates to milliseconds and + // booleans to 1 or 0; treat invalid dates coerced to `NaN` as not equal + return +a == +b; + + // regexps are compared by their source and flags + case regexpClass: + return a.source == b.source && + a.global == b.global && + a.multiline == b.multiline && + a.ignoreCase == b.ignoreCase; + } + if (typeof a != 'object' || typeof b != 'object') { + return false; + } + // Assume equality for cyclic structures. The algorithm for detecting cyclic + // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`. + var length = stack.length; + while (length--) { + // Linear search. Performance is inversely proportional to the number of + // unique nested structures. + if (stack[length] == a) { + return true; + } + } + + var index = -1, + result = true, + size = 0; + + // add the first collection to the stack of traversed objects + stack.push(a); + + // recursively compare objects and arrays + if (className == arrayClass) { + // compare array lengths to determine if a deep comparison is necessary + size = a.length; + result = size == b.length; + + if (result) { + // deep compare the contents, ignoring non-numeric properties + while (size--) { + if (!(result = isEqual(a[size], b[size], stack))) { + break; + } + } + } + } + else { + // objects with different constructors are not equivalent + if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) { + return false; + } + // deep compare objects. + for (var prop in a) { + if (hasOwnProperty.call(a, prop)) { + // count the number of properties. + size++; + // deep compare each property value. + if (!(result = hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack))) { + break; + } + } + } + // ensure both objects have the same number of properties + if (result) { + for (prop in b) { + // Adobe's JS engine, embedded in applications like InDesign, has a + // bug that causes `!size--` to throw an error so it must be wrapped + // in parentheses. + // https://github.com/documentcloud/underscore/issues/355 + if (hasOwnProperty.call(b, prop) && !(size--)) { + break; + } + } + result = !size; + } + // handle JScript [[DontEnum]] bug + if (result && hasDontEnumBug) { + while (++index < 7) { + prop = shadowed[index]; + if (hasOwnProperty.call(a, prop)) { + if (!(result = hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack))) { + break; + } + } + } + } + } + // remove the first collection from the stack of traversed objects + stack.pop(); + return result; + } + + /** + * Checks if `value` is a finite number. + * Note: This is not the same as native `isFinite`, which will return true for + * booleans and other values. See http://es5.github.com/#x15.1.2.5. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a finite number, else `false`. + * @example + * + * _.isFinite(-101); + * // => true + * + * _.isFinite('10'); + * // => false + * + * _.isFinite(Infinity); + * // => false + */ + function isFinite(value) { + return nativeIsFinite(value) && toString.call(value) == numberClass; + } + + /** + * Checks if `value` is a function. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a function, else `false`. + * @example + * + * _.isFunction(''.concat); + * // => true + */ + function isFunction(value) { + return toString.call(value) == funcClass; + } + + /** + * Checks if `value` is the language type of Object. + * (e.g. arrays, functions, objects, regexps, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject(1); + * // => false + */ + function isObject(value) { + // check if the value is the ECMAScript language type of Object + // http://es5.github.com/#x8 + return value && objectTypes[typeof value]; + } + + /** + * Checks if `value` is `NaN`. + * Note: This is not the same as native `isNaN`, which will return true for + * `undefined` and other values. See http://es5.github.com/#x15.1.2.4. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // `NaN` as a primitive is the only value that is not equal to itself + // (perform the [[Class]] check first to avoid errors with some host objects in IE) + return toString.call(value) == numberClass && value != +value + } + + /** + * Checks if `value` is `null`. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(undefined); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is a number. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a number, else `false`. + * @example + * + * _.isNumber(8.4 * 5; + * // => true + */ + function isNumber(value) { + return toString.call(value) == numberClass; + } + + /** + * Checks if `value` is a regular expression. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a regular expression, else `false`. + * @example + * + * _.isRegExp(/moe/); + * // => true + */ + function isRegExp(value) { + return toString.call(value) == regexpClass; + } + + /** + * Checks if `value` is a string. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a string, else `false`. + * @example + * + * _.isString('moe'); + * // => true + */ + function isString(value) { + return toString.call(value) == stringClass; + } + + /** + * Checks if `value` is `undefined`. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + */ + function isUndefined(value) { + return value === undefined; + } + + /** + * Produces an array of object`'s own enumerable property names. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property names. + * @example + * + * _.keys({ 'one': 1, 'two': 2, 'three': 3 }); + * // => ['one', 'two', 'three'] (order is not guaranteed) + */ + var keys = !nativeKeys ? shimKeys : function(object) { + // avoid iterating over the `prototype` property + return typeof object == 'function' && propertyIsEnumerable.call(object, 'prototype') + ? shimKeys(object) + : nativeKeys(object); + }; + + /** + * Creates an object composed of the specified properties. Property names may + * be specified as individual arguments or as arrays of property names. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to pluck. + * @param {Object} [prop1, prop2, ...] The properties to pick. + * @returns {Object} Returns an object composed of the picked properties. + * @example + * + * _.pick({ 'name': 'moe', 'age': 40, 'userid': 'moe1' }, 'name', 'age'); + * // => { 'name': 'moe', 'age': 40 } + */ + function pick(object) { + var prop, + index = 0, + props = concat.apply(ArrayProto, arguments), + length = props.length, + result = {}; + + // start `index` at `1` to skip `object` + while (++index < length) { + prop = props[index]; + if (prop in object) { + result[prop] = object[prop]; + } + } + return result; + } + + /** + * Gets the size of `value` by returning `value.length` if `value` is a string + * or array, or the number of own enumerable properties if `value` is an object. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Array|Object|String} value The value to inspect. + * @returns {Number} Returns `value.length` if `value` is a string or array, + * or the number of own enumerable properties if `value` is an object. + * @example + * + * _.size([1, 2]); + * // => 2 + * + * _.size({ 'one': 1, 'two': 2, 'three': 3 }); + * // => 3 + * + * _.size('curly'); + * // => 5 + */ + function size(value) { + if (!value) { + return 0; + } + var length = value.length; + return length === length >>> 0 ? value.length : keys(value).length; + } + + /** + * Produces an array of `object`'s own enumerable property values. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property values. + * @example + * + * _.values({ 'one': 1, 'two': 2, 'three': 3 }); + * // => [1, 2, 3] + */ + var values = createIterator({ + 'args': 'object', + 'init': '[]', + 'inLoop': 'result.push(iteratee[index])' + }); + + /*--------------------------------------------------------------------------*/ + + /** + * Escapes a string for inclusion in HTML, replacing `&`, `<`, `"`, and `'` + * characters. + * + * @static + * @memberOf _ + * @category Utilities + * @param {String} string The string to escape. + * @returns {String} Returns the escaped string. + * @example + * + * _.escape('Curly, Larry & Moe'); + * // => "Curly, Larry & Moe" + */ + function escape(string) { + return string == null ? '' : (string + '').replace(reUnescapedHtml, escapeHtmlChar); + } + + /** + * This function returns the first argument passed to it. + * Note: It is used throughout Lo-Dash as a default callback. + * + * @static + * @memberOf _ + * @category Utilities + * @param {Mixed} value Any value. + * @returns {Mixed} Returns `value`. + * @example + * + * var moe = { 'name': 'moe' }; + * moe === _.identity(moe); + * // => true + */ + function identity(value) { + return value; + } + + /** + * Adds functions properties of `object` to the `lodash` function and chainable + * wrapper. + * + * @static + * @memberOf _ + * @category Utilities + * @param {Object} object The object of function properties to add to `lodash`. + * @example + * + * _.mixin({ + * 'capitalize': function(string) { + * return string.charAt(0).toUpperCase() + string.slice(1).toLowerCase(); + * } + * }); + * + * _.capitalize('curly'); + * // => 'Curly' + * + * _('larry').capitalize(); + * // => 'Larry' + */ + function mixin(object) { + forEach(functions(object), function(methodName) { + var func = lodash[methodName] = object[methodName]; + + LoDash.prototype[methodName] = function() { + var args = [this._wrapped]; + if (arguments.length) { + push.apply(args, arguments); + } + var result = func.apply(lodash, args); + if (this._chain) { + result = new LoDash(result); + result._chain = true; + } + return result; + }; + }); + } + + /** + * Reverts the '_' variable to its previous value and returns a reference to + * the `lodash` function. + * + * @static + * @memberOf _ + * @category Utilities + * @returns {Function} Returns the `lodash` function. + * @example + * + * var lodash = _.noConflict(); + */ + function noConflict() { + window._ = oldDash; + return this; + } + + /** + * Resolves the value of `property` on `object`. If `property` is a function + * it will be invoked and its result returned, else the property value is + * returned. If `object` is falsey, then `null` is returned. + * + * @deprecated + * @static + * @memberOf _ + * @category Utilities + * @param {Object} object The object to inspect. + * @param {String} property The property to get the result of. + * @returns {Mixed} Returns the resolved value. + * @example + * + * var object = { + * 'cheese': 'crumpets', + * 'stuff': function() { + * return 'nonsense'; + * } + * }; + * + * _.result(object, 'cheese'); + * // => 'crumpets' + * + * _.result(object, 'stuff'); + * // => 'nonsense' + */ + function result(object, property) { + // based on Backbone's private `getValue` function + // https://github.com/documentcloud/backbone/blob/0.9.2/backbone.js#L1419-1424 + if (!object) { + return null; + } + var value = object[property]; + return toString.call(value) == funcClass ? object[property]() : value; + } + + /** + * A micro-templating method that handles arbitrary delimiters, preserves + * whitespace, and correctly escapes quotes within interpolated code. + * + * @static + * @memberOf _ + * @category Utilities + * @param {String} text The template text. + * @param {Obect} data The data object used to populate the text. + * @param {Object} options The options object. + * @returns {Function|String} Returns a compiled function when no `data` object + * is given, else it returns the interpolated text. + * @example + * + * // using compiled template + * var compiled = _.template('hello: <%= name %>'); + * compiled({ 'name': 'moe' }); + * // => 'hello: moe' + * + * var list = '<% _.forEach(people, function(name) { %>
    • <%= name %>
      • <% }); %>'; + * _.template(list, { 'people': ['moe', 'curly', 'larry'] }); + * // => '
    • moe
    • curly
    • larry
      • ' + * + * var template = _.template('<%- value %>'); + * template({ 'value': ' + */ + function template(text, data, options) { + // based on John Resig's `tmpl` implementation + // http://ejohn.org/blog/javascript-micro-templating/ + // and Laura Doktorova's doT.js + // https://github.com/olado/doT + options || (options = {}); + + var isEvaluating, + result, + escapeDelimiter = options.escape, + evaluateDelimiter = options.evaluate, + interpolateDelimiter = options.interpolate, + settings = lodash.templateSettings, + variable = options.variable; + + // use default settings if no options object is provided + if (escapeDelimiter == null) { + escapeDelimiter = settings.escape; + } + if (evaluateDelimiter == null) { + evaluateDelimiter = settings.evaluate; + } + if (interpolateDelimiter == null) { + interpolateDelimiter = settings.interpolate; + } + + // tokenize delimiters to avoid escaping them + if (escapeDelimiter) { + text = text.replace(escapeDelimiter, tokenizeEscape); + } + if (interpolateDelimiter) { + text = text.replace(interpolateDelimiter, tokenizeInterpolate); + } + if (evaluateDelimiter != lastEvaluateDelimiter) { + // generate `reEvaluateDelimiter` to match `_.templateSettings.evaluate` + // and internal ``, `` delimiters + lastEvaluateDelimiter = evaluateDelimiter; + reEvaluateDelimiter = RegExp( + (evaluateDelimiter ? evaluateDelimiter.source : '($^)') + + '||' + , 'g'); + } + isEvaluating = tokenized.length; + text = text.replace(reEvaluateDelimiter, tokenizeEvaluate); + isEvaluating = isEvaluating != tokenized.length; + + // escape characters that cannot be included in string literals and + // detokenize delimiter code snippets + text = "__p += '" + text + .replace(reUnescapedString, escapeStringChar) + .replace(reToken, detokenize) + "';\n"; + + // clear stored code snippets + tokenized.length = 0; + + // if `options.variable` is not specified and the template contains "evaluate" + // delimiters, wrap a with-statement around the generated code to add the + // data object to the top of the scope chain + if (!variable) { + variable = settings.variable || lastVariable || 'obj'; + + if (isEvaluating) { + text = 'with (' + variable + ') {\n' + text + '\n}\n'; + } + else { + if (variable != lastVariable) { + // generate `reDoubleVariable` to match references like `obj.obj` inside + // transformed "escape" and "interpolate" delimiters + lastVariable = variable; + reDoubleVariable = RegExp('(\\(\\s*)' + variable + '\\.' + variable + '\\b', 'g'); + } + // avoid a with-statement by prepending data object references to property names + text = text + .replace(reInsertVariable, '$&' + variable + '.') + .replace(reDoubleVariable, '$1__d'); + } + } + + // cleanup code by stripping empty strings + text = ( isEvaluating ? text.replace(reEmptyStringLeading, '') : text) + .replace(reEmptyStringMiddle, '$1') + .replace(reEmptyStringTrailing, '$1;'); + + // frame code as the function body + text = 'function(' + variable + ') {\n' + + variable + ' || (' + variable + ' = {});\n' + + 'var __t, __p = \'\', __e = _.escape' + + (isEvaluating + ? ', __j = Array.prototype.join;\n' + + 'function print() { __p += __j.call(arguments, \'\') }\n' + : ', __d = ' + variable + '.' + variable + ' || ' + variable + ';\n' + ) + + text + + 'return __p\n}'; + + // add a sourceURL for easier debugging + // http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl + if (useSourceURL) { + text += '\n//@ sourceURL=/lodash/template/source[' + (templateCounter++) + ']'; + } + + try { + result = Function('_', 'return ' + text)(lodash); + } catch(e) { + result = function() { throw e; }; + } + + if (data) { + return result(data); + } + // provide the compiled function's source via its `toString` method, in + // supported environments, or the `source` property as a convenience for + // build time precompilation + result.source = text; + return result; + } + + /** + * Executes the `callback` function `n` times. The `callback` is bound to + * `thisArg` and invoked with 1 argument; (index). + * + * @static + * @memberOf _ + * @category Utilities + * @param {Number} n The number of times to execute the callback. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @example + * + * _.times(3, function() { genie.grantWish(); }); + * // => calls `genie.grantWish()` 3 times + * + * _.times(3, function() { this.grantWish(); }, genie); + * // => also calls `genie.grantWish()` 3 times + */ + function times(n, callback, thisArg) { + var index = -1; + if (thisArg) { + while (++index < n) { + callback.call(thisArg, index); + } + } else { + while (++index < n) { + callback(index); + } + } + } + + /** + * Generates a unique id. If `prefix` is passed, the id will be appended to it. + * + * @static + * @memberOf _ + * @category Utilities + * @param {String} [prefix] The value to prefix the id with. + * @returns {Number|String} Returns a numeric id if no prefix is passed, else + * a string id may be returned. + * @example + * + * _.uniqueId('contact_'); + * // => 'contact_104' + */ + function uniqueId(prefix) { + var id = idCounter++; + return prefix ? prefix + id : id; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Wraps the value in a `lodash` wrapper object. + * + * @static + * @memberOf _ + * @category Chaining + * @param {Mixed} value The value to wrap. + * @returns {Object} Returns the wrapper object. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * var youngest = _.chain(stooges) + * .sortBy(function(stooge) { return stooge.age; }) + * .map(function(stooge) { return stooge.name + ' is ' + stooge.age; }) + * .first() + * .value(); + * // => 'moe is 40' + */ + function chain(value) { + value = new LoDash(value); + value._chain = true; + return value; + } + + /** + * Invokes `interceptor` with the `value` as the first argument, and then + * returns `value`. The purpose of this method is to "tap into" a method chain, + * in order to perform operations on intermediate results within the chain. + * + * @static + * @memberOf _ + * @category Chaining + * @param {Mixed} value The value to pass to `callback`. + * @param {Function} interceptor The function to invoke. + * @returns {Mixed} Returns `value`. + * @example + * + * _.chain([1,2,3,200]) + * .filter(function(num) { return num % 2 == 0; }) + * .tap(alert) + * .map(function(num) { return num * num }) + * .value(); + * // => // [2, 200] (alerted) + * // => [4, 40000] + */ + function tap(value, interceptor) { + interceptor(value); + return value; + } + + /** + * Enables method chaining on the wrapper object. + * + * @name chain + * @deprecated + * @memberOf _ + * @category Chaining + * @returns {Mixed} Returns the wrapper object. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperChain() { + this._chain = true; + return this; + } + + /** + * Extracts the wrapped value. + * + * @name value + * @memberOf _ + * @category Chaining + * @returns {Mixed} Returns the wrapped value. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperValue() { + return this._wrapped; + } + + /*--------------------------------------------------------------------------*/ + + /** + * The semantic version number. + * + * @static + * @memberOf _ + * @type String + */ + lodash.VERSION = '0.4.2'; + + // assign static methods + lodash.after = after; + lodash.bind = bind; + lodash.bindAll = bindAll; + lodash.chain = chain; + lodash.clone = clone; + lodash.compact = compact; + lodash.compose = compose; + lodash.contains = contains; + lodash.debounce = debounce; + lodash.defaults = defaults; + lodash.defer = defer; + lodash.delay = delay; + lodash.difference = difference; + lodash.escape = escape; + lodash.every = every; + lodash.extend = extend; + lodash.filter = filter; + lodash.find = find; + lodash.first = first; + lodash.flatten = flatten; + lodash.forEach = forEach; + lodash.forIn = forIn; + lodash.forOwn = forOwn; + lodash.functions = functions; + lodash.groupBy = groupBy; + lodash.has = has; + lodash.identity = identity; + lodash.indexOf = indexOf; + lodash.initial = initial; + lodash.intersection = intersection; + lodash.invoke = invoke; + lodash.isArguments = isArguments; + lodash.isArray = isArray; + lodash.isBoolean = isBoolean; + lodash.isDate = isDate; + lodash.isElement = isElement; + lodash.isEmpty = isEmpty; + lodash.isEqual = isEqual; + lodash.isFinite = isFinite; + lodash.isFunction = isFunction; + lodash.isNaN = isNaN; + lodash.isNull = isNull; + lodash.isNumber = isNumber; + lodash.isObject = isObject; + lodash.isRegExp = isRegExp; + lodash.isString = isString; + lodash.isUndefined = isUndefined; + lodash.keys = keys; + lodash.last = last; + lodash.lastIndexOf = lastIndexOf; + lodash.map = map; + lodash.max = max; + lodash.memoize = memoize; + lodash.min = min; + lodash.mixin = mixin; + lodash.noConflict = noConflict; + lodash.once = once; + lodash.partial = partial; + lodash.pick = pick; + lodash.pluck = pluck; + lodash.range = range; + lodash.reduce = reduce; + lodash.reduceRight = reduceRight; + lodash.reject = reject; + lodash.rest = rest; + lodash.result = result; + lodash.shuffle = shuffle; + lodash.size = size; + lodash.some = some; + lodash.sortBy = sortBy; + lodash.sortedIndex = sortedIndex; + lodash.tap = tap; + lodash.template = template; + lodash.throttle = throttle; + lodash.times = times; + lodash.toArray = toArray; + lodash.union = union; + lodash.uniq = uniq; + lodash.uniqueId = uniqueId; + lodash.values = values; + lodash.without = without; + lodash.wrap = wrap; + lodash.zip = zip; + lodash.zipObject = zipObject; + + // assign aliases + lodash.all = every; + lodash.any = some; + lodash.collect = map; + lodash.detect = find; + lodash.each = forEach; + lodash.foldl = reduce; + lodash.foldr = reduceRight; + lodash.head = first; + lodash.include = contains; + lodash.inject = reduce; + lodash.methods = functions; + lodash.select = filter; + lodash.tail = rest; + lodash.take = first; + lodash.unique = uniq; + + // add pseudo private properties used and removed during the build process + lodash._iteratorTemplate = iteratorTemplate; + lodash._shimKeys = shimKeys; + + /*--------------------------------------------------------------------------*/ + + // assign private `LoDash` constructor's prototype + LoDash.prototype = lodash.prototype; + + // add all static functions to `LoDash.prototype` + mixin(lodash); + + // add `LoDash.prototype.chain` after calling `mixin()` to avoid overwriting + // it with the wrapped `lodash.chain` + LoDash.prototype.chain = wrapperChain; + LoDash.prototype.value = wrapperValue; + + // add all mutator Array functions to the wrapper. + forEach(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(methodName) { + var func = ArrayProto[methodName]; + + LoDash.prototype[methodName] = function() { + var value = this._wrapped; + func.apply(value, arguments); + + // Firefox < 10, IE compatibility mode, and IE < 9 have buggy Array + // `shift()` and `splice()` functions that fail to remove the last element, + // `value[0]`, of array-like objects even though the `length` property is + // set to `0`. The `shift()` method is buggy in IE 8 compatibility mode, + // while `splice()` is buggy regardless of mode in IE < 9 and buggy in + // compatibility mode in IE 9. + if (value.length === 0) { + delete value[0]; + } + if (this._chain) { + value = new LoDash(value); + value._chain = true; + } + return value; + }; + }); + + // add all accessor Array functions to the wrapper. + forEach(['concat', 'join', 'slice'], function(methodName) { + var func = ArrayProto[methodName]; + + LoDash.prototype[methodName] = function() { + var value = this._wrapped, + result = func.apply(value, arguments); + + if (this._chain) { + result = new LoDash(result); + result._chain = true; + } + return result; + }; + }); + + /*--------------------------------------------------------------------------*/ + + // expose Lo-Dash + // some AMD build optimizers, like r.js, check for specific condition patterns like the following: + if (typeof define == 'function' && typeof define.amd == 'object' && define.amd) { + // Expose Lo-Dash to the global object even when an AMD loader is present in + // case Lo-Dash was injected by a third-party script and not intended to be + // loaded as a module. The global assignment can be reverted in the Lo-Dash + // module via its `noConflict()` method. + window._ = lodash; + + // define as an anonymous module so, through path mapping, it can be + // referenced as the "underscore" module + define(function() { + return lodash; + }); + } + // check for `exports` after `define` in case a build optimizer adds an `exports` object + else if (freeExports) { + // in Node.js or RingoJS v0.8.0+ + if (typeof module == 'object' && module && module.exports == freeExports) { + (module.exports = lodash)._ = lodash; + } + // in Narwhal or RingoJS v0.7.0- + else { + freeExports._ = lodash; + } + } + else { + // in a browser or Rhino + window._ = lodash; + } +}(this)); \ No newline at end of file diff --git a/module/web/static/js/libs/require-2.0.5.js b/module/web/static/js/libs/require-2.0.5.js new file mode 100644 index 000000000..16bded58a --- /dev/null +++ b/module/web/static/js/libs/require-2.0.5.js @@ -0,0 +1,2053 @@ +/** vim: et:ts=4:sw=4:sts=4 + * @license RequireJS 2.0.5 Copyright (c) 2010-2012, The Dojo Foundation All Rights Reserved. + * Available via the MIT or new BSD license. + * see: http://github.com/jrburke/requirejs for details + */ +//Not using strict: uneven strict support in browsers, #392, and causes +//problems with requirejs.exec()/transpiler plugins that may not be strict. +/*jslint regexp: true, nomen: true, sloppy: true */ +/*global window, navigator, document, importScripts, jQuery, setTimeout, opera */ + +var requirejs, require, define; +(function (global) { + var req, s, head, baseElement, dataMain, src, + interactiveScript, currentlyAddingScript, mainScript, subPath, + version = '2.0.5', + commentRegExp = /(\/\*([\s\S]*?)\*\/|([^:]|^)\/\/(.*)$)/mg, + cjsRequireRegExp = /[^.]\s*require\s*\(\s*["']([^'"\s]+)["']\s*\)/g, + jsSuffixRegExp = /\.js$/, + currDirRegExp = /^\.\//, + op = Object.prototype, + ostring = op.toString, + hasOwn = op.hasOwnProperty, + ap = Array.prototype, + aps = ap.slice, + apsp = ap.splice, + isBrowser = !!(typeof window !== 'undefined' && navigator && document), + isWebWorker = !isBrowser && typeof importScripts !== 'undefined', + //PS3 indicates loaded and complete, but need to wait for complete + //specifically. Sequence is 'loading', 'loaded', execution, + // then 'complete'. The UA check is unfortunate, but not sure how + //to feature test w/o causing perf issues. + readyRegExp = isBrowser && navigator.platform === 'PLAYSTATION 3' ? + /^complete$/ : /^(complete|loaded)$/, + defContextName = '_', + //Oh the tragedy, detecting opera. See the usage of isOpera for reason. + isOpera = typeof opera !== 'undefined' && opera.toString() === '[object Opera]', + contexts = {}, + cfg = {}, + globalDefQueue = [], + useInteractive = false; + + function isFunction(it) { + return ostring.call(it) === '[object Function]'; + } + + function isArray(it) { + return ostring.call(it) === '[object Array]'; + } + + /** + * Helper function for iterating over an array. If the func returns + * a true value, it will break out of the loop. + */ + function each(ary, func) { + if (ary) { + var i; + for (i = 0; i < ary.length; i += 1) { + if (ary[i] && func(ary[i], i, ary)) { + break; + } + } + } + } + + /** + * Helper function for iterating over an array backwards. If the func + * returns a true value, it will break out of the loop. + */ + function eachReverse(ary, func) { + if (ary) { + var i; + for (i = ary.length - 1; i > -1; i -= 1) { + if (ary[i] && func(ary[i], i, ary)) { + break; + } + } + } + } + + function hasProp(obj, prop) { + return hasOwn.call(obj, prop); + } + + /** + * Cycles over properties in an object and calls a function for each + * property value. If the function returns a truthy value, then the + * iteration is stopped. + */ + function eachProp(obj, func) { + var prop; + for (prop in obj) { + if (obj.hasOwnProperty(prop)) { + if (func(obj[prop], prop)) { + break; + } + } + } + } + + /** + * Simple function to mix in properties from source into target, + * but only if target does not already have a property of the same name. + * This is not robust in IE for transferring methods that match + * Object.prototype names, but the uses of mixin here seem unlikely to + * trigger a problem related to that. + */ + function mixin(target, source, force, deepStringMixin) { + if (source) { + eachProp(source, function (value, prop) { + if (force || !hasProp(target, prop)) { + if (deepStringMixin && typeof value !== 'string') { + if (!target[prop]) { + target[prop] = {}; + } + mixin(target[prop], value, force, deepStringMixin); + } else { + target[prop] = value; + } + } + }); + } + return target; + } + + //Similar to Function.prototype.bind, but the 'this' object is specified + //first, since it is easier to read/figure out what 'this' will be. + function bind(obj, fn) { + return function () { + return fn.apply(obj, arguments); + }; + } + + function scripts() { + return document.getElementsByTagName('script'); + } + + //Allow getting a global that expressed in + //dot notation, like 'a.b.c'. + function getGlobal(value) { + if (!value) { + return value; + } + var g = global; + each(value.split('.'), function (part) { + g = g[part]; + }); + return g; + } + + function makeContextModuleFunc(func, relMap, enableBuildCallback) { + return function () { + //A version of a require function that passes a moduleName + //value for items that may need to + //look up paths relative to the moduleName + var args = aps.call(arguments, 0), lastArg; + if (enableBuildCallback && + isFunction((lastArg = args[args.length - 1]))) { + lastArg.__requireJsBuild = true; + } + args.push(relMap); + return func.apply(null, args); + }; + } + + function addRequireMethods(req, context, relMap) { + each([ + ['toUrl'], + ['undef'], + ['defined', 'requireDefined'], + ['specified', 'requireSpecified'] + ], function (item) { + var prop = item[1] || item[0]; + req[item[0]] = context ? makeContextModuleFunc(context[prop], relMap) : + //If no context, then use default context. Reference from + //contexts instead of early binding to default context, so + //that during builds, the latest instance of the default + //context with its config gets used. + function () { + var ctx = contexts[defContextName]; + return ctx[prop].apply(ctx, arguments); + }; + }); + } + + /** + * Constructs an error with a pointer to an URL with more information. + * @param {String} id the error ID that maps to an ID on a web page. + * @param {String} message human readable error. + * @param {Error} [err] the original error, if there is one. + * + * @returns {Error} + */ + function makeError(id, msg, err, requireModules) { + var e = new Error(msg + '\nhttp://requirejs.org/docs/errors.html#' + id); + e.requireType = id; + e.requireModules = requireModules; + if (err) { + e.originalError = err; + } + return e; + } + + if (typeof define !== 'undefined') { + //If a define is already in play via another AMD loader, + //do not overwrite. + return; + } + + if (typeof requirejs !== 'undefined') { + if (isFunction(requirejs)) { + //Do not overwrite and existing requirejs instance. + return; + } + cfg = requirejs; + requirejs = undefined; + } + + //Allow for a require config object + if (typeof require !== 'undefined' && !isFunction(require)) { + //assume it is a config object. + cfg = require; + require = undefined; + } + + function newContext(contextName) { + var inCheckLoaded, Module, context, handlers, + checkLoadedTimeoutId, + config = { + waitSeconds: 7, + baseUrl: './', + paths: {}, + pkgs: {}, + shim: {} + }, + registry = {}, + undefEvents = {}, + defQueue = [], + defined = {}, + urlFetched = {}, + requireCounter = 1, + unnormalizedCounter = 1, + //Used to track the order in which modules + //should be executed, by the order they + //load. Important for consistent cycle resolution + //behavior. + waitAry = []; + + /** + * Trims the . and .. from an array of path segments. + * It will keep a leading path segment if a .. will become + * the first path segment, to help with module name lookups, + * which act like paths, but can be remapped. But the end result, + * all paths that use this function should look normalized. + * NOTE: this method MODIFIES the input array. + * @param {Array} ary the array of path segments. + */ + function trimDots(ary) { + var i, part; + for (i = 0; ary[i]; i += 1) { + part = ary[i]; + if (part === '.') { + ary.splice(i, 1); + i -= 1; + } else if (part === '..') { + if (i === 1 && (ary[2] === '..' || ary[0] === '..')) { + //End of the line. Keep at least one non-dot + //path segment at the front so it can be mapped + //correctly to disk. Otherwise, there is likely + //no path mapping for a path starting with '..'. + //This can still fail, but catches the most reasonable + //uses of .. + break; + } else if (i > 0) { + ary.splice(i - 1, 2); + i -= 2; + } + } + } + } + + /** + * Given a relative module name, like ./something, normalize it to + * a real name that can be mapped to a path. + * @param {String} name the relative name + * @param {String} baseName a real name that the name arg is relative + * to. + * @param {Boolean} applyMap apply the map config to the value. Should + * only be done if this normalization is for a dependency ID. + * @returns {String} normalized name + */ + function normalize(name, baseName, applyMap) { + var pkgName, pkgConfig, mapValue, nameParts, i, j, nameSegment, + foundMap, foundI, foundStarMap, starI, + baseParts = baseName && baseName.split('/'), + normalizedBaseParts = baseParts, + map = config.map, + starMap = map && map['*']; + + //Adjust any relative paths. + if (name && name.charAt(0) === '.') { + //If have a base name, try to normalize against it, + //otherwise, assume it is a top-level require that will + //be relative to baseUrl in the end. + if (baseName) { + if (config.pkgs[baseName]) { + //If the baseName is a package name, then just treat it as one + //name to concat the name with. + normalizedBaseParts = baseParts = [baseName]; + } else { + //Convert baseName to array, and lop off the last part, + //so that . matches that 'directory' and not name of the baseName's + //module. For instance, baseName of 'one/two/three', maps to + //'one/two/three.js', but we want the directory, 'one/two' for + //this normalization. + normalizedBaseParts = baseParts.slice(0, baseParts.length - 1); + } + + name = normalizedBaseParts.concat(name.split('/')); + trimDots(name); + + //Some use of packages may use a . path to reference the + //'main' module name, so normalize for that. + pkgConfig = config.pkgs[(pkgName = name[0])]; + name = name.join('/'); + if (pkgConfig && name === pkgName + '/' + pkgConfig.main) { + name = pkgName; + } + } else if (name.indexOf('./') === 0) { + // No baseName, so this is ID is resolved relative + // to baseUrl, pull off the leading dot. + name = name.substring(2); + } + } + + //Apply map config if available. + if (applyMap && (baseParts || starMap) && map) { + nameParts = name.split('/'); + + for (i = nameParts.length; i > 0; i -= 1) { + nameSegment = nameParts.slice(0, i).join('/'); + + if (baseParts) { + //Find the longest baseName segment match in the config. + //So, do joins on the biggest to smallest lengths of baseParts. + for (j = baseParts.length; j > 0; j -= 1) { + mapValue = map[baseParts.slice(0, j).join('/')]; + + //baseName segment has config, find if it has one for + //this name. + if (mapValue) { + mapValue = mapValue[nameSegment]; + if (mapValue) { + //Match, update name to the new value. + foundMap = mapValue; + foundI = i; + break; + } + } + } + } + + if (foundMap) { + break; + } + + //Check for a star map match, but just hold on to it, + //if there is a shorter segment match later in a matching + //config, then favor over this star map. + if (!foundStarMap && starMap && starMap[nameSegment]) { + foundStarMap = starMap[nameSegment]; + starI = i; + } + } + + if (!foundMap && foundStarMap) { + foundMap = foundStarMap; + foundI = starI; + } + + if (foundMap) { + nameParts.splice(0, foundI, foundMap); + name = nameParts.join('/'); + } + } + + return name; + } + + function removeScript(name) { + if (isBrowser) { + each(scripts(), function (scriptNode) { + if (scriptNode.getAttribute('data-requiremodule') === name && + scriptNode.getAttribute('data-requirecontext') === context.contextName) { + scriptNode.parentNode.removeChild(scriptNode); + return true; + } + }); + } + } + + function hasPathFallback(id) { + var pathConfig = config.paths[id]; + if (pathConfig && isArray(pathConfig) && pathConfig.length > 1) { + removeScript(id); + //Pop off the first array value, since it failed, and + //retry + pathConfig.shift(); + context.undef(id); + context.require([id]); + return true; + } + } + + /** + * Creates a module mapping that includes plugin prefix, module + * name, and path. If parentModuleMap is provided it will + * also normalize the name via require.normalize() + * + * @param {String} name the module name + * @param {String} [parentModuleMap] parent module map + * for the module name, used to resolve relative names. + * @param {Boolean} isNormalized: is the ID already normalized. + * This is true if this call is done for a define() module ID. + * @param {Boolean} applyMap: apply the map config to the ID. + * Should only be true if this map is for a dependency. + * + * @returns {Object} + */ + function makeModuleMap(name, parentModuleMap, isNormalized, applyMap) { + var url, pluginModule, suffix, + index = name ? name.indexOf('!') : -1, + prefix = null, + parentName = parentModuleMap ? parentModuleMap.name : null, + originalName = name, + isDefine = true, + normalizedName = ''; + + //If no name, then it means it is a require call, generate an + //internal name. + if (!name) { + isDefine = false; + name = '_@r' + (requireCounter += 1); + } + + if (index !== -1) { + prefix = name.substring(0, index); + name = name.substring(index + 1, name.length); + } + + if (prefix) { + prefix = normalize(prefix, parentName, applyMap); + pluginModule = defined[prefix]; + } + + //Account for relative paths if there is a base name. + if (name) { + if (prefix) { + if (pluginModule && pluginModule.normalize) { + //Plugin is loaded, use its normalize method. + normalizedName = pluginModule.normalize(name, function (name) { + return normalize(name, parentName, applyMap); + }); + } else { + normalizedName = normalize(name, parentName, applyMap); + } + } else { + //A regular module. + normalizedName = normalize(name, parentName, applyMap); + url = context.nameToUrl(normalizedName); + } + } + + //If the id is a plugin id that cannot be determined if it needs + //normalization, stamp it with a unique ID so two matching relative + //ids that may conflict can be separate. + suffix = prefix && !pluginModule && !isNormalized ? + '_unnormalized' + (unnormalizedCounter += 1) : + ''; + + return { + prefix: prefix, + name: normalizedName, + parentMap: parentModuleMap, + unnormalized: !!suffix, + url: url, + originalName: originalName, + isDefine: isDefine, + id: (prefix ? + prefix + '!' + normalizedName : + normalizedName) + suffix + }; + } + + function getModule(depMap) { + var id = depMap.id, + mod = registry[id]; + + if (!mod) { + mod = registry[id] = new context.Module(depMap); + } + + return mod; + } + + function on(depMap, name, fn) { + var id = depMap.id, + mod = registry[id]; + + if (hasProp(defined, id) && + (!mod || mod.defineEmitComplete)) { + if (name === 'defined') { + fn(defined[id]); + } + } else { + getModule(depMap).on(name, fn); + } + } + + function onError(err, errback) { + var ids = err.requireModules, + notified = false; + + if (errback) { + errback(err); + } else { + each(ids, function (id) { + var mod = registry[id]; + if (mod) { + //Set error on module, so it skips timeout checks. + mod.error = err; + if (mod.events.error) { + notified = true; + mod.emit('error', err); + } + } + }); + + if (!notified) { + req.onError(err); + } + } + } + + /** + * Internal method to transfer globalQueue items to this context's + * defQueue. + */ + function takeGlobalQueue() { + //Push all the globalDefQueue items into the context's defQueue + if (globalDefQueue.length) { + //Array splice in the values since the context code has a + //local var ref to defQueue, so cannot just reassign the one + //on context. + apsp.apply(defQueue, + [defQueue.length - 1, 0].concat(globalDefQueue)); + globalDefQueue = []; + } + } + + /** + * Helper function that creates a require function object to give to + * modules that ask for it as a dependency. It needs to be specific + * per module because of the implication of path mappings that may + * need to be relative to the module name. + */ + function makeRequire(mod, enableBuildCallback, altRequire) { + var relMap = mod && mod.map, + modRequire = makeContextModuleFunc(altRequire || context.require, + relMap, + enableBuildCallback); + + addRequireMethods(modRequire, context, relMap); + modRequire.isBrowser = isBrowser; + + return modRequire; + } + + handlers = { + 'require': function (mod) { + return makeRequire(mod); + }, + 'exports': function (mod) { + mod.usingExports = true; + if (mod.map.isDefine) { + return (mod.exports = defined[mod.map.id] = {}); + } + }, + 'module': function (mod) { + return (mod.module = { + id: mod.map.id, + uri: mod.map.url, + config: function () { + return (config.config && config.config[mod.map.id]) || {}; + }, + exports: defined[mod.map.id] + }); + } + }; + + function removeWaiting(id) { + //Clean up machinery used for waiting modules. + delete registry[id]; + + each(waitAry, function (mod, i) { + if (mod.map.id === id) { + waitAry.splice(i, 1); + if (!mod.defined) { + context.waitCount -= 1; + } + return true; + } + }); + } + + function findCycle(mod, traced) { + var id = mod.map.id, + depArray = mod.depMaps, + foundModule; + + //Do not bother with unitialized modules or not yet enabled + //modules. + if (!mod.inited) { + return; + } + + //Found the cycle. + if (traced[id]) { + return mod; + } + + traced[id] = true; + + //Trace through the dependencies. + each(depArray, function (depMap) { + var depId = depMap.id, + depMod = registry[depId]; + + if (!depMod) { + return; + } + + if (!depMod.inited || !depMod.enabled) { + //Dependency is not inited, so this cannot + //be used to determine a cycle. + foundModule = null; + delete traced[id]; + return true; + } + + //mixin traced to a new object for each dependency, so that + //sibling dependencies in this object to not generate a + //false positive match on a cycle. Ideally an Object.create + //type of prototype delegation would be used here, but + //optimizing for file size vs. execution speed since hopefully + //the trees are small for circular dependency scans relative + //to the full app perf. + return (foundModule = findCycle(depMod, mixin({}, traced))); + }); + + return foundModule; + } + + function forceExec(mod, traced, uninited) { + var id = mod.map.id, + depArray = mod.depMaps; + + if (!mod.inited || !mod.map.isDefine) { + return; + } + + if (traced[id]) { + return defined[id]; + } + + traced[id] = mod; + + each(depArray, function (depMap) { + var depId = depMap.id, + depMod = registry[depId], + value; + + if (handlers[depId]) { + return; + } + + if (depMod) { + if (!depMod.inited || !depMod.enabled) { + //Dependency is not inited, + //so this module cannot be + //given a forced value yet. + uninited[id] = true; + return; + } + + //Get the value for the current dependency + value = forceExec(depMod, traced, uninited); + + //Even with forcing it may not be done, + //in particular if the module is waiting + //on a plugin resource. + if (!uninited[depId]) { + mod.defineDepById(depId, value); + } + } + }); + + mod.check(true); + + return defined[id]; + } + + function modCheck(mod) { + mod.check(); + } + + function checkLoaded() { + var map, modId, err, usingPathFallback, + waitInterval = config.waitSeconds * 1000, + //It is possible to disable the wait interval by using waitSeconds of 0. + expired = waitInterval && (context.startTime + waitInterval) < new Date().getTime(), + noLoads = [], + stillLoading = false, + needCycleCheck = true; + + //Do not bother if this call was a result of a cycle break. + if (inCheckLoaded) { + return; + } + + inCheckLoaded = true; + + //Figure out the state of all the modules. + eachProp(registry, function (mod) { + map = mod.map; + modId = map.id; + + //Skip things that are not enabled or in error state. + if (!mod.enabled) { + return; + } + + if (!mod.error) { + //If the module should be executed, and it has not + //been inited and time is up, remember it. + if (!mod.inited && expired) { + if (hasPathFallback(modId)) { + usingPathFallback = true; + stillLoading = true; + } else { + noLoads.push(modId); + removeScript(modId); + } + } else if (!mod.inited && mod.fetched && map.isDefine) { + stillLoading = true; + if (!map.prefix) { + //No reason to keep looking for unfinished + //loading. If the only stillLoading is a + //plugin resource though, keep going, + //because it may be that a plugin resource + //is waiting on a non-plugin cycle. + return (needCycleCheck = false); + } + } + } + }); + + if (expired && noLoads.length) { + //If wait time expired, throw error of unloaded modules. + err = makeError('timeout', 'Load timeout for modules: ' + noLoads, null, noLoads); + err.contextName = context.contextName; + return onError(err); + } + + //Not expired, check for a cycle. + if (needCycleCheck) { + + each(waitAry, function (mod) { + if (mod.defined) { + return; + } + + var cycleMod = findCycle(mod, {}), + traced = {}; + + if (cycleMod) { + forceExec(cycleMod, traced, {}); + + //traced modules may have been + //removed from the registry, but + //their listeners still need to + //be called. + eachProp(traced, modCheck); + } + }); + + //Now that dependencies have + //been satisfied, trigger the + //completion check that then + //notifies listeners. + eachProp(registry, modCheck); + } + + //If still waiting on loads, and the waiting load is something + //other than a plugin resource, or there are still outstanding + //scripts, then just try back later. + if ((!expired || usingPathFallback) && stillLoading) { + //Something is still waiting to load. Wait for it, but only + //if a timeout is not already in effect. + if ((isBrowser || isWebWorker) && !checkLoadedTimeoutId) { + checkLoadedTimeoutId = setTimeout(function () { + checkLoadedTimeoutId = 0; + checkLoaded(); + }, 50); + } + } + + inCheckLoaded = false; + } + + Module = function (map) { + this.events = undefEvents[map.id] || {}; + this.map = map; + this.shim = config.shim[map.id]; + this.depExports = []; + this.depMaps = []; + this.depMatched = []; + this.pluginMaps = {}; + this.depCount = 0; + + /* this.exports this.factory + this.depMaps = [], + this.enabled, this.fetched + */ + }; + + Module.prototype = { + init: function (depMaps, factory, errback, options) { + options = options || {}; + + //Do not do more inits if already done. Can happen if there + //are multiple define calls for the same module. That is not + //a normal, common case, but it is also not unexpected. + if (this.inited) { + return; + } + + this.factory = factory; + + if (errback) { + //Register for errors on this module. + this.on('error', errback); + } else if (this.events.error) { + //If no errback already, but there are error listeners + //on this module, set up an errback to pass to the deps. + errback = bind(this, function (err) { + this.emit('error', err); + }); + } + + //Do a copy of the dependency array, so that + //source inputs are not modified. For example + //"shim" deps are passed in here directly, and + //doing a direct modification of the depMaps array + //would affect that config. + this.depMaps = depMaps && depMaps.slice(0); + this.depMaps.rjsSkipMap = depMaps.rjsSkipMap; + + this.errback = errback; + + //Indicate this module has be initialized + this.inited = true; + + this.ignore = options.ignore; + + //Could have option to init this module in enabled mode, + //or could have been previously marked as enabled. However, + //the dependencies are not known until init is called. So + //if enabled previously, now trigger dependencies as enabled. + if (options.enabled || this.enabled) { + //Enable this module and dependencies. + //Will call this.check() + this.enable(); + } else { + this.check(); + } + }, + + defineDepById: function (id, depExports) { + var i; + + //Find the index for this dependency. + each(this.depMaps, function (map, index) { + if (map.id === id) { + i = index; + return true; + } + }); + + return this.defineDep(i, depExports); + }, + + defineDep: function (i, depExports) { + //Because of cycles, defined callback for a given + //export can be called more than once. + if (!this.depMatched[i]) { + this.depMatched[i] = true; + this.depCount -= 1; + this.depExports[i] = depExports; + } + }, + + fetch: function () { + if (this.fetched) { + return; + } + this.fetched = true; + + context.startTime = (new Date()).getTime(); + + var map = this.map; + + //If the manager is for a plugin managed resource, + //ask the plugin to load it now. + if (this.shim) { + makeRequire(this, true)(this.shim.deps || [], bind(this, function () { + return map.prefix ? this.callPlugin() : this.load(); + })); + } else { + //Regular dependency. + return map.prefix ? this.callPlugin() : this.load(); + } + }, + + load: function () { + var url = this.map.url; + + //Regular dependency. + if (!urlFetched[url]) { + urlFetched[url] = true; + context.load(this.map.id, url); + } + }, + + /** + * Checks is the module is ready to define itself, and if so, + * define it. If the silent argument is true, then it will just + * define, but not notify listeners, and not ask for a context-wide + * check of all loaded modules. That is useful for cycle breaking. + */ + check: function (silent) { + if (!this.enabled || this.enabling) { + return; + } + + var err, cjsModule, + id = this.map.id, + depExports = this.depExports, + exports = this.exports, + factory = this.factory; + + if (!this.inited) { + this.fetch(); + } else if (this.error) { + this.emit('error', this.error); + } else if (!this.defining) { + //The factory could trigger another require call + //that would result in checking this module to + //define itself again. If already in the process + //of doing that, skip this work. + this.defining = true; + + if (this.depCount < 1 && !this.defined) { + if (isFunction(factory)) { + //If there is an error listener, favor passing + //to that instead of throwing an error. + if (this.events.error) { + try { + exports = context.execCb(id, factory, depExports, exports); + } catch (e) { + err = e; + } + } else { + exports = context.execCb(id, factory, depExports, exports); + } + + if (this.map.isDefine) { + //If setting exports via 'module' is in play, + //favor that over return value and exports. After that, + //favor a non-undefined return value over exports use. + cjsModule = this.module; + if (cjsModule && + cjsModule.exports !== undefined && + //Make sure it is not already the exports value + cjsModule.exports !== this.exports) { + exports = cjsModule.exports; + } else if (exports === undefined && this.usingExports) { + //exports already set the defined value. + exports = this.exports; + } + } + + if (err) { + err.requireMap = this.map; + err.requireModules = [this.map.id]; + err.requireType = 'define'; + return onError((this.error = err)); + } + + } else { + //Just a literal value + exports = factory; + } + + this.exports = exports; + + if (this.map.isDefine && !this.ignore) { + defined[id] = exports; + + if (req.onResourceLoad) { + req.onResourceLoad(context, this.map, this.depMaps); + } + } + + //Clean up + delete registry[id]; + + this.defined = true; + context.waitCount -= 1; + if (context.waitCount === 0) { + //Clear the wait array used for cycles. + waitAry = []; + } + } + + //Finished the define stage. Allow calling check again + //to allow define notifications below in the case of a + //cycle. + this.defining = false; + + if (!silent) { + if (this.defined && !this.defineEmitted) { + this.defineEmitted = true; + this.emit('defined', this.exports); + this.defineEmitComplete = true; + } + } + } + }, + + callPlugin: function () { + var map = this.map, + id = map.id, + pluginMap = makeModuleMap(map.prefix, null, false, true); + + on(pluginMap, 'defined', bind(this, function (plugin) { + var load, normalizedMap, normalizedMod, + name = this.map.name, + parentName = this.map.parentMap ? this.map.parentMap.name : null; + + //If current map is not normalized, wait for that + //normalized name to load instead of continuing. + if (this.map.unnormalized) { + //Normalize the ID if the plugin allows it. + if (plugin.normalize) { + name = plugin.normalize(name, function (name) { + return normalize(name, parentName, true); + }) || ''; + } + + normalizedMap = makeModuleMap(map.prefix + '!' + name, + this.map.parentMap, + false, + true); + on(normalizedMap, + 'defined', bind(this, function (value) { + this.init([], function () { return value; }, null, { + enabled: true, + ignore: true + }); + })); + normalizedMod = registry[normalizedMap.id]; + if (normalizedMod) { + if (this.events.error) { + normalizedMod.on('error', bind(this, function (err) { + this.emit('error', err); + })); + } + normalizedMod.enable(); + } + + return; + } + + load = bind(this, function (value) { + this.init([], function () { return value; }, null, { + enabled: true + }); + }); + + load.error = bind(this, function (err) { + this.inited = true; + this.error = err; + err.requireModules = [id]; + + //Remove temp unnormalized modules for this module, + //since they will never be resolved otherwise now. + eachProp(registry, function (mod) { + if (mod.map.id.indexOf(id + '_unnormalized') === 0) { + removeWaiting(mod.map.id); + } + }); + + onError(err); + }); + + //Allow plugins to load other code without having to know the + //context or how to 'complete' the load. + load.fromText = function (moduleName, text) { + /*jslint evil: true */ + var hasInteractive = useInteractive; + + //Turn off interactive script matching for IE for any define + //calls in the text, then turn it back on at the end. + if (hasInteractive) { + useInteractive = false; + } + + //Prime the system by creating a module instance for + //it. + getModule(makeModuleMap(moduleName)); + + req.exec(text); + + if (hasInteractive) { + useInteractive = true; + } + + //Support anonymous modules. + context.completeLoad(moduleName); + }; + + //Use parentName here since the plugin's name is not reliable, + //could be some weird string with no path that actually wants to + //reference the parentName's path. + plugin.load(map.name, makeRequire(map.parentMap, true, function (deps, cb, er) { + deps.rjsSkipMap = true; + return context.require(deps, cb, er); + }), load, config); + })); + + context.enable(pluginMap, this); + this.pluginMaps[pluginMap.id] = pluginMap; + }, + + enable: function () { + this.enabled = true; + + if (!this.waitPushed) { + waitAry.push(this); + context.waitCount += 1; + this.waitPushed = true; + } + + //Set flag mentioning that the module is enabling, + //so that immediate calls to the defined callbacks + //for dependencies do not trigger inadvertent load + //with the depCount still being zero. + this.enabling = true; + + //Enable each dependency + each(this.depMaps, bind(this, function (depMap, i) { + var id, mod, handler; + + if (typeof depMap === 'string') { + //Dependency needs to be converted to a depMap + //and wired up to this module. + depMap = makeModuleMap(depMap, + (this.map.isDefine ? this.map : this.map.parentMap), + false, + !this.depMaps.rjsSkipMap); + this.depMaps[i] = depMap; + + handler = handlers[depMap.id]; + + if (handler) { + this.depExports[i] = handler(this); + return; + } + + this.depCount += 1; + + on(depMap, 'defined', bind(this, function (depExports) { + this.defineDep(i, depExports); + this.check(); + })); + + if (this.errback) { + on(depMap, 'error', this.errback); + } + } + + id = depMap.id; + mod = registry[id]; + + //Skip special modules like 'require', 'exports', 'module' + //Also, don't call enable if it is already enabled, + //important in circular dependency cases. + if (!handlers[id] && mod && !mod.enabled) { + context.enable(depMap, this); + } + })); + + //Enable each plugin that is used in + //a dependency + eachProp(this.pluginMaps, bind(this, function (pluginMap) { + var mod = registry[pluginMap.id]; + if (mod && !mod.enabled) { + context.enable(pluginMap, this); + } + })); + + this.enabling = false; + + this.check(); + }, + + on: function (name, cb) { + var cbs = this.events[name]; + if (!cbs) { + cbs = this.events[name] = []; + } + cbs.push(cb); + }, + + emit: function (name, evt) { + each(this.events[name], function (cb) { + cb(evt); + }); + if (name === 'error') { + //Now that the error handler was triggered, remove + //the listeners, since this broken Module instance + //can stay around for a while in the registry/waitAry. + delete this.events[name]; + } + } + }; + + function callGetModule(args) { + getModule(makeModuleMap(args[0], null, true)).init(args[1], args[2]); + } + + function removeListener(node, func, name, ieName) { + //Favor detachEvent because of IE9 + //issue, see attachEvent/addEventListener comment elsewhere + //in this file. + if (node.detachEvent && !isOpera) { + //Probably IE. If not it will throw an error, which will be + //useful to know. + if (ieName) { + node.detachEvent(ieName, func); + } + } else { + node.removeEventListener(name, func, false); + } + } + + /** + * Given an event from a script node, get the requirejs info from it, + * and then removes the event listeners on the node. + * @param {Event} evt + * @returns {Object} + */ + function getScriptData(evt) { + //Using currentTarget instead of target for Firefox 2.0's sake. Not + //all old browsers will be supported, but this one was easy enough + //to support and still makes sense. + var node = evt.currentTarget || evt.srcElement; + + //Remove the listeners once here. + removeListener(node, context.onScriptLoad, 'load', 'onreadystatechange'); + removeListener(node, context.onScriptError, 'error'); + + return { + node: node, + id: node && node.getAttribute('data-requiremodule') + }; + } + + return (context = { + config: config, + contextName: contextName, + registry: registry, + defined: defined, + urlFetched: urlFetched, + waitCount: 0, + defQueue: defQueue, + Module: Module, + makeModuleMap: makeModuleMap, + + /** + * Set a configuration for the context. + * @param {Object} cfg config object to integrate. + */ + configure: function (cfg) { + //Make sure the baseUrl ends in a slash. + if (cfg.baseUrl) { + if (cfg.baseUrl.charAt(cfg.baseUrl.length - 1) !== '/') { + cfg.baseUrl += '/'; + } + } + + //Save off the paths and packages since they require special processing, + //they are additive. + var pkgs = config.pkgs, + shim = config.shim, + paths = config.paths, + map = config.map; + + //Mix in the config values, favoring the new values over + //existing ones in context.config. + mixin(config, cfg, true); + + //Merge paths. + config.paths = mixin(paths, cfg.paths, true); + + //Merge map + if (cfg.map) { + config.map = mixin(map || {}, cfg.map, true, true); + } + + //Merge shim + if (cfg.shim) { + eachProp(cfg.shim, function (value, id) { + //Normalize the structure + if (isArray(value)) { + value = { + deps: value + }; + } + if (value.exports && !value.exports.__buildReady) { + value.exports = context.makeShimExports(value.exports); + } + shim[id] = value; + }); + config.shim = shim; + } + + //Adjust packages if necessary. + if (cfg.packages) { + each(cfg.packages, function (pkgObj) { + var location; + + pkgObj = typeof pkgObj === 'string' ? { name: pkgObj } : pkgObj; + location = pkgObj.location; + + //Create a brand new object on pkgs, since currentPackages can + //be passed in again, and config.pkgs is the internal transformed + //state for all package configs. + pkgs[pkgObj.name] = { + name: pkgObj.name, + location: location || pkgObj.name, + //Remove leading dot in main, so main paths are normalized, + //and remove any trailing .js, since different package + //envs have different conventions: some use a module name, + //some use a file name. + main: (pkgObj.main || 'main') + .replace(currDirRegExp, '') + .replace(jsSuffixRegExp, '') + }; + }); + + //Done with modifications, assing packages back to context config + config.pkgs = pkgs; + } + + //If there are any "waiting to execute" modules in the registry, + //update the maps for them, since their info, like URLs to load, + //may have changed. + eachProp(registry, function (mod, id) { + //If module already has init called, since it is too + //late to modify them, and ignore unnormalized ones + //since they are transient. + if (!mod.inited && !mod.map.unnormalized) { + mod.map = makeModuleMap(id); + } + }); + + //If a deps array or a config callback is specified, then call + //require with those args. This is useful when require is defined as a + //config object before require.js is loaded. + if (cfg.deps || cfg.callback) { + context.require(cfg.deps || [], cfg.callback); + } + }, + + makeShimExports: function (exports) { + var func; + if (typeof exports === 'string') { + func = function () { + return getGlobal(exports); + }; + //Save the exports for use in nodefine checking. + func.exports = exports; + return func; + } else { + return function () { + return exports.apply(global, arguments); + }; + } + }, + + requireDefined: function (id, relMap) { + return hasProp(defined, makeModuleMap(id, relMap, false, true).id); + }, + + requireSpecified: function (id, relMap) { + id = makeModuleMap(id, relMap, false, true).id; + return hasProp(defined, id) || hasProp(registry, id); + }, + + require: function (deps, callback, errback, relMap) { + var moduleName, id, map, requireMod, args; + if (typeof deps === 'string') { + if (isFunction(callback)) { + //Invalid call + return onError(makeError('requireargs', 'Invalid require call'), errback); + } + + //Synchronous access to one module. If require.get is + //available (as in the Node adapter), prefer that. + //In this case deps is the moduleName and callback is + //the relMap + if (req.get) { + return req.get(context, deps, callback); + } + + //Just return the module wanted. In this scenario, the + //second arg (if passed) is just the relMap. + moduleName = deps; + relMap = callback; + + //Normalize module name, if it contains . or .. + map = makeModuleMap(moduleName, relMap, false, true); + id = map.id; + + if (!hasProp(defined, id)) { + return onError(makeError('notloaded', 'Module name "' + + id + + '" has not been loaded yet for context: ' + + contextName)); + } + return defined[id]; + } + + //Callback require. Normalize args. if callback or errback is + //not a function, it means it is a relMap. Test errback first. + if (errback && !isFunction(errback)) { + relMap = errback; + errback = undefined; + } + if (callback && !isFunction(callback)) { + relMap = callback; + callback = undefined; + } + + //Any defined modules in the global queue, intake them now. + takeGlobalQueue(); + + //Make sure any remaining defQueue items get properly processed. + while (defQueue.length) { + args = defQueue.shift(); + if (args[0] === null) { + return onError(makeError('mismatch', 'Mismatched anonymous define() module: ' + args[args.length - 1])); + } else { + //args are id, deps, factory. Should be normalized by the + //define() function. + callGetModule(args); + } + } + + //Mark all the dependencies as needing to be loaded. + requireMod = getModule(makeModuleMap(null, relMap)); + + requireMod.init(deps, callback, errback, { + enabled: true + }); + + checkLoaded(); + + return context.require; + }, + + undef: function (id) { + //Bind any waiting define() calls to this context, + //fix for #408 + takeGlobalQueue(); + + var map = makeModuleMap(id, null, true), + mod = registry[id]; + + delete defined[id]; + delete urlFetched[map.url]; + delete undefEvents[id]; + + if (mod) { + //Hold on to listeners in case the + //module will be attempted to be reloaded + //using a different config. + if (mod.events.defined) { + undefEvents[id] = mod.events; + } + + removeWaiting(id); + } + }, + + /** + * Called to enable a module if it is still in the registry + * awaiting enablement. parent module is passed in for context, + * used by the optimizer. + */ + enable: function (depMap, parent) { + var mod = registry[depMap.id]; + if (mod) { + getModule(depMap).enable(); + } + }, + + /** + * Internal method used by environment adapters to complete a load event. + * A load event could be a script load or just a load pass from a synchronous + * load call. + * @param {String} moduleName the name of the module to potentially complete. + */ + completeLoad: function (moduleName) { + var found, args, mod, + shim = config.shim[moduleName] || {}, + shExports = shim.exports && shim.exports.exports; + + takeGlobalQueue(); + + while (defQueue.length) { + args = defQueue.shift(); + if (args[0] === null) { + args[0] = moduleName; + //If already found an anonymous module and bound it + //to this name, then this is some other anon module + //waiting for its completeLoad to fire. + if (found) { + break; + } + found = true; + } else if (args[0] === moduleName) { + //Found matching define call for this script! + found = true; + } + + callGetModule(args); + } + + //Do this after the cycle of callGetModule in case the result + //of those calls/init calls changes the registry. + mod = registry[moduleName]; + + if (!found && !defined[moduleName] && mod && !mod.inited) { + if (config.enforceDefine && (!shExports || !getGlobal(shExports))) { + if (hasPathFallback(moduleName)) { + return; + } else { + return onError(makeError('nodefine', + 'No define call for ' + moduleName, + null, + [moduleName])); + } + } else { + //A script that does not call define(), so just simulate + //the call for it. + callGetModule([moduleName, (shim.deps || []), shim.exports]); + } + } + + checkLoaded(); + }, + + /** + * Converts a module name + .extension into an URL path. + * *Requires* the use of a module name. It does not support using + * plain URLs like nameToUrl. + */ + toUrl: function (moduleNamePlusExt, relModuleMap) { + var index = moduleNamePlusExt.lastIndexOf('.'), + ext = null; + + if (index !== -1) { + ext = moduleNamePlusExt.substring(index, moduleNamePlusExt.length); + moduleNamePlusExt = moduleNamePlusExt.substring(0, index); + } + + return context.nameToUrl(normalize(moduleNamePlusExt, relModuleMap && relModuleMap.id, true), + ext); + }, + + /** + * Converts a module name to a file path. Supports cases where + * moduleName may actually be just an URL. + * Note that it **does not** call normalize on the moduleName, + * it is assumed to have already been normalized. This is an + * internal API, not a public one. Use toUrl for the public API. + */ + nameToUrl: function (moduleName, ext) { + var paths, pkgs, pkg, pkgPath, syms, i, parentModule, url, + parentPath; + + //If a colon is in the URL, it indicates a protocol is used and it is just + //an URL to a file, or if it starts with a slash, contains a query arg (i.e. ?) + //or ends with .js, then assume the user meant to use an url and not a module id. + //The slash is important for protocol-less URLs as well as full paths. + if (req.jsExtRegExp.test(moduleName)) { + //Just a plain path, not module name lookup, so just return it. + //Add extension if it is included. This is a bit wonky, only non-.js things pass + //an extension, this method probably needs to be reworked. + url = moduleName + (ext || ''); + } else { + //A module that needs to be converted to a path. + paths = config.paths; + pkgs = config.pkgs; + + syms = moduleName.split('/'); + //For each module name segment, see if there is a path + //registered for it. Start with most specific name + //and work up from it. + for (i = syms.length; i > 0; i -= 1) { + parentModule = syms.slice(0, i).join('/'); + pkg = pkgs[parentModule]; + parentPath = paths[parentModule]; + if (parentPath) { + //If an array, it means there are a few choices, + //Choose the one that is desired + if (isArray(parentPath)) { + parentPath = parentPath[0]; + } + syms.splice(0, i, parentPath); + break; + } else if (pkg) { + //If module name is just the package name, then looking + //for the main module. + if (moduleName === pkg.name) { + pkgPath = pkg.location + '/' + pkg.main; + } else { + pkgPath = pkg.location; + } + syms.splice(0, i, pkgPath); + break; + } + } + + //Join the path parts together, then figure out if baseUrl is needed. + url = syms.join('/'); + url += (ext || (/\?/.test(url) ? '' : '.js')); + url = (url.charAt(0) === '/' || url.match(/^[\w\+\.\-]+:/) ? '' : config.baseUrl) + url; + } + + return config.urlArgs ? url + + ((url.indexOf('?') === -1 ? '?' : '&') + + config.urlArgs) : url; + }, + + //Delegates to req.load. Broken out as a separate function to + //allow overriding in the optimizer. + load: function (id, url) { + req.load(context, id, url); + }, + + /** + * Executes a module callack function. Broken out as a separate function + * solely to allow the build system to sequence the files in the built + * layer in the right sequence. + * + * @private + */ + execCb: function (name, callback, args, exports) { + return callback.apply(exports, args); + }, + + /** + * callback for script loads, used to check status of loading. + * + * @param {Event} evt the event from the browser for the script + * that was loaded. + */ + onScriptLoad: function (evt) { + //Using currentTarget instead of target for Firefox 2.0's sake. Not + //all old browsers will be supported, but this one was easy enough + //to support and still makes sense. + if (evt.type === 'load' || + (readyRegExp.test((evt.currentTarget || evt.srcElement).readyState))) { + //Reset interactive script so a script node is not held onto for + //to long. + interactiveScript = null; + + //Pull out the name of the module and the context. + var data = getScriptData(evt); + context.completeLoad(data.id); + } + }, + + /** + * Callback for script errors. + */ + onScriptError: function (evt) { + var data = getScriptData(evt); + if (!hasPathFallback(data.id)) { + return onError(makeError('scripterror', 'Script error', evt, [data.id])); + } + } + }); + } + + /** + * Main entry point. + * + * If the only argument to require is a string, then the module that + * is represented by that string is fetched for the appropriate context. + * + * If the first argument is an array, then it will be treated as an array + * of dependency string names to fetch. An optional function callback can + * be specified to execute when all of those dependencies are available. + * + * Make a local req variable to help Caja compliance (it assumes things + * on a require that are not standardized), and to give a short + * name for minification/local scope use. + */ + req = requirejs = function (deps, callback, errback, optional) { + + //Find the right context, use default + var context, config, + contextName = defContextName; + + // Determine if have config object in the call. + if (!isArray(deps) && typeof deps !== 'string') { + // deps is a config object + config = deps; + if (isArray(callback)) { + // Adjust args if there are dependencies + deps = callback; + callback = errback; + errback = optional; + } else { + deps = []; + } + } + + if (config && config.context) { + contextName = config.context; + } + + context = contexts[contextName]; + if (!context) { + context = contexts[contextName] = req.s.newContext(contextName); + } + + if (config) { + context.configure(config); + } + + return context.require(deps, callback, errback); + }; + + /** + * Support require.config() to make it easier to cooperate with other + * AMD loaders on globally agreed names. + */ + req.config = function (config) { + return req(config); + }; + + /** + * Export require as a global, but only if it does not already exist. + */ + if (!require) { + require = req; + } + + req.version = version; + + //Used to filter out dependencies that are already paths. + req.jsExtRegExp = /^\/|:|\?|\.js$/; + req.isBrowser = isBrowser; + s = req.s = { + contexts: contexts, + newContext: newContext + }; + + //Create default context. + req({}); + + //Exports some context-sensitive methods on global require, using + //default context if no context specified. + addRequireMethods(req); + + if (isBrowser) { + head = s.head = document.getElementsByTagName('head')[0]; + //If BASE tag is in play, using appendChild is a problem for IE6. + //When that browser dies, this can be removed. Details in this jQuery bug: + //http://dev.jquery.com/ticket/2709 + baseElement = document.getElementsByTagName('base')[0]; + if (baseElement) { + head = s.head = baseElement.parentNode; + } + } + + /** + * Any errors that require explicitly generates will be passed to this + * function. Intercept/override it if you want custom error handling. + * @param {Error} err the error object. + */ + req.onError = function (err) { + throw err; + }; + + /** + * Does the request to load a module for the browser case. + * Make this a separate function to allow other environments + * to override it. + * + * @param {Object} context the require context to find state. + * @param {String} moduleName the name of the module. + * @param {Object} url the URL to the module. + */ + req.load = function (context, moduleName, url) { + var config = (context && context.config) || {}, + node; + if (isBrowser) { + //In the browser so use a script tag + node = config.xhtml ? + document.createElementNS('http://www.w3.org/1999/xhtml', 'html:script') : + document.createElement('script'); + node.type = config.scriptType || 'text/javascript'; + node.charset = 'utf-8'; + node.async = true; + + node.setAttribute('data-requirecontext', context.contextName); + node.setAttribute('data-requiremodule', moduleName); + + //Set up load listener. Test attachEvent first because IE9 has + //a subtle issue in its addEventListener and script onload firings + //that do not match the behavior of all other browsers with + //addEventListener support, which fire the onload event for a + //script right after the script execution. See: + //https://connect.microsoft.com/IE/feedback/details/648057/script-onload-event-is-not-fired-immediately-after-script-execution + //UNFORTUNATELY Opera implements attachEvent but does not follow the script + //script execution mode. + if (node.attachEvent && + //Check if node.attachEvent is artificially added by custom script or + //natively supported by browser + //read https://github.com/jrburke/requirejs/issues/187 + //if we can NOT find [native code] then it must NOT natively supported. + //in IE8, node.attachEvent does not have toString() + //Note the test for "[native code" with no closing brace, see: + //https://github.com/jrburke/requirejs/issues/273 + !(node.attachEvent.toString && node.attachEvent.toString().indexOf('[native code') < 0) && + !isOpera) { + //Probably IE. IE (at least 6-8) do not fire + //script onload right after executing the script, so + //we cannot tie the anonymous define call to a name. + //However, IE reports the script as being in 'interactive' + //readyState at the time of the define call. + useInteractive = true; + + node.attachEvent('onreadystatechange', context.onScriptLoad); + //It would be great to add an error handler here to catch + //404s in IE9+. However, onreadystatechange will fire before + //the error handler, so that does not help. If addEvenListener + //is used, then IE will fire error before load, but we cannot + //use that pathway given the connect.microsoft.com issue + //mentioned above about not doing the 'script execute, + //then fire the script load event listener before execute + //next script' that other browsers do. + //Best hope: IE10 fixes the issues, + //and then destroys all installs of IE 6-9. + //node.attachEvent('onerror', context.onScriptError); + } else { + node.addEventListener('load', context.onScriptLoad, false); + node.addEventListener('error', context.onScriptError, false); + } + node.src = url; + + //For some cache cases in IE 6-8, the script executes before the end + //of the appendChild execution, so to tie an anonymous define + //call to the module name (which is stored on the node), hold on + //to a reference to this node, but clear after the DOM insertion. + currentlyAddingScript = node; + if (baseElement) { + head.insertBefore(node, baseElement); + } else { + head.appendChild(node); + } + currentlyAddingScript = null; + + return node; + } else if (isWebWorker) { + //In a web worker, use importScripts. This is not a very + //efficient use of importScripts, importScripts will block until + //its script is downloaded and evaluated. However, if web workers + //are in play, the expectation that a build has been done so that + //only one script needs to be loaded anyway. This may need to be + //reevaluated if other use cases become common. + importScripts(url); + + //Account for anonymous modules + context.completeLoad(moduleName); + } + }; + + function getInteractiveScript() { + if (interactiveScript && interactiveScript.readyState === 'interactive') { + return interactiveScript; + } + + eachReverse(scripts(), function (script) { + if (script.readyState === 'interactive') { + return (interactiveScript = script); + } + }); + return interactiveScript; + } + + //Look for a data-main script attribute, which could also adjust the baseUrl. + if (isBrowser) { + //Figure out baseUrl. Get it from the script tag with require.js in it. + eachReverse(scripts(), function (script) { + //Set the 'head' where we can append children by + //using the script's parent. + if (!head) { + head = script.parentNode; + } + + //Look for a data-main attribute to set main script for the page + //to load. If it is there, the path to data main becomes the + //baseUrl, if it is not already set. + dataMain = script.getAttribute('data-main'); + if (dataMain) { + //Set final baseUrl if there is not already an explicit one. + if (!cfg.baseUrl) { + //Pull off the directory of data-main for use as the + //baseUrl. + src = dataMain.split('/'); + mainScript = src.pop(); + subPath = src.length ? src.join('/') + '/' : './'; + + cfg.baseUrl = subPath; + dataMain = mainScript; + } + + //Strip off any trailing .js since dataMain is now + //like a module name. + dataMain = dataMain.replace(jsSuffixRegExp, ''); + + //Put the data-main script in the files to load. + cfg.deps = cfg.deps ? cfg.deps.concat(dataMain) : [dataMain]; + + return true; + } + }); + } + + /** + * The function that handles definitions of modules. Differs from + * require() in that a string for the module should be the first argument, + * and the function to execute after dependencies are loaded should + * return a value to define the module corresponding to the first argument's + * name. + */ + define = function (name, deps, callback) { + var node, context; + + //Allow for anonymous functions + if (typeof name !== 'string') { + //Adjust args appropriately + callback = deps; + deps = name; + name = null; + } + + //This module may not have dependencies + if (!isArray(deps)) { + callback = deps; + deps = []; + } + + //If no name, and callback is a function, then figure out if it a + //CommonJS thing with dependencies. + if (!deps.length && isFunction(callback)) { + //Remove comments from the callback string, + //look for require calls, and pull them into the dependencies, + //but only if there are function args. + if (callback.length) { + callback + .toString() + .replace(commentRegExp, '') + .replace(cjsRequireRegExp, function (match, dep) { + deps.push(dep); + }); + + //May be a CommonJS thing even without require calls, but still + //could use exports, and module. Avoid doing exports and module + //work though if it just needs require. + //REQUIRES the function to expect the CommonJS variables in the + //order listed below. + deps = (callback.length === 1 ? ['require'] : ['require', 'exports', 'module']).concat(deps); + } + } + + //If in IE 6-8 and hit an anonymous define() call, do the interactive + //work. + if (useInteractive) { + node = currentlyAddingScript || getInteractiveScript(); + if (node) { + if (!name) { + name = node.getAttribute('data-requiremodule'); + } + context = contexts[node.getAttribute('data-requirecontext')]; + } + } + + //Always save off evaluating the def call until the script onload handler. + //This allows multiple modules to be in a file without prematurely + //tracing dependencies, and allows for anonymous module support, + //where the module name is not known until the script onload event + //occurs. If no context, use the global queue, and get it processed + //in the onscript load callback. + (context ? context.defQueue : globalDefQueue).push([name, deps, callback]); + }; + + define.amd = { + jQuery: true + }; + + + /** + * Executes the text. Normally just uses eval, but can be modified + * to use a better, environment-specific call. Only used for transpiling + * loader plugins, not for plain JS modules. + * @param {String} text the text to execute/evaluate. + */ + req.exec = function (text) { + /*jslint evil: true */ + return eval(text); + }; + + //Set up with config info. + req(cfg); +}(this)); \ No newline at end of file diff --git a/module/web/static/js/libs/underscore-min.js b/module/web/static/js/libs/underscore-min.js deleted file mode 100644 index 5a0cb3b00..000000000 --- a/module/web/static/js/libs/underscore-min.js +++ /dev/null @@ -1,32 +0,0 @@ -// Underscore.js 1.3.3 -// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. -// Underscore is freely distributable under the MIT license. -// Portions of Underscore are inspired or borrowed from Prototype, -// Oliver Steele's Functional, and John Resig's Micro-Templating. -// For all details and documentation: -// http://documentcloud.github.com/underscore -(function(){function r(a,c,d){if(a===c)return 0!==a||1/a==1/c;if(null==a||null==c)return a===c;a._chain&&(a=a._wrapped);c._chain&&(c=c._wrapped);if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return!1;switch(e){case "[object String]":return a==""+c;case "[object Number]":return a!=+a?c!=+c:0==a?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source== -c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if("object"!=typeof a||"object"!=typeof c)return!1;for(var f=d.length;f--;)if(d[f]==a)return!0;d.push(a);var f=0,g=!0;if("[object Array]"==e){if(f=a.length,g=f==c.length)for(;f--&&(g=f in a==f in c&&r(a[f],c[f],d)););}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return!1;for(var h in a)if(b.has(a,h)&&(f++,!(g=b.has(c,h)&&r(a[h],c[h],d))))break;if(g){for(h in c)if(b.has(c,h)&&!f--)break; -g=!f}}d.pop();return g}var s=this,I=s._,o={},k=Array.prototype,p=Object.prototype,i=k.slice,J=k.unshift,l=p.toString,K=p.hasOwnProperty,y=k.forEach,z=k.map,A=k.reduce,B=k.reduceRight,C=k.filter,D=k.every,E=k.some,q=k.indexOf,F=k.lastIndexOf,p=Array.isArray,L=Object.keys,t=Function.prototype.bind,b=function(a){return new m(a)};"undefined"!==typeof exports?("undefined"!==typeof module&&module.exports&&(exports=module.exports=b),exports._=b):s._=b;b.VERSION="1.3.3";var j=b.each=b.forEach=function(a, -c,d){if(a!=null)if(y&&a.forEach===y)a.forEach(c,d);else if(a.length===+a.length)for(var e=0,f=a.length;e2;a==null&&(a=[]);if(A&& -a.reduce===A){e&&(c=b.bind(c,e));return f?a.reduce(c,d):a.reduce(c)}j(a,function(a,b,i){if(f)d=c.call(e,d,a,b,i);else{d=a;f=true}});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(B&&a.reduceRight===B){e&&(c=b.bind(c,e));return f?a.reduceRight(c,d):a.reduceRight(c)}var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g,c,d,e):b.reduce(g,c)};b.find=b.detect=function(a, -c,b){var e;G(a,function(a,g,h){if(c.call(b,a,g,h)){e=a;return true}});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(C&&a.filter===C)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(D&&a.every===D)return a.every(c,b);j(a,function(a,g,h){if(!(e=e&&c.call(b, -a,g,h)))return o});return!!e};var G=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(E&&a.some===E)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return o});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;if(q&&a.indexOf===q)return a.indexOf(c)!=-1;return b=G(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(b.isFunction(c)?c||a:a[c]).apply(a,d)})};b.pluck= -function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a)&&a[0]===+a[0])return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a)&&a[0]===+a[0])return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;bd?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]}; -j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex=function(a,c,d){d||(d=b.identity);for(var e=0,f=a.length;e>1;d(a[g])=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1),true);return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a= -i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e=0;d--)b=[a[d].apply(this,b)];return b[0]}};b.after=function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=L||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var c=[],d;for(d in a)b.has(a,d)&&(c[c.length]=d);return c};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&& -c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)a[d]=b[d]});return a};b.pick=function(a){var c={};j(b.flatten(i.call(arguments,1)),function(b){b in a&&(c[b]=a[b])});return c};b.defaults=function(a){j(i.call(arguments,1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return r(a,b,[])};b.isEmpty= -function(a){if(a==null)return true;if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(b.has(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=p||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a===Object(a)};b.isArguments=function(a){return l.call(a)=="[object Arguments]"};b.isArguments(arguments)||(b.isArguments=function(a){return!(!a||!b.has(a,"callee"))});b.isFunction=function(a){return l.call(a)=="[object Function]"}; -b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isFinite=function(a){return b.isNumber(a)&&isFinite(a)};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)=="[object Date]"};b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.has=function(a, -b){return K.call(a,b)};b.noConflict=function(){s._=I;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;e/g,">").replace(/"/g,""").replace(/'/g,"'").replace(/\//g,"/")};b.result=function(a,c){if(a==null)return null;var d=a[c];return b.isFunction(d)?d.call(a):d};b.mixin=function(a){j(b.functions(a),function(c){M(c,b[c]=a[c])})};var N=0;b.uniqueId= -function(a){var b=N++;return a?a+b:b};b.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};var u=/.^/,n={"\\":"\\","'":"'",r:"\r",n:"\n",t:"\t",u2028:"\u2028",u2029:"\u2029"},v;for(v in n)n[n[v]]=v;var O=/\\|'|\r|\n|\t|\u2028|\u2029/g,P=/\\(\\|'|r|n|t|u2028|u2029)/g,w=function(a){return a.replace(P,function(a,b){return n[b]})};b.template=function(a,c,d){d=b.defaults(d||{},b.templateSettings);a="__p+='"+a.replace(O,function(a){return"\\"+n[a]}).replace(d.escape|| -u,function(a,b){return"'+\n_.escape("+w(b)+")+\n'"}).replace(d.interpolate||u,function(a,b){return"'+\n("+w(b)+")+\n'"}).replace(d.evaluate||u,function(a,b){return"';\n"+w(b)+"\n;__p+='"})+"';\n";d.variable||(a="with(obj||{}){\n"+a+"}\n");var a="var __p='';var print=function(){__p+=Array.prototype.join.call(arguments, '')};\n"+a+"return __p;\n",e=new Function(d.variable||"obj","_",a);if(c)return e(c,b);c=function(a){return e.call(this,a,b)};c.source="function("+(d.variable||"obj")+"){\n"+a+"}";return c}; -b.chain=function(a){return b(a).chain()};var m=function(a){this._wrapped=a};b.prototype=m.prototype;var x=function(a,c){return c?b(a).chain():a},M=function(a,c){m.prototype[a]=function(){var a=i.call(arguments);J.call(a,this._wrapped);return x(c.apply(b,a),this._chain)}};b.mixin(b);j("pop,push,reverse,shift,sort,splice,unshift".split(","),function(a){var b=k[a];m.prototype[a]=function(){var d=this._wrapped;b.apply(d,arguments);var e=d.length;(a=="shift"||a=="splice")&&e===0&&delete d[0];return x(d, -this._chain)}});j(["concat","join","slice"],function(a){var b=k[a];m.prototype[a]=function(){return x(b.apply(this._wrapped,arguments),this._chain)}});m.prototype.chain=function(){this._chain=true;return this};m.prototype.value=function(){return this._wrapped}}).call(this); diff --git a/module/web/static/js/mobile.js b/module/web/static/js/mobile.js new file mode 100644 index 000000000..21d1be26c --- /dev/null +++ b/module/web/static/js/mobile.js @@ -0,0 +1,34 @@ +// Sets the require.js configuration for your application. +require.config({ + + // 3rd party script alias names (Easier to type "jquery" than "libs/jquery-1.7.2.min") + paths: { + + // Core Libraries + jquery: "libs/jquery-1.8.0", + underscore: "libs/lodash-0.4.2", + backbone: "libs/backbone-0.9.2", + + // Require.js Plugins + text: "plugins/text-2.0.0" + + }, + + // Sets the configuration for your third party scripts that are not AMD compatible + shim: { + + "backbone": { + deps: ["underscore", "jquery"], + exports: "Backbone" //attaches "Backbone" to the window object + } + + } // end Shim Configuration + +}); + +// Include Desktop Specific JavaScript files here (or inside of your Desktop router) +require(['jquery','backbone','routers/mobileRouter'], function($, Backbone, Mobile) { + + // Instantiates a new Router + this.router = new Mobile(); +}); \ No newline at end of file diff --git a/module/web/static/js/mobile/my.js b/module/web/static/js/mobile/my.js deleted file mode 100644 index 41203e6c5..000000000 --- a/module/web/static/js/mobile/my.js +++ /dev/null @@ -1,275 +0,0 @@ -(function($) { - $.widget('mobile.tabbar', $.mobile.navbar, { - _create: function() { - // Set the theme before we call the prototype, which will - // ensure buttonMarkup() correctly grabs the inheritied theme. - // We default to the "a" swatch if none is found - var theme = this.element.jqmData('theme') || "a"; - this.element.addClass('ui-footer ui-footer-fixed ui-bar-' + theme); - - // Make sure the page has padding added to it to account for the fixed bar - this.element.closest('[data-role="page"]').addClass('ui-page-footer-fixed'); - - - // Call the NavBar _create prototype - $.mobile.navbar.prototype._create.call(this); - }, - - // Set the active URL for the Tab Bar, and highlight that button on the bar - setActive: function(url) { - // Sometimes the active state isn't properly cleared, so we reset it ourselves - this.element.find('a').removeClass('ui-btn-active ui-state-persist'); - this.element.find('a[href="' + url + '"]').addClass('ui-btn-active ui-state-persist'); - } - }); - - $(document).bind('pagecreate create', function(e) { - return $(e.target).find(":jqmData(role='tabbar')").tabbar(); - }); - - $(":jqmData(role='page')").live('pageshow', function(e) { - // Grab the id of the page that's showing, and select it on the Tab Bar on the page - var tabBar, id = $(e.target).attr('id'); - - tabBar = $.mobile.activePage.find(':jqmData(role="tabbar")'); - if(tabBar.length) { - tabBar.tabbar('setActive', '#' + id); - } - }); - -var attachEvents = function() { - var hoverDelay = $.mobile.buttonMarkup.hoverDelay, hov, foc; - - $( document ).bind( { - "vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart": function( event ) { - var theme, - $btn = $( closestEnabledButton( event.target ) ), - evt = event.type; - - if ( $btn.length ) { - theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); - - if ( evt === "vmousedown" ) { - if ( $.support.touch ) { - hov = setTimeout(function() { - $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); - }, hoverDelay ); - } else { - $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); - } - } else if ( evt === "vmousecancel" || evt === "vmouseup" ) { - $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); - } else if ( evt === "vmouseover" || evt === "focus" ) { - if ( $.support.touch ) { - foc = setTimeout(function() { - $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); - }, hoverDelay ); - } else { - $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); - } - } else if ( evt === "vmouseout" || evt === "blur" || evt === "scrollstart" ) { - $btn.removeClass( "ui-btn-hover-" + theme + " ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); - if ( hov ) { - clearTimeout( hov ); - } - if ( foc ) { - clearTimeout( foc ); - } - } - } - }, - "focusin focus": function( event ){ - $( closestEnabledButton( event.target ) ).addClass( $.mobile.focusClass ); - }, - "focusout blur": function( event ){ - $( closestEnabledButton( event.target ) ).removeClass( $.mobile.focusClass ); - } - }); - - attachEvents = null; -}; - -$.fn.buttonMarkup = function( options ) { - var $workingSet = this; - - // Enforce options to be of type string - options = ( options && ( $.type( options ) == "object" ) )? options : {}; - for ( var i = 0; i < $workingSet.length; i++ ) { - var el = $workingSet.eq( i ), - e = el[ 0 ], - o = $.extend( {}, $.fn.buttonMarkup.defaults, { - icon: options.icon !== undefined ? options.icon : el.jqmData( "icon" ), - iconpos: options.iconpos !== undefined ? options.iconpos : el.jqmData( "iconpos" ), - theme: options.theme !== undefined ? options.theme : el.jqmData( "theme" ) || $.mobile.getInheritedTheme( el, "c" ), - inline: options.inline !== undefined ? options.inline : el.jqmData( "inline" ), - shadow: options.shadow !== undefined ? options.shadow : el.jqmData( "shadow" ), - corners: options.corners !== undefined ? options.corners : el.jqmData( "corners" ), - iconshadow: options.iconshadow !== undefined ? options.iconshadow : el.jqmData( "iconshadow" ), - iconsize: options.iconsize !== undefined ? options.iconsize : el.jqmData( "iconsize" ), - mini: options.mini !== undefined ? options.mini : el.jqmData( "mini" ) - }, options ), - - // Classes Defined - innerClass = "ui-btn-inner", - textClass = "ui-btn-text", - buttonClass, iconClass, - // Button inner markup - buttonInner, - buttonText, - buttonIcon, - buttonElements; - - $.each(o, function(key, value) { - e.setAttribute( "data-" + $.mobile.ns + key, value ); - el.jqmData(key, value); - }); - - // Check if this element is already enhanced - buttonElements = $.data(((e.tagName === "INPUT" || e.tagName === "BUTTON") ? e.parentNode : e), "buttonElements"); - - if (buttonElements) { - e = buttonElements.outer; - el = $(e); - buttonInner = buttonElements.inner; - buttonText = buttonElements.text; - // We will recreate this icon below - $(buttonElements.icon).remove(); - buttonElements.icon = null; - } - else { - buttonInner = document.createElement( o.wrapperEls ); - buttonText = document.createElement( o.wrapperEls ); - } - buttonIcon = o.icon ? document.createElement( "span" ) : null; - - if ( attachEvents && !buttonElements) { - attachEvents(); - } - - // if not, try to find closest theme container - if ( !o.theme ) { - o.theme = $.mobile.getInheritedTheme( el, "c" ); - } - - buttonClass = "ui-btn ui-btn-up-" + o.theme; - buttonClass += o.inline ? " ui-btn-inline" : ""; - buttonClass += o.shadow ? " ui-shadow" : ""; - buttonClass += o.corners ? " ui-btn-corner-all" : ""; - - if ( o.mini !== undefined ) { - // Used to control styling in headers/footers, where buttons default to `mini` style. - buttonClass += o.mini ? " ui-mini" : " ui-fullsize"; - } - - if ( o.inline !== undefined ) { - // Used to control styling in headers/footers, where buttons default to `mini` style. - buttonClass += o.inline === false ? " ui-btn-block" : " ui-btn-inline"; - } - - - if ( o.icon ) { - o.icon = "ui-icon-" + o.icon; - o.iconpos = o.iconpos || "left"; - - iconClass = "ui-icon " + o.icon; - - if ( o.iconshadow ) { - iconClass += " ui-icon-shadow"; - } - - if ( o.iconsize ) { - iconClass += " ui-iconsize-" + o.iconsize; - } - } - - if ( o.iconpos ) { - buttonClass += " ui-btn-icon-" + o.iconpos; - - if ( o.iconpos == "notext" && !el.attr( "title" ) ) { - el.attr( "title", el.getEncodedText() ); - } - } - - innerClass += o.corners ? " ui-btn-corner-all" : ""; - - if ( o.iconpos && o.iconpos === "notext" && !el.attr( "title" ) ) { - el.attr( "title", el.getEncodedText() ); - } - - if ( buttonElements ) { - el.removeClass( buttonElements.bcls || "" ); - } - el.removeClass( "ui-link" ).addClass( buttonClass ); - - buttonInner.className = innerClass; - - buttonText.className = textClass; - if ( !buttonElements ) { - buttonInner.appendChild( buttonText ); - } - if ( buttonIcon ) { - buttonIcon.className = iconClass; - if ( !(buttonElements && buttonElements.icon) ) { - buttonIcon.appendChild( document.createTextNode("\u00a0") ); - buttonInner.appendChild( buttonIcon ); - } - } - - while ( e.firstChild && !buttonElements) { - buttonText.appendChild( e.firstChild ); - } - - if ( !buttonElements ) { - e.appendChild( buttonInner ); - } - - // Assign a structure containing the elements of this button to the elements of this button. This - // will allow us to recognize this as an already-enhanced button in future calls to buttonMarkup(). - buttonElements = { - bcls : buttonClass, - outer : e, - inner : buttonInner, - text : buttonText, - icon : buttonIcon - }; - - $.data(e, 'buttonElements', buttonElements); - $.data(buttonInner, 'buttonElements', buttonElements); - $.data(buttonText, 'buttonElements', buttonElements); - if (buttonIcon) { - $.data(buttonIcon, 'buttonElements', buttonElements); - } - } - - return this; -}; - -$.fn.buttonMarkup.defaults = { - corners: true, - shadow: true, - iconshadow: true, - iconsize: 18, - wrapperEls: "span" -}; - -function closestEnabledButton( element ) { - var cname; - - while ( element ) { - // Note that we check for typeof className below because the element we - // handed could be in an SVG DOM where className on SVG elements is defined to - // be of a different type (SVGAnimatedString). We only operate on HTML DOM - // elements, so we look for plain "string". - cname = ( typeof element.className === 'string' ) && (element.className + ' '); - if ( cname && cname.indexOf("ui-btn ") > -1 && cname.indexOf("ui-disabled ") < 0 ) { - break; - } - - element = element.parentNode; - } - - return element; -} - - -})(jQuery); diff --git a/module/web/static/js/models/model.js b/module/web/static/js/models/model.js new file mode 100644 index 000000000..2ea2db616 --- /dev/null +++ b/module/web/static/js/models/model.js @@ -0,0 +1,24 @@ +define(['jquery', 'backbone'], function($, Backbone) { + + var Model = Backbone.Model.extend({ + + defaults: { + message: "You are now using Backbone, Lodash, Require, Modernizr, and jQuery! (Click Me)" + }, + + // Model Constructor + initialize: function() { + + }, + + // Any time a model attribute is set, this method is called + validate: function(attrs) { + + } + + }); + + // Returns the Model class + return Model; + +}); \ No newline at end of file diff --git a/module/web/static/js/routers/defaultRouter.js b/module/web/static/js/routers/defaultRouter.js new file mode 100644 index 000000000..95b8de967 --- /dev/null +++ b/module/web/static/js/routers/defaultRouter.js @@ -0,0 +1,29 @@ +define(['jquery','backbone','views/headerView'], function($, Backbone, HeaderView){ + + var Router = Backbone.Router.extend({ + + initialize: function(){ + Backbone.history.start(); + }, + + // All of your Backbone Routes (add more) + routes: { + + // When there is no hash bang on the url, the home method is called + '': 'home' + + }, + + 'home': function(){ + // Instantiating mainView and anotherView instances + var headerView = new HeaderView(); + + // Renders the mainView template + headerView.render(); + + } + }); + + // Returns the Router class + return Router; +}); \ No newline at end of file diff --git a/module/web/static/js/views/headerView.js b/module/web/static/js/views/headerView.js new file mode 100644 index 000000000..26f2ea706 --- /dev/null +++ b/module/web/static/js/views/headerView.js @@ -0,0 +1,76 @@ +define(['jquery', 'backbone', 'flot'], function($, Backbone){ + // Renders the header with all information + return Backbone.View.extend({ + + el: 'header', + + events: { + + }, + + initialize: function() { + this.$el.find("#globalprogress").progressbar({ value:37 }); + + var totalPoints = 100; + var data = []; + + function getRandomData() { + if (data.length > 0) + data = data.slice(1); + + // do a random walk + while (data.length < totalPoints) { + var prev = data.length > 0 ? data[data.length - 1] : 50; + var y = prev + Math.random() * 10 - 5; + if (y < 0) + y = 0; + if (y > 100) + y = 100; + data.push(y); + } + + // zip the generated y values with the x values + var res = []; + for (var i = 0; i < data.length; ++i) + res.push([i, data[i]]) + return res; + } + + var updateInterval = 1500; + + var speedgraph = $.plot(this.$el.find("#speedgraph"), [getRandomData()], { + series:{ + lines:{ show:true, lineWidth:2 }, + shadowSize:0, + color:"#fee247" + }, + xaxis:{ ticks:[], mode:"time" }, + yaxis:{ ticks:[], min:0, autoscaleMargin:0.1 }, + grid:{ + show:true, +// borderColor: "#757575", + borderColor:"white", + borderWidth:1, + labelMargin:0, + axisMargin:0, + minBorderMargin:0 + } + }); + + function update() { + speedgraph.setData([ getRandomData() ]); + // since the axes don't change, we don't need to call plot.setupGrid() + speedgraph.draw(); + + setTimeout(update, updateInterval); + } + + update(); + + }, + + + render: function() { + } + }); +}); \ No newline at end of file diff --git a/module/web/static/js/views/mobile/my.js b/module/web/static/js/views/mobile/my.js new file mode 100644 index 000000000..41203e6c5 --- /dev/null +++ b/module/web/static/js/views/mobile/my.js @@ -0,0 +1,275 @@ +(function($) { + $.widget('mobile.tabbar', $.mobile.navbar, { + _create: function() { + // Set the theme before we call the prototype, which will + // ensure buttonMarkup() correctly grabs the inheritied theme. + // We default to the "a" swatch if none is found + var theme = this.element.jqmData('theme') || "a"; + this.element.addClass('ui-footer ui-footer-fixed ui-bar-' + theme); + + // Make sure the page has padding added to it to account for the fixed bar + this.element.closest('[data-role="page"]').addClass('ui-page-footer-fixed'); + + + // Call the NavBar _create prototype + $.mobile.navbar.prototype._create.call(this); + }, + + // Set the active URL for the Tab Bar, and highlight that button on the bar + setActive: function(url) { + // Sometimes the active state isn't properly cleared, so we reset it ourselves + this.element.find('a').removeClass('ui-btn-active ui-state-persist'); + this.element.find('a[href="' + url + '"]').addClass('ui-btn-active ui-state-persist'); + } + }); + + $(document).bind('pagecreate create', function(e) { + return $(e.target).find(":jqmData(role='tabbar')").tabbar(); + }); + + $(":jqmData(role='page')").live('pageshow', function(e) { + // Grab the id of the page that's showing, and select it on the Tab Bar on the page + var tabBar, id = $(e.target).attr('id'); + + tabBar = $.mobile.activePage.find(':jqmData(role="tabbar")'); + if(tabBar.length) { + tabBar.tabbar('setActive', '#' + id); + } + }); + +var attachEvents = function() { + var hoverDelay = $.mobile.buttonMarkup.hoverDelay, hov, foc; + + $( document ).bind( { + "vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart": function( event ) { + var theme, + $btn = $( closestEnabledButton( event.target ) ), + evt = event.type; + + if ( $btn.length ) { + theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); + + if ( evt === "vmousedown" ) { + if ( $.support.touch ) { + hov = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + } + } else if ( evt === "vmousecancel" || evt === "vmouseup" ) { + $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + } else if ( evt === "vmouseover" || evt === "focus" ) { + if ( $.support.touch ) { + foc = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + } + } else if ( evt === "vmouseout" || evt === "blur" || evt === "scrollstart" ) { + $btn.removeClass( "ui-btn-hover-" + theme + " ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + if ( hov ) { + clearTimeout( hov ); + } + if ( foc ) { + clearTimeout( foc ); + } + } + } + }, + "focusin focus": function( event ){ + $( closestEnabledButton( event.target ) ).addClass( $.mobile.focusClass ); + }, + "focusout blur": function( event ){ + $( closestEnabledButton( event.target ) ).removeClass( $.mobile.focusClass ); + } + }); + + attachEvents = null; +}; + +$.fn.buttonMarkup = function( options ) { + var $workingSet = this; + + // Enforce options to be of type string + options = ( options && ( $.type( options ) == "object" ) )? options : {}; + for ( var i = 0; i < $workingSet.length; i++ ) { + var el = $workingSet.eq( i ), + e = el[ 0 ], + o = $.extend( {}, $.fn.buttonMarkup.defaults, { + icon: options.icon !== undefined ? options.icon : el.jqmData( "icon" ), + iconpos: options.iconpos !== undefined ? options.iconpos : el.jqmData( "iconpos" ), + theme: options.theme !== undefined ? options.theme : el.jqmData( "theme" ) || $.mobile.getInheritedTheme( el, "c" ), + inline: options.inline !== undefined ? options.inline : el.jqmData( "inline" ), + shadow: options.shadow !== undefined ? options.shadow : el.jqmData( "shadow" ), + corners: options.corners !== undefined ? options.corners : el.jqmData( "corners" ), + iconshadow: options.iconshadow !== undefined ? options.iconshadow : el.jqmData( "iconshadow" ), + iconsize: options.iconsize !== undefined ? options.iconsize : el.jqmData( "iconsize" ), + mini: options.mini !== undefined ? options.mini : el.jqmData( "mini" ) + }, options ), + + // Classes Defined + innerClass = "ui-btn-inner", + textClass = "ui-btn-text", + buttonClass, iconClass, + // Button inner markup + buttonInner, + buttonText, + buttonIcon, + buttonElements; + + $.each(o, function(key, value) { + e.setAttribute( "data-" + $.mobile.ns + key, value ); + el.jqmData(key, value); + }); + + // Check if this element is already enhanced + buttonElements = $.data(((e.tagName === "INPUT" || e.tagName === "BUTTON") ? e.parentNode : e), "buttonElements"); + + if (buttonElements) { + e = buttonElements.outer; + el = $(e); + buttonInner = buttonElements.inner; + buttonText = buttonElements.text; + // We will recreate this icon below + $(buttonElements.icon).remove(); + buttonElements.icon = null; + } + else { + buttonInner = document.createElement( o.wrapperEls ); + buttonText = document.createElement( o.wrapperEls ); + } + buttonIcon = o.icon ? document.createElement( "span" ) : null; + + if ( attachEvents && !buttonElements) { + attachEvents(); + } + + // if not, try to find closest theme container + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( el, "c" ); + } + + buttonClass = "ui-btn ui-btn-up-" + o.theme; + buttonClass += o.inline ? " ui-btn-inline" : ""; + buttonClass += o.shadow ? " ui-shadow" : ""; + buttonClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.mini !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.mini ? " ui-mini" : " ui-fullsize"; + } + + if ( o.inline !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.inline === false ? " ui-btn-block" : " ui-btn-inline"; + } + + + if ( o.icon ) { + o.icon = "ui-icon-" + o.icon; + o.iconpos = o.iconpos || "left"; + + iconClass = "ui-icon " + o.icon; + + if ( o.iconshadow ) { + iconClass += " ui-icon-shadow"; + } + + if ( o.iconsize ) { + iconClass += " ui-iconsize-" + o.iconsize; + } + } + + if ( o.iconpos ) { + buttonClass += " ui-btn-icon-" + o.iconpos; + + if ( o.iconpos == "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + } + + innerClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.iconpos && o.iconpos === "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + + if ( buttonElements ) { + el.removeClass( buttonElements.bcls || "" ); + } + el.removeClass( "ui-link" ).addClass( buttonClass ); + + buttonInner.className = innerClass; + + buttonText.className = textClass; + if ( !buttonElements ) { + buttonInner.appendChild( buttonText ); + } + if ( buttonIcon ) { + buttonIcon.className = iconClass; + if ( !(buttonElements && buttonElements.icon) ) { + buttonIcon.appendChild( document.createTextNode("\u00a0") ); + buttonInner.appendChild( buttonIcon ); + } + } + + while ( e.firstChild && !buttonElements) { + buttonText.appendChild( e.firstChild ); + } + + if ( !buttonElements ) { + e.appendChild( buttonInner ); + } + + // Assign a structure containing the elements of this button to the elements of this button. This + // will allow us to recognize this as an already-enhanced button in future calls to buttonMarkup(). + buttonElements = { + bcls : buttonClass, + outer : e, + inner : buttonInner, + text : buttonText, + icon : buttonIcon + }; + + $.data(e, 'buttonElements', buttonElements); + $.data(buttonInner, 'buttonElements', buttonElements); + $.data(buttonText, 'buttonElements', buttonElements); + if (buttonIcon) { + $.data(buttonIcon, 'buttonElements', buttonElements); + } + } + + return this; +}; + +$.fn.buttonMarkup.defaults = { + corners: true, + shadow: true, + iconshadow: true, + iconsize: 18, + wrapperEls: "span" +}; + +function closestEnabledButton( element ) { + var cname; + + while ( element ) { + // Note that we check for typeof className below because the element we + // handed could be in an SVG DOM where className on SVG elements is defined to + // be of a different type (SVGAnimatedString). We only operate on HTML DOM + // elements, so we look for plain "string". + cname = ( typeof element.className === 'string' ) && (element.className + ' '); + if ( cname && cname.indexOf("ui-btn ") > -1 && cname.indexOf("ui-disabled ") < 0 ) { + break; + } + + element = element.parentNode; + } + + return element; +} + + +})(jQuery); -- cgit v1.2.3 From ca3c01063b2c1f3e8f5ed0ff6b63a1226ab084f0 Mon Sep 17 00:00:00 2001 From: RaNaN Date: Tue, 21 Aug 2012 19:56:48 +0200 Subject: added jqueryui amd version --- module/web/static/js/default.js | 5 +- module/web/static/js/libs/jquery-ui-1.8.22.min.js | 125 -- module/web/static/js/libs/jqueryui/accordion.js | 614 +++++++ module/web/static/js/libs/jqueryui/autocomplete.js | 634 +++++++ module/web/static/js/libs/jqueryui/button.js | 417 +++++ module/web/static/js/libs/jqueryui/core.js | 337 ++++ module/web/static/js/libs/jqueryui/datepicker.js | 1857 ++++++++++++++++++++ module/web/static/js/libs/jqueryui/dialog.js | 869 +++++++++ module/web/static/js/libs/jqueryui/draggable.js | 836 +++++++++ module/web/static/js/libs/jqueryui/droppable.js | 299 ++++ .../web/static/js/libs/jqueryui/effects/blind.js | 52 + .../web/static/js/libs/jqueryui/effects/bounce.js | 81 + module/web/static/js/libs/jqueryui/effects/clip.js | 57 + module/web/static/js/libs/jqueryui/effects/core.js | 615 +++++++ module/web/static/js/libs/jqueryui/effects/drop.js | 53 + .../web/static/js/libs/jqueryui/effects/explode.js | 82 + module/web/static/js/libs/jqueryui/effects/fade.js | 35 + module/web/static/js/libs/jqueryui/effects/fold.js | 59 + .../static/js/libs/jqueryui/effects/highlight.js | 53 + .../web/static/js/libs/jqueryui/effects/pulsate.js | 54 + .../web/static/js/libs/jqueryui/effects/scale.js | 181 ++ .../web/static/js/libs/jqueryui/effects/shake.js | 60 + .../web/static/js/libs/jqueryui/effects/slide.js | 53 + .../static/js/libs/jqueryui/effects/transfer.js | 48 + module/web/static/js/libs/jqueryui/mouse.js | 170 ++ module/web/static/js/libs/jqueryui/position.js | 311 ++++ module/web/static/js/libs/jqueryui/progressbar.js | 112 ++ module/web/static/js/libs/jqueryui/resizable.js | 810 +++++++++ module/web/static/js/libs/jqueryui/selectable.js | 270 +++ module/web/static/js/libs/jqueryui/slider.js | 665 +++++++ module/web/static/js/libs/jqueryui/sortable.js | 1087 ++++++++++++ module/web/static/js/libs/jqueryui/tabs.js | 760 ++++++++ module/web/static/js/libs/jqueryui/widget.js | 275 +++ module/web/static/js/views/headerView.js | 2 +- 34 files changed, 11809 insertions(+), 129 deletions(-) delete mode 100644 module/web/static/js/libs/jquery-ui-1.8.22.min.js create mode 100644 module/web/static/js/libs/jqueryui/accordion.js create mode 100644 module/web/static/js/libs/jqueryui/autocomplete.js create mode 100644 module/web/static/js/libs/jqueryui/button.js create mode 100644 module/web/static/js/libs/jqueryui/core.js create mode 100644 module/web/static/js/libs/jqueryui/datepicker.js create mode 100644 module/web/static/js/libs/jqueryui/dialog.js create mode 100644 module/web/static/js/libs/jqueryui/draggable.js create mode 100644 module/web/static/js/libs/jqueryui/droppable.js create mode 100644 module/web/static/js/libs/jqueryui/effects/blind.js create mode 100644 module/web/static/js/libs/jqueryui/effects/bounce.js create mode 100644 module/web/static/js/libs/jqueryui/effects/clip.js create mode 100644 module/web/static/js/libs/jqueryui/effects/core.js create mode 100644 module/web/static/js/libs/jqueryui/effects/drop.js create mode 100644 module/web/static/js/libs/jqueryui/effects/explode.js create mode 100644 module/web/static/js/libs/jqueryui/effects/fade.js create mode 100644 module/web/static/js/libs/jqueryui/effects/fold.js create mode 100644 module/web/static/js/libs/jqueryui/effects/highlight.js create mode 100644 module/web/static/js/libs/jqueryui/effects/pulsate.js create mode 100644 module/web/static/js/libs/jqueryui/effects/scale.js create mode 100644 module/web/static/js/libs/jqueryui/effects/shake.js create mode 100644 module/web/static/js/libs/jqueryui/effects/slide.js create mode 100644 module/web/static/js/libs/jqueryui/effects/transfer.js create mode 100644 module/web/static/js/libs/jqueryui/mouse.js create mode 100644 module/web/static/js/libs/jqueryui/position.js create mode 100644 module/web/static/js/libs/jqueryui/progressbar.js create mode 100644 module/web/static/js/libs/jqueryui/resizable.js create mode 100644 module/web/static/js/libs/jqueryui/selectable.js create mode 100644 module/web/static/js/libs/jqueryui/slider.js create mode 100644 module/web/static/js/libs/jqueryui/sortable.js create mode 100644 module/web/static/js/libs/jqueryui/tabs.js create mode 100644 module/web/static/js/libs/jqueryui/widget.js (limited to 'module/web/static') diff --git a/module/web/static/js/default.js b/module/web/static/js/default.js index a9e377328..05f8ad1c7 100644 --- a/module/web/static/js/default.js +++ b/module/web/static/js/default.js @@ -6,7 +6,7 @@ require.config({ paths:{ jquery:"libs/jquery-1.8.0", - jqueryui:"libs/jquery-ui-1.8.22.min", + jqueryui:"libs/jqueryui", flot:"libs/jquery.flot.min", omniwindow: "libs/jquery.omniwindow", @@ -25,14 +25,13 @@ require.config({ deps:["underscore", "jquery"], exports:"Backbone" //attaches "Backbone" to the window object }, - "jqueryui": ["jquery"], "flot" : ["jquery"], "omniwindow" : ["jquery"] } // end Shim Configuration }); -define('default', ['jquery', 'backbone', 'routers/defaultRouter', 'views/headerView', 'jqueryui'], function ($, Backbone, DefaultRouter, HeaderView) { +define('default', ['jquery', 'backbone', 'routers/defaultRouter', 'views/headerView'], function ($, Backbone, DefaultRouter, HeaderView) { var init = function(){ var view = new HeaderView(); diff --git a/module/web/static/js/libs/jquery-ui-1.8.22.min.js b/module/web/static/js/libs/jquery-ui-1.8.22.min.js deleted file mode 100644 index e36a7f0f6..000000000 --- a/module/web/static/js/libs/jquery-ui-1.8.22.min.js +++ /dev/null @@ -1,125 +0,0 @@ -/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.core.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.22",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a("").outerWidth(1).jquery||a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(b){return function(c){return!!a.data(c,b)}}):function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.curCSS||(a.curCSS=a.css),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.position.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?a.isFunction(b)?this.each(function(c){a(this).offset(b.call(this,c,a(this).offset()))}):this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.draggable.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('
      ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return this.options.iframeFix===!0&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.lefth[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.toph[3]?j-this.offset.click.toph[2]?k-this.offset.click.left=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f=k&&g<=l||h>=k&&h<=l||gl)&&(e>=i&&e<=j||f>=i&&f<=j||ej);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),ea.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.22"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.selectable.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("
      ")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.righth||i.bottome&&i.rightf&&i.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+jf&&b+ka[this.floating?"width":"height"]?l:f0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.containers[d].floating?this.items[i].item.offset().left:this.items[i].item.offset().top;Math.abs(j-h)0?"down":"up")}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.leftthis.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.topthis.containment[3]?h-this.offset.click.topthis.containment[2]?i-this.offset.click.left=0;f--)a.ui.contains(this.containers[f].element[0],this.currentItem[0])&&!c&&(d.push(function(a){return function(b){a._trigger("receive",b,this._uiHash(this))}}.call(this,this.containers[f])),d.push(function(a){return function(b){a._trigger("update",b,this._uiHash(this))}}.call(this,this.containers[f])))}for(var f=this.containers.length-1;f>=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.22",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.autocomplete.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("
        ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length").data("item.autocomplete",c).append(a("        ").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})})(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend(""),d.secondary&&b.append(""),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.dialog.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},f=a.attrFn||{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0,click:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("
        ")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("
        ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("
        ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=a("
        ").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(g);a.each(d,function(a,b){if(a==="click")return;a in f?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.22",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;ic&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.tabs.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
        ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
      • #{label}
        • "},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.22"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.22"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('
        ')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$(''+c+""),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('').addClass(this._triggerClass).html(g==""?f:$("").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;db&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$(''),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a)),this._attachHandlers(a);var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+(c?0:$(document).scrollLeft()),i=document.documentElement.clientHeight+(c?0:$(document).scrollTop());return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+112?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_attachHandlers:function(a){var b=this._get(a,"stepMonths"),c="#"+a.id;a.dpDiv.find("[data-handler]").map(function(){var a={prev:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,-b,"M")},next:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,+b,"M")},hide:function(){window["DP_jQuery_"+dpuuid].datepicker._hideDatepicker()},today:function(){window["DP_jQuery_"+dpuuid].datepicker._gotoToday(c)},selectDay:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectDay(c,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"M"),!1},selectYear:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"Y"),!1}};$(this).bind(this.getAttribute("data-event"),a[this.getAttribute("data-handler")])})},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&pp)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?''+q+"":e?"":''+q+"",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?''+s+"":e?"":''+s+"",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'",x=d?'
        '+(c?w:"")+(this._isInRange(a,v)?'":"")+(c?"":w)+"
        ":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='
        '+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'
        '+"";var R=z?'":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="=5?' class="ui-datepicker-week-end"':"")+">"+''+C[T]+""}Q+=R+"";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z";var _=z?'":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Ym;_+='",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+""}n++,n>11&&(n=0,o++),Q+="
        '+this._get(a,"weekHeader")+"
        '+this._get(a,"calculateWeek")(Y)+""+(bb&&!G?" ":bc?''+Y.getDate()+"":''+Y.getDate()+"")+"
        "+(j?""+(g[0]>0&&N==g[1]-1?'
        ':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
        ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
        ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.22",window["DP_jQuery_"+dpuuid]=$})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.ui.progressbar.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
        ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.22"})})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.core.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=(a.curCSS||a.css)(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.22",save:function(a,b){for(var c=0;c").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;try{e.id}catch(f){e=document.body}return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.fade.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.fold.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.highlight.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}})(jQuery);;/*! jQuery UI - v1.8.22 - 2012-07-24 -* https://github.com/jquery/jquery-ui -* Includes: jquery.effects.pulsate.js -* Copyright (c) 2012 AUTHORS.txt; Licensed MIT, GPL */ -(function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}})(jQuery);; \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/accordion.js b/module/web/static/js/libs/jqueryui/accordion.js new file mode 100644 index 000000000..b5a0a9dd0 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/accordion.js @@ -0,0 +1,614 @@ +define(['jquery','./core','./widget'], function (jQuery) { +/*! + * jQuery UI Accordion 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.23", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/autocomplete.js b/module/web/static/js/libs/jqueryui/autocomplete.js new file mode 100644 index 000000000..dd6bf1119 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/autocomplete.js @@ -0,0 +1,634 @@ +define(['jquery','./core','./widget','./position'], function (jQuery) { +/*! + * jQuery UI Autocomplete 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "
          " ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "
        • " ) + .data( "item.autocomplete", item ) + .append( $( "" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/button.js b/module/web/static/js/libs/jqueryui/button.js new file mode 100644 index 000000000..efc824f71 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/button.js @@ -0,0 +1,417 @@ +define(['jquery','./core','./widget'], function (jQuery) { +/*! + * jQuery UI Button 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "" ); + } + + if ( icons.secondary ) { + buttonElement.append( "" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/core.js b/module/web/static/js/libs/jqueryui/core.js new file mode 100644 index 000000000..771316b5a --- /dev/null +++ b/module/web/static/js/libs/jqueryui/core.js @@ -0,0 +1,337 @@ +define(['jquery'], function (jQuery) { +/*! + * jQuery UI 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.23", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
          + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/datepicker.js b/module/web/static/js/libs/jqueryui/datepicker.js new file mode 100644 index 000000000..331cbd60e --- /dev/null +++ b/module/web/static/js/libs/jqueryui/datepicker.js @@ -0,0 +1,1857 @@ +define(['jquery','./core'], function (jQuery) { +/*! + * jQuery UI Datepicker 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.23" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('
          ')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('
          ')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '          ' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
          ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
          ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
          '; + } + calender += '
          ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
          ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
          ' + this._get(inst, 'weekHeader') + '
          ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
          ' + (isMultiMonth ? '
          ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
          ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
          '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
          '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.23"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/dialog.js b/module/web/static/js/libs/jqueryui/dialog.js new file mode 100644 index 000000000..87e91c0a4 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/dialog.js @@ -0,0 +1,869 @@ +define(['jquery','./core','./widget','./button','./draggable','./mouse','./position','./resizable'], function (jQuery) { +/*! + * jQuery UI Dialog 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
          ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
          ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
          ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
          " ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in button ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.23", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
          ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/draggable.js b/module/web/static/js/libs/jqueryui/draggable.js new file mode 100644 index 000000000..17163fe9e --- /dev/null +++ b/module/web/static/js/libs/jqueryui/draggable.js @@ -0,0 +1,836 @@ +define(['jquery','./core','./mouse','./widget'], function (jQuery) { +/*! + * jQuery UI Draggable 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
          ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + this.helper.addClass("ui-draggable-dragging"); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.23" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/droppable.js b/module/web/static/js/libs/jqueryui/droppable.js new file mode 100644 index 000000000..e16574638 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/droppable.js @@ -0,0 +1,299 @@ +define(['jquery','./core','./widget','./mouse','./draggable'], function (jQuery) { +/*! + * jQuery UI Droppable 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.23" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/blind.js b/module/web/static/js/libs/jqueryui/effects/blind.js new file mode 100644 index 000000000..c00004566 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/blind.js @@ -0,0 +1,52 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Blind 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/bounce.js b/module/web/static/js/libs/jqueryui/effects/bounce.js new file mode 100644 index 000000000..41d1c6885 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/bounce.js @@ -0,0 +1,81 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Bounce 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight(true) / 3 : el.outerWidth(true) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/clip.js b/module/web/static/js/libs/jqueryui/effects/clip.js new file mode 100644 index 000000000..7ff13d5d1 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/clip.js @@ -0,0 +1,57 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Clip 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/core.js b/module/web/static/js/libs/jqueryui/effects/core.js new file mode 100644 index 000000000..9900118aa --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/core.js @@ -0,0 +1,615 @@ +define(['jquery'], function (jQuery) { +/*! + * jQuery UI Effects 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css + color = ($.curCSS || $.css)(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.23", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
          ') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +}); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < .5 ? + easeIn( p * 2 ) / 2 : + easeIn( p * -2 + 2 ) / -2 + 1; + }; +}); + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/drop.js b/module/web/static/js/libs/jqueryui/effects/drop.js new file mode 100644 index 000000000..2ee4cf6d2 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/drop.js @@ -0,0 +1,53 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Drop 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) / 2 : el.outerWidth( true ) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/explode.js b/module/web/static/js/libs/jqueryui/effects/explode.js new file mode 100644 index 000000000..e7f3024a7 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/explode.js @@ -0,0 +1,82 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Explode 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/fade.js b/module/web/static/js/libs/jqueryui/effects/fade.js new file mode 100644 index 000000000..c31973c74 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/fade.js @@ -0,0 +1,35 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Fade 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/fold.js b/module/web/static/js/libs/jqueryui/effects/fold.js new file mode 100644 index 000000000..540c77c16 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/fold.js @@ -0,0 +1,59 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Fold 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/highlight.js b/module/web/static/js/libs/jqueryui/effects/highlight.js new file mode 100644 index 000000000..f7a2f2bcd --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/highlight.js @@ -0,0 +1,53 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Highlight 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/pulsate.js b/module/web/static/js/libs/jqueryui/effects/pulsate.js new file mode 100644 index 000000000..95105801c --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/pulsate.js @@ -0,0 +1,54 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Pulsate 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/scale.js b/module/web/static/js/libs/jqueryui/effects/scale.js new file mode 100644 index 000000000..1f31ed36e --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/scale.js @@ -0,0 +1,181 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Scale 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/shake.js b/module/web/static/js/libs/jqueryui/effects/shake.js new file mode 100644 index 000000000..9f615050b --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/shake.js @@ -0,0 +1,60 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Shake 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/slide.js b/module/web/static/js/libs/jqueryui/effects/slide.js new file mode 100644 index 000000000..d39877fa9 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/slide.js @@ -0,0 +1,53 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Slide 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) : el.outerWidth( true )); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/effects/transfer.js b/module/web/static/js/libs/jqueryui/effects/transfer.js new file mode 100644 index 000000000..5704255ab --- /dev/null +++ b/module/web/static/js/libs/jqueryui/effects/transfer.js @@ -0,0 +1,48 @@ +define(['jquery','./effects/core'], function (jQuery) { +/*! + * jQuery UI Effects Transfer 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
          ') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/mouse.js b/module/web/static/js/libs/jqueryui/mouse.js new file mode 100644 index 000000000..e2f1695bc --- /dev/null +++ b/module/web/static/js/libs/jqueryui/mouse.js @@ -0,0 +1,170 @@ +define(['jquery','./widget'], function (jQuery) { +/*! + * jQuery UI Mouse 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/position.js b/module/web/static/js/libs/jqueryui/position.js new file mode 100644 index 000000000..0b4b33656 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/position.js @@ -0,0 +1,311 @@ +define(['jquery'], function (jQuery) { +/*! + * jQuery UI Position 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/progressbar.js b/module/web/static/js/libs/jqueryui/progressbar.js new file mode 100644 index 000000000..fceee99fa --- /dev/null +++ b/module/web/static/js/libs/jqueryui/progressbar.js @@ -0,0 +1,112 @@ +define(['jquery','./core','./widget'], function (jQuery) { +/*! + * jQuery UI Progressbar 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
          " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.23" +}); + +})( jQuery ); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/resizable.js b/module/web/static/js/libs/jqueryui/resizable.js new file mode 100644 index 000000000..4b0900140 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/resizable.js @@ -0,0 +1,810 @@ +define(['jquery','./core','./mouse','./widget'], function (jQuery) { +/*! + * jQuery UI Resizable 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
          ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
          '); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
          '); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.23" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/selectable.js b/module/web/static/js/libs/jqueryui/selectable.js new file mode 100644 index 000000000..abefc9d2c --- /dev/null +++ b/module/web/static/js/libs/jqueryui/selectable.js @@ -0,0 +1,270 @@ +define(['jquery','./core','./mouse','./widget'], function (jQuery) { +/*! + * jQuery UI Selectable 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
          "); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.23" +}); + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/slider.js b/module/web/static/js/libs/jqueryui/slider.js new file mode 100644 index 000000000..be11afcdf --- /dev/null +++ b/module/web/static/js/libs/jqueryui/slider.js @@ -0,0 +1,665 @@ +define(['jquery','./core','./mouse','./widget'], function (jQuery) { +/*! + * jQuery UI Slider 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
          " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.23" +}); + +}(jQuery)); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/sortable.js b/module/web/static/js/libs/jqueryui/sortable.js new file mode 100644 index 000000000..ae808d561 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/sortable.js @@ -0,0 +1,1087 @@ +define(['jquery','./core','./mouse','./widget'], function (jQuery) { +/*! + * jQuery UI Sortable 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = (cur - base > 0) ? 'down' : 'up'; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.23" +}); + +})(jQuery); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/tabs.js b/module/web/static/js/libs/jqueryui/tabs.js new file mode 100644 index 000000000..335aadf83 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/tabs.js @@ -0,0 +1,760 @@ +define(['jquery','./core','./widget'], function (jQuery) { +/*! + * jQuery UI Tabs 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
          ", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
        • #{label}
          • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
        • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.23" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); + +}); \ No newline at end of file diff --git a/module/web/static/js/libs/jqueryui/widget.js b/module/web/static/js/libs/jqueryui/widget.js new file mode 100644 index 000000000..9c6dc93a8 --- /dev/null +++ b/module/web/static/js/libs/jqueryui/widget.js @@ -0,0 +1,275 @@ +define(['jquery'], function (jQuery) { +/*! + * jQuery UI Widget 1.8.23 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +}); \ No newline at end of file diff --git a/module/web/static/js/views/headerView.js b/module/web/static/js/views/headerView.js index 26f2ea706..0c6447c3e 100644 --- a/module/web/static/js/views/headerView.js +++ b/module/web/static/js/views/headerView.js @@ -1,4 +1,4 @@ -define(['jquery', 'backbone', 'flot'], function($, Backbone){ +define(['jquery', 'backbone', 'flot', 'jqueryui/progressbar'], function($, Backbone){ // Renders the header with all information return Backbone.View.extend({ -- cgit v1.2.3 From 459f4291cb7ae4174d7c7dfa6a06bf89e3538338 Mon Sep 17 00:00:00 2001 From: RaNaN Date: Sun, 26 Aug 2012 17:46:04 +0200 Subject: dependency updates --- module/web/static/js/default.js | 4 +- module/web/static/js/libs/lodash-0.4.2.js | 3803 ------------------------- module/web/static/js/libs/lodash-0.5.2.js | 4263 ++++++++++++++++++++++++++++ module/web/static/js/libs/require-2.0.5.js | 2053 -------------- module/web/static/js/libs/require-2.0.6.js | 2041 +++++++++++++ module/web/static/js/models/model.js | 2 +- module/web/static/js/plugins/text-2.0.3.js | 308 ++ 7 files changed, 6615 insertions(+), 5859 deletions(-) delete mode 100644 module/web/static/js/libs/lodash-0.4.2.js create mode 100644 module/web/static/js/libs/lodash-0.5.2.js delete mode 100644 module/web/static/js/libs/require-2.0.5.js create mode 100644 module/web/static/js/libs/require-2.0.6.js create mode 100644 module/web/static/js/plugins/text-2.0.3.js (limited to 'module/web/static') diff --git a/module/web/static/js/default.js b/module/web/static/js/default.js index 05f8ad1c7..3ec133a87 100644 --- a/module/web/static/js/default.js +++ b/module/web/static/js/default.js @@ -10,11 +10,11 @@ require.config({ flot:"libs/jquery.flot.min", omniwindow: "libs/jquery.omniwindow", - underscore:"libs/lodash-0.4.2", + underscore:"libs/lodash-0.5.2", backbone:"libs/backbone-0.9.2", // Require.js Plugins - text:"plugins/text-2.0.0" + text:"plugins/text-2.0.3" }, diff --git a/module/web/static/js/libs/lodash-0.4.2.js b/module/web/static/js/libs/lodash-0.4.2.js deleted file mode 100644 index 67806db05..000000000 --- a/module/web/static/js/libs/lodash-0.4.2.js +++ /dev/null @@ -1,3803 +0,0 @@ -/*! - * Lo-Dash v0.4.2 - * Copyright 2012 John-David Dalton - * Based on Underscore.js 1.3.3, copyright 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. - * - * Available under MIT license - */ -;(function(window, undefined) { - 'use strict'; - - /** - * Used to cache the last `_.templateSettings.evaluate` delimiter to avoid - * unnecessarily assigning `reEvaluateDelimiter` a new generated regexp. - * Assigned in `_.template`. - */ - var lastEvaluateDelimiter; - - /** - * Used to cache the last template `options.variable` to avoid unnecessarily - * assigning `reDoubleVariable` a new generated regexp. Assigned in `_.template`. - */ - var lastVariable; - - /** - * Used to match potentially incorrect data object references, like `obj.obj`, - * in compiled templates. Assigned in `_.template`. - */ - var reDoubleVariable; - - /** - * Used to match "evaluate" delimiters, including internal delimiters, - * in template text. Assigned in `_.template`. - */ - var reEvaluateDelimiter; - - /** Detect free variable `exports` */ - var freeExports = typeof exports == 'object' && exports && - (typeof global == 'object' && global && global == global.global && (window = global), exports); - - /** Native prototype shortcuts */ - var ArrayProto = Array.prototype, - ObjectProto = Object.prototype; - - /** Used to generate unique IDs */ - var idCounter = 0; - - /** Used to restore the original `_` reference in `noConflict` */ - var oldDash = window._; - - /** Used to detect delimiter values that should be processed by `tokenizeEvaluate` */ - var reComplexDelimiter = /[-+=!~*%&^<>|{(\/]|\[\D|\b(?:delete|in|instanceof|new|typeof|void)\b/; - - /** Used to match empty string literals in compiled template source */ - var reEmptyStringLeading = /\b__p \+= '';/g, - reEmptyStringMiddle = /\b(__p \+=) '' \+/g, - reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; - - /** Used to insert the data object variable into compiled template source */ - var reInsertVariable = /(?:__e|__t = )\(\s*(?![\d\s"']|this\.)/g; - - /** Used to detect if a method is native */ - var reNative = RegExp('^' + - (ObjectProto.valueOf + '') - .replace(/[.*+?^=!:${}()|[\]\/\\]/g, '\\$&') - .replace(/valueOf|for [^\]]+/g, '.+?') + '$' - ); - - /** Used to match tokens in template text */ - var reToken = /__token__(\d+)/g; - - /** Used to match unescaped characters in strings for inclusion in HTML */ - var reUnescapedHtml = /[&<"']/g; - - /** Used to match unescaped characters in compiled string literals */ - var reUnescapedString = /['\n\r\t\u2028\u2029\\]/g; - - /** Used to fix the JScript [[DontEnum]] bug */ - var shadowed = [ - 'constructor', 'hasOwnProperty', 'isPrototypeOf', 'propertyIsEnumerable', - 'toLocaleString', 'toString', 'valueOf' - ]; - - /** Used to make template sourceURLs easier to identify */ - var templateCounter = 0; - - /** Used to replace template delimiters */ - var token = '__token__'; - - /** Used to store tokenized template text snippets */ - var tokenized = []; - - /** Native method shortcuts */ - var concat = ArrayProto.concat, - hasOwnProperty = ObjectProto.hasOwnProperty, - push = ArrayProto.push, - propertyIsEnumerable = ObjectProto.propertyIsEnumerable, - slice = ArrayProto.slice, - toString = ObjectProto.toString; - - /* Native method shortcuts for methods with the same name as other `lodash` methods */ - var nativeBind = reNative.test(nativeBind = slice.bind) && nativeBind, - nativeIsArray = reNative.test(nativeIsArray = Array.isArray) && nativeIsArray, - nativeIsFinite = window.isFinite, - nativeKeys = reNative.test(nativeKeys = Object.keys) && nativeKeys; - - /** `Object#toString` result shortcuts */ - var arrayClass = '[object Array]', - boolClass = '[object Boolean]', - dateClass = '[object Date]', - funcClass = '[object Function]', - numberClass = '[object Number]', - regexpClass = '[object RegExp]', - stringClass = '[object String]'; - - /** Timer shortcuts */ - var clearTimeout = window.clearTimeout, - setTimeout = window.setTimeout; - - /** - * Detect the JScript [[DontEnum]] bug: - * In IE < 9 an objects own properties, shadowing non-enumerable ones, are - * made non-enumerable as well. - */ - var hasDontEnumBug = !propertyIsEnumerable.call({ 'valueOf': 0 }, 'valueOf'); - - /** Detect if `Array#slice` cannot be used to convert strings to arrays (Opera < 10.52) */ - var noArraySliceOnStrings = slice.call('x')[0] != 'x'; - - /** - * Detect lack of support for accessing string characters by index: - * IE < 8 can't access characters by index and IE 8 can only access - * characters by index on string literals. - */ - var noCharByIndex = ('x'[0] + Object('x')[0]) != 'xx'; - - /* Detect if `Function#bind` exists and is inferred to be fast (all but V8) */ - var isBindFast = nativeBind && /\n|Opera/.test(nativeBind + toString.call(window.opera)); - - /* Detect if `Object.keys` exists and is inferred to be fast (V8, Opera, IE) */ - var isKeysFast = nativeKeys && /^.+$|true/.test(nativeKeys + !!window.attachEvent); - - /** Detect if sourceURL syntax is usable without erroring */ - try { - // Adobe's and Narwhal's JS engines will error - var useSourceURL = (Function('//@')(), true); - } catch(e){ } - - /** - * Used to escape characters for inclusion in HTML. - * The `>` and `/` characters don't require escaping in HTML and have no - * special meaning unless they're part of a tag or an unquoted attribute value - * http://mathiasbynens.be/notes/ambiguous-ampersands (semi-related fun fact) - */ - var htmlEscapes = { - '&': '&', - '<': '<', - '"': '"', - "'": ''' - }; - - /** Used to determine if values are of the language type Object */ - var objectTypes = { - 'boolean': false, - 'function': true, - 'object': true, - 'number': false, - 'string': false, - 'undefined': false - }; - - /** Used to escape characters for inclusion in compiled string literals */ - var stringEscapes = { - '\\': '\\', - "'": "'", - '\n': 'n', - '\r': 'r', - '\t': 't', - '\u2028': 'u2028', - '\u2029': 'u2029' - }; - - /*--------------------------------------------------------------------------*/ - - /** - * The `lodash` function. - * - * @name _ - * @constructor - * @param {Mixed} value The value to wrap in a `LoDash` instance. - * @returns {Object} Returns a `LoDash` instance. - */ - function lodash(value) { - // allow invoking `lodash` without the `new` operator - return new LoDash(value); - } - - /** - * Creates a `LoDash` instance that wraps a value to allow chaining. - * - * @private - * @constructor - * @param {Mixed} value The value to wrap. - */ - function LoDash(value) { - // exit early if already wrapped - if (value && value._wrapped) { - return value; - } - this._wrapped = value; - } - - /** - * By default, Lo-Dash uses embedded Ruby (ERB) style template delimiters, - * change the following template settings to use alternative delimiters. - * - * @static - * @memberOf _ - * @type Object - */ - lodash.templateSettings = { - - /** - * Used to detect `data` property values to be HTML-escaped. - * - * @static - * @memberOf _.templateSettings - * @type RegExp - */ - 'escape': /<%-([\s\S]+?)%>/g, - - /** - * Used to detect code to be evaluated. - * - * @static - * @memberOf _.templateSettings - * @type RegExp - */ - 'evaluate': /<%([\s\S]+?)%>/g, - - /** - * Used to detect `data` property values to inject. - * - * @static - * @memberOf _.templateSettings - * @type RegExp - */ - 'interpolate': /<%=([\s\S]+?)%>/g, - - /** - * Used to reference the data object in the template text. - * - * @static - * @memberOf _.templateSettings - * @type String - */ - 'variable': 'obj' - }; - - /*--------------------------------------------------------------------------*/ - - /** - * The template used to create iterator functions. - * - * @private - * @param {Obect} data The data object used to populate the text. - * @returns {String} Returns the interpolated text. - */ - var iteratorTemplate = template( - // conditional strict mode - '<% if (useStrict) { %>\'use strict\';\n<% } %>' + - - // the `iteratee` may be reassigned by the `top` snippet - 'var index, iteratee = <%= firstArg %>, ' + - // assign the `result` variable an initial value - 'result<% if (init) { %> = <%= init %><% } %>;\n' + - // add code to exit early or do so if the first argument is falsey - '<%= exit %>;\n' + - // add code after the exit snippet but before the iteration branches - '<%= top %>;\n' + - - // the following branch is for iterating arrays and array-like objects - '<% if (arrayBranch) { %>' + - 'var length = iteratee.length; index = -1;' + - ' <% if (objectBranch) { %>\nif (length === length >>> 0) {<% } %>' + - - // add support for accessing string characters by index if needed - ' <% if (noCharByIndex) { %>\n' + - ' if (toString.call(iteratee) == stringClass) {\n' + - ' iteratee = iteratee.split(\'\')\n' + - ' }' + - ' <% } %>\n' + - - ' <%= arrayBranch.beforeLoop %>;\n' + - ' while (++index < length) {\n' + - ' <%= arrayBranch.inLoop %>\n' + - ' }' + - ' <% if (objectBranch) { %>\n}<% } %>' + - '<% } %>' + - - // the following branch is for iterating an object's own/inherited properties - '<% if (objectBranch) { %>' + - ' <% if (arrayBranch) { %>\nelse {<% } %>' + - ' <% if (!hasDontEnumBug) { %>\n' + - ' var skipProto = typeof iteratee == \'function\' && \n' + - ' propertyIsEnumerable.call(iteratee, \'prototype\');\n' + - ' <% } %>' + - - // iterate own properties using `Object.keys` if it's fast - ' <% if (isKeysFast && useHas) { %>\n' + - ' var props = nativeKeys(iteratee),\n' + - ' propIndex = -1,\n' + - ' length = props.length;\n\n' + - ' <%= objectBranch.beforeLoop %>;\n' + - ' while (++propIndex < length) {\n' + - ' index = props[propIndex];\n' + - ' if (!(skipProto && index == \'prototype\')) {\n' + - ' <%= objectBranch.inLoop %>\n' + - ' }\n' + - ' }' + - - // else using a for-in loop - ' <% } else { %>\n' + - ' <%= objectBranch.beforeLoop %>;\n' + - ' for (index in iteratee) {' + - ' <% if (hasDontEnumBug) { %>\n' + - ' <% if (useHas) { %>if (hasOwnProperty.call(iteratee, index)) {\n <% } %>' + - ' <%= objectBranch.inLoop %>;\n' + - ' <% if (useHas) { %>}<% } %>' + - ' <% } else { %>\n' + - - // Firefox < 3.6, Opera > 9.50 - Opera < 11.60, and Safari < 5.1 - // (if the prototype or a property on the prototype has been set) - // incorrectly sets a function's `prototype` property [[Enumerable]] - // value to `true`. Because of this Lo-Dash standardizes on skipping - // the the `prototype` property of functions regardless of its - // [[Enumerable]] value. - ' if (!(skipProto && index == \'prototype\')<% if (useHas) { %> &&\n' + - ' hasOwnProperty.call(iteratee, index)<% } %>) {\n' + - ' <%= objectBranch.inLoop %>\n' + - ' }' + - ' <% } %>\n' + - ' }' + - ' <% } %>' + - - // Because IE < 9 can't set the `[[Enumerable]]` attribute of an - // existing property and the `constructor` property of a prototype - // defaults to non-enumerable, Lo-Dash skips the `constructor` - // property when it infers it's iterating over a `prototype` object. - ' <% if (hasDontEnumBug) { %>\n\n' + - ' var ctor = iteratee.constructor;\n' + - ' <% for (var k = 0; k < 7; k++) { %>\n' + - ' index = \'<%= shadowed[k] %>\';\n' + - ' if (<%' + - ' if (shadowed[k] == \'constructor\') {' + - ' %>!(ctor && ctor.prototype === iteratee) && <%' + - ' } %>hasOwnProperty.call(iteratee, index)) {\n' + - ' <%= objectBranch.inLoop %>\n' + - ' }' + - ' <% } %>' + - ' <% } %>' + - ' <% if (arrayBranch) { %>\n}<% } %>' + - '<% } %>\n' + - - // add code to the bottom of the iteration function - '<%= bottom %>;\n' + - // finally, return the `result` - 'return result' - ); - - /** - * Reusable iterator options shared by - * `every`, `filter`, `find`, `forEach`, `forIn`, `forOwn`, `groupBy`, `map`, - * `reject`, `some`, and `sortBy`. - */ - var baseIteratorOptions = { - 'args': 'collection, callback, thisArg', - 'init': 'collection', - 'top': - 'if (!callback) {\n' + - ' callback = identity\n' + - '}\n' + - 'else if (thisArg) {\n' + - ' callback = iteratorBind(callback, thisArg)\n' + - '}', - 'inLoop': 'callback(iteratee[index], index, collection)' - }; - - /** Reusable iterator options for `every` and `some` */ - var everyIteratorOptions = { - 'init': 'true', - 'inLoop': 'if (!callback(iteratee[index], index, collection)) return !result' - }; - - /** Reusable iterator options for `defaults` and `extend` */ - var extendIteratorOptions = { - 'useHas': false, - 'useStrict': false, - 'args': 'object', - 'init': 'object', - 'top': - 'for (var iterateeIndex = 1, length = arguments.length; iterateeIndex < length; iterateeIndex++) {\n' + - ' iteratee = arguments[iterateeIndex];\n' + - (hasDontEnumBug ? ' if (iteratee) {' : ''), - 'inLoop': 'result[index] = iteratee[index]', - 'bottom': (hasDontEnumBug ? ' }\n' : '') + '}' - }; - - /** Reusable iterator options for `filter` and `reject` */ - var filterIteratorOptions = { - 'init': '[]', - 'inLoop': 'callback(iteratee[index], index, collection) && result.push(iteratee[index])' - }; - - /** Reusable iterator options for `find`, `forEach`, `forIn`, and `forOwn` */ - var forEachIteratorOptions = { - 'top': 'if (thisArg) callback = iteratorBind(callback, thisArg)' - }; - - /** Reusable iterator options for `forIn` and `forOwn` */ - var forOwnIteratorOptions = { - 'inLoop': { - 'object': baseIteratorOptions.inLoop - } - }; - - /** Reusable iterator options for `invoke`, `map`, `pluck`, and `sortBy` */ - var mapIteratorOptions = { - 'init': '', - 'exit': 'if (!collection) return []', - 'beforeLoop': { - 'array': 'result = Array(length)', - 'object': 'result = ' + (isKeysFast ? 'Array(length)' : '[]') - }, - 'inLoop': { - 'array': 'result[index] = callback(iteratee[index], index, collection)', - 'object': 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + '(callback(iteratee[index], index, collection))' - } - }; - - /*--------------------------------------------------------------------------*/ - - /** - * Creates a new function optimized for searching large arrays for a given `value`, - * starting at `fromIndex`, using strict equality for comparisons, i.e. `===`. - * - * @private - * @param {Array} array The array to search. - * @param {Mixed} value The value to search for. - * @param {Number} [fromIndex=0] The index to start searching from. - * @param {Number} [largeSize=30] The length at which an array is considered large. - * @returns {Boolean} Returns `true` if `value` is found, else `false`. - */ - function cachedContains(array, fromIndex, largeSize) { - fromIndex || (fromIndex = 0); - - var length = array.length, - isLarge = (length - fromIndex) >= (largeSize || 30), - cache = isLarge ? {} : array; - - if (isLarge) { - // init value cache - var key, - index = fromIndex - 1; - - while (++index < length) { - // manually coerce `value` to string because `hasOwnProperty`, in some - // older versions of Firefox, coerces objects incorrectly - key = array[index] + ''; - (hasOwnProperty.call(cache, key) ? cache[key] : (cache[key] = [])).push(array[index]); - } - } - return function(value) { - if (isLarge) { - var key = value + ''; - return hasOwnProperty.call(cache, key) && indexOf(cache[key], value) > -1; - } - return indexOf(cache, value, fromIndex) > -1; - } - } - - /** - * Creates compiled iteration functions. The iteration function will be created - * to iterate over only objects if the first argument of `options.args` is - * "object" or `options.inLoop.array` is falsey. - * - * @private - * @param {Object} [options1, options2, ...] The compile options objects. - * - * useHas - A boolean to specify whether or not to use `hasOwnProperty` checks - * in the object loop. - * - * useStrict - A boolean to specify whether or not to include the ES5 - * "use strict" directive. - * - * args - A string of comma separated arguments the iteration function will - * accept. - * - * init - A string to specify the initial value of the `result` variable. - * - * exit - A string of code to use in place of the default exit-early check - * of `if (!arguments[0]) return result`. - * - * top - A string of code to execute after the exit-early check but before - * the iteration branches. - * - * beforeLoop - A string or object containing an "array" or "object" property - * of code to execute before the array or object loops. - * - * inLoop - A string or object containing an "array" or "object" property - * of code to execute in the array or object loops. - * - * bottom - A string of code to execute after the iteration branches but - * before the `result` is returned. - * - * @returns {Function} Returns the compiled function. - */ - function createIterator() { - var object, - prop, - value, - index = -1, - length = arguments.length; - - // merge options into a template data object - var data = { - 'bottom': '', - 'exit': '', - 'init': '', - 'top': '', - 'arrayBranch': { 'beforeLoop': '' }, - 'objectBranch': { 'beforeLoop': '' } - }; - - while (++index < length) { - object = arguments[index]; - for (prop in object) { - value = (value = object[prop]) == null ? '' : value; - // keep this regexp explicit for the build pre-process - if (/beforeLoop|inLoop/.test(prop)) { - if (typeof value == 'string') { - value = { 'array': value, 'object': value }; - } - data.arrayBranch[prop] = value.array; - data.objectBranch[prop] = value.object; - } else { - data[prop] = value; - } - } - } - // set additional template `data` values - var args = data.args, - firstArg = /^[^,]+/.exec(args)[0]; - - data.firstArg = firstArg; - data.hasDontEnumBug = hasDontEnumBug; - data.isKeysFast = isKeysFast; - data.shadowed = shadowed; - data.useHas = data.useHas !== false; - data.useStrict = data.useStrict !== false; - - if (!('noCharByIndex' in data)) { - data.noCharByIndex = noCharByIndex; - } - if (!data.exit) { - data.exit = 'if (!' + firstArg + ') return result'; - } - if (firstArg != 'collection' || !data.arrayBranch.inLoop) { - data.arrayBranch = null; - } - // create the function factory - var factory = Function( - 'arrayClass, bind, compareAscending, funcClass, hasOwnProperty, identity, ' + - 'iteratorBind, objectTypes, nativeKeys, propertyIsEnumerable, slice, ' + - 'stringClass, toString', - 'return function(' + args + ') {\n' + iteratorTemplate(data) + '\n}' - ); - // return the compiled function - return factory( - arrayClass, bind, compareAscending, funcClass, hasOwnProperty, identity, - iteratorBind, objectTypes, nativeKeys, propertyIsEnumerable, slice, - stringClass, toString - ); - } - - /** - * Used by `sortBy` to compare transformed values of `collection`, sorting - * them in ascending order. - * - * @private - * @param {Object} a The object to compare to `b`. - * @param {Object} b The object to compare to `a`. - * @returns {Number} Returns `-1` if `a` < `b`, `0` if `a` == `b`, or `1` if `a` > `b`. - */ - function compareAscending(a, b) { - a = a.criteria; - b = b.criteria; - - if (a === undefined) { - return 1; - } - if (b === undefined) { - return -1; - } - return a < b ? -1 : a > b ? 1 : 0; - } - - /** - * Used by `template` to replace tokens with their corresponding code snippets. - * - * @private - * @param {String} match The matched token. - * @param {String} index The `tokenized` index of the code snippet. - * @returns {String} Returns the code snippet. - */ - function detokenize(match, index) { - return tokenized[index]; - } - - /** - * Used by `template` to escape characters for inclusion in compiled - * string literals. - * - * @private - * @param {String} match The matched character to escape. - * @returns {String} Returns the escaped character. - */ - function escapeStringChar(match) { - return '\\' + stringEscapes[match]; - } - - /** - * Used by `escape` to escape characters for inclusion in HTML. - * - * @private - * @param {String} match The matched character to escape. - * @returns {String} Returns the escaped character. - */ - function escapeHtmlChar(match) { - return htmlEscapes[match]; - } - - /** - * Creates a new function that, when called, invokes `func` with the `this` - * binding of `thisArg` and the arguments (value, index, object). - * - * @private - * @param {Function} func The function to bind. - * @param {Mixed} [thisArg] The `this` binding of `func`. - * @returns {Function} Returns the new bound function. - */ - function iteratorBind(func, thisArg) { - return function(value, index, object) { - return func.call(thisArg, value, index, object); - }; - } - - /** - * A no-operation function. - * - * @private - */ - function noop() { - // no operation performed - } - - /** - * A shim implementation of `Object.keys` that produces an array of the given - * object's own enumerable property names. - * - * @private - * @param {Object} object The object to inspect. - * @returns {Array} Returns a new array of property names. - */ - var shimKeys = createIterator({ - 'args': 'object', - 'exit': 'if (!(object && objectTypes[typeof object])) throw TypeError()', - 'init': '[]', - 'inLoop': 'result.push(index)' - }); - - /** - * Used by `template` to replace "escape" template delimiters with tokens. - * - * @private - * @param {String} match The matched template delimiter. - * @param {String} value The delimiter value. - * @returns {String} Returns a token. - */ - function tokenizeEscape(match, value) { - if (reComplexDelimiter.test(value)) { - return ''; - } - var index = tokenized.length; - tokenized[index] = "' +\n__e(" + value + ") +\n'"; - return token + index; - } - - /** - * Used by `template` to replace "evaluate" template delimiters, or complex - * "escape" and "interpolate" delimiters, with tokens. - * - * @private - * @param {String} match The matched template delimiter. - * @param {String} value The delimiter value. - * @param {String} escapeValue The "escape" delimiter value. - * @param {String} interpolateValue The "interpolate" delimiter value. - * @returns {String} Returns a token. - */ - function tokenizeEvaluate(match, value, escapeValue, interpolateValue) { - var index = tokenized.length; - if (value) { - tokenized[index] = "';\n" + value + ";\n__p += '" - } else if (escapeValue) { - tokenized[index] = "' +\n__e(" + escapeValue + ") +\n'"; - } else if (interpolateValue) { - tokenized[index] = "' +\n((__t = (" + interpolateValue + ")) == null ? '' : __t) +\n'"; - } - return token + index; - } - - /** - * Used by `template` to replace "interpolate" template delimiters with tokens. - * - * @private - * @param {String} match The matched template delimiter. - * @param {String} value The delimiter value. - * @returns {String} Returns a token. - */ - function tokenizeInterpolate(match, value) { - if (reComplexDelimiter.test(value)) { - return ''; - } - var index = tokenized.length; - tokenized[index] = "' +\n((__t = (" + value + ")) == null ? '' : __t) +\n'"; - return token + index; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Checks if a given `target` value is present in a `collection` using strict - * equality for comparisons, i.e. `===`. - * - * @static - * @memberOf _ - * @alias include - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Mixed} target The value to check for. - * @returns {Boolean} Returns `true` if `target` value is found, else `false`. - * @example - * - * _.contains([1, 2, 3], 3); - * // => true - * - * _.contains({ 'name': 'moe', 'age': 40 }, 'moe'); - * // => true - * - * _.contains('curly', 'ur'); - * // => true - */ - var contains = createIterator({ - 'args': 'collection, target', - 'init': 'false', - 'noCharByIndex': false, - 'beforeLoop': { - 'array': 'if (toString.call(iteratee) == stringClass) return collection.indexOf(target) > -1' - }, - 'inLoop': 'if (iteratee[index] === target) return true' - }); - - /** - * Checks if the `callback` returns a truthy value for **all** elements of a - * `collection`. The `callback` is bound to `thisArg` and invoked with 3 - * arguments; (value, index|key, collection). - * - * @static - * @memberOf _ - * @alias all - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Boolean} Returns `true` if all values pass the callback check, else `false`. - * @example - * - * _.every([true, 1, null, 'yes'], Boolean); - * // => false - */ - var every = createIterator(baseIteratorOptions, everyIteratorOptions); - - /** - * Examines each value in a `collection`, returning an array of all values the - * `callback` returns truthy for. The `callback` is bound to `thisArg` and - * invoked with 3 arguments; (value, index|key, collection). - * - * @static - * @memberOf _ - * @alias select - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Array} Returns a new array of values that passed callback check. - * @example - * - * var evens = _.filter([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); - * // => [2, 4, 6] - */ - var filter = createIterator(baseIteratorOptions, filterIteratorOptions); - - /** - * Examines each value in a `collection`, returning the first one the `callback` - * returns truthy for. The function returns as soon as it finds an acceptable - * value, and does not iterate over the entire `collection`. The `callback` is - * bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection). - * - * @static - * @memberOf _ - * @alias detect - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Mixed} Returns the value that passed the callback check, else `undefined`. - * @example - * - * var even = _.find([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); - * // => 2 - */ - var find = createIterator(baseIteratorOptions, forEachIteratorOptions, { - 'init': '', - 'inLoop': 'if (callback(iteratee[index], index, collection)) return iteratee[index]' - }); - - /** - * Iterates over a `collection`, executing the `callback` for each value in the - * `collection`. The `callback` is bound to `thisArg` and invoked with 3 - * arguments; (value, index|key, collection). - * - * @static - * @memberOf _ - * @alias each - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Array|Object} Returns the `collection`. - * @example - * - * _([1, 2, 3]).forEach(alert).join(','); - * // => alerts each number and returns '1,2,3' - * - * _.forEach({ 'one': 1, 'two': 2, 'three': 3 }, alert); - * // => alerts each number (order is not guaranteed) - */ - var forEach = createIterator(baseIteratorOptions, forEachIteratorOptions); - - /** - * Splits `collection` into sets, grouped by the result of running each value - * through `callback`. The `callback` is bound to `thisArg` and invoked with - * 3 arguments; (value, index|key, collection). The `callback` argument may - * also be the name of a property to group by. - * - * @static - * @memberOf _ - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function|String} callback The function called per iteration or - * property name to group by. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Object} Returns an object of grouped values. - * @example - * - * _.groupBy([1.3, 2.1, 2.4], function(num) { return Math.floor(num); }); - * // => { '1': [1.3], '2': [2.1, 2.4] } - * - * _.groupBy([1.3, 2.1, 2.4], function(num) { return this.floor(num); }, Math); - * // => { '1': [1.3], '2': [2.1, 2.4] } - * - * _.groupBy(['one', 'two', 'three'], 'length'); - * // => { '3': ['one', 'two'], '5': ['three'] } - */ - var groupBy = createIterator(baseIteratorOptions, { - 'init': '{}', - 'top': - 'var prop, isFunc = typeof callback == \'function\';\n' + - 'if (isFunc && thisArg) callback = iteratorBind(callback, thisArg)', - 'inLoop': - 'prop = isFunc\n' + - ' ? callback(iteratee[index], index, collection)\n' + - ' : iteratee[index][callback];\n' + - '(hasOwnProperty.call(result, prop) ? result[prop] : result[prop] = []).push(iteratee[index])' - }); - - /** - * Invokes the method named by `methodName` on each element in the `collection`. - * Additional arguments will be passed to each invoked method. If `methodName` - * is a function it will be invoked for, and `this` bound to, each element - * in the `collection`. - * - * @static - * @memberOf _ - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function|String} methodName The name of the method to invoke or - * the function invoked per iteration. - * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the method with. - * @returns {Array} Returns a new array of values returned from each invoked method. - * @example - * - * _.invoke([[5, 1, 7], [3, 2, 1]], 'sort'); - * // => [[1, 5, 7], [1, 2, 3]] - * - * _.invoke([123, 456], String.prototype.split, ''); - * // => [['1', '2', '3'], ['4', '5', '6']] - */ - var invoke = createIterator(mapIteratorOptions, { - 'args': 'collection, methodName', - 'top': - 'var args = slice.call(arguments, 2),\n' + - ' isFunc = typeof methodName == \'function\'', - 'inLoop': { - 'array': - 'result[index] = (isFunc ? methodName : iteratee[index][methodName])' + - '.apply(iteratee[index], args)', - 'object': - 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + - '((isFunc ? methodName : iteratee[index][methodName]).apply(iteratee[index], args))' - } - }); - - /** - * Produces a new array of values by mapping each element in the `collection` - * through a transformation `callback`. The `callback` is bound to `thisArg` - * and invoked with 3 arguments; (value, index|key, collection). - * - * @static - * @memberOf _ - * @alias collect - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Array} Returns a new array of values returned by the callback. - * @example - * - * _.map([1, 2, 3], function(num) { return num * 3; }); - * // => [3, 6, 9] - * - * _.map({ 'one': 1, 'two': 2, 'three': 3 }, function(num) { return num * 3; }); - * // => [3, 6, 9] (order is not guaranteed) - */ - var map = createIterator(baseIteratorOptions, mapIteratorOptions); - - /** - * Retrieves the value of a specified property from all elements in - * the `collection`. - * - * @static - * @memberOf _ - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {String} property The property to pluck. - * @returns {Array} Returns a new array of property values. - * @example - * - * var stooges = [ - * { 'name': 'moe', 'age': 40 }, - * { 'name': 'larry', 'age': 50 }, - * { 'name': 'curly', 'age': 60 } - * ]; - * - * _.pluck(stooges, 'name'); - * // => ['moe', 'larry', 'curly'] - */ - var pluck = createIterator(mapIteratorOptions, { - 'args': 'collection, property', - 'inLoop': { - 'array': 'result[index] = iteratee[index][property]', - 'object': 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + '(iteratee[index][property])' - } - }); - - /** - * Boils down a `collection` to a single value. The initial state of the - * reduction is `accumulator` and each successive step of it should be returned - * by the `callback`. The `callback` is bound to `thisArg` and invoked with 4 - * arguments; for arrays they are (accumulator, value, index|key, collection). - * - * @static - * @memberOf _ - * @alias foldl, inject - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [accumulator] Initial value of the accumulator. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Mixed} Returns the accumulated value. - * @example - * - * var sum = _.reduce([1, 2, 3], function(memo, num) { return memo + num; }); - * // => 6 - */ - var reduce = createIterator({ - 'args': 'collection, callback, accumulator, thisArg', - 'init': 'accumulator', - 'top': - 'var noaccum = arguments.length < 3;\n' + - 'if (thisArg) callback = iteratorBind(callback, thisArg)', - 'beforeLoop': { - 'array': 'if (noaccum) result = collection[++index]' - }, - 'inLoop': { - 'array': - 'result = callback(result, iteratee[index], index, collection)', - 'object': - 'result = noaccum\n' + - ' ? (noaccum = false, iteratee[index])\n' + - ' : callback(result, iteratee[index], index, collection)' - } - }); - - /** - * The right-associative version of `_.reduce`. - * - * @static - * @memberOf _ - * @alias foldr - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [accumulator] Initial value of the accumulator. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Mixed} Returns the accumulated value. - * @example - * - * var list = [[0, 1], [2, 3], [4, 5]]; - * var flat = _.reduceRight(list, function(a, b) { return a.concat(b); }, []); - * // => [4, 5, 2, 3, 0, 1] - */ - function reduceRight(collection, callback, accumulator, thisArg) { - if (!collection) { - return accumulator; - } - - var length = collection.length, - noaccum = arguments.length < 3; - - if(thisArg) { - callback = iteratorBind(callback, thisArg); - } - if (length === length >>> 0) { - var iteratee = noCharByIndex && toString.call(collection) == stringClass - ? collection.split('') - : collection; - - if (length && noaccum) { - accumulator = iteratee[--length]; - } - while (length--) { - accumulator = callback(accumulator, iteratee[length], length, collection); - } - return accumulator; - } - - var prop, - props = keys(collection); - - length = props.length; - if (length && noaccum) { - accumulator = collection[props[--length]]; - } - while (length--) { - prop = props[length]; - accumulator = callback(accumulator, collection[prop], prop, collection); - } - return accumulator; - } - - /** - * The opposite of `_.filter`, this method returns the values of a - * `collection` that `callback` does **not** return truthy for. - * - * @static - * @memberOf _ - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Array} Returns a new array of values that did **not** pass the callback check. - * @example - * - * var odds = _.reject([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); - * // => [1, 3, 5] - */ - var reject = createIterator(baseIteratorOptions, filterIteratorOptions, { - 'inLoop': '!' + filterIteratorOptions.inLoop - }); - - /** - * Checks if the `callback` returns a truthy value for **any** element of a - * `collection`. The function returns as soon as it finds passing value, and - * does not iterate over the entire `collection`. The `callback` is bound to - * `thisArg` and invoked with 3 arguments; (value, index|key, collection). - * - * @static - * @memberOf _ - * @alias any - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Boolean} Returns `true` if any value passes the callback check, else `false`. - * @example - * - * _.some([null, 0, 'yes', false]); - * // => true - */ - var some = createIterator(baseIteratorOptions, everyIteratorOptions, { - 'init': 'false', - 'inLoop': everyIteratorOptions.inLoop.replace('!', '') - }); - - - /** - * Produces a new sorted array, sorted in ascending order by the results of - * running each element of `collection` through a transformation `callback`. - * The `callback` is bound to `thisArg` and invoked with 3 arguments; - * (value, index|key, collection). The `callback` argument may also be the - * name of a property to sort by (e.g. 'length'). - * - * @static - * @memberOf _ - * @category Collections - * @param {Array|Object|String} collection The collection to iterate over. - * @param {Function|String} callback The function called per iteration or - * property name to sort by. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Array} Returns a new array of sorted values. - * @example - * - * _.sortBy([1, 2, 3], function(num) { return Math.sin(num); }); - * // => [3, 1, 2] - * - * _.sortBy([1, 2, 3], function(num) { return this.sin(num); }, Math); - * // => [3, 1, 2] - * - * _.sortBy(['larry', 'brendan', 'moe'], 'length'); - * // => ['moe', 'larry', 'brendan'] - */ - var sortBy = createIterator(baseIteratorOptions, mapIteratorOptions, { - 'top': - 'if (typeof callback == \'string\') {\n' + - ' var prop = callback;\n' + - ' callback = function(collection) { return collection[prop] }\n' + - '}\n' + - 'else if (thisArg) {\n' + - ' callback = iteratorBind(callback, thisArg)\n' + - '}', - 'inLoop': { - 'array': - 'result[index] = {\n' + - ' criteria: callback(iteratee[index], index, collection),\n' + - ' value: iteratee[index]\n' + - '}', - 'object': - 'result' + (isKeysFast ? '[propIndex] = ' : '.push') + '({\n' + - ' criteria: callback(iteratee[index], index, collection),\n' + - ' value: iteratee[index]\n' + - '})' - }, - 'bottom': - 'result.sort(compareAscending);\n' + - 'length = result.length;\n' + - 'while (length--) {\n' + - ' result[length] = result[length].value\n' + - '}' - }); - - /** - * Converts the `collection`, into an array. Useful for converting the - * `arguments` object. - * - * @static - * @memberOf _ - * @category Collections - * @param {Array|Object|String} collection The collection to convert. - * @returns {Array} Returns the new converted array. - * @example - * - * (function() { return _.toArray(arguments).slice(1); })(1, 2, 3, 4); - * // => [2, 3, 4] - */ - function toArray(collection) { - if (!collection) { - return []; - } - if (collection.toArray && toString.call(collection.toArray) == funcClass) { - return collection.toArray(); - } - var length = collection.length; - if (length === length >>> 0) { - return (noArraySliceOnStrings ? toString.call(collection) == stringClass : typeof collection == 'string') - ? collection.split('') - : slice.call(collection); - } - return values(collection); - } - - /*--------------------------------------------------------------------------*/ - - /** - * Produces a new array with all falsey values of `array` removed. The values - * `false`, `null`, `0`, `""`, `undefined` and `NaN` are all falsey. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to compact. - * @returns {Array} Returns a new filtered array. - * @example - * - * _.compact([0, 1, false, 2, '', 3]); - * // => [1, 2, 3] - */ - function compact(array) { - var result = []; - if (!array) { - return result; - } - var index = -1, - length = array.length; - - while (++index < length) { - if (array[index]) { - result.push(array[index]); - } - } - return result; - } - - /** - * Produces a new array of `array` values not present in the other arrays - * using strict equality for comparisons, i.e. `===`. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to process. - * @param {Array} [array1, array2, ...] Arrays to check. - * @returns {Array} Returns a new array of `array` values not present in the - * other arrays. - * @example - * - * _.difference([1, 2, 3, 4, 5], [5, 2, 10]); - * // => [1, 3, 4] - */ - function difference(array) { - var result = []; - if (!array) { - return result; - } - var index = -1, - length = array.length, - flattened = concat.apply(result, arguments), - contains = cachedContains(flattened, length); - - while (++index < length) { - if (!contains(array[index])) { - result.push(array[index]); - } - } - return result; - } - - /** - * Gets the first value of the `array`. Pass `n` to return the first `n` values - * of the `array`. - * - * @static - * @memberOf _ - * @alias head, take - * @category Arrays - * @param {Array} array The array to query. - * @param {Number} [n] The number of elements to return. - * @param {Object} [guard] Internally used to allow this method to work with - * others like `_.map` without using their callback `index` argument for `n`. - * @returns {Mixed} Returns the first value or an array of the first `n` values - * of `array`. - * @example - * - * _.first([5, 4, 3, 2, 1]); - * // => 5 - */ - function first(array, n, guard) { - if (array) { - return (n == null || guard) ? array[0] : slice.call(array, 0, n); - } - } - - /** - * Flattens a nested array (the nesting can be to any depth). If `shallow` is - * truthy, `array` will only be flattened a single level. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to compact. - * @param {Boolean} shallow A flag to indicate only flattening a single level. - * @returns {Array} Returns a new flattened array. - * @example - * - * _.flatten([1, [2], [3, [[4]]]]); - * // => [1, 2, 3, 4]; - * - * _.flatten([1, [2], [3, [[4]]]], true); - * // => [1, 2, 3, [[4]]]; - */ - function flatten(array, shallow) { - var result = []; - if (!array) { - return result; - } - var value, - index = -1, - length = array.length; - - while (++index < length) { - value = array[index]; - if (isArray(value)) { - push.apply(result, shallow ? value : flatten(value)); - } else { - result.push(value); - } - } - return result; - } - - /** - * Gets the index at which the first occurrence of `value` is found using - * strict equality for comparisons, i.e. `===`. If the `array` is already - * sorted, passing `true` for `isSorted` will run a faster binary search. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to search. - * @param {Mixed} value The value to search for. - * @param {Boolean|Number} [fromIndex=0] The index to start searching from or - * `true` to perform a binary search on a sorted `array`. - * @returns {Number} Returns the index of the matched value or `-1`. - * @example - * - * _.indexOf([1, 2, 3, 1, 2, 3], 2); - * // => 1 - * - * _.indexOf([1, 2, 3, 1, 2, 3], 2, 3); - * // => 4 - * - * _.indexOf([1, 1, 2, 2, 3, 3], 2, true); - * // => 2 - */ - function indexOf(array, value, fromIndex) { - if (!array) { - return -1; - } - var index = -1, - length = array.length; - - if (fromIndex) { - if (typeof fromIndex == 'number') { - index = (fromIndex < 0 ? Math.max(0, length + fromIndex) : fromIndex) - 1; - } else { - index = sortedIndex(array, value); - return array[index] === value ? index : -1; - } - } - while (++index < length) { - if (array[index] === value) { - return index; - } - } - return -1; - } - - /** - * Gets all but the last value of `array`. Pass `n` to exclude the last `n` - * values from the result. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to query. - * @param {Number} [n] The number of elements to return. - * @param {Object} [guard] Internally used to allow this method to work with - * others like `_.map` without using their callback `index` argument for `n`. - * @returns {Array} Returns all but the last value or `n` values of `array`. - * @example - * - * _.initial([3, 2, 1]); - * // => [3, 2] - */ - function initial(array, n, guard) { - if (!array) { - return []; - } - return slice.call(array, 0, -((n == null || guard) ? 1 : n)); - } - - /** - * Computes the intersection of all the passed-in arrays. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} [array1, array2, ...] Arrays to process. - * @returns {Array} Returns a new array of unique values, in order, that are - * present in **all** of the arrays. - * @example - * - * _.intersection([1, 2, 3], [101, 2, 1, 10], [2, 1]); - * // => [1, 2] - */ - function intersection(array) { - var result = []; - if (!array) { - return result; - } - var value, - index = -1, - length = array.length, - others = slice.call(arguments, 1), - cache = []; - - while (++index < length) { - value = array[index]; - if (indexOf(result, value) < 0 && - every(others, function(other, index) { - return (cache[index] || (cache[index] = cachedContains(other)))(value); - })) { - result.push(value); - } - } - return result; - } - - /** - * Gets the last value of the `array`. Pass `n` to return the lasy `n` values - * of the `array`. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to query. - * @param {Number} [n] The number of elements to return. - * @param {Object} [guard] Internally used to allow this method to work with - * others like `_.map` without using their callback `index` argument for `n`. - * @returns {Mixed} Returns the last value or an array of the last `n` values - * of `array`. - * @example - * - * _.last([3, 2, 1]); - * // => 1 - */ - function last(array, n, guard) { - if (array) { - var length = array.length; - return (n == null || guard) ? array[length - 1] : slice.call(array, -n || length); - } - } - - /** - * Gets the index at which the last occurrence of `value` is found using - * strict equality for comparisons, i.e. `===`. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to search. - * @param {Mixed} value The value to search for. - * @param {Number} [fromIndex=array.length-1] The index to start searching from. - * @returns {Number} Returns the index of the matched value or `-1`. - * @example - * - * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2); - * // => 4 - * - * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2, 3); - * // => 1 - */ - function lastIndexOf(array, value, fromIndex) { - if (!array) { - return -1; - } - var index = array.length; - if (fromIndex && typeof fromIndex == 'number') { - index = (fromIndex < 0 ? Math.max(0, index + fromIndex) : Math.min(fromIndex, index - 1)) + 1; - } - while (index--) { - if (array[index] === value) { - return index; - } - } - return -1; - } - - /** - * Retrieves the maximum value of an `array`. If `callback` is passed, - * it will be executed for each value in the `array` to generate the - * criterion by which the value is ranked. The `callback` is bound to - * `thisArg` and invoked with 3 arguments; (value, index, array). - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to iterate over. - * @param {Function} [callback] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Mixed} Returns the maximum value. - * @example - * - * var stooges = [ - * { 'name': 'moe', 'age': 40 }, - * { 'name': 'larry', 'age': 50 }, - * { 'name': 'curly', 'age': 60 } - * ]; - * - * _.max(stooges, function(stooge) { return stooge.age; }); - * // => { 'name': 'curly', 'age': 60 }; - */ - function max(array, callback, thisArg) { - var computed = -Infinity, - result = computed; - - if (!array) { - return result; - } - var current, - index = -1, - length = array.length; - - if (!callback) { - while (++index < length) { - if (array[index] > result) { - result = array[index]; - } - } - return result; - } - if (thisArg) { - callback = iteratorBind(callback, thisArg); - } - while (++index < length) { - current = callback(array[index], index, array); - if (current > computed) { - computed = current; - result = array[index]; - } - } - return result; - } - - /** - * Retrieves the minimum value of an `array`. If `callback` is passed, - * it will be executed for each value in the `array` to generate the - * criterion by which the value is ranked. The `callback` is bound to `thisArg` - * and invoked with 3 arguments; (value, index, array). - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to iterate over. - * @param {Function} [callback] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Mixed} Returns the minimum value. - * @example - * - * _.min([10, 5, 100, 2, 1000]); - * // => 2 - */ - function min(array, callback, thisArg) { - var computed = Infinity, - result = computed; - - if (!array) { - return result; - } - var current, - index = -1, - length = array.length; - - if (!callback) { - while (++index < length) { - if (array[index] < result) { - result = array[index]; - } - } - return result; - } - if (thisArg) { - callback = iteratorBind(callback, thisArg); - } - while (++index < length) { - current = callback(array[index], index, array); - if (current < computed) { - computed = current; - result = array[index]; - } - } - return result; - } - - /** - * Creates an array of numbers (positive and/or negative) progressing from - * `start` up to but not including `stop`. This method is a port of Python's - * `range()` function. See http://docs.python.org/library/functions.html#range. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Number} [start=0] The start of the range. - * @param {Number} end The end of the range. - * @param {Number} [step=1] The value to increment or descrement by. - * @returns {Array} Returns a new range array. - * @example - * - * _.range(10); - * // => [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] - * - * _.range(1, 11); - * // => [1, 2, 3, 4, 5, 6, 7, 8, 9, 10] - * - * _.range(0, 30, 5); - * // => [0, 5, 10, 15, 20, 25] - * - * _.range(0, -10, -1); - * // => [0, -1, -2, -3, -4, -5, -6, -7, -8, -9] - * - * _.range(0); - * // => [] - */ - function range(start, end, step) { - step || (step = 1); - if (end == null) { - end = start || 0; - start = 0; - } - // use `Array(length)` so V8 will avoid the slower "dictionary" mode - // http://www.youtube.com/watch?v=XAqIpGU8ZZk#t=16m27s - var index = -1, - length = Math.max(0, Math.ceil((end - start) / step)), - result = Array(length); - - while (++index < length) { - result[index] = start; - start += step; - } - return result; - } - - /** - * The opposite of `_.initial`, this method gets all but the first value of - * `array`. Pass `n` to exclude the first `n` values from the result. - * - * @static - * @memberOf _ - * @alias tail - * @category Arrays - * @param {Array} array The array to query. - * @param {Number} [n] The number of elements to return. - * @param {Object} [guard] Internally used to allow this method to work with - * others like `_.map` without using their callback `index` argument for `n`. - * @returns {Array} Returns all but the first value or `n` values of `array`. - * @example - * - * _.rest([3, 2, 1]); - * // => [2, 1] - */ - function rest(array, n, guard) { - if (!array) { - return []; - } - return slice.call(array, (n == null || guard) ? 1 : n); - } - - /** - * Produces a new array of shuffled `array` values, using a version of the - * Fisher-Yates shuffle. See http://en.wikipedia.org/wiki/Fisher-Yates_shuffle. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to shuffle. - * @returns {Array} Returns a new shuffled array. - * @example - * - * _.shuffle([1, 2, 3, 4, 5, 6]); - * // => [4, 1, 6, 3, 5, 2] - */ - function shuffle(array) { - if (!array) { - return []; - } - var rand, - index = -1, - length = array.length, - result = Array(length); - - while (++index < length) { - rand = Math.floor(Math.random() * (index + 1)); - result[index] = result[rand]; - result[rand] = array[index]; - } - return result; - } - - /** - * Uses a binary search to determine the smallest index at which the `value` - * should be inserted into `array` in order to maintain the sort order of the - * sorted `array`. If `callback` is passed, it will be executed for `value` and - * each element in `array` to compute their sort ranking. The `callback` is - * bound to `thisArg` and invoked with 1 argument; (value). - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to iterate over. - * @param {Mixed} value The value to evaluate. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Number} Returns the index at which the value should be inserted - * into `array`. - * @example - * - * _.sortedIndex([20, 30, 40], 35); - * // => 2 - * - * var dict = { - * 'wordToNumber': { 'twenty': 20, 'thirty': 30, 'thirty-five': 35, 'fourty': 40 } - * }; - * - * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) { - * return dict.wordToNumber[word]; - * }); - * // => 2 - * - * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) { - * return this.wordToNumber[word]; - * }, dict); - * // => 2 - */ - function sortedIndex(array, value, callback, thisArg) { - if (!array) { - return 0; - } - var mid, - low = 0, - high = array.length; - - if (callback) { - if (thisArg) { - callback = bind(callback, thisArg); - } - value = callback(value); - while (low < high) { - mid = (low + high) >>> 1; - callback(array[mid]) < value ? low = mid + 1 : high = mid; - } - } else { - while (low < high) { - mid = (low + high) >>> 1; - array[mid] < value ? low = mid + 1 : high = mid; - } - } - return low; - } - - /** - * Computes the union of the passed-in arrays. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} [array1, array2, ...] Arrays to process. - * @returns {Array} Returns a new array of unique values, in order, that are - * present in one or more of the arrays. - * @example - * - * _.union([1, 2, 3], [101, 2, 1, 10], [2, 1]); - * // => [1, 2, 3, 101, 10] - */ - function union() { - var index = -1, - result = [], - flattened = concat.apply(result, arguments), - length = flattened.length; - - while (++index < length) { - if (indexOf(result, flattened[index]) < 0) { - result.push(flattened[index]); - } - } - return result; - } - - /** - * Produces a duplicate-value-free version of the `array` using strict equality - * for comparisons, i.e. `===`. If the `array` is already sorted, passing `true` - * for `isSorted` will run a faster algorithm. If `callback` is passed, - * each value of `array` is passed through a transformation `callback` before - * uniqueness is computed. The `callback` is bound to `thisArg` and invoked - * with 3 arguments; (value, index, array). - * - * @static - * @memberOf _ - * @alias unique - * @category Arrays - * @param {Array} array The array to process. - * @param {Boolean} [isSorted=false] A flag to indicate that the `array` is already sorted. - * @param {Function} [callback=identity] The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Array} Returns a duplicate-value-free array. - * @example - * - * _.uniq([1, 2, 1, 3, 1]); - * // => [1, 2, 3] - * - * _.uniq([1, 1, 2, 2, 3], true); - * // => [1, 2, 3] - * - * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return Math.floor(num); }); - * // => [1, 2, 3] - * - * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return this.floor(num); }, Math); - * // => [1, 2, 3] - */ - function uniq(array, isSorted, callback, thisArg) { - var result = []; - if (!array) { - return result; - } - var computed, - index = -1, - length = array.length, - seen = []; - - // juggle arguments - if (typeof isSorted == 'function') { - thisArg = callback; - callback = isSorted; - isSorted = false; - } - if (!callback) { - callback = identity; - } else if (thisArg) { - callback = iteratorBind(callback, thisArg); - } - while (++index < length) { - computed = callback(array[index], index, array); - if (isSorted - ? !index || seen[seen.length - 1] !== computed - : indexOf(seen, computed) < 0 - ) { - seen.push(computed); - result.push(array[index]); - } - } - return result; - } - - /** - * Produces a new array with all occurrences of the passed values removed using - * strict equality for comparisons, i.e. `===`. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} array The array to filter. - * @param {Mixed} [value1, value2, ...] Values to remove. - * @returns {Array} Returns a new filtered array. - * @example - * - * _.without([1, 2, 1, 0, 3, 1, 4], 0, 1); - * // => [2, 3, 4] - */ - function without(array) { - var result = []; - if (!array) { - return result; - } - var index = -1, - length = array.length, - contains = cachedContains(arguments, 1, 20); - - while (++index < length) { - if (!contains(array[index])) { - result.push(array[index]); - } - } - return result; - } - - /** - * Merges the elements of each array at their corresponding indexes. Useful for - * separate data sources that are coordinated through matching array indexes. - * For a matrix of nested arrays, `_.zip.apply(...)` can transpose the matrix - * in a similar fashion. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} [array1, array2, ...] Arrays to process. - * @returns {Array} Returns a new array of merged arrays. - * @example - * - * _.zip(['moe', 'larry', 'curly'], [30, 40, 50], [true, false, false]); - * // => [['moe', 30, true], ['larry', 40, false], ['curly', 50, false]] - */ - function zip(array) { - if (!array) { - return []; - } - var index = -1, - length = max(pluck(arguments, 'length')), - result = Array(length); - - while (++index < length) { - result[index] = pluck(arguments, index); - } - return result; - } - - /** - * Merges an array of `keys` and an array of `values` into a single object. - * - * @static - * @memberOf _ - * @category Arrays - * @param {Array} keys The array of keys. - * @param {Array} [values=[]] The array of values. - * @returns {Object} Returns an object composed of the given keys and - * corresponding values. - * @example - * - * _.zipObject(['moe', 'larry', 'curly'], [30, 40, 50]); - * // => { 'moe': 30, 'larry': 40, 'curly': 50 } - */ - function zipObject(keys, values) { - if (!keys) { - return {}; - } - var index = -1, - length = keys.length, - result = {}; - - values || (values = []); - while (++index < length) { - result[keys[index]] = values[index]; - } - return result; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Creates a new function that is restricted to executing only after it is - * called `n` times. - * - * @static - * @memberOf _ - * @category Functions - * @param {Number} n The number of times the function must be called before - * it is executed. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var renderNotes = _.after(notes.length, render); - * _.forEach(notes, function(note) { - * note.asyncSave({ 'success': renderNotes }); - * }); - * // `renderNotes` is run once, after all notes have saved - */ - function after(n, func) { - if (n < 1) { - return func(); - } - return function() { - if (--n < 1) { - return func.apply(this, arguments); - } - }; - } - - /** - * Creates a new function that, when called, invokes `func` with the `this` - * binding of `thisArg` and prepends any additional `bind` arguments to those - * passed to the bound function. Lazy defined methods may be bound by passing - * the object they are bound to as `func` and the method name as `thisArg`. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function|Object} func The function to bind or the object the method belongs to. - * @param {Mixed} [thisArg] The `this` binding of `func` or the method name. - * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * // basic bind - * var func = function(greeting) { - * return greeting + ' ' + this.name; - * }; - * - * func = _.bind(func, { 'name': 'moe' }, 'hi'); - * func(); - * // => 'hi moe' - * - * // lazy bind - * var object = { - * 'name': 'moe', - * 'greet': function(greeting) { - * return greeting + ' ' + this.name; - * } - * }; - * - * var func = _.bind(object, 'greet', 'hi'); - * func(); - * // => 'hi moe' - * - * object.greet = function(greeting) { - * return greeting + ', ' + this.name + '!'; - * }; - * - * func(); - * // => 'hi, moe!' - */ - function bind(func, thisArg) { - var methodName, - isFunc = toString.call(func) == funcClass; - - // juggle arguments - if (!isFunc) { - methodName = thisArg; - thisArg = func; - } - // use `Function#bind` if it exists and is fast - // (in V8 `Function#bind` is slower except when partially applied) - else if (isBindFast || (nativeBind && arguments.length > 2)) { - return nativeBind.call.apply(nativeBind, arguments); - } - - var partialArgs = slice.call(arguments, 2); - - function bound() { - // `Function#bind` spec - // http://es5.github.com/#x15.3.4.5 - var args = arguments, - thisBinding = thisArg; - - if (!isFunc) { - func = thisArg[methodName]; - } - if (partialArgs.length) { - args = args.length - ? concat.apply(partialArgs, args) - : partialArgs; - } - if (this instanceof bound) { - // get `func` instance if `bound` is invoked in a `new` expression - noop.prototype = func.prototype; - thisBinding = new noop; - - // mimic the constructor's `return` behavior - // http://es5.github.com/#x13.2.2 - var result = func.apply(thisBinding, args); - return result && objectTypes[typeof result] - ? result - : thisBinding - } - return func.apply(thisBinding, args); - } - return bound; - } - - /** - * Binds methods on `object` to `object`, overwriting the existing method. - * If no method names are provided, all the function properties of `object` - * will be bound. - * - * @static - * @memberOf _ - * @category Functions - * @param {Object} object The object to bind and assign the bound methods to. - * @param {String} [methodName1, methodName2, ...] Method names on the object to bind. - * @returns {Object} Returns the `object`. - * @example - * - * var buttonView = { - * 'label': 'lodash', - * 'onClick': function() { alert('clicked: ' + this.label); } - * }; - * - * _.bindAll(buttonView); - * jQuery('#lodash_button').on('click', buttonView.onClick); - * // => When the button is clicked, `this.label` will have the correct value - */ - var bindAll = createIterator({ - 'useHas': false, - 'useStrict': false, - 'args': 'object', - 'init': 'object', - 'top': - 'var funcs = arguments,\n' + - ' length = funcs.length;\n' + - 'if (length > 1) {\n' + - ' for (var index = 1; index < length; index++)\n' + - ' result[funcs[index]] = bind(result[funcs[index]], result);\n' + - ' return result\n' + - '}', - 'inLoop': - 'if (toString.call(result[index]) == funcClass)' + - ' result[index] = bind(result[index], result)' - }); - - /** - * Creates a new function that is the composition of the passed functions, - * where each function consumes the return value of the function that follows. - * In math terms, composing the functions `f()`, `g()`, and `h()` produces `f(g(h()))`. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} [func1, func2, ...] Functions to compose. - * @returns {Function} Returns the new composed function. - * @example - * - * var greet = function(name) { return 'hi: ' + name; }; - * var exclaim = function(statement) { return statement + '!'; }; - * var welcome = _.compose(exclaim, greet); - * welcome('moe'); - * // => 'hi: moe!' - */ - function compose() { - var funcs = arguments; - return function() { - var args = arguments, - length = funcs.length; - - while (length--) { - args = [funcs[length].apply(this, args)]; - } - return args[0]; - }; - } - - /** - * Creates a new function that will delay the execution of `func` until after - * `wait` milliseconds have elapsed since the last time it was invoked. Pass - * `true` for `immediate` to cause debounce to invoke `func` on the leading, - * instead of the trailing, edge of the `wait` timeout. Subsequent calls to - * the debounced function will return the result of the last `func` call. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to debounce. - * @param {Number} wait The number of milliseconds to delay. - * @param {Boolean} immediate A flag to indicate execution is on the leading - * edge of the timeout. - * @returns {Function} Returns the new debounced function. - * @example - * - * var lazyLayout = _.debounce(calculateLayout, 300); - * jQuery(window).on('resize', lazyLayout); - */ - function debounce(func, wait, immediate) { - var args, - result, - thisArg, - timeoutId; - - function delayed() { - timeoutId = null; - if (!immediate) { - func.apply(thisArg, args); - } - } - - return function() { - var isImmediate = immediate && !timeoutId; - args = arguments; - thisArg = this; - - clearTimeout(timeoutId); - timeoutId = setTimeout(delayed, wait); - - if (isImmediate) { - result = func.apply(thisArg, args); - } - return result; - }; - } - - /** - * Executes the `func` function after `wait` milliseconds. Additional arguments - * are passed to `func` when it is invoked. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to delay. - * @param {Number} wait The number of milliseconds to delay execution. - * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with. - * @returns {Number} Returns the `setTimeout` timeout id. - * @example - * - * var log = _.bind(console.log, console); - * _.delay(log, 1000, 'logged later'); - * // => 'logged later' (Appears after one second.) - */ - function delay(func, wait) { - var args = slice.call(arguments, 2); - return setTimeout(function() { return func.apply(undefined, args); }, wait); - } - - /** - * Defers executing the `func` function until the current call stack has cleared. - * Additional arguments are passed to `func` when it is invoked. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to defer. - * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with. - * @returns {Number} Returns the `setTimeout` timeout id. - * @example - * - * _.defer(function() { alert('deferred'); }); - * // returns from the function before `alert` is called - */ - function defer(func) { - var args = slice.call(arguments, 1); - return setTimeout(function() { return func.apply(undefined, args); }, 1); - } - - /** - * Creates a new function that memoizes the result of `func`. If `resolver` is - * passed, it will be used to determine the cache key for storing the result - * based on the arguments passed to the memoized function. By default, the first - * argument passed to the memoized function is used as the cache key. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to have its output memoized. - * @param {Function} [resolver] A function used to resolve the cache key. - * @returns {Function} Returns the new memoizing function. - * @example - * - * var fibonacci = _.memoize(function(n) { - * return n < 2 ? n : fibonacci(n - 1) + fibonacci(n - 2); - * }); - */ - function memoize(func, resolver) { - var cache = {}; - return function() { - var prop = resolver ? resolver.apply(this, arguments) : arguments[0]; - return hasOwnProperty.call(cache, prop) - ? cache[prop] - : (cache[prop] = func.apply(this, arguments)); - }; - } - - /** - * Creates a new function that is restricted to one execution. Repeat calls to - * the function will return the value of the first call. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var initialize = _.once(createApplication); - * initialize(); - * initialize(); - * // Application is only created once. - */ - function once(func) { - var result, - ran = false; - - return function() { - if (ran) { - return result; - } - ran = true; - result = func.apply(this, arguments); - return result; - }; - } - - /** - * Creates a new function that, when called, invokes `func` with any additional - * `partial` arguments prepended to those passed to the partially applied - * function. This method is similar `bind`, except it does **not** alter the - * `this` binding. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to partially apply arguments to. - * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * var greet = function(greeting, name) { return greeting + ': ' + name; }; - * var hi = _.partial(greet, 'hi'); - * hi('moe'); - * // => 'hi: moe' - */ - function partial(func) { - var args = slice.call(arguments, 1), - argsLength = args.length; - - return function() { - var result, - others = arguments; - - if (others.length) { - args.length = argsLength; - push.apply(args, others); - } - result = args.length == 1 ? func.call(this, args[0]) : func.apply(this, args); - args.length = argsLength; - return result; - }; - } - - /** - * Creates a new function that, when executed, will only call the `func` - * function at most once per every `wait` milliseconds. If the throttled - * function is invoked more than once during the `wait` timeout, `func` will - * also be called on the trailing edge of the timeout. Subsequent calls to the - * throttled function will return the result of the last `func` call. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to throttle. - * @param {Number} wait The number of milliseconds to throttle executions to. - * @returns {Function} Returns the new throttled function. - * @example - * - * var throttled = _.throttle(updatePosition, 100); - * jQuery(window).on('scroll', throttled); - */ - function throttle(func, wait) { - var args, - result, - thisArg, - timeoutId, - lastCalled = 0; - - function trailingCall() { - lastCalled = new Date; - timeoutId = null; - func.apply(thisArg, args); - } - - return function() { - var now = new Date, - remain = wait - (now - lastCalled); - - args = arguments; - thisArg = this; - - if (remain <= 0) { - lastCalled = now; - result = func.apply(thisArg, args); - } - else if (!timeoutId) { - timeoutId = setTimeout(trailingCall, remain); - } - return result; - }; - } - - /** - * Create a new function that passes the `func` function to the `wrapper` - * function as its first argument. Additional arguments are appended to those - * passed to the `wrapper` function. - * - * @static - * @memberOf _ - * @category Functions - * @param {Function} func The function to wrap. - * @param {Function} wrapper The wrapper function. - * @param {Mixed} [arg1, arg2, ...] Arguments to append to those passed to the wrapper. - * @returns {Function} Returns the new function. - * @example - * - * var hello = function(name) { return 'hello: ' + name; }; - * hello = _.wrap(hello, function(func) { - * return 'before, ' + func('moe') + ', after'; - * }); - * hello(); - * // => 'before, hello: moe, after' - */ - function wrap(func, wrapper) { - return function() { - var args = [func]; - if (arguments.length) { - push.apply(args, arguments); - } - return wrapper.apply(this, args); - }; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Create a shallow clone of the `value`. Any nested objects or arrays will be - * assigned by reference and not cloned. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to clone. - * @returns {Mixed} Returns the cloned `value`. - * @example - * - * _.clone({ 'name': 'moe' }); - * // => { 'name': 'moe' }; - */ - function clone(value) { - return value && objectTypes[typeof value] - ? (isArray(value) ? value.slice() : extend({}, value)) - : value; - } - - /** - * Assigns missing properties on `object` with default values from the defaults - * objects. Once a property is set, additional defaults of the same property - * will be ignored. - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to populate. - * @param {Object} [defaults1, defaults2, ...] The defaults objects to apply to `object`. - * @returns {Object} Returns `object`. - * @example - * - * var iceCream = { 'flavor': 'chocolate' }; - * _.defaults(iceCream, { 'flavor': 'vanilla', 'sprinkles': 'rainbow' }); - * // => { 'flavor': 'chocolate', 'sprinkles': 'rainbow' } - */ - var defaults = createIterator(extendIteratorOptions, { - 'inLoop': 'if (result[index] == null) ' + extendIteratorOptions.inLoop - }); - - /** - * Copies enumerable properties from the source objects to the `destination` object. - * Subsequent sources will overwrite propery assignments of previous sources. - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The destination object. - * @param {Object} [source1, source2, ...] The source objects. - * @returns {Object} Returns the destination object. - * @example - * - * _.extend({ 'name': 'moe' }, { 'age': 40 }); - * // => { 'name': 'moe', 'age': 40 } - */ - var extend = createIterator(extendIteratorOptions); - - /** - * Iterates over `object`'s own and inherited enumerable properties, executing - * the `callback` for each property. The `callback` is bound to `thisArg` and - * invoked with 3 arguments; (value, key, object). - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to iterate over. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Object} Returns the `object`. - * @example - * - * function Dog(name) { - * this.name = name; - * } - * - * Dog.prototype.bark = function() { - * alert('Woof, woof!'); - * }; - * - * _.forIn(new Dog('Dagny'), function(value, key) { - * alert(key); - * }); - * // => alerts 'name' and 'bark' (order is not guaranteed) - */ - var forIn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions, { - 'useHas': false - }); - - /** - * Iterates over `object`'s own enumerable properties, executing the `callback` - * for each property. The `callback` is bound to `thisArg` and invoked with 3 - * arguments; (value, key, object). - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to iterate over. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @returns {Object} Returns the `object`. - * @example - * - * _.forOwn({ '0': 'zero', '1': 'one', 'length': 2 }, function(num, key) { - * alert(key); - * }); - * // => alerts '0', '1', and 'length' (order is not guaranteed) - */ - var forOwn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions); - - /** - * Produces a sorted array of the enumerable properties, own and inherited, - * of `object` that have function values. - * - * @static - * @memberOf _ - * @alias methods - * @category Objects - * @param {Object} object The object to inspect. - * @returns {Array} Returns a new array of property names that have function values. - * @example - * - * _.functions(_); - * // => ['all', 'any', 'bind', 'bindAll', 'clone', 'compact', 'compose', ...] - */ - var functions = createIterator({ - 'useHas': false, - 'args': 'object', - 'init': '[]', - 'inLoop': 'if (toString.call(iteratee[index]) == funcClass) result.push(index)', - 'bottom': 'result.sort()' - }); - - /** - * Checks if the specified object `property` exists and is a direct property, - * instead of an inherited property. - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to check. - * @param {String} property The property to check for. - * @returns {Boolean} Returns `true` if key is a direct property, else `false`. - * @example - * - * _.has({ 'a': 1, 'b': 2, 'c': 3 }, 'b'); - * // => true - */ - function has(object, property) { - return hasOwnProperty.call(object, property); - } - - /** - * Checks if `value` is an `arguments` object. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is an `arguments` object, else `false`. - * @example - * - * (function() { return _.isArguments(arguments); })(1, 2, 3); - * // => true - * - * _.isArguments([1, 2, 3]); - * // => false - */ - var isArguments = function(value) { - return toString.call(value) == '[object Arguments]'; - }; - // fallback for browser like Firefox < 4 and IE < 9 which detect - // `arguments` as `[object Object]` - if (!isArguments(arguments)) { - isArguments = function(value) { - return !!(value && hasOwnProperty.call(value, 'callee')); - }; - } - - /** - * Checks if `value` is an array. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is an array, else `false`. - * @example - * - * (function() { return _.isArray(arguments); })(); - * // => false - * - * _.isArray([1, 2, 3]); - * // => true - */ - var isArray = nativeIsArray || function(value) { - return toString.call(value) == arrayClass; - }; - - /** - * Checks if `value` is a boolean (`true` or `false`) value. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a boolean value, else `false`. - * @example - * - * _.isBoolean(null); - * // => false - */ - function isBoolean(value) { - return value === true || value === false || toString.call(value) == boolClass; - } - - /** - * Checks if `value` is a date. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a date, else `false`. - * @example - * - * _.isDate(new Date); - * // => true - */ - function isDate(value) { - return toString.call(value) == dateClass; - } - - /** - * Checks if `value` is a DOM element. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a DOM element, else `false`. - * @example - * - * _.isElement(document.body); - * // => true - */ - function isElement(value) { - return !!(value && value.nodeType == 1); - } - - /** - * Checks if `value` is empty. Arrays or strings with a length of `0` and - * objects with no own enumerable properties are considered "empty". - * - * @static - * @memberOf _ - * @category Objects - * @param {Array|Object|String} value The value to inspect. - * @returns {Boolean} Returns `true` if the `value` is empty, else `false`. - * @example - * - * _.isEmpty([1, 2, 3]); - * // => false - * - * _.isEmpty({}); - * // => true - * - * _.isEmpty(''); - * // => true - */ - var isEmpty = createIterator({ - 'args': 'value', - 'init': 'true', - 'top': - 'var className = toString.call(value);\n' + - 'if (className == arrayClass || className == stringClass) return !value.length', - 'inLoop': { - 'object': 'return false' - } - }); - - /** - * Performs a deep comparison between two values to determine if they are - * equivalent to each other. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} a The value to compare. - * @param {Mixed} b The other value to compare. - * @param {Array} [stack] Internally used to keep track of "seen" objects to - * avoid circular references. - * @returns {Boolean} Returns `true` if the values are equvalent, else `false`. - * @example - * - * var moe = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] }; - * var clone = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] }; - * - * moe == clone; - * // => false - * - * _.isEqual(moe, clone); - * // => true - */ - function isEqual(a, b, stack) { - stack || (stack = []); - - // exit early for identical values - if (a === b) { - // treat `+0` vs. `-0` as not equal - return a !== 0 || (1 / a == 1 / b); - } - // a strict comparison is necessary because `undefined == null` - if (a == null || b == null) { - return a === b; - } - // unwrap any wrapped objects - if (a._chain) { - a = a._wrapped; - } - if (b._chain) { - b = b._wrapped; - } - // invoke a custom `isEqual` method if one is provided - if (a.isEqual && toString.call(a.isEqual) == funcClass) { - return a.isEqual(b); - } - if (b.isEqual && toString.call(b.isEqual) == funcClass) { - return b.isEqual(a); - } - // compare [[Class]] names - var className = toString.call(a); - if (className != toString.call(b)) { - return false; - } - switch (className) { - // strings, numbers, dates, and booleans are compared by value - case stringClass: - // primitives and their corresponding object instances are equivalent; - // thus, `'5'` is quivalent to `new String('5')` - return a == String(b); - - case numberClass: - // treat `NaN` vs. `NaN` as equal - return a != +a - ? b != +b - // but treat `+0` vs. `-0` as not equal - : (a == 0 ? (1 / a == 1 / b) : a == +b); - - case boolClass: - case dateClass: - // coerce dates and booleans to numeric values, dates to milliseconds and - // booleans to 1 or 0; treat invalid dates coerced to `NaN` as not equal - return +a == +b; - - // regexps are compared by their source and flags - case regexpClass: - return a.source == b.source && - a.global == b.global && - a.multiline == b.multiline && - a.ignoreCase == b.ignoreCase; - } - if (typeof a != 'object' || typeof b != 'object') { - return false; - } - // Assume equality for cyclic structures. The algorithm for detecting cyclic - // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`. - var length = stack.length; - while (length--) { - // Linear search. Performance is inversely proportional to the number of - // unique nested structures. - if (stack[length] == a) { - return true; - } - } - - var index = -1, - result = true, - size = 0; - - // add the first collection to the stack of traversed objects - stack.push(a); - - // recursively compare objects and arrays - if (className == arrayClass) { - // compare array lengths to determine if a deep comparison is necessary - size = a.length; - result = size == b.length; - - if (result) { - // deep compare the contents, ignoring non-numeric properties - while (size--) { - if (!(result = isEqual(a[size], b[size], stack))) { - break; - } - } - } - } - else { - // objects with different constructors are not equivalent - if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) { - return false; - } - // deep compare objects. - for (var prop in a) { - if (hasOwnProperty.call(a, prop)) { - // count the number of properties. - size++; - // deep compare each property value. - if (!(result = hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack))) { - break; - } - } - } - // ensure both objects have the same number of properties - if (result) { - for (prop in b) { - // Adobe's JS engine, embedded in applications like InDesign, has a - // bug that causes `!size--` to throw an error so it must be wrapped - // in parentheses. - // https://github.com/documentcloud/underscore/issues/355 - if (hasOwnProperty.call(b, prop) && !(size--)) { - break; - } - } - result = !size; - } - // handle JScript [[DontEnum]] bug - if (result && hasDontEnumBug) { - while (++index < 7) { - prop = shadowed[index]; - if (hasOwnProperty.call(a, prop)) { - if (!(result = hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack))) { - break; - } - } - } - } - } - // remove the first collection from the stack of traversed objects - stack.pop(); - return result; - } - - /** - * Checks if `value` is a finite number. - * Note: This is not the same as native `isFinite`, which will return true for - * booleans and other values. See http://es5.github.com/#x15.1.2.5. - * - * @deprecated - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a finite number, else `false`. - * @example - * - * _.isFinite(-101); - * // => true - * - * _.isFinite('10'); - * // => false - * - * _.isFinite(Infinity); - * // => false - */ - function isFinite(value) { - return nativeIsFinite(value) && toString.call(value) == numberClass; - } - - /** - * Checks if `value` is a function. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a function, else `false`. - * @example - * - * _.isFunction(''.concat); - * // => true - */ - function isFunction(value) { - return toString.call(value) == funcClass; - } - - /** - * Checks if `value` is the language type of Object. - * (e.g. arrays, functions, objects, regexps, `new Number(0)`, and `new String('')`) - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is an object, else `false`. - * @example - * - * _.isObject({}); - * // => true - * - * _.isObject(1); - * // => false - */ - function isObject(value) { - // check if the value is the ECMAScript language type of Object - // http://es5.github.com/#x8 - return value && objectTypes[typeof value]; - } - - /** - * Checks if `value` is `NaN`. - * Note: This is not the same as native `isNaN`, which will return true for - * `undefined` and other values. See http://es5.github.com/#x15.1.2.4. - * - * @deprecated - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is `NaN`, else `false`. - * @example - * - * _.isNaN(NaN); - * // => true - * - * _.isNaN(new Number(NaN)); - * // => true - * - * isNaN(undefined); - * // => true - * - * _.isNaN(undefined); - * // => false - */ - function isNaN(value) { - // `NaN` as a primitive is the only value that is not equal to itself - // (perform the [[Class]] check first to avoid errors with some host objects in IE) - return toString.call(value) == numberClass && value != +value - } - - /** - * Checks if `value` is `null`. - * - * @deprecated - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is `null`, else `false`. - * @example - * - * _.isNull(null); - * // => true - * - * _.isNull(undefined); - * // => false - */ - function isNull(value) { - return value === null; - } - - /** - * Checks if `value` is a number. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a number, else `false`. - * @example - * - * _.isNumber(8.4 * 5; - * // => true - */ - function isNumber(value) { - return toString.call(value) == numberClass; - } - - /** - * Checks if `value` is a regular expression. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a regular expression, else `false`. - * @example - * - * _.isRegExp(/moe/); - * // => true - */ - function isRegExp(value) { - return toString.call(value) == regexpClass; - } - - /** - * Checks if `value` is a string. - * - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is a string, else `false`. - * @example - * - * _.isString('moe'); - * // => true - */ - function isString(value) { - return toString.call(value) == stringClass; - } - - /** - * Checks if `value` is `undefined`. - * - * @deprecated - * @static - * @memberOf _ - * @category Objects - * @param {Mixed} value The value to check. - * @returns {Boolean} Returns `true` if the `value` is `undefined`, else `false`. - * @example - * - * _.isUndefined(void 0); - * // => true - */ - function isUndefined(value) { - return value === undefined; - } - - /** - * Produces an array of object`'s own enumerable property names. - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to inspect. - * @returns {Array} Returns a new array of property names. - * @example - * - * _.keys({ 'one': 1, 'two': 2, 'three': 3 }); - * // => ['one', 'two', 'three'] (order is not guaranteed) - */ - var keys = !nativeKeys ? shimKeys : function(object) { - // avoid iterating over the `prototype` property - return typeof object == 'function' && propertyIsEnumerable.call(object, 'prototype') - ? shimKeys(object) - : nativeKeys(object); - }; - - /** - * Creates an object composed of the specified properties. Property names may - * be specified as individual arguments or as arrays of property names. - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to pluck. - * @param {Object} [prop1, prop2, ...] The properties to pick. - * @returns {Object} Returns an object composed of the picked properties. - * @example - * - * _.pick({ 'name': 'moe', 'age': 40, 'userid': 'moe1' }, 'name', 'age'); - * // => { 'name': 'moe', 'age': 40 } - */ - function pick(object) { - var prop, - index = 0, - props = concat.apply(ArrayProto, arguments), - length = props.length, - result = {}; - - // start `index` at `1` to skip `object` - while (++index < length) { - prop = props[index]; - if (prop in object) { - result[prop] = object[prop]; - } - } - return result; - } - - /** - * Gets the size of `value` by returning `value.length` if `value` is a string - * or array, or the number of own enumerable properties if `value` is an object. - * - * @deprecated - * @static - * @memberOf _ - * @category Objects - * @param {Array|Object|String} value The value to inspect. - * @returns {Number} Returns `value.length` if `value` is a string or array, - * or the number of own enumerable properties if `value` is an object. - * @example - * - * _.size([1, 2]); - * // => 2 - * - * _.size({ 'one': 1, 'two': 2, 'three': 3 }); - * // => 3 - * - * _.size('curly'); - * // => 5 - */ - function size(value) { - if (!value) { - return 0; - } - var length = value.length; - return length === length >>> 0 ? value.length : keys(value).length; - } - - /** - * Produces an array of `object`'s own enumerable property values. - * - * @static - * @memberOf _ - * @category Objects - * @param {Object} object The object to inspect. - * @returns {Array} Returns a new array of property values. - * @example - * - * _.values({ 'one': 1, 'two': 2, 'three': 3 }); - * // => [1, 2, 3] - */ - var values = createIterator({ - 'args': 'object', - 'init': '[]', - 'inLoop': 'result.push(iteratee[index])' - }); - - /*--------------------------------------------------------------------------*/ - - /** - * Escapes a string for inclusion in HTML, replacing `&`, `<`, `"`, and `'` - * characters. - * - * @static - * @memberOf _ - * @category Utilities - * @param {String} string The string to escape. - * @returns {String} Returns the escaped string. - * @example - * - * _.escape('Curly, Larry & Moe'); - * // => "Curly, Larry & Moe" - */ - function escape(string) { - return string == null ? '' : (string + '').replace(reUnescapedHtml, escapeHtmlChar); - } - - /** - * This function returns the first argument passed to it. - * Note: It is used throughout Lo-Dash as a default callback. - * - * @static - * @memberOf _ - * @category Utilities - * @param {Mixed} value Any value. - * @returns {Mixed} Returns `value`. - * @example - * - * var moe = { 'name': 'moe' }; - * moe === _.identity(moe); - * // => true - */ - function identity(value) { - return value; - } - - /** - * Adds functions properties of `object` to the `lodash` function and chainable - * wrapper. - * - * @static - * @memberOf _ - * @category Utilities - * @param {Object} object The object of function properties to add to `lodash`. - * @example - * - * _.mixin({ - * 'capitalize': function(string) { - * return string.charAt(0).toUpperCase() + string.slice(1).toLowerCase(); - * } - * }); - * - * _.capitalize('curly'); - * // => 'Curly' - * - * _('larry').capitalize(); - * // => 'Larry' - */ - function mixin(object) { - forEach(functions(object), function(methodName) { - var func = lodash[methodName] = object[methodName]; - - LoDash.prototype[methodName] = function() { - var args = [this._wrapped]; - if (arguments.length) { - push.apply(args, arguments); - } - var result = func.apply(lodash, args); - if (this._chain) { - result = new LoDash(result); - result._chain = true; - } - return result; - }; - }); - } - - /** - * Reverts the '_' variable to its previous value and returns a reference to - * the `lodash` function. - * - * @static - * @memberOf _ - * @category Utilities - * @returns {Function} Returns the `lodash` function. - * @example - * - * var lodash = _.noConflict(); - */ - function noConflict() { - window._ = oldDash; - return this; - } - - /** - * Resolves the value of `property` on `object`. If `property` is a function - * it will be invoked and its result returned, else the property value is - * returned. If `object` is falsey, then `null` is returned. - * - * @deprecated - * @static - * @memberOf _ - * @category Utilities - * @param {Object} object The object to inspect. - * @param {String} property The property to get the result of. - * @returns {Mixed} Returns the resolved value. - * @example - * - * var object = { - * 'cheese': 'crumpets', - * 'stuff': function() { - * return 'nonsense'; - * } - * }; - * - * _.result(object, 'cheese'); - * // => 'crumpets' - * - * _.result(object, 'stuff'); - * // => 'nonsense' - */ - function result(object, property) { - // based on Backbone's private `getValue` function - // https://github.com/documentcloud/backbone/blob/0.9.2/backbone.js#L1419-1424 - if (!object) { - return null; - } - var value = object[property]; - return toString.call(value) == funcClass ? object[property]() : value; - } - - /** - * A micro-templating method that handles arbitrary delimiters, preserves - * whitespace, and correctly escapes quotes within interpolated code. - * - * @static - * @memberOf _ - * @category Utilities - * @param {String} text The template text. - * @param {Obect} data The data object used to populate the text. - * @param {Object} options The options object. - * @returns {Function|String} Returns a compiled function when no `data` object - * is given, else it returns the interpolated text. - * @example - * - * // using compiled template - * var compiled = _.template('hello: <%= name %>'); - * compiled({ 'name': 'moe' }); - * // => 'hello: moe' - * - * var list = '<% _.forEach(people, function(name) { %>
        • <%= name %>
          • <% }); %>'; - * _.template(list, { 'people': ['moe', 'curly', 'larry'] }); - * // => '
        • moe
        • curly
        • larry
          • ' - * - * var template = _.template('<%- value %>'); - * template({ 'value': ' - */ - function template(text, data, options) { - // based on John Resig's `tmpl` implementation - // http://ejohn.org/blog/javascript-micro-templating/ - // and Laura Doktorova's doT.js - // https://github.com/olado/doT - options || (options = {}); - - var isEvaluating, - result, - escapeDelimiter = options.escape, - evaluateDelimiter = options.evaluate, - interpolateDelimiter = options.interpolate, - settings = lodash.templateSettings, - variable = options.variable; - - // use default settings if no options object is provided - if (escapeDelimiter == null) { - escapeDelimiter = settings.escape; - } - if (evaluateDelimiter == null) { - evaluateDelimiter = settings.evaluate; - } - if (interpolateDelimiter == null) { - interpolateDelimiter = settings.interpolate; - } - - // tokenize delimiters to avoid escaping them - if (escapeDelimiter) { - text = text.replace(escapeDelimiter, tokenizeEscape); - } - if (interpolateDelimiter) { - text = text.replace(interpolateDelimiter, tokenizeInterpolate); - } - if (evaluateDelimiter != lastEvaluateDelimiter) { - // generate `reEvaluateDelimiter` to match `_.templateSettings.evaluate` - // and internal ``, `` delimiters - lastEvaluateDelimiter = evaluateDelimiter; - reEvaluateDelimiter = RegExp( - (evaluateDelimiter ? evaluateDelimiter.source : '($^)') + - '||' - , 'g'); - } - isEvaluating = tokenized.length; - text = text.replace(reEvaluateDelimiter, tokenizeEvaluate); - isEvaluating = isEvaluating != tokenized.length; - - // escape characters that cannot be included in string literals and - // detokenize delimiter code snippets - text = "__p += '" + text - .replace(reUnescapedString, escapeStringChar) - .replace(reToken, detokenize) + "';\n"; - - // clear stored code snippets - tokenized.length = 0; - - // if `options.variable` is not specified and the template contains "evaluate" - // delimiters, wrap a with-statement around the generated code to add the - // data object to the top of the scope chain - if (!variable) { - variable = settings.variable || lastVariable || 'obj'; - - if (isEvaluating) { - text = 'with (' + variable + ') {\n' + text + '\n}\n'; - } - else { - if (variable != lastVariable) { - // generate `reDoubleVariable` to match references like `obj.obj` inside - // transformed "escape" and "interpolate" delimiters - lastVariable = variable; - reDoubleVariable = RegExp('(\\(\\s*)' + variable + '\\.' + variable + '\\b', 'g'); - } - // avoid a with-statement by prepending data object references to property names - text = text - .replace(reInsertVariable, '$&' + variable + '.') - .replace(reDoubleVariable, '$1__d'); - } - } - - // cleanup code by stripping empty strings - text = ( isEvaluating ? text.replace(reEmptyStringLeading, '') : text) - .replace(reEmptyStringMiddle, '$1') - .replace(reEmptyStringTrailing, '$1;'); - - // frame code as the function body - text = 'function(' + variable + ') {\n' + - variable + ' || (' + variable + ' = {});\n' + - 'var __t, __p = \'\', __e = _.escape' + - (isEvaluating - ? ', __j = Array.prototype.join;\n' + - 'function print() { __p += __j.call(arguments, \'\') }\n' - : ', __d = ' + variable + '.' + variable + ' || ' + variable + ';\n' - ) + - text + - 'return __p\n}'; - - // add a sourceURL for easier debugging - // http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl - if (useSourceURL) { - text += '\n//@ sourceURL=/lodash/template/source[' + (templateCounter++) + ']'; - } - - try { - result = Function('_', 'return ' + text)(lodash); - } catch(e) { - result = function() { throw e; }; - } - - if (data) { - return result(data); - } - // provide the compiled function's source via its `toString` method, in - // supported environments, or the `source` property as a convenience for - // build time precompilation - result.source = text; - return result; - } - - /** - * Executes the `callback` function `n` times. The `callback` is bound to - * `thisArg` and invoked with 1 argument; (index). - * - * @static - * @memberOf _ - * @category Utilities - * @param {Number} n The number of times to execute the callback. - * @param {Function} callback The function called per iteration. - * @param {Mixed} [thisArg] The `this` binding for the callback. - * @example - * - * _.times(3, function() { genie.grantWish(); }); - * // => calls `genie.grantWish()` 3 times - * - * _.times(3, function() { this.grantWish(); }, genie); - * // => also calls `genie.grantWish()` 3 times - */ - function times(n, callback, thisArg) { - var index = -1; - if (thisArg) { - while (++index < n) { - callback.call(thisArg, index); - } - } else { - while (++index < n) { - callback(index); - } - } - } - - /** - * Generates a unique id. If `prefix` is passed, the id will be appended to it. - * - * @static - * @memberOf _ - * @category Utilities - * @param {String} [prefix] The value to prefix the id with. - * @returns {Number|String} Returns a numeric id if no prefix is passed, else - * a string id may be returned. - * @example - * - * _.uniqueId('contact_'); - * // => 'contact_104' - */ - function uniqueId(prefix) { - var id = idCounter++; - return prefix ? prefix + id : id; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Wraps the value in a `lodash` wrapper object. - * - * @static - * @memberOf _ - * @category Chaining - * @param {Mixed} value The value to wrap. - * @returns {Object} Returns the wrapper object. - * @example - * - * var stooges = [ - * { 'name': 'moe', 'age': 40 }, - * { 'name': 'larry', 'age': 50 }, - * { 'name': 'curly', 'age': 60 } - * ]; - * - * var youngest = _.chain(stooges) - * .sortBy(function(stooge) { return stooge.age; }) - * .map(function(stooge) { return stooge.name + ' is ' + stooge.age; }) - * .first() - * .value(); - * // => 'moe is 40' - */ - function chain(value) { - value = new LoDash(value); - value._chain = true; - return value; - } - - /** - * Invokes `interceptor` with the `value` as the first argument, and then - * returns `value`. The purpose of this method is to "tap into" a method chain, - * in order to perform operations on intermediate results within the chain. - * - * @static - * @memberOf _ - * @category Chaining - * @param {Mixed} value The value to pass to `callback`. - * @param {Function} interceptor The function to invoke. - * @returns {Mixed} Returns `value`. - * @example - * - * _.chain([1,2,3,200]) - * .filter(function(num) { return num % 2 == 0; }) - * .tap(alert) - * .map(function(num) { return num * num }) - * .value(); - * // => // [2, 200] (alerted) - * // => [4, 40000] - */ - function tap(value, interceptor) { - interceptor(value); - return value; - } - - /** - * Enables method chaining on the wrapper object. - * - * @name chain - * @deprecated - * @memberOf _ - * @category Chaining - * @returns {Mixed} Returns the wrapper object. - * @example - * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] - */ - function wrapperChain() { - this._chain = true; - return this; - } - - /** - * Extracts the wrapped value. - * - * @name value - * @memberOf _ - * @category Chaining - * @returns {Mixed} Returns the wrapped value. - * @example - * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] - */ - function wrapperValue() { - return this._wrapped; - } - - /*--------------------------------------------------------------------------*/ - - /** - * The semantic version number. - * - * @static - * @memberOf _ - * @type String - */ - lodash.VERSION = '0.4.2'; - - // assign static methods - lodash.after = after; - lodash.bind = bind; - lodash.bindAll = bindAll; - lodash.chain = chain; - lodash.clone = clone; - lodash.compact = compact; - lodash.compose = compose; - lodash.contains = contains; - lodash.debounce = debounce; - lodash.defaults = defaults; - lodash.defer = defer; - lodash.delay = delay; - lodash.difference = difference; - lodash.escape = escape; - lodash.every = every; - lodash.extend = extend; - lodash.filter = filter; - lodash.find = find; - lodash.first = first; - lodash.flatten = flatten; - lodash.forEach = forEach; - lodash.forIn = forIn; - lodash.forOwn = forOwn; - lodash.functions = functions; - lodash.groupBy = groupBy; - lodash.has = has; - lodash.identity = identity; - lodash.indexOf = indexOf; - lodash.initial = initial; - lodash.intersection = intersection; - lodash.invoke = invoke; - lodash.isArguments = isArguments; - lodash.isArray = isArray; - lodash.isBoolean = isBoolean; - lodash.isDate = isDate; - lodash.isElement = isElement; - lodash.isEmpty = isEmpty; - lodash.isEqual = isEqual; - lodash.isFinite = isFinite; - lodash.isFunction = isFunction; - lodash.isNaN = isNaN; - lodash.isNull = isNull; - lodash.isNumber = isNumber; - lodash.isObject = isObject; - lodash.isRegExp = isRegExp; - lodash.isString = isString; - lodash.isUndefined = isUndefined; - lodash.keys = keys; - lodash.last = last; - lodash.lastIndexOf = lastIndexOf; - lodash.map = map; - lodash.max = max; - lodash.memoize = memoize; - lodash.min = min; - lodash.mixin = mixin; - lodash.noConflict = noConflict; - lodash.once = once; - lodash.partial = partial; - lodash.pick = pick; - lodash.pluck = pluck; - lodash.range = range; - lodash.reduce = reduce; - lodash.reduceRight = reduceRight; - lodash.reject = reject; - lodash.rest = rest; - lodash.result = result; - lodash.shuffle = shuffle; - lodash.size = size; - lodash.some = some; - lodash.sortBy = sortBy; - lodash.sortedIndex = sortedIndex; - lodash.tap = tap; - lodash.template = template; - lodash.throttle = throttle; - lodash.times = times; - lodash.toArray = toArray; - lodash.union = union; - lodash.uniq = uniq; - lodash.uniqueId = uniqueId; - lodash.values = values; - lodash.without = without; - lodash.wrap = wrap; - lodash.zip = zip; - lodash.zipObject = zipObject; - - // assign aliases - lodash.all = every; - lodash.any = some; - lodash.collect = map; - lodash.detect = find; - lodash.each = forEach; - lodash.foldl = reduce; - lodash.foldr = reduceRight; - lodash.head = first; - lodash.include = contains; - lodash.inject = reduce; - lodash.methods = functions; - lodash.select = filter; - lodash.tail = rest; - lodash.take = first; - lodash.unique = uniq; - - // add pseudo private properties used and removed during the build process - lodash._iteratorTemplate = iteratorTemplate; - lodash._shimKeys = shimKeys; - - /*--------------------------------------------------------------------------*/ - - // assign private `LoDash` constructor's prototype - LoDash.prototype = lodash.prototype; - - // add all static functions to `LoDash.prototype` - mixin(lodash); - - // add `LoDash.prototype.chain` after calling `mixin()` to avoid overwriting - // it with the wrapped `lodash.chain` - LoDash.prototype.chain = wrapperChain; - LoDash.prototype.value = wrapperValue; - - // add all mutator Array functions to the wrapper. - forEach(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(methodName) { - var func = ArrayProto[methodName]; - - LoDash.prototype[methodName] = function() { - var value = this._wrapped; - func.apply(value, arguments); - - // Firefox < 10, IE compatibility mode, and IE < 9 have buggy Array - // `shift()` and `splice()` functions that fail to remove the last element, - // `value[0]`, of array-like objects even though the `length` property is - // set to `0`. The `shift()` method is buggy in IE 8 compatibility mode, - // while `splice()` is buggy regardless of mode in IE < 9 and buggy in - // compatibility mode in IE 9. - if (value.length === 0) { - delete value[0]; - } - if (this._chain) { - value = new LoDash(value); - value._chain = true; - } - return value; - }; - }); - - // add all accessor Array functions to the wrapper. - forEach(['concat', 'join', 'slice'], function(methodName) { - var func = ArrayProto[methodName]; - - LoDash.prototype[methodName] = function() { - var value = this._wrapped, - result = func.apply(value, arguments); - - if (this._chain) { - result = new LoDash(result); - result._chain = true; - } - return result; - }; - }); - - /*--------------------------------------------------------------------------*/ - - // expose Lo-Dash - // some AMD build optimizers, like r.js, check for specific condition patterns like the following: - if (typeof define == 'function' && typeof define.amd == 'object' && define.amd) { - // Expose Lo-Dash to the global object even when an AMD loader is present in - // case Lo-Dash was injected by a third-party script and not intended to be - // loaded as a module. The global assignment can be reverted in the Lo-Dash - // module via its `noConflict()` method. - window._ = lodash; - - // define as an anonymous module so, through path mapping, it can be - // referenced as the "underscore" module - define(function() { - return lodash; - }); - } - // check for `exports` after `define` in case a build optimizer adds an `exports` object - else if (freeExports) { - // in Node.js or RingoJS v0.8.0+ - if (typeof module == 'object' && module && module.exports == freeExports) { - (module.exports = lodash)._ = lodash; - } - // in Narwhal or RingoJS v0.7.0- - else { - freeExports._ = lodash; - } - } - else { - // in a browser or Rhino - window._ = lodash; - } -}(this)); \ No newline at end of file diff --git a/module/web/static/js/libs/lodash-0.5.2.js b/module/web/static/js/libs/lodash-0.5.2.js new file mode 100644 index 000000000..3c5448223 --- /dev/null +++ b/module/web/static/js/libs/lodash-0.5.2.js @@ -0,0 +1,4263 @@ +/*! + * Lo-Dash v0.5.2 + * Copyright 2012 John-David Dalton + * Based on Underscore.js 1.3.3, copyright 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. + * + * Available under MIT license + */ +;(function(window, undefined) { + 'use strict'; + + /** + * Used to cache the last `_.templateSettings.evaluate` delimiter to avoid + * unnecessarily assigning `reEvaluateDelimiter` a new generated regexp. + * Assigned in `_.template`. + */ + var lastEvaluateDelimiter; + + /** + * Used to cache the last template `options.variable` to avoid unnecessarily + * assigning `reDoubleVariable` a new generated regexp. Assigned in `_.template`. + */ + var lastVariable; + + /** + * Used to match potentially incorrect data object references, like `obj.obj`, + * in compiled templates. Assigned in `_.template`. + */ + var reDoubleVariable; + + /** + * Used to match "evaluate" delimiters, including internal delimiters, + * in template text. Assigned in `_.template`. + */ + var reEvaluateDelimiter; + + /** Detect free variable `exports` */ + var freeExports = typeof exports == 'object' && exports && + (typeof global == 'object' && global && global == global.global && (window = global), exports); + + /** Native prototype shortcuts */ + var ArrayProto = Array.prototype, + BoolProto = Boolean.prototype, + ObjectProto = Object.prototype, + NumberProto = Number.prototype, + StringProto = String.prototype; + + /** Used to generate unique IDs */ + var idCounter = 0; + + /** Used to restore the original `_` reference in `noConflict` */ + var oldDash = window._; + + /** Used to detect delimiter values that should be processed by `tokenizeEvaluate` */ + var reComplexDelimiter = /[-+=!~*%&^<>|{(\/]|\[\D|\b(?:delete|in|instanceof|new|typeof|void)\b/; + + /** Used to match empty string literals in compiled template source */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to match regexp flags from their coerced string values */ + var reFlags = /\w*$/; + + /** Used to insert the data object variable into compiled template source */ + var reInsertVariable = /(?:__e|__t = )\(\s*(?![\d\s"']|this\.)/g; + + /** Used to detect if a method is native */ + var reNative = RegExp('^' + + (ObjectProto.valueOf + '') + .replace(/[.*+?^=!:${}()|[\]\/\\]/g, '\\$&') + .replace(/valueOf|for [^\]]+/g, '.+?') + '$' + ); + + /** Used to match tokens in template text */ + var reToken = /__token__(\d+)/g; + + /** Used to match unescaped characters in strings for inclusion in HTML */ + var reUnescapedHtml = /[&<"']/g; + + /** Used to match unescaped characters in compiled string literals */ + var reUnescapedString = /['\n\r\t\u2028\u2029\\]/g; + + /** Used to fix the JScript [[DontEnum]] bug */ + var shadowed = [ + 'constructor', 'hasOwnProperty', 'isPrototypeOf', 'propertyIsEnumerable', + 'toLocaleString', 'toString', 'valueOf' + ]; + + /** Used to make template sourceURLs easier to identify */ + var templateCounter = 0; + + /** Used to replace template delimiters */ + var token = '__token__'; + + /** Used to store tokenized template text snippets */ + var tokenized = []; + + /** Native method shortcuts */ + var concat = ArrayProto.concat, + hasOwnProperty = ObjectProto.hasOwnProperty, + push = ArrayProto.push, + propertyIsEnumerable = ObjectProto.propertyIsEnumerable, + slice = ArrayProto.slice, + toString = ObjectProto.toString; + + /* Native method shortcuts for methods with the same name as other `lodash` methods */ + var nativeBind = reNative.test(nativeBind = slice.bind) && nativeBind, + nativeIsArray = reNative.test(nativeIsArray = Array.isArray) && nativeIsArray, + nativeIsFinite = window.isFinite, + nativeKeys = reNative.test(nativeKeys = Object.keys) && nativeKeys; + + /** `Object#toString` result shortcuts */ + var argsClass = '[object Arguments]', + arrayClass = '[object Array]', + boolClass = '[object Boolean]', + dateClass = '[object Date]', + funcClass = '[object Function]', + numberClass = '[object Number]', + objectClass = '[object Object]', + regexpClass = '[object RegExp]', + stringClass = '[object String]'; + + /** Timer shortcuts */ + var clearTimeout = window.clearTimeout, + setTimeout = window.setTimeout; + + /** + * Detect the JScript [[DontEnum]] bug: + * In IE < 9 an objects own properties, shadowing non-enumerable ones, are + * made non-enumerable as well. + */ + var hasDontEnumBug; + + /** Detect if own properties are iterated after inherited properties (IE < 9) */ + var iteratesOwnLast; + + /** Detect if an `arguments` object's indexes are non-enumerable (IE < 9) */ + var noArgsEnum = true; + + (function() { + var props = []; + function ctor() { this.x = 1; } + ctor.prototype = { 'valueOf': 1, 'y': 1 }; + for (var prop in new ctor) { props.push(prop); } + for (prop in arguments) { noArgsEnum = !prop; } + hasDontEnumBug = (props + '').length < 4; + iteratesOwnLast = props[0] != 'x'; + }(1)); + + /** Detect if an `arguments` object's [[Class]] is unresolvable (Firefox < 4, IE < 9) */ + var noArgsClass = !isArguments(arguments); + + /** Detect if `Array#slice` cannot be used to convert strings to arrays (Opera < 10.52) */ + var noArraySliceOnStrings = slice.call('x')[0] != 'x'; + + /** + * Detect lack of support for accessing string characters by index: + * IE < 8 can't access characters by index and IE 8 can only access + * characters by index on string literals. + */ + var noCharByIndex = ('x'[0] + Object('x')[0]) != 'xx'; + + /** + * Detect if a node's [[Class]] is unresolvable (IE < 9) + * and that the JS engine won't error when attempting to coerce an object to + * a string without a `toString` property value of `typeof` "function". + */ + try { + var noNodeClass = ({ 'toString': 0 } + '', toString.call(window.document || 0) == objectClass); + } catch(e) { } + + /* Detect if `Function#bind` exists and is inferred to be fast (all but V8) */ + var isBindFast = nativeBind && /\n|Opera/.test(nativeBind + toString.call(window.opera)); + + /* Detect if `Object.keys` exists and is inferred to be fast (IE, Opera, V8) */ + var isKeysFast = nativeKeys && /^.+$|true/.test(nativeKeys + !!window.attachEvent); + + /** Detect if sourceURL syntax is usable without erroring */ + try { + // The JS engine in Adobe products, like InDesign, will throw a syntax error + // when it encounters a single line comment beginning with the `@` symbol. + // The JS engine in Narwhal will generate the function `function anonymous(){//}` + // and throw a syntax error. In IE, `@` symbols are part of its non-standard + // conditional compilation support. The `@cc_on` statement activates its support + // while the trailing ` !` induces a syntax error to exlude it. Compatibility + // modes in IE > 8 require a space before the `!` to induce a syntax error. + // See http://msdn.microsoft.com/en-us/library/121hztk3(v=vs.94).aspx + var useSourceURL = (Function('//@cc_on !')(), true); + } catch(e){ } + + /** Used to identify object classifications that are array-like */ + var arrayLikeClasses = {}; + arrayLikeClasses[boolClass] = arrayLikeClasses[dateClass] = arrayLikeClasses[funcClass] = + arrayLikeClasses[numberClass] = arrayLikeClasses[objectClass] = arrayLikeClasses[regexpClass] = false; + arrayLikeClasses[argsClass] = arrayLikeClasses[arrayClass] = arrayLikeClasses[stringClass] = true; + + /** Used to identify object classifications that `_.clone` supports */ + var cloneableClasses = {}; + cloneableClasses[argsClass] = cloneableClasses[funcClass] = false; + cloneableClasses[arrayClass] = cloneableClasses[boolClass] = cloneableClasses[dateClass] = + cloneableClasses[numberClass] = cloneableClasses[objectClass] = cloneableClasses[regexpClass] = + cloneableClasses[stringClass] = true; + + /** + * Used to escape characters for inclusion in HTML. + * The `>` and `/` characters don't require escaping in HTML and have no + * special meaning unless they're part of a tag or an unquoted attribute value + * http://mathiasbynens.be/notes/ambiguous-ampersands (semi-related fun fact) + */ + var htmlEscapes = { + '&': '&', + '<': '<', + '"': '"', + "'": ''' + }; + + /** Used to determine if values are of the language type Object */ + var objectTypes = { + 'boolean': false, + 'function': true, + 'object': true, + 'number': false, + 'string': false, + 'undefined': false, + 'unknown': true + }; + + /** Used to escape characters for inclusion in compiled string literals */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\t': 't', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; + + /*--------------------------------------------------------------------------*/ + + /** + * The `lodash` function. + * + * @name _ + * @constructor + * @param {Mixed} value The value to wrap in a `LoDash` instance. + * @returns {Object} Returns a `LoDash` instance. + */ + function lodash(value) { + // allow invoking `lodash` without the `new` operator + return new LoDash(value); + } + + /** + * Creates a `LoDash` instance that wraps a value to allow chaining. + * + * @private + * @constructor + * @param {Mixed} value The value to wrap. + */ + function LoDash(value) { + // exit early if already wrapped + if (value && value._wrapped) { + return value; + } + this._wrapped = value; + } + + /** + * By default, the template delimiters used by Lo-Dash are similar to those in + * embedded Ruby (ERB). Change the following template settings to use alternative + * delimiters. + * + * @static + * @memberOf _ + * @type Object + */ + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @static + * @memberOf _.templateSettings + * @type RegExp + */ + 'escape': /<%-([\s\S]+?)%>/g, + + /** + * Used to detect code to be evaluated. + * + * @static + * @memberOf _.templateSettings + * @type RegExp + */ + 'evaluate': /<%([\s\S]+?)%>/g, + + /** + * Used to detect `data` property values to inject. + * + * @static + * @memberOf _.templateSettings + * @type RegExp + */ + 'interpolate': /<%=([\s\S]+?)%>/g, + + /** + * Used to reference the data object in the template text. + * + * @static + * @memberOf _.templateSettings + * @type String + */ + 'variable': '' + }; + + /*--------------------------------------------------------------------------*/ + + /** + * The template used to create iterator functions. + * + * @private + * @param {Obect} data The data object used to populate the text. + * @returns {String} Returns the interpolated text. + */ + var iteratorTemplate = template( + // conditional strict mode + '<% if (useStrict) { %>\'use strict\';\n<% } %>' + + + // the `iteratee` may be reassigned by the `top` snippet + 'var index, value, iteratee = <%= firstArg %>, ' + + // assign the `result` variable an initial value + 'result<% if (init) { %> = <%= init %><% } %>;\n' + + // add code to exit early or do so if the first argument is falsey + '<%= exit %>;\n' + + // add code after the exit snippet but before the iteration branches + '<%= top %>;\n' + + + // the following branch is for iterating arrays and array-like objects + '<% if (arrayBranch) { %>' + + 'var length = iteratee.length; index = -1;' + + ' <% if (objectBranch) { %>\nif (length > -1 && length === length >>> 0) {<% } %>' + + + // add support for accessing string characters by index if needed + ' <% if (noCharByIndex) { %>\n' + + ' if (toString.call(iteratee) == stringClass) {\n' + + ' iteratee = iteratee.split(\'\')\n' + + ' }' + + ' <% } %>\n' + + + ' <%= arrayBranch.beforeLoop %>;\n' + + ' while (++index < length) {\n' + + ' value = iteratee[index];\n' + + ' <%= arrayBranch.inLoop %>\n' + + ' }' + + ' <% if (objectBranch) { %>\n}<% } %>' + + '<% } %>' + + + // the following branch is for iterating an object's own/inherited properties + '<% if (objectBranch) { %>' + + ' <% if (arrayBranch) { %>\nelse {' + + + // add support for iterating over `arguments` objects if needed + ' <% } else if (noArgsEnum) { %>\n' + + ' var length = iteratee.length; index = -1;\n' + + ' if (length && isArguments(iteratee)) {\n' + + ' while (++index < length) {\n' + + ' value = iteratee[index += \'\'];\n' + + ' <%= objectBranch.inLoop %>\n' + + ' }\n' + + ' } else {' + + ' <% } %>' + + + ' <% if (!hasDontEnumBug) { %>\n' + + ' var skipProto = typeof iteratee == \'function\' && \n' + + ' propertyIsEnumerable.call(iteratee, \'prototype\');\n' + + ' <% } %>' + + + // iterate own properties using `Object.keys` if it's fast + ' <% if (isKeysFast && useHas) { %>\n' + + ' var ownIndex = -1,\n' + + ' ownProps = objectTypes[typeof iteratee] ? nativeKeys(iteratee) : [],\n' + + ' length = ownProps.length;\n\n' + + ' <%= objectBranch.beforeLoop %>;\n' + + ' while (++ownIndex < length) {\n' + + ' index = ownProps[ownIndex];\n' + + ' <% if (!hasDontEnumBug) { %>if (!(skipProto && index == \'prototype\')) {\n <% } %>' + + ' value = iteratee[index];\n' + + ' <%= objectBranch.inLoop %>\n' + + ' <% if (!hasDontEnumBug) { %>}\n<% } %>' + + ' }' + + + // else using a for-in loop + ' <% } else { %>\n' + + ' <%= objectBranch.beforeLoop %>;\n' + + ' for (index in iteratee) {' + + ' <% if (hasDontEnumBug) { %>\n' + + ' <% if (useHas) { %>if (hasOwnProperty.call(iteratee, index)) {\n <% } %>' + + ' value = iteratee[index];\n' + + ' <%= objectBranch.inLoop %>;\n' + + ' <% if (useHas) { %>}<% } %>' + + + // Firefox < 3.6, Opera > 9.50 - Opera < 11.60, and Safari < 5.1 + // (if the prototype or a property on the prototype has been set) + // incorrectly sets a function's `prototype` property [[Enumerable]] + // value to `true`. Because of this Lo-Dash standardizes on skipping + // the the `prototype` property of functions regardless of its + // [[Enumerable]] value. + ' <% } else { %>\n' + + ' if (!(skipProto && index == \'prototype\')<% if (useHas) { %> &&\n' + + ' hasOwnProperty.call(iteratee, index)<% } %>) {\n' + + ' value = iteratee[index];\n' + + ' <%= objectBranch.inLoop %>\n' + + ' }' + + ' <% } %>\n' + + ' }' + + ' <% } %>' + + + // Because IE < 9 can't set the `[[Enumerable]]` attribute of an + // existing property and the `constructor` property of a prototype + // defaults to non-enumerable, Lo-Dash skips the `constructor` + // property when it infers it's iterating over a `prototype` object. + ' <% if (hasDontEnumBug) { %>\n\n' + + ' var ctor = iteratee.constructor;\n' + + ' <% for (var k = 0; k < 7; k++) { %>\n' + + ' index = \'<%= shadowed[k] %>\';\n' + + ' if (<%' + + ' if (shadowed[k] == \'constructor\') {' + + ' %>!(ctor && ctor.prototype === iteratee) && <%' + + ' } %>hasOwnProperty.call(iteratee, index)) {\n' + + ' value = iteratee[index];\n' + + ' <%= objectBranch.inLoop %>\n' + + ' }' + + ' <% } %>' + + ' <% } %>' + + ' <% if (arrayBranch || noArgsEnum) { %>\n}<% } %>' + + '<% } %>\n' + + + // add code to the bottom of the iteration function + '<%= bottom %>;\n' + + // finally, return the `result` + 'return result' + ); + + /** + * Reusable iterator options shared by + * `every`, `filter`, `find`, `forEach`, `forIn`, `forOwn`, `groupBy`, `map`, + * `reject`, `some`, and `sortBy`. + */ + var baseIteratorOptions = { + 'args': 'collection, callback, thisArg', + 'init': 'collection', + 'top': + 'if (!callback) {\n' + + ' callback = identity\n' + + '}\n' + + 'else if (thisArg) {\n' + + ' callback = iteratorBind(callback, thisArg)\n' + + '}', + 'inLoop': 'if (callback(value, index, collection) === false) return result' + }; + + /** Reusable iterator options for `countBy`, `groupBy`, and `sortBy` */ + var countByIteratorOptions = { + 'init': '{}', + 'top': + 'var prop;\n' + + 'if (typeof callback != \'function\') {\n' + + ' var valueProp = callback;\n' + + ' callback = function(value) { return value[valueProp] }\n' + + '}\n' + + 'else if (thisArg) {\n' + + ' callback = iteratorBind(callback, thisArg)\n' + + '}', + 'inLoop': + 'prop = callback(value, index, collection);\n' + + '(hasOwnProperty.call(result, prop) ? result[prop]++ : result[prop] = 1)' + }; + + /** Reusable iterator options for `every` and `some` */ + var everyIteratorOptions = { + 'init': 'true', + 'inLoop': 'if (!callback(value, index, collection)) return !result' + }; + + /** Reusable iterator options for `defaults` and `extend` */ + var extendIteratorOptions = { + 'useHas': false, + 'useStrict': false, + 'args': 'object', + 'init': 'object', + 'top': + 'for (var argsIndex = 1, argsLength = arguments.length; argsIndex < argsLength; argsIndex++) {\n' + + ' if (iteratee = arguments[argsIndex]) {', + 'inLoop': 'result[index] = value', + 'bottom': ' }\n}' + }; + + /** Reusable iterator options for `filter`, `reject`, and `where` */ + var filterIteratorOptions = { + 'init': '[]', + 'inLoop': 'callback(value, index, collection) && result.push(value)' + }; + + /** Reusable iterator options for `find`, `forEach`, `forIn`, and `forOwn` */ + var forEachIteratorOptions = { + 'top': 'if (thisArg) callback = iteratorBind(callback, thisArg)' + }; + + /** Reusable iterator options for `forIn` and `forOwn` */ + var forOwnIteratorOptions = { + 'inLoop': { + 'object': baseIteratorOptions.inLoop + } + }; + + /** Reusable iterator options for `invoke`, `map`, `pluck`, and `sortBy` */ + var mapIteratorOptions = { + 'init': '', + 'exit': 'if (!collection) return []', + 'beforeLoop': { + 'array': 'result = Array(length)', + 'object': 'result = ' + (isKeysFast ? 'Array(length)' : '[]') + }, + 'inLoop': { + 'array': 'result[index] = callback(value, index, collection)', + 'object': 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + '(callback(value, index, collection))' + } + }; + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a new function optimized for searching large arrays for a given `value`, + * starting at `fromIndex`, using strict equality for comparisons, i.e. `===`. + * + * @private + * @param {Array} array The array to search. + * @param {Mixed} value The value to search for. + * @param {Number} [fromIndex=0] The index to start searching from. + * @param {Number} [largeSize=30] The length at which an array is considered large. + * @returns {Boolean} Returns `true` if `value` is found, else `false`. + */ + function cachedContains(array, fromIndex, largeSize) { + fromIndex || (fromIndex = 0); + + var length = array.length, + isLarge = (length - fromIndex) >= (largeSize || 30), + cache = isLarge ? {} : array; + + if (isLarge) { + // init value cache + var key, + index = fromIndex - 1; + + while (++index < length) { + // manually coerce `value` to string because `hasOwnProperty`, in some + // older versions of Firefox, coerces objects incorrectly + key = array[index] + ''; + (hasOwnProperty.call(cache, key) ? cache[key] : (cache[key] = [])).push(array[index]); + } + } + return function(value) { + if (isLarge) { + var key = value + ''; + return hasOwnProperty.call(cache, key) && indexOf(cache[key], value) > -1; + } + return indexOf(cache, value, fromIndex) > -1; + } + } + + /** + * Creates compiled iteration functions. The iteration function will be created + * to iterate over only objects if the first argument of `options.args` is + * "object" or `options.inLoop.array` is falsey. + * + * @private + * @param {Object} [options1, options2, ...] The compile options objects. + * + * useHas - A boolean to specify whether or not to use `hasOwnProperty` checks + * in the object loop. + * + * useStrict - A boolean to specify whether or not to include the ES5 + * "use strict" directive. + * + * args - A string of comma separated arguments the iteration function will + * accept. + * + * init - A string to specify the initial value of the `result` variable. + * + * exit - A string of code to use in place of the default exit-early check + * of `if (!arguments[0]) return result`. + * + * top - A string of code to execute after the exit-early check but before + * the iteration branches. + * + * beforeLoop - A string or object containing an "array" or "object" property + * of code to execute before the array or object loops. + * + * inLoop - A string or object containing an "array" or "object" property + * of code to execute in the array or object loops. + * + * bottom - A string of code to execute after the iteration branches but + * before the `result` is returned. + * + * @returns {Function} Returns the compiled function. + */ + function createIterator() { + var object, + prop, + value, + index = -1, + length = arguments.length; + + // merge options into a template data object + var data = { + 'bottom': '', + 'exit': '', + 'init': '', + 'top': '', + 'arrayBranch': { 'beforeLoop': '' }, + 'objectBranch': { 'beforeLoop': '' } + }; + + while (++index < length) { + object = arguments[index]; + for (prop in object) { + value = (value = object[prop]) == null ? '' : value; + // keep this regexp explicit for the build pre-process + if (/beforeLoop|inLoop/.test(prop)) { + if (typeof value == 'string') { + value = { 'array': value, 'object': value }; + } + data.arrayBranch[prop] = value.array; + data.objectBranch[prop] = value.object; + } else { + data[prop] = value; + } + } + } + // set additional template `data` values + var args = data.args, + firstArg = /^[^,]+/.exec(args)[0]; + + data.firstArg = firstArg; + data.hasDontEnumBug = hasDontEnumBug; + data.isKeysFast = isKeysFast; + data.noArgsEnum = noArgsEnum; + data.shadowed = shadowed; + data.useHas = data.useHas !== false; + data.useStrict = data.useStrict !== false; + + if (!('noCharByIndex' in data)) { + data.noCharByIndex = noCharByIndex; + } + if (!data.exit) { + data.exit = 'if (!' + firstArg + ') return result'; + } + if (firstArg != 'collection' || !data.arrayBranch.inLoop) { + data.arrayBranch = null; + } + // create the function factory + var factory = Function( + 'arrayLikeClasses, ArrayProto, bind, compareAscending, concat, forIn, ' + + 'hasOwnProperty, identity, indexOf, isArguments, isArray, isFunction, ' + + 'isPlainObject, iteratorBind, objectClass, objectTypes, nativeKeys, ' + + 'propertyIsEnumerable, slice, stringClass, toString', + 'var callee = function(' + args + ') {\n' + iteratorTemplate(data) + '\n};\n' + + 'return callee' + ); + // return the compiled function + return factory( + arrayLikeClasses, ArrayProto, bind, compareAscending, concat, forIn, + hasOwnProperty, identity, indexOf, isArguments, isArray, isFunction, + isPlainObject, iteratorBind, objectClass, objectTypes, nativeKeys, + propertyIsEnumerable, slice, stringClass, toString + ); + } + + /** + * Used by `sortBy` to compare transformed `collection` values, stable sorting + * them in ascending order. + * + * @private + * @param {Object} a The object to compare to `b`. + * @param {Object} b The object to compare to `a`. + * @returns {Number} Returns the sort order indicator of `1` or `-1`. + */ + function compareAscending(a, b) { + var ai = a.index, + bi = b.index; + + a = a.criteria; + b = b.criteria; + + if (a === undefined) { + return 1; + } + if (b === undefined) { + return -1; + } + // ensure a stable sort in V8 and other engines + // http://code.google.com/p/v8/issues/detail?id=90 + return a < b ? -1 : a > b ? 1 : ai < bi ? -1 : 1; + } + + /** + * Used by `template` to replace tokens with their corresponding code snippets. + * + * @private + * @param {String} match The matched token. + * @param {String} index The `tokenized` index of the code snippet. + * @returns {String} Returns the code snippet. + */ + function detokenize(match, index) { + return tokenized[index]; + } + + /** + * Used by `template` to escape characters for inclusion in compiled + * string literals. + * + * @private + * @param {String} match The matched character to escape. + * @returns {String} Returns the escaped character. + */ + function escapeStringChar(match) { + return '\\' + stringEscapes[match]; + } + + /** + * Used by `escape` to escape characters for inclusion in HTML. + * + * @private + * @param {String} match The matched character to escape. + * @returns {String} Returns the escaped character. + */ + function escapeHtmlChar(match) { + return htmlEscapes[match]; + } + + /** + * Checks if a given `value` is an object created by the `Object` constructor + * assuming objects created by the `Object` constructor have no inherited + * enumerable properties and that there are no `Object.prototype` extensions. + * + * @private + * @param {Mixed} value The value to check. + * @param {Boolean} [skipArgsCheck=false] Internally used to skip checks for + * `arguments` objects. + * @returns {Boolean} Returns `true` if the `value` is a plain `Object` object, + * else `false`. + */ + function isPlainObject(value, skipArgsCheck) { + // avoid non-objects and false positives for `arguments` objects + var result = false; + if (!(value && typeof value == 'object') || (!skipArgsCheck && isArguments(value))) { + return result; + } + // IE < 9 presents DOM nodes as `Object` objects except they have `toString` + // methods that are `typeof` "string" and still can coerce nodes to strings. + // Also check that the constructor is `Object` (i.e. `Object instanceof Object`) + var ctor = value.constructor; + if ((!noNodeClass || !(typeof value.toString != 'function' && typeof (value + '') == 'string')) && + (!isFunction(ctor) || ctor instanceof ctor)) { + // IE < 9 iterates inherited properties before own properties. If the first + // iterated property is an object's own property then there are no inherited + // enumerable properties. + if (iteratesOwnLast) { + forIn(value, function(objValue, objKey) { + result = !hasOwnProperty.call(value, objKey); + return false; + }); + return result === false; + } + // In most environments an object's own properties are iterated before + // its inherited properties. If the last iterated property is an object's + // own property then there are no inherited enumerable properties. + forIn(value, function(objValue, objKey) { + result = objKey; + }); + return result === false || hasOwnProperty.call(value, result); + } + return result; + } + + /** + * Creates a new function that, when called, invokes `func` with the `this` + * binding of `thisArg` and the arguments (value, index, object). + * + * @private + * @param {Function} func The function to bind. + * @param {Mixed} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new bound function. + */ + function iteratorBind(func, thisArg) { + return function(value, index, object) { + return func.call(thisArg, value, index, object); + }; + } + + /** + * A no-operation function. + * + * @private + */ + function noop() { + // no operation performed + } + + /** + * Used by `template` to replace "escape" template delimiters with tokens. + * + * @private + * @param {String} match The matched template delimiter. + * @param {String} value The delimiter value. + * @returns {String} Returns a token. + */ + function tokenizeEscape(match, value) { + if (match && reComplexDelimiter.test(value)) { + return ''; + } + var index = tokenized.length; + tokenized[index] = "' +\n__e(" + value + ") +\n'"; + return token + index; + } + + /** + * Used by `template` to replace "evaluate" template delimiters, or complex + * "escape" and "interpolate" delimiters, with tokens. + * + * @private + * @param {String} match The matched template delimiter. + * @param {String} escapeValue The complex "escape" delimiter value. + * @param {String} interpolateValue The complex "interpolate" delimiter value. + * @param {String} [evaluateValue] The "evaluate" delimiter value. + * @returns {String} Returns a token. + */ + function tokenizeEvaluate(match, escapeValue, interpolateValue, evaluateValue) { + if (evaluateValue) { + var index = tokenized.length; + tokenized[index] = "';\n" + evaluateValue + ";\n__p += '"; + return token + index; + } + return escapeValue + ? tokenizeEscape(null, escapeValue) + : tokenizeInterpolate(null, interpolateValue); + } + + /** + * Used by `template` to replace "interpolate" template delimiters with tokens. + * + * @private + * @param {String} match The matched template delimiter. + * @param {String} value The delimiter value. + * @returns {String} Returns a token. + */ + function tokenizeInterpolate(match, value) { + if (match && reComplexDelimiter.test(value)) { + return ''; + } + var index = tokenized.length; + tokenized[index] = "' +\n((__t = (" + value + ")) == null ? '' : __t) +\n'"; + return token + index; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Checks if `value` is an `arguments` object. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is an `arguments` object, else `false`. + * @example + * + * (function() { return _.isArguments(arguments); })(1, 2, 3); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + function isArguments(value) { + return toString.call(value) == argsClass; + } + // fallback for browsers that can't detect `arguments` objects by [[Class]] + if (noArgsClass) { + isArguments = function(value) { + return !!(value && hasOwnProperty.call(value, 'callee')); + }; + } + + /** + * Checks if `value` is an array. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is an array, else `false`. + * @example + * + * (function() { return _.isArray(arguments); })(); + * // => false + * + * _.isArray([1, 2, 3]); + * // => true + */ + var isArray = nativeIsArray || function(value) { + return toString.call(value) == arrayClass; + }; + + /** + * Checks if `value` is a function. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a function, else `false`. + * @example + * + * _.isFunction(''.concat); + * // => true + */ + function isFunction(value) { + return typeof value == 'function'; + } + // fallback for older versions of Chrome and Safari + if (isFunction(/x/)) { + isFunction = function(value) { + return toString.call(value) == funcClass; + }; + } + + /** + * A shim implementation of `Object.keys` that produces an array of the given + * object's own enumerable property names. + * + * @private + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property names. + */ + var shimKeys = createIterator({ + 'args': 'object', + 'init': '[]', + 'inLoop': 'result.push(index)' + }); + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a clone of `value`. If `deep` is `true`, all nested objects will + * also be cloned otherwise they will be assigned by reference. If a value has + * a `clone` method it will be used to perform the clone. Functions, DOM nodes, + * `arguments` objects, and objects created by constructors other than `Object` + * are **not** cloned unless they have a custom `clone` method. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to clone. + * @param {Boolean} deep A flag to indicate a deep clone. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `deep`. + * @param {Array} [stack=[]] Internally used to keep track of traversed objects + * to avoid circular references. + * @param {Object} thorough Internally used to indicate whether or not to perform + * a more thorough clone of non-object values. + * @returns {Mixed} Returns the cloned `value`. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * _.clone({ 'name': 'moe' }); + * // => { 'name': 'moe' } + * + * var shallow = _.clone(stooges); + * shallow[0] === stooges[0]; + * // => true + * + * var deep = _.clone(stooges, true); + * shallow[0] === stooges[0]; + * // => false + */ + function clone(value, deep, guard, stack, thorough) { + if (value == null) { + return value; + } + if (guard) { + deep = false; + } + // avoid slower checks on primitives + thorough || (thorough = { 'value': null }); + if (thorough.value == null) { + // primitives passed from iframes use the primary document's native prototypes + thorough.value = !!(BoolProto.clone || NumberProto.clone || StringProto.clone); + } + // use custom `clone` method if available + var isObj = objectTypes[typeof value]; + if ((isObj || thorough.value) && value.clone && isFunction(value.clone)) { + thorough.value = null; + return value.clone(deep); + } + // inspect [[Class]] + if (isObj) { + // don't clone `arguments` objects, functions, or non-object Objects + var className = toString.call(value); + if (!cloneableClasses[className] || (noArgsClass && isArguments(value))) { + return value; + } + var isArr = className == arrayClass; + isObj = isArr || (className == objectClass ? isPlainObject(value, true) : isObj); + } + // shallow clone + if (!isObj || !deep) { + // don't clone functions + return isObj + ? (isArr ? slice.call(value) : extend({}, value)) + : value; + } + + var ctor = value.constructor; + switch (className) { + case boolClass: + return new ctor(value == true); + + case dateClass: + return new ctor(+value); + + case numberClass: + case stringClass: + return new ctor(value); + + case regexpClass: + return ctor(value.source, reFlags.exec(value)); + } + + // check for circular references and return corresponding clone + stack || (stack = []); + var length = stack.length; + while (length--) { + if (stack[length].source == value) { + return stack[length].value; + } + } + + // init cloned object + length = value.length; + var result = isArr ? ctor(length) : {}; + + // add current clone and original source value to the stack of traversed objects + stack.push({ 'value': result, 'source': value }); + + // recursively populate clone (susceptible to call stack limits) + if (isArr) { + var index = -1; + while (++index < length) { + result[index] = clone(value[index], deep, null, stack, thorough); + } + } else { + forOwn(value, function(objValue, key) { + result[key] = clone(objValue, deep, null, stack, thorough); + }); + } + return result; + } + + /** + * Assigns enumerable properties of the default object(s) to the `destination` + * object for all `destination` properties that resolve to `null`/`undefined`. + * Once a property is set, additional defaults of the same property will be + * ignored. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The destination object. + * @param {Object} [default1, default2, ...] The default objects. + * @returns {Object} Returns the destination object. + * @example + * + * var iceCream = { 'flavor': 'chocolate' }; + * _.defaults(iceCream, { 'flavor': 'vanilla', 'sprinkles': 'rainbow' }); + * // => { 'flavor': 'chocolate', 'sprinkles': 'rainbow' } + */ + var defaults = createIterator(extendIteratorOptions, { + 'inLoop': 'if (result[index] == null) ' + extendIteratorOptions.inLoop + }); + + /** + * Creates a shallow clone of `object` excluding the specified properties. + * Property names may be specified as individual arguments or as arrays of + * property names. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The source object. + * @param {Object} [prop1, prop2, ...] The properties to drop. + * @returns {Object} Returns an object without the dropped properties. + * @example + * + * _.drop({ 'name': 'moe', 'age': 40, 'userid': 'moe1' }, 'userid'); + * // => { 'name': 'moe', 'age': 40 } + */ + var drop = createIterator({ + 'useHas': false, + 'args': 'object', + 'init': '{}', + 'top': 'var props = concat.apply(ArrayProto, arguments)', + 'inLoop': 'if (indexOf(props, index) < 0) result[index] = value' + }); + + /** + * Assigns enumerable properties of the source object(s) to the `destination` + * object. Subsequent sources will overwrite propery assignments of previous + * sources. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The destination object. + * @param {Object} [source1, source2, ...] The source objects. + * @returns {Object} Returns the destination object. + * @example + * + * _.extend({ 'name': 'moe' }, { 'age': 40 }); + * // => { 'name': 'moe', 'age': 40 } + */ + var extend = createIterator(extendIteratorOptions); + + /** + * Iterates over `object`'s own and inherited enumerable properties, executing + * the `callback` for each property. The `callback` is bound to `thisArg` and + * invoked with 3 arguments; (value, key, object). Callbacks may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns `object`. + * @example + * + * function Dog(name) { + * this.name = name; + * } + * + * Dog.prototype.bark = function() { + * alert('Woof, woof!'); + * }; + * + * _.forIn(new Dog('Dagny'), function(value, key) { + * alert(key); + * }); + * // => alerts 'name' and 'bark' (order is not guaranteed) + */ + var forIn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions, { + 'useHas': false + }); + + /** + * Iterates over `object`'s own enumerable properties, executing the `callback` + * for each property. The `callback` is bound to `thisArg` and invoked with 3 + * arguments; (value, key, object). Callbacks may exit iteration early by + * explicitly returning `false`. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns `object`. + * @example + * + * _.forOwn({ '0': 'zero', '1': 'one', 'length': 2 }, function(num, key) { + * alert(key); + * }); + * // => alerts '0', '1', and 'length' (order is not guaranteed) + */ + var forOwn = createIterator(baseIteratorOptions, forEachIteratorOptions, forOwnIteratorOptions); + + /** + * Creates a sorted array of all enumerable properties, own and inherited, + * of `object` that have function values. + * + * @static + * @memberOf _ + * @alias methods + * @category Objects + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property names that have function values. + * @example + * + * _.functions(_); + * // => ['all', 'any', 'bind', 'bindAll', 'clone', 'compact', 'compose', ...] + */ + var functions = createIterator({ + 'useHas': false, + 'args': 'object', + 'init': '[]', + 'inLoop': 'if (isFunction(value)) result.push(index)', + 'bottom': 'result.sort()' + }); + + /** + * Checks if the specified object `property` exists and is a direct property, + * instead of an inherited property. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to check. + * @param {String} property The property to check for. + * @returns {Boolean} Returns `true` if key is a direct property, else `false`. + * @example + * + * _.has({ 'a': 1, 'b': 2, 'c': 3 }, 'b'); + * // => true + */ + function has(object, property) { + return object ? hasOwnProperty.call(object, property) : false; + } + + /** + * Checks if `value` is a boolean (`true` or `false`) value. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a boolean value, else `false`. + * @example + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return value === true || value === false || toString.call(value) == boolClass; + } + + /** + * Checks if `value` is a date. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a date, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + */ + function isDate(value) { + return toString.call(value) == dateClass; + } + + /** + * Checks if `value` is a DOM element. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + */ + function isElement(value) { + return value ? value.nodeType === 1 : false; + } + + /** + * Checks if `value` is empty. Arrays, strings, or `arguments` objects with a + * length of `0` and objects with no own enumerable properties are considered + * "empty". + * + * @static + * @memberOf _ + * @category Objects + * @param {Array|Object|String} value The value to inspect. + * @returns {Boolean} Returns `true` if the `value` is empty, else `false`. + * @example + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({}); + * // => true + * + * _.isEmpty(''); + * // => true + */ + var isEmpty = createIterator({ + 'args': 'value', + 'init': 'true', + 'top': + 'var className = toString.call(value),\n' + + ' length = value.length;\n' + + 'if (arrayLikeClasses[className]' + + (noArgsClass ? ' || isArguments(value)' : '') + ' ||\n' + + ' (className == objectClass && length > -1 && length === length >>> 0 &&\n' + + ' isFunction(value.splice))' + + ') return !length', + 'inLoop': { + 'object': 'return false' + } + }); + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent to each other. If a value has an `isEqual` method it will be + * used to perform the comparison. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} a The value to compare. + * @param {Mixed} b The other value to compare. + * @param {Array} [stack=[]] Internally used to keep track of traversed objects + * to avoid circular references. + * @param {Object} thorough Internally used to indicate whether or not to perform + * a more thorough comparison of non-object values. + * @returns {Boolean} Returns `true` if the values are equvalent, else `false`. + * @example + * + * var moe = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] }; + * var clone = { 'name': 'moe', 'luckyNumbers': [13, 27, 34] }; + * + * moe == clone; + * // => false + * + * _.isEqual(moe, clone); + * // => true + */ + function isEqual(a, b, stack, thorough) { + // a strict comparison is necessary because `null == undefined` + if (a == null || b == null) { + return a === b; + } + // avoid slower checks on non-objects + thorough || (thorough = { 'value': null }); + if (thorough.value == null) { + // primitives passed from iframes use the primary document's native prototypes + thorough.value = !!(BoolProto.isEqual || NumberProto.isEqual || StringProto.isEqual); + } + if (objectTypes[typeof a] || objectTypes[typeof b] || thorough.value) { + // unwrap any LoDash wrapped values + if (a._chain) { + a = a._wrapped; + } + if (b._chain) { + b = b._wrapped; + } + // use custom `isEqual` method if available + if (a.isEqual && isFunction(a.isEqual)) { + thorough.value = null; + return a.isEqual(b); + } + if (b.isEqual && isFunction(b.isEqual)) { + thorough.value = null; + return b.isEqual(a); + } + } + // exit early for identical values + if (a === b) { + // treat `+0` vs. `-0` as not equal + return a !== 0 || (1 / a == 1 / b); + } + // compare [[Class]] names + var className = toString.call(a); + if (className != toString.call(b)) { + return false; + } + switch (className) { + case boolClass: + case dateClass: + // coerce dates and booleans to numbers, dates to milliseconds and booleans + // to `1` or `0`, treating invalid dates coerced to `NaN` as not equal + return +a == +b; + + case numberClass: + // treat `NaN` vs. `NaN` as equal + return a != +a + ? b != +b + // but treat `+0` vs. `-0` as not equal + : (a == 0 ? (1 / a == 1 / b) : a == +b); + + case regexpClass: + case stringClass: + // coerce regexes to strings (http://es5.github.com/#x15.10.6.4) + // treat string primitives and their corresponding object instances as equal + return a == b + ''; + } + // exit early, in older browsers, if `a` is array-like but not `b` + var isArr = arrayLikeClasses[className]; + if (noArgsClass && !isArr && (isArr = isArguments(a)) && !isArguments(b)) { + return false; + } + // exit for functions and DOM nodes + if (!isArr && (className != objectClass || (noNodeClass && ( + (typeof a.toString != 'function' && typeof (a + '') == 'string') || + (typeof b.toString != 'function' && typeof (b + '') == 'string'))))) { + return false; + } + + // assume cyclic structures are equal + // the algorithm for detecting cyclic structures is adapted from ES 5.1 + // section 15.12.3, abstract operation `JO` (http://es5.github.com/#x15.12.3) + stack || (stack = []); + var length = stack.length; + while (length--) { + if (stack[length] == a) { + return true; + } + } + + var index = -1, + result = true, + size = 0; + + // add `a` to the stack of traversed objects + stack.push(a); + + // recursively compare objects and arrays (susceptible to call stack limits) + if (isArr) { + // compare lengths to determine if a deep comparison is necessary + size = a.length; + result = size == b.length; + + if (result) { + // deep compare the contents, ignoring non-numeric properties + while (size--) { + if (!(result = isEqual(a[size], b[size], stack, thorough))) { + break; + } + } + } + return result; + } + + var ctorA = a.constructor, + ctorB = b.constructor; + + // non `Object` object instances with different constructors are not equal + if (ctorA != ctorB && !( + isFunction(ctorA) && ctorA instanceof ctorA && + isFunction(ctorB) && ctorB instanceof ctorB + )) { + return false; + } + // deep compare objects + for (var prop in a) { + if (hasOwnProperty.call(a, prop)) { + // count the number of properties. + size++; + // deep compare each property value. + if (!(hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack, thorough))) { + return false; + } + } + } + // ensure both objects have the same number of properties + for (prop in b) { + // The JS engine in Adobe products, like InDesign, has a bug that causes + // `!size--` to throw an error so it must be wrapped in parentheses. + // https://github.com/documentcloud/underscore/issues/355 + if (hasOwnProperty.call(b, prop) && !(size--)) { + // `size` will be `-1` if `b` has more properties than `a` + return false; + } + } + // handle JScript [[DontEnum]] bug + if (hasDontEnumBug) { + while (++index < 7) { + prop = shadowed[index]; + if (hasOwnProperty.call(a, prop) && + !(hasOwnProperty.call(b, prop) && isEqual(a[prop], b[prop], stack, thorough))) { + return false; + } + } + } + return true; + } + + /** + * Checks if `value` is a finite number. + * + * Note: This is not the same as native `isFinite`, which will return true for + * booleans and other values. See http://es5.github.com/#x15.1.2.5. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a finite number, else `false`. + * @example + * + * _.isFinite(-101); + * // => true + * + * _.isFinite('10'); + * // => false + * + * _.isFinite(Infinity); + * // => false + */ + function isFinite(value) { + return nativeIsFinite(value) && toString.call(value) == numberClass; + } + + /** + * Checks if `value` is the language type of Object. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject(1); + * // => false + */ + function isObject(value) { + // check if the value is the ECMAScript language type of Object + // http://es5.github.com/#x8 + // and avoid a V8 bug + // http://code.google.com/p/v8/issues/detail?id=2291 + return value ? objectTypes[typeof value] : false; + } + + /** + * Checks if `value` is `NaN`. + * + * Note: This is not the same as native `isNaN`, which will return true for + * `undefined` and other values. See http://es5.github.com/#x15.1.2.4. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // `NaN` as a primitive is the only value that is not equal to itself + // (perform the [[Class]] check first to avoid errors with some host objects in IE) + return toString.call(value) == numberClass && value != +value + } + + /** + * Checks if `value` is `null`. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(undefined); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is a number. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a number, else `false`. + * @example + * + * _.isNumber(8.4 * 5; + * // => true + */ + function isNumber(value) { + return toString.call(value) == numberClass; + } + + /** + * Checks if `value` is a regular expression. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a regular expression, else `false`. + * @example + * + * _.isRegExp(/moe/); + * // => true + */ + function isRegExp(value) { + return toString.call(value) == regexpClass; + } + + /** + * Checks if `value` is a string. + * + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is a string, else `false`. + * @example + * + * _.isString('moe'); + * // => true + */ + function isString(value) { + return toString.call(value) == stringClass; + } + + /** + * Checks if `value` is `undefined`. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Mixed} value The value to check. + * @returns {Boolean} Returns `true` if the `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + */ + function isUndefined(value) { + return value === undefined; + } + + /** + * Creates an array composed of the own enumerable property names of `object`. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property names. + * @example + * + * _.keys({ 'one': 1, 'two': 2, 'three': 3 }); + * // => ['one', 'two', 'three'] (order is not guaranteed) + */ + var keys = !nativeKeys ? shimKeys : function(object) { + var type = typeof object; + + // avoid iterating over the `prototype` property + if (type == 'function' && propertyIsEnumerable.call(object, 'prototype')) { + return shimKeys(object); + } + return object && objectTypes[type] + ? nativeKeys(object) + : []; + }; + + /** + * Merges enumerable properties of the source object(s) into the `destination` + * object. Subsequent sources will overwrite propery assignments of previous + * sources. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The destination object. + * @param {Object} [source1, source2, ...] The source objects. + * @param {Object} [indicator] Internally used to indicate that the `stack` + * argument is an array of traversed objects instead of another source object. + * @param {Array} [stack=[]] Internally used to keep track of traversed objects + * to avoid circular references. + * @returns {Object} Returns the destination object. + * @example + * + * var stooges = [ + * { 'name': 'moe' }, + * { 'name': 'larry' } + * ]; + * + * var ages = [ + * { 'age': 40 }, + * { 'age': 50 } + * ]; + * + * _.merge(stooges, ages); + * // => [{ 'name': 'moe', 'age': 40 }, { 'name': 'larry', 'age': 50 }] + */ + var merge = createIterator(extendIteratorOptions, { + 'args': 'object, source, indicator, stack', + 'top': + 'var destValue, found, isArr, stackLength, recursive = indicator == isPlainObject;\n' + + 'if (!recursive) stack = [];\n' + + 'for (var argsIndex = 1, argsLength = recursive ? 2 : arguments.length; argsIndex < argsLength; argsIndex++) {\n' + + ' if (iteratee = arguments[argsIndex]) {', + 'inLoop': + 'if (value && ((isArr = isArray(value)) || isPlainObject(value))) {\n' + + ' found = false; stackLength = stack.length;\n' + + ' while (stackLength--) {\n' + + ' if (found = stack[stackLength].source == value) break\n' + + ' }\n' + + ' if (found) {\n' + + ' result[index] = stack[stackLength].value\n' + + ' } else {\n' + + ' destValue = (destValue = result[index]) && isArr\n' + + ' ? (isArray(destValue) ? destValue : [])\n' + + ' : (isPlainObject(destValue) ? destValue : {});\n' + + ' stack.push({ value: destValue, source: value });\n' + + ' result[index] = callee(destValue, value, isPlainObject, stack)\n' + + ' }\n' + + '} else if (value != null) {\n' + + ' result[index] = value\n' + + '}' + }); + + /** + * Creates a shallow clone of `object` composed of the specified properties. + * Property names may be specified as individual arguments or as arrays of + * property names. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The source object. + * @param {Object} [prop1, prop2, ...] The properties to pick. + * @returns {Object} Returns an object composed of the picked properties. + * @example + * + * _.pick({ 'name': 'moe', 'age': 40, 'userid': 'moe1' }, 'name', 'age'); + * // => { 'name': 'moe', 'age': 40 } + */ + function pick(object) { + var result = {}; + if (!object) { + return result; + } + var prop, + index = 0, + props = concat.apply(ArrayProto, arguments), + length = props.length; + + // start `index` at `1` to skip `object` + while (++index < length) { + prop = props[index]; + if (prop in object) { + result[prop] = object[prop]; + } + } + return result; + } + + /** + * Gets the size of `value` by returning `value.length` if `value` is an + * array, string, or `arguments` object. If `value` is an object, size is + * determined by returning the number of own enumerable properties it has. + * + * @deprecated + * @static + * @memberOf _ + * @category Objects + * @param {Array|Object|String} value The value to inspect. + * @returns {Number} Returns `value.length` or number of own enumerable properties. + * @example + * + * _.size([1, 2]); + * // => 2 + * + * _.size({ 'one': 1, 'two': 2, 'three': 3 }); + * // => 3 + * + * _.size('curly'); + * // => 5 + */ + function size(value) { + if (!value) { + return 0; + } + var className = toString.call(value), + length = value.length; + + // return `value.length` for `arguments` objects, arrays, strings, and DOM + // query collections of libraries like jQuery and MooTools + // http://code.google.com/p/fbug/source/browse/branches/firebug1.9/content/firebug/chrome/reps.js?r=12614#653 + // http://trac.webkit.org/browser/trunk/Source/WebCore/inspector/InjectedScriptSource.js?rev=125186#L609 + if (arrayLikeClasses[className] || (noArgsClass && isArguments(value)) || + (className == objectClass && length > -1 && length === length >>> 0 && isFunction(value.splice))) { + return length; + } + return keys(value).length; + } + + /** + * Creates an array composed of the own enumerable property values of `object`. + * + * @static + * @memberOf _ + * @category Objects + * @param {Object} object The object to inspect. + * @returns {Array} Returns a new array of property values. + * @example + * + * _.values({ 'one': 1, 'two': 2, 'three': 3 }); + * // => [1, 2, 3] + */ + var values = createIterator({ + 'args': 'object', + 'init': '[]', + 'inLoop': 'result.push(value)' + }); + + /*--------------------------------------------------------------------------*/ + + /** + * Checks if a given `target` element is present in a `collection` using strict + * equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @alias include + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Mixed} target The value to check for. + * @returns {Boolean} Returns `true` if the `target` element is found, else `false`. + * @example + * + * _.contains([1, 2, 3], 3); + * // => true + * + * _.contains({ 'name': 'moe', 'age': 40 }, 'moe'); + * // => true + * + * _.contains('curly', 'ur'); + * // => true + */ + var contains = createIterator({ + 'args': 'collection, target', + 'init': 'false', + 'noCharByIndex': false, + 'beforeLoop': { + 'array': 'if (toString.call(iteratee) == stringClass) return collection.indexOf(target) > -1' + }, + 'inLoop': 'if (value === target) return true' + }); + + /** + * Creates an object composed of keys returned from running each element of + * `collection` through a `callback`. The corresponding value of each key is + * the number of times the key was returned by `callback`. The `callback` is + * bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * The `callback` argument may also be the name of a property to count by (e.g. 'length'). + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} callback The function called per iteration or + * property name to count by. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.countBy([4.3, 6.1, 6.4], function(num) { return Math.floor(num); }); + * // => { '4': 1, '6': 2 } + * + * _.countBy([4.3, 6.1, 6.4], function(num) { return this.floor(num); }, Math); + * // => { '4': 1, '6': 2 } + * + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } + */ + var countBy = createIterator(baseIteratorOptions, countByIteratorOptions); + + /** + * Checks if the `callback` returns a truthy value for **all** elements of a + * `collection`. The `callback` is bound to `thisArg` and invoked with 3 + * arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias all + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Boolean} Returns `true` if all elements pass the callback check, else `false`. + * @example + * + * _.every([true, 1, null, 'yes'], Boolean); + * // => false + */ + var every = createIterator(baseIteratorOptions, everyIteratorOptions); + + /** + * Examines each element in a `collection`, returning an array of all elements + * the `callback` returns truthy for. The `callback` is bound to `thisArg` and + * invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias select + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of elements that passed callback check. + * @example + * + * var evens = _.filter([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); + * // => [2, 4, 6] + */ + var filter = createIterator(baseIteratorOptions, filterIteratorOptions); + + /** + * Examines each element in a `collection`, returning the first one the `callback` + * returns truthy for. The function returns as soon as it finds an acceptable + * element, and does not iterate over the entire `collection`. The `callback` is + * bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias detect + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the element that passed the callback check, else `undefined`. + * @example + * + * var even = _.find([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); + * // => 2 + */ + var find = createIterator(baseIteratorOptions, forEachIteratorOptions, { + 'init': '', + 'inLoop': 'if (callback(value, index, collection)) return value' + }); + + /** + * Iterates over a `collection`, executing the `callback` for each element in + * the `collection`. The `callback` is bound to `thisArg` and invoked with 3 + * arguments; (value, index|key, collection). Callbacks may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @alias each + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array|Object} Returns `collection`. + * @example + * + * _([1, 2, 3]).forEach(alert).join(','); + * // => alerts each number and returns '1,2,3' + * + * _.forEach({ 'one': 1, 'two': 2, 'three': 3 }, alert); + * // => alerts each number (order is not guaranteed) + */ + var forEach = createIterator(baseIteratorOptions, forEachIteratorOptions); + + /** + * Creates an object composed of keys returned from running each element of + * `collection` through a `callback`. The corresponding value of each key is an + * array of elements passed to `callback` that returned the key. The `callback` + * is bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * The `callback` argument may also be the name of a property to count by (e.g. 'length'). + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} callback The function called per iteration or + * property name to group by. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.groupBy([4.2, 6.1, 6.4], function(num) { return Math.floor(num); }); + * // => { '4': [4.2], '6': [6.1, 6.4] } + * + * _.groupBy([4.2, 6.1, 6.4], function(num) { return this.floor(num); }, Math); + * // => { '4': [4.2], '6': [6.1, 6.4] } + * + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createIterator(baseIteratorOptions, countByIteratorOptions, { + 'inLoop': + 'prop = callback(value, index, collection);\n' + + '(hasOwnProperty.call(result, prop) ? result[prop] : result[prop] = []).push(value)' + }); + + /** + * Invokes the method named by `methodName` on each element in the `collection`. + * Additional arguments will be passed to each invoked method. If `methodName` + * is a function it will be invoked for, and `this` bound to, each element + * in the `collection`. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} methodName The name of the method to invoke or + * the function invoked per iteration. + * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the method with. + * @returns {Array} Returns a new array of values returned from each invoked method. + * @example + * + * _.invoke([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invoke([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + var invoke = createIterator(mapIteratorOptions, { + 'args': 'collection, methodName', + 'top': + 'var args = slice.call(arguments, 2),\n' + + ' isFunc = typeof methodName == \'function\'', + 'inLoop': { + 'array': + 'result[index] = (isFunc ? methodName : value[methodName]).apply(value, args)', + 'object': + 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + + '((isFunc ? methodName : value[methodName]).apply(value, args))' + } + }); + + /** + * Creates a new array of values by running each element in the `collection` + * through a `callback`. The `callback` is bound to `thisArg` and invoked with + * 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias collect + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of elements returned by the callback. + * @example + * + * _.map([1, 2, 3], function(num) { return num * 3; }); + * // => [3, 6, 9] + * + * _.map({ 'one': 1, 'two': 2, 'three': 3 }, function(num) { return num * 3; }); + * // => [3, 6, 9] (order is not guaranteed) + */ + var map = createIterator(baseIteratorOptions, mapIteratorOptions); + + /** + * Retrieves the value of a specified property from all elements in + * the `collection`. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {String} property The property to pluck. + * @returns {Array} Returns a new array of property values. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * _.pluck(stooges, 'name'); + * // => ['moe', 'larry', 'curly'] + */ + var pluck = createIterator(mapIteratorOptions, { + 'args': 'collection, property', + 'inLoop': { + 'array': 'result[index] = value[property]', + 'object': 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + '(value[property])' + } + }); + + /** + * Boils down a `collection` to a single value. The initial state of the + * reduction is `accumulator` and each successive step of it should be returned + * by the `callback`. The `callback` is bound to `thisArg` and invoked with 4 + * arguments; for arrays they are (accumulator, value, index|key, collection). + * + * @static + * @memberOf _ + * @alias foldl, inject + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [accumulator] Initial value of the accumulator. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the accumulated value. + * @example + * + * var sum = _.reduce([1, 2, 3], function(memo, num) { return memo + num; }); + * // => 6 + */ + var reduce = createIterator({ + 'args': 'collection, callback, accumulator, thisArg', + 'init': 'accumulator', + 'top': + 'var noaccum = arguments.length < 3;\n' + + 'if (thisArg) callback = iteratorBind(callback, thisArg)', + 'beforeLoop': { + 'array': 'if (noaccum) result = collection[++index]' + }, + 'inLoop': { + 'array': + 'result = callback(result, value, index, collection)', + 'object': + 'result = noaccum\n' + + ' ? (noaccum = false, value)\n' + + ' : callback(result, value, index, collection)' + } + }); + + /** + * The right-associative version of `_.reduce`. + * + * @static + * @memberOf _ + * @alias foldr + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} callback The function called per iteration. + * @param {Mixed} [accumulator] Initial value of the accumulator. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the accumulated value. + * @example + * + * var list = [[0, 1], [2, 3], [4, 5]]; + * var flat = _.reduceRight(list, function(a, b) { return a.concat(b); }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, callback, accumulator, thisArg) { + if (!collection) { + return accumulator; + } + + var length = collection.length, + noaccum = arguments.length < 3; + + if(thisArg) { + callback = iteratorBind(callback, thisArg); + } + // Opera 10.53-10.60 JITted `length >>> 0` returns the wrong value for negative numbers + if (length > -1 && length === length >>> 0) { + var iteratee = noCharByIndex && toString.call(collection) == stringClass + ? collection.split('') + : collection; + + if (length && noaccum) { + accumulator = iteratee[--length]; + } + while (length--) { + accumulator = callback(accumulator, iteratee[length], length, collection); + } + return accumulator; + } + + var prop, + props = keys(collection); + + length = props.length; + if (length && noaccum) { + accumulator = collection[props[--length]]; + } + while (length--) { + prop = props[length]; + accumulator = callback(accumulator, collection[prop], prop, collection); + } + return accumulator; + } + + /** + * The opposite of `_.filter`, this method returns the values of a + * `collection` that `callback` does **not** return truthy for. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of elements that did **not** pass the callback check. + * @example + * + * var odds = _.reject([1, 2, 3, 4, 5, 6], function(num) { return num % 2 == 0; }); + * // => [1, 3, 5] + */ + var reject = createIterator(baseIteratorOptions, filterIteratorOptions, { + 'inLoop': '!' + filterIteratorOptions.inLoop + }); + + /** + * Checks if the `callback` returns a truthy value for **any** element of a + * `collection`. The function returns as soon as it finds passing value, and + * does not iterate over the entire `collection`. The `callback` is bound to + * `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * + * @static + * @memberOf _ + * @alias any + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Boolean} Returns `true` if any element passes the callback check, else `false`. + * @example + * + * _.some([null, 0, 'yes', false]); + * // => true + */ + var some = createIterator(baseIteratorOptions, everyIteratorOptions, { + 'init': 'false', + 'inLoop': everyIteratorOptions.inLoop.replace('!', '') + }); + + /** + * Creates a new array, stable sorted in ascending order by the results of + * running each element of `collection` through a `callback`. The `callback` + * is bound to `thisArg` and invoked with 3 arguments; (value, index|key, collection). + * The `callback` argument may also be the name of a property to sort by (e.g. 'length'). + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Function|String} callback The function called per iteration or + * property name to sort by. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a new array of sorted elements. + * @example + * + * _.sortBy([1, 2, 3], function(num) { return Math.sin(num); }); + * // => [3, 1, 2] + * + * _.sortBy([1, 2, 3], function(num) { return this.sin(num); }, Math); + * // => [3, 1, 2] + * + * _.sortBy(['larry', 'brendan', 'moe'], 'length'); + * // => ['moe', 'larry', 'brendan'] + */ + var sortBy = createIterator(baseIteratorOptions, countByIteratorOptions, mapIteratorOptions, { + 'inLoop': { + 'array': + 'result[index] = {\n' + + ' criteria: callback(value, index, collection),\n' + + ' index: index,\n' + + ' value: value\n' + + '}', + 'object': + 'result' + (isKeysFast ? '[ownIndex] = ' : '.push') + '({\n' + + ' criteria: callback(value, index, collection),\n' + + ' index: index,\n' + + ' value: value\n' + + '})' + }, + 'bottom': + 'result.sort(compareAscending);\n' + + 'length = result.length;\n' + + 'while (length--) {\n' + + ' result[length] = result[length].value\n' + + '}' + }); + + /** + * Converts the `collection`, to an array. Useful for converting the + * `arguments` object. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to convert. + * @returns {Array} Returns the new converted array. + * @example + * + * (function() { return _.toArray(arguments).slice(1); })(1, 2, 3, 4); + * // => [2, 3, 4] + */ + function toArray(collection) { + if (!collection) { + return []; + } + if (collection.toArray && isFunction(collection.toArray)) { + return collection.toArray(); + } + var length = collection.length; + if (length > -1 && length === length >>> 0) { + return (noArraySliceOnStrings ? toString.call(collection) == stringClass : typeof collection == 'string') + ? collection.split('') + : slice.call(collection); + } + return values(collection); + } + + /** + * Examines each element in a `collection`, returning an array of all elements + * that contain the given `properties`. + * + * @static + * @memberOf _ + * @category Collections + * @param {Array|Object|String} collection The collection to iterate over. + * @param {Object} properties The object of properties/values to filter by. + * @returns {Array} Returns a new array of elements that contain the given `properties`. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * _.where(stooges, { 'age': 40 }); + * // => [{ 'name': 'moe', 'age': 40 }] + */ + var where = createIterator(filterIteratorOptions, { + 'args': 'collection, properties', + 'top': + 'var pass, prop, propIndex, props = [];\n' + + 'forIn(properties, function(value, prop) { props.push(prop) });\n' + + 'var propsLength = props.length', + 'inLoop': + 'for (pass = true, propIndex = 0; propIndex < propsLength; propIndex++) {\n' + + ' prop = props[propIndex];\n' + + ' if (!(pass = value[prop] === properties[prop])) break\n' + + '}\n' + + 'if (pass) result.push(value)' + }); + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a new array with all falsey values of `array` removed. The values + * `false`, `null`, `0`, `""`, `undefined` and `NaN` are all falsey. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to compact. + * @returns {Array} Returns a new filtered array. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var result = []; + if (!array) { + return result; + } + var index = -1, + length = array.length; + + while (++index < length) { + if (array[index]) { + result.push(array[index]); + } + } + return result; + } + + /** + * Creates a new array of `array` elements not present in the other arrays + * using strict equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to process. + * @param {Array} [array1, array2, ...] Arrays to check. + * @returns {Array} Returns a new array of `array` elements not present in the + * other arrays. + * @example + * + * _.difference([1, 2, 3, 4, 5], [5, 2, 10]); + * // => [1, 3, 4] + */ + function difference(array) { + var result = []; + if (!array) { + return result; + } + var index = -1, + length = array.length, + flattened = concat.apply(result, arguments), + contains = cachedContains(flattened, length); + + while (++index < length) { + if (!contains(array[index])) { + result.push(array[index]); + } + } + return result; + } + + /** + * Gets the first element of the `array`. Pass `n` to return the first `n` + * elements of the `array`. + * + * @static + * @memberOf _ + * @alias head, take + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Mixed} Returns the first element or an array of the first `n` + * elements of `array`. + * @example + * + * _.first([5, 4, 3, 2, 1]); + * // => 5 + */ + function first(array, n, guard) { + if (array) { + return (n == null || guard) ? array[0] : slice.call(array, 0, n); + } + } + + /** + * Flattens a nested array (the nesting can be to any depth). If `shallow` is + * truthy, `array` will only be flattened a single level. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to compact. + * @param {Boolean} shallow A flag to indicate only flattening a single level. + * @returns {Array} Returns a new flattened array. + * @example + * + * _.flatten([1, [2], [3, [[4]]]]); + * // => [1, 2, 3, 4]; + * + * _.flatten([1, [2], [3, [[4]]]], true); + * // => [1, 2, 3, [[4]]]; + */ + function flatten(array, shallow) { + var result = []; + if (!array) { + return result; + } + var value, + index = -1, + length = array.length; + + while (++index < length) { + value = array[index]; + if (isArray(value)) { + push.apply(result, shallow ? value : flatten(value)); + } else { + result.push(value); + } + } + return result; + } + + /** + * Gets the index at which the first occurrence of `value` is found using + * strict equality for comparisons, i.e. `===`. If the `array` is already + * sorted, passing `true` for `isSorted` will run a faster binary search. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to search. + * @param {Mixed} value The value to search for. + * @param {Boolean|Number} [fromIndex=0] The index to start searching from or + * `true` to perform a binary search on a sorted `array`. + * @returns {Number} Returns the index of the matched value or `-1`. + * @example + * + * _.indexOf([1, 2, 3, 1, 2, 3], 2); + * // => 1 + * + * _.indexOf([1, 2, 3, 1, 2, 3], 2, 3); + * // => 4 + * + * _.indexOf([1, 1, 2, 2, 3, 3], 2, true); + * // => 2 + */ + function indexOf(array, value, fromIndex) { + if (!array) { + return -1; + } + var index = -1, + length = array.length; + + if (fromIndex) { + if (typeof fromIndex == 'number') { + index = (fromIndex < 0 ? Math.max(0, length + fromIndex) : fromIndex) - 1; + } else { + index = sortedIndex(array, value); + return array[index] === value ? index : -1; + } + } + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * Gets all but the last element of `array`. Pass `n` to exclude the last `n` + * elements from the result. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Array} Returns all but the last element or `n` elements of `array`. + * @example + * + * _.initial([3, 2, 1]); + * // => [3, 2] + */ + function initial(array, n, guard) { + if (!array) { + return []; + } + return slice.call(array, 0, -((n == null || guard) ? 1 : n)); + } + + /** + * Computes the intersection of all the passed-in arrays using strict equality + * for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} [array1, array2, ...] Arrays to process. + * @returns {Array} Returns a new array of unique elements, in order, that are + * present in **all** of the arrays. + * @example + * + * _.intersection([1, 2, 3], [101, 2, 1, 10], [2, 1]); + * // => [1, 2] + */ + function intersection(array) { + var result = []; + if (!array) { + return result; + } + var value, + index = -1, + length = array.length, + others = slice.call(arguments, 1), + cache = []; + + while (++index < length) { + value = array[index]; + if (indexOf(result, value) < 0 && + every(others, function(other, index) { + return (cache[index] || (cache[index] = cachedContains(other)))(value); + })) { + result.push(value); + } + } + return result; + } + + /** + * Gets the last element of the `array`. Pass `n` to return the lasy `n` + * elementsvof the `array`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Mixed} Returns the last element or an array of the last `n` + * elements of `array`. + * @example + * + * _.last([3, 2, 1]); + * // => 1 + */ + function last(array, n, guard) { + if (array) { + var length = array.length; + return (n == null || guard) ? array[length - 1] : slice.call(array, -n || length); + } + } + + /** + * Gets the index at which the last occurrence of `value` is found using + * strict equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to search. + * @param {Mixed} value The value to search for. + * @param {Number} [fromIndex=array.length-1] The index to start searching from. + * @returns {Number} Returns the index of the matched value or `-1`. + * @example + * + * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2); + * // => 4 + * + * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2, 3); + * // => 1 + */ + function lastIndexOf(array, value, fromIndex) { + if (!array) { + return -1; + } + var index = array.length; + if (fromIndex && typeof fromIndex == 'number') { + index = (fromIndex < 0 ? Math.max(0, index + fromIndex) : Math.min(fromIndex, index - 1)) + 1; + } + while (index--) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * Retrieves the maximum value of an `array`. If `callback` is passed, + * it will be executed for each value in the `array` to generate the + * criterion by which the value is ranked. The `callback` is bound to + * `thisArg` and invoked with 3 arguments; (value, index, array). + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to iterate over. + * @param {Function} [callback] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the maximum value. + * @example + * + * var stooges = [ + * { 'name': 'moe', 'age': 40 }, + * { 'name': 'larry', 'age': 50 }, + * { 'name': 'curly', 'age': 60 } + * ]; + * + * _.max(stooges, function(stooge) { return stooge.age; }); + * // => { 'name': 'curly', 'age': 60 }; + */ + function max(array, callback, thisArg) { + var computed = -Infinity, + result = computed; + + if (!array) { + return result; + } + var current, + index = -1, + length = array.length; + + if (!callback) { + while (++index < length) { + if (array[index] > result) { + result = array[index]; + } + } + return result; + } + if (thisArg) { + callback = iteratorBind(callback, thisArg); + } + while (++index < length) { + current = callback(array[index], index, array); + if (current > computed) { + computed = current; + result = array[index]; + } + } + return result; + } + + /** + * Retrieves the minimum value of an `array`. If `callback` is passed, + * it will be executed for each value in the `array` to generate the + * criterion by which the value is ranked. The `callback` is bound to `thisArg` + * and invoked with 3 arguments; (value, index, array). + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to iterate over. + * @param {Function} [callback] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Mixed} Returns the minimum value. + * @example + * + * _.min([10, 5, 100, 2, 1000]); + * // => 2 + */ + function min(array, callback, thisArg) { + var computed = Infinity, + result = computed; + + if (!array) { + return result; + } + var current, + index = -1, + length = array.length; + + if (!callback) { + while (++index < length) { + if (array[index] < result) { + result = array[index]; + } + } + return result; + } + if (thisArg) { + callback = iteratorBind(callback, thisArg); + } + while (++index < length) { + current = callback(array[index], index, array); + if (current < computed) { + computed = current; + result = array[index]; + } + } + return result; + } + + /** + * Creates an array of numbers (positive and/or negative) progressing from + * `start` up to but not including `stop`. This method is a port of Python's + * `range()` function. See http://docs.python.org/library/functions.html#range. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Number} [start=0] The start of the range. + * @param {Number} end The end of the range. + * @param {Number} [step=1] The value to increment or descrement by. + * @returns {Array} Returns a new range array. + * @example + * + * _.range(10); + * // => [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] + * + * _.range(1, 11); + * // => [1, 2, 3, 4, 5, 6, 7, 8, 9, 10] + * + * _.range(0, 30, 5); + * // => [0, 5, 10, 15, 20, 25] + * + * _.range(0, -10, -1); + * // => [0, -1, -2, -3, -4, -5, -6, -7, -8, -9] + * + * _.range(0); + * // => [] + */ + function range(start, end, step) { + start = +start || 0; + step = +step || 1; + + if (end == null) { + end = start; + start = 0; + } + // use `Array(length)` so V8 will avoid the slower "dictionary" mode + // http://www.youtube.com/watch?v=XAqIpGU8ZZk#t=16m27s + var index = -1, + length = Math.max(0, Math.ceil((end - start) / step)), + result = Array(length); + + while (++index < length) { + result[index] = start; + start += step; + } + return result; + } + + /** + * The opposite of `_.initial`, this method gets all but the first value of + * `array`. Pass `n` to exclude the first `n` values from the result. + * + * @static + * @memberOf _ + * @alias tail + * @category Arrays + * @param {Array} array The array to query. + * @param {Number} [n] The number of elements to return. + * @param {Object} [guard] Internally used to allow this method to work with + * others like `_.map` without using their callback `index` argument for `n`. + * @returns {Array} Returns all but the first value or `n` values of `array`. + * @example + * + * _.rest([3, 2, 1]); + * // => [2, 1] + */ + function rest(array, n, guard) { + if (!array) { + return []; + } + return slice.call(array, (n == null || guard) ? 1 : n); + } + + /** + * Creates a new array of shuffled `array` values, using a version of the + * Fisher-Yates shuffle. See http://en.wikipedia.org/wiki/Fisher-Yates_shuffle. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to shuffle. + * @returns {Array} Returns a new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4, 5, 6]); + * // => [4, 1, 6, 3, 5, 2] + */ + function shuffle(array) { + if (!array) { + return []; + } + var rand, + index = -1, + length = array.length, + result = Array(length); + + while (++index < length) { + rand = Math.floor(Math.random() * (index + 1)); + result[index] = result[rand]; + result[rand] = array[index]; + } + return result; + } + + /** + * Uses a binary search to determine the smallest index at which the `value` + * should be inserted into `array` in order to maintain the sort order of the + * sorted `array`. If `callback` is passed, it will be executed for `value` and + * each element in `array` to compute their sort ranking. The `callback` is + * bound to `thisArg` and invoked with 1 argument; (value). + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to iterate over. + * @param {Mixed} value The value to evaluate. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Number} Returns the index at which the value should be inserted + * into `array`. + * @example + * + * _.sortedIndex([20, 30, 40], 35); + * // => 2 + * + * var dict = { + * 'wordToNumber': { 'twenty': 20, 'thirty': 30, 'thirty-five': 35, 'fourty': 40 } + * }; + * + * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) { + * return dict.wordToNumber[word]; + * }); + * // => 2 + * + * _.sortedIndex(['twenty', 'thirty', 'fourty'], 'thirty-five', function(word) { + * return this.wordToNumber[word]; + * }, dict); + * // => 2 + */ + function sortedIndex(array, value, callback, thisArg) { + if (!array) { + return 0; + } + var mid, + low = 0, + high = array.length; + + if (callback) { + if (thisArg) { + callback = bind(callback, thisArg); + } + value = callback(value); + while (low < high) { + mid = (low + high) >>> 1; + callback(array[mid]) < value ? low = mid + 1 : high = mid; + } + } else { + while (low < high) { + mid = (low + high) >>> 1; + array[mid] < value ? low = mid + 1 : high = mid; + } + } + return low; + } + + /** + * Computes the union of the passed-in arrays using strict equality for + * comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} [array1, array2, ...] Arrays to process. + * @returns {Array} Returns a new array of unique values, in order, that are + * present in one or more of the arrays. + * @example + * + * _.union([1, 2, 3], [101, 2, 1, 10], [2, 1]); + * // => [1, 2, 3, 101, 10] + */ + function union() { + var index = -1, + result = [], + flattened = concat.apply(result, arguments), + length = flattened.length; + + while (++index < length) { + if (indexOf(result, flattened[index]) < 0) { + result.push(flattened[index]); + } + } + return result; + } + + /** + * Creates a duplicate-value-free version of the `array` using strict equality + * for comparisons, i.e. `===`. If the `array` is already sorted, passing `true` + * for `isSorted` will run a faster algorithm. If `callback` is passed, each + * element of `array` is passed through a callback` before uniqueness is computed. + * The `callback` is bound to `thisArg` and invoked with 3 arguments; (value, index, array). + * + * @static + * @memberOf _ + * @alias unique + * @category Arrays + * @param {Array} array The array to process. + * @param {Boolean} [isSorted=false] A flag to indicate that the `array` is already sorted. + * @param {Function} [callback=identity] The function called per iteration. + * @param {Mixed} [thisArg] The `this` binding for the callback. + * @returns {Array} Returns a duplicate-value-free array. + * @example + * + * _.uniq([1, 2, 1, 3, 1]); + * // => [1, 2, 3] + * + * _.uniq([1, 1, 2, 2, 3], true); + * // => [1, 2, 3] + * + * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return Math.floor(num); }); + * // => [1, 2, 3] + * + * _.uniq([1, 2, 1.5, 3, 2.5], function(num) { return this.floor(num); }, Math); + * // => [1, 2, 3] + */ + function uniq(array, isSorted, callback, thisArg) { + var result = []; + if (!array) { + return result; + } + var computed, + index = -1, + length = array.length, + seen = []; + + // juggle arguments + if (typeof isSorted == 'function') { + thisArg = callback; + callback = isSorted; + isSorted = false; + } + if (!callback) { + callback = identity; + } else if (thisArg) { + callback = iteratorBind(callback, thisArg); + } + while (++index < length) { + computed = callback(array[index], index, array); + if (isSorted + ? !index || seen[seen.length - 1] !== computed + : indexOf(seen, computed) < 0 + ) { + seen.push(computed); + result.push(array[index]); + } + } + return result; + } + + /** + * Creates a new array with all occurrences of the passed values removed using + * strict equality for comparisons, i.e. `===`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} array The array to filter. + * @param {Mixed} [value1, value2, ...] Values to remove. + * @returns {Array} Returns a new filtered array. + * @example + * + * _.without([1, 2, 1, 0, 3, 1, 4], 0, 1); + * // => [2, 3, 4] + */ + function without(array) { + var result = []; + if (!array) { + return result; + } + var index = -1, + length = array.length, + contains = cachedContains(arguments, 1, 20); + + while (++index < length) { + if (!contains(array[index])) { + result.push(array[index]); + } + } + return result; + } + + /** + * Groups the elements of each array at their corresponding indexes. Useful for + * separate data sources that are coordinated through matching array indexes. + * For a matrix of nested arrays, `_.zip.apply(...)` can transpose the matrix + * in a similar fashion. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} [array1, array2, ...] Arrays to process. + * @returns {Array} Returns a new array of grouped elements. + * @example + * + * _.zip(['moe', 'larry', 'curly'], [30, 40, 50], [true, false, false]); + * // => [['moe', 30, true], ['larry', 40, false], ['curly', 50, false]] + */ + function zip(array) { + if (!array) { + return []; + } + var index = -1, + length = max(pluck(arguments, 'length')), + result = Array(length); + + while (++index < length) { + result[index] = pluck(arguments, index); + } + return result; + } + + /** + * Creates an object composed from an array of `keys` and an array of `values`. + * + * @static + * @memberOf _ + * @category Arrays + * @param {Array} keys The array of keys. + * @param {Array} [values=[]] The array of values. + * @returns {Object} Returns an object composed of the given keys and + * corresponding values. + * @example + * + * _.zipObject(['moe', 'larry', 'curly'], [30, 40, 50]); + * // => { 'moe': 30, 'larry': 40, 'curly': 50 } + */ + function zipObject(keys, values) { + if (!keys) { + return {}; + } + var index = -1, + length = keys.length, + result = {}; + + values || (values = []); + while (++index < length) { + result[keys[index]] = values[index]; + } + return result; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a new function that is restricted to executing only after it is + * called `n` times. + * + * @static + * @memberOf _ + * @category Functions + * @param {Number} n The number of times the function must be called before + * it is executed. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var renderNotes = _.after(notes.length, render); + * _.forEach(notes, function(note) { + * note.asyncSave({ 'success': renderNotes }); + * }); + * // `renderNotes` is run once, after all notes have saved + */ + function after(n, func) { + if (n < 1) { + return func(); + } + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a new function that, when called, invokes `func` with the `this` + * binding of `thisArg` and prepends any additional `bind` arguments to those + * passed to the bound function. Lazy defined methods may be bound by passing + * the object they are bound to as `func` and the method name as `thisArg`. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function|Object} func The function to bind or the object the method belongs to. + * @param {Mixed} [thisArg] The `this` binding of `func` or the method name. + * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * // basic bind + * var func = function(greeting) { + * return greeting + ' ' + this.name; + * }; + * + * func = _.bind(func, { 'name': 'moe' }, 'hi'); + * func(); + * // => 'hi moe' + * + * // lazy bind + * var object = { + * 'name': 'moe', + * 'greet': function(greeting) { + * return greeting + ' ' + this.name; + * } + * }; + * + * var func = _.bind(object, 'greet', 'hi'); + * func(); + * // => 'hi moe' + * + * object.greet = function(greeting) { + * return greeting + ', ' + this.name + '!'; + * }; + * + * func(); + * // => 'hi, moe!' + */ + function bind(func, thisArg) { + var methodName, + isFunc = isFunction(func); + + // juggle arguments + if (!isFunc) { + methodName = thisArg; + thisArg = func; + } + // use `Function#bind` if it exists and is fast + // (in V8 `Function#bind` is slower except when partially applied) + else if (isBindFast || (nativeBind && arguments.length > 2)) { + return nativeBind.call.apply(nativeBind, arguments); + } + + var partialArgs = slice.call(arguments, 2); + + function bound() { + // `Function#bind` spec + // http://es5.github.com/#x15.3.4.5 + var args = arguments, + thisBinding = thisArg; + + if (!isFunc) { + func = thisArg[methodName]; + } + if (partialArgs.length) { + args = args.length + ? partialArgs.concat(slice.call(args)) + : partialArgs; + } + if (this instanceof bound) { + // get `func` instance if `bound` is invoked in a `new` expression + noop.prototype = func.prototype; + thisBinding = new noop; + + // mimic the constructor's `return` behavior + // http://es5.github.com/#x13.2.2 + var result = func.apply(thisBinding, args); + return result && objectTypes[typeof result] + ? result + : thisBinding + } + return func.apply(thisBinding, args); + } + return bound; + } + + /** + * Binds methods on `object` to `object`, overwriting the existing method. + * If no method names are provided, all the function properties of `object` + * will be bound. + * + * @static + * @memberOf _ + * @category Functions + * @param {Object} object The object to bind and assign the bound methods to. + * @param {String} [methodName1, methodName2, ...] Method names on the object to bind. + * @returns {Object} Returns `object`. + * @example + * + * var buttonView = { + * 'label': 'lodash', + * 'onClick': function() { alert('clicked: ' + this.label); } + * }; + * + * _.bindAll(buttonView); + * jQuery('#lodash_button').on('click', buttonView.onClick); + * // => When the button is clicked, `this.label` will have the correct value + */ + var bindAll = createIterator({ + 'useHas': false, + 'useStrict': false, + 'args': 'object', + 'init': 'object', + 'top': + 'var funcs = arguments,\n' + + ' length = funcs.length;\n' + + 'if (length > 1) {\n' + + ' for (var index = 1; index < length; index++) {\n' + + ' result[funcs[index]] = bind(result[funcs[index]], result)\n' + + ' }\n' + + ' return result\n' + + '}', + 'inLoop': + 'if (isFunction(result[index])) {\n' + + ' result[index] = bind(result[index], result)\n' + + '}' + }); + + /** + * Creates a new function that is the composition of the passed functions, + * where each function consumes the return value of the function that follows. + * In math terms, composing the functions `f()`, `g()`, and `h()` produces `f(g(h()))`. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} [func1, func2, ...] Functions to compose. + * @returns {Function} Returns the new composed function. + * @example + * + * var greet = function(name) { return 'hi: ' + name; }; + * var exclaim = function(statement) { return statement + '!'; }; + * var welcome = _.compose(exclaim, greet); + * welcome('moe'); + * // => 'hi: moe!' + */ + function compose() { + var funcs = arguments; + return function() { + var args = arguments, + length = funcs.length; + + while (length--) { + args = [funcs[length].apply(this, args)]; + } + return args[0]; + }; + } + + /** + * Creates a new function that will delay the execution of `func` until after + * `wait` milliseconds have elapsed since the last time it was invoked. Pass + * `true` for `immediate` to cause debounce to invoke `func` on the leading, + * instead of the trailing, edge of the `wait` timeout. Subsequent calls to + * the debounced function will return the result of the last `func` call. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to debounce. + * @param {Number} wait The number of milliseconds to delay. + * @param {Boolean} immediate A flag to indicate execution is on the leading + * edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * var lazyLayout = _.debounce(calculateLayout, 300); + * jQuery(window).on('resize', lazyLayout); + */ + function debounce(func, wait, immediate) { + var args, + result, + thisArg, + timeoutId; + + function delayed() { + timeoutId = null; + if (!immediate) { + func.apply(thisArg, args); + } + } + + return function() { + var isImmediate = immediate && !timeoutId; + args = arguments; + thisArg = this; + + clearTimeout(timeoutId); + timeoutId = setTimeout(delayed, wait); + + if (isImmediate) { + result = func.apply(thisArg, args); + } + return result; + }; + } + + /** + * Executes the `func` function after `wait` milliseconds. Additional arguments + * will be passed to `func` when it is invoked. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to delay. + * @param {Number} wait The number of milliseconds to delay execution. + * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with. + * @returns {Number} Returns the `setTimeout` timeout id. + * @example + * + * var log = _.bind(console.log, console); + * _.delay(log, 1000, 'logged later'); + * // => 'logged later' (Appears after one second.) + */ + function delay(func, wait) { + var args = slice.call(arguments, 2); + return setTimeout(function() { return func.apply(undefined, args); }, wait); + } + + /** + * Defers executing the `func` function until the current call stack has cleared. + * Additional arguments will be passed to `func` when it is invoked. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to defer. + * @param {Mixed} [arg1, arg2, ...] Arguments to invoke the function with. + * @returns {Number} Returns the `setTimeout` timeout id. + * @example + * + * _.defer(function() { alert('deferred'); }); + * // returns from the function before `alert` is called + */ + function defer(func) { + var args = slice.call(arguments, 1); + return setTimeout(function() { return func.apply(undefined, args); }, 1); + } + + /** + * Creates a new function that memoizes the result of `func`. If `resolver` is + * passed, it will be used to determine the cache key for storing the result + * based on the arguments passed to the memoized function. By default, the first + * argument passed to the memoized function is used as the cache key. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] A function used to resolve the cache key. + * @returns {Function} Returns the new memoizing function. + * @example + * + * var fibonacci = _.memoize(function(n) { + * return n < 2 ? n : fibonacci(n - 1) + fibonacci(n - 2); + * }); + */ + function memoize(func, resolver) { + var cache = {}; + return function() { + var prop = resolver ? resolver.apply(this, arguments) : arguments[0]; + return hasOwnProperty.call(cache, prop) + ? cache[prop] + : (cache[prop] = func.apply(this, arguments)); + }; + } + + /** + * Creates a new function that is restricted to one execution. Repeat calls to + * the function will return the value of the first call. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // Application is only created once. + */ + function once(func) { + var result, + ran = false; + + return function() { + if (ran) { + return result; + } + ran = true; + result = func.apply(this, arguments); + + // clear the `func` variable so the function may be garbage collected + func = null; + return result; + }; + } + + /** + * Creates a new function that, when called, invokes `func` with any additional + * `partial` arguments prepended to those passed to the new function. This method + * is similar `bind`, except it does **not** alter the `this` binding. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to partially apply arguments to. + * @param {Mixed} [arg1, arg2, ...] Arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * var greet = function(greeting, name) { return greeting + ': ' + name; }; + * var hi = _.partial(greet, 'hi'); + * hi('moe'); + * // => 'hi: moe' + */ + function partial(func) { + var args = slice.call(arguments, 1), + argsLength = args.length; + + return function() { + var result, + others = arguments; + + if (others.length) { + args.length = argsLength; + push.apply(args, others); + } + result = args.length == 1 ? func.call(this, args[0]) : func.apply(this, args); + args.length = argsLength; + return result; + }; + } + + /** + * Creates a new function that, when executed, will only call the `func` + * function at most once per every `wait` milliseconds. If the throttled + * function is invoked more than once during the `wait` timeout, `func` will + * also be called on the trailing edge of the timeout. Subsequent calls to the + * throttled function will return the result of the last `func` call. + * + * @static + * @memberOf _ + * @category Functions + * @param {Function} func The function to throttle. + * @param {Number} wait The number of milliseconds to throttle executions to. + * @returns {Function} Returns the new throttled function. + * @example + * + * var throttled = _.throttle(updatePosition, 100); + * jQuery(window).on('scroll', throttled); + */ + function throttle(func, wait) { + var args, + result, + thisArg, + timeoutId, + lastCalled = 0; + + function trailingCall() { + lastCalled = new Date; + timeoutId = null; + func.apply(thisArg, args); + } + + return function() { + var now = new Date, + remain = wait - (now - lastCalled); + + args = arguments; + thisArg = this; + + if (remain <= 0) { + lastCalled = now; + result = func.apply(thisArg, args); + } + else if (!timeoutId) { + timeoutId = setTimeout(trailingCall, remain); + } + return result; + }; + } + + /** + * Creates a new function that passes `value` to the `wrapper` function as its + * first argument. Additional arguments passed to the new function are appended + * to those passed to the `wrapper` function. + * + * @static + * @memberOf _ + * @category Functions + * @param {Mixed} value The value to wrap. + * @param {Function} wrapper The wrapper function. + * @returns {Function} Returns the new function. + * @example + * + * var hello = function(name) { return 'hello: ' + name; }; + * hello = _.wrap(hello, function(func) { + * return 'before, ' + func('moe') + ', after'; + * }); + * hello(); + * // => 'before, hello: moe, after' + */ + function wrap(value, wrapper) { + return function() { + var args = [value]; + if (arguments.length) { + push.apply(args, arguments); + } + return wrapper.apply(this, args); + }; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Escapes a string for inclusion in HTML, replacing `&`, `<`, `"`, and `'` + * characters. + * + * @static + * @memberOf _ + * @category Utilities + * @param {String} string The string to escape. + * @returns {String} Returns the escaped string. + * @example + * + * _.escape('Moe, Larry & Curly'); + * // => "Moe, Larry & Curly" + */ + function escape(string) { + return string == null ? '' : (string + '').replace(reUnescapedHtml, escapeHtmlChar); + } + + /** + * This function returns the first argument passed to it. + * + * Note: It is used throughout Lo-Dash as a default callback. + * + * @static + * @memberOf _ + * @category Utilities + * @param {Mixed} value Any value. + * @returns {Mixed} Returns `value`. + * @example + * + * var moe = { 'name': 'moe' }; + * moe === _.identity(moe); + * // => true + */ + function identity(value) { + return value; + } + + /** + * Adds functions properties of `object` to the `lodash` function and chainable + * wrapper. + * + * @static + * @memberOf _ + * @category Utilities + * @param {Object} object The object of function properties to add to `lodash`. + * @example + * + * _.mixin({ + * 'capitalize': function(string) { + * return string.charAt(0).toUpperCase() + string.slice(1).toLowerCase(); + * } + * }); + * + * _.capitalize('larry'); + * // => 'Larry' + * + * _('curly').capitalize(); + * // => 'Curly' + */ + function mixin(object) { + forEach(functions(object), function(methodName) { + var func = lodash[methodName] = object[methodName]; + + LoDash.prototype[methodName] = function() { + var args = [this._wrapped]; + if (arguments.length) { + push.apply(args, arguments); + } + var result = func.apply(lodash, args); + if (this._chain) { + result = new LoDash(result); + result._chain = true; + } + return result; + }; + }); + } + + /** + * Reverts the '_' variable to its previous value and returns a reference to + * the `lodash` function. + * + * @static + * @memberOf _ + * @category Utilities + * @returns {Function} Returns the `lodash` function. + * @example + * + * var lodash = _.noConflict(); + */ + function noConflict() { + window._ = oldDash; + return this; + } + + /** + * Resolves the value of `property` on `object`. If `property` is a function + * it will be invoked and its result returned, else the property value is + * returned. If `object` is falsey, then `null` is returned. + * + * @deprecated + * @static + * @memberOf _ + * @category Utilities + * @param {Object} object The object to inspect. + * @param {String} property The property to get the result of. + * @returns {Mixed} Returns the resolved value. + * @example + * + * var object = { + * 'cheese': 'crumpets', + * 'stuff': function() { + * return 'nonsense'; + * } + * }; + * + * _.result(object, 'cheese'); + * // => 'crumpets' + * + * _.result(object, 'stuff'); + * // => 'nonsense' + */ + function result(object, property) { + // based on Backbone's private `getValue` function + // https://github.com/documentcloud/backbone/blob/0.9.2/backbone.js#L1419-1424 + if (!object) { + return null; + } + var value = object[property]; + return isFunction(value) ? object[property]() : value; + } + + /** + * A micro-templating method that handles arbitrary delimiters, preserves + * whitespace, and correctly escapes quotes within interpolated code. + * + * Note: In the development build `_.template` utilizes sourceURLs for easier + * debugging. See http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl + * + * Note: Lo-Dash may be used in Chrome extensions by either creating a `lodash csp` + * build and avoiding `_.template` use, or loading Lo-Dash in a sandboxed page. + * See http://developer.chrome.com/trunk/extensions/sandboxingEval.html + * + * @static + * @memberOf _ + * @category Utilities + * @param {String} text The template text. + * @param {Obect} data The data object used to populate the text. + * @param {Object} options The options object. + * @returns {Function|String} Returns a compiled function when no `data` object + * is given, else it returns the interpolated text. + * @example + * + * // using a compiled template + * var compiled = _.template('hello: <%= name %>'); + * compiled({ 'name': 'moe' }); + * // => 'hello: moe' + * + * var list = '<% _.forEach(people, function(name) { %>
        • <%= name %>
          • <% }); %>'; + * _.template(list, { 'people': ['moe', 'larry', 'curly'] }); + * // => '
        • moe
        • larry
        • curly
          • ' + * + * // using the "escape" delimiter to escape HTML in data property values + * _.template('<%- value %>', { 'value': '